imagen-jekyll-theme 0.1.0

This diff represents the content of publicly available package versions that have been released to one of the supported registries. The information contained in this diff is provided for informational purposes only and reflects changes between package versions as they appear in their respective public registries.
Files changed (166) hide show
  1. checksums.yaml +7 -0
  2. data/LICENSE.txt +168 -0
  3. data/README.md +176 -0
  4. data/_config.yml +47 -0
  5. data/_data/components.yml +18 -0
  6. data/_data/en.yml +109 -0
  7. data/_data/es.yml +162 -0
  8. data/_data/fixtures/grilla.yml +37 -0
  9. data/_data/forms/subir_imagen.yml +43 -0
  10. data/_data/full_width_components.yml +4 -0
  11. data/_data/layouts/about.yml +155 -0
  12. data/_data/layouts/code_of_conduct.yml +60 -0
  13. data/_data/layouts/imagen.yml +67 -0
  14. data/_data/layouts/license.yml +60 -0
  15. data/_data/layouts/menu.yml +72 -0
  16. data/_data/layouts/post.yml +100 -0
  17. data/_data/layouts/privacy_policy.yml +60 -0
  18. data/_data/layouts/theme.yml +293 -0
  19. data/_data/manifest.json +14535 -0
  20. data/_data/schema.yml +9 -0
  21. data/_data/sutty.yml +6 -0
  22. data/_data/theme.yml +173 -0
  23. data/_includes/boolean.html +38 -0
  24. data/_includes/buttons/button.html +9 -0
  25. data/_includes/buttons/copy.html +28 -0
  26. data/_includes/buttons/generic.html +15 -0
  27. data/_includes/buttons/link.html +14 -0
  28. data/_includes/contact.html +17 -0
  29. data/_includes/content.html +9 -0
  30. data/_includes/descriptor.html +18 -0
  31. data/_includes/device_detector.html +30 -0
  32. data/_includes/email.html +9 -0
  33. data/_includes/embed_responsive.html +16 -0
  34. data/_includes/file.html +43 -0
  35. data/_includes/floating_alert.html +6 -0
  36. data/_includes/footer.html +5 -0
  37. data/_includes/form/boolean.html +1 -0
  38. data/_includes/form/content.html +1 -0
  39. data/_includes/form/email.html +1 -0
  40. data/_includes/form/file.html +1 -0
  41. data/_includes/form/hidden.html +1 -0
  42. data/_includes/form/image.html +1 -0
  43. data/_includes/form/input.html +1 -0
  44. data/_includes/form/markdown_content.html +1 -0
  45. data/_includes/form/number.html +1 -0
  46. data/_includes/form/predefined_array.html +1 -0
  47. data/_includes/form/section.html +1 -0
  48. data/_includes/form/separator.html +1 -0
  49. data/_includes/form/string.html +1 -0
  50. data/_includes/form/submit.html +1 -0
  51. data/_includes/form/tel.html +1 -0
  52. data/_includes/form/text.html +1 -0
  53. data/_includes/form/url.html +1 -0
  54. data/_includes/grilla.html +21 -0
  55. data/_includes/headings/generic.html +14 -0
  56. data/_includes/headings/h1.html +9 -0
  57. data/_includes/headings/h2.html +9 -0
  58. data/_includes/headings/h3.html +9 -0
  59. data/_includes/headings/with_link.html +15 -0
  60. data/_includes/hidden.html +5 -0
  61. data/_includes/image.html +57 -0
  62. data/_includes/imagen.html +13 -0
  63. data/_includes/imagen_enviada.html +6 -0
  64. data/_includes/imagen_enviada_error.html +9 -0
  65. data/_includes/imagen_grilla.html +31 -0
  66. data/_includes/input.html +61 -0
  67. data/_includes/item.html +38 -0
  68. data/_includes/logo.html +12 -0
  69. data/_includes/markdown_content.html +9 -0
  70. data/_includes/menu.html +69 -0
  71. data/_includes/notification.html +5 -0
  72. data/_includes/number.html +9 -0
  73. data/_includes/pack.html +10 -0
  74. data/_includes/password.html +10 -0
  75. data/_includes/picture.html +25 -0
  76. data/_includes/predefined_array.html +47 -0
  77. data/_includes/preload_font.html +1 -0
  78. data/_includes/question_mark_button.html +6 -0
  79. data/_includes/script.html +5 -0
  80. data/_includes/search.html +25 -0
  81. data/_includes/section.html +1 -0
  82. data/_includes/send_message.html +6 -0
  83. data/_includes/separator.html +1 -0
  84. data/_includes/share.html +22 -0
  85. data/_includes/share_box.html +31 -0
  86. data/_includes/stretched_link.html +15 -0
  87. data/_includes/string.html +12 -0
  88. data/_includes/subir_imagen.html +29 -0
  89. data/_includes/submit.html +18 -0
  90. data/_includes/svg/arrow-left.svg +29 -0
  91. data/_includes/svg/check.svg +1 -0
  92. data/_includes/svg/copy-icon.svg +1 -0
  93. data/_includes/svg/done-icon.svg +1 -0
  94. data/_includes/svg/location.svg +13 -0
  95. data/_includes/svg/menu.svg +8 -0
  96. data/_includes/svg/photo.svg +7 -0
  97. data/_includes/svg/signo-pregunta.svg +16 -0
  98. data/_includes/svg/x.svg +3 -0
  99. data/_includes/tel.html +9 -0
  100. data/_includes/text.html +40 -0
  101. data/_includes/theme/blue_button.html +1 -0
  102. data/_includes/theme/button_with_copy.html +1 -0
  103. data/_includes/theme/button_with_link.html +5 -0
  104. data/_includes/theme/buttons.html +33 -0
  105. data/_includes/theme/colors.html +14 -0
  106. data/_includes/theme/content.html +41 -0
  107. data/_includes/theme/descriptor.html +1 -0
  108. data/_includes/theme/embed_responsive.html +10 -0
  109. data/_includes/theme/font_sizes.html +18 -0
  110. data/_includes/theme/footer.html +1 -0
  111. data/_includes/theme/grilla.html +3 -0
  112. data/_includes/theme/imagen.html +8 -0
  113. data/_includes/theme/imagen_enviada.html +5 -0
  114. data/_includes/theme/imagen_enviada_error.html +7 -0
  115. data/_includes/theme/imagen_grilla.html +8 -0
  116. data/_includes/theme/letter_spacing.html +3 -0
  117. data/_includes/theme/menu.html +1 -0
  118. data/_includes/theme/picture.html +5 -0
  119. data/_includes/theme/question.html +2 -0
  120. data/_includes/theme/subir_imagen.html +1 -0
  121. data/_includes/toggler/toggler.html +21 -0
  122. data/_includes/toggler/toggler_label.html +21 -0
  123. data/_includes/toggler/toggler_related.html +23 -0
  124. data/_includes/toggler.html +19 -0
  125. data/_includes/toggler_label.html +22 -0
  126. data/_includes/toggler_related.html +24 -0
  127. data/_includes/url.html +9 -0
  128. data/_layouts/ayuda.html +40 -0
  129. data/_layouts/code_of_conduct.html +45 -0
  130. data/_layouts/default.html +93 -0
  131. data/_layouts/home.html +49 -0
  132. data/_layouts/imagen.html +45 -0
  133. data/_layouts/imagen_enviada.html +17 -0
  134. data/_layouts/imagenes.html +21 -0
  135. data/_layouts/institucional.html +20 -0
  136. data/_layouts/license.html +45 -0
  137. data/_layouts/login.html +26 -0
  138. data/_layouts/page.html +5 -0
  139. data/_layouts/post.html +71 -0
  140. data/_layouts/privacy_policy.html +45 -0
  141. data/_layouts/subir_imagen.html +19 -0
  142. data/_layouts/theme.html +60 -0
  143. data/_sass/accessibility.scss +46 -0
  144. data/_sass/content.scss +28 -0
  145. data/_sass/editor.scss +17 -0
  146. data/_sass/embed.scss +13 -0
  147. data/_sass/floating_alert.scss +48 -0
  148. data/_sass/fonts.scss +36 -0
  149. data/_sass/menu.scss +36 -0
  150. data/_sass/share_box.scss +26 -0
  151. data/_sass/snap.scss +60 -0
  152. data/_sass/toggler.scss +20 -0
  153. data/_sass/utilities.scss +531 -0
  154. data/assets/css/styles.scss +39 -0
  155. data/assets/data/site.json +10 -0
  156. data/assets/fonts/Helvetica.woff2 +0 -0
  157. data/assets/fonts/forkawesome-webfont.woff2 +0 -0
  158. data/assets/fonts/roboto/v27/KFOjCnqEu92Fr1Mu51TzBhc9-subset.woff2 +0 -0
  159. data/assets/fonts/roboto/v27/KFOkCnqEu92Fr1MmgWxP-subset.woff2 +0 -0
  160. data/assets/fonts/roboto/v27/KFOkCnqEu92Fr1Mu52xP-subset.woff2 +0 -0
  161. data/assets/fonts/roboto/v27/KFOlCnqEu92Fr1MmWUlvAw-subset.woff2 +0 -0
  162. data/assets/fonts/roboto/v27/KFOmCnqEu92Fr1Me5Q-subset.woff2 +0 -0
  163. data/assets/js/env.js +8 -0
  164. data/assets/js/pack.5JQIOXYX.js +48 -0
  165. data/assets/js/pack.5JQIOXYX.js.map +7 -0
  166. metadata +544 -0
@@ -0,0 +1,7 @@
1
+ {
2
+ "version": 3,
3
+ "sources": ["../../node_modules/.pnpm/device-detector-js@3.0.3/node_modules/device-detector-js/dist/utils/trim.js", "../../node_modules/.pnpm/device-detector-js@3.0.3/node_modules/device-detector-js/dist/utils/version.js", "../../node_modules/.pnpm/device-detector-js@3.0.3/node_modules/device-detector-js/dist/utils/variable-replacement.js", "../../node_modules/.pnpm/device-detector-js@3.0.3/node_modules/device-detector-js/dist/utils/memory-cache.js", "../../node_modules/.pnpm/device-detector-js@3.0.3/node_modules/device-detector-js/dist/utils/user-agent.js", "../../node_modules/.pnpm/device-detector-js@3.0.3/node_modules/device-detector-js/dist/parsers/client/browser.js", "../../node_modules/.pnpm/device-detector-js@3.0.3/node_modules/device-detector-js/dist/parsers/client/mobile-apps.js", "../../node_modules/.pnpm/device-detector-js@3.0.3/node_modules/device-detector-js/dist/parsers/client/feed-readers.js", "../../node_modules/.pnpm/device-detector-js@3.0.3/node_modules/device-detector-js/dist/parsers/client/libraries.js", "../../node_modules/.pnpm/device-detector-js@3.0.3/node_modules/device-detector-js/dist/parsers/client/media-players.js", "../../node_modules/.pnpm/device-detector-js@3.0.3/node_modules/device-detector-js/dist/parsers/client/personal-information-managers.js", "../../node_modules/.pnpm/device-detector-js@3.0.3/node_modules/device-detector-js/dist/parsers/client/index.js", "../../node_modules/.pnpm/device-detector-js@3.0.3/node_modules/device-detector-js/dist/parsers/device/cameras.js", "../../node_modules/.pnpm/device-detector-js@3.0.3/node_modules/device-detector-js/dist/utils/model.js", "../../node_modules/.pnpm/device-detector-js@3.0.3/node_modules/device-detector-js/dist/parsers/device/mobiles.js", "../../node_modules/.pnpm/device-detector-js@3.0.3/node_modules/device-detector-js/dist/parsers/device/televisions.js", "../../node_modules/.pnpm/device-detector-js@3.0.3/node_modules/device-detector-js/dist/parsers/device/cars.js", "../../node_modules/.pnpm/device-detector-js@3.0.3/node_modules/device-detector-js/dist/parsers/device/consoles.js", "../../node_modules/.pnpm/device-detector-js@3.0.3/node_modules/device-detector-js/dist/parsers/device/notebooks.js", "../../node_modules/.pnpm/device-detector-js@3.0.3/node_modules/device-detector-js/dist/parsers/device/portable-media-players.js", "../../node_modules/.pnpm/device-detector-js@3.0.3/node_modules/device-detector-js/dist/parsers/device/index.js", "../../node_modules/.pnpm/device-detector-js@3.0.3/node_modules/device-detector-js/dist/parsers/operating-system/index.js", "../../node_modules/.pnpm/device-detector-js@3.0.3/node_modules/device-detector-js/dist/parsers/vendor-fragment/index.js", "../../node_modules/.pnpm/device-detector-js@3.0.3/node_modules/device-detector-js/dist/parsers/bot/index.js", "../../node_modules/.pnpm/device-detector-js@3.0.3/node_modules/device-detector-js/dist/utils/version-compare.js", "../../node_modules/.pnpm/device-detector-js@3.0.3/node_modules/device-detector-js/dist/index.js", "../../node_modules/.pnpm/stackframe@1.3.4/node_modules/stackframe/stackframe.js", "../../node_modules/.pnpm/error-stack-parser@2.1.4/node_modules/error-stack-parser/error-stack-parser.js", "../../node_modules/.pnpm/cross-fetch@3.1.5/node_modules/cross-fetch/dist/browser-ponyfill.js", "../../node_modules/.pnpm/bintrees@1.0.2/node_modules/bintrees/lib/treebase.js", "../../node_modules/.pnpm/bintrees@1.0.2/node_modules/bintrees/lib/rbtree.js", "../../node_modules/.pnpm/bintrees@1.0.2/node_modules/bintrees/lib/bintree.js", "../../node_modules/.pnpm/bintrees@1.0.2/node_modules/bintrees/index.js", "../../node_modules/.pnpm/tdigest@0.1.2/node_modules/tdigest/tdigest.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/core/Util.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/core/Class.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/core/Events.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/geometry/Point.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/geometry/Bounds.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/geo/LatLngBounds.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/geo/LatLng.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/geo/crs/CRS.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/geo/crs/CRS.Earth.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/geo/projection/Projection.SphericalMercator.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/geometry/Transformation.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/geo/crs/CRS.EPSG3857.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/vector/SVG.Util.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/core/Browser.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/dom/DomEvent.Pointer.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/dom/DomEvent.DoubleTap.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/dom/DomUtil.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/dom/DomEvent.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/dom/PosAnimation.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/map/Map.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/control/Control.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/control/Control.Layers.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/control/Control.Zoom.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/control/Control.Scale.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/control/Control.Attribution.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/control/index.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/core/Handler.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/core/index.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/dom/Draggable.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/geometry/PolyUtil.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/geometry/LineUtil.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/geo/projection/Projection.LonLat.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/geo/projection/Projection.Mercator.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/geo/projection/index.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/geo/crs/CRS.EPSG3395.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/geo/crs/CRS.EPSG4326.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/geo/crs/CRS.Simple.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/geo/crs/index.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/Layer.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/LayerGroup.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/FeatureGroup.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/marker/Icon.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/marker/Icon.Default.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/marker/Marker.Drag.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/marker/Marker.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/vector/Path.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/vector/CircleMarker.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/vector/Circle.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/vector/Polyline.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/vector/Polygon.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/GeoJSON.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/ImageOverlay.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/VideoOverlay.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/SVGOverlay.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/DivOverlay.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/Popup.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/Tooltip.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/marker/DivIcon.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/marker/index.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/tile/GridLayer.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/tile/TileLayer.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/tile/TileLayer.WMS.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/tile/index.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/vector/Renderer.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/vector/Canvas.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/vector/SVG.VML.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/vector/SVG.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/vector/Renderer.getRenderer.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/vector/Rectangle.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/vector/index.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/layer/index.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/map/handler/Map.BoxZoom.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/map/handler/Map.DoubleClickZoom.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/map/handler/Map.Drag.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/map/handler/Map.Keyboard.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/map/handler/Map.ScrollWheelZoom.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/map/handler/Map.TapHold.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/map/handler/Map.TouchZoom.js", "../../node_modules/.pnpm/leaflet@1.9.4/node_modules/leaflet/src/map/index.js", "../../_packs/entry.js", "../../node_modules/.pnpm/promise-polyfill@8.2.3/node_modules/promise-polyfill/src/finally.js", "../../node_modules/.pnpm/promise-polyfill@8.2.3/node_modules/promise-polyfill/src/allSettled.js", "../../node_modules/.pnpm/promise-polyfill@8.2.3/node_modules/promise-polyfill/src/index.js", "../../node_modules/.pnpm/@airbrake+browser@1.4.2/node_modules/@airbrake/browser/src/jsonify_notice.ts", "../../node_modules/.pnpm/@airbrake+browser@1.4.2/node_modules/@airbrake/browser/src/metrics.ts", "../../node_modules/.pnpm/@airbrake+browser@1.4.2/node_modules/@airbrake/browser/src/scope.ts", "../../node_modules/.pnpm/@airbrake+browser@1.4.2/node_modules/@airbrake/browser/src/processor/esp.ts", "../../node_modules/.pnpm/@airbrake+browser@1.4.2/node_modules/@airbrake/browser/src/filter/angular_message.ts", "../../node_modules/.pnpm/@airbrake+browser@1.4.2/node_modules/@airbrake/browser/src/filter/debounce.ts", "../../node_modules/.pnpm/@airbrake+browser@1.4.2/node_modules/@airbrake/browser/src/filter/ignore_noise.ts", "../../node_modules/.pnpm/@airbrake+browser@1.4.2/node_modules/@airbrake/browser/src/filter/uncaught_message.ts", "../../node_modules/.pnpm/@airbrake+browser@1.4.2/node_modules/@airbrake/browser/src/http_req/fetch.ts", "../../node_modules/.pnpm/@airbrake+browser@1.4.2/node_modules/@airbrake/browser/src/http_req/api.ts", "../../node_modules/.pnpm/@airbrake+browser@1.4.2/node_modules/@airbrake/browser/src/http_req/node.ts", "../../node_modules/.pnpm/@airbrake+browser@1.4.2/node_modules/@airbrake/browser/src/http_req/index.ts", "../../node_modules/.pnpm/@airbrake+browser@1.4.2/node_modules/@airbrake/browser/src/tdshared.ts", "../../node_modules/.pnpm/@airbrake+browser@1.4.2/node_modules/@airbrake/browser/src/queries.ts", "../../node_modules/.pnpm/@airbrake+browser@1.4.2/node_modules/@airbrake/browser/src/queues.ts", "../../node_modules/.pnpm/@airbrake+browser@1.4.2/node_modules/@airbrake/browser/src/routes.ts", "../../node_modules/.pnpm/@airbrake+browser@1.4.2/node_modules/@airbrake/browser/src/version.ts", "../../node_modules/.pnpm/@airbrake+browser@1.4.2/node_modules/@airbrake/browser/src/base_notifier.ts", "../../node_modules/.pnpm/@airbrake+browser@1.4.2/node_modules/@airbrake/browser/src/filter/window.ts", "../../node_modules/.pnpm/@airbrake+browser@1.4.2/node_modules/@airbrake/browser/src/instrumentation/console.ts", "../../node_modules/.pnpm/@airbrake+browser@1.4.2/node_modules/@airbrake/browser/src/instrumentation/dom.ts", "../../node_modules/.pnpm/@airbrake+browser@1.4.2/node_modules/@airbrake/browser/src/instrumentation/fetch.ts", "../../node_modules/.pnpm/@airbrake+browser@1.4.2/node_modules/@airbrake/browser/src/instrumentation/location.ts", "../../node_modules/.pnpm/@airbrake+browser@1.4.2/node_modules/@airbrake/browser/src/instrumentation/xhr.ts", "../../node_modules/.pnpm/@airbrake+browser@1.4.2/node_modules/@airbrake/browser/src/notifier.ts", "../../node_modules/.pnpm/@hotwired+turbo@7.2.4/node_modules/@hotwired/turbo/dist/turbo.es2017-esm.js", "../../node_modules/.pnpm/@hotwired+stimulus@3.2.1/node_modules/@hotwired/stimulus/dist/stimulus.js", "../../_packs/controllers/contact_controller.js", "../../_packs/controllers/device_detector_controller.js", "../../_packs/controllers/drop_controller.js", "../../_packs/controllers/non_geographical_map_controller.tsx", "../../node_modules/.pnpm/preact@10.19.2/node_modules/preact/src/constants.js", "../../node_modules/.pnpm/preact@10.19.2/node_modules/preact/src/util.js", "../../node_modules/.pnpm/preact@10.19.2/node_modules/preact/src/options.js", "../../node_modules/.pnpm/preact@10.19.2/node_modules/preact/src/create-element.js", "../../node_modules/.pnpm/preact@10.19.2/node_modules/preact/src/component.js", "../../node_modules/.pnpm/preact@10.19.2/node_modules/preact/src/create-context.js", "../../node_modules/.pnpm/preact@10.19.2/node_modules/preact/src/diff/children.js", "../../node_modules/.pnpm/preact@10.19.2/node_modules/preact/src/diff/props.js", "../../node_modules/.pnpm/preact@10.19.2/node_modules/preact/src/diff/index.js", "../../node_modules/.pnpm/preact@10.19.2/node_modules/preact/src/render.js", "../../node_modules/.pnpm/preact@10.19.2/node_modules/preact/src/clone-element.js", "../../node_modules/.pnpm/preact@10.19.2/node_modules/preact/src/diff/catch-error.js", "../../node_modules/.pnpm/preact@10.19.2/node_modules/preact/hooks/src/index.js", "../../node_modules/.pnpm/@babel+runtime@7.23.5/node_modules/@babel/runtime/helpers/esm/typeof.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/_lib/toInteger/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/_lib/requiredArgs/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/toDate/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/addMilliseconds/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/_lib/defaultOptions/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/_lib/getTimezoneOffsetInMilliseconds/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/startOfDay/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/differenceInCalendarDays/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/constants/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/isDate/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/isValid/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/subMilliseconds/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/_lib/getUTCDayOfYear/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/_lib/startOfUTCISOWeek/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/_lib/getUTCISOWeekYear/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/_lib/startOfUTCISOWeekYear/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/_lib/getUTCISOWeek/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/_lib/startOfUTCWeek/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/_lib/getUTCWeekYear/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/_lib/startOfUTCWeekYear/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/_lib/getUTCWeek/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/_lib/addLeadingZeros/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/_lib/format/lightFormatters/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/_lib/format/formatters/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/_lib/format/longFormatters/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/_lib/protectedTokens/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/locale/en-US/_lib/formatDistance/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/locale/_lib/buildFormatLongFn/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/locale/en-US/_lib/formatLong/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/locale/en-US/_lib/formatRelative/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/locale/_lib/buildLocalizeFn/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/locale/en-US/_lib/localize/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/locale/_lib/buildMatchFn/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/locale/_lib/buildMatchPatternFn/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/locale/en-US/_lib/match/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/locale/en-US/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/_lib/defaultLocale/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/format/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/formatRelative/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/parseISO/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/locale/es/_lib/formatDistance/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/locale/es/_lib/formatLong/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/locale/es/_lib/formatRelative/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/locale/es/_lib/localize/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/locale/es/_lib/match/index.js", "../../node_modules/.pnpm/date-fns@2.30.0/node_modules/date-fns/esm/locale/es/index.js", "../../node_modules/.pnpm/pocketbase@0.19.0/node_modules/pocketbase/src/ClientResponseError.ts", "../../node_modules/.pnpm/pocketbase@0.19.0/node_modules/pocketbase/src/stores/utils/cookie.ts", "../../node_modules/.pnpm/pocketbase@0.19.0/node_modules/pocketbase/src/stores/utils/jwt.ts", "../../node_modules/.pnpm/pocketbase@0.19.0/node_modules/pocketbase/src/stores/BaseAuthStore.ts", "../../node_modules/.pnpm/pocketbase@0.19.0/node_modules/pocketbase/src/stores/LocalAuthStore.ts", "../../node_modules/.pnpm/pocketbase@0.19.0/node_modules/pocketbase/src/services/utils/BaseService.ts", "../../node_modules/.pnpm/pocketbase@0.19.0/node_modules/pocketbase/src/services/SettingsService.ts", "../../node_modules/.pnpm/pocketbase@0.19.0/node_modules/pocketbase/src/services/utils/CrudService.ts", "../../node_modules/.pnpm/pocketbase@0.19.0/node_modules/pocketbase/src/services/utils/legacy.ts", "../../node_modules/.pnpm/pocketbase@0.19.0/node_modules/pocketbase/src/services/utils/refresh.ts", "../../node_modules/.pnpm/pocketbase@0.19.0/node_modules/pocketbase/src/services/AdminService.ts", "../../node_modules/.pnpm/pocketbase@0.19.0/node_modules/pocketbase/src/services/RealtimeService.ts", "../../node_modules/.pnpm/pocketbase@0.19.0/node_modules/pocketbase/src/services/RecordService.ts", "../../node_modules/.pnpm/pocketbase@0.19.0/node_modules/pocketbase/src/services/CollectionService.ts", "../../node_modules/.pnpm/pocketbase@0.19.0/node_modules/pocketbase/src/services/LogService.ts", "../../node_modules/.pnpm/pocketbase@0.19.0/node_modules/pocketbase/src/services/HealthService.ts", "../../node_modules/.pnpm/pocketbase@0.19.0/node_modules/pocketbase/src/services/FileService.ts", "../../node_modules/.pnpm/pocketbase@0.19.0/node_modules/pocketbase/src/services/BackupService.ts", "../../node_modules/.pnpm/pocketbase@0.19.0/node_modules/pocketbase/src/Client.ts", "../../node_modules/.pnpm/pocketbase@0.19.0/node_modules/pocketbase/src/stores/AsyncAuthStore.ts", "../../_packs/pocketbase.ts", "../../node_modules/.pnpm/preact@10.19.2/node_modules/preact/jsx-runtime/src/utils.js", "../../node_modules/.pnpm/preact@10.19.2/node_modules/preact/src/constants.js", "../../node_modules/.pnpm/preact@10.19.2/node_modules/preact/jsx-runtime/src/index.js", "../../_packs/controllers/load_profile_controller.js", "../../_packs/controllers/login_controller.js", "../../_packs/controllers/autofill_profile_controller.js", "../../_packs/controllers/logout_controller.js"],
4
+ "sourcesContent": ["\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.trim = (str, char) => {\n return str.replace(new RegExp(\"^[\" + char + \"]+|[\" + char + \"]+$\", \"g\"), \"\");\n};\n", "\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nconst trim_1 = require(\"./trim\");\nexports.formatVersion = (version, versionTruncation) => {\n if (version === undefined)\n return \"\";\n const versionString = trim_1.trim(version, \". \").replace(new RegExp(\"_\", \"g\"), \".\");\n const versionParts = versionString.split(\".\");\n // Return if the string is not only digits once we removed the dots\n if (!/^\\d+$/.test(versionParts.join(\"\"))) {\n return versionString;\n }\n if (versionTruncation !== 0) {\n if (Number.isInteger(parseFloat(versionString))) {\n return parseInt(versionString, 10).toFixed(1);\n }\n }\n if (versionParts.length > 1) {\n if (versionTruncation !== null) {\n return versionParts.slice(0, versionTruncation + 1).join(\".\");\n }\n }\n return versionString;\n};\nexports.parseBrowserEngineVersion = (userAgent, engine) => {\n if (!engine)\n return \"\";\n if (engine === \"Gecko\") {\n const geckoVersionRegex = /[ ](?:rv[: ]([0-9\\.]+)).*gecko\\/[0-9]{8,10}/i;\n const match = userAgent.match(geckoVersionRegex);\n if (match) {\n return match.pop();\n }\n }\n const regex = new RegExp(`${engine}\\\\s*\\\\/?\\\\s*((?:(?=\\\\d+\\\\.\\\\d)\\\\d+[.\\\\d]*|\\\\d{1,7}(?=(?:\\\\D|$))))`, \"i\");\n const match = userAgent.match(regex);\n if (!match)\n return \"\";\n return match.pop();\n};\n", "\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.variableReplacement = (template, variables) => {\n const regex = new RegExp(`\\\\$\\\\d`, \"g\");\n if (template === null || template === undefined)\n return \"\";\n return template.replace(regex, (match) => {\n const index = parseInt(match.substr(1), 10);\n const variable = variables[index - 1];\n return variable || \"\";\n });\n};\n", "\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.memoryCache = () => {\n const memoryCacheBucket = {};\n const set = (key, value) => {\n memoryCacheBucket[key] = value;\n };\n const get = (key) => {\n if (memoryCacheBucket.hasOwnProperty(key)) {\n return memoryCacheBucket[key];\n }\n };\n return {\n set,\n get\n };\n};\n", "\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nconst memory_cache_1 = require(\"./memory-cache\");\nconst cache = memory_cache_1.memoryCache();\nconst getRegexInstance = (rawRegex) => {\n const cachedRegexInstance = cache.get(rawRegex);\n if (cachedRegexInstance)\n return cachedRegexInstance.value;\n const regexInstance = RegExp(`(?:^|[^A-Z0-9\\-_]|[^A-Z0-9\\-]_|sprd-)(?:${rawRegex})`, \"i\");\n cache.set(rawRegex, {\n value: regexInstance\n });\n return regexInstance;\n};\nexports.userAgentParser = (rawRegex, userAgent) => {\n // TODO: find out why it fails in some browsers\n try {\n const regexInstance = getRegexInstance(rawRegex);\n const match = regexInstance.exec(userAgent);\n return match ? match.slice(1) : null;\n }\n catch (_a) {\n return null;\n }\n};\n", "\"use strict\";\nvar __importDefault = (this && this.__importDefault) || function (mod) {\n return (mod && mod.__esModule) ? mod : { \"default\": mod };\n};\nObject.defineProperty(exports, \"__esModule\", { value: true });\nconst version_1 = require(\"../../utils/version\");\nconst variable_replacement_1 = require(\"../../utils/variable-replacement\");\nconst user_agent_1 = require(\"../../utils/user-agent\");\nconst browsers_json_1 = __importDefault(require(\"../../fixtures/regexes/client/browsers.json\"));\nconst browser_engine_json_1 = __importDefault(require(\"../../fixtures/regexes/client/browser_engine.json\"));\nconst available_browsers_json_1 = __importDefault(require(\"./fixtures/available-browsers.json\"));\nconst mobile_only_browsers_json_1 = __importDefault(require(\"./fixtures/mobile-only-browsers.json\"));\nclass BrowserParser {\n constructor(options) {\n this.options = {\n versionTruncation: 1\n };\n this.parse = (userAgent) => {\n const result = {\n type: \"\",\n name: \"\",\n version: \"\",\n engine: \"\",\n engineVersion: \"\"\n };\n for (const browser of browsers_json_1.default) {\n const match = user_agent_1.userAgentParser(browser.regex, userAgent);\n if (!match)\n continue;\n const vrpVersion = variable_replacement_1.variableReplacement(browser.version, match);\n const version = version_1.formatVersion(vrpVersion, this.options.versionTruncation);\n const shortVersion = version && parseFloat(version_1.formatVersion(vrpVersion, 1)) || \"\";\n if (browser.engine) {\n result.engine = browser.engine.default;\n if (browser.engine && browser.engine.versions && shortVersion) {\n const sortedEngineVersions = Object.entries(browser.engine.versions).sort((a, b) => {\n return parseFloat(a[0]) > parseFloat(b[0]) ? 1 : -1;\n });\n for (const [versionThreshold, engineByVersion] of sortedEngineVersions) {\n if (parseFloat(versionThreshold) <= shortVersion) {\n result.engine = engineByVersion || \"\";\n }\n }\n }\n }\n result.type = \"browser\";\n result.name = variable_replacement_1.variableReplacement(browser.name, match);\n result.version = version;\n break;\n }\n if (!result.engine) {\n for (const browserEngine of browser_engine_json_1.default) {\n let match = null;\n try {\n match = RegExp(browserEngine.regex, \"i\").exec(userAgent);\n }\n catch (_a) {\n // TODO: find out why it fails in some browsers\n }\n if (!match)\n continue;\n result.engine = browserEngine.name;\n break;\n }\n }\n result.engineVersion = version_1.formatVersion(version_1.parseBrowserEngineVersion(userAgent, result.engine), this.options.versionTruncation);\n return result;\n };\n this.options = Object.assign(Object.assign({}, this.options), options);\n }\n}\nexports.default = BrowserParser;\nBrowserParser.getBrowserShortName = (browserName) => {\n for (const [shortName, name] of Object.entries(available_browsers_json_1.default)) {\n if (name === browserName) {\n return shortName;\n }\n }\n return \"\";\n};\nBrowserParser.isMobileOnlyBrowser = (browserName) => {\n return mobile_only_browsers_json_1.default.includes(BrowserParser.getBrowserShortName(browserName));\n};\n", "\"use strict\";\nvar __importDefault = (this && this.__importDefault) || function (mod) {\n return (mod && mod.__esModule) ? mod : { \"default\": mod };\n};\nObject.defineProperty(exports, \"__esModule\", { value: true });\nconst mobile_apps_json_1 = __importDefault(require(\"../../fixtures/regexes/client/mobile_apps.json\"));\nconst version_1 = require(\"../../utils/version\");\nconst variable_replacement_1 = require(\"../../utils/variable-replacement\");\nconst user_agent_1 = require(\"../../utils/user-agent\");\nclass MobileAppParser {\n constructor(options) {\n this.options = {\n versionTruncation: 1\n };\n this.parse = (userAgent) => {\n const result = {\n type: \"\",\n name: \"\",\n version: \"\"\n };\n for (const mobileApp of mobile_apps_json_1.default) {\n const match = user_agent_1.userAgentParser(mobileApp.regex, userAgent);\n if (!match)\n continue;\n result.type = \"mobile app\";\n result.name = variable_replacement_1.variableReplacement(mobileApp.name, match);\n result.version = version_1.formatVersion(variable_replacement_1.variableReplacement(mobileApp.version, match), this.options.versionTruncation);\n break;\n }\n return result;\n };\n this.options = Object.assign(Object.assign({}, this.options), options);\n }\n}\nexports.default = MobileAppParser;\n", "\"use strict\";\nvar __importDefault = (this && this.__importDefault) || function (mod) {\n return (mod && mod.__esModule) ? mod : { \"default\": mod };\n};\nObject.defineProperty(exports, \"__esModule\", { value: true });\nconst feed_readers_json_1 = __importDefault(require(\"../../fixtures/regexes/client/feed_readers.json\"));\nconst version_1 = require(\"../../utils/version\");\nconst variable_replacement_1 = require(\"../../utils/variable-replacement\");\nconst user_agent_1 = require(\"../../utils/user-agent\");\nclass FeedReaderParser {\n constructor(options) {\n this.options = {\n versionTruncation: 1\n };\n this.parse = (userAgent) => {\n const result = {\n type: \"\",\n name: \"\",\n version: \"\",\n url: \"\"\n };\n for (const feedReader of feed_readers_json_1.default) {\n const match = user_agent_1.userAgentParser(feedReader.regex, userAgent);\n if (!match)\n continue;\n result.type = \"feed reader\";\n result.name = variable_replacement_1.variableReplacement(feedReader.name, match);\n result.version = version_1.formatVersion(variable_replacement_1.variableReplacement(feedReader.version, match), this.options.versionTruncation);\n result.url = feedReader.url;\n break;\n }\n return result;\n };\n this.options = Object.assign(Object.assign({}, this.options), options);\n }\n}\nexports.default = FeedReaderParser;\n", "\"use strict\";\nvar __importDefault = (this && this.__importDefault) || function (mod) {\n return (mod && mod.__esModule) ? mod : { \"default\": mod };\n};\nObject.defineProperty(exports, \"__esModule\", { value: true });\nconst libraries_json_1 = __importDefault(require(\"../../fixtures/regexes/client/libraries.json\"));\nconst version_1 = require(\"../../utils/version\");\nconst variable_replacement_1 = require(\"../../utils/variable-replacement\");\nconst user_agent_1 = require(\"../../utils/user-agent\");\nclass LibraryParser {\n constructor(options) {\n this.options = {\n versionTruncation: 1\n };\n this.parse = (userAgent) => {\n const result = {\n type: \"\",\n name: \"\",\n version: \"\",\n url: \"\"\n };\n for (const library of libraries_json_1.default) {\n const match = user_agent_1.userAgentParser(library.regex, userAgent);\n if (!match)\n continue;\n result.type = \"library\";\n result.name = variable_replacement_1.variableReplacement(library.name, match);\n result.version = version_1.formatVersion(variable_replacement_1.variableReplacement(library.version, match), this.options.versionTruncation);\n result.url = library.url || \"\";\n break;\n }\n return result;\n };\n this.options = Object.assign(Object.assign({}, this.options), options);\n }\n}\nexports.default = LibraryParser;\n", "\"use strict\";\nvar __importDefault = (this && this.__importDefault) || function (mod) {\n return (mod && mod.__esModule) ? mod : { \"default\": mod };\n};\nObject.defineProperty(exports, \"__esModule\", { value: true });\nconst mediaplayers_json_1 = __importDefault(require(\"../../fixtures/regexes/client/mediaplayers.json\"));\nconst version_1 = require(\"../../utils/version\");\nconst variable_replacement_1 = require(\"../../utils/variable-replacement\");\nconst user_agent_1 = require(\"../../utils/user-agent\");\nclass MediaPlayerParser {\n constructor(options) {\n this.options = {\n versionTruncation: 1\n };\n this.parse = (userAgent) => {\n const result = {\n type: \"\",\n name: \"\",\n version: \"\"\n };\n for (const mediaPlayer of mediaplayers_json_1.default) {\n const match = user_agent_1.userAgentParser(mediaPlayer.regex, userAgent);\n if (!match)\n continue;\n result.type = \"media player\";\n result.name = variable_replacement_1.variableReplacement(mediaPlayer.name, match);\n result.version = version_1.formatVersion(variable_replacement_1.variableReplacement(mediaPlayer.version, match), this.options.versionTruncation);\n break;\n }\n return result;\n };\n this.options = Object.assign(Object.assign({}, this.options), options);\n }\n}\nexports.default = MediaPlayerParser;\n", "\"use strict\";\nvar __importDefault = (this && this.__importDefault) || function (mod) {\n return (mod && mod.__esModule) ? mod : { \"default\": mod };\n};\nObject.defineProperty(exports, \"__esModule\", { value: true });\nconst pim_json_1 = __importDefault(require(\"../../fixtures/regexes/client/pim.json\"));\nconst version_1 = require(\"../../utils/version\");\nconst variable_replacement_1 = require(\"../../utils/variable-replacement\");\nconst user_agent_1 = require(\"../../utils/user-agent\");\nclass PersonalInformationManagerParser {\n constructor(options) {\n this.options = {\n versionTruncation: 1\n };\n this.parse = (userAgent) => {\n const result = {\n type: \"\",\n name: \"\",\n version: \"\"\n };\n for (const personalInformationManager of pim_json_1.default) {\n const match = user_agent_1.userAgentParser(personalInformationManager.regex, userAgent);\n if (!match)\n continue;\n result.type = \"personal information manager\";\n result.name = variable_replacement_1.variableReplacement(personalInformationManager.name, match);\n result.version = version_1.formatVersion(variable_replacement_1.variableReplacement(personalInformationManager.version, match), this.options.versionTruncation);\n break;\n }\n return result;\n };\n this.options = Object.assign(Object.assign({}, this.options), options);\n }\n}\nexports.default = PersonalInformationManagerParser;\n", "\"use strict\";\nvar __importDefault = (this && this.__importDefault) || function (mod) {\n return (mod && mod.__esModule) ? mod : { \"default\": mod };\n};\nObject.defineProperty(exports, \"__esModule\", { value: true });\nconst browser_1 = __importDefault(require(\"./browser\"));\nconst mobile_apps_1 = __importDefault(require(\"./mobile-apps\"));\nconst feed_readers_1 = __importDefault(require(\"./feed-readers\"));\nconst libraries_1 = __importDefault(require(\"./libraries\"));\nconst media_players_1 = __importDefault(require(\"./media-players\"));\nconst personal_information_managers_1 = __importDefault(require(\"./personal-information-managers\"));\nconst clientParsers = [\n feed_readers_1.default,\n mobile_apps_1.default,\n media_players_1.default,\n personal_information_managers_1.default,\n browser_1.default,\n libraries_1.default\n];\nclass ClientParser {\n constructor(options) {\n this.options = {\n versionTruncation: 1\n };\n this.parse = (userAgent) => {\n for (const Parser of clientParsers) {\n const parser = new Parser(this.options);\n const client = parser.parse(userAgent);\n if (client.type !== \"\")\n return client;\n }\n return null;\n };\n this.options = Object.assign(Object.assign({}, this.options), options);\n }\n}\nexports.default = ClientParser;\n", "\"use strict\";\nvar __importDefault = (this && this.__importDefault) || function (mod) {\n return (mod && mod.__esModule) ? mod : { \"default\": mod };\n};\nObject.defineProperty(exports, \"__esModule\", { value: true });\nconst cameras_json_1 = __importDefault(require(\"../../fixtures/regexes/device/cameras.json\"));\nconst variable_replacement_1 = require(\"../../utils/variable-replacement\");\nconst user_agent_1 = require(\"../../utils/user-agent\");\nclass CameraParser {\n constructor() {\n this.parse = (userAgent) => {\n const result = {\n type: \"\",\n brand: \"\",\n model: \"\"\n };\n for (const [brand, camera] of Object.entries(cameras_json_1.default)) {\n const match = user_agent_1.userAgentParser(camera.regex, userAgent);\n if (!match)\n continue;\n result.type = \"camera\";\n result.brand = brand;\n if (\"model\" in camera && camera.model) {\n result.model = variable_replacement_1.variableReplacement(camera.model, match).trim();\n }\n else if (\"models\" in camera && camera.models) {\n for (const model of camera.models) {\n const modelMatch = user_agent_1.userAgentParser(model.regex, userAgent);\n if (!modelMatch)\n continue;\n result.model = variable_replacement_1.variableReplacement(model.model, modelMatch).trim();\n break;\n }\n }\n break;\n }\n return result;\n };\n }\n}\nexports.default = CameraParser;\n", "\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.buildModel = (model) => {\n model = model.replace(/_/g, \" \");\n model = model.replace(RegExp(\" TD$\", \"i\"), \"\");\n if (model === \"Build\")\n return \"\";\n return model;\n};\n", "\"use strict\";\nvar __importDefault = (this && this.__importDefault) || function (mod) {\n return (mod && mod.__esModule) ? mod : { \"default\": mod };\n};\nObject.defineProperty(exports, \"__esModule\", { value: true });\nconst mobiles_json_1 = __importDefault(require(\"../../fixtures/regexes/device/mobiles.json\"));\nconst variable_replacement_1 = require(\"../../utils/variable-replacement\");\nconst user_agent_1 = require(\"../../utils/user-agent\");\nconst model_1 = require(\"../../utils/model\");\nclass MobileParser {\n constructor() {\n this.parse = (userAgent) => {\n const result = {\n type: \"\",\n brand: \"\",\n model: \"\"\n };\n let resultType = \"\";\n for (const [brand, mobile] of Object.entries(mobiles_json_1.default)) {\n const match = user_agent_1.userAgentParser(mobile.regex, userAgent);\n if (!match)\n continue;\n resultType = \"device\" in mobile && mobile.device || \"\";\n result.brand = brand;\n if (\"model\" in mobile && mobile.model) {\n result.model = model_1.buildModel(variable_replacement_1.variableReplacement(mobile.model, match)).trim();\n }\n else if (\"models\" in mobile && mobile.models) {\n for (const model of mobile.models) {\n const modelMatch = user_agent_1.userAgentParser(model.regex, userAgent);\n if (!modelMatch)\n continue;\n result.model = model_1.buildModel(variable_replacement_1.variableReplacement(model.model, modelMatch)).trim();\n if (\"device\" in model && model.device) {\n resultType = model.device;\n }\n if (\"brand\" in model) {\n result.brand = model.brand || \"\";\n }\n break;\n }\n }\n break;\n }\n // Sanitize device type\n if (resultType === \"tv\") {\n result.type = \"television\";\n }\n else if (resultType === \"car browser\") {\n result.type = \"car\";\n }\n else {\n result.type = resultType;\n }\n // Sanitize device brand\n if (result.brand === \"Unknown\") {\n result.brand = \"\";\n }\n return result;\n };\n }\n}\nexports.default = MobileParser;\n", "\"use strict\";\nvar __importDefault = (this && this.__importDefault) || function (mod) {\n return (mod && mod.__esModule) ? mod : { \"default\": mod };\n};\nObject.defineProperty(exports, \"__esModule\", { value: true });\nconst televisions_json_1 = __importDefault(require(\"../../fixtures/regexes/device/televisions.json\"));\nconst variable_replacement_1 = require(\"../../utils/variable-replacement\");\nconst user_agent_1 = require(\"../../utils/user-agent\");\nconst model_1 = require(\"../../utils/model\");\nclass TelevisionParser {\n constructor() {\n this.parse = (userAgent) => {\n const result = {\n type: \"\",\n brand: \"\",\n model: \"\"\n };\n if (!this.isHbbTv(userAgent))\n return result;\n result.type = \"television\";\n for (const [brand, television] of Object.entries(televisions_json_1.default)) {\n const match = user_agent_1.userAgentParser(television.regex, userAgent);\n if (!match)\n continue;\n result.brand = brand;\n if (\"model\" in television && television.model) {\n result.model = model_1.buildModel(variable_replacement_1.variableReplacement(television.model, match)).trim();\n }\n else if (\"models\" in television && television.models) {\n for (const model of television.models) {\n const modelMatch = user_agent_1.userAgentParser(model.regex, userAgent);\n if (!modelMatch)\n continue;\n result.model = model_1.buildModel(variable_replacement_1.variableReplacement(model.model, modelMatch)).trim();\n break;\n }\n }\n break;\n }\n return result;\n };\n this.isHbbTv = (userAgent) => {\n return user_agent_1.userAgentParser(\"HbbTV\\/([1-9]{1}(?:\\.[0-9]{1}){1,2})\", userAgent);\n };\n }\n}\nexports.default = TelevisionParser;\n", "\"use strict\";\nvar __importDefault = (this && this.__importDefault) || function (mod) {\n return (mod && mod.__esModule) ? mod : { \"default\": mod };\n};\nObject.defineProperty(exports, \"__esModule\", { value: true });\nconst car_browsers_json_1 = __importDefault(require(\"../../fixtures/regexes/device/car_browsers.json\"));\nconst variable_replacement_1 = require(\"../../utils/variable-replacement\");\nconst user_agent_1 = require(\"../../utils/user-agent\");\nclass CarParser {\n constructor() {\n this.parse = (userAgent) => {\n const result = {\n type: \"\",\n brand: \"\",\n model: \"\"\n };\n for (const [brand, car] of Object.entries(car_browsers_json_1.default)) {\n const match = user_agent_1.userAgentParser(car.regex, userAgent);\n if (!match)\n continue;\n result.type = \"car\";\n result.brand = brand;\n for (const model of car.models) {\n const match = user_agent_1.userAgentParser(model.regex, userAgent);\n if (!match)\n continue;\n result.model = variable_replacement_1.variableReplacement(model.model, match).trim();\n }\n break;\n }\n return result;\n };\n }\n}\nexports.default = CarParser;\n", "\"use strict\";\nvar __importDefault = (this && this.__importDefault) || function (mod) {\n return (mod && mod.__esModule) ? mod : { \"default\": mod };\n};\nObject.defineProperty(exports, \"__esModule\", { value: true });\nconst consoles_json_1 = __importDefault(require(\"../../fixtures/regexes/device/consoles.json\"));\nconst variable_replacement_1 = require(\"../../utils/variable-replacement\");\nconst user_agent_1 = require(\"../../utils/user-agent\");\nclass ConsoleParser {\n constructor() {\n this.parse = (userAgent) => {\n const result = {\n type: \"\",\n brand: \"\",\n model: \"\"\n };\n for (const [brand, gameConsole] of Object.entries(consoles_json_1.default)) {\n const match = user_agent_1.userAgentParser(gameConsole.regex, userAgent);\n if (!match)\n continue;\n result.type = gameConsole.device;\n result.brand = brand;\n if (\"model\" in gameConsole && gameConsole.model) {\n result.model = variable_replacement_1.variableReplacement(gameConsole.model, match).trim();\n }\n else if (\"models\" in gameConsole && gameConsole.models) {\n for (const model of gameConsole.models) {\n const modelMatch = user_agent_1.userAgentParser(model.regex, userAgent);\n if (!modelMatch)\n continue;\n result.model = variable_replacement_1.variableReplacement(model.model, modelMatch).trim();\n break;\n }\n }\n break;\n }\n return result;\n };\n }\n}\nexports.default = ConsoleParser;\n", "\"use strict\";\nvar __importDefault = (this && this.__importDefault) || function (mod) {\n return (mod && mod.__esModule) ? mod : { \"default\": mod };\n};\nObject.defineProperty(exports, \"__esModule\", { value: true });\nconst notebooks_json_1 = __importDefault(require(\"../../fixtures/regexes/device/notebooks.json\"));\nconst variable_replacement_1 = require(\"../../utils/variable-replacement\");\nconst user_agent_1 = require(\"../../utils/user-agent\");\nconst model_1 = require(\"../../utils/model\");\nclass NotebooksParser {\n constructor() {\n this.parse = (userAgent) => {\n const result = {\n type: \"\",\n brand: \"\",\n model: \"\"\n };\n if (!user_agent_1.userAgentParser(\"FBMD/\", userAgent)) {\n return result;\n }\n for (const [brand, notebook] of Object.entries(notebooks_json_1.default)) {\n const match = user_agent_1.userAgentParser(notebook.regex, userAgent);\n if (!match)\n continue;\n result.type = \"desktop\";\n result.brand = brand;\n if (\"model\" in notebook && notebook.model) {\n result.model = model_1.buildModel(variable_replacement_1.variableReplacement(notebook.model, match)).trim();\n }\n else if (\"models\" in notebook && notebook.models) {\n for (const model of notebook.models) {\n const match = user_agent_1.userAgentParser(model.regex, userAgent);\n if (!match)\n continue;\n result.model = variable_replacement_1.variableReplacement(model.model, match).trim();\n }\n }\n break;\n }\n return result;\n };\n }\n}\nexports.default = NotebooksParser;\n", "\"use strict\";\nvar __importDefault = (this && this.__importDefault) || function (mod) {\n return (mod && mod.__esModule) ? mod : { \"default\": mod };\n};\nObject.defineProperty(exports, \"__esModule\", { value: true });\nconst portable_media_player_json_1 = __importDefault(require(\"../../fixtures/regexes/device/portable_media_player.json\"));\nconst variable_replacement_1 = require(\"../../utils/variable-replacement\");\nconst user_agent_1 = require(\"../../utils/user-agent\");\nclass PortableMediaPlayersParser {\n constructor() {\n this.parse = (userAgent) => {\n const result = {\n type: \"\",\n brand: \"\",\n model: \"\"\n };\n for (const [brand, portableMediaPlayer] of Object.entries(portable_media_player_json_1.default)) {\n const match = user_agent_1.userAgentParser(portableMediaPlayer.regex, userAgent);\n if (!match)\n continue;\n result.type = portableMediaPlayer.device;\n result.brand = brand;\n if (\"model\" in portableMediaPlayer && portableMediaPlayer.model) {\n result.model = variable_replacement_1.variableReplacement(portableMediaPlayer.model, match).trim();\n }\n else if (\"models\" in portableMediaPlayer && portableMediaPlayer.models) {\n for (const model of portableMediaPlayer.models) {\n const modelMatch = user_agent_1.userAgentParser(model.regex, userAgent);\n if (!modelMatch)\n continue;\n result.model = variable_replacement_1.variableReplacement(model.model, modelMatch).trim();\n break;\n }\n }\n break;\n }\n return result;\n };\n }\n}\nexports.default = PortableMediaPlayersParser;\n", "\"use strict\";\nvar __importDefault = (this && this.__importDefault) || function (mod) {\n return (mod && mod.__esModule) ? mod : { \"default\": mod };\n};\nObject.defineProperty(exports, \"__esModule\", { value: true });\nconst cameras_1 = __importDefault(require(\"./cameras\"));\nconst mobiles_1 = __importDefault(require(\"./mobiles\"));\nconst televisions_1 = __importDefault(require(\"./televisions\"));\nconst cars_1 = __importDefault(require(\"./cars\"));\nconst consoles_1 = __importDefault(require(\"./consoles\"));\nconst notebooks_1 = __importDefault(require(\"./notebooks\"));\nconst portable_media_players_1 = __importDefault(require(\"./portable-media-players\"));\nconst deviceParsers = [\n consoles_1.default,\n cars_1.default,\n cameras_1.default,\n televisions_1.default,\n portable_media_players_1.default,\n mobiles_1.default,\n notebooks_1.default\n];\nclass ClientParser {\n constructor() {\n this.parse = (userAgent) => {\n for (const Parser of deviceParsers) {\n const parser = new Parser();\n const device = parser.parse(userAgent);\n if (device.type !== \"\") {\n return device;\n }\n }\n return null;\n };\n }\n}\nexports.default = ClientParser;\n", "\"use strict\";\nvar __importDefault = (this && this.__importDefault) || function (mod) {\n return (mod && mod.__esModule) ? mod : { \"default\": mod };\n};\nObject.defineProperty(exports, \"__esModule\", { value: true });\nconst oss_json_1 = __importDefault(require(\"../../fixtures/regexes/oss.json\"));\nconst version_1 = require(\"../../utils/version\");\nconst variable_replacement_1 = require(\"../../utils/variable-replacement\");\nconst user_agent_1 = require(\"../../utils/user-agent\");\nconst operating_system_json_1 = __importDefault(require(\"./fixtures/operating-system.json\"));\nconst desktopOsArray = [\"AmigaOS\", \"IBM\", \"GNU/Linux\", \"Mac\", \"Unix\", \"Windows\", \"BeOS\", \"Chrome OS\"];\nconst shortOsNames = operating_system_json_1.default.operatingSystem;\nconst osFamilies = operating_system_json_1.default.osFamilies;\nclass OperatingSystemParser {\n constructor(options) {\n this.options = {\n versionTruncation: 1\n };\n this.parse = (userAgent) => {\n const result = {\n name: \"\",\n version: \"\",\n platform: this.parsePlatform(userAgent)\n };\n for (const operatingSystem of oss_json_1.default) {\n const match = user_agent_1.userAgentParser(operatingSystem.regex, userAgent);\n if (!match)\n continue;\n result.name = variable_replacement_1.variableReplacement(operatingSystem.name, match);\n result.version = version_1.formatVersion(variable_replacement_1.variableReplacement(operatingSystem.version, match), this.options.versionTruncation);\n if (result.name === \"lubuntu\") {\n result.name = \"Lubuntu\";\n }\n if (result.name === \"debian\") {\n result.name = \"Debian\";\n }\n if (result.name === \"YunOS\") {\n result.name = \"YunOs\";\n }\n return result;\n }\n return null;\n };\n this.parsePlatform = (userAgent) => {\n if (user_agent_1.userAgentParser(\"arm|aarch64|Watch ?OS|Watch1,[12]\", userAgent)) {\n return \"ARM\";\n }\n if (user_agent_1.userAgentParser(\"mips\", userAgent)) {\n return \"MIPS\";\n }\n if (user_agent_1.userAgentParser(\"sh4\", userAgent)) {\n return \"SuperH\";\n }\n if (user_agent_1.userAgentParser(\"WOW64|x64|win64|amd64|x86_?64\", userAgent)) {\n return \"x64\";\n }\n if (user_agent_1.userAgentParser(\"(?:i[0-9]|x)86|i86pc\", userAgent)) {\n return \"x86\";\n }\n return \"\";\n };\n this.options = Object.assign(Object.assign({}, this.options), options);\n }\n}\nexports.default = OperatingSystemParser;\nOperatingSystemParser.getDesktopOsArray = () => desktopOsArray;\nOperatingSystemParser.getOsFamily = (osName) => {\n const osShortName = OperatingSystemParser.getOsShortName(osName);\n for (const [osFamily, shortNames] of Object.entries(osFamilies)) {\n if (shortNames.includes(osShortName)) {\n return osFamily;\n }\n }\n return \"\";\n};\nOperatingSystemParser.getOsShortName = (osName) => {\n for (const [shortName, name] of Object.entries(shortOsNames)) {\n if (name === osName)\n return shortName;\n }\n return \"\";\n};\n", "\"use strict\";\nvar __importDefault = (this && this.__importDefault) || function (mod) {\n return (mod && mod.__esModule) ? mod : { \"default\": mod };\n};\nObject.defineProperty(exports, \"__esModule\", { value: true });\nconst vendorfragments_json_1 = __importDefault(require(\"../../fixtures/regexes/vendorfragments.json\"));\nconst user_agent_1 = require(\"../../utils/user-agent\");\nclass VendorFragmentParser {\n constructor() {\n this.parse = (userAgent) => {\n for (const [brand, vendorFragment] of Object.entries(vendorfragments_json_1.default)) {\n for (const regex of vendorFragment) {\n const match = user_agent_1.userAgentParser(regex, userAgent);\n if (!match)\n continue;\n return brand;\n }\n }\n return \"\";\n };\n }\n}\nexports.default = VendorFragmentParser;\n", "\"use strict\";\nvar __importDefault = (this && this.__importDefault) || function (mod) {\n return (mod && mod.__esModule) ? mod : { \"default\": mod };\n};\nconst bots_json_1 = __importDefault(require(\"../../fixtures/regexes/bots.json\"));\nconst user_agent_1 = require(\"../../utils/user-agent\");\nclass BotParser {\n constructor() {\n this.parse = (userAgent) => {\n var _a, _b, _c, _d;\n for (const bot of bots_json_1.default) {\n const match = user_agent_1.userAgentParser(bot.regex, userAgent);\n if (!match)\n continue;\n return {\n name: bot.name,\n category: bot.category || \"\",\n url: bot.url || \"\",\n producer: {\n name: ((_b = (_a = bot) === null || _a === void 0 ? void 0 : _a.producer) === null || _b === void 0 ? void 0 : _b.name) || \"\",\n url: ((_d = (_c = bot) === null || _c === void 0 ? void 0 : _c.producer) === null || _d === void 0 ? void 0 : _d.url) || \"\"\n }\n };\n }\n return null;\n };\n }\n}\nmodule.exports = BotParser;\n", "\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.versionCompare = (v1, v2, operator) => {\n // discuss at: http://locutus.io/php/version_compare/\n // original by: Philippe Jausions (http://pear.php.net/user/jausions)\n // original by: Aidan Lister (http://aidanlister.com/)\n // reimplemented by: Kankrelune (http://www.webfaktory.info/)\n // improved by: Brett Zamir (http://brett-zamir.me)\n // improved by: Scott Baker\n // improved by: Theriault (https://github.com/Theriault)\n // example 1: version_compare('8.2.5rc', '8.2.5a')\n // returns 1: 1\n // example 2: version_compare('8.2.50', '8.2.52', '<')\n // returns 2: true\n // example 3: version_compare('5.3.0-dev', '5.3.0')\n // returns 3: -1\n // example 4: version_compare('4.1.0.52','4.01.0.51')\n // returns 4: 1\n // Important: compare must be initialized at 0.\n let i;\n let x;\n let compare = 0;\n // vm maps textual PHP versions to negatives so they're less than 0.\n // PHP currently defines these as CASE-SENSITIVE. It is important to\n // leave these as negatives so that they can come before numerical versions\n // and as if no letters were there to begin with.\n // (1alpha is < 1 and < 1.1 but > 1dev1)\n // If a non-numerical value can't be mapped to this table, it receives\n // -7 as its value.\n const vm = {\n \"dev\": -6,\n \"alpha\": -5,\n \"a\": -5,\n \"beta\": -4,\n \"b\": -4,\n \"RC\": -3,\n \"rc\": -3,\n \"#\": -2,\n \"p\": 1,\n \"pl\": 1\n };\n // This function will be called to prepare each version argument.\n // It replaces every _, -, and + with a dot.\n // It surrounds any nonsequence of numbers/dots with dots.\n // It replaces sequences of dots with a single dot.\n // version_compare('4..0', '4.0') === 0\n // Important: A string of 0 length needs to be converted into a value\n // even less than an unexisting value in vm (-7), hence [-8].\n // It's also important to not strip spaces because of this.\n // version_compare('', ' ') === 1\n const prepVersion = (v) => {\n v = (\"\" + v).replace(/[_\\-+]/g, \".\");\n v = v.replace(/([^.\\d]+)/g, \".$1.\").replace(/\\.{2,}/g, \".\");\n return (!v.length ? [-8] : v.split(\".\"));\n };\n // This converts a version component to a number.\n // Empty component becomes 0.\n // Non-numerical component becomes a negative number.\n // Numerical component becomes itself as an integer.\n const numVersion = (v) => {\n return !v ? 0 : (isNaN(v) ? vm[v] || -7 : parseInt(v, 10));\n };\n v1 = prepVersion(v1);\n v2 = prepVersion(v2);\n x = Math.max(v1.length, v2.length);\n for (i = 0; i < x; i++) {\n if (v1[i] === v2[i]) {\n continue;\n }\n v1[i] = numVersion(v1[i]);\n v2[i] = numVersion(v2[i]);\n if (v1[i] < v2[i]) {\n compare = -1;\n break;\n }\n else if (v1[i] > v2[i]) {\n compare = 1;\n break;\n }\n }\n if (!operator) {\n return compare;\n }\n // Important: operator is CASE-SENSITIVE.\n // \"No operator\" seems to be treated as \"<.\"\n // Any other values seem to make the function return null.\n switch (operator) {\n case \">\":\n case \"gt\":\n return (compare > 0);\n case \">=\":\n case \"ge\":\n return (compare >= 0);\n case \"<=\":\n case \"le\":\n return (compare <= 0);\n case \"===\":\n case \"=\":\n case \"eq\":\n return (compare === 0);\n case \"<>\":\n case \"!==\":\n case \"ne\":\n return (compare !== 0);\n case \"\":\n case \"<\":\n case \"lt\":\n return (compare < 0);\n default:\n return null;\n }\n};\n", "\"use strict\";\nvar __importDefault = (this && this.__importDefault) || function (mod) {\n return (mod && mod.__esModule) ? mod : { \"default\": mod };\n};\nconst client_1 = __importDefault(require(\"./parsers/client\"));\nconst device_1 = __importDefault(require(\"./parsers/device\"));\nconst operating_system_1 = __importDefault(require(\"./parsers/operating-system\"));\nconst vendor_fragment_1 = __importDefault(require(\"./parsers/vendor-fragment\"));\nconst browser_1 = __importDefault(require(\"./parsers/client/browser\"));\nconst BotParser = require(\"./parsers/bot\");\nconst user_agent_1 = require(\"./utils/user-agent\");\nconst version_compare_1 = require(\"./utils/version-compare\");\nclass DeviceDetector {\n constructor(options) {\n // Default options\n this.options = {\n skipBotDetection: false,\n versionTruncation: 1\n };\n this.parse = (userAgent) => {\n var _a, _b, _c, _d, _e, _f, _g, _h, _j, _k, _l, _m, _o, _p;\n const result = {\n client: this.clientParser.parse(userAgent),\n os: this.operatingSystemParser.parse(userAgent),\n device: this.deviceParser.parse(userAgent),\n bot: this.options.skipBotDetection ? null : this.botParser.parse(userAgent)\n };\n const osName = (_a = result.os) === null || _a === void 0 ? void 0 : _a.name;\n const osVersion = (_b = result.os) === null || _b === void 0 ? void 0 : _b.version;\n const osFamily = operating_system_1.default.getOsFamily(osName || \"\");\n if (!((_c = result.device) === null || _c === void 0 ? void 0 : _c.brand)) {\n const brand = this.vendorFragmentParser.parse(userAgent);\n if (brand) {\n if (!result.device) {\n result.device = this.createDeviceObject();\n }\n result.device.brand = brand;\n }\n }\n /**\n * Assume all devices running iOS / Mac OS are from Apple\n */\n if (!((_d = result.device) === null || _d === void 0 ? void 0 : _d.brand) && [\"Apple TV\", \"watchOS\", \"iOS\", \"Mac\"].includes(osName || \"\")) {\n if (!result.device) {\n result.device = this.createDeviceObject();\n }\n result.device.brand = \"Apple\";\n }\n /**\n * Chrome on Android passes the device type based on the keyword 'Mobile'\n * If it is present the device should be a smartphone, otherwise it's a tablet\n * See https://developer.chrome.com/multidevice/user-agent#chrome_for_android_user_agent\n * Note: We do not check for browser (family) here, as there might be mobile apps using Chrome, that won't have\n * a detected browser, but can still be detected. So we check the useragent for Chrome instead.\n */\n if (!((_e = result.device) === null || _e === void 0 ? void 0 : _e.type) && osFamily === \"Android\" && user_agent_1.userAgentParser(\"Chrome/[\\\\.0-9]*\", userAgent)) {\n if (user_agent_1.userAgentParser(\"Chrome/[.0-9]* (?:Mobile|eliboM)\", userAgent)) {\n if (!result.device) {\n result.device = this.createDeviceObject();\n }\n result.device.type = \"smartphone\";\n }\n else if (user_agent_1.userAgentParser(\"Chrome/[.0-9]* (?!Mobile)\", userAgent)) {\n if (!result.device) {\n result.device = this.createDeviceObject();\n }\n result.device.type = \"tablet\";\n }\n }\n /**\n * Some user agents simply contain the fragment 'Android; Tablet;' or 'Opera Tablet', so we assume those devices are tablets\n */\n if (!((_f = result.device) === null || _f === void 0 ? void 0 : _f.type) && this.hasAndroidTabletFragment(userAgent) || user_agent_1.userAgentParser(\"Opera Tablet\", userAgent)) {\n if (!result.device) {\n result.device = this.createDeviceObject();\n }\n result.device.type = \"tablet\";\n }\n /**\n * Some user agents simply contain the fragment 'Android; Mobile;', so we assume those devices are smartphones\n */\n if (!((_g = result.device) === null || _g === void 0 ? void 0 : _g.type) && this.hasAndroidMobileFragment(userAgent)) {\n if (!result.device) {\n result.device = this.createDeviceObject();\n }\n result.device.type = \"smartphone\";\n }\n /**\n * Android up to 3.0 was designed for smartphones only. But as 3.0, which was tablet only, was published\n * too late, there were a bunch of tablets running with 2.x\n * With 4.0 the two trees were merged and it is for smartphones and tablets\n *\n * So were are expecting that all devices running Android < 2 are smartphones\n * Devices running Android 3.X are tablets. Device type of Android 2.X and 4.X+ are unknown\n */\n if (!((_h = result.device) === null || _h === void 0 ? void 0 : _h.type) && osName === \"Android\" && osVersion !== \"\") {\n if (version_compare_1.versionCompare(osVersion, \"2.0\") === -1) {\n if (!result.device) {\n result.device = this.createDeviceObject();\n }\n result.device.type = \"smartphone\";\n }\n else if (version_compare_1.versionCompare(osVersion, \"3.0\") >= 0 && version_compare_1.versionCompare(osVersion, \"4.0\") === -1) {\n if (!result.device) {\n result.device = this.createDeviceObject();\n }\n result.device.type = \"tablet\";\n }\n }\n /**\n * All detected feature phones running android are more likely smartphones\n */\n if (((_j = result.device) === null || _j === void 0 ? void 0 : _j.type) === \"feature phone\" && osFamily === \"Android\") {\n result.device.type = \"smartphone\";\n }\n /**\n * According to http://msdn.microsoft.com/en-us/library/ie/hh920767(v=vs.85).aspx\n * Internet Explorer 10 introduces the \"Touch\" UA string token. If this token is present at the end of the\n * UA string, the computer has touch capability, and is running Windows 8 (or later).\n * This UA string will be transmitted on a touch-enabled system running Windows 8 (RT)\n *\n * As most touch enabled devices are tablets and only a smaller part are desktops/notebooks we assume that\n * all Windows 8 touch devices are tablets.\n */\n if (!((_k = result.device) === null || _k === void 0 ? void 0 : _k.type)\n && this.isToucheEnabled(userAgent)\n && (osName === \"Windows RT\"\n || (osName === \"Windows\"\n && version_compare_1.versionCompare(osVersion, \"8.0\") >= 0))) {\n if (!result.device) {\n result.device = this.createDeviceObject();\n }\n result.device.type = \"tablet\";\n }\n /**\n * All devices running Opera TV Store are assumed to be televisions\n */\n if (user_agent_1.userAgentParser(\"Opera TV Store\", userAgent)) {\n if (!result.device) {\n result.device = this.createDeviceObject();\n }\n result.device.type = \"television\";\n }\n /**\n * All devices running Tizen TV or SmartTV are assumed to be televisions\n */\n if (user_agent_1.userAgentParser(\"SmartTV|Tizen.+ TV .+$\", userAgent)) {\n if (!result.device) {\n result.device = this.createDeviceObject();\n }\n result.device.type = \"television\";\n }\n /**\n * Devices running Kylo or Espital TV Browsers are assumed to be televisions\n */\n if (!((_l = result.device) === null || _l === void 0 ? void 0 : _l.type) && [\"Kylo\", \"Espial TV Browser\"].includes(((_m = result.client) === null || _m === void 0 ? void 0 : _m.name) || \"\")) {\n if (!result.device) {\n result.device = this.createDeviceObject();\n }\n result.device.type = \"television\";\n }\n /**\n * Set device type to desktop if string ua contains desktop\n */\n const hasDesktop = \"desktop\" !== ((_o = result.device) === null || _o === void 0 ? void 0 : _o.type)\n && null !== user_agent_1.userAgentParser(\"Desktop\", userAgent)\n && this.hasDesktopFragment(userAgent);\n if (hasDesktop) {\n if (!result.device) {\n result.device = this.createDeviceObject();\n }\n result.device.type = \"desktop\";\n }\n // set device type to desktop for all devices running a desktop os that were not detected as an other device type\n if (!((_p = result.device) === null || _p === void 0 ? void 0 : _p.type) && this.isDesktop(result, osFamily)) {\n if (!result.device) {\n result.device = this.createDeviceObject();\n }\n result.device.type = \"desktop\";\n }\n return result;\n };\n this.hasAndroidMobileFragment = (userAgent) => {\n return user_agent_1.userAgentParser(\"Android( [\\.0-9]+)?; Mobile;\", userAgent);\n };\n this.hasAndroidTabletFragment = (userAgent) => {\n return user_agent_1.userAgentParser(\"Android( [\\.0-9]+)?; Tablet;\", userAgent);\n };\n this.hasDesktopFragment = (userAgent) => {\n return user_agent_1.userAgentParser(\"Desktop (x(?:32|64)|WOW64);\", userAgent);\n };\n this.isDesktop = (result, osFamily) => {\n if (!result.os) {\n return false;\n }\n // Check for browsers available for mobile devices only\n if (this.usesMobileBrowser(result.client)) {\n return false;\n }\n return operating_system_1.default.getDesktopOsArray().includes(osFamily);\n };\n this.usesMobileBrowser = (client) => {\n var _a, _b;\n if (!client)\n return false;\n return ((_a = client) === null || _a === void 0 ? void 0 : _a.type) === \"browser\" && browser_1.default.isMobileOnlyBrowser((_b = client) === null || _b === void 0 ? void 0 : _b.name);\n };\n this.isToucheEnabled = (userAgent) => {\n return user_agent_1.userAgentParser(\"Touch\", userAgent);\n };\n this.createDeviceObject = () => ({\n type: \"\",\n brand: \"\",\n model: \"\"\n });\n this.options = Object.assign(Object.assign({}, this.options), options);\n this.clientParser = new client_1.default(this.options);\n this.deviceParser = new device_1.default();\n this.operatingSystemParser = new operating_system_1.default(this.options);\n this.vendorFragmentParser = new vendor_fragment_1.default();\n this.botParser = new BotParser();\n }\n}\nmodule.exports = DeviceDetector;\n", "(function(root, factory) {\n 'use strict';\n // Universal Module Definition (UMD) to support AMD, CommonJS/Node.js, Rhino, and browsers.\n\n /* istanbul ignore next */\n if (typeof define === 'function' && define.amd) {\n define('stackframe', [], factory);\n } else if (typeof exports === 'object') {\n module.exports = factory();\n } else {\n root.StackFrame = factory();\n }\n}(this, function() {\n 'use strict';\n function _isNumber(n) {\n return !isNaN(parseFloat(n)) && isFinite(n);\n }\n\n function _capitalize(str) {\n return str.charAt(0).toUpperCase() + str.substring(1);\n }\n\n function _getter(p) {\n return function() {\n return this[p];\n };\n }\n\n var booleanProps = ['isConstructor', 'isEval', 'isNative', 'isToplevel'];\n var numericProps = ['columnNumber', 'lineNumber'];\n var stringProps = ['fileName', 'functionName', 'source'];\n var arrayProps = ['args'];\n var objectProps = ['evalOrigin'];\n\n var props = booleanProps.concat(numericProps, stringProps, arrayProps, objectProps);\n\n function StackFrame(obj) {\n if (!obj) return;\n for (var i = 0; i < props.length; i++) {\n if (obj[props[i]] !== undefined) {\n this['set' + _capitalize(props[i])](obj[props[i]]);\n }\n }\n }\n\n StackFrame.prototype = {\n getArgs: function() {\n return this.args;\n },\n setArgs: function(v) {\n if (Object.prototype.toString.call(v) !== '[object Array]') {\n throw new TypeError('Args must be an Array');\n }\n this.args = v;\n },\n\n getEvalOrigin: function() {\n return this.evalOrigin;\n },\n setEvalOrigin: function(v) {\n if (v instanceof StackFrame) {\n this.evalOrigin = v;\n } else if (v instanceof Object) {\n this.evalOrigin = new StackFrame(v);\n } else {\n throw new TypeError('Eval Origin must be an Object or StackFrame');\n }\n },\n\n toString: function() {\n var fileName = this.getFileName() || '';\n var lineNumber = this.getLineNumber() || '';\n var columnNumber = this.getColumnNumber() || '';\n var functionName = this.getFunctionName() || '';\n if (this.getIsEval()) {\n if (fileName) {\n return '[eval] (' + fileName + ':' + lineNumber + ':' + columnNumber + ')';\n }\n return '[eval]:' + lineNumber + ':' + columnNumber;\n }\n if (functionName) {\n return functionName + ' (' + fileName + ':' + lineNumber + ':' + columnNumber + ')';\n }\n return fileName + ':' + lineNumber + ':' + columnNumber;\n }\n };\n\n StackFrame.fromString = function StackFrame$$fromString(str) {\n var argsStartIndex = str.indexOf('(');\n var argsEndIndex = str.lastIndexOf(')');\n\n var functionName = str.substring(0, argsStartIndex);\n var args = str.substring(argsStartIndex + 1, argsEndIndex).split(',');\n var locationString = str.substring(argsEndIndex + 1);\n\n if (locationString.indexOf('@') === 0) {\n var parts = /@(.+?)(?::(\\d+))?(?::(\\d+))?$/.exec(locationString, '');\n var fileName = parts[1];\n var lineNumber = parts[2];\n var columnNumber = parts[3];\n }\n\n return new StackFrame({\n functionName: functionName,\n args: args || undefined,\n fileName: fileName,\n lineNumber: lineNumber || undefined,\n columnNumber: columnNumber || undefined\n });\n };\n\n for (var i = 0; i < booleanProps.length; i++) {\n StackFrame.prototype['get' + _capitalize(booleanProps[i])] = _getter(booleanProps[i]);\n StackFrame.prototype['set' + _capitalize(booleanProps[i])] = (function(p) {\n return function(v) {\n this[p] = Boolean(v);\n };\n })(booleanProps[i]);\n }\n\n for (var j = 0; j < numericProps.length; j++) {\n StackFrame.prototype['get' + _capitalize(numericProps[j])] = _getter(numericProps[j]);\n StackFrame.prototype['set' + _capitalize(numericProps[j])] = (function(p) {\n return function(v) {\n if (!_isNumber(v)) {\n throw new TypeError(p + ' must be a Number');\n }\n this[p] = Number(v);\n };\n })(numericProps[j]);\n }\n\n for (var k = 0; k < stringProps.length; k++) {\n StackFrame.prototype['get' + _capitalize(stringProps[k])] = _getter(stringProps[k]);\n StackFrame.prototype['set' + _capitalize(stringProps[k])] = (function(p) {\n return function(v) {\n this[p] = String(v);\n };\n })(stringProps[k]);\n }\n\n return StackFrame;\n}));\n", "(function(root, factory) {\n 'use strict';\n // Universal Module Definition (UMD) to support AMD, CommonJS/Node.js, Rhino, and browsers.\n\n /* istanbul ignore next */\n if (typeof define === 'function' && define.amd) {\n define('error-stack-parser', ['stackframe'], factory);\n } else if (typeof exports === 'object') {\n module.exports = factory(require('stackframe'));\n } else {\n root.ErrorStackParser = factory(root.StackFrame);\n }\n}(this, function ErrorStackParser(StackFrame) {\n 'use strict';\n\n var FIREFOX_SAFARI_STACK_REGEXP = /(^|@)\\S+:\\d+/;\n var CHROME_IE_STACK_REGEXP = /^\\s*at .*(\\S+:\\d+|\\(native\\))/m;\n var SAFARI_NATIVE_CODE_REGEXP = /^(eval@)?(\\[native code])?$/;\n\n return {\n /**\n * Given an Error object, extract the most information from it.\n *\n * @param {Error} error object\n * @return {Array} of StackFrames\n */\n parse: function ErrorStackParser$$parse(error) {\n if (typeof error.stacktrace !== 'undefined' || typeof error['opera#sourceloc'] !== 'undefined') {\n return this.parseOpera(error);\n } else if (error.stack && error.stack.match(CHROME_IE_STACK_REGEXP)) {\n return this.parseV8OrIE(error);\n } else if (error.stack) {\n return this.parseFFOrSafari(error);\n } else {\n throw new Error('Cannot parse given Error object');\n }\n },\n\n // Separate line and column numbers from a string of the form: (URI:Line:Column)\n extractLocation: function ErrorStackParser$$extractLocation(urlLike) {\n // Fail-fast but return locations like \"(native)\"\n if (urlLike.indexOf(':') === -1) {\n return [urlLike];\n }\n\n var regExp = /(.+?)(?::(\\d+))?(?::(\\d+))?$/;\n var parts = regExp.exec(urlLike.replace(/[()]/g, ''));\n return [parts[1], parts[2] || undefined, parts[3] || undefined];\n },\n\n parseV8OrIE: function ErrorStackParser$$parseV8OrIE(error) {\n var filtered = error.stack.split('\\n').filter(function(line) {\n return !!line.match(CHROME_IE_STACK_REGEXP);\n }, this);\n\n return filtered.map(function(line) {\n if (line.indexOf('(eval ') > -1) {\n // Throw away eval information until we implement stacktrace.js/stackframe#8\n line = line.replace(/eval code/g, 'eval').replace(/(\\(eval at [^()]*)|(,.*$)/g, '');\n }\n var sanitizedLine = line.replace(/^\\s+/, '').replace(/\\(eval code/g, '(').replace(/^.*?\\s+/, '');\n\n // capture and preseve the parenthesized location \"(/foo/my bar.js:12:87)\" in\n // case it has spaces in it, as the string is split on \\s+ later on\n var location = sanitizedLine.match(/ (\\(.+\\)$)/);\n\n // remove the parenthesized location from the line, if it was matched\n sanitizedLine = location ? sanitizedLine.replace(location[0], '') : sanitizedLine;\n\n // if a location was matched, pass it to extractLocation() otherwise pass all sanitizedLine\n // because this line doesn't have function name\n var locationParts = this.extractLocation(location ? location[1] : sanitizedLine);\n var functionName = location && sanitizedLine || undefined;\n var fileName = ['eval', '<anonymous>'].indexOf(locationParts[0]) > -1 ? undefined : locationParts[0];\n\n return new StackFrame({\n functionName: functionName,\n fileName: fileName,\n lineNumber: locationParts[1],\n columnNumber: locationParts[2],\n source: line\n });\n }, this);\n },\n\n parseFFOrSafari: function ErrorStackParser$$parseFFOrSafari(error) {\n var filtered = error.stack.split('\\n').filter(function(line) {\n return !line.match(SAFARI_NATIVE_CODE_REGEXP);\n }, this);\n\n return filtered.map(function(line) {\n // Throw away eval information until we implement stacktrace.js/stackframe#8\n if (line.indexOf(' > eval') > -1) {\n line = line.replace(/ line (\\d+)(?: > eval line \\d+)* > eval:\\d+:\\d+/g, ':$1');\n }\n\n if (line.indexOf('@') === -1 && line.indexOf(':') === -1) {\n // Safari eval frames only have function names and nothing else\n return new StackFrame({\n functionName: line\n });\n } else {\n var functionNameRegex = /((.*\".+\"[^@]*)?[^@]*)(?:@)/;\n var matches = line.match(functionNameRegex);\n var functionName = matches && matches[1] ? matches[1] : undefined;\n var locationParts = this.extractLocation(line.replace(functionNameRegex, ''));\n\n return new StackFrame({\n functionName: functionName,\n fileName: locationParts[0],\n lineNumber: locationParts[1],\n columnNumber: locationParts[2],\n source: line\n });\n }\n }, this);\n },\n\n parseOpera: function ErrorStackParser$$parseOpera(e) {\n if (!e.stacktrace || (e.message.indexOf('\\n') > -1 &&\n e.message.split('\\n').length > e.stacktrace.split('\\n').length)) {\n return this.parseOpera9(e);\n } else if (!e.stack) {\n return this.parseOpera10(e);\n } else {\n return this.parseOpera11(e);\n }\n },\n\n parseOpera9: function ErrorStackParser$$parseOpera9(e) {\n var lineRE = /Line (\\d+).*script (?:in )?(\\S+)/i;\n var lines = e.message.split('\\n');\n var result = [];\n\n for (var i = 2, len = lines.length; i < len; i += 2) {\n var match = lineRE.exec(lines[i]);\n if (match) {\n result.push(new StackFrame({\n fileName: match[2],\n lineNumber: match[1],\n source: lines[i]\n }));\n }\n }\n\n return result;\n },\n\n parseOpera10: function ErrorStackParser$$parseOpera10(e) {\n var lineRE = /Line (\\d+).*script (?:in )?(\\S+)(?:: In function (\\S+))?$/i;\n var lines = e.stacktrace.split('\\n');\n var result = [];\n\n for (var i = 0, len = lines.length; i < len; i += 2) {\n var match = lineRE.exec(lines[i]);\n if (match) {\n result.push(\n new StackFrame({\n functionName: match[3] || undefined,\n fileName: match[2],\n lineNumber: match[1],\n source: lines[i]\n })\n );\n }\n }\n\n return result;\n },\n\n // Opera 10.65+ Error.stack very similar to FF/Safari\n parseOpera11: function ErrorStackParser$$parseOpera11(error) {\n var filtered = error.stack.split('\\n').filter(function(line) {\n return !!line.match(FIREFOX_SAFARI_STACK_REGEXP) && !line.match(/^Error created at/);\n }, this);\n\n return filtered.map(function(line) {\n var tokens = line.split('@');\n var locationParts = this.extractLocation(tokens.pop());\n var functionCall = (tokens.shift() || '');\n var functionName = functionCall\n .replace(/<anonymous function(: (\\w+))?>/, '$2')\n .replace(/\\([^)]*\\)/g, '') || undefined;\n var argsRaw;\n if (functionCall.match(/\\(([^)]*)\\)/)) {\n argsRaw = functionCall.replace(/^[^(]+\\(([^)]*)\\)$/, '$1');\n }\n var args = (argsRaw === undefined || argsRaw === '[arguments not available]') ?\n undefined : argsRaw.split(',');\n\n return new StackFrame({\n functionName: functionName,\n args: args,\n fileName: locationParts[0],\n lineNumber: locationParts[1],\n columnNumber: locationParts[2],\n source: line\n });\n }, this);\n }\n };\n}));\n", "var global = typeof self !== 'undefined' ? self : this;\nvar __self__ = (function () {\nfunction F() {\nthis.fetch = false;\nthis.DOMException = global.DOMException\n}\nF.prototype = global;\nreturn new F();\n})();\n(function(self) {\n\nvar irrelevant = (function (exports) {\n\n var support = {\n searchParams: 'URLSearchParams' in self,\n iterable: 'Symbol' in self && 'iterator' in Symbol,\n blob:\n 'FileReader' in self &&\n 'Blob' in self &&\n (function() {\n try {\n new Blob();\n return true\n } catch (e) {\n return false\n }\n })(),\n formData: 'FormData' in self,\n arrayBuffer: 'ArrayBuffer' in self\n };\n\n function isDataView(obj) {\n return obj && DataView.prototype.isPrototypeOf(obj)\n }\n\n if (support.arrayBuffer) {\n var viewClasses = [\n '[object Int8Array]',\n '[object Uint8Array]',\n '[object Uint8ClampedArray]',\n '[object Int16Array]',\n '[object Uint16Array]',\n '[object Int32Array]',\n '[object Uint32Array]',\n '[object Float32Array]',\n '[object Float64Array]'\n ];\n\n var isArrayBufferView =\n ArrayBuffer.isView ||\n function(obj) {\n return obj && viewClasses.indexOf(Object.prototype.toString.call(obj)) > -1\n };\n }\n\n function normalizeName(name) {\n if (typeof name !== 'string') {\n name = String(name);\n }\n if (/[^a-z0-9\\-#$%&'*+.^_`|~]/i.test(name)) {\n throw new TypeError('Invalid character in header field name')\n }\n return name.toLowerCase()\n }\n\n function normalizeValue(value) {\n if (typeof value !== 'string') {\n value = String(value);\n }\n return value\n }\n\n // Build a destructive iterator for the value list\n function iteratorFor(items) {\n var iterator = {\n next: function() {\n var value = items.shift();\n return {done: value === undefined, value: value}\n }\n };\n\n if (support.iterable) {\n iterator[Symbol.iterator] = function() {\n return iterator\n };\n }\n\n return iterator\n }\n\n function Headers(headers) {\n this.map = {};\n\n if (headers instanceof Headers) {\n headers.forEach(function(value, name) {\n this.append(name, value);\n }, this);\n } else if (Array.isArray(headers)) {\n headers.forEach(function(header) {\n this.append(header[0], header[1]);\n }, this);\n } else if (headers) {\n Object.getOwnPropertyNames(headers).forEach(function(name) {\n this.append(name, headers[name]);\n }, this);\n }\n }\n\n Headers.prototype.append = function(name, value) {\n name = normalizeName(name);\n value = normalizeValue(value);\n var oldValue = this.map[name];\n this.map[name] = oldValue ? oldValue + ', ' + value : value;\n };\n\n Headers.prototype['delete'] = function(name) {\n delete this.map[normalizeName(name)];\n };\n\n Headers.prototype.get = function(name) {\n name = normalizeName(name);\n return this.has(name) ? this.map[name] : null\n };\n\n Headers.prototype.has = function(name) {\n return this.map.hasOwnProperty(normalizeName(name))\n };\n\n Headers.prototype.set = function(name, value) {\n this.map[normalizeName(name)] = normalizeValue(value);\n };\n\n Headers.prototype.forEach = function(callback, thisArg) {\n for (var name in this.map) {\n if (this.map.hasOwnProperty(name)) {\n callback.call(thisArg, this.map[name], name, this);\n }\n }\n };\n\n Headers.prototype.keys = function() {\n var items = [];\n this.forEach(function(value, name) {\n items.push(name);\n });\n return iteratorFor(items)\n };\n\n Headers.prototype.values = function() {\n var items = [];\n this.forEach(function(value) {\n items.push(value);\n });\n return iteratorFor(items)\n };\n\n Headers.prototype.entries = function() {\n var items = [];\n this.forEach(function(value, name) {\n items.push([name, value]);\n });\n return iteratorFor(items)\n };\n\n if (support.iterable) {\n Headers.prototype[Symbol.iterator] = Headers.prototype.entries;\n }\n\n function consumed(body) {\n if (body.bodyUsed) {\n return Promise.reject(new TypeError('Already read'))\n }\n body.bodyUsed = true;\n }\n\n function fileReaderReady(reader) {\n return new Promise(function(resolve, reject) {\n reader.onload = function() {\n resolve(reader.result);\n };\n reader.onerror = function() {\n reject(reader.error);\n };\n })\n }\n\n function readBlobAsArrayBuffer(blob) {\n var reader = new FileReader();\n var promise = fileReaderReady(reader);\n reader.readAsArrayBuffer(blob);\n return promise\n }\n\n function readBlobAsText(blob) {\n var reader = new FileReader();\n var promise = fileReaderReady(reader);\n reader.readAsText(blob);\n return promise\n }\n\n function readArrayBufferAsText(buf) {\n var view = new Uint8Array(buf);\n var chars = new Array(view.length);\n\n for (var i = 0; i < view.length; i++) {\n chars[i] = String.fromCharCode(view[i]);\n }\n return chars.join('')\n }\n\n function bufferClone(buf) {\n if (buf.slice) {\n return buf.slice(0)\n } else {\n var view = new Uint8Array(buf.byteLength);\n view.set(new Uint8Array(buf));\n return view.buffer\n }\n }\n\n function Body() {\n this.bodyUsed = false;\n\n this._initBody = function(body) {\n this._bodyInit = body;\n if (!body) {\n this._bodyText = '';\n } else if (typeof body === 'string') {\n this._bodyText = body;\n } else if (support.blob && Blob.prototype.isPrototypeOf(body)) {\n this._bodyBlob = body;\n } else if (support.formData && FormData.prototype.isPrototypeOf(body)) {\n this._bodyFormData = body;\n } else if (support.searchParams && URLSearchParams.prototype.isPrototypeOf(body)) {\n this._bodyText = body.toString();\n } else if (support.arrayBuffer && support.blob && isDataView(body)) {\n this._bodyArrayBuffer = bufferClone(body.buffer);\n // IE 10-11 can't handle a DataView body.\n this._bodyInit = new Blob([this._bodyArrayBuffer]);\n } else if (support.arrayBuffer && (ArrayBuffer.prototype.isPrototypeOf(body) || isArrayBufferView(body))) {\n this._bodyArrayBuffer = bufferClone(body);\n } else {\n this._bodyText = body = Object.prototype.toString.call(body);\n }\n\n if (!this.headers.get('content-type')) {\n if (typeof body === 'string') {\n this.headers.set('content-type', 'text/plain;charset=UTF-8');\n } else if (this._bodyBlob && this._bodyBlob.type) {\n this.headers.set('content-type', this._bodyBlob.type);\n } else if (support.searchParams && URLSearchParams.prototype.isPrototypeOf(body)) {\n this.headers.set('content-type', 'application/x-www-form-urlencoded;charset=UTF-8');\n }\n }\n };\n\n if (support.blob) {\n this.blob = function() {\n var rejected = consumed(this);\n if (rejected) {\n return rejected\n }\n\n if (this._bodyBlob) {\n return Promise.resolve(this._bodyBlob)\n } else if (this._bodyArrayBuffer) {\n return Promise.resolve(new Blob([this._bodyArrayBuffer]))\n } else if (this._bodyFormData) {\n throw new Error('could not read FormData body as blob')\n } else {\n return Promise.resolve(new Blob([this._bodyText]))\n }\n };\n\n this.arrayBuffer = function() {\n if (this._bodyArrayBuffer) {\n return consumed(this) || Promise.resolve(this._bodyArrayBuffer)\n } else {\n return this.blob().then(readBlobAsArrayBuffer)\n }\n };\n }\n\n this.text = function() {\n var rejected = consumed(this);\n if (rejected) {\n return rejected\n }\n\n if (this._bodyBlob) {\n return readBlobAsText(this._bodyBlob)\n } else if (this._bodyArrayBuffer) {\n return Promise.resolve(readArrayBufferAsText(this._bodyArrayBuffer))\n } else if (this._bodyFormData) {\n throw new Error('could not read FormData body as text')\n } else {\n return Promise.resolve(this._bodyText)\n }\n };\n\n if (support.formData) {\n this.formData = function() {\n return this.text().then(decode)\n };\n }\n\n this.json = function() {\n return this.text().then(JSON.parse)\n };\n\n return this\n }\n\n // HTTP methods whose capitalization should be normalized\n var methods = ['DELETE', 'GET', 'HEAD', 'OPTIONS', 'POST', 'PUT'];\n\n function normalizeMethod(method) {\n var upcased = method.toUpperCase();\n return methods.indexOf(upcased) > -1 ? upcased : method\n }\n\n function Request(input, options) {\n options = options || {};\n var body = options.body;\n\n if (input instanceof Request) {\n if (input.bodyUsed) {\n throw new TypeError('Already read')\n }\n this.url = input.url;\n this.credentials = input.credentials;\n if (!options.headers) {\n this.headers = new Headers(input.headers);\n }\n this.method = input.method;\n this.mode = input.mode;\n this.signal = input.signal;\n if (!body && input._bodyInit != null) {\n body = input._bodyInit;\n input.bodyUsed = true;\n }\n } else {\n this.url = String(input);\n }\n\n this.credentials = options.credentials || this.credentials || 'same-origin';\n if (options.headers || !this.headers) {\n this.headers = new Headers(options.headers);\n }\n this.method = normalizeMethod(options.method || this.method || 'GET');\n this.mode = options.mode || this.mode || null;\n this.signal = options.signal || this.signal;\n this.referrer = null;\n\n if ((this.method === 'GET' || this.method === 'HEAD') && body) {\n throw new TypeError('Body not allowed for GET or HEAD requests')\n }\n this._initBody(body);\n }\n\n Request.prototype.clone = function() {\n return new Request(this, {body: this._bodyInit})\n };\n\n function decode(body) {\n var form = new FormData();\n body\n .trim()\n .split('&')\n .forEach(function(bytes) {\n if (bytes) {\n var split = bytes.split('=');\n var name = split.shift().replace(/\\+/g, ' ');\n var value = split.join('=').replace(/\\+/g, ' ');\n form.append(decodeURIComponent(name), decodeURIComponent(value));\n }\n });\n return form\n }\n\n function parseHeaders(rawHeaders) {\n var headers = new Headers();\n // Replace instances of \\r\\n and \\n followed by at least one space or horizontal tab with a space\n // https://tools.ietf.org/html/rfc7230#section-3.2\n var preProcessedHeaders = rawHeaders.replace(/\\r?\\n[\\t ]+/g, ' ');\n preProcessedHeaders.split(/\\r?\\n/).forEach(function(line) {\n var parts = line.split(':');\n var key = parts.shift().trim();\n if (key) {\n var value = parts.join(':').trim();\n headers.append(key, value);\n }\n });\n return headers\n }\n\n Body.call(Request.prototype);\n\n function Response(bodyInit, options) {\n if (!options) {\n options = {};\n }\n\n this.type = 'default';\n this.status = options.status === undefined ? 200 : options.status;\n this.ok = this.status >= 200 && this.status < 300;\n this.statusText = 'statusText' in options ? options.statusText : 'OK';\n this.headers = new Headers(options.headers);\n this.url = options.url || '';\n this._initBody(bodyInit);\n }\n\n Body.call(Response.prototype);\n\n Response.prototype.clone = function() {\n return new Response(this._bodyInit, {\n status: this.status,\n statusText: this.statusText,\n headers: new Headers(this.headers),\n url: this.url\n })\n };\n\n Response.error = function() {\n var response = new Response(null, {status: 0, statusText: ''});\n response.type = 'error';\n return response\n };\n\n var redirectStatuses = [301, 302, 303, 307, 308];\n\n Response.redirect = function(url, status) {\n if (redirectStatuses.indexOf(status) === -1) {\n throw new RangeError('Invalid status code')\n }\n\n return new Response(null, {status: status, headers: {location: url}})\n };\n\n exports.DOMException = self.DOMException;\n try {\n new exports.DOMException();\n } catch (err) {\n exports.DOMException = function(message, name) {\n this.message = message;\n this.name = name;\n var error = Error(message);\n this.stack = error.stack;\n };\n exports.DOMException.prototype = Object.create(Error.prototype);\n exports.DOMException.prototype.constructor = exports.DOMException;\n }\n\n function fetch(input, init) {\n return new Promise(function(resolve, reject) {\n var request = new Request(input, init);\n\n if (request.signal && request.signal.aborted) {\n return reject(new exports.DOMException('Aborted', 'AbortError'))\n }\n\n var xhr = new XMLHttpRequest();\n\n function abortXhr() {\n xhr.abort();\n }\n\n xhr.onload = function() {\n var options = {\n status: xhr.status,\n statusText: xhr.statusText,\n headers: parseHeaders(xhr.getAllResponseHeaders() || '')\n };\n options.url = 'responseURL' in xhr ? xhr.responseURL : options.headers.get('X-Request-URL');\n var body = 'response' in xhr ? xhr.response : xhr.responseText;\n resolve(new Response(body, options));\n };\n\n xhr.onerror = function() {\n reject(new TypeError('Network request failed'));\n };\n\n xhr.ontimeout = function() {\n reject(new TypeError('Network request failed'));\n };\n\n xhr.onabort = function() {\n reject(new exports.DOMException('Aborted', 'AbortError'));\n };\n\n xhr.open(request.method, request.url, true);\n\n if (request.credentials === 'include') {\n xhr.withCredentials = true;\n } else if (request.credentials === 'omit') {\n xhr.withCredentials = false;\n }\n\n if ('responseType' in xhr && support.blob) {\n xhr.responseType = 'blob';\n }\n\n request.headers.forEach(function(value, name) {\n xhr.setRequestHeader(name, value);\n });\n\n if (request.signal) {\n request.signal.addEventListener('abort', abortXhr);\n\n xhr.onreadystatechange = function() {\n // DONE (success or failure)\n if (xhr.readyState === 4) {\n request.signal.removeEventListener('abort', abortXhr);\n }\n };\n }\n\n xhr.send(typeof request._bodyInit === 'undefined' ? null : request._bodyInit);\n })\n }\n\n fetch.polyfill = true;\n\n if (!self.fetch) {\n self.fetch = fetch;\n self.Headers = Headers;\n self.Request = Request;\n self.Response = Response;\n }\n\n exports.Headers = Headers;\n exports.Request = Request;\n exports.Response = Response;\n exports.fetch = fetch;\n\n Object.defineProperty(exports, '__esModule', { value: true });\n\n return exports;\n\n})({});\n})(__self__);\n__self__.fetch.ponyfill = true;\n// Remove \"polyfill\" property added by whatwg-fetch\ndelete __self__.fetch.polyfill;\n// Choose between native implementation (global) or custom implementation (__self__)\n// var ctx = global.fetch ? global : __self__;\nvar ctx = __self__; // this line disable service worker support temporarily\nexports = ctx.fetch // To enable: import fetch from 'cross-fetch'\nexports.default = ctx.fetch // For TypeScript consumers without esModuleInterop.\nexports.fetch = ctx.fetch // To enable: import {fetch} from 'cross-fetch'\nexports.Headers = ctx.Headers\nexports.Request = ctx.Request\nexports.Response = ctx.Response\nmodule.exports = exports\n", "\nfunction TreeBase() {}\n\n// removes all nodes from the tree\nTreeBase.prototype.clear = function() {\n this._root = null;\n this.size = 0;\n};\n\n// returns node data if found, null otherwise\nTreeBase.prototype.find = function(data) {\n var res = this._root;\n\n while(res !== null) {\n var c = this._comparator(data, res.data);\n if(c === 0) {\n return res.data;\n }\n else {\n res = res.get_child(c > 0);\n }\n }\n\n return null;\n};\n\n// returns iterator to node if found, null otherwise\nTreeBase.prototype.findIter = function(data) {\n var res = this._root;\n var iter = this.iterator();\n\n while(res !== null) {\n var c = this._comparator(data, res.data);\n if(c === 0) {\n iter._cursor = res;\n return iter;\n }\n else {\n iter._ancestors.push(res);\n res = res.get_child(c > 0);\n }\n }\n\n return null;\n};\n\n// Returns an iterator to the tree node at or immediately after the item\nTreeBase.prototype.lowerBound = function(item) {\n var cur = this._root;\n var iter = this.iterator();\n var cmp = this._comparator;\n\n while(cur !== null) {\n var c = cmp(item, cur.data);\n if(c === 0) {\n iter._cursor = cur;\n return iter;\n }\n iter._ancestors.push(cur);\n cur = cur.get_child(c > 0);\n }\n\n for(var i=iter._ancestors.length - 1; i >= 0; --i) {\n cur = iter._ancestors[i];\n if(cmp(item, cur.data) < 0) {\n iter._cursor = cur;\n iter._ancestors.length = i;\n return iter;\n }\n }\n\n iter._ancestors.length = 0;\n return iter;\n};\n\n// Returns an iterator to the tree node immediately after the item\nTreeBase.prototype.upperBound = function(item) {\n var iter = this.lowerBound(item);\n var cmp = this._comparator;\n\n while(iter.data() !== null && cmp(iter.data(), item) === 0) {\n iter.next();\n }\n\n return iter;\n};\n\n// returns null if tree is empty\nTreeBase.prototype.min = function() {\n var res = this._root;\n if(res === null) {\n return null;\n }\n\n while(res.left !== null) {\n res = res.left;\n }\n\n return res.data;\n};\n\n// returns null if tree is empty\nTreeBase.prototype.max = function() {\n var res = this._root;\n if(res === null) {\n return null;\n }\n\n while(res.right !== null) {\n res = res.right;\n }\n\n return res.data;\n};\n\n// returns a null iterator\n// call next() or prev() to point to an element\nTreeBase.prototype.iterator = function() {\n return new Iterator(this);\n};\n\n// calls cb on each node's data, in order\nTreeBase.prototype.each = function(cb) {\n var it=this.iterator(), data;\n while((data = it.next()) !== null) {\n if(cb(data) === false) {\n return;\n }\n }\n};\n\n// calls cb on each node's data, in reverse order\nTreeBase.prototype.reach = function(cb) {\n var it=this.iterator(), data;\n while((data = it.prev()) !== null) {\n if(cb(data) === false) {\n return;\n }\n }\n};\n\n\nfunction Iterator(tree) {\n this._tree = tree;\n this._ancestors = [];\n this._cursor = null;\n}\n\nIterator.prototype.data = function() {\n return this._cursor !== null ? this._cursor.data : null;\n};\n\n// if null-iterator, returns first node\n// otherwise, returns next node\nIterator.prototype.next = function() {\n if(this._cursor === null) {\n var root = this._tree._root;\n if(root !== null) {\n this._minNode(root);\n }\n }\n else {\n if(this._cursor.right === null) {\n // no greater node in subtree, go up to parent\n // if coming from a right child, continue up the stack\n var save;\n do {\n save = this._cursor;\n if(this._ancestors.length) {\n this._cursor = this._ancestors.pop();\n }\n else {\n this._cursor = null;\n break;\n }\n } while(this._cursor.right === save);\n }\n else {\n // get the next node from the subtree\n this._ancestors.push(this._cursor);\n this._minNode(this._cursor.right);\n }\n }\n return this._cursor !== null ? this._cursor.data : null;\n};\n\n// if null-iterator, returns last node\n// otherwise, returns previous node\nIterator.prototype.prev = function() {\n if(this._cursor === null) {\n var root = this._tree._root;\n if(root !== null) {\n this._maxNode(root);\n }\n }\n else {\n if(this._cursor.left === null) {\n var save;\n do {\n save = this._cursor;\n if(this._ancestors.length) {\n this._cursor = this._ancestors.pop();\n }\n else {\n this._cursor = null;\n break;\n }\n } while(this._cursor.left === save);\n }\n else {\n this._ancestors.push(this._cursor);\n this._maxNode(this._cursor.left);\n }\n }\n return this._cursor !== null ? this._cursor.data : null;\n};\n\nIterator.prototype._minNode = function(start) {\n while(start.left !== null) {\n this._ancestors.push(start);\n start = start.left;\n }\n this._cursor = start;\n};\n\nIterator.prototype._maxNode = function(start) {\n while(start.right !== null) {\n this._ancestors.push(start);\n start = start.right;\n }\n this._cursor = start;\n};\n\nmodule.exports = TreeBase;\n\n", "\nvar TreeBase = require('./treebase');\n\nfunction Node(data) {\n this.data = data;\n this.left = null;\n this.right = null;\n this.red = true;\n}\n\nNode.prototype.get_child = function(dir) {\n return dir ? this.right : this.left;\n};\n\nNode.prototype.set_child = function(dir, val) {\n if(dir) {\n this.right = val;\n }\n else {\n this.left = val;\n }\n};\n\nfunction RBTree(comparator) {\n this._root = null;\n this._comparator = comparator;\n this.size = 0;\n}\n\nRBTree.prototype = new TreeBase();\n\n// returns true if inserted, false if duplicate\nRBTree.prototype.insert = function(data) {\n var ret = false;\n\n if(this._root === null) {\n // empty tree\n this._root = new Node(data);\n ret = true;\n this.size++;\n }\n else {\n var head = new Node(undefined); // fake tree root\n\n var dir = 0;\n var last = 0;\n\n // setup\n var gp = null; // grandparent\n var ggp = head; // grand-grand-parent\n var p = null; // parent\n var node = this._root;\n ggp.right = this._root;\n\n // search down\n while(true) {\n if(node === null) {\n // insert new node at the bottom\n node = new Node(data);\n p.set_child(dir, node);\n ret = true;\n this.size++;\n }\n else if(is_red(node.left) && is_red(node.right)) {\n // color flip\n node.red = true;\n node.left.red = false;\n node.right.red = false;\n }\n\n // fix red violation\n if(is_red(node) && is_red(p)) {\n var dir2 = ggp.right === gp;\n\n if(node === p.get_child(last)) {\n ggp.set_child(dir2, single_rotate(gp, !last));\n }\n else {\n ggp.set_child(dir2, double_rotate(gp, !last));\n }\n }\n\n var cmp = this._comparator(node.data, data);\n\n // stop if found\n if(cmp === 0) {\n break;\n }\n\n last = dir;\n dir = cmp < 0;\n\n // update helpers\n if(gp !== null) {\n ggp = gp;\n }\n gp = p;\n p = node;\n node = node.get_child(dir);\n }\n\n // update root\n this._root = head.right;\n }\n\n // make root black\n this._root.red = false;\n\n return ret;\n};\n\n// returns true if removed, false if not found\nRBTree.prototype.remove = function(data) {\n if(this._root === null) {\n return false;\n }\n\n var head = new Node(undefined); // fake tree root\n var node = head;\n node.right = this._root;\n var p = null; // parent\n var gp = null; // grand parent\n var found = null; // found item\n var dir = 1;\n\n while(node.get_child(dir) !== null) {\n var last = dir;\n\n // update helpers\n gp = p;\n p = node;\n node = node.get_child(dir);\n\n var cmp = this._comparator(data, node.data);\n\n dir = cmp > 0;\n\n // save found node\n if(cmp === 0) {\n found = node;\n }\n\n // push the red node down\n if(!is_red(node) && !is_red(node.get_child(dir))) {\n if(is_red(node.get_child(!dir))) {\n var sr = single_rotate(node, dir);\n p.set_child(last, sr);\n p = sr;\n }\n else if(!is_red(node.get_child(!dir))) {\n var sibling = p.get_child(!last);\n if(sibling !== null) {\n if(!is_red(sibling.get_child(!last)) && !is_red(sibling.get_child(last))) {\n // color flip\n p.red = false;\n sibling.red = true;\n node.red = true;\n }\n else {\n var dir2 = gp.right === p;\n\n if(is_red(sibling.get_child(last))) {\n gp.set_child(dir2, double_rotate(p, last));\n }\n else if(is_red(sibling.get_child(!last))) {\n gp.set_child(dir2, single_rotate(p, last));\n }\n\n // ensure correct coloring\n var gpc = gp.get_child(dir2);\n gpc.red = true;\n node.red = true;\n gpc.left.red = false;\n gpc.right.red = false;\n }\n }\n }\n }\n }\n\n // replace and remove if found\n if(found !== null) {\n found.data = node.data;\n p.set_child(p.right === node, node.get_child(node.left === null));\n this.size--;\n }\n\n // update root and make it black\n this._root = head.right;\n if(this._root !== null) {\n this._root.red = false;\n }\n\n return found !== null;\n};\n\nfunction is_red(node) {\n return node !== null && node.red;\n}\n\nfunction single_rotate(root, dir) {\n var save = root.get_child(!dir);\n\n root.set_child(!dir, save.get_child(dir));\n save.set_child(dir, root);\n\n root.red = true;\n save.red = false;\n\n return save;\n}\n\nfunction double_rotate(root, dir) {\n root.set_child(!dir, single_rotate(root.get_child(!dir), !dir));\n return single_rotate(root, dir);\n}\n\nmodule.exports = RBTree;\n", "\nvar TreeBase = require('./treebase');\n\nfunction Node(data) {\n this.data = data;\n this.left = null;\n this.right = null;\n}\n\nNode.prototype.get_child = function(dir) {\n return dir ? this.right : this.left;\n};\n\nNode.prototype.set_child = function(dir, val) {\n if(dir) {\n this.right = val;\n }\n else {\n this.left = val;\n }\n};\n\nfunction BinTree(comparator) {\n this._root = null;\n this._comparator = comparator;\n this.size = 0;\n}\n\nBinTree.prototype = new TreeBase();\n\n// returns true if inserted, false if duplicate\nBinTree.prototype.insert = function(data) {\n if(this._root === null) {\n // empty tree\n this._root = new Node(data);\n this.size++;\n return true;\n }\n\n var dir = 0;\n\n // setup\n var p = null; // parent\n var node = this._root;\n\n // search down\n while(true) {\n if(node === null) {\n // insert new node at the bottom\n node = new Node(data);\n p.set_child(dir, node);\n ret = true;\n this.size++;\n return true;\n }\n\n // stop if found\n if(this._comparator(node.data, data) === 0) {\n return false;\n }\n\n dir = this._comparator(node.data, data) < 0;\n\n // update helpers\n p = node;\n node = node.get_child(dir);\n }\n};\n\n// returns true if removed, false if not found\nBinTree.prototype.remove = function(data) {\n if(this._root === null) {\n return false;\n }\n\n var head = new Node(undefined); // fake tree root\n var node = head;\n node.right = this._root;\n var p = null; // parent\n var found = null; // found item\n var dir = 1;\n\n while(node.get_child(dir) !== null) {\n p = node;\n node = node.get_child(dir);\n var cmp = this._comparator(data, node.data);\n dir = cmp > 0;\n\n if(cmp === 0) {\n found = node;\n }\n }\n\n if(found !== null) {\n found.data = node.data;\n p.set_child(p.right === node, node.get_child(node.left === null));\n\n this._root = head.right;\n this.size--;\n return true;\n }\n else {\n return false;\n }\n};\n\nmodule.exports = BinTree;\n\n", "module.exports = {\n RBTree: require('./lib/rbtree'),\n BinTree: require('./lib/bintree')\n};\n", "//\n// TDigest:\n//\n// approximate distribution percentiles from a stream of reals\n//\nvar RBTree = require('bintrees').RBTree;\n\nfunction TDigest(delta, K, CX) {\n // allocate a TDigest structure.\n //\n // delta is the compression factor, the max fraction of mass that\n // can be owned by one centroid (bigger, up to 1.0, means more\n // compression). delta=false switches off TDigest behavior and treats\n // the distribution as discrete, with no merging and exact values\n // reported.\n //\n // K is a size threshold that triggers recompression as the TDigest\n // grows during input. (Set it to 0 to disable automatic recompression)\n //\n // CX specifies how often to update cached cumulative totals used\n // for quantile estimation during ingest (see cumulate()). Set to\n // 0 to use exact quantiles for each new point.\n //\n this.discrete = (delta === false);\n this.delta = delta || 0.01;\n this.K = (K === undefined) ? 25 : K;\n this.CX = (CX === undefined) ? 1.1 : CX;\n this.centroids = new RBTree(compare_centroid_means);\n this.nreset = 0;\n this.reset();\n}\n\nTDigest.prototype.reset = function() {\n // prepare to digest new points.\n //\n this.centroids.clear();\n this.n = 0;\n this.nreset += 1;\n this.last_cumulate = 0;\n};\n\nTDigest.prototype.size = function() {\n return this.centroids.size;\n};\n\nTDigest.prototype.toArray = function(everything) {\n // return {mean,n} of centroids as an array ordered by mean.\n //\n var result = [];\n if (everything) {\n this._cumulate(true); // be sure cumns are exact\n this.centroids.each(function(c) { result.push(c); });\n } else {\n this.centroids.each(function(c) { result.push({mean:c.mean, n:c.n}); });\n }\n return result;\n};\n\nTDigest.prototype.summary = function() {\n var approx = (this.discrete) ? \"exact \" : \"approximating \";\n var s = [approx + this.n + \" samples using \" + this.size() + \" centroids\",\n \"min = \"+this.percentile(0),\n \"Q1 = \"+this.percentile(0.25),\n \"Q2 = \"+this.percentile(0.5),\n \"Q3 = \"+this.percentile(0.75),\n \"max = \"+this.percentile(1.0)];\n return s.join('\\n');\n};\n\nfunction compare_centroid_means(a, b) {\n // order two centroids by mean.\n //\n return (a.mean > b.mean) ? 1 : (a.mean < b.mean) ? -1 : 0;\n}\n\nfunction compare_centroid_mean_cumns(a, b) {\n // order two centroids by mean_cumn.\n //\n return (a.mean_cumn - b.mean_cumn);\n}\n\nTDigest.prototype.push = function(x, n) {\n // incorporate value or array of values x, having count n into the\n // TDigest. n defaults to 1.\n //\n n = n || 1;\n x = Array.isArray(x) ? x : [x];\n for (var i = 0 ; i < x.length ; i++) {\n this._digest(x[i], n);\n }\n};\n\nTDigest.prototype.push_centroid = function(c) {\n // incorporate centroid or array of centroids c\n //\n c = Array.isArray(c) ? c : [c];\n for (var i = 0 ; i < c.length ; i++) {\n this._digest(c[i].mean, c[i].n);\n }\n};\n\nTDigest.prototype._cumulate = function(exact) {\n // update cumulative counts for each centroid\n //\n // exact: falsey means only cumulate after sufficient\n // growth. During ingest, these counts are used as quantile\n // estimates, and they work well even when somewhat out of\n // date. (this is a departure from the publication, you may set CX\n // to 0 to disable).\n //\n if (this.n === this.last_cumulate ||\n !exact && this.CX && this.CX > (this.n / this.last_cumulate)) {\n return;\n }\n var cumn = 0;\n this.centroids.each(function(c) {\n c.mean_cumn = cumn + c.n / 2; // half of n at the mean\n cumn = c.cumn = cumn + c.n;\n });\n this.n = this.last_cumulate = cumn;\n};\n\nTDigest.prototype.find_nearest = function(x) {\n // find the centroid closest to x. The assumption of\n // unique means and a unique nearest centroid departs from the\n // paper, see _digest() below\n //\n if (this.size() === 0) {\n return null;\n }\n var iter = this.centroids.lowerBound({mean:x}); // x <= iter || iter==null\n var c = (iter.data() === null) ? iter.prev() : iter.data();\n if (c.mean === x || this.discrete) {\n return c; // c is either x or a neighbor (discrete: no distance func)\n }\n var prev = iter.prev();\n if (prev && Math.abs(prev.mean - x) < Math.abs(c.mean - x)) {\n return prev;\n } else {\n return c;\n }\n};\n\nTDigest.prototype._new_centroid = function(x, n, cumn) {\n // create and insert a new centroid into the digest (don't update\n // cumulatives).\n //\n var c = {mean:x, n:n, cumn:cumn};\n this.centroids.insert(c);\n this.n += n;\n return c;\n};\n\nTDigest.prototype._addweight = function(nearest, x, n) {\n // add weight at location x to nearest centroid. adding x to\n // nearest will not shift its relative position in the tree and\n // require reinsertion.\n //\n if (x !== nearest.mean) {\n nearest.mean += n * (x - nearest.mean) / (nearest.n + n);\n }\n nearest.cumn += n;\n nearest.mean_cumn += n / 2;\n nearest.n += n;\n this.n += n;\n};\n\nTDigest.prototype._digest = function(x, n) {\n // incorporate value x, having count n into the TDigest.\n //\n var min = this.centroids.min();\n var max = this.centroids.max();\n var nearest = this.find_nearest(x);\n if (nearest && nearest.mean === x) {\n // accumulate exact matches into the centroid without\n // limit. this is a departure from the paper, made so\n // centroids remain unique and code can be simple.\n this._addweight(nearest, x, n);\n } else if (nearest === min) {\n this._new_centroid(x, n, 0); // new point around min boundary\n } else if (nearest === max ) {\n this._new_centroid(x, n, this.n); // new point around max boundary\n } else if (this.discrete) {\n this._new_centroid(x, n, nearest.cumn); // never merge\n } else {\n // conider a merge based on nearest centroid's capacity. if\n // there's not room for all of n, don't bother merging any of\n // it into nearest, as we'll have to make a new centroid\n // anyway for the remainder (departure from the paper).\n var p = nearest.mean_cumn / this.n;\n var max_n = Math.floor(4 * this.n * this.delta * p * (1 - p));\n if (max_n - nearest.n >= n) {\n this._addweight(nearest, x, n);\n } else {\n this._new_centroid(x, n, nearest.cumn);\n }\n }\n this._cumulate(false);\n if (!this.discrete && this.K && this.size() > this.K / this.delta) {\n // re-process the centroids and hope for some compression.\n this.compress();\n }\n};\n\nTDigest.prototype.bound_mean = function(x) {\n // find centroids lower and upper such that lower.mean < x <\n // upper.mean or lower.mean === x === upper.mean. Don't call\n // this for x out of bounds.\n //\n var iter = this.centroids.upperBound({mean:x}); // x < iter\n var lower = iter.prev(); // lower <= x\n var upper = (lower.mean === x) ? lower : iter.next();\n return [lower, upper];\n};\n\nTDigest.prototype.p_rank = function(x_or_xlist) {\n // return approximate percentile-ranks (0..1) for data value x.\n // or list of x. calculated according to\n // https://en.wikipedia.org/wiki/Percentile_rank\n //\n // (Note that in continuous mode, boundary sample values will\n // report half their centroid weight inward from 0/1 as the\n // percentile-rank. X values outside the observed range return\n // 0/1)\n //\n // this triggers cumulate() if cumn's are out of date.\n //\n var xs = Array.isArray(x_or_xlist) ? x_or_xlist : [x_or_xlist];\n var ps = xs.map(this._p_rank, this);\n return Array.isArray(x_or_xlist) ? ps : ps[0];\n};\n\nTDigest.prototype._p_rank = function(x) {\n if (this.size() === 0) {\n return undefined;\n } else if (x < this.centroids.min().mean) {\n return 0.0;\n } else if (x > this.centroids.max().mean) {\n return 1.0;\n }\n // find centroids that bracket x and interpolate x's cumn from\n // their cumn's.\n this._cumulate(true); // be sure cumns are exact\n var bound = this.bound_mean(x);\n var lower = bound[0], upper = bound[1];\n if (this.discrete) {\n return lower.cumn / this.n;\n } else {\n var cumn = lower.mean_cumn;\n if (lower !== upper) {\n cumn += (x - lower.mean) * (upper.mean_cumn - lower.mean_cumn) / (upper.mean - lower.mean);\n }\n return cumn / this.n;\n }\n};\n\nTDigest.prototype.bound_mean_cumn = function(cumn) {\n // find centroids lower and upper such that lower.mean_cumn < x <\n // upper.mean_cumn or lower.mean_cumn === x === upper.mean_cumn. Don't call\n // this for cumn out of bounds.\n //\n // XXX because mean and mean_cumn give rise to the same sort order\n // (up to identical means), use the mean rbtree for our search.\n this.centroids._comparator = compare_centroid_mean_cumns;\n var iter = this.centroids.upperBound({mean_cumn:cumn}); // cumn < iter\n this.centroids._comparator = compare_centroid_means;\n var lower = iter.prev(); // lower <= cumn\n var upper = (lower && lower.mean_cumn === cumn) ? lower : iter.next();\n return [lower, upper];\n};\n\nTDigest.prototype.percentile = function(p_or_plist) {\n // for percentage p (0..1), or for each p in a list of ps, return\n // the smallest data value q at which at least p percent of the\n // observations <= q.\n //\n // for discrete distributions, this selects q using the Nearest\n // Rank Method\n // (https://en.wikipedia.org/wiki/Percentile#The_Nearest_Rank_method)\n // (in scipy, same as percentile(...., interpolation='higher')\n //\n // for continuous distributions, interpolates data values between\n // count-weighted bracketing means.\n //\n // this triggers cumulate() if cumn's are out of date.\n //\n var ps = Array.isArray(p_or_plist) ? p_or_plist : [p_or_plist];\n var qs = ps.map(this._percentile, this);\n return Array.isArray(p_or_plist) ? qs : qs[0];\n};\n\nTDigest.prototype._percentile = function(p) {\n if (this.size() === 0) {\n return undefined;\n }\n this._cumulate(true); // be sure cumns are exact\n var h = this.n * p;\n var bound = this.bound_mean_cumn(h);\n var lower = bound[0], upper = bound[1];\n\n if (upper === lower || lower === null || upper === null) {\n return (lower || upper).mean;\n } else if (!this.discrete) {\n return lower.mean + (h - lower.mean_cumn) * (upper.mean - lower.mean) / (upper.mean_cumn - lower.mean_cumn);\n } else if (h <= lower.cumn) {\n return lower.mean;\n } else {\n return upper.mean;\n }\n};\n\nfunction pop_random(choices) {\n // remove and return an item randomly chosen from the array of choices\n // (mutates choices)\n //\n var idx = Math.floor(Math.random() * choices.length);\n return choices.splice(idx, 1)[0];\n}\n\nTDigest.prototype.compress = function() {\n // TDigests experience worst case compression (none) when input\n // increases monotonically. Improve on any bad luck by\n // reconsuming digest centroids as if they were weighted points\n // while shuffling their order (and hope for the best).\n //\n if (this.compressing) {\n return;\n }\n var points = this.toArray();\n this.reset();\n this.compressing = true;\n while (points.length > 0) {\n this.push_centroid(pop_random(points));\n }\n this._cumulate(true);\n this.compressing = false;\n};\n\nfunction Digest(config) {\n // allocate a distribution digest structure. This is an extension\n // of a TDigest structure that starts in exact histogram (discrete)\n // mode, and automatically switches to TDigest mode for large\n // samples that appear to be from a continuous distribution.\n //\n this.config = config || {};\n this.mode = this.config.mode || 'auto'; // disc, cont, auto\n TDigest.call(this, this.mode === 'cont' ? config.delta : false);\n this.digest_ratio = this.config.ratio || 0.9;\n this.digest_thresh = this.config.thresh || 1000;\n this.n_unique = 0;\n}\nDigest.prototype = Object.create(TDigest.prototype);\nDigest.prototype.constructor = Digest;\n\nDigest.prototype.push = function(x_or_xlist) {\n TDigest.prototype.push.call(this, x_or_xlist);\n this.check_continuous();\n};\n\nDigest.prototype._new_centroid = function(x, n, cumn) {\n this.n_unique += 1;\n TDigest.prototype._new_centroid.call(this, x, n, cumn);\n};\n\nDigest.prototype._addweight = function(nearest, x, n) {\n if (nearest.n === 1) {\n this.n_unique -= 1;\n }\n TDigest.prototype._addweight.call(this, nearest, x, n);\n};\n\nDigest.prototype.check_continuous = function() {\n // while in 'auto' mode, if there are many unique elements, assume\n // they are from a continuous distribution and switch to 'cont'\n // mode (tdigest behavior). Return true on transition from\n // disctete to continuous.\n if (this.mode !== 'auto' || this.size() < this.digest_thresh) {\n return false;\n }\n if (this.n_unique / this.size() > this.digest_ratio) {\n this.mode = 'cont';\n this.discrete = false;\n this.delta = this.config.delta || 0.01;\n this.compress();\n return true;\n }\n return false;\n};\n\nmodule.exports = {\n 'TDigest': TDigest,\n 'Digest': Digest\n};\n", "/*\r\n * @namespace Util\r\n *\r\n * Various utility functions, used by Leaflet internally.\r\n */\r\n\r\n// @function extend(dest: Object, src?: Object): Object\r\n// Merges the properties of the `src` object (or multiple objects) into `dest` object and returns the latter. Has an `L.extend` shortcut.\r\nexport function extend(dest) {\r\n\tvar i, j, len, src;\r\n\r\n\tfor (j = 1, len = arguments.length; j < len; j++) {\r\n\t\tsrc = arguments[j];\r\n\t\tfor (i in src) {\r\n\t\t\tdest[i] = src[i];\r\n\t\t}\r\n\t}\r\n\treturn dest;\r\n}\r\n\r\n// @function create(proto: Object, properties?: Object): Object\r\n// Compatibility polyfill for [Object.create](https://developer.mozilla.org/docs/Web/JavaScript/Reference/Global_Objects/Object/create)\r\nexport var create = Object.create || (function () {\r\n\tfunction F() {}\r\n\treturn function (proto) {\r\n\t\tF.prototype = proto;\r\n\t\treturn new F();\r\n\t};\r\n})();\r\n\r\n// @function bind(fn: Function, …): Function\r\n// Returns a new function bound to the arguments passed, like [Function.prototype.bind](https://developer.mozilla.org/docs/Web/JavaScript/Reference/Global_Objects/Function/bind).\r\n// Has a `L.bind()` shortcut.\r\nexport function bind(fn, obj) {\r\n\tvar slice = Array.prototype.slice;\r\n\r\n\tif (fn.bind) {\r\n\t\treturn fn.bind.apply(fn, slice.call(arguments, 1));\r\n\t}\r\n\r\n\tvar args = slice.call(arguments, 2);\r\n\r\n\treturn function () {\r\n\t\treturn fn.apply(obj, args.length ? args.concat(slice.call(arguments)) : arguments);\r\n\t};\r\n}\r\n\r\n// @property lastId: Number\r\n// Last unique ID used by [`stamp()`](#util-stamp)\r\nexport var lastId = 0;\r\n\r\n// @function stamp(obj: Object): Number\r\n// Returns the unique ID of an object, assigning it one if it doesn't have it.\r\nexport function stamp(obj) {\r\n\tif (!('_leaflet_id' in obj)) {\r\n\t\tobj['_leaflet_id'] = ++lastId;\r\n\t}\r\n\treturn obj._leaflet_id;\r\n}\r\n\r\n// @function throttle(fn: Function, time: Number, context: Object): Function\r\n// Returns a function which executes function `fn` with the given scope `context`\r\n// (so that the `this` keyword refers to `context` inside `fn`'s code). The function\r\n// `fn` will be called no more than one time per given amount of `time`. The arguments\r\n// received by the bound function will be any arguments passed when binding the\r\n// function, followed by any arguments passed when invoking the bound function.\r\n// Has an `L.throttle` shortcut.\r\nexport function throttle(fn, time, context) {\r\n\tvar lock, args, wrapperFn, later;\r\n\r\n\tlater = function () {\r\n\t\t// reset lock and call if queued\r\n\t\tlock = false;\r\n\t\tif (args) {\r\n\t\t\twrapperFn.apply(context, args);\r\n\t\t\targs = false;\r\n\t\t}\r\n\t};\r\n\r\n\twrapperFn = function () {\r\n\t\tif (lock) {\r\n\t\t\t// called too soon, queue to call later\r\n\t\t\targs = arguments;\r\n\r\n\t\t} else {\r\n\t\t\t// call and lock until later\r\n\t\t\tfn.apply(context, arguments);\r\n\t\t\tsetTimeout(later, time);\r\n\t\t\tlock = true;\r\n\t\t}\r\n\t};\r\n\r\n\treturn wrapperFn;\r\n}\r\n\r\n// @function wrapNum(num: Number, range: Number[], includeMax?: Boolean): Number\r\n// Returns the number `num` modulo `range` in such a way so it lies within\r\n// `range[0]` and `range[1]`. The returned value will be always smaller than\r\n// `range[1]` unless `includeMax` is set to `true`.\r\nexport function wrapNum(x, range, includeMax) {\r\n\tvar max = range[1],\r\n\t min = range[0],\r\n\t d = max - min;\r\n\treturn x === max && includeMax ? x : ((x - min) % d + d) % d + min;\r\n}\r\n\r\n// @function falseFn(): Function\r\n// Returns a function which always returns `false`.\r\nexport function falseFn() { return false; }\r\n\r\n// @function formatNum(num: Number, precision?: Number|false): Number\r\n// Returns the number `num` rounded with specified `precision`.\r\n// The default `precision` value is 6 decimal places.\r\n// `false` can be passed to skip any processing (can be useful to avoid round-off errors).\r\nexport function formatNum(num, precision) {\r\n\tif (precision === false) { return num; }\r\n\tvar pow = Math.pow(10, precision === undefined ? 6 : precision);\r\n\treturn Math.round(num * pow) / pow;\r\n}\r\n\r\n// @function trim(str: String): String\r\n// Compatibility polyfill for [String.prototype.trim](https://developer.mozilla.org/docs/Web/JavaScript/Reference/Global_Objects/String/Trim)\r\nexport function trim(str) {\r\n\treturn str.trim ? str.trim() : str.replace(/^\\s+|\\s+$/g, '');\r\n}\r\n\r\n// @function splitWords(str: String): String[]\r\n// Trims and splits the string on whitespace and returns the array of parts.\r\nexport function splitWords(str) {\r\n\treturn trim(str).split(/\\s+/);\r\n}\r\n\r\n// @function setOptions(obj: Object, options: Object): Object\r\n// Merges the given properties to the `options` of the `obj` object, returning the resulting options. See `Class options`. Has an `L.setOptions` shortcut.\r\nexport function setOptions(obj, options) {\r\n\tif (!Object.prototype.hasOwnProperty.call(obj, 'options')) {\r\n\t\tobj.options = obj.options ? create(obj.options) : {};\r\n\t}\r\n\tfor (var i in options) {\r\n\t\tobj.options[i] = options[i];\r\n\t}\r\n\treturn obj.options;\r\n}\r\n\r\n// @function getParamString(obj: Object, existingUrl?: String, uppercase?: Boolean): String\r\n// Converts an object into a parameter URL string, e.g. `{a: \"foo\", b: \"bar\"}`\r\n// translates to `'?a=foo&b=bar'`. If `existingUrl` is set, the parameters will\r\n// be appended at the end. If `uppercase` is `true`, the parameter names will\r\n// be uppercased (e.g. `'?A=foo&B=bar'`)\r\nexport function getParamString(obj, existingUrl, uppercase) {\r\n\tvar params = [];\r\n\tfor (var i in obj) {\r\n\t\tparams.push(encodeURIComponent(uppercase ? i.toUpperCase() : i) + '=' + encodeURIComponent(obj[i]));\r\n\t}\r\n\treturn ((!existingUrl || existingUrl.indexOf('?') === -1) ? '?' : '&') + params.join('&');\r\n}\r\n\r\nvar templateRe = /\\{ *([\\w_ -]+) *\\}/g;\r\n\r\n// @function template(str: String, data: Object): String\r\n// Simple templating facility, accepts a template string of the form `'Hello {a}, {b}'`\r\n// and a data object like `{a: 'foo', b: 'bar'}`, returns evaluated string\r\n// `('Hello foo, bar')`. You can also specify functions instead of strings for\r\n// data values — they will be evaluated passing `data` as an argument.\r\nexport function template(str, data) {\r\n\treturn str.replace(templateRe, function (str, key) {\r\n\t\tvar value = data[key];\r\n\r\n\t\tif (value === undefined) {\r\n\t\t\tthrow new Error('No value provided for variable ' + str);\r\n\r\n\t\t} else if (typeof value === 'function') {\r\n\t\t\tvalue = value(data);\r\n\t\t}\r\n\t\treturn value;\r\n\t});\r\n}\r\n\r\n// @function isArray(obj): Boolean\r\n// Compatibility polyfill for [Array.isArray](https://developer.mozilla.org/docs/Web/JavaScript/Reference/Global_Objects/Array/isArray)\r\nexport var isArray = Array.isArray || function (obj) {\r\n\treturn (Object.prototype.toString.call(obj) === '[object Array]');\r\n};\r\n\r\n// @function indexOf(array: Array, el: Object): Number\r\n// Compatibility polyfill for [Array.prototype.indexOf](https://developer.mozilla.org/docs/Web/JavaScript/Reference/Global_Objects/Array/indexOf)\r\nexport function indexOf(array, el) {\r\n\tfor (var i = 0; i < array.length; i++) {\r\n\t\tif (array[i] === el) { return i; }\r\n\t}\r\n\treturn -1;\r\n}\r\n\r\n// @property emptyImageUrl: String\r\n// Data URI string containing a base64-encoded empty GIF image.\r\n// Used as a hack to free memory from unused images on WebKit-powered\r\n// mobile devices (by setting image `src` to this string).\r\nexport var emptyImageUrl = 'data:image/gif;base64,R0lGODlhAQABAAD/ACwAAAAAAQABAAACADs=';\r\n\r\n// inspired by https://paulirish.com/2011/requestanimationframe-for-smart-animating/\r\n\r\nfunction getPrefixed(name) {\r\n\treturn window['webkit' + name] || window['moz' + name] || window['ms' + name];\r\n}\r\n\r\nvar lastTime = 0;\r\n\r\n// fallback for IE 7-8\r\nfunction timeoutDefer(fn) {\r\n\tvar time = +new Date(),\r\n\t timeToCall = Math.max(0, 16 - (time - lastTime));\r\n\r\n\tlastTime = time + timeToCall;\r\n\treturn window.setTimeout(fn, timeToCall);\r\n}\r\n\r\nexport var requestFn = window.requestAnimationFrame || getPrefixed('RequestAnimationFrame') || timeoutDefer;\r\nexport var cancelFn = window.cancelAnimationFrame || getPrefixed('CancelAnimationFrame') ||\r\n\t\tgetPrefixed('CancelRequestAnimationFrame') || function (id) { window.clearTimeout(id); };\r\n\r\n// @function requestAnimFrame(fn: Function, context?: Object, immediate?: Boolean): Number\r\n// Schedules `fn` to be executed when the browser repaints. `fn` is bound to\r\n// `context` if given. When `immediate` is set, `fn` is called immediately if\r\n// the browser doesn't have native support for\r\n// [`window.requestAnimationFrame`](https://developer.mozilla.org/docs/Web/API/window/requestAnimationFrame),\r\n// otherwise it's delayed. Returns a request ID that can be used to cancel the request.\r\nexport function requestAnimFrame(fn, context, immediate) {\r\n\tif (immediate && requestFn === timeoutDefer) {\r\n\t\tfn.call(context);\r\n\t} else {\r\n\t\treturn requestFn.call(window, bind(fn, context));\r\n\t}\r\n}\r\n\r\n// @function cancelAnimFrame(id: Number): undefined\r\n// Cancels a previous `requestAnimFrame`. See also [window.cancelAnimationFrame](https://developer.mozilla.org/docs/Web/API/window/cancelAnimationFrame).\r\nexport function cancelAnimFrame(id) {\r\n\tif (id) {\r\n\t\tcancelFn.call(window, id);\r\n\t}\r\n}\r\n", "import * as Util from './Util';\r\n\r\n// @class Class\r\n// @aka L.Class\r\n\r\n// @section\r\n// @uninheritable\r\n\r\n// Thanks to John Resig and Dean Edwards for inspiration!\r\n\r\nexport function Class() {}\r\n\r\nClass.extend = function (props) {\r\n\r\n\t// @function extend(props: Object): Function\r\n\t// [Extends the current class](#class-inheritance) given the properties to be included.\r\n\t// Returns a Javascript function that is a class constructor (to be called with `new`).\r\n\tvar NewClass = function () {\r\n\r\n\t\tUtil.setOptions(this);\r\n\r\n\t\t// call the constructor\r\n\t\tif (this.initialize) {\r\n\t\t\tthis.initialize.apply(this, arguments);\r\n\t\t}\r\n\r\n\t\t// call all constructor hooks\r\n\t\tthis.callInitHooks();\r\n\t};\r\n\r\n\tvar parentProto = NewClass.__super__ = this.prototype;\r\n\r\n\tvar proto = Util.create(parentProto);\r\n\tproto.constructor = NewClass;\r\n\r\n\tNewClass.prototype = proto;\r\n\r\n\t// inherit parent's statics\r\n\tfor (var i in this) {\r\n\t\tif (Object.prototype.hasOwnProperty.call(this, i) && i !== 'prototype' && i !== '__super__') {\r\n\t\t\tNewClass[i] = this[i];\r\n\t\t}\r\n\t}\r\n\r\n\t// mix static properties into the class\r\n\tif (props.statics) {\r\n\t\tUtil.extend(NewClass, props.statics);\r\n\t}\r\n\r\n\t// mix includes into the prototype\r\n\tif (props.includes) {\r\n\t\tcheckDeprecatedMixinEvents(props.includes);\r\n\t\tUtil.extend.apply(null, [proto].concat(props.includes));\r\n\t}\r\n\r\n\t// mix given properties into the prototype\r\n\tUtil.extend(proto, props);\r\n\tdelete proto.statics;\r\n\tdelete proto.includes;\r\n\r\n\t// merge options\r\n\tif (proto.options) {\r\n\t\tproto.options = parentProto.options ? Util.create(parentProto.options) : {};\r\n\t\tUtil.extend(proto.options, props.options);\r\n\t}\r\n\r\n\tproto._initHooks = [];\r\n\r\n\t// add method for calling all hooks\r\n\tproto.callInitHooks = function () {\r\n\r\n\t\tif (this._initHooksCalled) { return; }\r\n\r\n\t\tif (parentProto.callInitHooks) {\r\n\t\t\tparentProto.callInitHooks.call(this);\r\n\t\t}\r\n\r\n\t\tthis._initHooksCalled = true;\r\n\r\n\t\tfor (var i = 0, len = proto._initHooks.length; i < len; i++) {\r\n\t\t\tproto._initHooks[i].call(this);\r\n\t\t}\r\n\t};\r\n\r\n\treturn NewClass;\r\n};\r\n\r\n\r\n// @function include(properties: Object): this\r\n// [Includes a mixin](#class-includes) into the current class.\r\nClass.include = function (props) {\r\n\tvar parentOptions = this.prototype.options;\r\n\tUtil.extend(this.prototype, props);\r\n\tif (props.options) {\r\n\t\tthis.prototype.options = parentOptions;\r\n\t\tthis.mergeOptions(props.options);\r\n\t}\r\n\treturn this;\r\n};\r\n\r\n// @function mergeOptions(options: Object): this\r\n// [Merges `options`](#class-options) into the defaults of the class.\r\nClass.mergeOptions = function (options) {\r\n\tUtil.extend(this.prototype.options, options);\r\n\treturn this;\r\n};\r\n\r\n// @function addInitHook(fn: Function): this\r\n// Adds a [constructor hook](#class-constructor-hooks) to the class.\r\nClass.addInitHook = function (fn) { // (Function) || (String, args...)\r\n\tvar args = Array.prototype.slice.call(arguments, 1);\r\n\r\n\tvar init = typeof fn === 'function' ? fn : function () {\r\n\t\tthis[fn].apply(this, args);\r\n\t};\r\n\r\n\tthis.prototype._initHooks = this.prototype._initHooks || [];\r\n\tthis.prototype._initHooks.push(init);\r\n\treturn this;\r\n};\r\n\r\nfunction checkDeprecatedMixinEvents(includes) {\r\n\t/* global L: true */\r\n\tif (typeof L === 'undefined' || !L || !L.Mixin) { return; }\r\n\r\n\tincludes = Util.isArray(includes) ? includes : [includes];\r\n\r\n\tfor (var i = 0; i < includes.length; i++) {\r\n\t\tif (includes[i] === L.Mixin.Events) {\r\n\t\t\tconsole.warn('Deprecated include of L.Mixin.Events: ' +\r\n\t\t\t\t'this property will be removed in future releases, ' +\r\n\t\t\t\t'please inherit from L.Evented instead.', new Error().stack);\r\n\t\t}\r\n\t}\r\n}\r\n", "import {Class} from './Class';\r\nimport * as Util from './Util';\r\n\r\n/*\r\n * @class Evented\r\n * @aka L.Evented\r\n * @inherits Class\r\n *\r\n * A set of methods shared between event-powered classes (like `Map` and `Marker`). Generally, events allow you to execute some function when something happens with an object (e.g. the user clicks on the map, causing the map to fire `'click'` event).\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * map.on('click', function(e) {\r\n * \talert(e.latlng);\r\n * } );\r\n * ```\r\n *\r\n * Leaflet deals with event listeners by reference, so if you want to add a listener and then remove it, define it as a function:\r\n *\r\n * ```js\r\n * function onClick(e) { ... }\r\n *\r\n * map.on('click', onClick);\r\n * map.off('click', onClick);\r\n * ```\r\n */\r\n\r\nexport var Events = {\r\n\t/* @method on(type: String, fn: Function, context?: Object): this\r\n\t * Adds a listener function (`fn`) to a particular event type of the object. You can optionally specify the context of the listener (object the this keyword will point to). You can also pass several space-separated types (e.g. `'click dblclick'`).\r\n\t *\r\n\t * @alternative\r\n\t * @method on(eventMap: Object): this\r\n\t * Adds a set of type/listener pairs, e.g. `{click: onClick, mousemove: onMouseMove}`\r\n\t */\r\n\ton: function (types, fn, context) {\r\n\r\n\t\t// types can be a map of types/handlers\r\n\t\tif (typeof types === 'object') {\r\n\t\t\tfor (var type in types) {\r\n\t\t\t\t// we don't process space-separated events here for performance;\r\n\t\t\t\t// it's a hot path since Layer uses the on(obj) syntax\r\n\t\t\t\tthis._on(type, types[type], fn);\r\n\t\t\t}\r\n\r\n\t\t} else {\r\n\t\t\t// types can be a string of space-separated words\r\n\t\t\ttypes = Util.splitWords(types);\r\n\r\n\t\t\tfor (var i = 0, len = types.length; i < len; i++) {\r\n\t\t\t\tthis._on(types[i], fn, context);\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t/* @method off(type: String, fn?: Function, context?: Object): this\r\n\t * Removes a previously added listener function. If no function is specified, it will remove all the listeners of that particular event from the object. Note that if you passed a custom context to `on`, you must pass the same context to `off` in order to remove the listener.\r\n\t *\r\n\t * @alternative\r\n\t * @method off(eventMap: Object): this\r\n\t * Removes a set of type/listener pairs.\r\n\t *\r\n\t * @alternative\r\n\t * @method off: this\r\n\t * Removes all listeners to all events on the object. This includes implicitly attached events.\r\n\t */\r\n\toff: function (types, fn, context) {\r\n\r\n\t\tif (!arguments.length) {\r\n\t\t\t// clear all listeners if called without arguments\r\n\t\t\tdelete this._events;\r\n\r\n\t\t} else if (typeof types === 'object') {\r\n\t\t\tfor (var type in types) {\r\n\t\t\t\tthis._off(type, types[type], fn);\r\n\t\t\t}\r\n\r\n\t\t} else {\r\n\t\t\ttypes = Util.splitWords(types);\r\n\r\n\t\t\tvar removeAll = arguments.length === 1;\r\n\t\t\tfor (var i = 0, len = types.length; i < len; i++) {\r\n\t\t\t\tif (removeAll) {\r\n\t\t\t\t\tthis._off(types[i]);\r\n\t\t\t\t} else {\r\n\t\t\t\t\tthis._off(types[i], fn, context);\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// attach listener (without syntactic sugar now)\r\n\t_on: function (type, fn, context, _once) {\r\n\t\tif (typeof fn !== 'function') {\r\n\t\t\tconsole.warn('wrong listener type: ' + typeof fn);\r\n\t\t\treturn;\r\n\t\t}\r\n\r\n\t\t// check if fn already there\r\n\t\tif (this._listens(type, fn, context) !== false) {\r\n\t\t\treturn;\r\n\t\t}\r\n\r\n\t\tif (context === this) {\r\n\t\t\t// Less memory footprint.\r\n\t\t\tcontext = undefined;\r\n\t\t}\r\n\r\n\t\tvar newListener = {fn: fn, ctx: context};\r\n\t\tif (_once) {\r\n\t\t\tnewListener.once = true;\r\n\t\t}\r\n\r\n\t\tthis._events = this._events || {};\r\n\t\tthis._events[type] = this._events[type] || [];\r\n\t\tthis._events[type].push(newListener);\r\n\t},\r\n\r\n\t_off: function (type, fn, context) {\r\n\t\tvar listeners,\r\n\t\t i,\r\n\t\t len;\r\n\r\n\t\tif (!this._events) {\r\n\t\t\treturn;\r\n\t\t}\r\n\r\n\t\tlisteners = this._events[type];\r\n\t\tif (!listeners) {\r\n\t\t\treturn;\r\n\t\t}\r\n\r\n\t\tif (arguments.length === 1) { // remove all\r\n\t\t\tif (this._firingCount) {\r\n\t\t\t\t// Set all removed listeners to noop\r\n\t\t\t\t// so they are not called if remove happens in fire\r\n\t\t\t\tfor (i = 0, len = listeners.length; i < len; i++) {\r\n\t\t\t\t\tlisteners[i].fn = Util.falseFn;\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\t\t// clear all listeners for a type if function isn't specified\r\n\t\t\tdelete this._events[type];\r\n\t\t\treturn;\r\n\t\t}\r\n\r\n\t\tif (typeof fn !== 'function') {\r\n\t\t\tconsole.warn('wrong listener type: ' + typeof fn);\r\n\t\t\treturn;\r\n\t\t}\r\n\r\n\t\t// find fn and remove it\r\n\t\tvar index = this._listens(type, fn, context);\r\n\t\tif (index !== false) {\r\n\t\t\tvar listener = listeners[index];\r\n\t\t\tif (this._firingCount) {\r\n\t\t\t\t// set the removed listener to noop so that's not called if remove happens in fire\r\n\t\t\t\tlistener.fn = Util.falseFn;\r\n\r\n\t\t\t\t/* copy array in case events are being fired */\r\n\t\t\t\tthis._events[type] = listeners = listeners.slice();\r\n\t\t\t}\r\n\t\t\tlisteners.splice(index, 1);\r\n\t\t}\r\n\t},\r\n\r\n\t// @method fire(type: String, data?: Object, propagate?: Boolean): this\r\n\t// Fires an event of the specified type. You can optionally provide a data\r\n\t// object — the first argument of the listener function will contain its\r\n\t// properties. The event can optionally be propagated to event parents.\r\n\tfire: function (type, data, propagate) {\r\n\t\tif (!this.listens(type, propagate)) { return this; }\r\n\r\n\t\tvar event = Util.extend({}, data, {\r\n\t\t\ttype: type,\r\n\t\t\ttarget: this,\r\n\t\t\tsourceTarget: data && data.sourceTarget || this\r\n\t\t});\r\n\r\n\t\tif (this._events) {\r\n\t\t\tvar listeners = this._events[type];\r\n\t\t\tif (listeners) {\r\n\t\t\t\tthis._firingCount = (this._firingCount + 1) || 1;\r\n\t\t\t\tfor (var i = 0, len = listeners.length; i < len; i++) {\r\n\t\t\t\t\tvar l = listeners[i];\r\n\t\t\t\t\t// off overwrites l.fn, so we need to copy fn to a var\r\n\t\t\t\t\tvar fn = l.fn;\r\n\t\t\t\t\tif (l.once) {\r\n\t\t\t\t\t\tthis.off(type, fn, l.ctx);\r\n\t\t\t\t\t}\r\n\t\t\t\t\tfn.call(l.ctx || this, event);\r\n\t\t\t\t}\r\n\r\n\t\t\t\tthis._firingCount--;\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\tif (propagate) {\r\n\t\t\t// propagate the event to parents (set with addEventParent)\r\n\t\t\tthis._propagateEvent(event);\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method listens(type: String, propagate?: Boolean): Boolean\r\n\t// @method listens(type: String, fn: Function, context?: Object, propagate?: Boolean): Boolean\r\n\t// Returns `true` if a particular event type has any listeners attached to it.\r\n\t// The verification can optionally be propagated, it will return `true` if parents have the listener attached to it.\r\n\tlistens: function (type, fn, context, propagate) {\r\n\t\tif (typeof type !== 'string') {\r\n\t\t\tconsole.warn('\"string\" type argument expected');\r\n\t\t}\r\n\r\n\t\t// we don't overwrite the input `fn` value, because we need to use it for propagation\r\n\t\tvar _fn = fn;\r\n\t\tif (typeof fn !== 'function') {\r\n\t\t\tpropagate = !!fn;\r\n\t\t\t_fn = undefined;\r\n\t\t\tcontext = undefined;\r\n\t\t}\r\n\r\n\t\tvar listeners = this._events && this._events[type];\r\n\t\tif (listeners && listeners.length) {\r\n\t\t\tif (this._listens(type, _fn, context) !== false) {\r\n\t\t\t\treturn true;\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\tif (propagate) {\r\n\t\t\t// also check parents for listeners if event propagates\r\n\t\t\tfor (var id in this._eventParents) {\r\n\t\t\t\tif (this._eventParents[id].listens(type, fn, context, propagate)) { return true; }\r\n\t\t\t}\r\n\t\t}\r\n\t\treturn false;\r\n\t},\r\n\r\n\t// returns the index (number) or false\r\n\t_listens: function (type, fn, context) {\r\n\t\tif (!this._events) {\r\n\t\t\treturn false;\r\n\t\t}\r\n\r\n\t\tvar listeners = this._events[type] || [];\r\n\t\tif (!fn) {\r\n\t\t\treturn !!listeners.length;\r\n\t\t}\r\n\r\n\t\tif (context === this) {\r\n\t\t\t// Less memory footprint.\r\n\t\t\tcontext = undefined;\r\n\t\t}\r\n\r\n\t\tfor (var i = 0, len = listeners.length; i < len; i++) {\r\n\t\t\tif (listeners[i].fn === fn && listeners[i].ctx === context) {\r\n\t\t\t\treturn i;\r\n\t\t\t}\r\n\t\t}\r\n\t\treturn false;\r\n\r\n\t},\r\n\r\n\t// @method once(…): this\r\n\t// Behaves as [`on(…)`](#evented-on), except the listener will only get fired once and then removed.\r\n\tonce: function (types, fn, context) {\r\n\r\n\t\t// types can be a map of types/handlers\r\n\t\tif (typeof types === 'object') {\r\n\t\t\tfor (var type in types) {\r\n\t\t\t\t// we don't process space-separated events here for performance;\r\n\t\t\t\t// it's a hot path since Layer uses the on(obj) syntax\r\n\t\t\t\tthis._on(type, types[type], fn, true);\r\n\t\t\t}\r\n\r\n\t\t} else {\r\n\t\t\t// types can be a string of space-separated words\r\n\t\t\ttypes = Util.splitWords(types);\r\n\r\n\t\t\tfor (var i = 0, len = types.length; i < len; i++) {\r\n\t\t\t\tthis._on(types[i], fn, context, true);\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method addEventParent(obj: Evented): this\r\n\t// Adds an event parent - an `Evented` that will receive propagated events\r\n\taddEventParent: function (obj) {\r\n\t\tthis._eventParents = this._eventParents || {};\r\n\t\tthis._eventParents[Util.stamp(obj)] = obj;\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method removeEventParent(obj: Evented): this\r\n\t// Removes an event parent, so it will stop receiving propagated events\r\n\tremoveEventParent: function (obj) {\r\n\t\tif (this._eventParents) {\r\n\t\t\tdelete this._eventParents[Util.stamp(obj)];\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t_propagateEvent: function (e) {\r\n\t\tfor (var id in this._eventParents) {\r\n\t\t\tthis._eventParents[id].fire(e.type, Util.extend({\r\n\t\t\t\tlayer: e.target,\r\n\t\t\t\tpropagatedFrom: e.target\r\n\t\t\t}, e), true);\r\n\t\t}\r\n\t}\r\n};\r\n\r\n// aliases; we should ditch those eventually\r\n\r\n// @method addEventListener(…): this\r\n// Alias to [`on(…)`](#evented-on)\r\nEvents.addEventListener = Events.on;\r\n\r\n// @method removeEventListener(…): this\r\n// Alias to [`off(…)`](#evented-off)\r\n\r\n// @method clearAllEventListeners(…): this\r\n// Alias to [`off()`](#evented-off)\r\nEvents.removeEventListener = Events.clearAllEventListeners = Events.off;\r\n\r\n// @method addOneTimeEventListener(…): this\r\n// Alias to [`once(…)`](#evented-once)\r\nEvents.addOneTimeEventListener = Events.once;\r\n\r\n// @method fireEvent(…): this\r\n// Alias to [`fire(…)`](#evented-fire)\r\nEvents.fireEvent = Events.fire;\r\n\r\n// @method hasEventListeners(…): Boolean\r\n// Alias to [`listens(…)`](#evented-listens)\r\nEvents.hasEventListeners = Events.listens;\r\n\r\nexport var Evented = Class.extend(Events);\r\n", "import {isArray, formatNum} from '../core/Util';\r\n\r\n/*\r\n * @class Point\r\n * @aka L.Point\r\n *\r\n * Represents a point with `x` and `y` coordinates in pixels.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * var point = L.point(200, 300);\r\n * ```\r\n *\r\n * All Leaflet methods and options that accept `Point` objects also accept them in a simple Array form (unless noted otherwise), so these lines are equivalent:\r\n *\r\n * ```js\r\n * map.panBy([200, 300]);\r\n * map.panBy(L.point(200, 300));\r\n * ```\r\n *\r\n * Note that `Point` does not inherit from Leaflet's `Class` object,\r\n * which means new classes can't inherit from it, and new methods\r\n * can't be added to it with the `include` function.\r\n */\r\n\r\nexport function Point(x, y, round) {\r\n\t// @property x: Number; The `x` coordinate of the point\r\n\tthis.x = (round ? Math.round(x) : x);\r\n\t// @property y: Number; The `y` coordinate of the point\r\n\tthis.y = (round ? Math.round(y) : y);\r\n}\r\n\r\nvar trunc = Math.trunc || function (v) {\r\n\treturn v > 0 ? Math.floor(v) : Math.ceil(v);\r\n};\r\n\r\nPoint.prototype = {\r\n\r\n\t// @method clone(): Point\r\n\t// Returns a copy of the current point.\r\n\tclone: function () {\r\n\t\treturn new Point(this.x, this.y);\r\n\t},\r\n\r\n\t// @method add(otherPoint: Point): Point\r\n\t// Returns the result of addition of the current and the given points.\r\n\tadd: function (point) {\r\n\t\t// non-destructive, returns a new point\r\n\t\treturn this.clone()._add(toPoint(point));\r\n\t},\r\n\r\n\t_add: function (point) {\r\n\t\t// destructive, used directly for performance in situations where it's safe to modify existing point\r\n\t\tthis.x += point.x;\r\n\t\tthis.y += point.y;\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method subtract(otherPoint: Point): Point\r\n\t// Returns the result of subtraction of the given point from the current.\r\n\tsubtract: function (point) {\r\n\t\treturn this.clone()._subtract(toPoint(point));\r\n\t},\r\n\r\n\t_subtract: function (point) {\r\n\t\tthis.x -= point.x;\r\n\t\tthis.y -= point.y;\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method divideBy(num: Number): Point\r\n\t// Returns the result of division of the current point by the given number.\r\n\tdivideBy: function (num) {\r\n\t\treturn this.clone()._divideBy(num);\r\n\t},\r\n\r\n\t_divideBy: function (num) {\r\n\t\tthis.x /= num;\r\n\t\tthis.y /= num;\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method multiplyBy(num: Number): Point\r\n\t// Returns the result of multiplication of the current point by the given number.\r\n\tmultiplyBy: function (num) {\r\n\t\treturn this.clone()._multiplyBy(num);\r\n\t},\r\n\r\n\t_multiplyBy: function (num) {\r\n\t\tthis.x *= num;\r\n\t\tthis.y *= num;\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method scaleBy(scale: Point): Point\r\n\t// Multiply each coordinate of the current point by each coordinate of\r\n\t// `scale`. In linear algebra terms, multiply the point by the\r\n\t// [scaling matrix](https://en.wikipedia.org/wiki/Scaling_%28geometry%29#Matrix_representation)\r\n\t// defined by `scale`.\r\n\tscaleBy: function (point) {\r\n\t\treturn new Point(this.x * point.x, this.y * point.y);\r\n\t},\r\n\r\n\t// @method unscaleBy(scale: Point): Point\r\n\t// Inverse of `scaleBy`. Divide each coordinate of the current point by\r\n\t// each coordinate of `scale`.\r\n\tunscaleBy: function (point) {\r\n\t\treturn new Point(this.x / point.x, this.y / point.y);\r\n\t},\r\n\r\n\t// @method round(): Point\r\n\t// Returns a copy of the current point with rounded coordinates.\r\n\tround: function () {\r\n\t\treturn this.clone()._round();\r\n\t},\r\n\r\n\t_round: function () {\r\n\t\tthis.x = Math.round(this.x);\r\n\t\tthis.y = Math.round(this.y);\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method floor(): Point\r\n\t// Returns a copy of the current point with floored coordinates (rounded down).\r\n\tfloor: function () {\r\n\t\treturn this.clone()._floor();\r\n\t},\r\n\r\n\t_floor: function () {\r\n\t\tthis.x = Math.floor(this.x);\r\n\t\tthis.y = Math.floor(this.y);\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method ceil(): Point\r\n\t// Returns a copy of the current point with ceiled coordinates (rounded up).\r\n\tceil: function () {\r\n\t\treturn this.clone()._ceil();\r\n\t},\r\n\r\n\t_ceil: function () {\r\n\t\tthis.x = Math.ceil(this.x);\r\n\t\tthis.y = Math.ceil(this.y);\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method trunc(): Point\r\n\t// Returns a copy of the current point with truncated coordinates (rounded towards zero).\r\n\ttrunc: function () {\r\n\t\treturn this.clone()._trunc();\r\n\t},\r\n\r\n\t_trunc: function () {\r\n\t\tthis.x = trunc(this.x);\r\n\t\tthis.y = trunc(this.y);\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method distanceTo(otherPoint: Point): Number\r\n\t// Returns the cartesian distance between the current and the given points.\r\n\tdistanceTo: function (point) {\r\n\t\tpoint = toPoint(point);\r\n\r\n\t\tvar x = point.x - this.x,\r\n\t\t y = point.y - this.y;\r\n\r\n\t\treturn Math.sqrt(x * x + y * y);\r\n\t},\r\n\r\n\t// @method equals(otherPoint: Point): Boolean\r\n\t// Returns `true` if the given point has the same coordinates.\r\n\tequals: function (point) {\r\n\t\tpoint = toPoint(point);\r\n\r\n\t\treturn point.x === this.x &&\r\n\t\t point.y === this.y;\r\n\t},\r\n\r\n\t// @method contains(otherPoint: Point): Boolean\r\n\t// Returns `true` if both coordinates of the given point are less than the corresponding current point coordinates (in absolute values).\r\n\tcontains: function (point) {\r\n\t\tpoint = toPoint(point);\r\n\r\n\t\treturn Math.abs(point.x) <= Math.abs(this.x) &&\r\n\t\t Math.abs(point.y) <= Math.abs(this.y);\r\n\t},\r\n\r\n\t// @method toString(): String\r\n\t// Returns a string representation of the point for debugging purposes.\r\n\ttoString: function () {\r\n\t\treturn 'Point(' +\r\n\t\t formatNum(this.x) + ', ' +\r\n\t\t formatNum(this.y) + ')';\r\n\t}\r\n};\r\n\r\n// @factory L.point(x: Number, y: Number, round?: Boolean)\r\n// Creates a Point object with the given `x` and `y` coordinates. If optional `round` is set to true, rounds the `x` and `y` values.\r\n\r\n// @alternative\r\n// @factory L.point(coords: Number[])\r\n// Expects an array of the form `[x, y]` instead.\r\n\r\n// @alternative\r\n// @factory L.point(coords: Object)\r\n// Expects a plain object of the form `{x: Number, y: Number}` instead.\r\nexport function toPoint(x, y, round) {\r\n\tif (x instanceof Point) {\r\n\t\treturn x;\r\n\t}\r\n\tif (isArray(x)) {\r\n\t\treturn new Point(x[0], x[1]);\r\n\t}\r\n\tif (x === undefined || x === null) {\r\n\t\treturn x;\r\n\t}\r\n\tif (typeof x === 'object' && 'x' in x && 'y' in x) {\r\n\t\treturn new Point(x.x, x.y);\r\n\t}\r\n\treturn new Point(x, y, round);\r\n}\r\n", "import {Point, toPoint} from './Point';\r\n\r\n/*\r\n * @class Bounds\r\n * @aka L.Bounds\r\n *\r\n * Represents a rectangular area in pixel coordinates.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * var p1 = L.point(10, 10),\r\n * p2 = L.point(40, 60),\r\n * bounds = L.bounds(p1, p2);\r\n * ```\r\n *\r\n * All Leaflet methods that accept `Bounds` objects also accept them in a simple Array form (unless noted otherwise), so the bounds example above can be passed like this:\r\n *\r\n * ```js\r\n * otherBounds.intersects([[10, 10], [40, 60]]);\r\n * ```\r\n *\r\n * Note that `Bounds` does not inherit from Leaflet's `Class` object,\r\n * which means new classes can't inherit from it, and new methods\r\n * can't be added to it with the `include` function.\r\n */\r\n\r\nexport function Bounds(a, b) {\r\n\tif (!a) { return; }\r\n\r\n\tvar points = b ? [a, b] : a;\r\n\r\n\tfor (var i = 0, len = points.length; i < len; i++) {\r\n\t\tthis.extend(points[i]);\r\n\t}\r\n}\r\n\r\nBounds.prototype = {\r\n\t// @method extend(point: Point): this\r\n\t// Extends the bounds to contain the given point.\r\n\r\n\t// @alternative\r\n\t// @method extend(otherBounds: Bounds): this\r\n\t// Extend the bounds to contain the given bounds\r\n\textend: function (obj) {\r\n\t\tvar min2, max2;\r\n\t\tif (!obj) { return this; }\r\n\r\n\t\tif (obj instanceof Point || typeof obj[0] === 'number' || 'x' in obj) {\r\n\t\t\tmin2 = max2 = toPoint(obj);\r\n\t\t} else {\r\n\t\t\tobj = toBounds(obj);\r\n\t\t\tmin2 = obj.min;\r\n\t\t\tmax2 = obj.max;\r\n\r\n\t\t\tif (!min2 || !max2) { return this; }\r\n\t\t}\r\n\r\n\t\t// @property min: Point\r\n\t\t// The top left corner of the rectangle.\r\n\t\t// @property max: Point\r\n\t\t// The bottom right corner of the rectangle.\r\n\t\tif (!this.min && !this.max) {\r\n\t\t\tthis.min = min2.clone();\r\n\t\t\tthis.max = max2.clone();\r\n\t\t} else {\r\n\t\t\tthis.min.x = Math.min(min2.x, this.min.x);\r\n\t\t\tthis.max.x = Math.max(max2.x, this.max.x);\r\n\t\t\tthis.min.y = Math.min(min2.y, this.min.y);\r\n\t\t\tthis.max.y = Math.max(max2.y, this.max.y);\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method getCenter(round?: Boolean): Point\r\n\t// Returns the center point of the bounds.\r\n\tgetCenter: function (round) {\r\n\t\treturn toPoint(\r\n\t\t (this.min.x + this.max.x) / 2,\r\n\t\t (this.min.y + this.max.y) / 2, round);\r\n\t},\r\n\r\n\t// @method getBottomLeft(): Point\r\n\t// Returns the bottom-left point of the bounds.\r\n\tgetBottomLeft: function () {\r\n\t\treturn toPoint(this.min.x, this.max.y);\r\n\t},\r\n\r\n\t// @method getTopRight(): Point\r\n\t// Returns the top-right point of the bounds.\r\n\tgetTopRight: function () { // -> Point\r\n\t\treturn toPoint(this.max.x, this.min.y);\r\n\t},\r\n\r\n\t// @method getTopLeft(): Point\r\n\t// Returns the top-left point of the bounds (i.e. [`this.min`](#bounds-min)).\r\n\tgetTopLeft: function () {\r\n\t\treturn this.min; // left, top\r\n\t},\r\n\r\n\t// @method getBottomRight(): Point\r\n\t// Returns the bottom-right point of the bounds (i.e. [`this.max`](#bounds-max)).\r\n\tgetBottomRight: function () {\r\n\t\treturn this.max; // right, bottom\r\n\t},\r\n\r\n\t// @method getSize(): Point\r\n\t// Returns the size of the given bounds\r\n\tgetSize: function () {\r\n\t\treturn this.max.subtract(this.min);\r\n\t},\r\n\r\n\t// @method contains(otherBounds: Bounds): Boolean\r\n\t// Returns `true` if the rectangle contains the given one.\r\n\t// @alternative\r\n\t// @method contains(point: Point): Boolean\r\n\t// Returns `true` if the rectangle contains the given point.\r\n\tcontains: function (obj) {\r\n\t\tvar min, max;\r\n\r\n\t\tif (typeof obj[0] === 'number' || obj instanceof Point) {\r\n\t\t\tobj = toPoint(obj);\r\n\t\t} else {\r\n\t\t\tobj = toBounds(obj);\r\n\t\t}\r\n\r\n\t\tif (obj instanceof Bounds) {\r\n\t\t\tmin = obj.min;\r\n\t\t\tmax = obj.max;\r\n\t\t} else {\r\n\t\t\tmin = max = obj;\r\n\t\t}\r\n\r\n\t\treturn (min.x >= this.min.x) &&\r\n\t\t (max.x <= this.max.x) &&\r\n\t\t (min.y >= this.min.y) &&\r\n\t\t (max.y <= this.max.y);\r\n\t},\r\n\r\n\t// @method intersects(otherBounds: Bounds): Boolean\r\n\t// Returns `true` if the rectangle intersects the given bounds. Two bounds\r\n\t// intersect if they have at least one point in common.\r\n\tintersects: function (bounds) { // (Bounds) -> Boolean\r\n\t\tbounds = toBounds(bounds);\r\n\r\n\t\tvar min = this.min,\r\n\t\t max = this.max,\r\n\t\t min2 = bounds.min,\r\n\t\t max2 = bounds.max,\r\n\t\t xIntersects = (max2.x >= min.x) && (min2.x <= max.x),\r\n\t\t yIntersects = (max2.y >= min.y) && (min2.y <= max.y);\r\n\r\n\t\treturn xIntersects && yIntersects;\r\n\t},\r\n\r\n\t// @method overlaps(otherBounds: Bounds): Boolean\r\n\t// Returns `true` if the rectangle overlaps the given bounds. Two bounds\r\n\t// overlap if their intersection is an area.\r\n\toverlaps: function (bounds) { // (Bounds) -> Boolean\r\n\t\tbounds = toBounds(bounds);\r\n\r\n\t\tvar min = this.min,\r\n\t\t max = this.max,\r\n\t\t min2 = bounds.min,\r\n\t\t max2 = bounds.max,\r\n\t\t xOverlaps = (max2.x > min.x) && (min2.x < max.x),\r\n\t\t yOverlaps = (max2.y > min.y) && (min2.y < max.y);\r\n\r\n\t\treturn xOverlaps && yOverlaps;\r\n\t},\r\n\r\n\t// @method isValid(): Boolean\r\n\t// Returns `true` if the bounds are properly initialized.\r\n\tisValid: function () {\r\n\t\treturn !!(this.min && this.max);\r\n\t},\r\n\r\n\r\n\t// @method pad(bufferRatio: Number): Bounds\r\n\t// Returns bounds created by extending or retracting the current bounds by a given ratio in each direction.\r\n\t// For example, a ratio of 0.5 extends the bounds by 50% in each direction.\r\n\t// Negative values will retract the bounds.\r\n\tpad: function (bufferRatio) {\r\n\t\tvar min = this.min,\r\n\t\tmax = this.max,\r\n\t\theightBuffer = Math.abs(min.x - max.x) * bufferRatio,\r\n\t\twidthBuffer = Math.abs(min.y - max.y) * bufferRatio;\r\n\r\n\r\n\t\treturn toBounds(\r\n\t\t\ttoPoint(min.x - heightBuffer, min.y - widthBuffer),\r\n\t\t\ttoPoint(max.x + heightBuffer, max.y + widthBuffer));\r\n\t},\r\n\r\n\r\n\t// @method equals(otherBounds: Bounds): Boolean\r\n\t// Returns `true` if the rectangle is equivalent to the given bounds.\r\n\tequals: function (bounds) {\r\n\t\tif (!bounds) { return false; }\r\n\r\n\t\tbounds = toBounds(bounds);\r\n\r\n\t\treturn this.min.equals(bounds.getTopLeft()) &&\r\n\t\t\tthis.max.equals(bounds.getBottomRight());\r\n\t},\r\n};\r\n\r\n\r\n// @factory L.bounds(corner1: Point, corner2: Point)\r\n// Creates a Bounds object from two corners coordinate pairs.\r\n// @alternative\r\n// @factory L.bounds(points: Point[])\r\n// Creates a Bounds object from the given array of points.\r\nexport function toBounds(a, b) {\r\n\tif (!a || a instanceof Bounds) {\r\n\t\treturn a;\r\n\t}\r\n\treturn new Bounds(a, b);\r\n}\r\n", "import {LatLng, toLatLng} from './LatLng';\r\n\r\n/*\r\n * @class LatLngBounds\r\n * @aka L.LatLngBounds\r\n *\r\n * Represents a rectangular geographical area on a map.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * var corner1 = L.latLng(40.712, -74.227),\r\n * corner2 = L.latLng(40.774, -74.125),\r\n * bounds = L.latLngBounds(corner1, corner2);\r\n * ```\r\n *\r\n * All Leaflet methods that accept LatLngBounds objects also accept them in a simple Array form (unless noted otherwise), so the bounds example above can be passed like this:\r\n *\r\n * ```js\r\n * map.fitBounds([\r\n * \t[40.712, -74.227],\r\n * \t[40.774, -74.125]\r\n * ]);\r\n * ```\r\n *\r\n * Caution: if the area crosses the antimeridian (often confused with the International Date Line), you must specify corners _outside_ the [-180, 180] degrees longitude range.\r\n *\r\n * Note that `LatLngBounds` does not inherit from Leaflet's `Class` object,\r\n * which means new classes can't inherit from it, and new methods\r\n * can't be added to it with the `include` function.\r\n */\r\n\r\nexport function LatLngBounds(corner1, corner2) { // (LatLng, LatLng) or (LatLng[])\r\n\tif (!corner1) { return; }\r\n\r\n\tvar latlngs = corner2 ? [corner1, corner2] : corner1;\r\n\r\n\tfor (var i = 0, len = latlngs.length; i < len; i++) {\r\n\t\tthis.extend(latlngs[i]);\r\n\t}\r\n}\r\n\r\nLatLngBounds.prototype = {\r\n\r\n\t// @method extend(latlng: LatLng): this\r\n\t// Extend the bounds to contain the given point\r\n\r\n\t// @alternative\r\n\t// @method extend(otherBounds: LatLngBounds): this\r\n\t// Extend the bounds to contain the given bounds\r\n\textend: function (obj) {\r\n\t\tvar sw = this._southWest,\r\n\t\t ne = this._northEast,\r\n\t\t sw2, ne2;\r\n\r\n\t\tif (obj instanceof LatLng) {\r\n\t\t\tsw2 = obj;\r\n\t\t\tne2 = obj;\r\n\r\n\t\t} else if (obj instanceof LatLngBounds) {\r\n\t\t\tsw2 = obj._southWest;\r\n\t\t\tne2 = obj._northEast;\r\n\r\n\t\t\tif (!sw2 || !ne2) { return this; }\r\n\r\n\t\t} else {\r\n\t\t\treturn obj ? this.extend(toLatLng(obj) || toLatLngBounds(obj)) : this;\r\n\t\t}\r\n\r\n\t\tif (!sw && !ne) {\r\n\t\t\tthis._southWest = new LatLng(sw2.lat, sw2.lng);\r\n\t\t\tthis._northEast = new LatLng(ne2.lat, ne2.lng);\r\n\t\t} else {\r\n\t\t\tsw.lat = Math.min(sw2.lat, sw.lat);\r\n\t\t\tsw.lng = Math.min(sw2.lng, sw.lng);\r\n\t\t\tne.lat = Math.max(ne2.lat, ne.lat);\r\n\t\t\tne.lng = Math.max(ne2.lng, ne.lng);\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method pad(bufferRatio: Number): LatLngBounds\r\n\t// Returns bounds created by extending or retracting the current bounds by a given ratio in each direction.\r\n\t// For example, a ratio of 0.5 extends the bounds by 50% in each direction.\r\n\t// Negative values will retract the bounds.\r\n\tpad: function (bufferRatio) {\r\n\t\tvar sw = this._southWest,\r\n\t\t ne = this._northEast,\r\n\t\t heightBuffer = Math.abs(sw.lat - ne.lat) * bufferRatio,\r\n\t\t widthBuffer = Math.abs(sw.lng - ne.lng) * bufferRatio;\r\n\r\n\t\treturn new LatLngBounds(\r\n\t\t new LatLng(sw.lat - heightBuffer, sw.lng - widthBuffer),\r\n\t\t new LatLng(ne.lat + heightBuffer, ne.lng + widthBuffer));\r\n\t},\r\n\r\n\t// @method getCenter(): LatLng\r\n\t// Returns the center point of the bounds.\r\n\tgetCenter: function () {\r\n\t\treturn new LatLng(\r\n\t\t (this._southWest.lat + this._northEast.lat) / 2,\r\n\t\t (this._southWest.lng + this._northEast.lng) / 2);\r\n\t},\r\n\r\n\t// @method getSouthWest(): LatLng\r\n\t// Returns the south-west point of the bounds.\r\n\tgetSouthWest: function () {\r\n\t\treturn this._southWest;\r\n\t},\r\n\r\n\t// @method getNorthEast(): LatLng\r\n\t// Returns the north-east point of the bounds.\r\n\tgetNorthEast: function () {\r\n\t\treturn this._northEast;\r\n\t},\r\n\r\n\t// @method getNorthWest(): LatLng\r\n\t// Returns the north-west point of the bounds.\r\n\tgetNorthWest: function () {\r\n\t\treturn new LatLng(this.getNorth(), this.getWest());\r\n\t},\r\n\r\n\t// @method getSouthEast(): LatLng\r\n\t// Returns the south-east point of the bounds.\r\n\tgetSouthEast: function () {\r\n\t\treturn new LatLng(this.getSouth(), this.getEast());\r\n\t},\r\n\r\n\t// @method getWest(): Number\r\n\t// Returns the west longitude of the bounds\r\n\tgetWest: function () {\r\n\t\treturn this._southWest.lng;\r\n\t},\r\n\r\n\t// @method getSouth(): Number\r\n\t// Returns the south latitude of the bounds\r\n\tgetSouth: function () {\r\n\t\treturn this._southWest.lat;\r\n\t},\r\n\r\n\t// @method getEast(): Number\r\n\t// Returns the east longitude of the bounds\r\n\tgetEast: function () {\r\n\t\treturn this._northEast.lng;\r\n\t},\r\n\r\n\t// @method getNorth(): Number\r\n\t// Returns the north latitude of the bounds\r\n\tgetNorth: function () {\r\n\t\treturn this._northEast.lat;\r\n\t},\r\n\r\n\t// @method contains(otherBounds: LatLngBounds): Boolean\r\n\t// Returns `true` if the rectangle contains the given one.\r\n\r\n\t// @alternative\r\n\t// @method contains (latlng: LatLng): Boolean\r\n\t// Returns `true` if the rectangle contains the given point.\r\n\tcontains: function (obj) { // (LatLngBounds) or (LatLng) -> Boolean\r\n\t\tif (typeof obj[0] === 'number' || obj instanceof LatLng || 'lat' in obj) {\r\n\t\t\tobj = toLatLng(obj);\r\n\t\t} else {\r\n\t\t\tobj = toLatLngBounds(obj);\r\n\t\t}\r\n\r\n\t\tvar sw = this._southWest,\r\n\t\t ne = this._northEast,\r\n\t\t sw2, ne2;\r\n\r\n\t\tif (obj instanceof LatLngBounds) {\r\n\t\t\tsw2 = obj.getSouthWest();\r\n\t\t\tne2 = obj.getNorthEast();\r\n\t\t} else {\r\n\t\t\tsw2 = ne2 = obj;\r\n\t\t}\r\n\r\n\t\treturn (sw2.lat >= sw.lat) && (ne2.lat <= ne.lat) &&\r\n\t\t (sw2.lng >= sw.lng) && (ne2.lng <= ne.lng);\r\n\t},\r\n\r\n\t// @method intersects(otherBounds: LatLngBounds): Boolean\r\n\t// Returns `true` if the rectangle intersects the given bounds. Two bounds intersect if they have at least one point in common.\r\n\tintersects: function (bounds) {\r\n\t\tbounds = toLatLngBounds(bounds);\r\n\r\n\t\tvar sw = this._southWest,\r\n\t\t ne = this._northEast,\r\n\t\t sw2 = bounds.getSouthWest(),\r\n\t\t ne2 = bounds.getNorthEast(),\r\n\r\n\t\t latIntersects = (ne2.lat >= sw.lat) && (sw2.lat <= ne.lat),\r\n\t\t lngIntersects = (ne2.lng >= sw.lng) && (sw2.lng <= ne.lng);\r\n\r\n\t\treturn latIntersects && lngIntersects;\r\n\t},\r\n\r\n\t// @method overlaps(otherBounds: LatLngBounds): Boolean\r\n\t// Returns `true` if the rectangle overlaps the given bounds. Two bounds overlap if their intersection is an area.\r\n\toverlaps: function (bounds) {\r\n\t\tbounds = toLatLngBounds(bounds);\r\n\r\n\t\tvar sw = this._southWest,\r\n\t\t ne = this._northEast,\r\n\t\t sw2 = bounds.getSouthWest(),\r\n\t\t ne2 = bounds.getNorthEast(),\r\n\r\n\t\t latOverlaps = (ne2.lat > sw.lat) && (sw2.lat < ne.lat),\r\n\t\t lngOverlaps = (ne2.lng > sw.lng) && (sw2.lng < ne.lng);\r\n\r\n\t\treturn latOverlaps && lngOverlaps;\r\n\t},\r\n\r\n\t// @method toBBoxString(): String\r\n\t// Returns a string with bounding box coordinates in a 'southwest_lng,southwest_lat,northeast_lng,northeast_lat' format. Useful for sending requests to web services that return geo data.\r\n\ttoBBoxString: function () {\r\n\t\treturn [this.getWest(), this.getSouth(), this.getEast(), this.getNorth()].join(',');\r\n\t},\r\n\r\n\t// @method equals(otherBounds: LatLngBounds, maxMargin?: Number): Boolean\r\n\t// Returns `true` if the rectangle is equivalent (within a small margin of error) to the given bounds. The margin of error can be overridden by setting `maxMargin` to a small number.\r\n\tequals: function (bounds, maxMargin) {\r\n\t\tif (!bounds) { return false; }\r\n\r\n\t\tbounds = toLatLngBounds(bounds);\r\n\r\n\t\treturn this._southWest.equals(bounds.getSouthWest(), maxMargin) &&\r\n\t\t this._northEast.equals(bounds.getNorthEast(), maxMargin);\r\n\t},\r\n\r\n\t// @method isValid(): Boolean\r\n\t// Returns `true` if the bounds are properly initialized.\r\n\tisValid: function () {\r\n\t\treturn !!(this._southWest && this._northEast);\r\n\t}\r\n};\r\n\r\n// TODO International date line?\r\n\r\n// @factory L.latLngBounds(corner1: LatLng, corner2: LatLng)\r\n// Creates a `LatLngBounds` object by defining two diagonally opposite corners of the rectangle.\r\n\r\n// @alternative\r\n// @factory L.latLngBounds(latlngs: LatLng[])\r\n// Creates a `LatLngBounds` object defined by the geographical points it contains. Very useful for zooming the map to fit a particular set of locations with [`fitBounds`](#map-fitbounds).\r\nexport function toLatLngBounds(a, b) {\r\n\tif (a instanceof LatLngBounds) {\r\n\t\treturn a;\r\n\t}\r\n\treturn new LatLngBounds(a, b);\r\n}\r\n", "import * as Util from '../core/Util';\r\nimport {Earth} from './crs/CRS.Earth';\r\nimport {toLatLngBounds} from './LatLngBounds';\r\n\r\n/* @class LatLng\r\n * @aka L.LatLng\r\n *\r\n * Represents a geographical point with a certain latitude and longitude.\r\n *\r\n * @example\r\n *\r\n * ```\r\n * var latlng = L.latLng(50.5, 30.5);\r\n * ```\r\n *\r\n * All Leaflet methods that accept LatLng objects also accept them in a simple Array form and simple object form (unless noted otherwise), so these lines are equivalent:\r\n *\r\n * ```\r\n * map.panTo([50, 30]);\r\n * map.panTo({lon: 30, lat: 50});\r\n * map.panTo({lat: 50, lng: 30});\r\n * map.panTo(L.latLng(50, 30));\r\n * ```\r\n *\r\n * Note that `LatLng` does not inherit from Leaflet's `Class` object,\r\n * which means new classes can't inherit from it, and new methods\r\n * can't be added to it with the `include` function.\r\n */\r\n\r\nexport function LatLng(lat, lng, alt) {\r\n\tif (isNaN(lat) || isNaN(lng)) {\r\n\t\tthrow new Error('Invalid LatLng object: (' + lat + ', ' + lng + ')');\r\n\t}\r\n\r\n\t// @property lat: Number\r\n\t// Latitude in degrees\r\n\tthis.lat = +lat;\r\n\r\n\t// @property lng: Number\r\n\t// Longitude in degrees\r\n\tthis.lng = +lng;\r\n\r\n\t// @property alt: Number\r\n\t// Altitude in meters (optional)\r\n\tif (alt !== undefined) {\r\n\t\tthis.alt = +alt;\r\n\t}\r\n}\r\n\r\nLatLng.prototype = {\r\n\t// @method equals(otherLatLng: LatLng, maxMargin?: Number): Boolean\r\n\t// Returns `true` if the given `LatLng` point is at the same position (within a small margin of error). The margin of error can be overridden by setting `maxMargin` to a small number.\r\n\tequals: function (obj, maxMargin) {\r\n\t\tif (!obj) { return false; }\r\n\r\n\t\tobj = toLatLng(obj);\r\n\r\n\t\tvar margin = Math.max(\r\n\t\t Math.abs(this.lat - obj.lat),\r\n\t\t Math.abs(this.lng - obj.lng));\r\n\r\n\t\treturn margin <= (maxMargin === undefined ? 1.0E-9 : maxMargin);\r\n\t},\r\n\r\n\t// @method toString(): String\r\n\t// Returns a string representation of the point (for debugging purposes).\r\n\ttoString: function (precision) {\r\n\t\treturn 'LatLng(' +\r\n\t\t Util.formatNum(this.lat, precision) + ', ' +\r\n\t\t Util.formatNum(this.lng, precision) + ')';\r\n\t},\r\n\r\n\t// @method distanceTo(otherLatLng: LatLng): Number\r\n\t// Returns the distance (in meters) to the given `LatLng` calculated using the [Spherical Law of Cosines](https://en.wikipedia.org/wiki/Spherical_law_of_cosines).\r\n\tdistanceTo: function (other) {\r\n\t\treturn Earth.distance(this, toLatLng(other));\r\n\t},\r\n\r\n\t// @method wrap(): LatLng\r\n\t// Returns a new `LatLng` object with the longitude wrapped so it's always between -180 and +180 degrees.\r\n\twrap: function () {\r\n\t\treturn Earth.wrapLatLng(this);\r\n\t},\r\n\r\n\t// @method toBounds(sizeInMeters: Number): LatLngBounds\r\n\t// Returns a new `LatLngBounds` object in which each boundary is `sizeInMeters/2` meters apart from the `LatLng`.\r\n\ttoBounds: function (sizeInMeters) {\r\n\t\tvar latAccuracy = 180 * sizeInMeters / 40075017,\r\n\t\t lngAccuracy = latAccuracy / Math.cos((Math.PI / 180) * this.lat);\r\n\r\n\t\treturn toLatLngBounds(\r\n\t\t [this.lat - latAccuracy, this.lng - lngAccuracy],\r\n\t\t [this.lat + latAccuracy, this.lng + lngAccuracy]);\r\n\t},\r\n\r\n\tclone: function () {\r\n\t\treturn new LatLng(this.lat, this.lng, this.alt);\r\n\t}\r\n};\r\n\r\n\r\n\r\n// @factory L.latLng(latitude: Number, longitude: Number, altitude?: Number): LatLng\r\n// Creates an object representing a geographical point with the given latitude and longitude (and optionally altitude).\r\n\r\n// @alternative\r\n// @factory L.latLng(coords: Array): LatLng\r\n// Expects an array of the form `[Number, Number]` or `[Number, Number, Number]` instead.\r\n\r\n// @alternative\r\n// @factory L.latLng(coords: Object): LatLng\r\n// Expects an plain object of the form `{lat: Number, lng: Number}` or `{lat: Number, lng: Number, alt: Number}` instead.\r\n\r\nexport function toLatLng(a, b, c) {\r\n\tif (a instanceof LatLng) {\r\n\t\treturn a;\r\n\t}\r\n\tif (Util.isArray(a) && typeof a[0] !== 'object') {\r\n\t\tif (a.length === 3) {\r\n\t\t\treturn new LatLng(a[0], a[1], a[2]);\r\n\t\t}\r\n\t\tif (a.length === 2) {\r\n\t\t\treturn new LatLng(a[0], a[1]);\r\n\t\t}\r\n\t\treturn null;\r\n\t}\r\n\tif (a === undefined || a === null) {\r\n\t\treturn a;\r\n\t}\r\n\tif (typeof a === 'object' && 'lat' in a) {\r\n\t\treturn new LatLng(a.lat, 'lng' in a ? a.lng : a.lon, a.alt);\r\n\t}\r\n\tif (b === undefined) {\r\n\t\treturn null;\r\n\t}\r\n\treturn new LatLng(a, b, c);\r\n}\r\n", "\r\nimport {Bounds} from '../../geometry/Bounds';\r\nimport {LatLng} from '../LatLng';\r\nimport {LatLngBounds} from '../LatLngBounds';\r\nimport * as Util from '../../core/Util';\r\n\r\n/*\r\n * @namespace CRS\r\n * @crs L.CRS.Base\r\n * Object that defines coordinate reference systems for projecting\r\n * geographical points into pixel (screen) coordinates and back (and to\r\n * coordinates in other units for [WMS](https://en.wikipedia.org/wiki/Web_Map_Service) services). See\r\n * [spatial reference system](https://en.wikipedia.org/wiki/Spatial_reference_system).\r\n *\r\n * Leaflet defines the most usual CRSs by default. If you want to use a\r\n * CRS not defined by default, take a look at the\r\n * [Proj4Leaflet](https://github.com/kartena/Proj4Leaflet) plugin.\r\n *\r\n * Note that the CRS instances do not inherit from Leaflet's `Class` object,\r\n * and can't be instantiated. Also, new classes can't inherit from them,\r\n * and methods can't be added to them with the `include` function.\r\n */\r\n\r\nexport var CRS = {\r\n\t// @method latLngToPoint(latlng: LatLng, zoom: Number): Point\r\n\t// Projects geographical coordinates into pixel coordinates for a given zoom.\r\n\tlatLngToPoint: function (latlng, zoom) {\r\n\t\tvar projectedPoint = this.projection.project(latlng),\r\n\t\t scale = this.scale(zoom);\r\n\r\n\t\treturn this.transformation._transform(projectedPoint, scale);\r\n\t},\r\n\r\n\t// @method pointToLatLng(point: Point, zoom: Number): LatLng\r\n\t// The inverse of `latLngToPoint`. Projects pixel coordinates on a given\r\n\t// zoom into geographical coordinates.\r\n\tpointToLatLng: function (point, zoom) {\r\n\t\tvar scale = this.scale(zoom),\r\n\t\t untransformedPoint = this.transformation.untransform(point, scale);\r\n\r\n\t\treturn this.projection.unproject(untransformedPoint);\r\n\t},\r\n\r\n\t// @method project(latlng: LatLng): Point\r\n\t// Projects geographical coordinates into coordinates in units accepted for\r\n\t// this CRS (e.g. meters for EPSG:3857, for passing it to WMS services).\r\n\tproject: function (latlng) {\r\n\t\treturn this.projection.project(latlng);\r\n\t},\r\n\r\n\t// @method unproject(point: Point): LatLng\r\n\t// Given a projected coordinate returns the corresponding LatLng.\r\n\t// The inverse of `project`.\r\n\tunproject: function (point) {\r\n\t\treturn this.projection.unproject(point);\r\n\t},\r\n\r\n\t// @method scale(zoom: Number): Number\r\n\t// Returns the scale used when transforming projected coordinates into\r\n\t// pixel coordinates for a particular zoom. For example, it returns\r\n\t// `256 * 2^zoom` for Mercator-based CRS.\r\n\tscale: function (zoom) {\r\n\t\treturn 256 * Math.pow(2, zoom);\r\n\t},\r\n\r\n\t// @method zoom(scale: Number): Number\r\n\t// Inverse of `scale()`, returns the zoom level corresponding to a scale\r\n\t// factor of `scale`.\r\n\tzoom: function (scale) {\r\n\t\treturn Math.log(scale / 256) / Math.LN2;\r\n\t},\r\n\r\n\t// @method getProjectedBounds(zoom: Number): Bounds\r\n\t// Returns the projection's bounds scaled and transformed for the provided `zoom`.\r\n\tgetProjectedBounds: function (zoom) {\r\n\t\tif (this.infinite) { return null; }\r\n\r\n\t\tvar b = this.projection.bounds,\r\n\t\t s = this.scale(zoom),\r\n\t\t min = this.transformation.transform(b.min, s),\r\n\t\t max = this.transformation.transform(b.max, s);\r\n\r\n\t\treturn new Bounds(min, max);\r\n\t},\r\n\r\n\t// @method distance(latlng1: LatLng, latlng2: LatLng): Number\r\n\t// Returns the distance between two geographical coordinates.\r\n\r\n\t// @property code: String\r\n\t// Standard code name of the CRS passed into WMS services (e.g. `'EPSG:3857'`)\r\n\t//\r\n\t// @property wrapLng: Number[]\r\n\t// An array of two numbers defining whether the longitude (horizontal) coordinate\r\n\t// axis wraps around a given range and how. Defaults to `[-180, 180]` in most\r\n\t// geographical CRSs. If `undefined`, the longitude axis does not wrap around.\r\n\t//\r\n\t// @property wrapLat: Number[]\r\n\t// Like `wrapLng`, but for the latitude (vertical) axis.\r\n\r\n\t// wrapLng: [min, max],\r\n\t// wrapLat: [min, max],\r\n\r\n\t// @property infinite: Boolean\r\n\t// If true, the coordinate space will be unbounded (infinite in both axes)\r\n\tinfinite: false,\r\n\r\n\t// @method wrapLatLng(latlng: LatLng): LatLng\r\n\t// Returns a `LatLng` where lat and lng has been wrapped according to the\r\n\t// CRS's `wrapLat` and `wrapLng` properties, if they are outside the CRS's bounds.\r\n\twrapLatLng: function (latlng) {\r\n\t\tvar lng = this.wrapLng ? Util.wrapNum(latlng.lng, this.wrapLng, true) : latlng.lng,\r\n\t\t lat = this.wrapLat ? Util.wrapNum(latlng.lat, this.wrapLat, true) : latlng.lat,\r\n\t\t alt = latlng.alt;\r\n\r\n\t\treturn new LatLng(lat, lng, alt);\r\n\t},\r\n\r\n\t// @method wrapLatLngBounds(bounds: LatLngBounds): LatLngBounds\r\n\t// Returns a `LatLngBounds` with the same size as the given one, ensuring\r\n\t// that its center is within the CRS's bounds.\r\n\t// Only accepts actual `L.LatLngBounds` instances, not arrays.\r\n\twrapLatLngBounds: function (bounds) {\r\n\t\tvar center = bounds.getCenter(),\r\n\t\t newCenter = this.wrapLatLng(center),\r\n\t\t latShift = center.lat - newCenter.lat,\r\n\t\t lngShift = center.lng - newCenter.lng;\r\n\r\n\t\tif (latShift === 0 && lngShift === 0) {\r\n\t\t\treturn bounds;\r\n\t\t}\r\n\r\n\t\tvar sw = bounds.getSouthWest(),\r\n\t\t ne = bounds.getNorthEast(),\r\n\t\t newSw = new LatLng(sw.lat - latShift, sw.lng - lngShift),\r\n\t\t newNe = new LatLng(ne.lat - latShift, ne.lng - lngShift);\r\n\r\n\t\treturn new LatLngBounds(newSw, newNe);\r\n\t}\r\n};\r\n", "import {CRS} from './CRS';\nimport * as Util from '../../core/Util';\n\n/*\n * @namespace CRS\n * @crs L.CRS.Earth\n *\n * Serves as the base for CRS that are global such that they cover the earth.\n * Can only be used as the base for other CRS and cannot be used directly,\n * since it does not have a `code`, `projection` or `transformation`. `distance()` returns\n * meters.\n */\n\nexport var Earth = Util.extend({}, CRS, {\n\twrapLng: [-180, 180],\n\n\t// Mean Earth Radius, as recommended for use by\n\t// the International Union of Geodesy and Geophysics,\n\t// see https://rosettacode.org/wiki/Haversine_formula\n\tR: 6371000,\n\n\t// distance between two geographical points using spherical law of cosines approximation\n\tdistance: function (latlng1, latlng2) {\n\t\tvar rad = Math.PI / 180,\n\t\t lat1 = latlng1.lat * rad,\n\t\t lat2 = latlng2.lat * rad,\n\t\t sinDLat = Math.sin((latlng2.lat - latlng1.lat) * rad / 2),\n\t\t sinDLon = Math.sin((latlng2.lng - latlng1.lng) * rad / 2),\n\t\t a = sinDLat * sinDLat + Math.cos(lat1) * Math.cos(lat2) * sinDLon * sinDLon,\n\t\t c = 2 * Math.atan2(Math.sqrt(a), Math.sqrt(1 - a));\n\t\treturn this.R * c;\n\t}\n});\n", "import {LatLng} from '../LatLng';\r\nimport {Bounds} from '../../geometry/Bounds';\r\nimport {Point} from '../../geometry/Point';\r\n\r\n/*\r\n * @namespace Projection\r\n * @projection L.Projection.SphericalMercator\r\n *\r\n * Spherical Mercator projection — the most common projection for online maps,\r\n * used by almost all free and commercial tile providers. Assumes that Earth is\r\n * a sphere. Used by the `EPSG:3857` CRS.\r\n */\r\n\r\nvar earthRadius = 6378137;\r\n\r\nexport var SphericalMercator = {\r\n\r\n\tR: earthRadius,\r\n\tMAX_LATITUDE: 85.0511287798,\r\n\r\n\tproject: function (latlng) {\r\n\t\tvar d = Math.PI / 180,\r\n\t\t max = this.MAX_LATITUDE,\r\n\t\t lat = Math.max(Math.min(max, latlng.lat), -max),\r\n\t\t sin = Math.sin(lat * d);\r\n\r\n\t\treturn new Point(\r\n\t\t\tthis.R * latlng.lng * d,\r\n\t\t\tthis.R * Math.log((1 + sin) / (1 - sin)) / 2);\r\n\t},\r\n\r\n\tunproject: function (point) {\r\n\t\tvar d = 180 / Math.PI;\r\n\r\n\t\treturn new LatLng(\r\n\t\t\t(2 * Math.atan(Math.exp(point.y / this.R)) - (Math.PI / 2)) * d,\r\n\t\t\tpoint.x * d / this.R);\r\n\t},\r\n\r\n\tbounds: (function () {\r\n\t\tvar d = earthRadius * Math.PI;\r\n\t\treturn new Bounds([-d, -d], [d, d]);\r\n\t})()\r\n};\r\n", "import {Point} from './Point';\r\nimport * as Util from '../core/Util';\r\n\r\n/*\r\n * @class Transformation\r\n * @aka L.Transformation\r\n *\r\n * Represents an affine transformation: a set of coefficients `a`, `b`, `c`, `d`\r\n * for transforming a point of a form `(x, y)` into `(a*x + b, c*y + d)` and doing\r\n * the reverse. Used by Leaflet in its projections code.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * var transformation = L.transformation(2, 5, -1, 10),\r\n * \tp = L.point(1, 2),\r\n * \tp2 = transformation.transform(p), // L.point(7, 8)\r\n * \tp3 = transformation.untransform(p2); // L.point(1, 2)\r\n * ```\r\n */\r\n\r\n\r\n// factory new L.Transformation(a: Number, b: Number, c: Number, d: Number)\r\n// Creates a `Transformation` object with the given coefficients.\r\nexport function Transformation(a, b, c, d) {\r\n\tif (Util.isArray(a)) {\r\n\t\t// use array properties\r\n\t\tthis._a = a[0];\r\n\t\tthis._b = a[1];\r\n\t\tthis._c = a[2];\r\n\t\tthis._d = a[3];\r\n\t\treturn;\r\n\t}\r\n\tthis._a = a;\r\n\tthis._b = b;\r\n\tthis._c = c;\r\n\tthis._d = d;\r\n}\r\n\r\nTransformation.prototype = {\r\n\t// @method transform(point: Point, scale?: Number): Point\r\n\t// Returns a transformed point, optionally multiplied by the given scale.\r\n\t// Only accepts actual `L.Point` instances, not arrays.\r\n\ttransform: function (point, scale) { // (Point, Number) -> Point\r\n\t\treturn this._transform(point.clone(), scale);\r\n\t},\r\n\r\n\t// destructive transform (faster)\r\n\t_transform: function (point, scale) {\r\n\t\tscale = scale || 1;\r\n\t\tpoint.x = scale * (this._a * point.x + this._b);\r\n\t\tpoint.y = scale * (this._c * point.y + this._d);\r\n\t\treturn point;\r\n\t},\r\n\r\n\t// @method untransform(point: Point, scale?: Number): Point\r\n\t// Returns the reverse transformation of the given point, optionally divided\r\n\t// by the given scale. Only accepts actual `L.Point` instances, not arrays.\r\n\tuntransform: function (point, scale) {\r\n\t\tscale = scale || 1;\r\n\t\treturn new Point(\r\n\t\t (point.x / scale - this._b) / this._a,\r\n\t\t (point.y / scale - this._d) / this._c);\r\n\t}\r\n};\r\n\r\n// factory L.transformation(a: Number, b: Number, c: Number, d: Number)\r\n\r\n// @factory L.transformation(a: Number, b: Number, c: Number, d: Number)\r\n// Instantiates a Transformation object with the given coefficients.\r\n\r\n// @alternative\r\n// @factory L.transformation(coefficients: Array): Transformation\r\n// Expects an coefficients array of the form\r\n// `[a: Number, b: Number, c: Number, d: Number]`.\r\n\r\nexport function toTransformation(a, b, c, d) {\r\n\treturn new Transformation(a, b, c, d);\r\n}\r\n", "import {Earth} from './CRS.Earth';\r\nimport {SphericalMercator} from '../projection/Projection.SphericalMercator';\r\nimport {toTransformation} from '../../geometry/Transformation';\r\nimport * as Util from '../../core/Util';\r\n\r\n/*\r\n * @namespace CRS\r\n * @crs L.CRS.EPSG3857\r\n *\r\n * The most common CRS for online maps, used by almost all free and commercial\r\n * tile providers. Uses Spherical Mercator projection. Set in by default in\r\n * Map's `crs` option.\r\n */\r\n\r\nexport var EPSG3857 = Util.extend({}, Earth, {\r\n\tcode: 'EPSG:3857',\r\n\tprojection: SphericalMercator,\r\n\r\n\ttransformation: (function () {\r\n\t\tvar scale = 0.5 / (Math.PI * SphericalMercator.R);\r\n\t\treturn toTransformation(scale, 0.5, -scale, 0.5);\r\n\t}())\r\n});\r\n\r\nexport var EPSG900913 = Util.extend({}, EPSG3857, {\r\n\tcode: 'EPSG:900913'\r\n});\r\n", "import Browser from '../../core/Browser';\n\n// @namespace SVG; @section\n// There are several static functions which can be called without instantiating L.SVG:\n\n// @function create(name: String): SVGElement\n// Returns a instance of [SVGElement](https://developer.mozilla.org/docs/Web/API/SVGElement),\n// corresponding to the class name passed. For example, using 'line' will return\n// an instance of [SVGLineElement](https://developer.mozilla.org/docs/Web/API/SVGLineElement).\nexport function svgCreate(name) {\n\treturn document.createElementNS('http://www.w3.org/2000/svg', name);\n}\n\n// @function pointsToPath(rings: Point[], closed: Boolean): String\n// Generates a SVG path string for multiple rings, with each ring turning\n// into \"M..L..L..\" instructions\nexport function pointsToPath(rings, closed) {\n\tvar str = '',\n\ti, j, len, len2, points, p;\n\n\tfor (i = 0, len = rings.length; i < len; i++) {\n\t\tpoints = rings[i];\n\n\t\tfor (j = 0, len2 = points.length; j < len2; j++) {\n\t\t\tp = points[j];\n\t\t\tstr += (j ? 'L' : 'M') + p.x + ' ' + p.y;\n\t\t}\n\n\t\t// closes the ring for polygons; \"x\" is VML syntax\n\t\tstr += closed ? (Browser.svg ? 'z' : 'x') : '';\n\t}\n\n\t// SVG complains about empty path strings\n\treturn str || 'M0 0';\n}\n\n\n\n\n", "import * as Util from './Util';\r\nimport {svgCreate} from '../layer/vector/SVG.Util';\r\n\r\n/*\r\n * @namespace Browser\r\n * @aka L.Browser\r\n *\r\n * A namespace with static properties for browser/feature detection used by Leaflet internally.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * if (L.Browser.ielt9) {\r\n * alert('Upgrade your browser, dude!');\r\n * }\r\n * ```\r\n */\r\n\r\nvar style = document.documentElement.style;\r\n\r\n// @property ie: Boolean; `true` for all Internet Explorer versions (not Edge).\r\nvar ie = 'ActiveXObject' in window;\r\n\r\n// @property ielt9: Boolean; `true` for Internet Explorer versions less than 9.\r\nvar ielt9 = ie && !document.addEventListener;\r\n\r\n// @property edge: Boolean; `true` for the Edge web browser.\r\nvar edge = 'msLaunchUri' in navigator && !('documentMode' in document);\r\n\r\n// @property webkit: Boolean;\r\n// `true` for webkit-based browsers like Chrome and Safari (including mobile versions).\r\nvar webkit = userAgentContains('webkit');\r\n\r\n// @property android: Boolean\r\n// **Deprecated.** `true` for any browser running on an Android platform.\r\nvar android = userAgentContains('android');\r\n\r\n// @property android23: Boolean; **Deprecated.** `true` for browsers running on Android 2 or Android 3.\r\nvar android23 = userAgentContains('android 2') || userAgentContains('android 3');\r\n\r\n/* See https://stackoverflow.com/a/17961266 for details on detecting stock Android */\r\nvar webkitVer = parseInt(/WebKit\\/([0-9]+)|$/.exec(navigator.userAgent)[1], 10); // also matches AppleWebKit\r\n// @property androidStock: Boolean; **Deprecated.** `true` for the Android stock browser (i.e. not Chrome)\r\nvar androidStock = android && userAgentContains('Google') && webkitVer < 537 && !('AudioNode' in window);\r\n\r\n// @property opera: Boolean; `true` for the Opera browser\r\nvar opera = !!window.opera;\r\n\r\n// @property chrome: Boolean; `true` for the Chrome browser.\r\nvar chrome = !edge && userAgentContains('chrome');\r\n\r\n// @property gecko: Boolean; `true` for gecko-based browsers like Firefox.\r\nvar gecko = userAgentContains('gecko') && !webkit && !opera && !ie;\r\n\r\n// @property safari: Boolean; `true` for the Safari browser.\r\nvar safari = !chrome && userAgentContains('safari');\r\n\r\nvar phantom = userAgentContains('phantom');\r\n\r\n// @property opera12: Boolean\r\n// `true` for the Opera browser supporting CSS transforms (version 12 or later).\r\nvar opera12 = 'OTransition' in style;\r\n\r\n// @property win: Boolean; `true` when the browser is running in a Windows platform\r\nvar win = navigator.platform.indexOf('Win') === 0;\r\n\r\n// @property ie3d: Boolean; `true` for all Internet Explorer versions supporting CSS transforms.\r\nvar ie3d = ie && ('transition' in style);\r\n\r\n// @property webkit3d: Boolean; `true` for webkit-based browsers supporting CSS transforms.\r\nvar webkit3d = ('WebKitCSSMatrix' in window) && ('m11' in new window.WebKitCSSMatrix()) && !android23;\r\n\r\n// @property gecko3d: Boolean; `true` for gecko-based browsers supporting CSS transforms.\r\nvar gecko3d = 'MozPerspective' in style;\r\n\r\n// @property any3d: Boolean\r\n// `true` for all browsers supporting CSS transforms.\r\nvar any3d = !window.L_DISABLE_3D && (ie3d || webkit3d || gecko3d) && !opera12 && !phantom;\r\n\r\n// @property mobile: Boolean; `true` for all browsers running in a mobile device.\r\nvar mobile = typeof orientation !== 'undefined' || userAgentContains('mobile');\r\n\r\n// @property mobileWebkit: Boolean; `true` for all webkit-based browsers in a mobile device.\r\nvar mobileWebkit = mobile && webkit;\r\n\r\n// @property mobileWebkit3d: Boolean\r\n// `true` for all webkit-based browsers in a mobile device supporting CSS transforms.\r\nvar mobileWebkit3d = mobile && webkit3d;\r\n\r\n// @property msPointer: Boolean\r\n// `true` for browsers implementing the Microsoft touch events model (notably IE10).\r\nvar msPointer = !window.PointerEvent && window.MSPointerEvent;\r\n\r\n// @property pointer: Boolean\r\n// `true` for all browsers supporting [pointer events](https://msdn.microsoft.com/en-us/library/dn433244%28v=vs.85%29.aspx).\r\nvar pointer = !!(window.PointerEvent || msPointer);\r\n\r\n// @property touchNative: Boolean\r\n// `true` for all browsers supporting [touch events](https://developer.mozilla.org/docs/Web/API/Touch_events).\r\n// **This does not necessarily mean** that the browser is running in a computer with\r\n// a touchscreen, it only means that the browser is capable of understanding\r\n// touch events.\r\nvar touchNative = 'ontouchstart' in window || !!window.TouchEvent;\r\n\r\n// @property touch: Boolean\r\n// `true` for all browsers supporting either [touch](#browser-touch) or [pointer](#browser-pointer) events.\r\n// Note: pointer events will be preferred (if available), and processed for all `touch*` listeners.\r\nvar touch = !window.L_NO_TOUCH && (touchNative || pointer);\r\n\r\n// @property mobileOpera: Boolean; `true` for the Opera browser in a mobile device.\r\nvar mobileOpera = mobile && opera;\r\n\r\n// @property mobileGecko: Boolean\r\n// `true` for gecko-based browsers running in a mobile device.\r\nvar mobileGecko = mobile && gecko;\r\n\r\n// @property retina: Boolean\r\n// `true` for browsers on a high-resolution \"retina\" screen or on any screen when browser's display zoom is more than 100%.\r\nvar retina = (window.devicePixelRatio || (window.screen.deviceXDPI / window.screen.logicalXDPI)) > 1;\r\n\r\n// @property passiveEvents: Boolean\r\n// `true` for browsers that support passive events.\r\nvar passiveEvents = (function () {\r\n\tvar supportsPassiveOption = false;\r\n\ttry {\r\n\t\tvar opts = Object.defineProperty({}, 'passive', {\r\n\t\t\tget: function () { // eslint-disable-line getter-return\r\n\t\t\t\tsupportsPassiveOption = true;\r\n\t\t\t}\r\n\t\t});\r\n\t\twindow.addEventListener('testPassiveEventSupport', Util.falseFn, opts);\r\n\t\twindow.removeEventListener('testPassiveEventSupport', Util.falseFn, opts);\r\n\t} catch (e) {\r\n\t\t// Errors can safely be ignored since this is only a browser support test.\r\n\t}\r\n\treturn supportsPassiveOption;\r\n}());\r\n\r\n// @property canvas: Boolean\r\n// `true` when the browser supports [`<canvas>`](https://developer.mozilla.org/docs/Web/API/Canvas_API).\r\nvar canvas = (function () {\r\n\treturn !!document.createElement('canvas').getContext;\r\n}());\r\n\r\n// @property svg: Boolean\r\n// `true` when the browser supports [SVG](https://developer.mozilla.org/docs/Web/SVG).\r\nvar svg = !!(document.createElementNS && svgCreate('svg').createSVGRect);\r\n\r\nvar inlineSvg = !!svg && (function () {\r\n\tvar div = document.createElement('div');\r\n\tdiv.innerHTML = '<svg/>';\r\n\treturn (div.firstChild && div.firstChild.namespaceURI) === 'http://www.w3.org/2000/svg';\r\n})();\r\n\r\n// @property vml: Boolean\r\n// `true` if the browser supports [VML](https://en.wikipedia.org/wiki/Vector_Markup_Language).\r\nvar vml = !svg && (function () {\r\n\ttry {\r\n\t\tvar div = document.createElement('div');\r\n\t\tdiv.innerHTML = '<v:shape adj=\"1\"/>';\r\n\r\n\t\tvar shape = div.firstChild;\r\n\t\tshape.style.behavior = 'url(#default#VML)';\r\n\r\n\t\treturn shape && (typeof shape.adj === 'object');\r\n\r\n\t} catch (e) {\r\n\t\treturn false;\r\n\t}\r\n}());\r\n\r\n\r\n// @property mac: Boolean; `true` when the browser is running in a Mac platform\r\nvar mac = navigator.platform.indexOf('Mac') === 0;\r\n\r\n// @property mac: Boolean; `true` when the browser is running in a Linux platform\r\nvar linux = navigator.platform.indexOf('Linux') === 0;\r\n\r\nfunction userAgentContains(str) {\r\n\treturn navigator.userAgent.toLowerCase().indexOf(str) >= 0;\r\n}\r\n\r\n\r\nexport default {\r\n\tie: ie,\r\n\tielt9: ielt9,\r\n\tedge: edge,\r\n\twebkit: webkit,\r\n\tandroid: android,\r\n\tandroid23: android23,\r\n\tandroidStock: androidStock,\r\n\topera: opera,\r\n\tchrome: chrome,\r\n\tgecko: gecko,\r\n\tsafari: safari,\r\n\tphantom: phantom,\r\n\topera12: opera12,\r\n\twin: win,\r\n\tie3d: ie3d,\r\n\twebkit3d: webkit3d,\r\n\tgecko3d: gecko3d,\r\n\tany3d: any3d,\r\n\tmobile: mobile,\r\n\tmobileWebkit: mobileWebkit,\r\n\tmobileWebkit3d: mobileWebkit3d,\r\n\tmsPointer: msPointer,\r\n\tpointer: pointer,\r\n\ttouch: touch,\r\n\ttouchNative: touchNative,\r\n\tmobileOpera: mobileOpera,\r\n\tmobileGecko: mobileGecko,\r\n\tretina: retina,\r\n\tpassiveEvents: passiveEvents,\r\n\tcanvas: canvas,\r\n\tsvg: svg,\r\n\tvml: vml,\r\n\tinlineSvg: inlineSvg,\r\n\tmac: mac,\r\n\tlinux: linux\r\n};\r\n", "import * as DomEvent from './DomEvent';\nimport Browser from '../core/Browser';\nimport {falseFn} from '../core/Util';\n\n/*\n * Extends L.DomEvent to provide touch support for Internet Explorer and Windows-based devices.\n */\n\nvar POINTER_DOWN = Browser.msPointer ? 'MSPointerDown' : 'pointerdown';\nvar POINTER_MOVE = Browser.msPointer ? 'MSPointerMove' : 'pointermove';\nvar POINTER_UP = Browser.msPointer ? 'MSPointerUp' : 'pointerup';\nvar POINTER_CANCEL = Browser.msPointer ? 'MSPointerCancel' : 'pointercancel';\nvar pEvent = {\n\ttouchstart : POINTER_DOWN,\n\ttouchmove : POINTER_MOVE,\n\ttouchend : POINTER_UP,\n\ttouchcancel : POINTER_CANCEL\n};\nvar handle = {\n\ttouchstart : _onPointerStart,\n\ttouchmove : _handlePointer,\n\ttouchend : _handlePointer,\n\ttouchcancel : _handlePointer\n};\nvar _pointers = {};\nvar _pointerDocListener = false;\n\n// Provides a touch events wrapper for (ms)pointer events.\n// ref https://www.w3.org/TR/pointerevents/ https://www.w3.org/Bugs/Public/show_bug.cgi?id=22890\n\nexport function addPointerListener(obj, type, handler) {\n\tif (type === 'touchstart') {\n\t\t_addPointerDocListener();\n\t}\n\tif (!handle[type]) {\n\t\tconsole.warn('wrong event specified:', type);\n\t\treturn falseFn;\n\t}\n\thandler = handle[type].bind(this, handler);\n\tobj.addEventListener(pEvent[type], handler, false);\n\treturn handler;\n}\n\nexport function removePointerListener(obj, type, handler) {\n\tif (!pEvent[type]) {\n\t\tconsole.warn('wrong event specified:', type);\n\t\treturn;\n\t}\n\tobj.removeEventListener(pEvent[type], handler, false);\n}\n\nfunction _globalPointerDown(e) {\n\t_pointers[e.pointerId] = e;\n}\n\nfunction _globalPointerMove(e) {\n\tif (_pointers[e.pointerId]) {\n\t\t_pointers[e.pointerId] = e;\n\t}\n}\n\nfunction _globalPointerUp(e) {\n\tdelete _pointers[e.pointerId];\n}\n\nfunction _addPointerDocListener() {\n\t// need to keep track of what pointers and how many are active to provide e.touches emulation\n\tif (!_pointerDocListener) {\n\t\t// we listen document as any drags that end by moving the touch off the screen get fired there\n\t\tdocument.addEventListener(POINTER_DOWN, _globalPointerDown, true);\n\t\tdocument.addEventListener(POINTER_MOVE, _globalPointerMove, true);\n\t\tdocument.addEventListener(POINTER_UP, _globalPointerUp, true);\n\t\tdocument.addEventListener(POINTER_CANCEL, _globalPointerUp, true);\n\n\t\t_pointerDocListener = true;\n\t}\n}\n\nfunction _handlePointer(handler, e) {\n\tif (e.pointerType === (e.MSPOINTER_TYPE_MOUSE || 'mouse')) { return; }\n\n\te.touches = [];\n\tfor (var i in _pointers) {\n\t\te.touches.push(_pointers[i]);\n\t}\n\te.changedTouches = [e];\n\n\thandler(e);\n}\n\nfunction _onPointerStart(handler, e) {\n\t// IE10 specific: MsTouch needs preventDefault. See #2000\n\tif (e.MSPOINTER_TYPE_TOUCH && e.pointerType === e.MSPOINTER_TYPE_TOUCH) {\n\t\tDomEvent.preventDefault(e);\n\t}\n\t_handlePointer(handler, e);\n}\n", "import * as DomEvent from './DomEvent';\r\n\r\n/*\r\n * Extends the event handling code with double tap support for mobile browsers.\r\n *\r\n * Note: currently most browsers fire native dblclick, with only a few exceptions\r\n * (see https://github.com/Leaflet/Leaflet/issues/7012#issuecomment-595087386)\r\n */\r\n\r\nfunction makeDblclick(event) {\r\n\t// in modern browsers `type` cannot be just overridden:\r\n\t// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Errors/Getter_only\r\n\tvar newEvent = {},\r\n\t prop, i;\r\n\tfor (i in event) {\r\n\t\tprop = event[i];\r\n\t\tnewEvent[i] = prop && prop.bind ? prop.bind(event) : prop;\r\n\t}\r\n\tevent = newEvent;\r\n\tnewEvent.type = 'dblclick';\r\n\tnewEvent.detail = 2;\r\n\tnewEvent.isTrusted = false;\r\n\tnewEvent._simulated = true; // for debug purposes\r\n\treturn newEvent;\r\n}\r\n\r\nvar delay = 200;\r\nexport function addDoubleTapListener(obj, handler) {\r\n\t// Most browsers handle double tap natively\r\n\tobj.addEventListener('dblclick', handler);\r\n\r\n\t// On some platforms the browser doesn't fire native dblclicks for touch events.\r\n\t// It seems that in all such cases `detail` property of `click` event is always `1`.\r\n\t// So here we rely on that fact to avoid excessive 'dblclick' simulation when not needed.\r\n\tvar last = 0,\r\n\t detail;\r\n\tfunction simDblclick(e) {\r\n\t\tif (e.detail !== 1) {\r\n\t\t\tdetail = e.detail; // keep in sync to avoid false dblclick in some cases\r\n\t\t\treturn;\r\n\t\t}\r\n\r\n\t\tif (e.pointerType === 'mouse' ||\r\n\t\t\t(e.sourceCapabilities && !e.sourceCapabilities.firesTouchEvents)) {\r\n\r\n\t\t\treturn;\r\n\t\t}\r\n\r\n\t\t// When clicking on an <input>, the browser generates a click on its\r\n\t\t// <label> (and vice versa) triggering two clicks in quick succession.\r\n\t\t// This ignores clicks on elements which are a label with a 'for'\r\n\t\t// attribute (or children of such a label), but not children of\r\n\t\t// a <input>.\r\n\t\tvar path = DomEvent.getPropagationPath(e);\r\n\t\tif (path.some(function (el) {\r\n\t\t\treturn el instanceof HTMLLabelElement && el.attributes.for;\r\n\t\t}) &&\r\n\t\t\t!path.some(function (el) {\r\n\t\t\t\treturn (\r\n\t\t\t\t\tel instanceof HTMLInputElement ||\r\n\t\t\t\t\tel instanceof HTMLSelectElement\r\n\t\t\t\t);\r\n\t\t\t})\r\n\t\t) {\r\n\t\t\treturn;\r\n\t\t}\r\n\r\n\t\tvar now = Date.now();\r\n\t\tif (now - last <= delay) {\r\n\t\t\tdetail++;\r\n\t\t\tif (detail === 2) {\r\n\t\t\t\thandler(makeDblclick(e));\r\n\t\t\t}\r\n\t\t} else {\r\n\t\t\tdetail = 1;\r\n\t\t}\r\n\t\tlast = now;\r\n\t}\r\n\r\n\tobj.addEventListener('click', simDblclick);\r\n\r\n\treturn {\r\n\t\tdblclick: handler,\r\n\t\tsimDblclick: simDblclick\r\n\t};\r\n}\r\n\r\nexport function removeDoubleTapListener(obj, handlers) {\r\n\tobj.removeEventListener('dblclick', handlers.dblclick);\r\n\tobj.removeEventListener('click', handlers.simDblclick);\r\n}\r\n", "import * as DomEvent from './DomEvent';\r\nimport * as Util from '../core/Util';\r\nimport {Point} from '../geometry/Point';\r\nimport Browser from '../core/Browser';\r\n\r\n/*\r\n * @namespace DomUtil\r\n *\r\n * Utility functions to work with the [DOM](https://developer.mozilla.org/docs/Web/API/Document_Object_Model)\r\n * tree, used by Leaflet internally.\r\n *\r\n * Most functions expecting or returning a `HTMLElement` also work for\r\n * SVG elements. The only difference is that classes refer to CSS classes\r\n * in HTML and SVG classes in SVG.\r\n */\r\n\r\n\r\n// @property TRANSFORM: String\r\n// Vendor-prefixed transform style name (e.g. `'webkitTransform'` for WebKit).\r\nexport var TRANSFORM = testProp(\r\n\t['transform', 'webkitTransform', 'OTransform', 'MozTransform', 'msTransform']);\r\n\r\n// webkitTransition comes first because some browser versions that drop vendor prefix don't do\r\n// the same for the transitionend event, in particular the Android 4.1 stock browser\r\n\r\n// @property TRANSITION: String\r\n// Vendor-prefixed transition style name.\r\nexport var TRANSITION = testProp(\r\n\t['webkitTransition', 'transition', 'OTransition', 'MozTransition', 'msTransition']);\r\n\r\n// @property TRANSITION_END: String\r\n// Vendor-prefixed transitionend event name.\r\nexport var TRANSITION_END =\r\n\tTRANSITION === 'webkitTransition' || TRANSITION === 'OTransition' ? TRANSITION + 'End' : 'transitionend';\r\n\r\n\r\n// @function get(id: String|HTMLElement): HTMLElement\r\n// Returns an element given its DOM id, or returns the element itself\r\n// if it was passed directly.\r\nexport function get(id) {\r\n\treturn typeof id === 'string' ? document.getElementById(id) : id;\r\n}\r\n\r\n// @function getStyle(el: HTMLElement, styleAttrib: String): String\r\n// Returns the value for a certain style attribute on an element,\r\n// including computed values or values set through CSS.\r\nexport function getStyle(el, style) {\r\n\tvar value = el.style[style] || (el.currentStyle && el.currentStyle[style]);\r\n\r\n\tif ((!value || value === 'auto') && document.defaultView) {\r\n\t\tvar css = document.defaultView.getComputedStyle(el, null);\r\n\t\tvalue = css ? css[style] : null;\r\n\t}\r\n\treturn value === 'auto' ? null : value;\r\n}\r\n\r\n// @function create(tagName: String, className?: String, container?: HTMLElement): HTMLElement\r\n// Creates an HTML element with `tagName`, sets its class to `className`, and optionally appends it to `container` element.\r\nexport function create(tagName, className, container) {\r\n\tvar el = document.createElement(tagName);\r\n\tel.className = className || '';\r\n\r\n\tif (container) {\r\n\t\tcontainer.appendChild(el);\r\n\t}\r\n\treturn el;\r\n}\r\n\r\n// @function remove(el: HTMLElement)\r\n// Removes `el` from its parent element\r\nexport function remove(el) {\r\n\tvar parent = el.parentNode;\r\n\tif (parent) {\r\n\t\tparent.removeChild(el);\r\n\t}\r\n}\r\n\r\n// @function empty(el: HTMLElement)\r\n// Removes all of `el`'s children elements from `el`\r\nexport function empty(el) {\r\n\twhile (el.firstChild) {\r\n\t\tel.removeChild(el.firstChild);\r\n\t}\r\n}\r\n\r\n// @function toFront(el: HTMLElement)\r\n// Makes `el` the last child of its parent, so it renders in front of the other children.\r\nexport function toFront(el) {\r\n\tvar parent = el.parentNode;\r\n\tif (parent && parent.lastChild !== el) {\r\n\t\tparent.appendChild(el);\r\n\t}\r\n}\r\n\r\n// @function toBack(el: HTMLElement)\r\n// Makes `el` the first child of its parent, so it renders behind the other children.\r\nexport function toBack(el) {\r\n\tvar parent = el.parentNode;\r\n\tif (parent && parent.firstChild !== el) {\r\n\t\tparent.insertBefore(el, parent.firstChild);\r\n\t}\r\n}\r\n\r\n// @function hasClass(el: HTMLElement, name: String): Boolean\r\n// Returns `true` if the element's class attribute contains `name`.\r\nexport function hasClass(el, name) {\r\n\tif (el.classList !== undefined) {\r\n\t\treturn el.classList.contains(name);\r\n\t}\r\n\tvar className = getClass(el);\r\n\treturn className.length > 0 && new RegExp('(^|\\\\s)' + name + '(\\\\s|$)').test(className);\r\n}\r\n\r\n// @function addClass(el: HTMLElement, name: String)\r\n// Adds `name` to the element's class attribute.\r\nexport function addClass(el, name) {\r\n\tif (el.classList !== undefined) {\r\n\t\tvar classes = Util.splitWords(name);\r\n\t\tfor (var i = 0, len = classes.length; i < len; i++) {\r\n\t\t\tel.classList.add(classes[i]);\r\n\t\t}\r\n\t} else if (!hasClass(el, name)) {\r\n\t\tvar className = getClass(el);\r\n\t\tsetClass(el, (className ? className + ' ' : '') + name);\r\n\t}\r\n}\r\n\r\n// @function removeClass(el: HTMLElement, name: String)\r\n// Removes `name` from the element's class attribute.\r\nexport function removeClass(el, name) {\r\n\tif (el.classList !== undefined) {\r\n\t\tel.classList.remove(name);\r\n\t} else {\r\n\t\tsetClass(el, Util.trim((' ' + getClass(el) + ' ').replace(' ' + name + ' ', ' ')));\r\n\t}\r\n}\r\n\r\n// @function setClass(el: HTMLElement, name: String)\r\n// Sets the element's class.\r\nexport function setClass(el, name) {\r\n\tif (el.className.baseVal === undefined) {\r\n\t\tel.className = name;\r\n\t} else {\r\n\t\t// in case of SVG element\r\n\t\tel.className.baseVal = name;\r\n\t}\r\n}\r\n\r\n// @function getClass(el: HTMLElement): String\r\n// Returns the element's class.\r\nexport function getClass(el) {\r\n\t// Check if the element is an SVGElementInstance and use the correspondingElement instead\r\n\t// (Required for linked SVG elements in IE11.)\r\n\tif (el.correspondingElement) {\r\n\t\tel = el.correspondingElement;\r\n\t}\r\n\treturn el.className.baseVal === undefined ? el.className : el.className.baseVal;\r\n}\r\n\r\n// @function setOpacity(el: HTMLElement, opacity: Number)\r\n// Set the opacity of an element (including old IE support).\r\n// `opacity` must be a number from `0` to `1`.\r\nexport function setOpacity(el, value) {\r\n\tif ('opacity' in el.style) {\r\n\t\tel.style.opacity = value;\r\n\t} else if ('filter' in el.style) {\r\n\t\t_setOpacityIE(el, value);\r\n\t}\r\n}\r\n\r\nfunction _setOpacityIE(el, value) {\r\n\tvar filter = false,\r\n\t filterName = 'DXImageTransform.Microsoft.Alpha';\r\n\r\n\t// filters collection throws an error if we try to retrieve a filter that doesn't exist\r\n\ttry {\r\n\t\tfilter = el.filters.item(filterName);\r\n\t} catch (e) {\r\n\t\t// don't set opacity to 1 if we haven't already set an opacity,\r\n\t\t// it isn't needed and breaks transparent pngs.\r\n\t\tif (value === 1) { return; }\r\n\t}\r\n\r\n\tvalue = Math.round(value * 100);\r\n\r\n\tif (filter) {\r\n\t\tfilter.Enabled = (value !== 100);\r\n\t\tfilter.Opacity = value;\r\n\t} else {\r\n\t\tel.style.filter += ' progid:' + filterName + '(opacity=' + value + ')';\r\n\t}\r\n}\r\n\r\n// @function testProp(props: String[]): String|false\r\n// Goes through the array of style names and returns the first name\r\n// that is a valid style name for an element. If no such name is found,\r\n// it returns false. Useful for vendor-prefixed styles like `transform`.\r\nexport function testProp(props) {\r\n\tvar style = document.documentElement.style;\r\n\r\n\tfor (var i = 0; i < props.length; i++) {\r\n\t\tif (props[i] in style) {\r\n\t\t\treturn props[i];\r\n\t\t}\r\n\t}\r\n\treturn false;\r\n}\r\n\r\n// @function setTransform(el: HTMLElement, offset: Point, scale?: Number)\r\n// Resets the 3D CSS transform of `el` so it is translated by `offset` pixels\r\n// and optionally scaled by `scale`. Does not have an effect if the\r\n// browser doesn't support 3D CSS transforms.\r\nexport function setTransform(el, offset, scale) {\r\n\tvar pos = offset || new Point(0, 0);\r\n\r\n\tel.style[TRANSFORM] =\r\n\t\t(Browser.ie3d ?\r\n\t\t\t'translate(' + pos.x + 'px,' + pos.y + 'px)' :\r\n\t\t\t'translate3d(' + pos.x + 'px,' + pos.y + 'px,0)') +\r\n\t\t(scale ? ' scale(' + scale + ')' : '');\r\n}\r\n\r\n// @function setPosition(el: HTMLElement, position: Point)\r\n// Sets the position of `el` to coordinates specified by `position`,\r\n// using CSS translate or top/left positioning depending on the browser\r\n// (used by Leaflet internally to position its layers).\r\nexport function setPosition(el, point) {\r\n\r\n\t/*eslint-disable */\r\n\tel._leaflet_pos = point;\r\n\t/* eslint-enable */\r\n\r\n\tif (Browser.any3d) {\r\n\t\tsetTransform(el, point);\r\n\t} else {\r\n\t\tel.style.left = point.x + 'px';\r\n\t\tel.style.top = point.y + 'px';\r\n\t}\r\n}\r\n\r\n// @function getPosition(el: HTMLElement): Point\r\n// Returns the coordinates of an element previously positioned with setPosition.\r\nexport function getPosition(el) {\r\n\t// this method is only used for elements previously positioned using setPosition,\r\n\t// so it's safe to cache the position for performance\r\n\r\n\treturn el._leaflet_pos || new Point(0, 0);\r\n}\r\n\r\n// @function disableTextSelection()\r\n// Prevents the user from generating `selectstart` DOM events, usually generated\r\n// when the user drags the mouse through a page with text. Used internally\r\n// by Leaflet to override the behaviour of any click-and-drag interaction on\r\n// the map. Affects drag interactions on the whole document.\r\n\r\n// @function enableTextSelection()\r\n// Cancels the effects of a previous [`L.DomUtil.disableTextSelection`](#domutil-disabletextselection).\r\nexport var disableTextSelection;\r\nexport var enableTextSelection;\r\nvar _userSelect;\r\nif ('onselectstart' in document) {\r\n\tdisableTextSelection = function () {\r\n\t\tDomEvent.on(window, 'selectstart', DomEvent.preventDefault);\r\n\t};\r\n\tenableTextSelection = function () {\r\n\t\tDomEvent.off(window, 'selectstart', DomEvent.preventDefault);\r\n\t};\r\n} else {\r\n\tvar userSelectProperty = testProp(\r\n\t\t['userSelect', 'WebkitUserSelect', 'OUserSelect', 'MozUserSelect', 'msUserSelect']);\r\n\r\n\tdisableTextSelection = function () {\r\n\t\tif (userSelectProperty) {\r\n\t\t\tvar style = document.documentElement.style;\r\n\t\t\t_userSelect = style[userSelectProperty];\r\n\t\t\tstyle[userSelectProperty] = 'none';\r\n\t\t}\r\n\t};\r\n\tenableTextSelection = function () {\r\n\t\tif (userSelectProperty) {\r\n\t\t\tdocument.documentElement.style[userSelectProperty] = _userSelect;\r\n\t\t\t_userSelect = undefined;\r\n\t\t}\r\n\t};\r\n}\r\n\r\n// @function disableImageDrag()\r\n// As [`L.DomUtil.disableTextSelection`](#domutil-disabletextselection), but\r\n// for `dragstart` DOM events, usually generated when the user drags an image.\r\nexport function disableImageDrag() {\r\n\tDomEvent.on(window, 'dragstart', DomEvent.preventDefault);\r\n}\r\n\r\n// @function enableImageDrag()\r\n// Cancels the effects of a previous [`L.DomUtil.disableImageDrag`](#domutil-disabletextselection).\r\nexport function enableImageDrag() {\r\n\tDomEvent.off(window, 'dragstart', DomEvent.preventDefault);\r\n}\r\n\r\nvar _outlineElement, _outlineStyle;\r\n// @function preventOutline(el: HTMLElement)\r\n// Makes the [outline](https://developer.mozilla.org/docs/Web/CSS/outline)\r\n// of the element `el` invisible. Used internally by Leaflet to prevent\r\n// focusable elements from displaying an outline when the user performs a\r\n// drag interaction on them.\r\nexport function preventOutline(element) {\r\n\twhile (element.tabIndex === -1) {\r\n\t\telement = element.parentNode;\r\n\t}\r\n\tif (!element.style) { return; }\r\n\trestoreOutline();\r\n\t_outlineElement = element;\r\n\t_outlineStyle = element.style.outlineStyle;\r\n\telement.style.outlineStyle = 'none';\r\n\tDomEvent.on(window, 'keydown', restoreOutline);\r\n}\r\n\r\n// @function restoreOutline()\r\n// Cancels the effects of a previous [`L.DomUtil.preventOutline`]().\r\nexport function restoreOutline() {\r\n\tif (!_outlineElement) { return; }\r\n\t_outlineElement.style.outlineStyle = _outlineStyle;\r\n\t_outlineElement = undefined;\r\n\t_outlineStyle = undefined;\r\n\tDomEvent.off(window, 'keydown', restoreOutline);\r\n}\r\n\r\n// @function getSizedParentNode(el: HTMLElement): HTMLElement\r\n// Finds the closest parent node which size (width and height) is not null.\r\nexport function getSizedParentNode(element) {\r\n\tdo {\r\n\t\telement = element.parentNode;\r\n\t} while ((!element.offsetWidth || !element.offsetHeight) && element !== document.body);\r\n\treturn element;\r\n}\r\n\r\n// @function getScale(el: HTMLElement): Object\r\n// Computes the CSS scale currently applied on the element.\r\n// Returns an object with `x` and `y` members as horizontal and vertical scales respectively,\r\n// and `boundingClientRect` as the result of [`getBoundingClientRect()`](https://developer.mozilla.org/en-US/docs/Web/API/Element/getBoundingClientRect).\r\nexport function getScale(element) {\r\n\tvar rect = element.getBoundingClientRect(); // Read-only in old browsers.\r\n\r\n\treturn {\r\n\t\tx: rect.width / element.offsetWidth || 1,\r\n\t\ty: rect.height / element.offsetHeight || 1,\r\n\t\tboundingClientRect: rect\r\n\t};\r\n}\r\n", "import {Point} from '../geometry/Point';\r\nimport * as Util from '../core/Util';\r\nimport Browser from '../core/Browser';\r\nimport {addPointerListener, removePointerListener} from './DomEvent.Pointer';\r\nimport {addDoubleTapListener, removeDoubleTapListener} from './DomEvent.DoubleTap';\r\nimport {getScale} from './DomUtil';\r\n\r\n/*\r\n * @namespace DomEvent\r\n * Utility functions to work with the [DOM events](https://developer.mozilla.org/docs/Web/API/Event), used by Leaflet internally.\r\n */\r\n\r\n// Inspired by John Resig, Dean Edwards and YUI addEvent implementations.\r\n\r\n// @function on(el: HTMLElement, types: String, fn: Function, context?: Object): this\r\n// Adds a listener function (`fn`) to a particular DOM event type of the\r\n// element `el`. You can optionally specify the context of the listener\r\n// (object the `this` keyword will point to). You can also pass several\r\n// space-separated types (e.g. `'click dblclick'`).\r\n\r\n// @alternative\r\n// @function on(el: HTMLElement, eventMap: Object, context?: Object): this\r\n// Adds a set of type/listener pairs, e.g. `{click: onClick, mousemove: onMouseMove}`\r\nexport function on(obj, types, fn, context) {\r\n\r\n\tif (types && typeof types === 'object') {\r\n\t\tfor (var type in types) {\r\n\t\t\taddOne(obj, type, types[type], fn);\r\n\t\t}\r\n\t} else {\r\n\t\ttypes = Util.splitWords(types);\r\n\r\n\t\tfor (var i = 0, len = types.length; i < len; i++) {\r\n\t\t\taddOne(obj, types[i], fn, context);\r\n\t\t}\r\n\t}\r\n\r\n\treturn this;\r\n}\r\n\r\nvar eventsKey = '_leaflet_events';\r\n\r\n// @function off(el: HTMLElement, types: String, fn: Function, context?: Object): this\r\n// Removes a previously added listener function.\r\n// Note that if you passed a custom context to on, you must pass the same\r\n// context to `off` in order to remove the listener.\r\n\r\n// @alternative\r\n// @function off(el: HTMLElement, eventMap: Object, context?: Object): this\r\n// Removes a set of type/listener pairs, e.g. `{click: onClick, mousemove: onMouseMove}`\r\n\r\n// @alternative\r\n// @function off(el: HTMLElement, types: String): this\r\n// Removes all previously added listeners of given types.\r\n\r\n// @alternative\r\n// @function off(el: HTMLElement): this\r\n// Removes all previously added listeners from given HTMLElement\r\nexport function off(obj, types, fn, context) {\r\n\r\n\tif (arguments.length === 1) {\r\n\t\tbatchRemove(obj);\r\n\t\tdelete obj[eventsKey];\r\n\r\n\t} else if (types && typeof types === 'object') {\r\n\t\tfor (var type in types) {\r\n\t\t\tremoveOne(obj, type, types[type], fn);\r\n\t\t}\r\n\r\n\t} else {\r\n\t\ttypes = Util.splitWords(types);\r\n\r\n\t\tif (arguments.length === 2) {\r\n\t\t\tbatchRemove(obj, function (type) {\r\n\t\t\t\treturn Util.indexOf(types, type) !== -1;\r\n\t\t\t});\r\n\t\t} else {\r\n\t\t\tfor (var i = 0, len = types.length; i < len; i++) {\r\n\t\t\t\tremoveOne(obj, types[i], fn, context);\r\n\t\t\t}\r\n\t\t}\r\n\t}\r\n\r\n\treturn this;\r\n}\r\n\r\nfunction batchRemove(obj, filterFn) {\r\n\tfor (var id in obj[eventsKey]) {\r\n\t\tvar type = id.split(/\\d/)[0];\r\n\t\tif (!filterFn || filterFn(type)) {\r\n\t\t\tremoveOne(obj, type, null, null, id);\r\n\t\t}\r\n\t}\r\n}\r\n\r\nvar mouseSubst = {\r\n\tmouseenter: 'mouseover',\r\n\tmouseleave: 'mouseout',\r\n\twheel: !('onwheel' in window) && 'mousewheel'\r\n};\r\n\r\nfunction addOne(obj, type, fn, context) {\r\n\tvar id = type + Util.stamp(fn) + (context ? '_' + Util.stamp(context) : '');\r\n\r\n\tif (obj[eventsKey] && obj[eventsKey][id]) { return this; }\r\n\r\n\tvar handler = function (e) {\r\n\t\treturn fn.call(context || obj, e || window.event);\r\n\t};\r\n\r\n\tvar originalHandler = handler;\r\n\r\n\tif (!Browser.touchNative && Browser.pointer && type.indexOf('touch') === 0) {\r\n\t\t// Needs DomEvent.Pointer.js\r\n\t\thandler = addPointerListener(obj, type, handler);\r\n\r\n\t} else if (Browser.touch && (type === 'dblclick')) {\r\n\t\thandler = addDoubleTapListener(obj, handler);\r\n\r\n\t} else if ('addEventListener' in obj) {\r\n\r\n\t\tif (type === 'touchstart' || type === 'touchmove' || type === 'wheel' || type === 'mousewheel') {\r\n\t\t\tobj.addEventListener(mouseSubst[type] || type, handler, Browser.passiveEvents ? {passive: false} : false);\r\n\r\n\t\t} else if (type === 'mouseenter' || type === 'mouseleave') {\r\n\t\t\thandler = function (e) {\r\n\t\t\t\te = e || window.event;\r\n\t\t\t\tif (isExternalTarget(obj, e)) {\r\n\t\t\t\t\toriginalHandler(e);\r\n\t\t\t\t}\r\n\t\t\t};\r\n\t\t\tobj.addEventListener(mouseSubst[type], handler, false);\r\n\r\n\t\t} else {\r\n\t\t\tobj.addEventListener(type, originalHandler, false);\r\n\t\t}\r\n\r\n\t} else {\r\n\t\tobj.attachEvent('on' + type, handler);\r\n\t}\r\n\r\n\tobj[eventsKey] = obj[eventsKey] || {};\r\n\tobj[eventsKey][id] = handler;\r\n}\r\n\r\nfunction removeOne(obj, type, fn, context, id) {\r\n\tid = id || type + Util.stamp(fn) + (context ? '_' + Util.stamp(context) : '');\r\n\tvar handler = obj[eventsKey] && obj[eventsKey][id];\r\n\r\n\tif (!handler) { return this; }\r\n\r\n\tif (!Browser.touchNative && Browser.pointer && type.indexOf('touch') === 0) {\r\n\t\tremovePointerListener(obj, type, handler);\r\n\r\n\t} else if (Browser.touch && (type === 'dblclick')) {\r\n\t\tremoveDoubleTapListener(obj, handler);\r\n\r\n\t} else if ('removeEventListener' in obj) {\r\n\r\n\t\tobj.removeEventListener(mouseSubst[type] || type, handler, false);\r\n\r\n\t} else {\r\n\t\tobj.detachEvent('on' + type, handler);\r\n\t}\r\n\r\n\tobj[eventsKey][id] = null;\r\n}\r\n\r\n// @function stopPropagation(ev: DOMEvent): this\r\n// Stop the given event from propagation to parent elements. Used inside the listener functions:\r\n// ```js\r\n// L.DomEvent.on(div, 'click', function (ev) {\r\n// \tL.DomEvent.stopPropagation(ev);\r\n// });\r\n// ```\r\nexport function stopPropagation(e) {\r\n\r\n\tif (e.stopPropagation) {\r\n\t\te.stopPropagation();\r\n\t} else if (e.originalEvent) { // In case of Leaflet event.\r\n\t\te.originalEvent._stopped = true;\r\n\t} else {\r\n\t\te.cancelBubble = true;\r\n\t}\r\n\r\n\treturn this;\r\n}\r\n\r\n// @function disableScrollPropagation(el: HTMLElement): this\r\n// Adds `stopPropagation` to the element's `'wheel'` events (plus browser variants).\r\nexport function disableScrollPropagation(el) {\r\n\taddOne(el, 'wheel', stopPropagation);\r\n\treturn this;\r\n}\r\n\r\n// @function disableClickPropagation(el: HTMLElement): this\r\n// Adds `stopPropagation` to the element's `'click'`, `'dblclick'`, `'contextmenu'`,\r\n// `'mousedown'` and `'touchstart'` events (plus browser variants).\r\nexport function disableClickPropagation(el) {\r\n\ton(el, 'mousedown touchstart dblclick contextmenu', stopPropagation);\r\n\tel['_leaflet_disable_click'] = true;\r\n\treturn this;\r\n}\r\n\r\n// @function preventDefault(ev: DOMEvent): this\r\n// Prevents the default action of the DOM Event `ev` from happening (such as\r\n// following a link in the href of the a element, or doing a POST request\r\n// with page reload when a `<form>` is submitted).\r\n// Use it inside listener functions.\r\nexport function preventDefault(e) {\r\n\tif (e.preventDefault) {\r\n\t\te.preventDefault();\r\n\t} else {\r\n\t\te.returnValue = false;\r\n\t}\r\n\treturn this;\r\n}\r\n\r\n// @function stop(ev: DOMEvent): this\r\n// Does `stopPropagation` and `preventDefault` at the same time.\r\nexport function stop(e) {\r\n\tpreventDefault(e);\r\n\tstopPropagation(e);\r\n\treturn this;\r\n}\r\n\r\n// @function getPropagationPath(ev: DOMEvent): Array\r\n// Compatibility polyfill for [`Event.composedPath()`](https://developer.mozilla.org/en-US/docs/Web/API/Event/composedPath).\r\n// Returns an array containing the `HTMLElement`s that the given DOM event\r\n// should propagate to (if not stopped).\r\nexport function getPropagationPath(ev) {\r\n\tif (ev.composedPath) {\r\n\t\treturn ev.composedPath();\r\n\t}\r\n\r\n\tvar path = [];\r\n\tvar el = ev.target;\r\n\r\n\twhile (el) {\r\n\t\tpath.push(el);\r\n\t\tel = el.parentNode;\r\n\t}\r\n\treturn path;\r\n}\r\n\r\n\r\n// @function getMousePosition(ev: DOMEvent, container?: HTMLElement): Point\r\n// Gets normalized mouse position from a DOM event relative to the\r\n// `container` (border excluded) or to the whole page if not specified.\r\nexport function getMousePosition(e, container) {\r\n\tif (!container) {\r\n\t\treturn new Point(e.clientX, e.clientY);\r\n\t}\r\n\r\n\tvar scale = getScale(container),\r\n\t offset = scale.boundingClientRect; // left and top values are in page scale (like the event clientX/Y)\r\n\r\n\treturn new Point(\r\n\t\t// offset.left/top values are in page scale (like clientX/Y),\r\n\t\t// whereas clientLeft/Top (border width) values are the original values (before CSS scale applies).\r\n\t\t(e.clientX - offset.left) / scale.x - container.clientLeft,\r\n\t\t(e.clientY - offset.top) / scale.y - container.clientTop\r\n\t);\r\n}\r\n\r\n\r\n// except , Safari and\r\n// We need double the scroll pixels (see #7403 and #4538) for all Browsers\r\n// except OSX (Mac) -> 3x, Chrome running on Linux 1x\r\n\r\nvar wheelPxFactor =\r\n\t(Browser.linux && Browser.chrome) ? window.devicePixelRatio :\r\n\tBrowser.mac ? window.devicePixelRatio * 3 :\r\n\twindow.devicePixelRatio > 0 ? 2 * window.devicePixelRatio : 1;\r\n// @function getWheelDelta(ev: DOMEvent): Number\r\n// Gets normalized wheel delta from a wheel DOM event, in vertical\r\n// pixels scrolled (negative if scrolling down).\r\n// Events from pointing devices without precise scrolling are mapped to\r\n// a best guess of 60 pixels.\r\nexport function getWheelDelta(e) {\r\n\treturn (Browser.edge) ? e.wheelDeltaY / 2 : // Don't trust window-geometry-based delta\r\n\t (e.deltaY && e.deltaMode === 0) ? -e.deltaY / wheelPxFactor : // Pixels\r\n\t (e.deltaY && e.deltaMode === 1) ? -e.deltaY * 20 : // Lines\r\n\t (e.deltaY && e.deltaMode === 2) ? -e.deltaY * 60 : // Pages\r\n\t (e.deltaX || e.deltaZ) ? 0 :\t// Skip horizontal/depth wheel events\r\n\t e.wheelDelta ? (e.wheelDeltaY || e.wheelDelta) / 2 : // Legacy IE pixels\r\n\t (e.detail && Math.abs(e.detail) < 32765) ? -e.detail * 20 : // Legacy Moz lines\r\n\t e.detail ? e.detail / -32765 * 60 : // Legacy Moz pages\r\n\t 0;\r\n}\r\n\r\n// check if element really left/entered the event target (for mouseenter/mouseleave)\r\nexport function isExternalTarget(el, e) {\r\n\r\n\tvar related = e.relatedTarget;\r\n\r\n\tif (!related) { return true; }\r\n\r\n\ttry {\r\n\t\twhile (related && (related !== el)) {\r\n\t\t\trelated = related.parentNode;\r\n\t\t}\r\n\t} catch (err) {\r\n\t\treturn false;\r\n\t}\r\n\treturn (related !== el);\r\n}\r\n\r\n// @function addListener(…): this\r\n// Alias to [`L.DomEvent.on`](#domevent-on)\r\nexport {on as addListener};\r\n\r\n// @function removeListener(…): this\r\n// Alias to [`L.DomEvent.off`](#domevent-off)\r\nexport {off as removeListener};\r\n", "import * as Util from '../core/Util';\nimport {Evented} from '../core/Events';\nimport * as DomUtil from '../dom/DomUtil';\n\n\n/*\n * @class PosAnimation\n * @aka L.PosAnimation\n * @inherits Evented\n * Used internally for panning animations, utilizing CSS3 Transitions for modern browsers and a timer fallback for IE6-9.\n *\n * @example\n * ```js\n * var myPositionMarker = L.marker([48.864716, 2.294694]).addTo(map);\n *\n * myPositionMarker.on(\"click\", function() {\n * \tvar pos = map.latLngToLayerPoint(myPositionMarker.getLatLng());\n * \tpos.y -= 25;\n * \tvar fx = new L.PosAnimation();\n *\n * \tfx.once('end',function() {\n * \t\tpos.y += 25;\n * \t\tfx.run(myPositionMarker._icon, pos, 0.8);\n * \t});\n *\n * \tfx.run(myPositionMarker._icon, pos, 0.3);\n * });\n *\n * ```\n *\n * @constructor L.PosAnimation()\n * Creates a `PosAnimation` object.\n *\n */\n\nexport var PosAnimation = Evented.extend({\n\n\t// @method run(el: HTMLElement, newPos: Point, duration?: Number, easeLinearity?: Number)\n\t// Run an animation of a given element to a new position, optionally setting\n\t// duration in seconds (`0.25` by default) and easing linearity factor (3rd\n\t// argument of the [cubic bezier curve](https://cubic-bezier.com/#0,0,.5,1),\n\t// `0.5` by default).\n\trun: function (el, newPos, duration, easeLinearity) {\n\t\tthis.stop();\n\n\t\tthis._el = el;\n\t\tthis._inProgress = true;\n\t\tthis._duration = duration || 0.25;\n\t\tthis._easeOutPower = 1 / Math.max(easeLinearity || 0.5, 0.2);\n\n\t\tthis._startPos = DomUtil.getPosition(el);\n\t\tthis._offset = newPos.subtract(this._startPos);\n\t\tthis._startTime = +new Date();\n\n\t\t// @event start: Event\n\t\t// Fired when the animation starts\n\t\tthis.fire('start');\n\n\t\tthis._animate();\n\t},\n\n\t// @method stop()\n\t// Stops the animation (if currently running).\n\tstop: function () {\n\t\tif (!this._inProgress) { return; }\n\n\t\tthis._step(true);\n\t\tthis._complete();\n\t},\n\n\t_animate: function () {\n\t\t// animation loop\n\t\tthis._animId = Util.requestAnimFrame(this._animate, this);\n\t\tthis._step();\n\t},\n\n\t_step: function (round) {\n\t\tvar elapsed = (+new Date()) - this._startTime,\n\t\t duration = this._duration * 1000;\n\n\t\tif (elapsed < duration) {\n\t\t\tthis._runFrame(this._easeOut(elapsed / duration), round);\n\t\t} else {\n\t\t\tthis._runFrame(1);\n\t\t\tthis._complete();\n\t\t}\n\t},\n\n\t_runFrame: function (progress, round) {\n\t\tvar pos = this._startPos.add(this._offset.multiplyBy(progress));\n\t\tif (round) {\n\t\t\tpos._round();\n\t\t}\n\t\tDomUtil.setPosition(this._el, pos);\n\n\t\t// @event step: Event\n\t\t// Fired continuously during the animation.\n\t\tthis.fire('step');\n\t},\n\n\t_complete: function () {\n\t\tUtil.cancelAnimFrame(this._animId);\n\n\t\tthis._inProgress = false;\n\t\t// @event end: Event\n\t\t// Fired when the animation ends.\n\t\tthis.fire('end');\n\t},\n\n\t_easeOut: function (t) {\n\t\treturn 1 - Math.pow(1 - t, this._easeOutPower);\n\t}\n});\n", "import * as Util from '../core/Util';\r\nimport {Evented} from '../core/Events';\r\nimport {EPSG3857} from '../geo/crs/CRS.EPSG3857';\r\nimport {Point, toPoint} from '../geometry/Point';\r\nimport {Bounds, toBounds} from '../geometry/Bounds';\r\nimport {LatLng, toLatLng} from '../geo/LatLng';\r\nimport {LatLngBounds, toLatLngBounds} from '../geo/LatLngBounds';\r\nimport Browser from '../core/Browser';\r\nimport * as DomEvent from '../dom/DomEvent';\r\nimport * as DomUtil from '../dom/DomUtil';\r\nimport {PosAnimation} from '../dom/PosAnimation';\r\n\r\n/*\r\n * @class Map\r\n * @aka L.Map\r\n * @inherits Evented\r\n *\r\n * The central class of the API — it is used to create a map on a page and manipulate it.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * // initialize the map on the \"map\" div with a given center and zoom\r\n * var map = L.map('map', {\r\n * \tcenter: [51.505, -0.09],\r\n * \tzoom: 13\r\n * });\r\n * ```\r\n *\r\n */\r\n\r\nexport var Map = Evented.extend({\r\n\r\n\toptions: {\r\n\t\t// @section Map State Options\r\n\t\t// @option crs: CRS = L.CRS.EPSG3857\r\n\t\t// The [Coordinate Reference System](#crs) to use. Don't change this if you're not\r\n\t\t// sure what it means.\r\n\t\tcrs: EPSG3857,\r\n\r\n\t\t// @option center: LatLng = undefined\r\n\t\t// Initial geographic center of the map\r\n\t\tcenter: undefined,\r\n\r\n\t\t// @option zoom: Number = undefined\r\n\t\t// Initial map zoom level\r\n\t\tzoom: undefined,\r\n\r\n\t\t// @option minZoom: Number = *\r\n\t\t// Minimum zoom level of the map.\r\n\t\t// If not specified and at least one `GridLayer` or `TileLayer` is in the map,\r\n\t\t// the lowest of their `minZoom` options will be used instead.\r\n\t\tminZoom: undefined,\r\n\r\n\t\t// @option maxZoom: Number = *\r\n\t\t// Maximum zoom level of the map.\r\n\t\t// If not specified and at least one `GridLayer` or `TileLayer` is in the map,\r\n\t\t// the highest of their `maxZoom` options will be used instead.\r\n\t\tmaxZoom: undefined,\r\n\r\n\t\t// @option layers: Layer[] = []\r\n\t\t// Array of layers that will be added to the map initially\r\n\t\tlayers: [],\r\n\r\n\t\t// @option maxBounds: LatLngBounds = null\r\n\t\t// When this option is set, the map restricts the view to the given\r\n\t\t// geographical bounds, bouncing the user back if the user tries to pan\r\n\t\t// outside the view. To set the restriction dynamically, use\r\n\t\t// [`setMaxBounds`](#map-setmaxbounds) method.\r\n\t\tmaxBounds: undefined,\r\n\r\n\t\t// @option renderer: Renderer = *\r\n\t\t// The default method for drawing vector layers on the map. `L.SVG`\r\n\t\t// or `L.Canvas` by default depending on browser support.\r\n\t\trenderer: undefined,\r\n\r\n\r\n\t\t// @section Animation Options\r\n\t\t// @option zoomAnimation: Boolean = true\r\n\t\t// Whether the map zoom animation is enabled. By default it's enabled\r\n\t\t// in all browsers that support CSS3 Transitions except Android.\r\n\t\tzoomAnimation: true,\r\n\r\n\t\t// @option zoomAnimationThreshold: Number = 4\r\n\t\t// Won't animate zoom if the zoom difference exceeds this value.\r\n\t\tzoomAnimationThreshold: 4,\r\n\r\n\t\t// @option fadeAnimation: Boolean = true\r\n\t\t// Whether the tile fade animation is enabled. By default it's enabled\r\n\t\t// in all browsers that support CSS3 Transitions except Android.\r\n\t\tfadeAnimation: true,\r\n\r\n\t\t// @option markerZoomAnimation: Boolean = true\r\n\t\t// Whether markers animate their zoom with the zoom animation, if disabled\r\n\t\t// they will disappear for the length of the animation. By default it's\r\n\t\t// enabled in all browsers that support CSS3 Transitions except Android.\r\n\t\tmarkerZoomAnimation: true,\r\n\r\n\t\t// @option transform3DLimit: Number = 2^23\r\n\t\t// Defines the maximum size of a CSS translation transform. The default\r\n\t\t// value should not be changed unless a web browser positions layers in\r\n\t\t// the wrong place after doing a large `panBy`.\r\n\t\ttransform3DLimit: 8388608, // Precision limit of a 32-bit float\r\n\r\n\t\t// @section Interaction Options\r\n\t\t// @option zoomSnap: Number = 1\r\n\t\t// Forces the map's zoom level to always be a multiple of this, particularly\r\n\t\t// right after a [`fitBounds()`](#map-fitbounds) or a pinch-zoom.\r\n\t\t// By default, the zoom level snaps to the nearest integer; lower values\r\n\t\t// (e.g. `0.5` or `0.1`) allow for greater granularity. A value of `0`\r\n\t\t// means the zoom level will not be snapped after `fitBounds` or a pinch-zoom.\r\n\t\tzoomSnap: 1,\r\n\r\n\t\t// @option zoomDelta: Number = 1\r\n\t\t// Controls how much the map's zoom level will change after a\r\n\t\t// [`zoomIn()`](#map-zoomin), [`zoomOut()`](#map-zoomout), pressing `+`\r\n\t\t// or `-` on the keyboard, or using the [zoom controls](#control-zoom).\r\n\t\t// Values smaller than `1` (e.g. `0.5`) allow for greater granularity.\r\n\t\tzoomDelta: 1,\r\n\r\n\t\t// @option trackResize: Boolean = true\r\n\t\t// Whether the map automatically handles browser window resize to update itself.\r\n\t\ttrackResize: true\r\n\t},\r\n\r\n\tinitialize: function (id, options) { // (HTMLElement or String, Object)\r\n\t\toptions = Util.setOptions(this, options);\r\n\r\n\t\t// Make sure to assign internal flags at the beginning,\r\n\t\t// to avoid inconsistent state in some edge cases.\r\n\t\tthis._handlers = [];\r\n\t\tthis._layers = {};\r\n\t\tthis._zoomBoundLayers = {};\r\n\t\tthis._sizeChanged = true;\r\n\r\n\t\tthis._initContainer(id);\r\n\t\tthis._initLayout();\r\n\r\n\t\t// hack for https://github.com/Leaflet/Leaflet/issues/1980\r\n\t\tthis._onResize = Util.bind(this._onResize, this);\r\n\r\n\t\tthis._initEvents();\r\n\r\n\t\tif (options.maxBounds) {\r\n\t\t\tthis.setMaxBounds(options.maxBounds);\r\n\t\t}\r\n\r\n\t\tif (options.zoom !== undefined) {\r\n\t\t\tthis._zoom = this._limitZoom(options.zoom);\r\n\t\t}\r\n\r\n\t\tif (options.center && options.zoom !== undefined) {\r\n\t\t\tthis.setView(toLatLng(options.center), options.zoom, {reset: true});\r\n\t\t}\r\n\r\n\t\tthis.callInitHooks();\r\n\r\n\t\t// don't animate on browsers without hardware-accelerated transitions or old Android/Opera\r\n\t\tthis._zoomAnimated = DomUtil.TRANSITION && Browser.any3d && !Browser.mobileOpera &&\r\n\t\t\t\tthis.options.zoomAnimation;\r\n\r\n\t\t// zoom transitions run with the same duration for all layers, so if one of transitionend events\r\n\t\t// happens after starting zoom animation (propagating to the map pane), we know that it ended globally\r\n\t\tif (this._zoomAnimated) {\r\n\t\t\tthis._createAnimProxy();\r\n\t\t\tDomEvent.on(this._proxy, DomUtil.TRANSITION_END, this._catchTransitionEnd, this);\r\n\t\t}\r\n\r\n\t\tthis._addLayers(this.options.layers);\r\n\t},\r\n\r\n\r\n\t// @section Methods for modifying map state\r\n\r\n\t// @method setView(center: LatLng, zoom: Number, options?: Zoom/pan options): this\r\n\t// Sets the view of the map (geographical center and zoom) with the given\r\n\t// animation options.\r\n\tsetView: function (center, zoom, options) {\r\n\r\n\t\tzoom = zoom === undefined ? this._zoom : this._limitZoom(zoom);\r\n\t\tcenter = this._limitCenter(toLatLng(center), zoom, this.options.maxBounds);\r\n\t\toptions = options || {};\r\n\r\n\t\tthis._stop();\r\n\r\n\t\tif (this._loaded && !options.reset && options !== true) {\r\n\r\n\t\t\tif (options.animate !== undefined) {\r\n\t\t\t\toptions.zoom = Util.extend({animate: options.animate}, options.zoom);\r\n\t\t\t\toptions.pan = Util.extend({animate: options.animate, duration: options.duration}, options.pan);\r\n\t\t\t}\r\n\r\n\t\t\t// try animating pan or zoom\r\n\t\t\tvar moved = (this._zoom !== zoom) ?\r\n\t\t\t\tthis._tryAnimatedZoom && this._tryAnimatedZoom(center, zoom, options.zoom) :\r\n\t\t\t\tthis._tryAnimatedPan(center, options.pan);\r\n\r\n\t\t\tif (moved) {\r\n\t\t\t\t// prevent resize handler call, the view will refresh after animation anyway\r\n\t\t\t\tclearTimeout(this._sizeTimer);\r\n\t\t\t\treturn this;\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\t// animation didn't start, just reset the map view\r\n\t\tthis._resetView(center, zoom, options.pan && options.pan.noMoveStart);\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method setZoom(zoom: Number, options?: Zoom/pan options): this\r\n\t// Sets the zoom of the map.\r\n\tsetZoom: function (zoom, options) {\r\n\t\tif (!this._loaded) {\r\n\t\t\tthis._zoom = zoom;\r\n\t\t\treturn this;\r\n\t\t}\r\n\t\treturn this.setView(this.getCenter(), zoom, {zoom: options});\r\n\t},\r\n\r\n\t// @method zoomIn(delta?: Number, options?: Zoom options): this\r\n\t// Increases the zoom of the map by `delta` ([`zoomDelta`](#map-zoomdelta) by default).\r\n\tzoomIn: function (delta, options) {\r\n\t\tdelta = delta || (Browser.any3d ? this.options.zoomDelta : 1);\r\n\t\treturn this.setZoom(this._zoom + delta, options);\r\n\t},\r\n\r\n\t// @method zoomOut(delta?: Number, options?: Zoom options): this\r\n\t// Decreases the zoom of the map by `delta` ([`zoomDelta`](#map-zoomdelta) by default).\r\n\tzoomOut: function (delta, options) {\r\n\t\tdelta = delta || (Browser.any3d ? this.options.zoomDelta : 1);\r\n\t\treturn this.setZoom(this._zoom - delta, options);\r\n\t},\r\n\r\n\t// @method setZoomAround(latlng: LatLng, zoom: Number, options: Zoom options): this\r\n\t// Zooms the map while keeping a specified geographical point on the map\r\n\t// stationary (e.g. used internally for scroll zoom and double-click zoom).\r\n\t// @alternative\r\n\t// @method setZoomAround(offset: Point, zoom: Number, options: Zoom options): this\r\n\t// Zooms the map while keeping a specified pixel on the map (relative to the top-left corner) stationary.\r\n\tsetZoomAround: function (latlng, zoom, options) {\r\n\t\tvar scale = this.getZoomScale(zoom),\r\n\t\t viewHalf = this.getSize().divideBy(2),\r\n\t\t containerPoint = latlng instanceof Point ? latlng : this.latLngToContainerPoint(latlng),\r\n\r\n\t\t centerOffset = containerPoint.subtract(viewHalf).multiplyBy(1 - 1 / scale),\r\n\t\t newCenter = this.containerPointToLatLng(viewHalf.add(centerOffset));\r\n\r\n\t\treturn this.setView(newCenter, zoom, {zoom: options});\r\n\t},\r\n\r\n\t_getBoundsCenterZoom: function (bounds, options) {\r\n\r\n\t\toptions = options || {};\r\n\t\tbounds = bounds.getBounds ? bounds.getBounds() : toLatLngBounds(bounds);\r\n\r\n\t\tvar paddingTL = toPoint(options.paddingTopLeft || options.padding || [0, 0]),\r\n\t\t paddingBR = toPoint(options.paddingBottomRight || options.padding || [0, 0]),\r\n\r\n\t\t zoom = this.getBoundsZoom(bounds, false, paddingTL.add(paddingBR));\r\n\r\n\t\tzoom = (typeof options.maxZoom === 'number') ? Math.min(options.maxZoom, zoom) : zoom;\r\n\r\n\t\tif (zoom === Infinity) {\r\n\t\t\treturn {\r\n\t\t\t\tcenter: bounds.getCenter(),\r\n\t\t\t\tzoom: zoom\r\n\t\t\t};\r\n\t\t}\r\n\r\n\t\tvar paddingOffset = paddingBR.subtract(paddingTL).divideBy(2),\r\n\r\n\t\t swPoint = this.project(bounds.getSouthWest(), zoom),\r\n\t\t nePoint = this.project(bounds.getNorthEast(), zoom),\r\n\t\t center = this.unproject(swPoint.add(nePoint).divideBy(2).add(paddingOffset), zoom);\r\n\r\n\t\treturn {\r\n\t\t\tcenter: center,\r\n\t\t\tzoom: zoom\r\n\t\t};\r\n\t},\r\n\r\n\t// @method fitBounds(bounds: LatLngBounds, options?: fitBounds options): this\r\n\t// Sets a map view that contains the given geographical bounds with the\r\n\t// maximum zoom level possible.\r\n\tfitBounds: function (bounds, options) {\r\n\r\n\t\tbounds = toLatLngBounds(bounds);\r\n\r\n\t\tif (!bounds.isValid()) {\r\n\t\t\tthrow new Error('Bounds are not valid.');\r\n\t\t}\r\n\r\n\t\tvar target = this._getBoundsCenterZoom(bounds, options);\r\n\t\treturn this.setView(target.center, target.zoom, options);\r\n\t},\r\n\r\n\t// @method fitWorld(options?: fitBounds options): this\r\n\t// Sets a map view that mostly contains the whole world with the maximum\r\n\t// zoom level possible.\r\n\tfitWorld: function (options) {\r\n\t\treturn this.fitBounds([[-90, -180], [90, 180]], options);\r\n\t},\r\n\r\n\t// @method panTo(latlng: LatLng, options?: Pan options): this\r\n\t// Pans the map to a given center.\r\n\tpanTo: function (center, options) { // (LatLng)\r\n\t\treturn this.setView(center, this._zoom, {pan: options});\r\n\t},\r\n\r\n\t// @method panBy(offset: Point, options?: Pan options): this\r\n\t// Pans the map by a given number of pixels (animated).\r\n\tpanBy: function (offset, options) {\r\n\t\toffset = toPoint(offset).round();\r\n\t\toptions = options || {};\r\n\r\n\t\tif (!offset.x && !offset.y) {\r\n\t\t\treturn this.fire('moveend');\r\n\t\t}\r\n\t\t// If we pan too far, Chrome gets issues with tiles\r\n\t\t// and makes them disappear or appear in the wrong place (slightly offset) #2602\r\n\t\tif (options.animate !== true && !this.getSize().contains(offset)) {\r\n\t\t\tthis._resetView(this.unproject(this.project(this.getCenter()).add(offset)), this.getZoom());\r\n\t\t\treturn this;\r\n\t\t}\r\n\r\n\t\tif (!this._panAnim) {\r\n\t\t\tthis._panAnim = new PosAnimation();\r\n\r\n\t\t\tthis._panAnim.on({\r\n\t\t\t\t'step': this._onPanTransitionStep,\r\n\t\t\t\t'end': this._onPanTransitionEnd\r\n\t\t\t}, this);\r\n\t\t}\r\n\r\n\t\t// don't fire movestart if animating inertia\r\n\t\tif (!options.noMoveStart) {\r\n\t\t\tthis.fire('movestart');\r\n\t\t}\r\n\r\n\t\t// animate pan unless animate: false specified\r\n\t\tif (options.animate !== false) {\r\n\t\t\tDomUtil.addClass(this._mapPane, 'leaflet-pan-anim');\r\n\r\n\t\t\tvar newPos = this._getMapPanePos().subtract(offset).round();\r\n\t\t\tthis._panAnim.run(this._mapPane, newPos, options.duration || 0.25, options.easeLinearity);\r\n\t\t} else {\r\n\t\t\tthis._rawPanBy(offset);\r\n\t\t\tthis.fire('move').fire('moveend');\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method flyTo(latlng: LatLng, zoom?: Number, options?: Zoom/pan options): this\r\n\t// Sets the view of the map (geographical center and zoom) performing a smooth\r\n\t// pan-zoom animation.\r\n\tflyTo: function (targetCenter, targetZoom, options) {\r\n\r\n\t\toptions = options || {};\r\n\t\tif (options.animate === false || !Browser.any3d) {\r\n\t\t\treturn this.setView(targetCenter, targetZoom, options);\r\n\t\t}\r\n\r\n\t\tthis._stop();\r\n\r\n\t\tvar from = this.project(this.getCenter()),\r\n\t\t to = this.project(targetCenter),\r\n\t\t size = this.getSize(),\r\n\t\t startZoom = this._zoom;\r\n\r\n\t\ttargetCenter = toLatLng(targetCenter);\r\n\t\ttargetZoom = targetZoom === undefined ? startZoom : targetZoom;\r\n\r\n\t\tvar w0 = Math.max(size.x, size.y),\r\n\t\t w1 = w0 * this.getZoomScale(startZoom, targetZoom),\r\n\t\t u1 = (to.distanceTo(from)) || 1,\r\n\t\t rho = 1.42,\r\n\t\t rho2 = rho * rho;\r\n\r\n\t\tfunction r(i) {\r\n\t\t\tvar s1 = i ? -1 : 1,\r\n\t\t\t s2 = i ? w1 : w0,\r\n\t\t\t t1 = w1 * w1 - w0 * w0 + s1 * rho2 * rho2 * u1 * u1,\r\n\t\t\t b1 = 2 * s2 * rho2 * u1,\r\n\t\t\t b = t1 / b1,\r\n\t\t\t sq = Math.sqrt(b * b + 1) - b;\r\n\r\n\t\t\t // workaround for floating point precision bug when sq = 0, log = -Infinite,\r\n\t\t\t // thus triggering an infinite loop in flyTo\r\n\t\t\t var log = sq < 0.000000001 ? -18 : Math.log(sq);\r\n\r\n\t\t\treturn log;\r\n\t\t}\r\n\r\n\t\tfunction sinh(n) { return (Math.exp(n) - Math.exp(-n)) / 2; }\r\n\t\tfunction cosh(n) { return (Math.exp(n) + Math.exp(-n)) / 2; }\r\n\t\tfunction tanh(n) { return sinh(n) / cosh(n); }\r\n\r\n\t\tvar r0 = r(0);\r\n\r\n\t\tfunction w(s) { return w0 * (cosh(r0) / cosh(r0 + rho * s)); }\r\n\t\tfunction u(s) { return w0 * (cosh(r0) * tanh(r0 + rho * s) - sinh(r0)) / rho2; }\r\n\r\n\t\tfunction easeOut(t) { return 1 - Math.pow(1 - t, 1.5); }\r\n\r\n\t\tvar start = Date.now(),\r\n\t\t S = (r(1) - r0) / rho,\r\n\t\t duration = options.duration ? 1000 * options.duration : 1000 * S * 0.8;\r\n\r\n\t\tfunction frame() {\r\n\t\t\tvar t = (Date.now() - start) / duration,\r\n\t\t\t s = easeOut(t) * S;\r\n\r\n\t\t\tif (t <= 1) {\r\n\t\t\t\tthis._flyToFrame = Util.requestAnimFrame(frame, this);\r\n\r\n\t\t\t\tthis._move(\r\n\t\t\t\t\tthis.unproject(from.add(to.subtract(from).multiplyBy(u(s) / u1)), startZoom),\r\n\t\t\t\t\tthis.getScaleZoom(w0 / w(s), startZoom),\r\n\t\t\t\t\t{flyTo: true});\r\n\r\n\t\t\t} else {\r\n\t\t\t\tthis\r\n\t\t\t\t\t._move(targetCenter, targetZoom)\r\n\t\t\t\t\t._moveEnd(true);\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\tthis._moveStart(true, options.noMoveStart);\r\n\r\n\t\tframe.call(this);\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method flyToBounds(bounds: LatLngBounds, options?: fitBounds options): this\r\n\t// Sets the view of the map with a smooth animation like [`flyTo`](#map-flyto),\r\n\t// but takes a bounds parameter like [`fitBounds`](#map-fitbounds).\r\n\tflyToBounds: function (bounds, options) {\r\n\t\tvar target = this._getBoundsCenterZoom(bounds, options);\r\n\t\treturn this.flyTo(target.center, target.zoom, options);\r\n\t},\r\n\r\n\t// @method setMaxBounds(bounds: LatLngBounds): this\r\n\t// Restricts the map view to the given bounds (see the [maxBounds](#map-maxbounds) option).\r\n\tsetMaxBounds: function (bounds) {\r\n\t\tbounds = toLatLngBounds(bounds);\r\n\r\n\t\tif (this.listens('moveend', this._panInsideMaxBounds)) {\r\n\t\t\tthis.off('moveend', this._panInsideMaxBounds);\r\n\t\t}\r\n\r\n\t\tif (!bounds.isValid()) {\r\n\t\t\tthis.options.maxBounds = null;\r\n\t\t\treturn this;\r\n\t\t}\r\n\r\n\t\tthis.options.maxBounds = bounds;\r\n\r\n\t\tif (this._loaded) {\r\n\t\t\tthis._panInsideMaxBounds();\r\n\t\t}\r\n\r\n\t\treturn this.on('moveend', this._panInsideMaxBounds);\r\n\t},\r\n\r\n\t// @method setMinZoom(zoom: Number): this\r\n\t// Sets the lower limit for the available zoom levels (see the [minZoom](#map-minzoom) option).\r\n\tsetMinZoom: function (zoom) {\r\n\t\tvar oldZoom = this.options.minZoom;\r\n\t\tthis.options.minZoom = zoom;\r\n\r\n\t\tif (this._loaded && oldZoom !== zoom) {\r\n\t\t\tthis.fire('zoomlevelschange');\r\n\r\n\t\t\tif (this.getZoom() < this.options.minZoom) {\r\n\t\t\t\treturn this.setZoom(zoom);\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method setMaxZoom(zoom: Number): this\r\n\t// Sets the upper limit for the available zoom levels (see the [maxZoom](#map-maxzoom) option).\r\n\tsetMaxZoom: function (zoom) {\r\n\t\tvar oldZoom = this.options.maxZoom;\r\n\t\tthis.options.maxZoom = zoom;\r\n\r\n\t\tif (this._loaded && oldZoom !== zoom) {\r\n\t\t\tthis.fire('zoomlevelschange');\r\n\r\n\t\t\tif (this.getZoom() > this.options.maxZoom) {\r\n\t\t\t\treturn this.setZoom(zoom);\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method panInsideBounds(bounds: LatLngBounds, options?: Pan options): this\r\n\t// Pans the map to the closest view that would lie inside the given bounds (if it's not already), controlling the animation using the options specific, if any.\r\n\tpanInsideBounds: function (bounds, options) {\r\n\t\tthis._enforcingBounds = true;\r\n\t\tvar center = this.getCenter(),\r\n\t\t newCenter = this._limitCenter(center, this._zoom, toLatLngBounds(bounds));\r\n\r\n\t\tif (!center.equals(newCenter)) {\r\n\t\t\tthis.panTo(newCenter, options);\r\n\t\t}\r\n\r\n\t\tthis._enforcingBounds = false;\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method panInside(latlng: LatLng, options?: padding options): this\r\n\t// Pans the map the minimum amount to make the `latlng` visible. Use\r\n\t// padding options to fit the display to more restricted bounds.\r\n\t// If `latlng` is already within the (optionally padded) display bounds,\r\n\t// the map will not be panned.\r\n\tpanInside: function (latlng, options) {\r\n\t\toptions = options || {};\r\n\r\n\t\tvar paddingTL = toPoint(options.paddingTopLeft || options.padding || [0, 0]),\r\n\t\t paddingBR = toPoint(options.paddingBottomRight || options.padding || [0, 0]),\r\n\t\t pixelCenter = this.project(this.getCenter()),\r\n\t\t pixelPoint = this.project(latlng),\r\n\t\t pixelBounds = this.getPixelBounds(),\r\n\t\t paddedBounds = toBounds([pixelBounds.min.add(paddingTL), pixelBounds.max.subtract(paddingBR)]),\r\n\t\t paddedSize = paddedBounds.getSize();\r\n\r\n\t\tif (!paddedBounds.contains(pixelPoint)) {\r\n\t\t\tthis._enforcingBounds = true;\r\n\t\t\tvar centerOffset = pixelPoint.subtract(paddedBounds.getCenter());\r\n\t\t\tvar offset = paddedBounds.extend(pixelPoint).getSize().subtract(paddedSize);\r\n\t\t\tpixelCenter.x += centerOffset.x < 0 ? -offset.x : offset.x;\r\n\t\t\tpixelCenter.y += centerOffset.y < 0 ? -offset.y : offset.y;\r\n\t\t\tthis.panTo(this.unproject(pixelCenter), options);\r\n\t\t\tthis._enforcingBounds = false;\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method invalidateSize(options: Zoom/pan options): this\r\n\t// Checks if the map container size changed and updates the map if so —\r\n\t// call it after you've changed the map size dynamically, also animating\r\n\t// pan by default. If `options.pan` is `false`, panning will not occur.\r\n\t// If `options.debounceMoveend` is `true`, it will delay `moveend` event so\r\n\t// that it doesn't happen often even if the method is called many\r\n\t// times in a row.\r\n\r\n\t// @alternative\r\n\t// @method invalidateSize(animate: Boolean): this\r\n\t// Checks if the map container size changed and updates the map if so —\r\n\t// call it after you've changed the map size dynamically, also animating\r\n\t// pan by default.\r\n\tinvalidateSize: function (options) {\r\n\t\tif (!this._loaded) { return this; }\r\n\r\n\t\toptions = Util.extend({\r\n\t\t\tanimate: false,\r\n\t\t\tpan: true\r\n\t\t}, options === true ? {animate: true} : options);\r\n\r\n\t\tvar oldSize = this.getSize();\r\n\t\tthis._sizeChanged = true;\r\n\t\tthis._lastCenter = null;\r\n\r\n\t\tvar newSize = this.getSize(),\r\n\t\t oldCenter = oldSize.divideBy(2).round(),\r\n\t\t newCenter = newSize.divideBy(2).round(),\r\n\t\t offset = oldCenter.subtract(newCenter);\r\n\r\n\t\tif (!offset.x && !offset.y) { return this; }\r\n\r\n\t\tif (options.animate && options.pan) {\r\n\t\t\tthis.panBy(offset);\r\n\r\n\t\t} else {\r\n\t\t\tif (options.pan) {\r\n\t\t\t\tthis._rawPanBy(offset);\r\n\t\t\t}\r\n\r\n\t\t\tthis.fire('move');\r\n\r\n\t\t\tif (options.debounceMoveend) {\r\n\t\t\t\tclearTimeout(this._sizeTimer);\r\n\t\t\t\tthis._sizeTimer = setTimeout(Util.bind(this.fire, this, 'moveend'), 200);\r\n\t\t\t} else {\r\n\t\t\t\tthis.fire('moveend');\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\t// @section Map state change events\r\n\t\t// @event resize: ResizeEvent\r\n\t\t// Fired when the map is resized.\r\n\t\treturn this.fire('resize', {\r\n\t\t\toldSize: oldSize,\r\n\t\t\tnewSize: newSize\r\n\t\t});\r\n\t},\r\n\r\n\t// @section Methods for modifying map state\r\n\t// @method stop(): this\r\n\t// Stops the currently running `panTo` or `flyTo` animation, if any.\r\n\tstop: function () {\r\n\t\tthis.setZoom(this._limitZoom(this._zoom));\r\n\t\tif (!this.options.zoomSnap) {\r\n\t\t\tthis.fire('viewreset');\r\n\t\t}\r\n\t\treturn this._stop();\r\n\t},\r\n\r\n\t// @section Geolocation methods\r\n\t// @method locate(options?: Locate options): this\r\n\t// Tries to locate the user using the Geolocation API, firing a [`locationfound`](#map-locationfound)\r\n\t// event with location data on success or a [`locationerror`](#map-locationerror) event on failure,\r\n\t// and optionally sets the map view to the user's location with respect to\r\n\t// detection accuracy (or to the world view if geolocation failed).\r\n\t// Note that, if your page doesn't use HTTPS, this method will fail in\r\n\t// modern browsers ([Chrome 50 and newer](https://sites.google.com/a/chromium.org/dev/Home/chromium-security/deprecating-powerful-features-on-insecure-origins))\r\n\t// See `Locate options` for more details.\r\n\tlocate: function (options) {\r\n\r\n\t\toptions = this._locateOptions = Util.extend({\r\n\t\t\ttimeout: 10000,\r\n\t\t\twatch: false\r\n\t\t\t// setView: false\r\n\t\t\t// maxZoom: <Number>\r\n\t\t\t// maximumAge: 0\r\n\t\t\t// enableHighAccuracy: false\r\n\t\t}, options);\r\n\r\n\t\tif (!('geolocation' in navigator)) {\r\n\t\t\tthis._handleGeolocationError({\r\n\t\t\t\tcode: 0,\r\n\t\t\t\tmessage: 'Geolocation not supported.'\r\n\t\t\t});\r\n\t\t\treturn this;\r\n\t\t}\r\n\r\n\t\tvar onResponse = Util.bind(this._handleGeolocationResponse, this),\r\n\t\t onError = Util.bind(this._handleGeolocationError, this);\r\n\r\n\t\tif (options.watch) {\r\n\t\t\tthis._locationWatchId =\r\n\t\t\t navigator.geolocation.watchPosition(onResponse, onError, options);\r\n\t\t} else {\r\n\t\t\tnavigator.geolocation.getCurrentPosition(onResponse, onError, options);\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method stopLocate(): this\r\n\t// Stops watching location previously initiated by `map.locate({watch: true})`\r\n\t// and aborts resetting the map view if map.locate was called with\r\n\t// `{setView: true}`.\r\n\tstopLocate: function () {\r\n\t\tif (navigator.geolocation && navigator.geolocation.clearWatch) {\r\n\t\t\tnavigator.geolocation.clearWatch(this._locationWatchId);\r\n\t\t}\r\n\t\tif (this._locateOptions) {\r\n\t\t\tthis._locateOptions.setView = false;\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t_handleGeolocationError: function (error) {\r\n\t\tif (!this._container._leaflet_id) { return; }\r\n\r\n\t\tvar c = error.code,\r\n\t\t message = error.message ||\r\n\t\t (c === 1 ? 'permission denied' :\r\n\t\t (c === 2 ? 'position unavailable' : 'timeout'));\r\n\r\n\t\tif (this._locateOptions.setView && !this._loaded) {\r\n\t\t\tthis.fitWorld();\r\n\t\t}\r\n\r\n\t\t// @section Location events\r\n\t\t// @event locationerror: ErrorEvent\r\n\t\t// Fired when geolocation (using the [`locate`](#map-locate) method) failed.\r\n\t\tthis.fire('locationerror', {\r\n\t\t\tcode: c,\r\n\t\t\tmessage: 'Geolocation error: ' + message + '.'\r\n\t\t});\r\n\t},\r\n\r\n\t_handleGeolocationResponse: function (pos) {\r\n\t\tif (!this._container._leaflet_id) { return; }\r\n\r\n\t\tvar lat = pos.coords.latitude,\r\n\t\t lng = pos.coords.longitude,\r\n\t\t latlng = new LatLng(lat, lng),\r\n\t\t bounds = latlng.toBounds(pos.coords.accuracy * 2),\r\n\t\t options = this._locateOptions;\r\n\r\n\t\tif (options.setView) {\r\n\t\t\tvar zoom = this.getBoundsZoom(bounds);\r\n\t\t\tthis.setView(latlng, options.maxZoom ? Math.min(zoom, options.maxZoom) : zoom);\r\n\t\t}\r\n\r\n\t\tvar data = {\r\n\t\t\tlatlng: latlng,\r\n\t\t\tbounds: bounds,\r\n\t\t\ttimestamp: pos.timestamp\r\n\t\t};\r\n\r\n\t\tfor (var i in pos.coords) {\r\n\t\t\tif (typeof pos.coords[i] === 'number') {\r\n\t\t\t\tdata[i] = pos.coords[i];\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\t// @event locationfound: LocationEvent\r\n\t\t// Fired when geolocation (using the [`locate`](#map-locate) method)\r\n\t\t// went successfully.\r\n\t\tthis.fire('locationfound', data);\r\n\t},\r\n\r\n\t// TODO Appropriate docs section?\r\n\t// @section Other Methods\r\n\t// @method addHandler(name: String, HandlerClass: Function): this\r\n\t// Adds a new `Handler` to the map, given its name and constructor function.\r\n\taddHandler: function (name, HandlerClass) {\r\n\t\tif (!HandlerClass) { return this; }\r\n\r\n\t\tvar handler = this[name] = new HandlerClass(this);\r\n\r\n\t\tthis._handlers.push(handler);\r\n\r\n\t\tif (this.options[name]) {\r\n\t\t\thandler.enable();\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method remove(): this\r\n\t// Destroys the map and clears all related event listeners.\r\n\tremove: function () {\r\n\r\n\t\tthis._initEvents(true);\r\n\t\tif (this.options.maxBounds) { this.off('moveend', this._panInsideMaxBounds); }\r\n\r\n\t\tif (this._containerId !== this._container._leaflet_id) {\r\n\t\t\tthrow new Error('Map container is being reused by another instance');\r\n\t\t}\r\n\r\n\t\ttry {\r\n\t\t\t// throws error in IE6-8\r\n\t\t\tdelete this._container._leaflet_id;\r\n\t\t\tdelete this._containerId;\r\n\t\t} catch (e) {\r\n\t\t\t/*eslint-disable */\r\n\t\t\tthis._container._leaflet_id = undefined;\r\n\t\t\t/* eslint-enable */\r\n\t\t\tthis._containerId = undefined;\r\n\t\t}\r\n\r\n\t\tif (this._locationWatchId !== undefined) {\r\n\t\t\tthis.stopLocate();\r\n\t\t}\r\n\r\n\t\tthis._stop();\r\n\r\n\t\tDomUtil.remove(this._mapPane);\r\n\r\n\t\tif (this._clearControlPos) {\r\n\t\t\tthis._clearControlPos();\r\n\t\t}\r\n\t\tif (this._resizeRequest) {\r\n\t\t\tUtil.cancelAnimFrame(this._resizeRequest);\r\n\t\t\tthis._resizeRequest = null;\r\n\t\t}\r\n\r\n\t\tthis._clearHandlers();\r\n\r\n\t\tif (this._loaded) {\r\n\t\t\t// @section Map state change events\r\n\t\t\t// @event unload: Event\r\n\t\t\t// Fired when the map is destroyed with [remove](#map-remove) method.\r\n\t\t\tthis.fire('unload');\r\n\t\t}\r\n\r\n\t\tvar i;\r\n\t\tfor (i in this._layers) {\r\n\t\t\tthis._layers[i].remove();\r\n\t\t}\r\n\t\tfor (i in this._panes) {\r\n\t\t\tDomUtil.remove(this._panes[i]);\r\n\t\t}\r\n\r\n\t\tthis._layers = [];\r\n\t\tthis._panes = [];\r\n\t\tdelete this._mapPane;\r\n\t\tdelete this._renderer;\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @section Other Methods\r\n\t// @method createPane(name: String, container?: HTMLElement): HTMLElement\r\n\t// Creates a new [map pane](#map-pane) with the given name if it doesn't exist already,\r\n\t// then returns it. The pane is created as a child of `container`, or\r\n\t// as a child of the main map pane if not set.\r\n\tcreatePane: function (name, container) {\r\n\t\tvar className = 'leaflet-pane' + (name ? ' leaflet-' + name.replace('Pane', '') + '-pane' : ''),\r\n\t\t pane = DomUtil.create('div', className, container || this._mapPane);\r\n\r\n\t\tif (name) {\r\n\t\t\tthis._panes[name] = pane;\r\n\t\t}\r\n\t\treturn pane;\r\n\t},\r\n\r\n\t// @section Methods for Getting Map State\r\n\r\n\t// @method getCenter(): LatLng\r\n\t// Returns the geographical center of the map view\r\n\tgetCenter: function () {\r\n\t\tthis._checkIfLoaded();\r\n\r\n\t\tif (this._lastCenter && !this._moved()) {\r\n\t\t\treturn this._lastCenter.clone();\r\n\t\t}\r\n\t\treturn this.layerPointToLatLng(this._getCenterLayerPoint());\r\n\t},\r\n\r\n\t// @method getZoom(): Number\r\n\t// Returns the current zoom level of the map view\r\n\tgetZoom: function () {\r\n\t\treturn this._zoom;\r\n\t},\r\n\r\n\t// @method getBounds(): LatLngBounds\r\n\t// Returns the geographical bounds visible in the current map view\r\n\tgetBounds: function () {\r\n\t\tvar bounds = this.getPixelBounds(),\r\n\t\t sw = this.unproject(bounds.getBottomLeft()),\r\n\t\t ne = this.unproject(bounds.getTopRight());\r\n\r\n\t\treturn new LatLngBounds(sw, ne);\r\n\t},\r\n\r\n\t// @method getMinZoom(): Number\r\n\t// Returns the minimum zoom level of the map (if set in the `minZoom` option of the map or of any layers), or `0` by default.\r\n\tgetMinZoom: function () {\r\n\t\treturn this.options.minZoom === undefined ? this._layersMinZoom || 0 : this.options.minZoom;\r\n\t},\r\n\r\n\t// @method getMaxZoom(): Number\r\n\t// Returns the maximum zoom level of the map (if set in the `maxZoom` option of the map or of any layers).\r\n\tgetMaxZoom: function () {\r\n\t\treturn this.options.maxZoom === undefined ?\r\n\t\t\t(this._layersMaxZoom === undefined ? Infinity : this._layersMaxZoom) :\r\n\t\t\tthis.options.maxZoom;\r\n\t},\r\n\r\n\t// @method getBoundsZoom(bounds: LatLngBounds, inside?: Boolean, padding?: Point): Number\r\n\t// Returns the maximum zoom level on which the given bounds fit to the map\r\n\t// view in its entirety. If `inside` (optional) is set to `true`, the method\r\n\t// instead returns the minimum zoom level on which the map view fits into\r\n\t// the given bounds in its entirety.\r\n\tgetBoundsZoom: function (bounds, inside, padding) { // (LatLngBounds[, Boolean, Point]) -> Number\r\n\t\tbounds = toLatLngBounds(bounds);\r\n\t\tpadding = toPoint(padding || [0, 0]);\r\n\r\n\t\tvar zoom = this.getZoom() || 0,\r\n\t\t min = this.getMinZoom(),\r\n\t\t max = this.getMaxZoom(),\r\n\t\t nw = bounds.getNorthWest(),\r\n\t\t se = bounds.getSouthEast(),\r\n\t\t size = this.getSize().subtract(padding),\r\n\t\t boundsSize = toBounds(this.project(se, zoom), this.project(nw, zoom)).getSize(),\r\n\t\t snap = Browser.any3d ? this.options.zoomSnap : 1,\r\n\t\t scalex = size.x / boundsSize.x,\r\n\t\t scaley = size.y / boundsSize.y,\r\n\t\t scale = inside ? Math.max(scalex, scaley) : Math.min(scalex, scaley);\r\n\r\n\t\tzoom = this.getScaleZoom(scale, zoom);\r\n\r\n\t\tif (snap) {\r\n\t\t\tzoom = Math.round(zoom / (snap / 100)) * (snap / 100); // don't jump if within 1% of a snap level\r\n\t\t\tzoom = inside ? Math.ceil(zoom / snap) * snap : Math.floor(zoom / snap) * snap;\r\n\t\t}\r\n\r\n\t\treturn Math.max(min, Math.min(max, zoom));\r\n\t},\r\n\r\n\t// @method getSize(): Point\r\n\t// Returns the current size of the map container (in pixels).\r\n\tgetSize: function () {\r\n\t\tif (!this._size || this._sizeChanged) {\r\n\t\t\tthis._size = new Point(\r\n\t\t\t\tthis._container.clientWidth || 0,\r\n\t\t\t\tthis._container.clientHeight || 0);\r\n\r\n\t\t\tthis._sizeChanged = false;\r\n\t\t}\r\n\t\treturn this._size.clone();\r\n\t},\r\n\r\n\t// @method getPixelBounds(): Bounds\r\n\t// Returns the bounds of the current map view in projected pixel\r\n\t// coordinates (sometimes useful in layer and overlay implementations).\r\n\tgetPixelBounds: function (center, zoom) {\r\n\t\tvar topLeftPoint = this._getTopLeftPoint(center, zoom);\r\n\t\treturn new Bounds(topLeftPoint, topLeftPoint.add(this.getSize()));\r\n\t},\r\n\r\n\t// TODO: Check semantics - isn't the pixel origin the 0,0 coord relative to\r\n\t// the map pane? \"left point of the map layer\" can be confusing, specially\r\n\t// since there can be negative offsets.\r\n\t// @method getPixelOrigin(): Point\r\n\t// Returns the projected pixel coordinates of the top left point of\r\n\t// the map layer (useful in custom layer and overlay implementations).\r\n\tgetPixelOrigin: function () {\r\n\t\tthis._checkIfLoaded();\r\n\t\treturn this._pixelOrigin;\r\n\t},\r\n\r\n\t// @method getPixelWorldBounds(zoom?: Number): Bounds\r\n\t// Returns the world's bounds in pixel coordinates for zoom level `zoom`.\r\n\t// If `zoom` is omitted, the map's current zoom level is used.\r\n\tgetPixelWorldBounds: function (zoom) {\r\n\t\treturn this.options.crs.getProjectedBounds(zoom === undefined ? this.getZoom() : zoom);\r\n\t},\r\n\r\n\t// @section Other Methods\r\n\r\n\t// @method getPane(pane: String|HTMLElement): HTMLElement\r\n\t// Returns a [map pane](#map-pane), given its name or its HTML element (its identity).\r\n\tgetPane: function (pane) {\r\n\t\treturn typeof pane === 'string' ? this._panes[pane] : pane;\r\n\t},\r\n\r\n\t// @method getPanes(): Object\r\n\t// Returns a plain object containing the names of all [panes](#map-pane) as keys and\r\n\t// the panes as values.\r\n\tgetPanes: function () {\r\n\t\treturn this._panes;\r\n\t},\r\n\r\n\t// @method getContainer: HTMLElement\r\n\t// Returns the HTML element that contains the map.\r\n\tgetContainer: function () {\r\n\t\treturn this._container;\r\n\t},\r\n\r\n\r\n\t// @section Conversion Methods\r\n\r\n\t// @method getZoomScale(toZoom: Number, fromZoom: Number): Number\r\n\t// Returns the scale factor to be applied to a map transition from zoom level\r\n\t// `fromZoom` to `toZoom`. Used internally to help with zoom animations.\r\n\tgetZoomScale: function (toZoom, fromZoom) {\r\n\t\t// TODO replace with universal implementation after refactoring projections\r\n\t\tvar crs = this.options.crs;\r\n\t\tfromZoom = fromZoom === undefined ? this._zoom : fromZoom;\r\n\t\treturn crs.scale(toZoom) / crs.scale(fromZoom);\r\n\t},\r\n\r\n\t// @method getScaleZoom(scale: Number, fromZoom: Number): Number\r\n\t// Returns the zoom level that the map would end up at, if it is at `fromZoom`\r\n\t// level and everything is scaled by a factor of `scale`. Inverse of\r\n\t// [`getZoomScale`](#map-getZoomScale).\r\n\tgetScaleZoom: function (scale, fromZoom) {\r\n\t\tvar crs = this.options.crs;\r\n\t\tfromZoom = fromZoom === undefined ? this._zoom : fromZoom;\r\n\t\tvar zoom = crs.zoom(scale * crs.scale(fromZoom));\r\n\t\treturn isNaN(zoom) ? Infinity : zoom;\r\n\t},\r\n\r\n\t// @method project(latlng: LatLng, zoom: Number): Point\r\n\t// Projects a geographical coordinate `LatLng` according to the projection\r\n\t// of the map's CRS, then scales it according to `zoom` and the CRS's\r\n\t// `Transformation`. The result is pixel coordinate relative to\r\n\t// the CRS origin.\r\n\tproject: function (latlng, zoom) {\r\n\t\tzoom = zoom === undefined ? this._zoom : zoom;\r\n\t\treturn this.options.crs.latLngToPoint(toLatLng(latlng), zoom);\r\n\t},\r\n\r\n\t// @method unproject(point: Point, zoom: Number): LatLng\r\n\t// Inverse of [`project`](#map-project).\r\n\tunproject: function (point, zoom) {\r\n\t\tzoom = zoom === undefined ? this._zoom : zoom;\r\n\t\treturn this.options.crs.pointToLatLng(toPoint(point), zoom);\r\n\t},\r\n\r\n\t// @method layerPointToLatLng(point: Point): LatLng\r\n\t// Given a pixel coordinate relative to the [origin pixel](#map-getpixelorigin),\r\n\t// returns the corresponding geographical coordinate (for the current zoom level).\r\n\tlayerPointToLatLng: function (point) {\r\n\t\tvar projectedPoint = toPoint(point).add(this.getPixelOrigin());\r\n\t\treturn this.unproject(projectedPoint);\r\n\t},\r\n\r\n\t// @method latLngToLayerPoint(latlng: LatLng): Point\r\n\t// Given a geographical coordinate, returns the corresponding pixel coordinate\r\n\t// relative to the [origin pixel](#map-getpixelorigin).\r\n\tlatLngToLayerPoint: function (latlng) {\r\n\t\tvar projectedPoint = this.project(toLatLng(latlng))._round();\r\n\t\treturn projectedPoint._subtract(this.getPixelOrigin());\r\n\t},\r\n\r\n\t// @method wrapLatLng(latlng: LatLng): LatLng\r\n\t// Returns a `LatLng` where `lat` and `lng` has been wrapped according to the\r\n\t// map's CRS's `wrapLat` and `wrapLng` properties, if they are outside the\r\n\t// CRS's bounds.\r\n\t// By default this means longitude is wrapped around the dateline so its\r\n\t// value is between -180 and +180 degrees.\r\n\twrapLatLng: function (latlng) {\r\n\t\treturn this.options.crs.wrapLatLng(toLatLng(latlng));\r\n\t},\r\n\r\n\t// @method wrapLatLngBounds(bounds: LatLngBounds): LatLngBounds\r\n\t// Returns a `LatLngBounds` with the same size as the given one, ensuring that\r\n\t// its center is within the CRS's bounds.\r\n\t// By default this means the center longitude is wrapped around the dateline so its\r\n\t// value is between -180 and +180 degrees, and the majority of the bounds\r\n\t// overlaps the CRS's bounds.\r\n\twrapLatLngBounds: function (latlng) {\r\n\t\treturn this.options.crs.wrapLatLngBounds(toLatLngBounds(latlng));\r\n\t},\r\n\r\n\t// @method distance(latlng1: LatLng, latlng2: LatLng): Number\r\n\t// Returns the distance between two geographical coordinates according to\r\n\t// the map's CRS. By default this measures distance in meters.\r\n\tdistance: function (latlng1, latlng2) {\r\n\t\treturn this.options.crs.distance(toLatLng(latlng1), toLatLng(latlng2));\r\n\t},\r\n\r\n\t// @method containerPointToLayerPoint(point: Point): Point\r\n\t// Given a pixel coordinate relative to the map container, returns the corresponding\r\n\t// pixel coordinate relative to the [origin pixel](#map-getpixelorigin).\r\n\tcontainerPointToLayerPoint: function (point) { // (Point)\r\n\t\treturn toPoint(point).subtract(this._getMapPanePos());\r\n\t},\r\n\r\n\t// @method layerPointToContainerPoint(point: Point): Point\r\n\t// Given a pixel coordinate relative to the [origin pixel](#map-getpixelorigin),\r\n\t// returns the corresponding pixel coordinate relative to the map container.\r\n\tlayerPointToContainerPoint: function (point) { // (Point)\r\n\t\treturn toPoint(point).add(this._getMapPanePos());\r\n\t},\r\n\r\n\t// @method containerPointToLatLng(point: Point): LatLng\r\n\t// Given a pixel coordinate relative to the map container, returns\r\n\t// the corresponding geographical coordinate (for the current zoom level).\r\n\tcontainerPointToLatLng: function (point) {\r\n\t\tvar layerPoint = this.containerPointToLayerPoint(toPoint(point));\r\n\t\treturn this.layerPointToLatLng(layerPoint);\r\n\t},\r\n\r\n\t// @method latLngToContainerPoint(latlng: LatLng): Point\r\n\t// Given a geographical coordinate, returns the corresponding pixel coordinate\r\n\t// relative to the map container.\r\n\tlatLngToContainerPoint: function (latlng) {\r\n\t\treturn this.layerPointToContainerPoint(this.latLngToLayerPoint(toLatLng(latlng)));\r\n\t},\r\n\r\n\t// @method mouseEventToContainerPoint(ev: MouseEvent): Point\r\n\t// Given a MouseEvent object, returns the pixel coordinate relative to the\r\n\t// map container where the event took place.\r\n\tmouseEventToContainerPoint: function (e) {\r\n\t\treturn DomEvent.getMousePosition(e, this._container);\r\n\t},\r\n\r\n\t// @method mouseEventToLayerPoint(ev: MouseEvent): Point\r\n\t// Given a MouseEvent object, returns the pixel coordinate relative to\r\n\t// the [origin pixel](#map-getpixelorigin) where the event took place.\r\n\tmouseEventToLayerPoint: function (e) {\r\n\t\treturn this.containerPointToLayerPoint(this.mouseEventToContainerPoint(e));\r\n\t},\r\n\r\n\t// @method mouseEventToLatLng(ev: MouseEvent): LatLng\r\n\t// Given a MouseEvent object, returns geographical coordinate where the\r\n\t// event took place.\r\n\tmouseEventToLatLng: function (e) { // (MouseEvent)\r\n\t\treturn this.layerPointToLatLng(this.mouseEventToLayerPoint(e));\r\n\t},\r\n\r\n\r\n\t// map initialization methods\r\n\r\n\t_initContainer: function (id) {\r\n\t\tvar container = this._container = DomUtil.get(id);\r\n\r\n\t\tif (!container) {\r\n\t\t\tthrow new Error('Map container not found.');\r\n\t\t} else if (container._leaflet_id) {\r\n\t\t\tthrow new Error('Map container is already initialized.');\r\n\t\t}\r\n\r\n\t\tDomEvent.on(container, 'scroll', this._onScroll, this);\r\n\t\tthis._containerId = Util.stamp(container);\r\n\t},\r\n\r\n\t_initLayout: function () {\r\n\t\tvar container = this._container;\r\n\r\n\t\tthis._fadeAnimated = this.options.fadeAnimation && Browser.any3d;\r\n\r\n\t\tDomUtil.addClass(container, 'leaflet-container' +\r\n\t\t\t(Browser.touch ? ' leaflet-touch' : '') +\r\n\t\t\t(Browser.retina ? ' leaflet-retina' : '') +\r\n\t\t\t(Browser.ielt9 ? ' leaflet-oldie' : '') +\r\n\t\t\t(Browser.safari ? ' leaflet-safari' : '') +\r\n\t\t\t(this._fadeAnimated ? ' leaflet-fade-anim' : ''));\r\n\r\n\t\tvar position = DomUtil.getStyle(container, 'position');\r\n\r\n\t\tif (position !== 'absolute' && position !== 'relative' && position !== 'fixed' && position !== 'sticky') {\r\n\t\t\tcontainer.style.position = 'relative';\r\n\t\t}\r\n\r\n\t\tthis._initPanes();\r\n\r\n\t\tif (this._initControlPos) {\r\n\t\t\tthis._initControlPos();\r\n\t\t}\r\n\t},\r\n\r\n\t_initPanes: function () {\r\n\t\tvar panes = this._panes = {};\r\n\t\tthis._paneRenderers = {};\r\n\r\n\t\t// @section\r\n\t\t//\r\n\t\t// Panes are DOM elements used to control the ordering of layers on the map. You\r\n\t\t// can access panes with [`map.getPane`](#map-getpane) or\r\n\t\t// [`map.getPanes`](#map-getpanes) methods. New panes can be created with the\r\n\t\t// [`map.createPane`](#map-createpane) method.\r\n\t\t//\r\n\t\t// Every map has the following default panes that differ only in zIndex.\r\n\t\t//\r\n\t\t// @pane mapPane: HTMLElement = 'auto'\r\n\t\t// Pane that contains all other map panes\r\n\r\n\t\tthis._mapPane = this.createPane('mapPane', this._container);\r\n\t\tDomUtil.setPosition(this._mapPane, new Point(0, 0));\r\n\r\n\t\t// @pane tilePane: HTMLElement = 200\r\n\t\t// Pane for `GridLayer`s and `TileLayer`s\r\n\t\tthis.createPane('tilePane');\r\n\t\t// @pane overlayPane: HTMLElement = 400\r\n\t\t// Pane for vectors (`Path`s, like `Polyline`s and `Polygon`s), `ImageOverlay`s and `VideoOverlay`s\r\n\t\tthis.createPane('overlayPane');\r\n\t\t// @pane shadowPane: HTMLElement = 500\r\n\t\t// Pane for overlay shadows (e.g. `Marker` shadows)\r\n\t\tthis.createPane('shadowPane');\r\n\t\t// @pane markerPane: HTMLElement = 600\r\n\t\t// Pane for `Icon`s of `Marker`s\r\n\t\tthis.createPane('markerPane');\r\n\t\t// @pane tooltipPane: HTMLElement = 650\r\n\t\t// Pane for `Tooltip`s.\r\n\t\tthis.createPane('tooltipPane');\r\n\t\t// @pane popupPane: HTMLElement = 700\r\n\t\t// Pane for `Popup`s.\r\n\t\tthis.createPane('popupPane');\r\n\r\n\t\tif (!this.options.markerZoomAnimation) {\r\n\t\t\tDomUtil.addClass(panes.markerPane, 'leaflet-zoom-hide');\r\n\t\t\tDomUtil.addClass(panes.shadowPane, 'leaflet-zoom-hide');\r\n\t\t}\r\n\t},\r\n\r\n\r\n\t// private methods that modify map state\r\n\r\n\t// @section Map state change events\r\n\t_resetView: function (center, zoom, noMoveStart) {\r\n\t\tDomUtil.setPosition(this._mapPane, new Point(0, 0));\r\n\r\n\t\tvar loading = !this._loaded;\r\n\t\tthis._loaded = true;\r\n\t\tzoom = this._limitZoom(zoom);\r\n\r\n\t\tthis.fire('viewprereset');\r\n\r\n\t\tvar zoomChanged = this._zoom !== zoom;\r\n\t\tthis\r\n\t\t\t._moveStart(zoomChanged, noMoveStart)\r\n\t\t\t._move(center, zoom)\r\n\t\t\t._moveEnd(zoomChanged);\r\n\r\n\t\t// @event viewreset: Event\r\n\t\t// Fired when the map needs to redraw its content (this usually happens\r\n\t\t// on map zoom or load). Very useful for creating custom overlays.\r\n\t\tthis.fire('viewreset');\r\n\r\n\t\t// @event load: Event\r\n\t\t// Fired when the map is initialized (when its center and zoom are set\r\n\t\t// for the first time).\r\n\t\tif (loading) {\r\n\t\t\tthis.fire('load');\r\n\t\t}\r\n\t},\r\n\r\n\t_moveStart: function (zoomChanged, noMoveStart) {\r\n\t\t// @event zoomstart: Event\r\n\t\t// Fired when the map zoom is about to change (e.g. before zoom animation).\r\n\t\t// @event movestart: Event\r\n\t\t// Fired when the view of the map starts changing (e.g. user starts dragging the map).\r\n\t\tif (zoomChanged) {\r\n\t\t\tthis.fire('zoomstart');\r\n\t\t}\r\n\t\tif (!noMoveStart) {\r\n\t\t\tthis.fire('movestart');\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t_move: function (center, zoom, data, supressEvent) {\r\n\t\tif (zoom === undefined) {\r\n\t\t\tzoom = this._zoom;\r\n\t\t}\r\n\t\tvar zoomChanged = this._zoom !== zoom;\r\n\r\n\t\tthis._zoom = zoom;\r\n\t\tthis._lastCenter = center;\r\n\t\tthis._pixelOrigin = this._getNewPixelOrigin(center);\r\n\r\n\t\tif (!supressEvent) {\r\n\t\t\t// @event zoom: Event\r\n\t\t\t// Fired repeatedly during any change in zoom level,\r\n\t\t\t// including zoom and fly animations.\r\n\t\t\tif (zoomChanged || (data && data.pinch)) {\t// Always fire 'zoom' if pinching because #3530\r\n\t\t\t\tthis.fire('zoom', data);\r\n\t\t\t}\r\n\r\n\t\t\t// @event move: Event\r\n\t\t\t// Fired repeatedly during any movement of the map,\r\n\t\t\t// including pan and fly animations.\r\n\t\t\tthis.fire('move', data);\r\n\t\t} else if (data && data.pinch) {\t// Always fire 'zoom' if pinching because #3530\r\n\t\t\tthis.fire('zoom', data);\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t_moveEnd: function (zoomChanged) {\r\n\t\t// @event zoomend: Event\r\n\t\t// Fired when the map zoom changed, after any animations.\r\n\t\tif (zoomChanged) {\r\n\t\t\tthis.fire('zoomend');\r\n\t\t}\r\n\r\n\t\t// @event moveend: Event\r\n\t\t// Fired when the center of the map stops changing\r\n\t\t// (e.g. user stopped dragging the map or after non-centered zoom).\r\n\t\treturn this.fire('moveend');\r\n\t},\r\n\r\n\t_stop: function () {\r\n\t\tUtil.cancelAnimFrame(this._flyToFrame);\r\n\t\tif (this._panAnim) {\r\n\t\t\tthis._panAnim.stop();\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t_rawPanBy: function (offset) {\r\n\t\tDomUtil.setPosition(this._mapPane, this._getMapPanePos().subtract(offset));\r\n\t},\r\n\r\n\t_getZoomSpan: function () {\r\n\t\treturn this.getMaxZoom() - this.getMinZoom();\r\n\t},\r\n\r\n\t_panInsideMaxBounds: function () {\r\n\t\tif (!this._enforcingBounds) {\r\n\t\t\tthis.panInsideBounds(this.options.maxBounds);\r\n\t\t}\r\n\t},\r\n\r\n\t_checkIfLoaded: function () {\r\n\t\tif (!this._loaded) {\r\n\t\t\tthrow new Error('Set map center and zoom first.');\r\n\t\t}\r\n\t},\r\n\r\n\t// DOM event handling\r\n\r\n\t// @section Interaction events\r\n\t_initEvents: function (remove) {\r\n\t\tthis._targets = {};\r\n\t\tthis._targets[Util.stamp(this._container)] = this;\r\n\r\n\t\tvar onOff = remove ? DomEvent.off : DomEvent.on;\r\n\r\n\t\t// @event click: MouseEvent\r\n\t\t// Fired when the user clicks (or taps) the map.\r\n\t\t// @event dblclick: MouseEvent\r\n\t\t// Fired when the user double-clicks (or double-taps) the map.\r\n\t\t// @event mousedown: MouseEvent\r\n\t\t// Fired when the user pushes the mouse button on the map.\r\n\t\t// @event mouseup: MouseEvent\r\n\t\t// Fired when the user releases the mouse button on the map.\r\n\t\t// @event mouseover: MouseEvent\r\n\t\t// Fired when the mouse enters the map.\r\n\t\t// @event mouseout: MouseEvent\r\n\t\t// Fired when the mouse leaves the map.\r\n\t\t// @event mousemove: MouseEvent\r\n\t\t// Fired while the mouse moves over the map.\r\n\t\t// @event contextmenu: MouseEvent\r\n\t\t// Fired when the user pushes the right mouse button on the map, prevents\r\n\t\t// default browser context menu from showing if there are listeners on\r\n\t\t// this event. Also fired on mobile when the user holds a single touch\r\n\t\t// for a second (also called long press).\r\n\t\t// @event keypress: KeyboardEvent\r\n\t\t// Fired when the user presses a key from the keyboard that produces a character value while the map is focused.\r\n\t\t// @event keydown: KeyboardEvent\r\n\t\t// Fired when the user presses a key from the keyboard while the map is focused. Unlike the `keypress` event,\r\n\t\t// the `keydown` event is fired for keys that produce a character value and for keys\r\n\t\t// that do not produce a character value.\r\n\t\t// @event keyup: KeyboardEvent\r\n\t\t// Fired when the user releases a key from the keyboard while the map is focused.\r\n\t\tonOff(this._container, 'click dblclick mousedown mouseup ' +\r\n\t\t\t'mouseover mouseout mousemove contextmenu keypress keydown keyup', this._handleDOMEvent, this);\r\n\r\n\t\tif (this.options.trackResize) {\r\n\t\t\tonOff(window, 'resize', this._onResize, this);\r\n\t\t}\r\n\r\n\t\tif (Browser.any3d && this.options.transform3DLimit) {\r\n\t\t\t(remove ? this.off : this.on).call(this, 'moveend', this._onMoveEnd);\r\n\t\t}\r\n\t},\r\n\r\n\t_onResize: function () {\r\n\t\tUtil.cancelAnimFrame(this._resizeRequest);\r\n\t\tthis._resizeRequest = Util.requestAnimFrame(\r\n\t\t function () { this.invalidateSize({debounceMoveend: true}); }, this);\r\n\t},\r\n\r\n\t_onScroll: function () {\r\n\t\tthis._container.scrollTop = 0;\r\n\t\tthis._container.scrollLeft = 0;\r\n\t},\r\n\r\n\t_onMoveEnd: function () {\r\n\t\tvar pos = this._getMapPanePos();\r\n\t\tif (Math.max(Math.abs(pos.x), Math.abs(pos.y)) >= this.options.transform3DLimit) {\r\n\t\t\t// https://bugzilla.mozilla.org/show_bug.cgi?id=1203873 but Webkit also have\r\n\t\t\t// a pixel offset on very high values, see: https://jsfiddle.net/dg6r5hhb/\r\n\t\t\tthis._resetView(this.getCenter(), this.getZoom());\r\n\t\t}\r\n\t},\r\n\r\n\t_findEventTargets: function (e, type) {\r\n\t\tvar targets = [],\r\n\t\t target,\r\n\t\t isHover = type === 'mouseout' || type === 'mouseover',\r\n\t\t src = e.target || e.srcElement,\r\n\t\t dragging = false;\r\n\r\n\t\twhile (src) {\r\n\t\t\ttarget = this._targets[Util.stamp(src)];\r\n\t\t\tif (target && (type === 'click' || type === 'preclick') && this._draggableMoved(target)) {\r\n\t\t\t\t// Prevent firing click after you just dragged an object.\r\n\t\t\t\tdragging = true;\r\n\t\t\t\tbreak;\r\n\t\t\t}\r\n\t\t\tif (target && target.listens(type, true)) {\r\n\t\t\t\tif (isHover && !DomEvent.isExternalTarget(src, e)) { break; }\r\n\t\t\t\ttargets.push(target);\r\n\t\t\t\tif (isHover) { break; }\r\n\t\t\t}\r\n\t\t\tif (src === this._container) { break; }\r\n\t\t\tsrc = src.parentNode;\r\n\t\t}\r\n\t\tif (!targets.length && !dragging && !isHover && this.listens(type, true)) {\r\n\t\t\ttargets = [this];\r\n\t\t}\r\n\t\treturn targets;\r\n\t},\r\n\r\n\t_isClickDisabled: function (el) {\r\n\t\twhile (el && el !== this._container) {\r\n\t\t\tif (el['_leaflet_disable_click']) { return true; }\r\n\t\t\tel = el.parentNode;\r\n\t\t}\r\n\t},\r\n\r\n\t_handleDOMEvent: function (e) {\r\n\t\tvar el = (e.target || e.srcElement);\r\n\t\tif (!this._loaded || el['_leaflet_disable_events'] || e.type === 'click' && this._isClickDisabled(el)) {\r\n\t\t\treturn;\r\n\t\t}\r\n\r\n\t\tvar type = e.type;\r\n\r\n\t\tif (type === 'mousedown') {\r\n\t\t\t// prevents outline when clicking on keyboard-focusable element\r\n\t\t\tDomUtil.preventOutline(el);\r\n\t\t}\r\n\r\n\t\tthis._fireDOMEvent(e, type);\r\n\t},\r\n\r\n\t_mouseEvents: ['click', 'dblclick', 'mouseover', 'mouseout', 'contextmenu'],\r\n\r\n\t_fireDOMEvent: function (e, type, canvasTargets) {\r\n\r\n\t\tif (e.type === 'click') {\r\n\t\t\t// Fire a synthetic 'preclick' event which propagates up (mainly for closing popups).\r\n\t\t\t// @event preclick: MouseEvent\r\n\t\t\t// Fired before mouse click on the map (sometimes useful when you\r\n\t\t\t// want something to happen on click before any existing click\r\n\t\t\t// handlers start running).\r\n\t\t\tvar synth = Util.extend({}, e);\r\n\t\t\tsynth.type = 'preclick';\r\n\t\t\tthis._fireDOMEvent(synth, synth.type, canvasTargets);\r\n\t\t}\r\n\r\n\t\t// Find the layer the event is propagating from and its parents.\r\n\t\tvar targets = this._findEventTargets(e, type);\r\n\r\n\t\tif (canvasTargets) {\r\n\t\t\tvar filtered = []; // pick only targets with listeners\r\n\t\t\tfor (var i = 0; i < canvasTargets.length; i++) {\r\n\t\t\t\tif (canvasTargets[i].listens(type, true)) {\r\n\t\t\t\t\tfiltered.push(canvasTargets[i]);\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\t\ttargets = filtered.concat(targets);\r\n\t\t}\r\n\r\n\t\tif (!targets.length) { return; }\r\n\r\n\t\tif (type === 'contextmenu') {\r\n\t\t\tDomEvent.preventDefault(e);\r\n\t\t}\r\n\r\n\t\tvar target = targets[0];\r\n\t\tvar data = {\r\n\t\t\toriginalEvent: e\r\n\t\t};\r\n\r\n\t\tif (e.type !== 'keypress' && e.type !== 'keydown' && e.type !== 'keyup') {\r\n\t\t\tvar isMarker = target.getLatLng && (!target._radius || target._radius <= 10);\r\n\t\t\tdata.containerPoint = isMarker ?\r\n\t\t\t\tthis.latLngToContainerPoint(target.getLatLng()) : this.mouseEventToContainerPoint(e);\r\n\t\t\tdata.layerPoint = this.containerPointToLayerPoint(data.containerPoint);\r\n\t\t\tdata.latlng = isMarker ? target.getLatLng() : this.layerPointToLatLng(data.layerPoint);\r\n\t\t}\r\n\r\n\t\tfor (i = 0; i < targets.length; i++) {\r\n\t\t\ttargets[i].fire(type, data, true);\r\n\t\t\tif (data.originalEvent._stopped ||\r\n\t\t\t\t(targets[i].options.bubblingMouseEvents === false && Util.indexOf(this._mouseEvents, type) !== -1)) { return; }\r\n\t\t}\r\n\t},\r\n\r\n\t_draggableMoved: function (obj) {\r\n\t\tobj = obj.dragging && obj.dragging.enabled() ? obj : this;\r\n\t\treturn (obj.dragging && obj.dragging.moved()) || (this.boxZoom && this.boxZoom.moved());\r\n\t},\r\n\r\n\t_clearHandlers: function () {\r\n\t\tfor (var i = 0, len = this._handlers.length; i < len; i++) {\r\n\t\t\tthis._handlers[i].disable();\r\n\t\t}\r\n\t},\r\n\r\n\t// @section Other Methods\r\n\r\n\t// @method whenReady(fn: Function, context?: Object): this\r\n\t// Runs the given function `fn` when the map gets initialized with\r\n\t// a view (center and zoom) and at least one layer, or immediately\r\n\t// if it's already initialized, optionally passing a function context.\r\n\twhenReady: function (callback, context) {\r\n\t\tif (this._loaded) {\r\n\t\t\tcallback.call(context || this, {target: this});\r\n\t\t} else {\r\n\t\t\tthis.on('load', callback, context);\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\r\n\t// private methods for getting map state\r\n\r\n\t_getMapPanePos: function () {\r\n\t\treturn DomUtil.getPosition(this._mapPane) || new Point(0, 0);\r\n\t},\r\n\r\n\t_moved: function () {\r\n\t\tvar pos = this._getMapPanePos();\r\n\t\treturn pos && !pos.equals([0, 0]);\r\n\t},\r\n\r\n\t_getTopLeftPoint: function (center, zoom) {\r\n\t\tvar pixelOrigin = center && zoom !== undefined ?\r\n\t\t\tthis._getNewPixelOrigin(center, zoom) :\r\n\t\t\tthis.getPixelOrigin();\r\n\t\treturn pixelOrigin.subtract(this._getMapPanePos());\r\n\t},\r\n\r\n\t_getNewPixelOrigin: function (center, zoom) {\r\n\t\tvar viewHalf = this.getSize()._divideBy(2);\r\n\t\treturn this.project(center, zoom)._subtract(viewHalf)._add(this._getMapPanePos())._round();\r\n\t},\r\n\r\n\t_latLngToNewLayerPoint: function (latlng, zoom, center) {\r\n\t\tvar topLeft = this._getNewPixelOrigin(center, zoom);\r\n\t\treturn this.project(latlng, zoom)._subtract(topLeft);\r\n\t},\r\n\r\n\t_latLngBoundsToNewLayerBounds: function (latLngBounds, zoom, center) {\r\n\t\tvar topLeft = this._getNewPixelOrigin(center, zoom);\r\n\t\treturn toBounds([\r\n\t\t\tthis.project(latLngBounds.getSouthWest(), zoom)._subtract(topLeft),\r\n\t\t\tthis.project(latLngBounds.getNorthWest(), zoom)._subtract(topLeft),\r\n\t\t\tthis.project(latLngBounds.getSouthEast(), zoom)._subtract(topLeft),\r\n\t\t\tthis.project(latLngBounds.getNorthEast(), zoom)._subtract(topLeft)\r\n\t\t]);\r\n\t},\r\n\r\n\t// layer point of the current center\r\n\t_getCenterLayerPoint: function () {\r\n\t\treturn this.containerPointToLayerPoint(this.getSize()._divideBy(2));\r\n\t},\r\n\r\n\t// offset of the specified place to the current center in pixels\r\n\t_getCenterOffset: function (latlng) {\r\n\t\treturn this.latLngToLayerPoint(latlng).subtract(this._getCenterLayerPoint());\r\n\t},\r\n\r\n\t// adjust center for view to get inside bounds\r\n\t_limitCenter: function (center, zoom, bounds) {\r\n\r\n\t\tif (!bounds) { return center; }\r\n\r\n\t\tvar centerPoint = this.project(center, zoom),\r\n\t\t viewHalf = this.getSize().divideBy(2),\r\n\t\t viewBounds = new Bounds(centerPoint.subtract(viewHalf), centerPoint.add(viewHalf)),\r\n\t\t offset = this._getBoundsOffset(viewBounds, bounds, zoom);\r\n\r\n\t\t// If offset is less than a pixel, ignore.\r\n\t\t// This prevents unstable projections from getting into\r\n\t\t// an infinite loop of tiny offsets.\r\n\t\tif (Math.abs(offset.x) <= 1 && Math.abs(offset.y) <= 1) {\r\n\t\t\treturn center;\r\n\t\t}\r\n\r\n\t\treturn this.unproject(centerPoint.add(offset), zoom);\r\n\t},\r\n\r\n\t// adjust offset for view to get inside bounds\r\n\t_limitOffset: function (offset, bounds) {\r\n\t\tif (!bounds) { return offset; }\r\n\r\n\t\tvar viewBounds = this.getPixelBounds(),\r\n\t\t newBounds = new Bounds(viewBounds.min.add(offset), viewBounds.max.add(offset));\r\n\r\n\t\treturn offset.add(this._getBoundsOffset(newBounds, bounds));\r\n\t},\r\n\r\n\t// returns offset needed for pxBounds to get inside maxBounds at a specified zoom\r\n\t_getBoundsOffset: function (pxBounds, maxBounds, zoom) {\r\n\t\tvar projectedMaxBounds = toBounds(\r\n\t\t this.project(maxBounds.getNorthEast(), zoom),\r\n\t\t this.project(maxBounds.getSouthWest(), zoom)\r\n\t\t ),\r\n\t\t minOffset = projectedMaxBounds.min.subtract(pxBounds.min),\r\n\t\t maxOffset = projectedMaxBounds.max.subtract(pxBounds.max),\r\n\r\n\t\t dx = this._rebound(minOffset.x, -maxOffset.x),\r\n\t\t dy = this._rebound(minOffset.y, -maxOffset.y);\r\n\r\n\t\treturn new Point(dx, dy);\r\n\t},\r\n\r\n\t_rebound: function (left, right) {\r\n\t\treturn left + right > 0 ?\r\n\t\t\tMath.round(left - right) / 2 :\r\n\t\t\tMath.max(0, Math.ceil(left)) - Math.max(0, Math.floor(right));\r\n\t},\r\n\r\n\t_limitZoom: function (zoom) {\r\n\t\tvar min = this.getMinZoom(),\r\n\t\t max = this.getMaxZoom(),\r\n\t\t snap = Browser.any3d ? this.options.zoomSnap : 1;\r\n\t\tif (snap) {\r\n\t\t\tzoom = Math.round(zoom / snap) * snap;\r\n\t\t}\r\n\t\treturn Math.max(min, Math.min(max, zoom));\r\n\t},\r\n\r\n\t_onPanTransitionStep: function () {\r\n\t\tthis.fire('move');\r\n\t},\r\n\r\n\t_onPanTransitionEnd: function () {\r\n\t\tDomUtil.removeClass(this._mapPane, 'leaflet-pan-anim');\r\n\t\tthis.fire('moveend');\r\n\t},\r\n\r\n\t_tryAnimatedPan: function (center, options) {\r\n\t\t// difference between the new and current centers in pixels\r\n\t\tvar offset = this._getCenterOffset(center)._trunc();\r\n\r\n\t\t// don't animate too far unless animate: true specified in options\r\n\t\tif ((options && options.animate) !== true && !this.getSize().contains(offset)) { return false; }\r\n\r\n\t\tthis.panBy(offset, options);\r\n\r\n\t\treturn true;\r\n\t},\r\n\r\n\t_createAnimProxy: function () {\r\n\r\n\t\tvar proxy = this._proxy = DomUtil.create('div', 'leaflet-proxy leaflet-zoom-animated');\r\n\t\tthis._panes.mapPane.appendChild(proxy);\r\n\r\n\t\tthis.on('zoomanim', function (e) {\r\n\t\t\tvar prop = DomUtil.TRANSFORM,\r\n\t\t\t transform = this._proxy.style[prop];\r\n\r\n\t\t\tDomUtil.setTransform(this._proxy, this.project(e.center, e.zoom), this.getZoomScale(e.zoom, 1));\r\n\r\n\t\t\t// workaround for case when transform is the same and so transitionend event is not fired\r\n\t\t\tif (transform === this._proxy.style[prop] && this._animatingZoom) {\r\n\t\t\t\tthis._onZoomTransitionEnd();\r\n\t\t\t}\r\n\t\t}, this);\r\n\r\n\t\tthis.on('load moveend', this._animMoveEnd, this);\r\n\r\n\t\tthis._on('unload', this._destroyAnimProxy, this);\r\n\t},\r\n\r\n\t_destroyAnimProxy: function () {\r\n\t\tDomUtil.remove(this._proxy);\r\n\t\tthis.off('load moveend', this._animMoveEnd, this);\r\n\t\tdelete this._proxy;\r\n\t},\r\n\r\n\t_animMoveEnd: function () {\r\n\t\tvar c = this.getCenter(),\r\n\t\t z = this.getZoom();\r\n\t\tDomUtil.setTransform(this._proxy, this.project(c, z), this.getZoomScale(z, 1));\r\n\t},\r\n\r\n\t_catchTransitionEnd: function (e) {\r\n\t\tif (this._animatingZoom && e.propertyName.indexOf('transform') >= 0) {\r\n\t\t\tthis._onZoomTransitionEnd();\r\n\t\t}\r\n\t},\r\n\r\n\t_nothingToAnimate: function () {\r\n\t\treturn !this._container.getElementsByClassName('leaflet-zoom-animated').length;\r\n\t},\r\n\r\n\t_tryAnimatedZoom: function (center, zoom, options) {\r\n\r\n\t\tif (this._animatingZoom) { return true; }\r\n\r\n\t\toptions = options || {};\r\n\r\n\t\t// don't animate if disabled, not supported or zoom difference is too large\r\n\t\tif (!this._zoomAnimated || options.animate === false || this._nothingToAnimate() ||\r\n\t\t Math.abs(zoom - this._zoom) > this.options.zoomAnimationThreshold) { return false; }\r\n\r\n\t\t// offset is the pixel coords of the zoom origin relative to the current center\r\n\t\tvar scale = this.getZoomScale(zoom),\r\n\t\t offset = this._getCenterOffset(center)._divideBy(1 - 1 / scale);\r\n\r\n\t\t// don't animate if the zoom origin isn't within one screen from the current center, unless forced\r\n\t\tif (options.animate !== true && !this.getSize().contains(offset)) { return false; }\r\n\r\n\t\tUtil.requestAnimFrame(function () {\r\n\t\t\tthis\r\n\t\t\t ._moveStart(true, options.noMoveStart || false)\r\n\t\t\t ._animateZoom(center, zoom, true);\r\n\t\t}, this);\r\n\r\n\t\treturn true;\r\n\t},\r\n\r\n\t_animateZoom: function (center, zoom, startAnim, noUpdate) {\r\n\t\tif (!this._mapPane) { return; }\r\n\r\n\t\tif (startAnim) {\r\n\t\t\tthis._animatingZoom = true;\r\n\r\n\t\t\t// remember what center/zoom to set after animation\r\n\t\t\tthis._animateToCenter = center;\r\n\t\t\tthis._animateToZoom = zoom;\r\n\r\n\t\t\tDomUtil.addClass(this._mapPane, 'leaflet-zoom-anim');\r\n\t\t}\r\n\r\n\t\t// @section Other Events\r\n\t\t// @event zoomanim: ZoomAnimEvent\r\n\t\t// Fired at least once per zoom animation. For continuous zoom, like pinch zooming, fired once per frame during zoom.\r\n\t\tthis.fire('zoomanim', {\r\n\t\t\tcenter: center,\r\n\t\t\tzoom: zoom,\r\n\t\t\tnoUpdate: noUpdate\r\n\t\t});\r\n\r\n\t\tif (!this._tempFireZoomEvent) {\r\n\t\t\tthis._tempFireZoomEvent = this._zoom !== this._animateToZoom;\r\n\t\t}\r\n\r\n\t\tthis._move(this._animateToCenter, this._animateToZoom, undefined, true);\r\n\r\n\t\t// Work around webkit not firing 'transitionend', see https://github.com/Leaflet/Leaflet/issues/3689, 2693\r\n\t\tsetTimeout(Util.bind(this._onZoomTransitionEnd, this), 250);\r\n\t},\r\n\r\n\t_onZoomTransitionEnd: function () {\r\n\t\tif (!this._animatingZoom) { return; }\r\n\r\n\t\tif (this._mapPane) {\r\n\t\t\tDomUtil.removeClass(this._mapPane, 'leaflet-zoom-anim');\r\n\t\t}\r\n\r\n\t\tthis._animatingZoom = false;\r\n\r\n\t\tthis._move(this._animateToCenter, this._animateToZoom, undefined, true);\r\n\r\n\t\tif (this._tempFireZoomEvent) {\r\n\t\t\tthis.fire('zoom');\r\n\t\t}\r\n\t\tdelete this._tempFireZoomEvent;\r\n\r\n\t\tthis.fire('move');\r\n\r\n\t\tthis._moveEnd(true);\r\n\t}\r\n});\r\n\r\n// @section\r\n\r\n// @factory L.map(id: String, options?: Map options)\r\n// Instantiates a map object given the DOM ID of a `<div>` element\r\n// and optionally an object literal with `Map options`.\r\n//\r\n// @alternative\r\n// @factory L.map(el: HTMLElement, options?: Map options)\r\n// Instantiates a map object given an instance of a `<div>` HTML element\r\n// and optionally an object literal with `Map options`.\r\nexport function createMap(id, options) {\r\n\treturn new Map(id, options);\r\n}\r\n", "\r\nimport {Class} from '../core/Class';\r\nimport {Map} from '../map/Map';\r\nimport * as Util from '../core/Util';\r\nimport * as DomUtil from '../dom/DomUtil';\r\n\r\n/*\r\n * @class Control\r\n * @aka L.Control\r\n * @inherits Class\r\n *\r\n * L.Control is a base class for implementing map controls. Handles positioning.\r\n * All other controls extend from this class.\r\n */\r\n\r\nexport var Control = Class.extend({\r\n\t// @section\r\n\t// @aka Control Options\r\n\toptions: {\r\n\t\t// @option position: String = 'topright'\r\n\t\t// The position of the control (one of the map corners). Possible values are `'topleft'`,\r\n\t\t// `'topright'`, `'bottomleft'` or `'bottomright'`\r\n\t\tposition: 'topright'\r\n\t},\r\n\r\n\tinitialize: function (options) {\r\n\t\tUtil.setOptions(this, options);\r\n\t},\r\n\r\n\t/* @section\r\n\t * Classes extending L.Control will inherit the following methods:\r\n\t *\r\n\t * @method getPosition: string\r\n\t * Returns the position of the control.\r\n\t */\r\n\tgetPosition: function () {\r\n\t\treturn this.options.position;\r\n\t},\r\n\r\n\t// @method setPosition(position: string): this\r\n\t// Sets the position of the control.\r\n\tsetPosition: function (position) {\r\n\t\tvar map = this._map;\r\n\r\n\t\tif (map) {\r\n\t\t\tmap.removeControl(this);\r\n\t\t}\r\n\r\n\t\tthis.options.position = position;\r\n\r\n\t\tif (map) {\r\n\t\t\tmap.addControl(this);\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method getContainer: HTMLElement\r\n\t// Returns the HTMLElement that contains the control.\r\n\tgetContainer: function () {\r\n\t\treturn this._container;\r\n\t},\r\n\r\n\t// @method addTo(map: Map): this\r\n\t// Adds the control to the given map.\r\n\taddTo: function (map) {\r\n\t\tthis.remove();\r\n\t\tthis._map = map;\r\n\r\n\t\tvar container = this._container = this.onAdd(map),\r\n\t\t pos = this.getPosition(),\r\n\t\t corner = map._controlCorners[pos];\r\n\r\n\t\tDomUtil.addClass(container, 'leaflet-control');\r\n\r\n\t\tif (pos.indexOf('bottom') !== -1) {\r\n\t\t\tcorner.insertBefore(container, corner.firstChild);\r\n\t\t} else {\r\n\t\t\tcorner.appendChild(container);\r\n\t\t}\r\n\r\n\t\tthis._map.on('unload', this.remove, this);\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method remove: this\r\n\t// Removes the control from the map it is currently active on.\r\n\tremove: function () {\r\n\t\tif (!this._map) {\r\n\t\t\treturn this;\r\n\t\t}\r\n\r\n\t\tDomUtil.remove(this._container);\r\n\r\n\t\tif (this.onRemove) {\r\n\t\t\tthis.onRemove(this._map);\r\n\t\t}\r\n\r\n\t\tthis._map.off('unload', this.remove, this);\r\n\t\tthis._map = null;\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t_refocusOnMap: function (e) {\r\n\t\t// if map exists and event is not a keyboard event\r\n\t\tif (this._map && e && e.screenX > 0 && e.screenY > 0) {\r\n\t\t\tthis._map.getContainer().focus();\r\n\t\t}\r\n\t}\r\n});\r\n\r\nexport var control = function (options) {\r\n\treturn new Control(options);\r\n};\r\n\r\n/* @section Extension methods\r\n * @uninheritable\r\n *\r\n * Every control should extend from `L.Control` and (re-)implement the following methods.\r\n *\r\n * @method onAdd(map: Map): HTMLElement\r\n * Should return the container DOM element for the control and add listeners on relevant map events. Called on [`control.addTo(map)`](#control-addTo).\r\n *\r\n * @method onRemove(map: Map)\r\n * Optional method. Should contain all clean up code that removes the listeners previously added in [`onAdd`](#control-onadd). Called on [`control.remove()`](#control-remove).\r\n */\r\n\r\n/* @namespace Map\r\n * @section Methods for Layers and Controls\r\n */\r\nMap.include({\r\n\t// @method addControl(control: Control): this\r\n\t// Adds the given control to the map\r\n\taddControl: function (control) {\r\n\t\tcontrol.addTo(this);\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method removeControl(control: Control): this\r\n\t// Removes the given control from the map\r\n\tremoveControl: function (control) {\r\n\t\tcontrol.remove();\r\n\t\treturn this;\r\n\t},\r\n\r\n\t_initControlPos: function () {\r\n\t\tvar corners = this._controlCorners = {},\r\n\t\t l = 'leaflet-',\r\n\t\t container = this._controlContainer =\r\n\t\t DomUtil.create('div', l + 'control-container', this._container);\r\n\r\n\t\tfunction createCorner(vSide, hSide) {\r\n\t\t\tvar className = l + vSide + ' ' + l + hSide;\r\n\r\n\t\t\tcorners[vSide + hSide] = DomUtil.create('div', className, container);\r\n\t\t}\r\n\r\n\t\tcreateCorner('top', 'left');\r\n\t\tcreateCorner('top', 'right');\r\n\t\tcreateCorner('bottom', 'left');\r\n\t\tcreateCorner('bottom', 'right');\r\n\t},\r\n\r\n\t_clearControlPos: function () {\r\n\t\tfor (var i in this._controlCorners) {\r\n\t\t\tDomUtil.remove(this._controlCorners[i]);\r\n\t\t}\r\n\t\tDomUtil.remove(this._controlContainer);\r\n\t\tdelete this._controlCorners;\r\n\t\tdelete this._controlContainer;\r\n\t}\r\n});\r\n", "\r\nimport {Control} from './Control';\r\nimport * as Util from '../core/Util';\r\nimport * as DomEvent from '../dom/DomEvent';\r\nimport * as DomUtil from '../dom/DomUtil';\r\n\r\n/*\r\n * @class Control.Layers\r\n * @aka L.Control.Layers\r\n * @inherits Control\r\n *\r\n * The layers control gives users the ability to switch between different base layers and switch overlays on/off (check out the [detailed example](https://leafletjs.com/examples/layers-control/)). Extends `Control`.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * var baseLayers = {\r\n * \t\"Mapbox\": mapbox,\r\n * \t\"OpenStreetMap\": osm\r\n * };\r\n *\r\n * var overlays = {\r\n * \t\"Marker\": marker,\r\n * \t\"Roads\": roadsLayer\r\n * };\r\n *\r\n * L.control.layers(baseLayers, overlays).addTo(map);\r\n * ```\r\n *\r\n * The `baseLayers` and `overlays` parameters are object literals with layer names as keys and `Layer` objects as values:\r\n *\r\n * ```js\r\n * {\r\n * \"<someName1>\": layer1,\r\n * \"<someName2>\": layer2\r\n * }\r\n * ```\r\n *\r\n * The layer names can contain HTML, which allows you to add additional styling to the items:\r\n *\r\n * ```js\r\n * {\"<img src='my-layer-icon' /> <span class='my-layer-item'>My Layer</span>\": myLayer}\r\n * ```\r\n */\r\n\r\nexport var Layers = Control.extend({\r\n\t// @section\r\n\t// @aka Control.Layers options\r\n\toptions: {\r\n\t\t// @option collapsed: Boolean = true\r\n\t\t// If `true`, the control will be collapsed into an icon and expanded on mouse hover, touch, or keyboard activation.\r\n\t\tcollapsed: true,\r\n\t\tposition: 'topright',\r\n\r\n\t\t// @option autoZIndex: Boolean = true\r\n\t\t// If `true`, the control will assign zIndexes in increasing order to all of its layers so that the order is preserved when switching them on/off.\r\n\t\tautoZIndex: true,\r\n\r\n\t\t// @option hideSingleBase: Boolean = false\r\n\t\t// If `true`, the base layers in the control will be hidden when there is only one.\r\n\t\thideSingleBase: false,\r\n\r\n\t\t// @option sortLayers: Boolean = false\r\n\t\t// Whether to sort the layers. When `false`, layers will keep the order\r\n\t\t// in which they were added to the control.\r\n\t\tsortLayers: false,\r\n\r\n\t\t// @option sortFunction: Function = *\r\n\t\t// A [compare function](https://developer.mozilla.org/docs/Web/JavaScript/Reference/Global_Objects/Array/sort)\r\n\t\t// that will be used for sorting the layers, when `sortLayers` is `true`.\r\n\t\t// The function receives both the `L.Layer` instances and their names, as in\r\n\t\t// `sortFunction(layerA, layerB, nameA, nameB)`.\r\n\t\t// By default, it sorts layers alphabetically by their name.\r\n\t\tsortFunction: function (layerA, layerB, nameA, nameB) {\r\n\t\t\treturn nameA < nameB ? -1 : (nameB < nameA ? 1 : 0);\r\n\t\t}\r\n\t},\r\n\r\n\tinitialize: function (baseLayers, overlays, options) {\r\n\t\tUtil.setOptions(this, options);\r\n\r\n\t\tthis._layerControlInputs = [];\r\n\t\tthis._layers = [];\r\n\t\tthis._lastZIndex = 0;\r\n\t\tthis._handlingClick = false;\r\n\t\tthis._preventClick = false;\r\n\r\n\t\tfor (var i in baseLayers) {\r\n\t\t\tthis._addLayer(baseLayers[i], i);\r\n\t\t}\r\n\r\n\t\tfor (i in overlays) {\r\n\t\t\tthis._addLayer(overlays[i], i, true);\r\n\t\t}\r\n\t},\r\n\r\n\tonAdd: function (map) {\r\n\t\tthis._initLayout();\r\n\t\tthis._update();\r\n\r\n\t\tthis._map = map;\r\n\t\tmap.on('zoomend', this._checkDisabledLayers, this);\r\n\r\n\t\tfor (var i = 0; i < this._layers.length; i++) {\r\n\t\t\tthis._layers[i].layer.on('add remove', this._onLayerChange, this);\r\n\t\t}\r\n\r\n\t\treturn this._container;\r\n\t},\r\n\r\n\taddTo: function (map) {\r\n\t\tControl.prototype.addTo.call(this, map);\r\n\t\t// Trigger expand after Layers Control has been inserted into DOM so that is now has an actual height.\r\n\t\treturn this._expandIfNotCollapsed();\r\n\t},\r\n\r\n\tonRemove: function () {\r\n\t\tthis._map.off('zoomend', this._checkDisabledLayers, this);\r\n\r\n\t\tfor (var i = 0; i < this._layers.length; i++) {\r\n\t\t\tthis._layers[i].layer.off('add remove', this._onLayerChange, this);\r\n\t\t}\r\n\t},\r\n\r\n\t// @method addBaseLayer(layer: Layer, name: String): this\r\n\t// Adds a base layer (radio button entry) with the given name to the control.\r\n\taddBaseLayer: function (layer, name) {\r\n\t\tthis._addLayer(layer, name);\r\n\t\treturn (this._map) ? this._update() : this;\r\n\t},\r\n\r\n\t// @method addOverlay(layer: Layer, name: String): this\r\n\t// Adds an overlay (checkbox entry) with the given name to the control.\r\n\taddOverlay: function (layer, name) {\r\n\t\tthis._addLayer(layer, name, true);\r\n\t\treturn (this._map) ? this._update() : this;\r\n\t},\r\n\r\n\t// @method removeLayer(layer: Layer): this\r\n\t// Remove the given layer from the control.\r\n\tremoveLayer: function (layer) {\r\n\t\tlayer.off('add remove', this._onLayerChange, this);\r\n\r\n\t\tvar obj = this._getLayer(Util.stamp(layer));\r\n\t\tif (obj) {\r\n\t\t\tthis._layers.splice(this._layers.indexOf(obj), 1);\r\n\t\t}\r\n\t\treturn (this._map) ? this._update() : this;\r\n\t},\r\n\r\n\t// @method expand(): this\r\n\t// Expand the control container if collapsed.\r\n\texpand: function () {\r\n\t\tDomUtil.addClass(this._container, 'leaflet-control-layers-expanded');\r\n\t\tthis._section.style.height = null;\r\n\t\tvar acceptableHeight = this._map.getSize().y - (this._container.offsetTop + 50);\r\n\t\tif (acceptableHeight < this._section.clientHeight) {\r\n\t\t\tDomUtil.addClass(this._section, 'leaflet-control-layers-scrollbar');\r\n\t\t\tthis._section.style.height = acceptableHeight + 'px';\r\n\t\t} else {\r\n\t\t\tDomUtil.removeClass(this._section, 'leaflet-control-layers-scrollbar');\r\n\t\t}\r\n\t\tthis._checkDisabledLayers();\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method collapse(): this\r\n\t// Collapse the control container if expanded.\r\n\tcollapse: function () {\r\n\t\tDomUtil.removeClass(this._container, 'leaflet-control-layers-expanded');\r\n\t\treturn this;\r\n\t},\r\n\r\n\t_initLayout: function () {\r\n\t\tvar className = 'leaflet-control-layers',\r\n\t\t container = this._container = DomUtil.create('div', className),\r\n\t\t collapsed = this.options.collapsed;\r\n\r\n\t\t// makes this work on IE touch devices by stopping it from firing a mouseout event when the touch is released\r\n\t\tcontainer.setAttribute('aria-haspopup', true);\r\n\r\n\t\tDomEvent.disableClickPropagation(container);\r\n\t\tDomEvent.disableScrollPropagation(container);\r\n\r\n\t\tvar section = this._section = DomUtil.create('section', className + '-list');\r\n\r\n\t\tif (collapsed) {\r\n\t\t\tthis._map.on('click', this.collapse, this);\r\n\r\n\t\t\tDomEvent.on(container, {\r\n\t\t\t\tmouseenter: this._expandSafely,\r\n\t\t\t\tmouseleave: this.collapse\r\n\t\t\t}, this);\r\n\t\t}\r\n\r\n\t\tvar link = this._layersLink = DomUtil.create('a', className + '-toggle', container);\r\n\t\tlink.href = '#';\r\n\t\tlink.title = 'Layers';\r\n\t\tlink.setAttribute('role', 'button');\r\n\r\n\t\tDomEvent.on(link, {\r\n\t\t\tkeydown: function (e) {\r\n\t\t\t\tif (e.keyCode === 13) {\r\n\t\t\t\t\tthis._expandSafely();\r\n\t\t\t\t}\r\n\t\t\t},\r\n\t\t\t// Certain screen readers intercept the key event and instead send a click event\r\n\t\t\tclick: function (e) {\r\n\t\t\t\tDomEvent.preventDefault(e);\r\n\t\t\t\tthis._expandSafely();\r\n\t\t\t}\r\n\t\t}, this);\r\n\r\n\t\tif (!collapsed) {\r\n\t\t\tthis.expand();\r\n\t\t}\r\n\r\n\t\tthis._baseLayersList = DomUtil.create('div', className + '-base', section);\r\n\t\tthis._separator = DomUtil.create('div', className + '-separator', section);\r\n\t\tthis._overlaysList = DomUtil.create('div', className + '-overlays', section);\r\n\r\n\t\tcontainer.appendChild(section);\r\n\t},\r\n\r\n\t_getLayer: function (id) {\r\n\t\tfor (var i = 0; i < this._layers.length; i++) {\r\n\r\n\t\t\tif (this._layers[i] && Util.stamp(this._layers[i].layer) === id) {\r\n\t\t\t\treturn this._layers[i];\r\n\t\t\t}\r\n\t\t}\r\n\t},\r\n\r\n\t_addLayer: function (layer, name, overlay) {\r\n\t\tif (this._map) {\r\n\t\t\tlayer.on('add remove', this._onLayerChange, this);\r\n\t\t}\r\n\r\n\t\tthis._layers.push({\r\n\t\t\tlayer: layer,\r\n\t\t\tname: name,\r\n\t\t\toverlay: overlay\r\n\t\t});\r\n\r\n\t\tif (this.options.sortLayers) {\r\n\t\t\tthis._layers.sort(Util.bind(function (a, b) {\r\n\t\t\t\treturn this.options.sortFunction(a.layer, b.layer, a.name, b.name);\r\n\t\t\t}, this));\r\n\t\t}\r\n\r\n\t\tif (this.options.autoZIndex && layer.setZIndex) {\r\n\t\t\tthis._lastZIndex++;\r\n\t\t\tlayer.setZIndex(this._lastZIndex);\r\n\t\t}\r\n\r\n\t\tthis._expandIfNotCollapsed();\r\n\t},\r\n\r\n\t_update: function () {\r\n\t\tif (!this._container) { return this; }\r\n\r\n\t\tDomUtil.empty(this._baseLayersList);\r\n\t\tDomUtil.empty(this._overlaysList);\r\n\r\n\t\tthis._layerControlInputs = [];\r\n\t\tvar baseLayersPresent, overlaysPresent, i, obj, baseLayersCount = 0;\r\n\r\n\t\tfor (i = 0; i < this._layers.length; i++) {\r\n\t\t\tobj = this._layers[i];\r\n\t\t\tthis._addItem(obj);\r\n\t\t\toverlaysPresent = overlaysPresent || obj.overlay;\r\n\t\t\tbaseLayersPresent = baseLayersPresent || !obj.overlay;\r\n\t\t\tbaseLayersCount += !obj.overlay ? 1 : 0;\r\n\t\t}\r\n\r\n\t\t// Hide base layers section if there's only one layer.\r\n\t\tif (this.options.hideSingleBase) {\r\n\t\t\tbaseLayersPresent = baseLayersPresent && baseLayersCount > 1;\r\n\t\t\tthis._baseLayersList.style.display = baseLayersPresent ? '' : 'none';\r\n\t\t}\r\n\r\n\t\tthis._separator.style.display = overlaysPresent && baseLayersPresent ? '' : 'none';\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t_onLayerChange: function (e) {\r\n\t\tif (!this._handlingClick) {\r\n\t\t\tthis._update();\r\n\t\t}\r\n\r\n\t\tvar obj = this._getLayer(Util.stamp(e.target));\r\n\r\n\t\t// @namespace Map\r\n\t\t// @section Layer events\r\n\t\t// @event baselayerchange: LayersControlEvent\r\n\t\t// Fired when the base layer is changed through the [layers control](#control-layers).\r\n\t\t// @event overlayadd: LayersControlEvent\r\n\t\t// Fired when an overlay is selected through the [layers control](#control-layers).\r\n\t\t// @event overlayremove: LayersControlEvent\r\n\t\t// Fired when an overlay is deselected through the [layers control](#control-layers).\r\n\t\t// @namespace Control.Layers\r\n\t\tvar type = obj.overlay ?\r\n\t\t\t(e.type === 'add' ? 'overlayadd' : 'overlayremove') :\r\n\t\t\t(e.type === 'add' ? 'baselayerchange' : null);\r\n\r\n\t\tif (type) {\r\n\t\t\tthis._map.fire(type, obj);\r\n\t\t}\r\n\t},\r\n\r\n\t// IE7 bugs out if you create a radio dynamically, so you have to do it this hacky way (see https://stackoverflow.com/a/119079)\r\n\t_createRadioElement: function (name, checked) {\r\n\r\n\t\tvar radioHtml = '<input type=\"radio\" class=\"leaflet-control-layers-selector\" name=\"' +\r\n\t\t\t\tname + '\"' + (checked ? ' checked=\"checked\"' : '') + '/>';\r\n\r\n\t\tvar radioFragment = document.createElement('div');\r\n\t\tradioFragment.innerHTML = radioHtml;\r\n\r\n\t\treturn radioFragment.firstChild;\r\n\t},\r\n\r\n\t_addItem: function (obj) {\r\n\t\tvar label = document.createElement('label'),\r\n\t\t checked = this._map.hasLayer(obj.layer),\r\n\t\t input;\r\n\r\n\t\tif (obj.overlay) {\r\n\t\t\tinput = document.createElement('input');\r\n\t\t\tinput.type = 'checkbox';\r\n\t\t\tinput.className = 'leaflet-control-layers-selector';\r\n\t\t\tinput.defaultChecked = checked;\r\n\t\t} else {\r\n\t\t\tinput = this._createRadioElement('leaflet-base-layers_' + Util.stamp(this), checked);\r\n\t\t}\r\n\r\n\t\tthis._layerControlInputs.push(input);\r\n\t\tinput.layerId = Util.stamp(obj.layer);\r\n\r\n\t\tDomEvent.on(input, 'click', this._onInputClick, this);\r\n\r\n\t\tvar name = document.createElement('span');\r\n\t\tname.innerHTML = ' ' + obj.name;\r\n\r\n\t\t// Helps from preventing layer control flicker when checkboxes are disabled\r\n\t\t// https://github.com/Leaflet/Leaflet/issues/2771\r\n\t\tvar holder = document.createElement('span');\r\n\r\n\t\tlabel.appendChild(holder);\r\n\t\tholder.appendChild(input);\r\n\t\tholder.appendChild(name);\r\n\r\n\t\tvar container = obj.overlay ? this._overlaysList : this._baseLayersList;\r\n\t\tcontainer.appendChild(label);\r\n\r\n\t\tthis._checkDisabledLayers();\r\n\t\treturn label;\r\n\t},\r\n\r\n\t_onInputClick: function () {\r\n\t\t// expanding the control on mobile with a click can cause adding a layer - we don't want this\r\n\t\tif (this._preventClick) {\r\n\t\t\treturn;\r\n\t\t}\r\n\r\n\t\tvar inputs = this._layerControlInputs,\r\n\t\t input, layer;\r\n\t\tvar addedLayers = [],\r\n\t\t removedLayers = [];\r\n\r\n\t\tthis._handlingClick = true;\r\n\r\n\t\tfor (var i = inputs.length - 1; i >= 0; i--) {\r\n\t\t\tinput = inputs[i];\r\n\t\t\tlayer = this._getLayer(input.layerId).layer;\r\n\r\n\t\t\tif (input.checked) {\r\n\t\t\t\taddedLayers.push(layer);\r\n\t\t\t} else if (!input.checked) {\r\n\t\t\t\tremovedLayers.push(layer);\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\t// Bugfix issue 2318: Should remove all old layers before readding new ones\r\n\t\tfor (i = 0; i < removedLayers.length; i++) {\r\n\t\t\tif (this._map.hasLayer(removedLayers[i])) {\r\n\t\t\t\tthis._map.removeLayer(removedLayers[i]);\r\n\t\t\t}\r\n\t\t}\r\n\t\tfor (i = 0; i < addedLayers.length; i++) {\r\n\t\t\tif (!this._map.hasLayer(addedLayers[i])) {\r\n\t\t\t\tthis._map.addLayer(addedLayers[i]);\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\tthis._handlingClick = false;\r\n\r\n\t\tthis._refocusOnMap();\r\n\t},\r\n\r\n\t_checkDisabledLayers: function () {\r\n\t\tvar inputs = this._layerControlInputs,\r\n\t\t input,\r\n\t\t layer,\r\n\t\t zoom = this._map.getZoom();\r\n\r\n\t\tfor (var i = inputs.length - 1; i >= 0; i--) {\r\n\t\t\tinput = inputs[i];\r\n\t\t\tlayer = this._getLayer(input.layerId).layer;\r\n\t\t\tinput.disabled = (layer.options.minZoom !== undefined && zoom < layer.options.minZoom) ||\r\n\t\t\t (layer.options.maxZoom !== undefined && zoom > layer.options.maxZoom);\r\n\r\n\t\t}\r\n\t},\r\n\r\n\t_expandIfNotCollapsed: function () {\r\n\t\tif (this._map && !this.options.collapsed) {\r\n\t\t\tthis.expand();\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t_expandSafely: function () {\r\n\t\tvar section = this._section;\r\n\t\tthis._preventClick = true;\r\n\t\tDomEvent.on(section, 'click', DomEvent.preventDefault);\r\n\t\tthis.expand();\r\n\t\tvar that = this;\r\n\t\tsetTimeout(function () {\r\n\t\t\tDomEvent.off(section, 'click', DomEvent.preventDefault);\r\n\t\t\tthat._preventClick = false;\r\n\t\t});\r\n\t}\r\n\r\n});\r\n\r\n\r\n// @factory L.control.layers(baselayers?: Object, overlays?: Object, options?: Control.Layers options)\r\n// Creates a layers control with the given layers. Base layers will be switched with radio buttons, while overlays will be switched with checkboxes. Note that all base layers should be passed in the base layers object, but only one should be added to the map during map instantiation.\r\nexport var layers = function (baseLayers, overlays, options) {\r\n\treturn new Layers(baseLayers, overlays, options);\r\n};\r\n", "\r\nimport {Control} from './Control';\r\nimport {Map} from '../map/Map';\r\nimport * as DomUtil from '../dom/DomUtil';\r\nimport * as DomEvent from '../dom/DomEvent';\r\n\r\n/*\r\n * @class Control.Zoom\r\n * @aka L.Control.Zoom\r\n * @inherits Control\r\n *\r\n * A basic zoom control with two buttons (zoom in and zoom out). It is put on the map by default unless you set its [`zoomControl` option](#map-zoomcontrol) to `false`. Extends `Control`.\r\n */\r\n\r\nexport var Zoom = Control.extend({\r\n\t// @section\r\n\t// @aka Control.Zoom options\r\n\toptions: {\r\n\t\tposition: 'topleft',\r\n\r\n\t\t// @option zoomInText: String = '<span aria-hidden=\"true\">+</span>'\r\n\t\t// The text set on the 'zoom in' button.\r\n\t\tzoomInText: '<span aria-hidden=\"true\">+</span>',\r\n\r\n\t\t// @option zoomInTitle: String = 'Zoom in'\r\n\t\t// The title set on the 'zoom in' button.\r\n\t\tzoomInTitle: 'Zoom in',\r\n\r\n\t\t// @option zoomOutText: String = '<span aria-hidden=\"true\">&#x2212;</span>'\r\n\t\t// The text set on the 'zoom out' button.\r\n\t\tzoomOutText: '<span aria-hidden=\"true\">&#x2212;</span>',\r\n\r\n\t\t// @option zoomOutTitle: String = 'Zoom out'\r\n\t\t// The title set on the 'zoom out' button.\r\n\t\tzoomOutTitle: 'Zoom out'\r\n\t},\r\n\r\n\tonAdd: function (map) {\r\n\t\tvar zoomName = 'leaflet-control-zoom',\r\n\t\t container = DomUtil.create('div', zoomName + ' leaflet-bar'),\r\n\t\t options = this.options;\r\n\r\n\t\tthis._zoomInButton = this._createButton(options.zoomInText, options.zoomInTitle,\r\n\t\t zoomName + '-in', container, this._zoomIn);\r\n\t\tthis._zoomOutButton = this._createButton(options.zoomOutText, options.zoomOutTitle,\r\n\t\t zoomName + '-out', container, this._zoomOut);\r\n\r\n\t\tthis._updateDisabled();\r\n\t\tmap.on('zoomend zoomlevelschange', this._updateDisabled, this);\r\n\r\n\t\treturn container;\r\n\t},\r\n\r\n\tonRemove: function (map) {\r\n\t\tmap.off('zoomend zoomlevelschange', this._updateDisabled, this);\r\n\t},\r\n\r\n\tdisable: function () {\r\n\t\tthis._disabled = true;\r\n\t\tthis._updateDisabled();\r\n\t\treturn this;\r\n\t},\r\n\r\n\tenable: function () {\r\n\t\tthis._disabled = false;\r\n\t\tthis._updateDisabled();\r\n\t\treturn this;\r\n\t},\r\n\r\n\t_zoomIn: function (e) {\r\n\t\tif (!this._disabled && this._map._zoom < this._map.getMaxZoom()) {\r\n\t\t\tthis._map.zoomIn(this._map.options.zoomDelta * (e.shiftKey ? 3 : 1));\r\n\t\t}\r\n\t},\r\n\r\n\t_zoomOut: function (e) {\r\n\t\tif (!this._disabled && this._map._zoom > this._map.getMinZoom()) {\r\n\t\t\tthis._map.zoomOut(this._map.options.zoomDelta * (e.shiftKey ? 3 : 1));\r\n\t\t}\r\n\t},\r\n\r\n\t_createButton: function (html, title, className, container, fn) {\r\n\t\tvar link = DomUtil.create('a', className, container);\r\n\t\tlink.innerHTML = html;\r\n\t\tlink.href = '#';\r\n\t\tlink.title = title;\r\n\r\n\t\t/*\r\n\t\t * Will force screen readers like VoiceOver to read this as \"Zoom in - button\"\r\n\t\t */\r\n\t\tlink.setAttribute('role', 'button');\r\n\t\tlink.setAttribute('aria-label', title);\r\n\r\n\t\tDomEvent.disableClickPropagation(link);\r\n\t\tDomEvent.on(link, 'click', DomEvent.stop);\r\n\t\tDomEvent.on(link, 'click', fn, this);\r\n\t\tDomEvent.on(link, 'click', this._refocusOnMap, this);\r\n\r\n\t\treturn link;\r\n\t},\r\n\r\n\t_updateDisabled: function () {\r\n\t\tvar map = this._map,\r\n\t\t className = 'leaflet-disabled';\r\n\r\n\t\tDomUtil.removeClass(this._zoomInButton, className);\r\n\t\tDomUtil.removeClass(this._zoomOutButton, className);\r\n\t\tthis._zoomInButton.setAttribute('aria-disabled', 'false');\r\n\t\tthis._zoomOutButton.setAttribute('aria-disabled', 'false');\r\n\r\n\t\tif (this._disabled || map._zoom === map.getMinZoom()) {\r\n\t\t\tDomUtil.addClass(this._zoomOutButton, className);\r\n\t\t\tthis._zoomOutButton.setAttribute('aria-disabled', 'true');\r\n\t\t}\r\n\t\tif (this._disabled || map._zoom === map.getMaxZoom()) {\r\n\t\t\tDomUtil.addClass(this._zoomInButton, className);\r\n\t\t\tthis._zoomInButton.setAttribute('aria-disabled', 'true');\r\n\t\t}\r\n\t}\r\n});\r\n\r\n// @namespace Map\r\n// @section Control options\r\n// @option zoomControl: Boolean = true\r\n// Whether a [zoom control](#control-zoom) is added to the map by default.\r\nMap.mergeOptions({\r\n\tzoomControl: true\r\n});\r\n\r\nMap.addInitHook(function () {\r\n\tif (this.options.zoomControl) {\r\n\t\t// @section Controls\r\n\t\t// @property zoomControl: Control.Zoom\r\n\t\t// The default zoom control (only available if the\r\n\t\t// [`zoomControl` option](#map-zoomcontrol) was `true` when creating the map).\r\n\t\tthis.zoomControl = new Zoom();\r\n\t\tthis.addControl(this.zoomControl);\r\n\t}\r\n});\r\n\r\n// @namespace Control.Zoom\r\n// @factory L.control.zoom(options: Control.Zoom options)\r\n// Creates a zoom control\r\nexport var zoom = function (options) {\r\n\treturn new Zoom(options);\r\n};\r\n", "\nimport {Control} from './Control';\nimport * as DomUtil from '../dom/DomUtil';\n\n/*\n * @class Control.Scale\n * @aka L.Control.Scale\n * @inherits Control\n *\n * A simple scale control that shows the scale of the current center of screen in metric (m/km) and imperial (mi/ft) systems. Extends `Control`.\n *\n * @example\n *\n * ```js\n * L.control.scale().addTo(map);\n * ```\n */\n\nexport var Scale = Control.extend({\n\t// @section\n\t// @aka Control.Scale options\n\toptions: {\n\t\tposition: 'bottomleft',\n\n\t\t// @option maxWidth: Number = 100\n\t\t// Maximum width of the control in pixels. The width is set dynamically to show round values (e.g. 100, 200, 500).\n\t\tmaxWidth: 100,\n\n\t\t// @option metric: Boolean = True\n\t\t// Whether to show the metric scale line (m/km).\n\t\tmetric: true,\n\n\t\t// @option imperial: Boolean = True\n\t\t// Whether to show the imperial scale line (mi/ft).\n\t\timperial: true\n\n\t\t// @option updateWhenIdle: Boolean = false\n\t\t// If `true`, the control is updated on [`moveend`](#map-moveend), otherwise it's always up-to-date (updated on [`move`](#map-move)).\n\t},\n\n\tonAdd: function (map) {\n\t\tvar className = 'leaflet-control-scale',\n\t\t container = DomUtil.create('div', className),\n\t\t options = this.options;\n\n\t\tthis._addScales(options, className + '-line', container);\n\n\t\tmap.on(options.updateWhenIdle ? 'moveend' : 'move', this._update, this);\n\t\tmap.whenReady(this._update, this);\n\n\t\treturn container;\n\t},\n\n\tonRemove: function (map) {\n\t\tmap.off(this.options.updateWhenIdle ? 'moveend' : 'move', this._update, this);\n\t},\n\n\t_addScales: function (options, className, container) {\n\t\tif (options.metric) {\n\t\t\tthis._mScale = DomUtil.create('div', className, container);\n\t\t}\n\t\tif (options.imperial) {\n\t\t\tthis._iScale = DomUtil.create('div', className, container);\n\t\t}\n\t},\n\n\t_update: function () {\n\t\tvar map = this._map,\n\t\t y = map.getSize().y / 2;\n\n\t\tvar maxMeters = map.distance(\n\t\t\tmap.containerPointToLatLng([0, y]),\n\t\t\tmap.containerPointToLatLng([this.options.maxWidth, y]));\n\n\t\tthis._updateScales(maxMeters);\n\t},\n\n\t_updateScales: function (maxMeters) {\n\t\tif (this.options.metric && maxMeters) {\n\t\t\tthis._updateMetric(maxMeters);\n\t\t}\n\t\tif (this.options.imperial && maxMeters) {\n\t\t\tthis._updateImperial(maxMeters);\n\t\t}\n\t},\n\n\t_updateMetric: function (maxMeters) {\n\t\tvar meters = this._getRoundNum(maxMeters),\n\t\t label = meters < 1000 ? meters + ' m' : (meters / 1000) + ' km';\n\n\t\tthis._updateScale(this._mScale, label, meters / maxMeters);\n\t},\n\n\t_updateImperial: function (maxMeters) {\n\t\tvar maxFeet = maxMeters * 3.2808399,\n\t\t maxMiles, miles, feet;\n\n\t\tif (maxFeet > 5280) {\n\t\t\tmaxMiles = maxFeet / 5280;\n\t\t\tmiles = this._getRoundNum(maxMiles);\n\t\t\tthis._updateScale(this._iScale, miles + ' mi', miles / maxMiles);\n\n\t\t} else {\n\t\t\tfeet = this._getRoundNum(maxFeet);\n\t\t\tthis._updateScale(this._iScale, feet + ' ft', feet / maxFeet);\n\t\t}\n\t},\n\n\t_updateScale: function (scale, text, ratio) {\n\t\tscale.style.width = Math.round(this.options.maxWidth * ratio) + 'px';\n\t\tscale.innerHTML = text;\n\t},\n\n\t_getRoundNum: function (num) {\n\t\tvar pow10 = Math.pow(10, (Math.floor(num) + '').length - 1),\n\t\t d = num / pow10;\n\n\t\td = d >= 10 ? 10 :\n\t\t d >= 5 ? 5 :\n\t\t d >= 3 ? 3 :\n\t\t d >= 2 ? 2 : 1;\n\n\t\treturn pow10 * d;\n\t}\n});\n\n\n// @factory L.control.scale(options?: Control.Scale options)\n// Creates an scale control with the given options.\nexport var scale = function (options) {\n\treturn new Scale(options);\n};\n", "\r\nimport {Control} from './Control';\r\nimport {Map} from '../map/Map';\r\nimport * as Util from '../core/Util';\r\nimport * as DomEvent from '../dom/DomEvent';\r\nimport * as DomUtil from '../dom/DomUtil';\r\nimport Browser from '../core/Browser';\r\n\r\nvar ukrainianFlag = '<svg aria-hidden=\"true\" xmlns=\"http://www.w3.org/2000/svg\" width=\"12\" height=\"8\" viewBox=\"0 0 12 8\" class=\"leaflet-attribution-flag\"><path fill=\"#4C7BE1\" d=\"M0 0h12v4H0z\"/><path fill=\"#FFD500\" d=\"M0 4h12v3H0z\"/><path fill=\"#E0BC00\" d=\"M0 7h12v1H0z\"/></svg>';\r\n\r\n\r\n/*\r\n * @class Control.Attribution\r\n * @aka L.Control.Attribution\r\n * @inherits Control\r\n *\r\n * The attribution control allows you to display attribution data in a small text box on a map. It is put on the map by default unless you set its [`attributionControl` option](#map-attributioncontrol) to `false`, and it fetches attribution texts from layers with the [`getAttribution` method](#layer-getattribution) automatically. Extends Control.\r\n */\r\n\r\nexport var Attribution = Control.extend({\r\n\t// @section\r\n\t// @aka Control.Attribution options\r\n\toptions: {\r\n\t\tposition: 'bottomright',\r\n\r\n\t\t// @option prefix: String|false = 'Leaflet'\r\n\t\t// The HTML text shown before the attributions. Pass `false` to disable.\r\n\t\tprefix: '<a href=\"https://leafletjs.com\" title=\"A JavaScript library for interactive maps\">' + (Browser.inlineSvg ? ukrainianFlag + ' ' : '') + 'Leaflet</a>'\r\n\t},\r\n\r\n\tinitialize: function (options) {\r\n\t\tUtil.setOptions(this, options);\r\n\r\n\t\tthis._attributions = {};\r\n\t},\r\n\r\n\tonAdd: function (map) {\r\n\t\tmap.attributionControl = this;\r\n\t\tthis._container = DomUtil.create('div', 'leaflet-control-attribution');\r\n\t\tDomEvent.disableClickPropagation(this._container);\r\n\r\n\t\t// TODO ugly, refactor\r\n\t\tfor (var i in map._layers) {\r\n\t\t\tif (map._layers[i].getAttribution) {\r\n\t\t\t\tthis.addAttribution(map._layers[i].getAttribution());\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\tthis._update();\r\n\r\n\t\tmap.on('layeradd', this._addAttribution, this);\r\n\r\n\t\treturn this._container;\r\n\t},\r\n\r\n\tonRemove: function (map) {\r\n\t\tmap.off('layeradd', this._addAttribution, this);\r\n\t},\r\n\r\n\t_addAttribution: function (ev) {\r\n\t\tif (ev.layer.getAttribution) {\r\n\t\t\tthis.addAttribution(ev.layer.getAttribution());\r\n\t\t\tev.layer.once('remove', function () {\r\n\t\t\t\tthis.removeAttribution(ev.layer.getAttribution());\r\n\t\t\t}, this);\r\n\t\t}\r\n\t},\r\n\r\n\t// @method setPrefix(prefix: String|false): this\r\n\t// The HTML text shown before the attributions. Pass `false` to disable.\r\n\tsetPrefix: function (prefix) {\r\n\t\tthis.options.prefix = prefix;\r\n\t\tthis._update();\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method addAttribution(text: String): this\r\n\t// Adds an attribution text (e.g. `'&copy; OpenStreetMap contributors'`).\r\n\taddAttribution: function (text) {\r\n\t\tif (!text) { return this; }\r\n\r\n\t\tif (!this._attributions[text]) {\r\n\t\t\tthis._attributions[text] = 0;\r\n\t\t}\r\n\t\tthis._attributions[text]++;\r\n\r\n\t\tthis._update();\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method removeAttribution(text: String): this\r\n\t// Removes an attribution text.\r\n\tremoveAttribution: function (text) {\r\n\t\tif (!text) { return this; }\r\n\r\n\t\tif (this._attributions[text]) {\r\n\t\t\tthis._attributions[text]--;\r\n\t\t\tthis._update();\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t_update: function () {\r\n\t\tif (!this._map) { return; }\r\n\r\n\t\tvar attribs = [];\r\n\r\n\t\tfor (var i in this._attributions) {\r\n\t\t\tif (this._attributions[i]) {\r\n\t\t\t\tattribs.push(i);\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\tvar prefixAndAttribs = [];\r\n\r\n\t\tif (this.options.prefix) {\r\n\t\t\tprefixAndAttribs.push(this.options.prefix);\r\n\t\t}\r\n\t\tif (attribs.length) {\r\n\t\t\tprefixAndAttribs.push(attribs.join(', '));\r\n\t\t}\r\n\r\n\t\tthis._container.innerHTML = prefixAndAttribs.join(' <span aria-hidden=\"true\">|</span> ');\r\n\t}\r\n});\r\n\r\n// @namespace Map\r\n// @section Control options\r\n// @option attributionControl: Boolean = true\r\n// Whether a [attribution control](#control-attribution) is added to the map by default.\r\nMap.mergeOptions({\r\n\tattributionControl: true\r\n});\r\n\r\nMap.addInitHook(function () {\r\n\tif (this.options.attributionControl) {\r\n\t\tnew Attribution().addTo(this);\r\n\t}\r\n});\r\n\r\n// @namespace Control.Attribution\r\n// @factory L.control.attribution(options: Control.Attribution options)\r\n// Creates an attribution control.\r\nexport var attribution = function (options) {\r\n\treturn new Attribution(options);\r\n};\r\n", "import {Control, control} from './Control';\nimport {Layers, layers} from './Control.Layers';\nimport {Zoom, zoom} from './Control.Zoom';\nimport {Scale, scale} from './Control.Scale';\nimport {Attribution, attribution} from './Control.Attribution';\n\nControl.Layers = Layers;\nControl.Zoom = Zoom;\nControl.Scale = Scale;\nControl.Attribution = Attribution;\n\ncontrol.layers = layers;\ncontrol.zoom = zoom;\ncontrol.scale = scale;\ncontrol.attribution = attribution;\n\nexport {Control, control};\n", "import {Class} from './Class';\n\n/*\n\tL.Handler is a base class for handler classes that are used internally to inject\n\tinteraction features like dragging to classes like Map and Marker.\n*/\n\n// @class Handler\n// @aka L.Handler\n// Abstract class for map interaction handlers\n\nexport var Handler = Class.extend({\n\tinitialize: function (map) {\n\t\tthis._map = map;\n\t},\n\n\t// @method enable(): this\n\t// Enables the handler\n\tenable: function () {\n\t\tif (this._enabled) { return this; }\n\n\t\tthis._enabled = true;\n\t\tthis.addHooks();\n\t\treturn this;\n\t},\n\n\t// @method disable(): this\n\t// Disables the handler\n\tdisable: function () {\n\t\tif (!this._enabled) { return this; }\n\n\t\tthis._enabled = false;\n\t\tthis.removeHooks();\n\t\treturn this;\n\t},\n\n\t// @method enabled(): Boolean\n\t// Returns `true` if the handler is enabled\n\tenabled: function () {\n\t\treturn !!this._enabled;\n\t}\n\n\t// @section Extension methods\n\t// Classes inheriting from `Handler` must implement the two following methods:\n\t// @method addHooks()\n\t// Called when the handler is enabled, should add event hooks.\n\t// @method removeHooks()\n\t// Called when the handler is disabled, should remove the event hooks added previously.\n});\n\n// @section There is static function which can be called without instantiating L.Handler:\n// @function addTo(map: Map, name: String): this\n// Adds a new Handler to the given map with the given name.\nHandler.addTo = function (map, name) {\n\tmap.addHandler(name, this);\n\treturn this;\n};\n", "import Browser from './Browser';\nexport {Browser};\n\nexport {Class} from './Class';\n\nimport {Evented} from './Events';\nimport {Events} from './Events';\nexport {Evented};\nexport var Mixin = {Events: Events};\n\nexport {Handler} from './Handler';\n\nimport * as Util from './Util';\nexport {Util};\nexport {extend, bind, stamp, setOptions} from './Util';\n", "import {Evented} from '../core/Events';\r\nimport Browser from '../core/Browser';\r\nimport * as DomEvent from './DomEvent';\r\nimport * as DomUtil from './DomUtil';\r\nimport * as Util from '../core/Util';\r\nimport {Point} from '../geometry/Point';\r\n\r\n/*\r\n * @class Draggable\r\n * @aka L.Draggable\r\n * @inherits Evented\r\n *\r\n * A class for making DOM elements draggable (including touch support).\r\n * Used internally for map and marker dragging. Only works for elements\r\n * that were positioned with [`L.DomUtil.setPosition`](#domutil-setposition).\r\n *\r\n * @example\r\n * ```js\r\n * var draggable = new L.Draggable(elementToDrag);\r\n * draggable.enable();\r\n * ```\r\n */\r\n\r\nvar START = Browser.touch ? 'touchstart mousedown' : 'mousedown';\r\n\r\nexport var Draggable = Evented.extend({\r\n\r\n\toptions: {\r\n\t\t// @section\r\n\t\t// @aka Draggable options\r\n\t\t// @option clickTolerance: Number = 3\r\n\t\t// The max number of pixels a user can shift the mouse pointer during a click\r\n\t\t// for it to be considered a valid click (as opposed to a mouse drag).\r\n\t\tclickTolerance: 3\r\n\t},\r\n\r\n\t// @constructor L.Draggable(el: HTMLElement, dragHandle?: HTMLElement, preventOutline?: Boolean, options?: Draggable options)\r\n\t// Creates a `Draggable` object for moving `el` when you start dragging the `dragHandle` element (equals `el` itself by default).\r\n\tinitialize: function (element, dragStartTarget, preventOutline, options) {\r\n\t\tUtil.setOptions(this, options);\r\n\r\n\t\tthis._element = element;\r\n\t\tthis._dragStartTarget = dragStartTarget || element;\r\n\t\tthis._preventOutline = preventOutline;\r\n\t},\r\n\r\n\t// @method enable()\r\n\t// Enables the dragging ability\r\n\tenable: function () {\r\n\t\tif (this._enabled) { return; }\r\n\r\n\t\tDomEvent.on(this._dragStartTarget, START, this._onDown, this);\r\n\r\n\t\tthis._enabled = true;\r\n\t},\r\n\r\n\t// @method disable()\r\n\t// Disables the dragging ability\r\n\tdisable: function () {\r\n\t\tif (!this._enabled) { return; }\r\n\r\n\t\t// If we're currently dragging this draggable,\r\n\t\t// disabling it counts as first ending the drag.\r\n\t\tif (Draggable._dragging === this) {\r\n\t\t\tthis.finishDrag(true);\r\n\t\t}\r\n\r\n\t\tDomEvent.off(this._dragStartTarget, START, this._onDown, this);\r\n\r\n\t\tthis._enabled = false;\r\n\t\tthis._moved = false;\r\n\t},\r\n\r\n\t_onDown: function (e) {\r\n\t\t// Ignore the event if disabled; this happens in IE11\r\n\t\t// under some circumstances, see #3666.\r\n\t\tif (!this._enabled) { return; }\r\n\r\n\t\tthis._moved = false;\r\n\r\n\t\tif (DomUtil.hasClass(this._element, 'leaflet-zoom-anim')) { return; }\r\n\r\n\t\tif (e.touches && e.touches.length !== 1) {\r\n\t\t\t// Finish dragging to avoid conflict with touchZoom\r\n\t\t\tif (Draggable._dragging === this) {\r\n\t\t\t\tthis.finishDrag();\r\n\t\t\t}\r\n\t\t\treturn;\r\n\t\t}\r\n\r\n\t\tif (Draggable._dragging || e.shiftKey || ((e.which !== 1) && (e.button !== 1) && !e.touches)) { return; }\r\n\t\tDraggable._dragging = this; // Prevent dragging multiple objects at once.\r\n\r\n\t\tif (this._preventOutline) {\r\n\t\t\tDomUtil.preventOutline(this._element);\r\n\t\t}\r\n\r\n\t\tDomUtil.disableImageDrag();\r\n\t\tDomUtil.disableTextSelection();\r\n\r\n\t\tif (this._moving) { return; }\r\n\r\n\t\t// @event down: Event\r\n\t\t// Fired when a drag is about to start.\r\n\t\tthis.fire('down');\r\n\r\n\t\tvar first = e.touches ? e.touches[0] : e,\r\n\t\t sizedParent = DomUtil.getSizedParentNode(this._element);\r\n\r\n\t\tthis._startPoint = new Point(first.clientX, first.clientY);\r\n\t\tthis._startPos = DomUtil.getPosition(this._element);\r\n\r\n\t\t// Cache the scale, so that we can continuously compensate for it during drag (_onMove).\r\n\t\tthis._parentScale = DomUtil.getScale(sizedParent);\r\n\r\n\t\tvar mouseevent = e.type === 'mousedown';\r\n\t\tDomEvent.on(document, mouseevent ? 'mousemove' : 'touchmove', this._onMove, this);\r\n\t\tDomEvent.on(document, mouseevent ? 'mouseup' : 'touchend touchcancel', this._onUp, this);\r\n\t},\r\n\r\n\t_onMove: function (e) {\r\n\t\t// Ignore the event if disabled; this happens in IE11\r\n\t\t// under some circumstances, see #3666.\r\n\t\tif (!this._enabled) { return; }\r\n\r\n\t\tif (e.touches && e.touches.length > 1) {\r\n\t\t\tthis._moved = true;\r\n\t\t\treturn;\r\n\t\t}\r\n\r\n\t\tvar first = (e.touches && e.touches.length === 1 ? e.touches[0] : e),\r\n\t\t offset = new Point(first.clientX, first.clientY)._subtract(this._startPoint);\r\n\r\n\t\tif (!offset.x && !offset.y) { return; }\r\n\t\tif (Math.abs(offset.x) + Math.abs(offset.y) < this.options.clickTolerance) { return; }\r\n\r\n\t\t// We assume that the parent container's position, border and scale do not change for the duration of the drag.\r\n\t\t// Therefore there is no need to account for the position and border (they are eliminated by the subtraction)\r\n\t\t// and we can use the cached value for the scale.\r\n\t\toffset.x /= this._parentScale.x;\r\n\t\toffset.y /= this._parentScale.y;\r\n\r\n\t\tDomEvent.preventDefault(e);\r\n\r\n\t\tif (!this._moved) {\r\n\t\t\t// @event dragstart: Event\r\n\t\t\t// Fired when a drag starts\r\n\t\t\tthis.fire('dragstart');\r\n\r\n\t\t\tthis._moved = true;\r\n\r\n\t\t\tDomUtil.addClass(document.body, 'leaflet-dragging');\r\n\r\n\t\t\tthis._lastTarget = e.target || e.srcElement;\r\n\t\t\t// IE and Edge do not give the <use> element, so fetch it\r\n\t\t\t// if necessary\r\n\t\t\tif (window.SVGElementInstance && this._lastTarget instanceof window.SVGElementInstance) {\r\n\t\t\t\tthis._lastTarget = this._lastTarget.correspondingUseElement;\r\n\t\t\t}\r\n\t\t\tDomUtil.addClass(this._lastTarget, 'leaflet-drag-target');\r\n\t\t}\r\n\r\n\t\tthis._newPos = this._startPos.add(offset);\r\n\t\tthis._moving = true;\r\n\r\n\t\tthis._lastEvent = e;\r\n\t\tthis._updatePosition();\r\n\t},\r\n\r\n\t_updatePosition: function () {\r\n\t\tvar e = {originalEvent: this._lastEvent};\r\n\r\n\t\t// @event predrag: Event\r\n\t\t// Fired continuously during dragging *before* each corresponding\r\n\t\t// update of the element's position.\r\n\t\tthis.fire('predrag', e);\r\n\t\tDomUtil.setPosition(this._element, this._newPos);\r\n\r\n\t\t// @event drag: Event\r\n\t\t// Fired continuously during dragging.\r\n\t\tthis.fire('drag', e);\r\n\t},\r\n\r\n\t_onUp: function () {\r\n\t\t// Ignore the event if disabled; this happens in IE11\r\n\t\t// under some circumstances, see #3666.\r\n\t\tif (!this._enabled) { return; }\r\n\t\tthis.finishDrag();\r\n\t},\r\n\r\n\tfinishDrag: function (noInertia) {\r\n\t\tDomUtil.removeClass(document.body, 'leaflet-dragging');\r\n\r\n\t\tif (this._lastTarget) {\r\n\t\t\tDomUtil.removeClass(this._lastTarget, 'leaflet-drag-target');\r\n\t\t\tthis._lastTarget = null;\r\n\t\t}\r\n\r\n\t\tDomEvent.off(document, 'mousemove touchmove', this._onMove, this);\r\n\t\tDomEvent.off(document, 'mouseup touchend touchcancel', this._onUp, this);\r\n\r\n\t\tDomUtil.enableImageDrag();\r\n\t\tDomUtil.enableTextSelection();\r\n\r\n\t\tvar fireDragend = this._moved && this._moving;\r\n\r\n\t\tthis._moving = false;\r\n\t\tDraggable._dragging = false;\r\n\r\n\t\tif (fireDragend) {\r\n\t\t\t// @event dragend: DragEndEvent\r\n\t\t\t// Fired when the drag ends.\r\n\t\t\tthis.fire('dragend', {\r\n\t\t\t\tnoInertia: noInertia,\r\n\t\t\t\tdistance: this._newPos.distanceTo(this._startPos)\r\n\t\t\t});\r\n\t\t}\r\n\t}\r\n\r\n});\r\n", "import * as LineUtil from './LineUtil';\r\nimport {toLatLng} from '../geo/LatLng';\r\nimport {toPoint} from './Point';\r\nimport {toLatLngBounds} from '../geo/LatLngBounds';\r\n/*\r\n * @namespace PolyUtil\r\n * Various utility functions for polygon geometries.\r\n */\r\n\r\n/* @function clipPolygon(points: Point[], bounds: Bounds, round?: Boolean): Point[]\r\n * Clips the polygon geometry defined by the given `points` by the given bounds (using the [Sutherland-Hodgman algorithm](https://en.wikipedia.org/wiki/Sutherland%E2%80%93Hodgman_algorithm)).\r\n * Used by Leaflet to only show polygon points that are on the screen or near, increasing\r\n * performance. Note that polygon points needs different algorithm for clipping\r\n * than polyline, so there's a separate method for it.\r\n */\r\nexport function clipPolygon(points, bounds, round) {\r\n\tvar clippedPoints,\r\n\t edges = [1, 4, 2, 8],\r\n\t i, j, k,\r\n\t a, b,\r\n\t len, edge, p;\r\n\r\n\tfor (i = 0, len = points.length; i < len; i++) {\r\n\t\tpoints[i]._code = LineUtil._getBitCode(points[i], bounds);\r\n\t}\r\n\r\n\t// for each edge (left, bottom, right, top)\r\n\tfor (k = 0; k < 4; k++) {\r\n\t\tedge = edges[k];\r\n\t\tclippedPoints = [];\r\n\r\n\t\tfor (i = 0, len = points.length, j = len - 1; i < len; j = i++) {\r\n\t\t\ta = points[i];\r\n\t\t\tb = points[j];\r\n\r\n\t\t\t// if a is inside the clip window\r\n\t\t\tif (!(a._code & edge)) {\r\n\t\t\t\t// if b is outside the clip window (a->b goes out of screen)\r\n\t\t\t\tif (b._code & edge) {\r\n\t\t\t\t\tp = LineUtil._getEdgeIntersection(b, a, edge, bounds, round);\r\n\t\t\t\t\tp._code = LineUtil._getBitCode(p, bounds);\r\n\t\t\t\t\tclippedPoints.push(p);\r\n\t\t\t\t}\r\n\t\t\t\tclippedPoints.push(a);\r\n\r\n\t\t\t// else if b is inside the clip window (a->b enters the screen)\r\n\t\t\t} else if (!(b._code & edge)) {\r\n\t\t\t\tp = LineUtil._getEdgeIntersection(b, a, edge, bounds, round);\r\n\t\t\t\tp._code = LineUtil._getBitCode(p, bounds);\r\n\t\t\t\tclippedPoints.push(p);\r\n\t\t\t}\r\n\t\t}\r\n\t\tpoints = clippedPoints;\r\n\t}\r\n\r\n\treturn points;\r\n}\r\n\r\n/* @function polygonCenter(latlngs: LatLng[], crs: CRS): LatLng\r\n * Returns the center ([centroid](http://en.wikipedia.org/wiki/Centroid)) of the passed LatLngs (first ring) from a polygon.\r\n */\r\nexport function polygonCenter(latlngs, crs) {\r\n\tvar i, j, p1, p2, f, area, x, y, center;\r\n\r\n\tif (!latlngs || latlngs.length === 0) {\r\n\t\tthrow new Error('latlngs not passed');\r\n\t}\r\n\r\n\tif (!LineUtil.isFlat(latlngs)) {\r\n\t\tconsole.warn('latlngs are not flat! Only the first ring will be used');\r\n\t\tlatlngs = latlngs[0];\r\n\t}\r\n\r\n\tvar centroidLatLng = toLatLng([0, 0]);\r\n\r\n\tvar bounds = toLatLngBounds(latlngs);\r\n\tvar areaBounds = bounds.getNorthWest().distanceTo(bounds.getSouthWest()) * bounds.getNorthEast().distanceTo(bounds.getNorthWest());\r\n\t// tests showed that below 1700 rounding errors are happening\r\n\tif (areaBounds < 1700) {\r\n\t\t// getting a inexact center, to move the latlngs near to [0, 0] to prevent rounding errors\r\n\t\tcentroidLatLng = centroid(latlngs);\r\n\t}\r\n\r\n\tvar len = latlngs.length;\r\n\tvar points = [];\r\n\tfor (i = 0; i < len; i++) {\r\n\t\tvar latlng = toLatLng(latlngs[i]);\r\n\t\tpoints.push(crs.project(toLatLng([latlng.lat - centroidLatLng.lat, latlng.lng - centroidLatLng.lng])));\r\n\t}\r\n\r\n\tarea = x = y = 0;\r\n\r\n\t// polygon centroid algorithm;\r\n\tfor (i = 0, j = len - 1; i < len; j = i++) {\r\n\t\tp1 = points[i];\r\n\t\tp2 = points[j];\r\n\r\n\t\tf = p1.y * p2.x - p2.y * p1.x;\r\n\t\tx += (p1.x + p2.x) * f;\r\n\t\ty += (p1.y + p2.y) * f;\r\n\t\tarea += f * 3;\r\n\t}\r\n\r\n\tif (area === 0) {\r\n\t\t// Polygon is so small that all points are on same pixel.\r\n\t\tcenter = points[0];\r\n\t} else {\r\n\t\tcenter = [x / area, y / area];\r\n\t}\r\n\r\n\tvar latlngCenter = crs.unproject(toPoint(center));\r\n\treturn toLatLng([latlngCenter.lat + centroidLatLng.lat, latlngCenter.lng + centroidLatLng.lng]);\r\n}\r\n\r\n/* @function centroid(latlngs: LatLng[]): LatLng\r\n * Returns the 'center of mass' of the passed LatLngs.\r\n */\r\nexport function centroid(coords) {\r\n\tvar latSum = 0;\r\n\tvar lngSum = 0;\r\n\tvar len = 0;\r\n\tfor (var i = 0; i < coords.length; i++) {\r\n\t\tvar latlng = toLatLng(coords[i]);\r\n\t\tlatSum += latlng.lat;\r\n\t\tlngSum += latlng.lng;\r\n\t\tlen++;\r\n\t}\r\n\treturn toLatLng([latSum / len, lngSum / len]);\r\n}\r\n", "import {Point, toPoint} from './Point';\r\nimport * as Util from '../core/Util';\r\nimport {toLatLng} from '../geo/LatLng';\r\nimport {centroid} from './PolyUtil';\r\nimport {toLatLngBounds} from '../geo/LatLngBounds';\r\n\r\n\r\n/*\r\n * @namespace LineUtil\r\n *\r\n * Various utility functions for polyline points processing, used by Leaflet internally to make polylines lightning-fast.\r\n */\r\n\r\n// Simplify polyline with vertex reduction and Douglas-Peucker simplification.\r\n// Improves rendering performance dramatically by lessening the number of points to draw.\r\n\r\n// @function simplify(points: Point[], tolerance: Number): Point[]\r\n// Dramatically reduces the number of points in a polyline while retaining\r\n// its shape and returns a new array of simplified points, using the\r\n// [Ramer-Douglas-Peucker algorithm](https://en.wikipedia.org/wiki/Ramer-Douglas-Peucker_algorithm).\r\n// Used for a huge performance boost when processing/displaying Leaflet polylines for\r\n// each zoom level and also reducing visual noise. tolerance affects the amount of\r\n// simplification (lesser value means higher quality but slower and with more points).\r\n// Also released as a separated micro-library [Simplify.js](https://mourner.github.io/simplify-js/).\r\nexport function simplify(points, tolerance) {\r\n\tif (!tolerance || !points.length) {\r\n\t\treturn points.slice();\r\n\t}\r\n\r\n\tvar sqTolerance = tolerance * tolerance;\r\n\r\n\t // stage 1: vertex reduction\r\n\t points = _reducePoints(points, sqTolerance);\r\n\r\n\t // stage 2: Douglas-Peucker simplification\r\n\t points = _simplifyDP(points, sqTolerance);\r\n\r\n\treturn points;\r\n}\r\n\r\n// @function pointToSegmentDistance(p: Point, p1: Point, p2: Point): Number\r\n// Returns the distance between point `p` and segment `p1` to `p2`.\r\nexport function pointToSegmentDistance(p, p1, p2) {\r\n\treturn Math.sqrt(_sqClosestPointOnSegment(p, p1, p2, true));\r\n}\r\n\r\n// @function closestPointOnSegment(p: Point, p1: Point, p2: Point): Number\r\n// Returns the closest point from a point `p` on a segment `p1` to `p2`.\r\nexport function closestPointOnSegment(p, p1, p2) {\r\n\treturn _sqClosestPointOnSegment(p, p1, p2);\r\n}\r\n\r\n// Ramer-Douglas-Peucker simplification, see https://en.wikipedia.org/wiki/Ramer-Douglas-Peucker_algorithm\r\nfunction _simplifyDP(points, sqTolerance) {\r\n\r\n\tvar len = points.length,\r\n\t ArrayConstructor = typeof Uint8Array !== undefined + '' ? Uint8Array : Array,\r\n\t markers = new ArrayConstructor(len);\r\n\r\n\t markers[0] = markers[len - 1] = 1;\r\n\r\n\t_simplifyDPStep(points, markers, sqTolerance, 0, len - 1);\r\n\r\n\tvar i,\r\n\t newPoints = [];\r\n\r\n\tfor (i = 0; i < len; i++) {\r\n\t\tif (markers[i]) {\r\n\t\t\tnewPoints.push(points[i]);\r\n\t\t}\r\n\t}\r\n\r\n\treturn newPoints;\r\n}\r\n\r\nfunction _simplifyDPStep(points, markers, sqTolerance, first, last) {\r\n\r\n\tvar maxSqDist = 0,\r\n\tindex, i, sqDist;\r\n\r\n\tfor (i = first + 1; i <= last - 1; i++) {\r\n\t\tsqDist = _sqClosestPointOnSegment(points[i], points[first], points[last], true);\r\n\r\n\t\tif (sqDist > maxSqDist) {\r\n\t\t\tindex = i;\r\n\t\t\tmaxSqDist = sqDist;\r\n\t\t}\r\n\t}\r\n\r\n\tif (maxSqDist > sqTolerance) {\r\n\t\tmarkers[index] = 1;\r\n\r\n\t\t_simplifyDPStep(points, markers, sqTolerance, first, index);\r\n\t\t_simplifyDPStep(points, markers, sqTolerance, index, last);\r\n\t}\r\n}\r\n\r\n// reduce points that are too close to each other to a single point\r\nfunction _reducePoints(points, sqTolerance) {\r\n\tvar reducedPoints = [points[0]];\r\n\r\n\tfor (var i = 1, prev = 0, len = points.length; i < len; i++) {\r\n\t\tif (_sqDist(points[i], points[prev]) > sqTolerance) {\r\n\t\t\treducedPoints.push(points[i]);\r\n\t\t\tprev = i;\r\n\t\t}\r\n\t}\r\n\tif (prev < len - 1) {\r\n\t\treducedPoints.push(points[len - 1]);\r\n\t}\r\n\treturn reducedPoints;\r\n}\r\n\r\nvar _lastCode;\r\n\r\n// @function clipSegment(a: Point, b: Point, bounds: Bounds, useLastCode?: Boolean, round?: Boolean): Point[]|Boolean\r\n// Clips the segment a to b by rectangular bounds with the\r\n// [Cohen-Sutherland algorithm](https://en.wikipedia.org/wiki/Cohen%E2%80%93Sutherland_algorithm)\r\n// (modifying the segment points directly!). Used by Leaflet to only show polyline\r\n// points that are on the screen or near, increasing performance.\r\nexport function clipSegment(a, b, bounds, useLastCode, round) {\r\n\tvar codeA = useLastCode ? _lastCode : _getBitCode(a, bounds),\r\n\t codeB = _getBitCode(b, bounds),\r\n\r\n\t codeOut, p, newCode;\r\n\r\n\t // save 2nd code to avoid calculating it on the next segment\r\n\t _lastCode = codeB;\r\n\r\n\twhile (true) {\r\n\t\t// if a,b is inside the clip window (trivial accept)\r\n\t\tif (!(codeA | codeB)) {\r\n\t\t\treturn [a, b];\r\n\t\t}\r\n\r\n\t\t// if a,b is outside the clip window (trivial reject)\r\n\t\tif (codeA & codeB) {\r\n\t\t\treturn false;\r\n\t\t}\r\n\r\n\t\t// other cases\r\n\t\tcodeOut = codeA || codeB;\r\n\t\tp = _getEdgeIntersection(a, b, codeOut, bounds, round);\r\n\t\tnewCode = _getBitCode(p, bounds);\r\n\r\n\t\tif (codeOut === codeA) {\r\n\t\t\ta = p;\r\n\t\t\tcodeA = newCode;\r\n\t\t} else {\r\n\t\t\tb = p;\r\n\t\t\tcodeB = newCode;\r\n\t\t}\r\n\t}\r\n}\r\n\r\nexport function _getEdgeIntersection(a, b, code, bounds, round) {\r\n\tvar dx = b.x - a.x,\r\n\t dy = b.y - a.y,\r\n\t min = bounds.min,\r\n\t max = bounds.max,\r\n\t x, y;\r\n\r\n\tif (code & 8) { // top\r\n\t\tx = a.x + dx * (max.y - a.y) / dy;\r\n\t\ty = max.y;\r\n\r\n\t} else if (code & 4) { // bottom\r\n\t\tx = a.x + dx * (min.y - a.y) / dy;\r\n\t\ty = min.y;\r\n\r\n\t} else if (code & 2) { // right\r\n\t\tx = max.x;\r\n\t\ty = a.y + dy * (max.x - a.x) / dx;\r\n\r\n\t} else if (code & 1) { // left\r\n\t\tx = min.x;\r\n\t\ty = a.y + dy * (min.x - a.x) / dx;\r\n\t}\r\n\r\n\treturn new Point(x, y, round);\r\n}\r\n\r\nexport function _getBitCode(p, bounds) {\r\n\tvar code = 0;\r\n\r\n\tif (p.x < bounds.min.x) { // left\r\n\t\tcode |= 1;\r\n\t} else if (p.x > bounds.max.x) { // right\r\n\t\tcode |= 2;\r\n\t}\r\n\r\n\tif (p.y < bounds.min.y) { // bottom\r\n\t\tcode |= 4;\r\n\t} else if (p.y > bounds.max.y) { // top\r\n\t\tcode |= 8;\r\n\t}\r\n\r\n\treturn code;\r\n}\r\n\r\n// square distance (to avoid unnecessary Math.sqrt calls)\r\nfunction _sqDist(p1, p2) {\r\n\tvar dx = p2.x - p1.x,\r\n\t dy = p2.y - p1.y;\r\n\treturn dx * dx + dy * dy;\r\n}\r\n\r\n// return closest point on segment or distance to that point\r\nexport function _sqClosestPointOnSegment(p, p1, p2, sqDist) {\r\n\tvar x = p1.x,\r\n\t y = p1.y,\r\n\t dx = p2.x - x,\r\n\t dy = p2.y - y,\r\n\t dot = dx * dx + dy * dy,\r\n\t t;\r\n\r\n\tif (dot > 0) {\r\n\t\tt = ((p.x - x) * dx + (p.y - y) * dy) / dot;\r\n\r\n\t\tif (t > 1) {\r\n\t\t\tx = p2.x;\r\n\t\t\ty = p2.y;\r\n\t\t} else if (t > 0) {\r\n\t\t\tx += dx * t;\r\n\t\t\ty += dy * t;\r\n\t\t}\r\n\t}\r\n\r\n\tdx = p.x - x;\r\n\tdy = p.y - y;\r\n\r\n\treturn sqDist ? dx * dx + dy * dy : new Point(x, y);\r\n}\r\n\r\n\r\n// @function isFlat(latlngs: LatLng[]): Boolean\r\n// Returns true if `latlngs` is a flat array, false is nested.\r\nexport function isFlat(latlngs) {\r\n\treturn !Util.isArray(latlngs[0]) || (typeof latlngs[0][0] !== 'object' && typeof latlngs[0][0] !== 'undefined');\r\n}\r\n\r\nexport function _flat(latlngs) {\r\n\tconsole.warn('Deprecated use of _flat, please use L.LineUtil.isFlat instead.');\r\n\treturn isFlat(latlngs);\r\n}\r\n\r\n/* @function polylineCenter(latlngs: LatLng[], crs: CRS): LatLng\r\n * Returns the center ([centroid](http://en.wikipedia.org/wiki/Centroid)) of the passed LatLngs (first ring) from a polyline.\r\n */\r\nexport function polylineCenter(latlngs, crs) {\r\n\tvar i, halfDist, segDist, dist, p1, p2, ratio, center;\r\n\r\n\tif (!latlngs || latlngs.length === 0) {\r\n\t\tthrow new Error('latlngs not passed');\r\n\t}\r\n\r\n\tif (!isFlat(latlngs)) {\r\n\t\tconsole.warn('latlngs are not flat! Only the first ring will be used');\r\n\t\tlatlngs = latlngs[0];\r\n\t}\r\n\r\n\tvar centroidLatLng = toLatLng([0, 0]);\r\n\r\n\tvar bounds = toLatLngBounds(latlngs);\r\n\tvar areaBounds = bounds.getNorthWest().distanceTo(bounds.getSouthWest()) * bounds.getNorthEast().distanceTo(bounds.getNorthWest());\r\n\t// tests showed that below 1700 rounding errors are happening\r\n\tif (areaBounds < 1700) {\r\n\t\t// getting a inexact center, to move the latlngs near to [0, 0] to prevent rounding errors\r\n\t\tcentroidLatLng = centroid(latlngs);\r\n\t}\r\n\r\n\tvar len = latlngs.length;\r\n\tvar points = [];\r\n\tfor (i = 0; i < len; i++) {\r\n\t\tvar latlng = toLatLng(latlngs[i]);\r\n\t\tpoints.push(crs.project(toLatLng([latlng.lat - centroidLatLng.lat, latlng.lng - centroidLatLng.lng])));\r\n\t}\r\n\r\n\tfor (i = 0, halfDist = 0; i < len - 1; i++) {\r\n\t\thalfDist += points[i].distanceTo(points[i + 1]) / 2;\r\n\t}\r\n\r\n\t// The line is so small in the current view that all points are on the same pixel.\r\n\tif (halfDist === 0) {\r\n\t\tcenter = points[0];\r\n\t} else {\r\n\t\tfor (i = 0, dist = 0; i < len - 1; i++) {\r\n\t\t\tp1 = points[i];\r\n\t\t\tp2 = points[i + 1];\r\n\t\t\tsegDist = p1.distanceTo(p2);\r\n\t\t\tdist += segDist;\r\n\r\n\t\t\tif (dist > halfDist) {\r\n\t\t\t\tratio = (dist - halfDist) / segDist;\r\n\t\t\t\tcenter = [\r\n\t\t\t\t\tp2.x - ratio * (p2.x - p1.x),\r\n\t\t\t\t\tp2.y - ratio * (p2.y - p1.y)\r\n\t\t\t\t];\r\n\t\t\t\tbreak;\r\n\t\t\t}\r\n\t\t}\r\n\t}\r\n\r\n\tvar latlngCenter = crs.unproject(toPoint(center));\r\n\treturn toLatLng([latlngCenter.lat + centroidLatLng.lat, latlngCenter.lng + centroidLatLng.lng]);\r\n}\r\n", "import {LatLng} from '../LatLng';\r\nimport {Bounds} from '../../geometry/Bounds';\r\nimport {Point} from '../../geometry/Point';\r\n\r\n/*\r\n * @namespace Projection\r\n * @section\r\n * Leaflet comes with a set of already defined Projections out of the box:\r\n *\r\n * @projection L.Projection.LonLat\r\n *\r\n * Equirectangular, or Plate Carree projection — the most simple projection,\r\n * mostly used by GIS enthusiasts. Directly maps `x` as longitude, and `y` as\r\n * latitude. Also suitable for flat worlds, e.g. game maps. Used by the\r\n * `EPSG:4326` and `Simple` CRS.\r\n */\r\n\r\nexport var LonLat = {\r\n\tproject: function (latlng) {\r\n\t\treturn new Point(latlng.lng, latlng.lat);\r\n\t},\r\n\r\n\tunproject: function (point) {\r\n\t\treturn new LatLng(point.y, point.x);\r\n\t},\r\n\r\n\tbounds: new Bounds([-180, -90], [180, 90])\r\n};\r\n", "import {LatLng} from '../LatLng';\r\nimport {Bounds} from '../../geometry/Bounds';\r\nimport {Point} from '../../geometry/Point';\r\n\r\n/*\r\n * @namespace Projection\r\n * @projection L.Projection.Mercator\r\n *\r\n * Elliptical Mercator projection — more complex than Spherical Mercator. Assumes that Earth is an ellipsoid. Used by the EPSG:3395 CRS.\r\n */\r\n\r\nexport var Mercator = {\r\n\tR: 6378137,\r\n\tR_MINOR: 6356752.314245179,\r\n\r\n\tbounds: new Bounds([-20037508.34279, -15496570.73972], [20037508.34279, 18764656.23138]),\r\n\r\n\tproject: function (latlng) {\r\n\t\tvar d = Math.PI / 180,\r\n\t\t r = this.R,\r\n\t\t y = latlng.lat * d,\r\n\t\t tmp = this.R_MINOR / r,\r\n\t\t e = Math.sqrt(1 - tmp * tmp),\r\n\t\t con = e * Math.sin(y);\r\n\r\n\t\tvar ts = Math.tan(Math.PI / 4 - y / 2) / Math.pow((1 - con) / (1 + con), e / 2);\r\n\t\ty = -r * Math.log(Math.max(ts, 1E-10));\r\n\r\n\t\treturn new Point(latlng.lng * d * r, y);\r\n\t},\r\n\r\n\tunproject: function (point) {\r\n\t\tvar d = 180 / Math.PI,\r\n\t\t r = this.R,\r\n\t\t tmp = this.R_MINOR / r,\r\n\t\t e = Math.sqrt(1 - tmp * tmp),\r\n\t\t ts = Math.exp(-point.y / r),\r\n\t\t phi = Math.PI / 2 - 2 * Math.atan(ts);\r\n\r\n\t\tfor (var i = 0, dphi = 0.1, con; i < 15 && Math.abs(dphi) > 1e-7; i++) {\r\n\t\t\tcon = e * Math.sin(phi);\r\n\t\t\tcon = Math.pow((1 - con) / (1 + con), e / 2);\r\n\t\t\tdphi = Math.PI / 2 - 2 * Math.atan(ts * con) - phi;\r\n\t\t\tphi += dphi;\r\n\t\t}\r\n\r\n\t\treturn new LatLng(phi * d, point.x * d / r);\r\n\t}\r\n};\r\n", "/*\n * @class Projection\n\n * An object with methods for projecting geographical coordinates of the world onto\n * a flat surface (and back). See [Map projection](https://en.wikipedia.org/wiki/Map_projection).\n\n * @property bounds: Bounds\n * The bounds (specified in CRS units) where the projection is valid\n\n * @method project(latlng: LatLng): Point\n * Projects geographical coordinates into a 2D point.\n * Only accepts actual `L.LatLng` instances, not arrays.\n\n * @method unproject(point: Point): LatLng\n * The inverse of `project`. Projects a 2D point into a geographical location.\n * Only accepts actual `L.Point` instances, not arrays.\n\n * Note that the projection instances do not inherit from Leaflet's `Class` object,\n * and can't be instantiated. Also, new classes can't inherit from them,\n * and methods can't be added to them with the `include` function.\n\n */\n\nexport {LonLat} from './Projection.LonLat';\nexport {Mercator} from './Projection.Mercator';\nexport {SphericalMercator} from './Projection.SphericalMercator';\n", "import {Earth} from './CRS.Earth';\r\nimport {Mercator} from '../projection/Projection.Mercator';\r\nimport {toTransformation} from '../../geometry/Transformation';\r\nimport * as Util from '../../core/Util';\r\n\r\n/*\r\n * @namespace CRS\r\n * @crs L.CRS.EPSG3395\r\n *\r\n * Rarely used by some commercial tile providers. Uses Elliptical Mercator projection.\r\n */\r\nexport var EPSG3395 = Util.extend({}, Earth, {\r\n\tcode: 'EPSG:3395',\r\n\tprojection: Mercator,\r\n\r\n\ttransformation: (function () {\r\n\t\tvar scale = 0.5 / (Math.PI * Mercator.R);\r\n\t\treturn toTransformation(scale, 0.5, -scale, 0.5);\r\n\t}())\r\n});\r\n", "import {Earth} from './CRS.Earth';\r\nimport {LonLat} from '../projection/Projection.LonLat';\r\nimport {toTransformation} from '../../geometry/Transformation';\r\nimport * as Util from '../../core/Util';\r\n\r\n/*\r\n * @namespace CRS\r\n * @crs L.CRS.EPSG4326\r\n *\r\n * A common CRS among GIS enthusiasts. Uses simple Equirectangular projection.\r\n *\r\n * Leaflet 1.0.x complies with the [TMS coordinate scheme for EPSG:4326](https://wiki.osgeo.org/wiki/Tile_Map_Service_Specification#global-geodetic),\r\n * which is a breaking change from 0.7.x behaviour. If you are using a `TileLayer`\r\n * with this CRS, ensure that there are two 256x256 pixel tiles covering the\r\n * whole earth at zoom level zero, and that the tile coordinate origin is (-180,+90),\r\n * or (-180,-90) for `TileLayer`s with [the `tms` option](#tilelayer-tms) set.\r\n */\r\n\r\nexport var EPSG4326 = Util.extend({}, Earth, {\r\n\tcode: 'EPSG:4326',\r\n\tprojection: LonLat,\r\n\ttransformation: toTransformation(1 / 180, 1, -1 / 180, 0.5)\r\n});\r\n", "import {CRS} from './CRS';\nimport {LonLat} from '../projection/Projection.LonLat';\nimport {toTransformation} from '../../geometry/Transformation';\nimport * as Util from '../../core/Util';\n\n/*\n * @namespace CRS\n * @crs L.CRS.Simple\n *\n * A simple CRS that maps longitude and latitude into `x` and `y` directly.\n * May be used for maps of flat surfaces (e.g. game maps). Note that the `y`\n * axis should still be inverted (going from bottom to top). `distance()` returns\n * simple euclidean distance.\n */\n\nexport var Simple = Util.extend({}, CRS, {\n\tprojection: LonLat,\n\ttransformation: toTransformation(1, 0, -1, 0),\n\n\tscale: function (zoom) {\n\t\treturn Math.pow(2, zoom);\n\t},\n\n\tzoom: function (scale) {\n\t\treturn Math.log(scale) / Math.LN2;\n\t},\n\n\tdistance: function (latlng1, latlng2) {\n\t\tvar dx = latlng2.lng - latlng1.lng,\n\t\t dy = latlng2.lat - latlng1.lat;\n\n\t\treturn Math.sqrt(dx * dx + dy * dy);\n\t},\n\n\tinfinite: true\n});\n", "import {CRS} from './CRS';\nimport {Earth} from './CRS.Earth';\nimport {EPSG3395} from './CRS.EPSG3395';\nimport {EPSG3857, EPSG900913} from './CRS.EPSG3857';\nimport {EPSG4326} from './CRS.EPSG4326';\nimport {Simple} from './CRS.Simple';\n\nCRS.Earth = Earth;\nCRS.EPSG3395 = EPSG3395;\nCRS.EPSG3857 = EPSG3857;\nCRS.EPSG900913 = EPSG900913;\nCRS.EPSG4326 = EPSG4326;\nCRS.Simple = Simple;\n\nexport {CRS};\n", "import {Evented} from '../core/Events';\nimport {Map} from '../map/Map';\nimport * as Util from '../core/Util';\n\n/*\n * @class Layer\n * @inherits Evented\n * @aka L.Layer\n * @aka ILayer\n *\n * A set of methods from the Layer base class that all Leaflet layers use.\n * Inherits all methods, options and events from `L.Evented`.\n *\n * @example\n *\n * ```js\n * var layer = L.marker(latlng).addTo(map);\n * layer.addTo(map);\n * layer.remove();\n * ```\n *\n * @event add: Event\n * Fired after the layer is added to a map\n *\n * @event remove: Event\n * Fired after the layer is removed from a map\n */\n\n\nexport var Layer = Evented.extend({\n\n\t// Classes extending `L.Layer` will inherit the following options:\n\toptions: {\n\t\t// @option pane: String = 'overlayPane'\n\t\t// By default the layer will be added to the map's [overlay pane](#map-overlaypane). Overriding this option will cause the layer to be placed on another pane by default.\n\t\tpane: 'overlayPane',\n\n\t\t// @option attribution: String = null\n\t\t// String to be shown in the attribution control, e.g. \"© OpenStreetMap contributors\". It describes the layer data and is often a legal obligation towards copyright holders and tile providers.\n\t\tattribution: null,\n\n\t\tbubblingMouseEvents: true\n\t},\n\n\t/* @section\n\t * Classes extending `L.Layer` will inherit the following methods:\n\t *\n\t * @method addTo(map: Map|LayerGroup): this\n\t * Adds the layer to the given map or layer group.\n\t */\n\taddTo: function (map) {\n\t\tmap.addLayer(this);\n\t\treturn this;\n\t},\n\n\t// @method remove: this\n\t// Removes the layer from the map it is currently active on.\n\tremove: function () {\n\t\treturn this.removeFrom(this._map || this._mapToAdd);\n\t},\n\n\t// @method removeFrom(map: Map): this\n\t// Removes the layer from the given map\n\t//\n\t// @alternative\n\t// @method removeFrom(group: LayerGroup): this\n\t// Removes the layer from the given `LayerGroup`\n\tremoveFrom: function (obj) {\n\t\tif (obj) {\n\t\t\tobj.removeLayer(this);\n\t\t}\n\t\treturn this;\n\t},\n\n\t// @method getPane(name? : String): HTMLElement\n\t// Returns the `HTMLElement` representing the named pane on the map. If `name` is omitted, returns the pane for this layer.\n\tgetPane: function (name) {\n\t\treturn this._map.getPane(name ? (this.options[name] || name) : this.options.pane);\n\t},\n\n\taddInteractiveTarget: function (targetEl) {\n\t\tthis._map._targets[Util.stamp(targetEl)] = this;\n\t\treturn this;\n\t},\n\n\tremoveInteractiveTarget: function (targetEl) {\n\t\tdelete this._map._targets[Util.stamp(targetEl)];\n\t\treturn this;\n\t},\n\n\t// @method getAttribution: String\n\t// Used by the `attribution control`, returns the [attribution option](#gridlayer-attribution).\n\tgetAttribution: function () {\n\t\treturn this.options.attribution;\n\t},\n\n\t_layerAdd: function (e) {\n\t\tvar map = e.target;\n\n\t\t// check in case layer gets added and then removed before the map is ready\n\t\tif (!map.hasLayer(this)) { return; }\n\n\t\tthis._map = map;\n\t\tthis._zoomAnimated = map._zoomAnimated;\n\n\t\tif (this.getEvents) {\n\t\t\tvar events = this.getEvents();\n\t\t\tmap.on(events, this);\n\t\t\tthis.once('remove', function () {\n\t\t\t\tmap.off(events, this);\n\t\t\t}, this);\n\t\t}\n\n\t\tthis.onAdd(map);\n\n\t\tthis.fire('add');\n\t\tmap.fire('layeradd', {layer: this});\n\t}\n});\n\n/* @section Extension methods\n * @uninheritable\n *\n * Every layer should extend from `L.Layer` and (re-)implement the following methods.\n *\n * @method onAdd(map: Map): this\n * Should contain code that creates DOM elements for the layer, adds them to `map panes` where they should belong and puts listeners on relevant map events. Called on [`map.addLayer(layer)`](#map-addlayer).\n *\n * @method onRemove(map: Map): this\n * Should contain all clean up code that removes the layer's elements from the DOM and removes listeners previously added in [`onAdd`](#layer-onadd). Called on [`map.removeLayer(layer)`](#map-removelayer).\n *\n * @method getEvents(): Object\n * This optional method should return an object like `{ viewreset: this._reset }` for [`addEventListener`](#evented-addeventlistener). The event handlers in this object will be automatically added and removed from the map with your layer.\n *\n * @method getAttribution(): String\n * This optional method should return a string containing HTML to be shown on the `Attribution control` whenever the layer is visible.\n *\n * @method beforeAdd(map: Map): this\n * Optional method. Called on [`map.addLayer(layer)`](#map-addlayer), before the layer is added to the map, before events are initialized, without waiting until the map is in a usable state. Use for early initialization only.\n */\n\n\n/* @namespace Map\n * @section Layer events\n *\n * @event layeradd: LayerEvent\n * Fired when a new layer is added to the map.\n *\n * @event layerremove: LayerEvent\n * Fired when some layer is removed from the map\n *\n * @section Methods for Layers and Controls\n */\nMap.include({\n\t// @method addLayer(layer: Layer): this\n\t// Adds the given layer to the map\n\taddLayer: function (layer) {\n\t\tif (!layer._layerAdd) {\n\t\t\tthrow new Error('The provided object is not a Layer.');\n\t\t}\n\n\t\tvar id = Util.stamp(layer);\n\t\tif (this._layers[id]) { return this; }\n\t\tthis._layers[id] = layer;\n\n\t\tlayer._mapToAdd = this;\n\n\t\tif (layer.beforeAdd) {\n\t\t\tlayer.beforeAdd(this);\n\t\t}\n\n\t\tthis.whenReady(layer._layerAdd, layer);\n\n\t\treturn this;\n\t},\n\n\t// @method removeLayer(layer: Layer): this\n\t// Removes the given layer from the map.\n\tremoveLayer: function (layer) {\n\t\tvar id = Util.stamp(layer);\n\n\t\tif (!this._layers[id]) { return this; }\n\n\t\tif (this._loaded) {\n\t\t\tlayer.onRemove(this);\n\t\t}\n\n\t\tdelete this._layers[id];\n\n\t\tif (this._loaded) {\n\t\t\tthis.fire('layerremove', {layer: layer});\n\t\t\tlayer.fire('remove');\n\t\t}\n\n\t\tlayer._map = layer._mapToAdd = null;\n\n\t\treturn this;\n\t},\n\n\t// @method hasLayer(layer: Layer): Boolean\n\t// Returns `true` if the given layer is currently added to the map\n\thasLayer: function (layer) {\n\t\treturn Util.stamp(layer) in this._layers;\n\t},\n\n\t/* @method eachLayer(fn: Function, context?: Object): this\n\t * Iterates over the layers of the map, optionally specifying context of the iterator function.\n\t * ```\n\t * map.eachLayer(function(layer){\n\t * layer.bindPopup('Hello');\n\t * });\n\t * ```\n\t */\n\teachLayer: function (method, context) {\n\t\tfor (var i in this._layers) {\n\t\t\tmethod.call(context, this._layers[i]);\n\t\t}\n\t\treturn this;\n\t},\n\n\t_addLayers: function (layers) {\n\t\tlayers = layers ? (Util.isArray(layers) ? layers : [layers]) : [];\n\n\t\tfor (var i = 0, len = layers.length; i < len; i++) {\n\t\t\tthis.addLayer(layers[i]);\n\t\t}\n\t},\n\n\t_addZoomLimit: function (layer) {\n\t\tif (!isNaN(layer.options.maxZoom) || !isNaN(layer.options.minZoom)) {\n\t\t\tthis._zoomBoundLayers[Util.stamp(layer)] = layer;\n\t\t\tthis._updateZoomLevels();\n\t\t}\n\t},\n\n\t_removeZoomLimit: function (layer) {\n\t\tvar id = Util.stamp(layer);\n\n\t\tif (this._zoomBoundLayers[id]) {\n\t\t\tdelete this._zoomBoundLayers[id];\n\t\t\tthis._updateZoomLevels();\n\t\t}\n\t},\n\n\t_updateZoomLevels: function () {\n\t\tvar minZoom = Infinity,\n\t\t maxZoom = -Infinity,\n\t\t oldZoomSpan = this._getZoomSpan();\n\n\t\tfor (var i in this._zoomBoundLayers) {\n\t\t\tvar options = this._zoomBoundLayers[i].options;\n\n\t\t\tminZoom = options.minZoom === undefined ? minZoom : Math.min(minZoom, options.minZoom);\n\t\t\tmaxZoom = options.maxZoom === undefined ? maxZoom : Math.max(maxZoom, options.maxZoom);\n\t\t}\n\n\t\tthis._layersMaxZoom = maxZoom === -Infinity ? undefined : maxZoom;\n\t\tthis._layersMinZoom = minZoom === Infinity ? undefined : minZoom;\n\n\t\t// @section Map state change events\n\t\t// @event zoomlevelschange: Event\n\t\t// Fired when the number of zoomlevels on the map is changed due\n\t\t// to adding or removing a layer.\n\t\tif (oldZoomSpan !== this._getZoomSpan()) {\n\t\t\tthis.fire('zoomlevelschange');\n\t\t}\n\n\t\tif (this.options.maxZoom === undefined && this._layersMaxZoom && this.getZoom() > this._layersMaxZoom) {\n\t\t\tthis.setZoom(this._layersMaxZoom);\n\t\t}\n\t\tif (this.options.minZoom === undefined && this._layersMinZoom && this.getZoom() < this._layersMinZoom) {\n\t\t\tthis.setZoom(this._layersMinZoom);\n\t\t}\n\t}\n});\n", "\r\nimport {Layer} from './Layer';\r\nimport * as Util from '../core/Util';\r\n\r\n/*\r\n * @class LayerGroup\r\n * @aka L.LayerGroup\r\n * @inherits Interactive layer\r\n *\r\n * Used to group several layers and handle them as one. If you add it to the map,\r\n * any layers added or removed from the group will be added/removed on the map as\r\n * well. Extends `Layer`.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * L.layerGroup([marker1, marker2])\r\n * \t.addLayer(polyline)\r\n * \t.addTo(map);\r\n * ```\r\n */\r\n\r\nexport var LayerGroup = Layer.extend({\r\n\r\n\tinitialize: function (layers, options) {\r\n\t\tUtil.setOptions(this, options);\r\n\r\n\t\tthis._layers = {};\r\n\r\n\t\tvar i, len;\r\n\r\n\t\tif (layers) {\r\n\t\t\tfor (i = 0, len = layers.length; i < len; i++) {\r\n\t\t\t\tthis.addLayer(layers[i]);\r\n\t\t\t}\r\n\t\t}\r\n\t},\r\n\r\n\t// @method addLayer(layer: Layer): this\r\n\t// Adds the given layer to the group.\r\n\taddLayer: function (layer) {\r\n\t\tvar id = this.getLayerId(layer);\r\n\r\n\t\tthis._layers[id] = layer;\r\n\r\n\t\tif (this._map) {\r\n\t\t\tthis._map.addLayer(layer);\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method removeLayer(layer: Layer): this\r\n\t// Removes the given layer from the group.\r\n\t// @alternative\r\n\t// @method removeLayer(id: Number): this\r\n\t// Removes the layer with the given internal ID from the group.\r\n\tremoveLayer: function (layer) {\r\n\t\tvar id = layer in this._layers ? layer : this.getLayerId(layer);\r\n\r\n\t\tif (this._map && this._layers[id]) {\r\n\t\t\tthis._map.removeLayer(this._layers[id]);\r\n\t\t}\r\n\r\n\t\tdelete this._layers[id];\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method hasLayer(layer: Layer): Boolean\r\n\t// Returns `true` if the given layer is currently added to the group.\r\n\t// @alternative\r\n\t// @method hasLayer(id: Number): Boolean\r\n\t// Returns `true` if the given internal ID is currently added to the group.\r\n\thasLayer: function (layer) {\r\n\t\tvar layerId = typeof layer === 'number' ? layer : this.getLayerId(layer);\r\n\t\treturn layerId in this._layers;\r\n\t},\r\n\r\n\t// @method clearLayers(): this\r\n\t// Removes all the layers from the group.\r\n\tclearLayers: function () {\r\n\t\treturn this.eachLayer(this.removeLayer, this);\r\n\t},\r\n\r\n\t// @method invoke(methodName: String, …): this\r\n\t// Calls `methodName` on every layer contained in this group, passing any\r\n\t// additional parameters. Has no effect if the layers contained do not\r\n\t// implement `methodName`.\r\n\tinvoke: function (methodName) {\r\n\t\tvar args = Array.prototype.slice.call(arguments, 1),\r\n\t\t i, layer;\r\n\r\n\t\tfor (i in this._layers) {\r\n\t\t\tlayer = this._layers[i];\r\n\r\n\t\t\tif (layer[methodName]) {\r\n\t\t\t\tlayer[methodName].apply(layer, args);\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\tonAdd: function (map) {\r\n\t\tthis.eachLayer(map.addLayer, map);\r\n\t},\r\n\r\n\tonRemove: function (map) {\r\n\t\tthis.eachLayer(map.removeLayer, map);\r\n\t},\r\n\r\n\t// @method eachLayer(fn: Function, context?: Object): this\r\n\t// Iterates over the layers of the group, optionally specifying context of the iterator function.\r\n\t// ```js\r\n\t// group.eachLayer(function (layer) {\r\n\t// \tlayer.bindPopup('Hello');\r\n\t// });\r\n\t// ```\r\n\teachLayer: function (method, context) {\r\n\t\tfor (var i in this._layers) {\r\n\t\t\tmethod.call(context, this._layers[i]);\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method getLayer(id: Number): Layer\r\n\t// Returns the layer with the given internal ID.\r\n\tgetLayer: function (id) {\r\n\t\treturn this._layers[id];\r\n\t},\r\n\r\n\t// @method getLayers(): Layer[]\r\n\t// Returns an array of all the layers added to the group.\r\n\tgetLayers: function () {\r\n\t\tvar layers = [];\r\n\t\tthis.eachLayer(layers.push, layers);\r\n\t\treturn layers;\r\n\t},\r\n\r\n\t// @method setZIndex(zIndex: Number): this\r\n\t// Calls `setZIndex` on every layer contained in this group, passing the z-index.\r\n\tsetZIndex: function (zIndex) {\r\n\t\treturn this.invoke('setZIndex', zIndex);\r\n\t},\r\n\r\n\t// @method getLayerId(layer: Layer): Number\r\n\t// Returns the internal ID for a layer\r\n\tgetLayerId: function (layer) {\r\n\t\treturn Util.stamp(layer);\r\n\t}\r\n});\r\n\r\n\r\n// @factory L.layerGroup(layers?: Layer[], options?: Object)\r\n// Create a layer group, optionally given an initial set of layers and an `options` object.\r\nexport var layerGroup = function (layers, options) {\r\n\treturn new LayerGroup(layers, options);\r\n};\r\n", "import {LayerGroup} from './LayerGroup';\r\nimport {LatLngBounds} from '../geo/LatLngBounds';\r\n\r\n/*\r\n * @class FeatureGroup\r\n * @aka L.FeatureGroup\r\n * @inherits LayerGroup\r\n *\r\n * Extended `LayerGroup` that makes it easier to do the same thing to all its member layers:\r\n * * [`bindPopup`](#layer-bindpopup) binds a popup to all of the layers at once (likewise with [`bindTooltip`](#layer-bindtooltip))\r\n * * Events are propagated to the `FeatureGroup`, so if the group has an event\r\n * handler, it will handle events from any of the layers. This includes mouse events\r\n * and custom events.\r\n * * Has `layeradd` and `layerremove` events\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * L.featureGroup([marker1, marker2, polyline])\r\n * \t.bindPopup('Hello world!')\r\n * \t.on('click', function() { alert('Clicked on a member of the group!'); })\r\n * \t.addTo(map);\r\n * ```\r\n */\r\n\r\nexport var FeatureGroup = LayerGroup.extend({\r\n\r\n\taddLayer: function (layer) {\r\n\t\tif (this.hasLayer(layer)) {\r\n\t\t\treturn this;\r\n\t\t}\r\n\r\n\t\tlayer.addEventParent(this);\r\n\r\n\t\tLayerGroup.prototype.addLayer.call(this, layer);\r\n\r\n\t\t// @event layeradd: LayerEvent\r\n\t\t// Fired when a layer is added to this `FeatureGroup`\r\n\t\treturn this.fire('layeradd', {layer: layer});\r\n\t},\r\n\r\n\tremoveLayer: function (layer) {\r\n\t\tif (!this.hasLayer(layer)) {\r\n\t\t\treturn this;\r\n\t\t}\r\n\t\tif (layer in this._layers) {\r\n\t\t\tlayer = this._layers[layer];\r\n\t\t}\r\n\r\n\t\tlayer.removeEventParent(this);\r\n\r\n\t\tLayerGroup.prototype.removeLayer.call(this, layer);\r\n\r\n\t\t// @event layerremove: LayerEvent\r\n\t\t// Fired when a layer is removed from this `FeatureGroup`\r\n\t\treturn this.fire('layerremove', {layer: layer});\r\n\t},\r\n\r\n\t// @method setStyle(style: Path options): this\r\n\t// Sets the given path options to each layer of the group that has a `setStyle` method.\r\n\tsetStyle: function (style) {\r\n\t\treturn this.invoke('setStyle', style);\r\n\t},\r\n\r\n\t// @method bringToFront(): this\r\n\t// Brings the layer group to the top of all other layers\r\n\tbringToFront: function () {\r\n\t\treturn this.invoke('bringToFront');\r\n\t},\r\n\r\n\t// @method bringToBack(): this\r\n\t// Brings the layer group to the back of all other layers\r\n\tbringToBack: function () {\r\n\t\treturn this.invoke('bringToBack');\r\n\t},\r\n\r\n\t// @method getBounds(): LatLngBounds\r\n\t// Returns the LatLngBounds of the Feature Group (created from bounds and coordinates of its children).\r\n\tgetBounds: function () {\r\n\t\tvar bounds = new LatLngBounds();\r\n\r\n\t\tfor (var id in this._layers) {\r\n\t\t\tvar layer = this._layers[id];\r\n\t\t\tbounds.extend(layer.getBounds ? layer.getBounds() : layer.getLatLng());\r\n\t\t}\r\n\t\treturn bounds;\r\n\t}\r\n});\r\n\r\n// @factory L.featureGroup(layers?: Layer[], options?: Object)\r\n// Create a feature group, optionally given an initial set of layers and an `options` object.\r\nexport var featureGroup = function (layers, options) {\r\n\treturn new FeatureGroup(layers, options);\r\n};\r\n", "import {Class} from '../../core/Class';\r\nimport {setOptions} from '../../core/Util';\r\nimport {toPoint as point} from '../../geometry/Point';\r\nimport Browser from '../../core/Browser';\r\n\r\n/*\r\n * @class Icon\r\n * @aka L.Icon\r\n *\r\n * Represents an icon to provide when creating a marker.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * var myIcon = L.icon({\r\n * iconUrl: 'my-icon.png',\r\n * iconRetinaUrl: 'my-icon@2x.png',\r\n * iconSize: [38, 95],\r\n * iconAnchor: [22, 94],\r\n * popupAnchor: [-3, -76],\r\n * shadowUrl: 'my-icon-shadow.png',\r\n * shadowRetinaUrl: 'my-icon-shadow@2x.png',\r\n * shadowSize: [68, 95],\r\n * shadowAnchor: [22, 94]\r\n * });\r\n *\r\n * L.marker([50.505, 30.57], {icon: myIcon}).addTo(map);\r\n * ```\r\n *\r\n * `L.Icon.Default` extends `L.Icon` and is the blue icon Leaflet uses for markers by default.\r\n *\r\n */\r\n\r\nexport var Icon = Class.extend({\r\n\r\n\t/* @section\r\n\t * @aka Icon options\r\n\t *\r\n\t * @option iconUrl: String = null\r\n\t * **(required)** The URL to the icon image (absolute or relative to your script path).\r\n\t *\r\n\t * @option iconRetinaUrl: String = null\r\n\t * The URL to a retina sized version of the icon image (absolute or relative to your\r\n\t * script path). Used for Retina screen devices.\r\n\t *\r\n\t * @option iconSize: Point = null\r\n\t * Size of the icon image in pixels.\r\n\t *\r\n\t * @option iconAnchor: Point = null\r\n\t * The coordinates of the \"tip\" of the icon (relative to its top left corner). The icon\r\n\t * will be aligned so that this point is at the marker's geographical location. Centered\r\n\t * by default if size is specified, also can be set in CSS with negative margins.\r\n\t *\r\n\t * @option popupAnchor: Point = [0, 0]\r\n\t * The coordinates of the point from which popups will \"open\", relative to the icon anchor.\r\n\t *\r\n\t * @option tooltipAnchor: Point = [0, 0]\r\n\t * The coordinates of the point from which tooltips will \"open\", relative to the icon anchor.\r\n\t *\r\n\t * @option shadowUrl: String = null\r\n\t * The URL to the icon shadow image. If not specified, no shadow image will be created.\r\n\t *\r\n\t * @option shadowRetinaUrl: String = null\r\n\t *\r\n\t * @option shadowSize: Point = null\r\n\t * Size of the shadow image in pixels.\r\n\t *\r\n\t * @option shadowAnchor: Point = null\r\n\t * The coordinates of the \"tip\" of the shadow (relative to its top left corner) (the same\r\n\t * as iconAnchor if not specified).\r\n\t *\r\n\t * @option className: String = ''\r\n\t * A custom class name to assign to both icon and shadow images. Empty by default.\r\n\t */\r\n\r\n\toptions: {\r\n\t\tpopupAnchor: [0, 0],\r\n\t\ttooltipAnchor: [0, 0],\r\n\r\n\t\t// @option crossOrigin: Boolean|String = false\r\n\t\t// Whether the crossOrigin attribute will be added to the tiles.\r\n\t\t// If a String is provided, all tiles will have their crossOrigin attribute set to the String provided. This is needed if you want to access tile pixel data.\r\n\t\t// Refer to [CORS Settings](https://developer.mozilla.org/en-US/docs/Web/HTML/CORS_settings_attributes) for valid String values.\r\n\t\tcrossOrigin: false\r\n\t},\r\n\r\n\tinitialize: function (options) {\r\n\t\tsetOptions(this, options);\r\n\t},\r\n\r\n\t// @method createIcon(oldIcon?: HTMLElement): HTMLElement\r\n\t// Called internally when the icon has to be shown, returns a `<img>` HTML element\r\n\t// styled according to the options.\r\n\tcreateIcon: function (oldIcon) {\r\n\t\treturn this._createIcon('icon', oldIcon);\r\n\t},\r\n\r\n\t// @method createShadow(oldIcon?: HTMLElement): HTMLElement\r\n\t// As `createIcon`, but for the shadow beneath it.\r\n\tcreateShadow: function (oldIcon) {\r\n\t\treturn this._createIcon('shadow', oldIcon);\r\n\t},\r\n\r\n\t_createIcon: function (name, oldIcon) {\r\n\t\tvar src = this._getIconUrl(name);\r\n\r\n\t\tif (!src) {\r\n\t\t\tif (name === 'icon') {\r\n\t\t\t\tthrow new Error('iconUrl not set in Icon options (see the docs).');\r\n\t\t\t}\r\n\t\t\treturn null;\r\n\t\t}\r\n\r\n\t\tvar img = this._createImg(src, oldIcon && oldIcon.tagName === 'IMG' ? oldIcon : null);\r\n\t\tthis._setIconStyles(img, name);\r\n\r\n\t\tif (this.options.crossOrigin || this.options.crossOrigin === '') {\r\n\t\t\timg.crossOrigin = this.options.crossOrigin === true ? '' : this.options.crossOrigin;\r\n\t\t}\r\n\r\n\t\treturn img;\r\n\t},\r\n\r\n\t_setIconStyles: function (img, name) {\r\n\t\tvar options = this.options;\r\n\t\tvar sizeOption = options[name + 'Size'];\r\n\r\n\t\tif (typeof sizeOption === 'number') {\r\n\t\t\tsizeOption = [sizeOption, sizeOption];\r\n\t\t}\r\n\r\n\t\tvar size = point(sizeOption),\r\n\t\t anchor = point(name === 'shadow' && options.shadowAnchor || options.iconAnchor ||\r\n\t\t size && size.divideBy(2, true));\r\n\r\n\t\timg.className = 'leaflet-marker-' + name + ' ' + (options.className || '');\r\n\r\n\t\tif (anchor) {\r\n\t\t\timg.style.marginLeft = (-anchor.x) + 'px';\r\n\t\t\timg.style.marginTop = (-anchor.y) + 'px';\r\n\t\t}\r\n\r\n\t\tif (size) {\r\n\t\t\timg.style.width = size.x + 'px';\r\n\t\t\timg.style.height = size.y + 'px';\r\n\t\t}\r\n\t},\r\n\r\n\t_createImg: function (src, el) {\r\n\t\tel = el || document.createElement('img');\r\n\t\tel.src = src;\r\n\t\treturn el;\r\n\t},\r\n\r\n\t_getIconUrl: function (name) {\r\n\t\treturn Browser.retina && this.options[name + 'RetinaUrl'] || this.options[name + 'Url'];\r\n\t}\r\n});\r\n\r\n\r\n// @factory L.icon(options: Icon options)\r\n// Creates an icon instance with the given options.\r\nexport function icon(options) {\r\n\treturn new Icon(options);\r\n}\r\n", "import {Icon} from './Icon';\nimport * as DomUtil from '../../dom/DomUtil';\n\n/*\n * @miniclass Icon.Default (Icon)\n * @aka L.Icon.Default\n * @section\n *\n * A trivial subclass of `Icon`, represents the icon to use in `Marker`s when\n * no icon is specified. Points to the blue marker image distributed with Leaflet\n * releases.\n *\n * In order to customize the default icon, just change the properties of `L.Icon.Default.prototype.options`\n * (which is a set of `Icon options`).\n *\n * If you want to _completely_ replace the default icon, override the\n * `L.Marker.prototype.options.icon` with your own icon instead.\n */\n\nexport var IconDefault = Icon.extend({\n\n\toptions: {\n\t\ticonUrl: 'marker-icon.png',\n\t\ticonRetinaUrl: 'marker-icon-2x.png',\n\t\tshadowUrl: 'marker-shadow.png',\n\t\ticonSize: [25, 41],\n\t\ticonAnchor: [12, 41],\n\t\tpopupAnchor: [1, -34],\n\t\ttooltipAnchor: [16, -28],\n\t\tshadowSize: [41, 41]\n\t},\n\n\t_getIconUrl: function (name) {\n\t\tif (typeof IconDefault.imagePath !== 'string') {\t// Deprecated, backwards-compatibility only\n\t\t\tIconDefault.imagePath = this._detectIconPath();\n\t\t}\n\n\t\t// @option imagePath: String\n\t\t// `Icon.Default` will try to auto-detect the location of the\n\t\t// blue icon images. If you are placing these images in a non-standard\n\t\t// way, set this option to point to the right path.\n\t\treturn (this.options.imagePath || IconDefault.imagePath) + Icon.prototype._getIconUrl.call(this, name);\n\t},\n\n\t_stripUrl: function (path) {\t// separate function to use in tests\n\t\tvar strip = function (str, re, idx) {\n\t\t\tvar match = re.exec(str);\n\t\t\treturn match && match[idx];\n\t\t};\n\t\tpath = strip(path, /^url\\((['\"])?(.+)\\1\\)$/, 2);\n\t\treturn path && strip(path, /^(.*)marker-icon\\.png$/, 1);\n\t},\n\n\t_detectIconPath: function () {\n\t\tvar el = DomUtil.create('div', 'leaflet-default-icon-path', document.body);\n\t\tvar path = DomUtil.getStyle(el, 'background-image') ||\n\t\t DomUtil.getStyle(el, 'backgroundImage');\t// IE8\n\n\t\tdocument.body.removeChild(el);\n\t\tpath = this._stripUrl(path);\n\t\tif (path) { return path; }\n\t\tvar link = document.querySelector('link[href$=\"leaflet.css\"]');\n\t\tif (!link) { return ''; }\n\t\treturn link.href.substring(0, link.href.length - 'leaflet.css'.length - 1);\n\t}\n});\n", "import {Handler} from '../../core/Handler';\nimport * as DomUtil from '../../dom/DomUtil';\nimport {Draggable} from '../../dom/Draggable';\nimport {toBounds} from '../../geometry/Bounds';\nimport {toPoint} from '../../geometry/Point';\nimport {requestAnimFrame, cancelAnimFrame} from '../../core/Util';\n\n/*\n * L.Handler.MarkerDrag is used internally by L.Marker to make the markers draggable.\n */\n\n\n/* @namespace Marker\n * @section Interaction handlers\n *\n * Interaction handlers are properties of a marker instance that allow you to control interaction behavior in runtime, enabling or disabling certain features such as dragging (see `Handler` methods). Example:\n *\n * ```js\n * marker.dragging.disable();\n * ```\n *\n * @property dragging: Handler\n * Marker dragging handler (by both mouse and touch). Only valid when the marker is on the map (Otherwise set [`marker.options.draggable`](#marker-draggable)).\n */\n\nexport var MarkerDrag = Handler.extend({\n\tinitialize: function (marker) {\n\t\tthis._marker = marker;\n\t},\n\n\taddHooks: function () {\n\t\tvar icon = this._marker._icon;\n\n\t\tif (!this._draggable) {\n\t\t\tthis._draggable = new Draggable(icon, icon, true);\n\t\t}\n\n\t\tthis._draggable.on({\n\t\t\tdragstart: this._onDragStart,\n\t\t\tpredrag: this._onPreDrag,\n\t\t\tdrag: this._onDrag,\n\t\t\tdragend: this._onDragEnd\n\t\t}, this).enable();\n\n\t\tDomUtil.addClass(icon, 'leaflet-marker-draggable');\n\t},\n\n\tremoveHooks: function () {\n\t\tthis._draggable.off({\n\t\t\tdragstart: this._onDragStart,\n\t\t\tpredrag: this._onPreDrag,\n\t\t\tdrag: this._onDrag,\n\t\t\tdragend: this._onDragEnd\n\t\t}, this).disable();\n\n\t\tif (this._marker._icon) {\n\t\t\tDomUtil.removeClass(this._marker._icon, 'leaflet-marker-draggable');\n\t\t}\n\t},\n\n\tmoved: function () {\n\t\treturn this._draggable && this._draggable._moved;\n\t},\n\n\t_adjustPan: function (e) {\n\t\tvar marker = this._marker,\n\t\t map = marker._map,\n\t\t speed = this._marker.options.autoPanSpeed,\n\t\t padding = this._marker.options.autoPanPadding,\n\t\t iconPos = DomUtil.getPosition(marker._icon),\n\t\t bounds = map.getPixelBounds(),\n\t\t origin = map.getPixelOrigin();\n\n\t\tvar panBounds = toBounds(\n\t\t\tbounds.min._subtract(origin).add(padding),\n\t\t\tbounds.max._subtract(origin).subtract(padding)\n\t\t);\n\n\t\tif (!panBounds.contains(iconPos)) {\n\t\t\t// Compute incremental movement\n\t\t\tvar movement = toPoint(\n\t\t\t\t(Math.max(panBounds.max.x, iconPos.x) - panBounds.max.x) / (bounds.max.x - panBounds.max.x) -\n\t\t\t\t(Math.min(panBounds.min.x, iconPos.x) - panBounds.min.x) / (bounds.min.x - panBounds.min.x),\n\n\t\t\t\t(Math.max(panBounds.max.y, iconPos.y) - panBounds.max.y) / (bounds.max.y - panBounds.max.y) -\n\t\t\t\t(Math.min(panBounds.min.y, iconPos.y) - panBounds.min.y) / (bounds.min.y - panBounds.min.y)\n\t\t\t).multiplyBy(speed);\n\n\t\t\tmap.panBy(movement, {animate: false});\n\n\t\t\tthis._draggable._newPos._add(movement);\n\t\t\tthis._draggable._startPos._add(movement);\n\n\t\t\tDomUtil.setPosition(marker._icon, this._draggable._newPos);\n\t\t\tthis._onDrag(e);\n\n\t\t\tthis._panRequest = requestAnimFrame(this._adjustPan.bind(this, e));\n\t\t}\n\t},\n\n\t_onDragStart: function () {\n\t\t// @section Dragging events\n\t\t// @event dragstart: Event\n\t\t// Fired when the user starts dragging the marker.\n\n\t\t// @event movestart: Event\n\t\t// Fired when the marker starts moving (because of dragging).\n\n\t\tthis._oldLatLng = this._marker.getLatLng();\n\n\t\t// When using ES6 imports it could not be set when `Popup` was not imported as well\n\t\tthis._marker.closePopup && this._marker.closePopup();\n\n\t\tthis._marker\n\t\t\t.fire('movestart')\n\t\t\t.fire('dragstart');\n\t},\n\n\t_onPreDrag: function (e) {\n\t\tif (this._marker.options.autoPan) {\n\t\t\tcancelAnimFrame(this._panRequest);\n\t\t\tthis._panRequest = requestAnimFrame(this._adjustPan.bind(this, e));\n\t\t}\n\t},\n\n\t_onDrag: function (e) {\n\t\tvar marker = this._marker,\n\t\t shadow = marker._shadow,\n\t\t iconPos = DomUtil.getPosition(marker._icon),\n\t\t latlng = marker._map.layerPointToLatLng(iconPos);\n\n\t\t// update shadow position\n\t\tif (shadow) {\n\t\t\tDomUtil.setPosition(shadow, iconPos);\n\t\t}\n\n\t\tmarker._latlng = latlng;\n\t\te.latlng = latlng;\n\t\te.oldLatLng = this._oldLatLng;\n\n\t\t// @event drag: Event\n\t\t// Fired repeatedly while the user drags the marker.\n\t\tmarker\n\t\t .fire('move', e)\n\t\t .fire('drag', e);\n\t},\n\n\t_onDragEnd: function (e) {\n\t\t// @event dragend: DragEndEvent\n\t\t// Fired when the user stops dragging the marker.\n\n\t\t cancelAnimFrame(this._panRequest);\n\n\t\t// @event moveend: Event\n\t\t// Fired when the marker stops moving (because of dragging).\n\t\tdelete this._oldLatLng;\n\t\tthis._marker\n\t\t .fire('moveend')\n\t\t .fire('dragend', e);\n\t}\n});\n", "import {Layer} from '../Layer';\r\nimport {IconDefault} from './Icon.Default';\r\nimport * as Util from '../../core/Util';\r\nimport {toLatLng as latLng} from '../../geo/LatLng';\r\nimport {toPoint as point} from '../../geometry/Point';\r\nimport * as DomUtil from '../../dom/DomUtil';\r\nimport * as DomEvent from '../../dom/DomEvent';\r\nimport {MarkerDrag} from './Marker.Drag';\r\n\r\n/*\r\n * @class Marker\r\n * @inherits Interactive layer\r\n * @aka L.Marker\r\n * L.Marker is used to display clickable/draggable icons on the map. Extends `Layer`.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * L.marker([50.5, 30.5]).addTo(map);\r\n * ```\r\n */\r\n\r\nexport var Marker = Layer.extend({\r\n\r\n\t// @section\r\n\t// @aka Marker options\r\n\toptions: {\r\n\t\t// @option icon: Icon = *\r\n\t\t// Icon instance to use for rendering the marker.\r\n\t\t// See [Icon documentation](#L.Icon) for details on how to customize the marker icon.\r\n\t\t// If not specified, a common instance of `L.Icon.Default` is used.\r\n\t\ticon: new IconDefault(),\r\n\r\n\t\t// Option inherited from \"Interactive layer\" abstract class\r\n\t\tinteractive: true,\r\n\r\n\t\t// @option keyboard: Boolean = true\r\n\t\t// Whether the marker can be tabbed to with a keyboard and clicked by pressing enter.\r\n\t\tkeyboard: true,\r\n\r\n\t\t// @option title: String = ''\r\n\t\t// Text for the browser tooltip that appear on marker hover (no tooltip by default).\r\n\t\t// [Useful for accessibility](https://leafletjs.com/examples/accessibility/#markers-must-be-labelled).\r\n\t\ttitle: '',\r\n\r\n\t\t// @option alt: String = 'Marker'\r\n\t\t// Text for the `alt` attribute of the icon image.\r\n\t\t// [Useful for accessibility](https://leafletjs.com/examples/accessibility/#markers-must-be-labelled).\r\n\t\talt: 'Marker',\r\n\r\n\t\t// @option zIndexOffset: Number = 0\r\n\t\t// By default, marker images zIndex is set automatically based on its latitude. Use this option if you want to put the marker on top of all others (or below), specifying a high value like `1000` (or high negative value, respectively).\r\n\t\tzIndexOffset: 0,\r\n\r\n\t\t// @option opacity: Number = 1.0\r\n\t\t// The opacity of the marker.\r\n\t\topacity: 1,\r\n\r\n\t\t// @option riseOnHover: Boolean = false\r\n\t\t// If `true`, the marker will get on top of others when you hover the mouse over it.\r\n\t\triseOnHover: false,\r\n\r\n\t\t// @option riseOffset: Number = 250\r\n\t\t// The z-index offset used for the `riseOnHover` feature.\r\n\t\triseOffset: 250,\r\n\r\n\t\t// @option pane: String = 'markerPane'\r\n\t\t// `Map pane` where the markers icon will be added.\r\n\t\tpane: 'markerPane',\r\n\r\n\t\t// @option shadowPane: String = 'shadowPane'\r\n\t\t// `Map pane` where the markers shadow will be added.\r\n\t\tshadowPane: 'shadowPane',\r\n\r\n\t\t// @option bubblingMouseEvents: Boolean = false\r\n\t\t// When `true`, a mouse event on this marker will trigger the same event on the map\r\n\t\t// (unless [`L.DomEvent.stopPropagation`](#domevent-stoppropagation) is used).\r\n\t\tbubblingMouseEvents: false,\r\n\r\n\t\t// @option autoPanOnFocus: Boolean = true\r\n\t\t// When `true`, the map will pan whenever the marker is focused (via\r\n\t\t// e.g. pressing `tab` on the keyboard) to ensure the marker is\r\n\t\t// visible within the map's bounds\r\n\t\tautoPanOnFocus: true,\r\n\r\n\t\t// @section Draggable marker options\r\n\t\t// @option draggable: Boolean = false\r\n\t\t// Whether the marker is draggable with mouse/touch or not.\r\n\t\tdraggable: false,\r\n\r\n\t\t// @option autoPan: Boolean = false\r\n\t\t// Whether to pan the map when dragging this marker near its edge or not.\r\n\t\tautoPan: false,\r\n\r\n\t\t// @option autoPanPadding: Point = Point(50, 50)\r\n\t\t// Distance (in pixels to the left/right and to the top/bottom) of the\r\n\t\t// map edge to start panning the map.\r\n\t\tautoPanPadding: [50, 50],\r\n\r\n\t\t// @option autoPanSpeed: Number = 10\r\n\t\t// Number of pixels the map should pan by.\r\n\t\tautoPanSpeed: 10\r\n\t},\r\n\r\n\t/* @section\r\n\t *\r\n\t * In addition to [shared layer methods](#Layer) like `addTo()` and `remove()` and [popup methods](#Popup) like bindPopup() you can also use the following methods:\r\n\t */\r\n\r\n\tinitialize: function (latlng, options) {\r\n\t\tUtil.setOptions(this, options);\r\n\t\tthis._latlng = latLng(latlng);\r\n\t},\r\n\r\n\tonAdd: function (map) {\r\n\t\tthis._zoomAnimated = this._zoomAnimated && map.options.markerZoomAnimation;\r\n\r\n\t\tif (this._zoomAnimated) {\r\n\t\t\tmap.on('zoomanim', this._animateZoom, this);\r\n\t\t}\r\n\r\n\t\tthis._initIcon();\r\n\t\tthis.update();\r\n\t},\r\n\r\n\tonRemove: function (map) {\r\n\t\tif (this.dragging && this.dragging.enabled()) {\r\n\t\t\tthis.options.draggable = true;\r\n\t\t\tthis.dragging.removeHooks();\r\n\t\t}\r\n\t\tdelete this.dragging;\r\n\r\n\t\tif (this._zoomAnimated) {\r\n\t\t\tmap.off('zoomanim', this._animateZoom, this);\r\n\t\t}\r\n\r\n\t\tthis._removeIcon();\r\n\t\tthis._removeShadow();\r\n\t},\r\n\r\n\tgetEvents: function () {\r\n\t\treturn {\r\n\t\t\tzoom: this.update,\r\n\t\t\tviewreset: this.update\r\n\t\t};\r\n\t},\r\n\r\n\t// @method getLatLng: LatLng\r\n\t// Returns the current geographical position of the marker.\r\n\tgetLatLng: function () {\r\n\t\treturn this._latlng;\r\n\t},\r\n\r\n\t// @method setLatLng(latlng: LatLng): this\r\n\t// Changes the marker position to the given point.\r\n\tsetLatLng: function (latlng) {\r\n\t\tvar oldLatLng = this._latlng;\r\n\t\tthis._latlng = latLng(latlng);\r\n\t\tthis.update();\r\n\r\n\t\t// @event move: Event\r\n\t\t// Fired when the marker is moved via [`setLatLng`](#marker-setlatlng) or by [dragging](#marker-dragging). Old and new coordinates are included in event arguments as `oldLatLng`, `latlng`.\r\n\t\treturn this.fire('move', {oldLatLng: oldLatLng, latlng: this._latlng});\r\n\t},\r\n\r\n\t// @method setZIndexOffset(offset: Number): this\r\n\t// Changes the [zIndex offset](#marker-zindexoffset) of the marker.\r\n\tsetZIndexOffset: function (offset) {\r\n\t\tthis.options.zIndexOffset = offset;\r\n\t\treturn this.update();\r\n\t},\r\n\r\n\t// @method getIcon: Icon\r\n\t// Returns the current icon used by the marker\r\n\tgetIcon: function () {\r\n\t\treturn this.options.icon;\r\n\t},\r\n\r\n\t// @method setIcon(icon: Icon): this\r\n\t// Changes the marker icon.\r\n\tsetIcon: function (icon) {\r\n\r\n\t\tthis.options.icon = icon;\r\n\r\n\t\tif (this._map) {\r\n\t\t\tthis._initIcon();\r\n\t\t\tthis.update();\r\n\t\t}\r\n\r\n\t\tif (this._popup) {\r\n\t\t\tthis.bindPopup(this._popup, this._popup.options);\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\tgetElement: function () {\r\n\t\treturn this._icon;\r\n\t},\r\n\r\n\tupdate: function () {\r\n\r\n\t\tif (this._icon && this._map) {\r\n\t\t\tvar pos = this._map.latLngToLayerPoint(this._latlng).round();\r\n\t\t\tthis._setPos(pos);\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t_initIcon: function () {\r\n\t\tvar options = this.options,\r\n\t\t classToAdd = 'leaflet-zoom-' + (this._zoomAnimated ? 'animated' : 'hide');\r\n\r\n\t\tvar icon = options.icon.createIcon(this._icon),\r\n\t\t addIcon = false;\r\n\r\n\t\t// if we're not reusing the icon, remove the old one and init new one\r\n\t\tif (icon !== this._icon) {\r\n\t\t\tif (this._icon) {\r\n\t\t\t\tthis._removeIcon();\r\n\t\t\t}\r\n\t\t\taddIcon = true;\r\n\r\n\t\t\tif (options.title) {\r\n\t\t\t\ticon.title = options.title;\r\n\t\t\t}\r\n\r\n\t\t\tif (icon.tagName === 'IMG') {\r\n\t\t\t\ticon.alt = options.alt || '';\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\tDomUtil.addClass(icon, classToAdd);\r\n\r\n\t\tif (options.keyboard) {\r\n\t\t\ticon.tabIndex = '0';\r\n\t\t\ticon.setAttribute('role', 'button');\r\n\t\t}\r\n\r\n\t\tthis._icon = icon;\r\n\r\n\t\tif (options.riseOnHover) {\r\n\t\t\tthis.on({\r\n\t\t\t\tmouseover: this._bringToFront,\r\n\t\t\t\tmouseout: this._resetZIndex\r\n\t\t\t});\r\n\t\t}\r\n\r\n\t\tif (this.options.autoPanOnFocus) {\r\n\t\t\tDomEvent.on(icon, 'focus', this._panOnFocus, this);\r\n\t\t}\r\n\r\n\t\tvar newShadow = options.icon.createShadow(this._shadow),\r\n\t\t addShadow = false;\r\n\r\n\t\tif (newShadow !== this._shadow) {\r\n\t\t\tthis._removeShadow();\r\n\t\t\taddShadow = true;\r\n\t\t}\r\n\r\n\t\tif (newShadow) {\r\n\t\t\tDomUtil.addClass(newShadow, classToAdd);\r\n\t\t\tnewShadow.alt = '';\r\n\t\t}\r\n\t\tthis._shadow = newShadow;\r\n\r\n\r\n\t\tif (options.opacity < 1) {\r\n\t\t\tthis._updateOpacity();\r\n\t\t}\r\n\r\n\r\n\t\tif (addIcon) {\r\n\t\t\tthis.getPane().appendChild(this._icon);\r\n\t\t}\r\n\t\tthis._initInteraction();\r\n\t\tif (newShadow && addShadow) {\r\n\t\t\tthis.getPane(options.shadowPane).appendChild(this._shadow);\r\n\t\t}\r\n\t},\r\n\r\n\t_removeIcon: function () {\r\n\t\tif (this.options.riseOnHover) {\r\n\t\t\tthis.off({\r\n\t\t\t\tmouseover: this._bringToFront,\r\n\t\t\t\tmouseout: this._resetZIndex\r\n\t\t\t});\r\n\t\t}\r\n\r\n\t\tif (this.options.autoPanOnFocus) {\r\n\t\t\tDomEvent.off(this._icon, 'focus', this._panOnFocus, this);\r\n\t\t}\r\n\r\n\t\tDomUtil.remove(this._icon);\r\n\t\tthis.removeInteractiveTarget(this._icon);\r\n\r\n\t\tthis._icon = null;\r\n\t},\r\n\r\n\t_removeShadow: function () {\r\n\t\tif (this._shadow) {\r\n\t\t\tDomUtil.remove(this._shadow);\r\n\t\t}\r\n\t\tthis._shadow = null;\r\n\t},\r\n\r\n\t_setPos: function (pos) {\r\n\r\n\t\tif (this._icon) {\r\n\t\t\tDomUtil.setPosition(this._icon, pos);\r\n\t\t}\r\n\r\n\t\tif (this._shadow) {\r\n\t\t\tDomUtil.setPosition(this._shadow, pos);\r\n\t\t}\r\n\r\n\t\tthis._zIndex = pos.y + this.options.zIndexOffset;\r\n\r\n\t\tthis._resetZIndex();\r\n\t},\r\n\r\n\t_updateZIndex: function (offset) {\r\n\t\tif (this._icon) {\r\n\t\t\tthis._icon.style.zIndex = this._zIndex + offset;\r\n\t\t}\r\n\t},\r\n\r\n\t_animateZoom: function (opt) {\r\n\t\tvar pos = this._map._latLngToNewLayerPoint(this._latlng, opt.zoom, opt.center).round();\r\n\r\n\t\tthis._setPos(pos);\r\n\t},\r\n\r\n\t_initInteraction: function () {\r\n\r\n\t\tif (!this.options.interactive) { return; }\r\n\r\n\t\tDomUtil.addClass(this._icon, 'leaflet-interactive');\r\n\r\n\t\tthis.addInteractiveTarget(this._icon);\r\n\r\n\t\tif (MarkerDrag) {\r\n\t\t\tvar draggable = this.options.draggable;\r\n\t\t\tif (this.dragging) {\r\n\t\t\t\tdraggable = this.dragging.enabled();\r\n\t\t\t\tthis.dragging.disable();\r\n\t\t\t}\r\n\r\n\t\t\tthis.dragging = new MarkerDrag(this);\r\n\r\n\t\t\tif (draggable) {\r\n\t\t\t\tthis.dragging.enable();\r\n\t\t\t}\r\n\t\t}\r\n\t},\r\n\r\n\t// @method setOpacity(opacity: Number): this\r\n\t// Changes the opacity of the marker.\r\n\tsetOpacity: function (opacity) {\r\n\t\tthis.options.opacity = opacity;\r\n\t\tif (this._map) {\r\n\t\t\tthis._updateOpacity();\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t_updateOpacity: function () {\r\n\t\tvar opacity = this.options.opacity;\r\n\r\n\t\tif (this._icon) {\r\n\t\t\tDomUtil.setOpacity(this._icon, opacity);\r\n\t\t}\r\n\r\n\t\tif (this._shadow) {\r\n\t\t\tDomUtil.setOpacity(this._shadow, opacity);\r\n\t\t}\r\n\t},\r\n\r\n\t_bringToFront: function () {\r\n\t\tthis._updateZIndex(this.options.riseOffset);\r\n\t},\r\n\r\n\t_resetZIndex: function () {\r\n\t\tthis._updateZIndex(0);\r\n\t},\r\n\r\n\t_panOnFocus: function () {\r\n\t\tvar map = this._map;\r\n\t\tif (!map) { return; }\r\n\r\n\t\tvar iconOpts = this.options.icon.options;\r\n\t\tvar size = iconOpts.iconSize ? point(iconOpts.iconSize) : point(0, 0);\r\n\t\tvar anchor = iconOpts.iconAnchor ? point(iconOpts.iconAnchor) : point(0, 0);\r\n\r\n\t\tmap.panInside(this._latlng, {\r\n\t\t\tpaddingTopLeft: anchor,\r\n\t\t\tpaddingBottomRight: size.subtract(anchor)\r\n\t\t});\r\n\t},\r\n\r\n\t_getPopupAnchor: function () {\r\n\t\treturn this.options.icon.options.popupAnchor;\r\n\t},\r\n\r\n\t_getTooltipAnchor: function () {\r\n\t\treturn this.options.icon.options.tooltipAnchor;\r\n\t}\r\n});\r\n\r\n\r\n// factory L.marker(latlng: LatLng, options? : Marker options)\r\n\r\n// @factory L.marker(latlng: LatLng, options? : Marker options)\r\n// Instantiates a Marker object given a geographical point and optionally an options object.\r\nexport function marker(latlng, options) {\r\n\treturn new Marker(latlng, options);\r\n}\r\n", "import {Layer} from '../Layer';\nimport * as Util from '../../core/Util';\n\n/*\n * @class Path\n * @aka L.Path\n * @inherits Interactive layer\n *\n * An abstract class that contains options and constants shared between vector\n * overlays (Polygon, Polyline, Circle). Do not use it directly. Extends `Layer`.\n */\n\nexport var Path = Layer.extend({\n\n\t// @section\n\t// @aka Path options\n\toptions: {\n\t\t// @option stroke: Boolean = true\n\t\t// Whether to draw stroke along the path. Set it to `false` to disable borders on polygons or circles.\n\t\tstroke: true,\n\n\t\t// @option color: String = '#3388ff'\n\t\t// Stroke color\n\t\tcolor: '#3388ff',\n\n\t\t// @option weight: Number = 3\n\t\t// Stroke width in pixels\n\t\tweight: 3,\n\n\t\t// @option opacity: Number = 1.0\n\t\t// Stroke opacity\n\t\topacity: 1,\n\n\t\t// @option lineCap: String= 'round'\n\t\t// A string that defines [shape to be used at the end](https://developer.mozilla.org/docs/Web/SVG/Attribute/stroke-linecap) of the stroke.\n\t\tlineCap: 'round',\n\n\t\t// @option lineJoin: String = 'round'\n\t\t// A string that defines [shape to be used at the corners](https://developer.mozilla.org/docs/Web/SVG/Attribute/stroke-linejoin) of the stroke.\n\t\tlineJoin: 'round',\n\n\t\t// @option dashArray: String = null\n\t\t// A string that defines the stroke [dash pattern](https://developer.mozilla.org/docs/Web/SVG/Attribute/stroke-dasharray). Doesn't work on `Canvas`-powered layers in [some old browsers](https://developer.mozilla.org/docs/Web/API/CanvasRenderingContext2D/setLineDash#Browser_compatibility).\n\t\tdashArray: null,\n\n\t\t// @option dashOffset: String = null\n\t\t// A string that defines the [distance into the dash pattern to start the dash](https://developer.mozilla.org/docs/Web/SVG/Attribute/stroke-dashoffset). Doesn't work on `Canvas`-powered layers in [some old browsers](https://developer.mozilla.org/docs/Web/API/CanvasRenderingContext2D/setLineDash#Browser_compatibility).\n\t\tdashOffset: null,\n\n\t\t// @option fill: Boolean = depends\n\t\t// Whether to fill the path with color. Set it to `false` to disable filling on polygons or circles.\n\t\tfill: false,\n\n\t\t// @option fillColor: String = *\n\t\t// Fill color. Defaults to the value of the [`color`](#path-color) option\n\t\tfillColor: null,\n\n\t\t// @option fillOpacity: Number = 0.2\n\t\t// Fill opacity.\n\t\tfillOpacity: 0.2,\n\n\t\t// @option fillRule: String = 'evenodd'\n\t\t// A string that defines [how the inside of a shape](https://developer.mozilla.org/docs/Web/SVG/Attribute/fill-rule) is determined.\n\t\tfillRule: 'evenodd',\n\n\t\t// className: '',\n\n\t\t// Option inherited from \"Interactive layer\" abstract class\n\t\tinteractive: true,\n\n\t\t// @option bubblingMouseEvents: Boolean = true\n\t\t// When `true`, a mouse event on this path will trigger the same event on the map\n\t\t// (unless [`L.DomEvent.stopPropagation`](#domevent-stoppropagation) is used).\n\t\tbubblingMouseEvents: true\n\t},\n\n\tbeforeAdd: function (map) {\n\t\t// Renderer is set here because we need to call renderer.getEvents\n\t\t// before this.getEvents.\n\t\tthis._renderer = map.getRenderer(this);\n\t},\n\n\tonAdd: function () {\n\t\tthis._renderer._initPath(this);\n\t\tthis._reset();\n\t\tthis._renderer._addPath(this);\n\t},\n\n\tonRemove: function () {\n\t\tthis._renderer._removePath(this);\n\t},\n\n\t// @method redraw(): this\n\t// Redraws the layer. Sometimes useful after you changed the coordinates that the path uses.\n\tredraw: function () {\n\t\tif (this._map) {\n\t\t\tthis._renderer._updatePath(this);\n\t\t}\n\t\treturn this;\n\t},\n\n\t// @method setStyle(style: Path options): this\n\t// Changes the appearance of a Path based on the options in the `Path options` object.\n\tsetStyle: function (style) {\n\t\tUtil.setOptions(this, style);\n\t\tif (this._renderer) {\n\t\t\tthis._renderer._updateStyle(this);\n\t\t\tif (this.options.stroke && style && Object.prototype.hasOwnProperty.call(style, 'weight')) {\n\t\t\t\tthis._updateBounds();\n\t\t\t}\n\t\t}\n\t\treturn this;\n\t},\n\n\t// @method bringToFront(): this\n\t// Brings the layer to the top of all path layers.\n\tbringToFront: function () {\n\t\tif (this._renderer) {\n\t\t\tthis._renderer._bringToFront(this);\n\t\t}\n\t\treturn this;\n\t},\n\n\t// @method bringToBack(): this\n\t// Brings the layer to the bottom of all path layers.\n\tbringToBack: function () {\n\t\tif (this._renderer) {\n\t\t\tthis._renderer._bringToBack(this);\n\t\t}\n\t\treturn this;\n\t},\n\n\tgetElement: function () {\n\t\treturn this._path;\n\t},\n\n\t_reset: function () {\n\t\t// defined in child classes\n\t\tthis._project();\n\t\tthis._update();\n\t},\n\n\t_clickTolerance: function () {\n\t\t// used when doing hit detection for Canvas layers\n\t\treturn (this.options.stroke ? this.options.weight / 2 : 0) +\n\t\t (this._renderer.options.tolerance || 0);\n\t}\n});\n", "import {Path} from './Path';\nimport * as Util from '../../core/Util';\nimport {toLatLng} from '../../geo/LatLng';\nimport {Bounds} from '../../geometry/Bounds';\n\n\n/*\n * @class CircleMarker\n * @aka L.CircleMarker\n * @inherits Path\n *\n * A circle of a fixed size with radius specified in pixels. Extends `Path`.\n */\n\nexport var CircleMarker = Path.extend({\n\n\t// @section\n\t// @aka CircleMarker options\n\toptions: {\n\t\tfill: true,\n\n\t\t// @option radius: Number = 10\n\t\t// Radius of the circle marker, in pixels\n\t\tradius: 10\n\t},\n\n\tinitialize: function (latlng, options) {\n\t\tUtil.setOptions(this, options);\n\t\tthis._latlng = toLatLng(latlng);\n\t\tthis._radius = this.options.radius;\n\t},\n\n\t// @method setLatLng(latLng: LatLng): this\n\t// Sets the position of a circle marker to a new location.\n\tsetLatLng: function (latlng) {\n\t\tvar oldLatLng = this._latlng;\n\t\tthis._latlng = toLatLng(latlng);\n\t\tthis.redraw();\n\n\t\t// @event move: Event\n\t\t// Fired when the marker is moved via [`setLatLng`](#circlemarker-setlatlng). Old and new coordinates are included in event arguments as `oldLatLng`, `latlng`.\n\t\treturn this.fire('move', {oldLatLng: oldLatLng, latlng: this._latlng});\n\t},\n\n\t// @method getLatLng(): LatLng\n\t// Returns the current geographical position of the circle marker\n\tgetLatLng: function () {\n\t\treturn this._latlng;\n\t},\n\n\t// @method setRadius(radius: Number): this\n\t// Sets the radius of a circle marker. Units are in pixels.\n\tsetRadius: function (radius) {\n\t\tthis.options.radius = this._radius = radius;\n\t\treturn this.redraw();\n\t},\n\n\t// @method getRadius(): Number\n\t// Returns the current radius of the circle\n\tgetRadius: function () {\n\t\treturn this._radius;\n\t},\n\n\tsetStyle : function (options) {\n\t\tvar radius = options && options.radius || this._radius;\n\t\tPath.prototype.setStyle.call(this, options);\n\t\tthis.setRadius(radius);\n\t\treturn this;\n\t},\n\n\t_project: function () {\n\t\tthis._point = this._map.latLngToLayerPoint(this._latlng);\n\t\tthis._updateBounds();\n\t},\n\n\t_updateBounds: function () {\n\t\tvar r = this._radius,\n\t\t r2 = this._radiusY || r,\n\t\t w = this._clickTolerance(),\n\t\t p = [r + w, r2 + w];\n\t\tthis._pxBounds = new Bounds(this._point.subtract(p), this._point.add(p));\n\t},\n\n\t_update: function () {\n\t\tif (this._map) {\n\t\t\tthis._updatePath();\n\t\t}\n\t},\n\n\t_updatePath: function () {\n\t\tthis._renderer._updateCircle(this);\n\t},\n\n\t_empty: function () {\n\t\treturn this._radius && !this._renderer._bounds.intersects(this._pxBounds);\n\t},\n\n\t// Needed by the `Canvas` renderer for interactivity\n\t_containsPoint: function (p) {\n\t\treturn p.distanceTo(this._point) <= this._radius + this._clickTolerance();\n\t}\n});\n\n\n// @factory L.circleMarker(latlng: LatLng, options?: CircleMarker options)\n// Instantiates a circle marker object given a geographical point, and an optional options object.\nexport function circleMarker(latlng, options) {\n\treturn new CircleMarker(latlng, options);\n}\n", "import {CircleMarker} from './CircleMarker';\nimport {Path} from './Path';\nimport * as Util from '../../core/Util';\nimport {toLatLng} from '../../geo/LatLng';\nimport {LatLngBounds} from '../../geo/LatLngBounds';\nimport {Earth} from '../../geo/crs/CRS.Earth';\n\n\n/*\n * @class Circle\n * @aka L.Circle\n * @inherits CircleMarker\n *\n * A class for drawing circle overlays on a map. Extends `CircleMarker`.\n *\n * It's an approximation and starts to diverge from a real circle closer to poles (due to projection distortion).\n *\n * @example\n *\n * ```js\n * L.circle([50.5, 30.5], {radius: 200}).addTo(map);\n * ```\n */\n\nexport var Circle = CircleMarker.extend({\n\n\tinitialize: function (latlng, options, legacyOptions) {\n\t\tif (typeof options === 'number') {\n\t\t\t// Backwards compatibility with 0.7.x factory (latlng, radius, options?)\n\t\t\toptions = Util.extend({}, legacyOptions, {radius: options});\n\t\t}\n\t\tUtil.setOptions(this, options);\n\t\tthis._latlng = toLatLng(latlng);\n\n\t\tif (isNaN(this.options.radius)) { throw new Error('Circle radius cannot be NaN'); }\n\n\t\t// @section\n\t\t// @aka Circle options\n\t\t// @option radius: Number; Radius of the circle, in meters.\n\t\tthis._mRadius = this.options.radius;\n\t},\n\n\t// @method setRadius(radius: Number): this\n\t// Sets the radius of a circle. Units are in meters.\n\tsetRadius: function (radius) {\n\t\tthis._mRadius = radius;\n\t\treturn this.redraw();\n\t},\n\n\t// @method getRadius(): Number\n\t// Returns the current radius of a circle. Units are in meters.\n\tgetRadius: function () {\n\t\treturn this._mRadius;\n\t},\n\n\t// @method getBounds(): LatLngBounds\n\t// Returns the `LatLngBounds` of the path.\n\tgetBounds: function () {\n\t\tvar half = [this._radius, this._radiusY || this._radius];\n\n\t\treturn new LatLngBounds(\n\t\t\tthis._map.layerPointToLatLng(this._point.subtract(half)),\n\t\t\tthis._map.layerPointToLatLng(this._point.add(half)));\n\t},\n\n\tsetStyle: Path.prototype.setStyle,\n\n\t_project: function () {\n\n\t\tvar lng = this._latlng.lng,\n\t\t lat = this._latlng.lat,\n\t\t map = this._map,\n\t\t crs = map.options.crs;\n\n\t\tif (crs.distance === Earth.distance) {\n\t\t\tvar d = Math.PI / 180,\n\t\t\t latR = (this._mRadius / Earth.R) / d,\n\t\t\t top = map.project([lat + latR, lng]),\n\t\t\t bottom = map.project([lat - latR, lng]),\n\t\t\t p = top.add(bottom).divideBy(2),\n\t\t\t lat2 = map.unproject(p).lat,\n\t\t\t lngR = Math.acos((Math.cos(latR * d) - Math.sin(lat * d) * Math.sin(lat2 * d)) /\n\t\t\t (Math.cos(lat * d) * Math.cos(lat2 * d))) / d;\n\n\t\t\tif (isNaN(lngR) || lngR === 0) {\n\t\t\t\tlngR = latR / Math.cos(Math.PI / 180 * lat); // Fallback for edge case, #2425\n\t\t\t}\n\n\t\t\tthis._point = p.subtract(map.getPixelOrigin());\n\t\t\tthis._radius = isNaN(lngR) ? 0 : p.x - map.project([lat2, lng - lngR]).x;\n\t\t\tthis._radiusY = p.y - top.y;\n\n\t\t} else {\n\t\t\tvar latlng2 = crs.unproject(crs.project(this._latlng).subtract([this._mRadius, 0]));\n\n\t\t\tthis._point = map.latLngToLayerPoint(this._latlng);\n\t\t\tthis._radius = this._point.x - map.latLngToLayerPoint(latlng2).x;\n\t\t}\n\n\t\tthis._updateBounds();\n\t}\n});\n\n// @factory L.circle(latlng: LatLng, options?: Circle options)\n// Instantiates a circle object given a geographical point, and an options object\n// which contains the circle radius.\n// @alternative\n// @factory L.circle(latlng: LatLng, radius: Number, options?: Circle options)\n// Obsolete way of instantiating a circle, for compatibility with 0.7.x code.\n// Do not use in new applications or plugins.\nexport function circle(latlng, options, legacyOptions) {\n\treturn new Circle(latlng, options, legacyOptions);\n}\n", "import {Path} from './Path';\nimport * as Util from '../../core/Util';\nimport * as LineUtil from '../../geometry/LineUtil';\nimport {LatLng, toLatLng} from '../../geo/LatLng';\nimport {LatLngBounds} from '../../geo/LatLngBounds';\nimport {Bounds} from '../../geometry/Bounds';\nimport {Point} from '../../geometry/Point';\n\n/*\n * @class Polyline\n * @aka L.Polyline\n * @inherits Path\n *\n * A class for drawing polyline overlays on a map. Extends `Path`.\n *\n * @example\n *\n * ```js\n * // create a red polyline from an array of LatLng points\n * var latlngs = [\n * \t[45.51, -122.68],\n * \t[37.77, -122.43],\n * \t[34.04, -118.2]\n * ];\n *\n * var polyline = L.polyline(latlngs, {color: 'red'}).addTo(map);\n *\n * // zoom the map to the polyline\n * map.fitBounds(polyline.getBounds());\n * ```\n *\n * You can also pass a multi-dimensional array to represent a `MultiPolyline` shape:\n *\n * ```js\n * // create a red polyline from an array of arrays of LatLng points\n * var latlngs = [\n * \t[[45.51, -122.68],\n * \t [37.77, -122.43],\n * \t [34.04, -118.2]],\n * \t[[40.78, -73.91],\n * \t [41.83, -87.62],\n * \t [32.76, -96.72]]\n * ];\n * ```\n */\n\n\nexport var Polyline = Path.extend({\n\n\t// @section\n\t// @aka Polyline options\n\toptions: {\n\t\t// @option smoothFactor: Number = 1.0\n\t\t// How much to simplify the polyline on each zoom level. More means\n\t\t// better performance and smoother look, and less means more accurate representation.\n\t\tsmoothFactor: 1.0,\n\n\t\t// @option noClip: Boolean = false\n\t\t// Disable polyline clipping.\n\t\tnoClip: false\n\t},\n\n\tinitialize: function (latlngs, options) {\n\t\tUtil.setOptions(this, options);\n\t\tthis._setLatLngs(latlngs);\n\t},\n\n\t// @method getLatLngs(): LatLng[]\n\t// Returns an array of the points in the path, or nested arrays of points in case of multi-polyline.\n\tgetLatLngs: function () {\n\t\treturn this._latlngs;\n\t},\n\n\t// @method setLatLngs(latlngs: LatLng[]): this\n\t// Replaces all the points in the polyline with the given array of geographical points.\n\tsetLatLngs: function (latlngs) {\n\t\tthis._setLatLngs(latlngs);\n\t\treturn this.redraw();\n\t},\n\n\t// @method isEmpty(): Boolean\n\t// Returns `true` if the Polyline has no LatLngs.\n\tisEmpty: function () {\n\t\treturn !this._latlngs.length;\n\t},\n\n\t// @method closestLayerPoint(p: Point): Point\n\t// Returns the point closest to `p` on the Polyline.\n\tclosestLayerPoint: function (p) {\n\t\tvar minDistance = Infinity,\n\t\t minPoint = null,\n\t\t closest = LineUtil._sqClosestPointOnSegment,\n\t\t p1, p2;\n\n\t\tfor (var j = 0, jLen = this._parts.length; j < jLen; j++) {\n\t\t\tvar points = this._parts[j];\n\n\t\t\tfor (var i = 1, len = points.length; i < len; i++) {\n\t\t\t\tp1 = points[i - 1];\n\t\t\t\tp2 = points[i];\n\n\t\t\t\tvar sqDist = closest(p, p1, p2, true);\n\n\t\t\t\tif (sqDist < minDistance) {\n\t\t\t\t\tminDistance = sqDist;\n\t\t\t\t\tminPoint = closest(p, p1, p2);\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t\tif (minPoint) {\n\t\t\tminPoint.distance = Math.sqrt(minDistance);\n\t\t}\n\t\treturn minPoint;\n\t},\n\n\t// @method getCenter(): LatLng\n\t// Returns the center ([centroid](https://en.wikipedia.org/wiki/Centroid)) of the polyline.\n\tgetCenter: function () {\n\t\t// throws error when not yet added to map as this center calculation requires projected coordinates\n\t\tif (!this._map) {\n\t\t\tthrow new Error('Must add layer to map before using getCenter()');\n\t\t}\n\t\treturn LineUtil.polylineCenter(this._defaultShape(), this._map.options.crs);\n\t},\n\n\t// @method getBounds(): LatLngBounds\n\t// Returns the `LatLngBounds` of the path.\n\tgetBounds: function () {\n\t\treturn this._bounds;\n\t},\n\n\t// @method addLatLng(latlng: LatLng, latlngs?: LatLng[]): this\n\t// Adds a given point to the polyline. By default, adds to the first ring of\n\t// the polyline in case of a multi-polyline, but can be overridden by passing\n\t// a specific ring as a LatLng array (that you can earlier access with [`getLatLngs`](#polyline-getlatlngs)).\n\taddLatLng: function (latlng, latlngs) {\n\t\tlatlngs = latlngs || this._defaultShape();\n\t\tlatlng = toLatLng(latlng);\n\t\tlatlngs.push(latlng);\n\t\tthis._bounds.extend(latlng);\n\t\treturn this.redraw();\n\t},\n\n\t_setLatLngs: function (latlngs) {\n\t\tthis._bounds = new LatLngBounds();\n\t\tthis._latlngs = this._convertLatLngs(latlngs);\n\t},\n\n\t_defaultShape: function () {\n\t\treturn LineUtil.isFlat(this._latlngs) ? this._latlngs : this._latlngs[0];\n\t},\n\n\t// recursively convert latlngs input into actual LatLng instances; calculate bounds along the way\n\t_convertLatLngs: function (latlngs) {\n\t\tvar result = [],\n\t\t flat = LineUtil.isFlat(latlngs);\n\n\t\tfor (var i = 0, len = latlngs.length; i < len; i++) {\n\t\t\tif (flat) {\n\t\t\t\tresult[i] = toLatLng(latlngs[i]);\n\t\t\t\tthis._bounds.extend(result[i]);\n\t\t\t} else {\n\t\t\t\tresult[i] = this._convertLatLngs(latlngs[i]);\n\t\t\t}\n\t\t}\n\n\t\treturn result;\n\t},\n\n\t_project: function () {\n\t\tvar pxBounds = new Bounds();\n\t\tthis._rings = [];\n\t\tthis._projectLatlngs(this._latlngs, this._rings, pxBounds);\n\n\t\tif (this._bounds.isValid() && pxBounds.isValid()) {\n\t\t\tthis._rawPxBounds = pxBounds;\n\t\t\tthis._updateBounds();\n\t\t}\n\t},\n\n\t_updateBounds: function () {\n\t\tvar w = this._clickTolerance(),\n\t\t p = new Point(w, w);\n\n\t\tif (!this._rawPxBounds) {\n\t\t\treturn;\n\t\t}\n\n\t\tthis._pxBounds = new Bounds([\n\t\t\tthis._rawPxBounds.min.subtract(p),\n\t\t\tthis._rawPxBounds.max.add(p)\n\t\t]);\n\t},\n\n\t// recursively turns latlngs into a set of rings with projected coordinates\n\t_projectLatlngs: function (latlngs, result, projectedBounds) {\n\t\tvar flat = latlngs[0] instanceof LatLng,\n\t\t len = latlngs.length,\n\t\t i, ring;\n\n\t\tif (flat) {\n\t\t\tring = [];\n\t\t\tfor (i = 0; i < len; i++) {\n\t\t\t\tring[i] = this._map.latLngToLayerPoint(latlngs[i]);\n\t\t\t\tprojectedBounds.extend(ring[i]);\n\t\t\t}\n\t\t\tresult.push(ring);\n\t\t} else {\n\t\t\tfor (i = 0; i < len; i++) {\n\t\t\t\tthis._projectLatlngs(latlngs[i], result, projectedBounds);\n\t\t\t}\n\t\t}\n\t},\n\n\t// clip polyline by renderer bounds so that we have less to render for performance\n\t_clipPoints: function () {\n\t\tvar bounds = this._renderer._bounds;\n\n\t\tthis._parts = [];\n\t\tif (!this._pxBounds || !this._pxBounds.intersects(bounds)) {\n\t\t\treturn;\n\t\t}\n\n\t\tif (this.options.noClip) {\n\t\t\tthis._parts = this._rings;\n\t\t\treturn;\n\t\t}\n\n\t\tvar parts = this._parts,\n\t\t i, j, k, len, len2, segment, points;\n\n\t\tfor (i = 0, k = 0, len = this._rings.length; i < len; i++) {\n\t\t\tpoints = this._rings[i];\n\n\t\t\tfor (j = 0, len2 = points.length; j < len2 - 1; j++) {\n\t\t\t\tsegment = LineUtil.clipSegment(points[j], points[j + 1], bounds, j, true);\n\n\t\t\t\tif (!segment) { continue; }\n\n\t\t\t\tparts[k] = parts[k] || [];\n\t\t\t\tparts[k].push(segment[0]);\n\n\t\t\t\t// if segment goes out of screen, or it's the last one, it's the end of the line part\n\t\t\t\tif ((segment[1] !== points[j + 1]) || (j === len2 - 2)) {\n\t\t\t\t\tparts[k].push(segment[1]);\n\t\t\t\t\tk++;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t},\n\n\t// simplify each clipped part of the polyline for performance\n\t_simplifyPoints: function () {\n\t\tvar parts = this._parts,\n\t\t tolerance = this.options.smoothFactor;\n\n\t\tfor (var i = 0, len = parts.length; i < len; i++) {\n\t\t\tparts[i] = LineUtil.simplify(parts[i], tolerance);\n\t\t}\n\t},\n\n\t_update: function () {\n\t\tif (!this._map) { return; }\n\n\t\tthis._clipPoints();\n\t\tthis._simplifyPoints();\n\t\tthis._updatePath();\n\t},\n\n\t_updatePath: function () {\n\t\tthis._renderer._updatePoly(this);\n\t},\n\n\t// Needed by the `Canvas` renderer for interactivity\n\t_containsPoint: function (p, closed) {\n\t\tvar i, j, k, len, len2, part,\n\t\t w = this._clickTolerance();\n\n\t\tif (!this._pxBounds || !this._pxBounds.contains(p)) { return false; }\n\n\t\t// hit detection for polylines\n\t\tfor (i = 0, len = this._parts.length; i < len; i++) {\n\t\t\tpart = this._parts[i];\n\n\t\t\tfor (j = 0, len2 = part.length, k = len2 - 1; j < len2; k = j++) {\n\t\t\t\tif (!closed && (j === 0)) { continue; }\n\n\t\t\t\tif (LineUtil.pointToSegmentDistance(p, part[k], part[j]) <= w) {\n\t\t\t\t\treturn true;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t\treturn false;\n\t}\n});\n\n// @factory L.polyline(latlngs: LatLng[], options?: Polyline options)\n// Instantiates a polyline object given an array of geographical points and\n// optionally an options object. You can create a `Polyline` object with\n// multiple separate lines (`MultiPolyline`) by passing an array of arrays\n// of geographic points.\nexport function polyline(latlngs, options) {\n\treturn new Polyline(latlngs, options);\n}\n\n// Retrocompat. Allow plugins to support Leaflet versions before and after 1.1.\nPolyline._flat = LineUtil._flat;\n", "import {Polyline} from './Polyline';\nimport {LatLng} from '../../geo/LatLng';\nimport * as LineUtil from '../../geometry/LineUtil';\nimport {Point} from '../../geometry/Point';\nimport {Bounds} from '../../geometry/Bounds';\nimport * as PolyUtil from '../../geometry/PolyUtil';\n\n/*\n * @class Polygon\n * @aka L.Polygon\n * @inherits Polyline\n *\n * A class for drawing polygon overlays on a map. Extends `Polyline`.\n *\n * Note that points you pass when creating a polygon shouldn't have an additional last point equal to the first one — it's better to filter out such points.\n *\n *\n * @example\n *\n * ```js\n * // create a red polygon from an array of LatLng points\n * var latlngs = [[37, -109.05],[41, -109.03],[41, -102.05],[37, -102.04]];\n *\n * var polygon = L.polygon(latlngs, {color: 'red'}).addTo(map);\n *\n * // zoom the map to the polygon\n * map.fitBounds(polygon.getBounds());\n * ```\n *\n * You can also pass an array of arrays of latlngs, with the first array representing the outer shape and the other arrays representing holes in the outer shape:\n *\n * ```js\n * var latlngs = [\n * [[37, -109.05],[41, -109.03],[41, -102.05],[37, -102.04]], // outer ring\n * [[37.29, -108.58],[40.71, -108.58],[40.71, -102.50],[37.29, -102.50]] // hole\n * ];\n * ```\n *\n * Additionally, you can pass a multi-dimensional array to represent a MultiPolygon shape.\n *\n * ```js\n * var latlngs = [\n * [ // first polygon\n * [[37, -109.05],[41, -109.03],[41, -102.05],[37, -102.04]], // outer ring\n * [[37.29, -108.58],[40.71, -108.58],[40.71, -102.50],[37.29, -102.50]] // hole\n * ],\n * [ // second polygon\n * [[41, -111.03],[45, -111.04],[45, -104.05],[41, -104.05]]\n * ]\n * ];\n * ```\n */\n\nexport var Polygon = Polyline.extend({\n\n\toptions: {\n\t\tfill: true\n\t},\n\n\tisEmpty: function () {\n\t\treturn !this._latlngs.length || !this._latlngs[0].length;\n\t},\n\n\t// @method getCenter(): LatLng\n\t// Returns the center ([centroid](http://en.wikipedia.org/wiki/Centroid)) of the Polygon.\n\tgetCenter: function () {\n\t\t// throws error when not yet added to map as this center calculation requires projected coordinates\n\t\tif (!this._map) {\n\t\t\tthrow new Error('Must add layer to map before using getCenter()');\n\t\t}\n\t\treturn PolyUtil.polygonCenter(this._defaultShape(), this._map.options.crs);\n\t},\n\n\t_convertLatLngs: function (latlngs) {\n\t\tvar result = Polyline.prototype._convertLatLngs.call(this, latlngs),\n\t\t len = result.length;\n\n\t\t// remove last point if it equals first one\n\t\tif (len >= 2 && result[0] instanceof LatLng && result[0].equals(result[len - 1])) {\n\t\t\tresult.pop();\n\t\t}\n\t\treturn result;\n\t},\n\n\t_setLatLngs: function (latlngs) {\n\t\tPolyline.prototype._setLatLngs.call(this, latlngs);\n\t\tif (LineUtil.isFlat(this._latlngs)) {\n\t\t\tthis._latlngs = [this._latlngs];\n\t\t}\n\t},\n\n\t_defaultShape: function () {\n\t\treturn LineUtil.isFlat(this._latlngs[0]) ? this._latlngs[0] : this._latlngs[0][0];\n\t},\n\n\t_clipPoints: function () {\n\t\t// polygons need a different clipping algorithm so we redefine that\n\n\t\tvar bounds = this._renderer._bounds,\n\t\t w = this.options.weight,\n\t\t p = new Point(w, w);\n\n\t\t// increase clip padding by stroke width to avoid stroke on clip edges\n\t\tbounds = new Bounds(bounds.min.subtract(p), bounds.max.add(p));\n\n\t\tthis._parts = [];\n\t\tif (!this._pxBounds || !this._pxBounds.intersects(bounds)) {\n\t\t\treturn;\n\t\t}\n\n\t\tif (this.options.noClip) {\n\t\t\tthis._parts = this._rings;\n\t\t\treturn;\n\t\t}\n\n\t\tfor (var i = 0, len = this._rings.length, clipped; i < len; i++) {\n\t\t\tclipped = PolyUtil.clipPolygon(this._rings[i], bounds, true);\n\t\t\tif (clipped.length) {\n\t\t\t\tthis._parts.push(clipped);\n\t\t\t}\n\t\t}\n\t},\n\n\t_updatePath: function () {\n\t\tthis._renderer._updatePoly(this, true);\n\t},\n\n\t// Needed by the `Canvas` renderer for interactivity\n\t_containsPoint: function (p) {\n\t\tvar inside = false,\n\t\t part, p1, p2, i, j, k, len, len2;\n\n\t\tif (!this._pxBounds || !this._pxBounds.contains(p)) { return false; }\n\n\t\t// ray casting algorithm for detecting if point is in polygon\n\t\tfor (i = 0, len = this._parts.length; i < len; i++) {\n\t\t\tpart = this._parts[i];\n\n\t\t\tfor (j = 0, len2 = part.length, k = len2 - 1; j < len2; k = j++) {\n\t\t\t\tp1 = part[j];\n\t\t\t\tp2 = part[k];\n\n\t\t\t\tif (((p1.y > p.y) !== (p2.y > p.y)) && (p.x < (p2.x - p1.x) * (p.y - p1.y) / (p2.y - p1.y) + p1.x)) {\n\t\t\t\t\tinside = !inside;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\t// also check if it's on polygon stroke\n\t\treturn inside || Polyline.prototype._containsPoint.call(this, p, true);\n\t}\n\n});\n\n\n// @factory L.polygon(latlngs: LatLng[], options?: Polyline options)\nexport function polygon(latlngs, options) {\n\treturn new Polygon(latlngs, options);\n}\n", "import {LayerGroup} from './LayerGroup';\r\nimport {FeatureGroup} from './FeatureGroup';\r\nimport * as Util from '../core/Util';\r\nimport {Marker} from './marker/Marker';\r\nimport {Circle} from './vector/Circle';\r\nimport {CircleMarker} from './vector/CircleMarker';\r\nimport {Polyline} from './vector/Polyline';\r\nimport {Polygon} from './vector/Polygon';\r\nimport {LatLng} from '../geo/LatLng';\r\nimport * as LineUtil from '../geometry/LineUtil';\r\nimport {toLatLng} from '../geo/LatLng';\r\n\r\n\r\n/*\r\n * @class GeoJSON\r\n * @aka L.GeoJSON\r\n * @inherits FeatureGroup\r\n *\r\n * Represents a GeoJSON object or an array of GeoJSON objects. Allows you to parse\r\n * GeoJSON data and display it on the map. Extends `FeatureGroup`.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * L.geoJSON(data, {\r\n * \tstyle: function (feature) {\r\n * \t\treturn {color: feature.properties.color};\r\n * \t}\r\n * }).bindPopup(function (layer) {\r\n * \treturn layer.feature.properties.description;\r\n * }).addTo(map);\r\n * ```\r\n */\r\n\r\nexport var GeoJSON = FeatureGroup.extend({\r\n\r\n\t/* @section\r\n\t * @aka GeoJSON options\r\n\t *\r\n\t * @option pointToLayer: Function = *\r\n\t * A `Function` defining how GeoJSON points spawn Leaflet layers. It is internally\r\n\t * called when data is added, passing the GeoJSON point feature and its `LatLng`.\r\n\t * The default is to spawn a default `Marker`:\r\n\t * ```js\r\n\t * function(geoJsonPoint, latlng) {\r\n\t * \treturn L.marker(latlng);\r\n\t * }\r\n\t * ```\r\n\t *\r\n\t * @option style: Function = *\r\n\t * A `Function` defining the `Path options` for styling GeoJSON lines and polygons,\r\n\t * called internally when data is added.\r\n\t * The default value is to not override any defaults:\r\n\t * ```js\r\n\t * function (geoJsonFeature) {\r\n\t * \treturn {}\r\n\t * }\r\n\t * ```\r\n\t *\r\n\t * @option onEachFeature: Function = *\r\n\t * A `Function` that will be called once for each created `Feature`, after it has\r\n\t * been created and styled. Useful for attaching events and popups to features.\r\n\t * The default is to do nothing with the newly created layers:\r\n\t * ```js\r\n\t * function (feature, layer) {}\r\n\t * ```\r\n\t *\r\n\t * @option filter: Function = *\r\n\t * A `Function` that will be used to decide whether to include a feature or not.\r\n\t * The default is to include all features:\r\n\t * ```js\r\n\t * function (geoJsonFeature) {\r\n\t * \treturn true;\r\n\t * }\r\n\t * ```\r\n\t * Note: dynamically changing the `filter` option will have effect only on newly\r\n\t * added data. It will _not_ re-evaluate already included features.\r\n\t *\r\n\t * @option coordsToLatLng: Function = *\r\n\t * A `Function` that will be used for converting GeoJSON coordinates to `LatLng`s.\r\n\t * The default is the `coordsToLatLng` static method.\r\n\t *\r\n\t * @option markersInheritOptions: Boolean = false\r\n\t * Whether default Markers for \"Point\" type Features inherit from group options.\r\n\t */\r\n\r\n\tinitialize: function (geojson, options) {\r\n\t\tUtil.setOptions(this, options);\r\n\r\n\t\tthis._layers = {};\r\n\r\n\t\tif (geojson) {\r\n\t\t\tthis.addData(geojson);\r\n\t\t}\r\n\t},\r\n\r\n\t// @method addData( <GeoJSON> data ): this\r\n\t// Adds a GeoJSON object to the layer.\r\n\taddData: function (geojson) {\r\n\t\tvar features = Util.isArray(geojson) ? geojson : geojson.features,\r\n\t\t i, len, feature;\r\n\r\n\t\tif (features) {\r\n\t\t\tfor (i = 0, len = features.length; i < len; i++) {\r\n\t\t\t\t// only add this if geometry or geometries are set and not null\r\n\t\t\t\tfeature = features[i];\r\n\t\t\t\tif (feature.geometries || feature.geometry || feature.features || feature.coordinates) {\r\n\t\t\t\t\tthis.addData(feature);\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\t\treturn this;\r\n\t\t}\r\n\r\n\t\tvar options = this.options;\r\n\r\n\t\tif (options.filter && !options.filter(geojson)) { return this; }\r\n\r\n\t\tvar layer = geometryToLayer(geojson, options);\r\n\t\tif (!layer) {\r\n\t\t\treturn this;\r\n\t\t}\r\n\t\tlayer.feature = asFeature(geojson);\r\n\r\n\t\tlayer.defaultOptions = layer.options;\r\n\t\tthis.resetStyle(layer);\r\n\r\n\t\tif (options.onEachFeature) {\r\n\t\t\toptions.onEachFeature(geojson, layer);\r\n\t\t}\r\n\r\n\t\treturn this.addLayer(layer);\r\n\t},\r\n\r\n\t// @method resetStyle( <Path> layer? ): this\r\n\t// Resets the given vector layer's style to the original GeoJSON style, useful for resetting style after hover events.\r\n\t// If `layer` is omitted, the style of all features in the current layer is reset.\r\n\tresetStyle: function (layer) {\r\n\t\tif (layer === undefined) {\r\n\t\t\treturn this.eachLayer(this.resetStyle, this);\r\n\t\t}\r\n\t\t// reset any custom styles\r\n\t\tlayer.options = Util.extend({}, layer.defaultOptions);\r\n\t\tthis._setLayerStyle(layer, this.options.style);\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method setStyle( <Function> style ): this\r\n\t// Changes styles of GeoJSON vector layers with the given style function.\r\n\tsetStyle: function (style) {\r\n\t\treturn this.eachLayer(function (layer) {\r\n\t\t\tthis._setLayerStyle(layer, style);\r\n\t\t}, this);\r\n\t},\r\n\r\n\t_setLayerStyle: function (layer, style) {\r\n\t\tif (layer.setStyle) {\r\n\t\t\tif (typeof style === 'function') {\r\n\t\t\t\tstyle = style(layer.feature);\r\n\t\t\t}\r\n\t\t\tlayer.setStyle(style);\r\n\t\t}\r\n\t}\r\n});\r\n\r\n// @section\r\n// There are several static functions which can be called without instantiating L.GeoJSON:\r\n\r\n// @function geometryToLayer(featureData: Object, options?: GeoJSON options): Layer\r\n// Creates a `Layer` from a given GeoJSON feature. Can use a custom\r\n// [`pointToLayer`](#geojson-pointtolayer) and/or [`coordsToLatLng`](#geojson-coordstolatlng)\r\n// functions if provided as options.\r\nexport function geometryToLayer(geojson, options) {\r\n\r\n\tvar geometry = geojson.type === 'Feature' ? geojson.geometry : geojson,\r\n\t coords = geometry ? geometry.coordinates : null,\r\n\t layers = [],\r\n\t pointToLayer = options && options.pointToLayer,\r\n\t _coordsToLatLng = options && options.coordsToLatLng || coordsToLatLng,\r\n\t latlng, latlngs, i, len;\r\n\r\n\tif (!coords && !geometry) {\r\n\t\treturn null;\r\n\t}\r\n\r\n\tswitch (geometry.type) {\r\n\tcase 'Point':\r\n\t\tlatlng = _coordsToLatLng(coords);\r\n\t\treturn _pointToLayer(pointToLayer, geojson, latlng, options);\r\n\r\n\tcase 'MultiPoint':\r\n\t\tfor (i = 0, len = coords.length; i < len; i++) {\r\n\t\t\tlatlng = _coordsToLatLng(coords[i]);\r\n\t\t\tlayers.push(_pointToLayer(pointToLayer, geojson, latlng, options));\r\n\t\t}\r\n\t\treturn new FeatureGroup(layers);\r\n\r\n\tcase 'LineString':\r\n\tcase 'MultiLineString':\r\n\t\tlatlngs = coordsToLatLngs(coords, geometry.type === 'LineString' ? 0 : 1, _coordsToLatLng);\r\n\t\treturn new Polyline(latlngs, options);\r\n\r\n\tcase 'Polygon':\r\n\tcase 'MultiPolygon':\r\n\t\tlatlngs = coordsToLatLngs(coords, geometry.type === 'Polygon' ? 1 : 2, _coordsToLatLng);\r\n\t\treturn new Polygon(latlngs, options);\r\n\r\n\tcase 'GeometryCollection':\r\n\t\tfor (i = 0, len = geometry.geometries.length; i < len; i++) {\r\n\t\t\tvar geoLayer = geometryToLayer({\r\n\t\t\t\tgeometry: geometry.geometries[i],\r\n\t\t\t\ttype: 'Feature',\r\n\t\t\t\tproperties: geojson.properties\r\n\t\t\t}, options);\r\n\r\n\t\t\tif (geoLayer) {\r\n\t\t\t\tlayers.push(geoLayer);\r\n\t\t\t}\r\n\t\t}\r\n\t\treturn new FeatureGroup(layers);\r\n\r\n\tcase 'FeatureCollection':\r\n\t\tfor (i = 0, len = geometry.features.length; i < len; i++) {\r\n\t\t\tvar featureLayer = geometryToLayer(geometry.features[i], options);\r\n\r\n\t\t\tif (featureLayer) {\r\n\t\t\t\tlayers.push(featureLayer);\r\n\t\t\t}\r\n\t\t}\r\n\t\treturn new FeatureGroup(layers);\r\n\r\n\tdefault:\r\n\t\tthrow new Error('Invalid GeoJSON object.');\r\n\t}\r\n}\r\n\r\nfunction _pointToLayer(pointToLayerFn, geojson, latlng, options) {\r\n\treturn pointToLayerFn ?\r\n\t\tpointToLayerFn(geojson, latlng) :\r\n\t\tnew Marker(latlng, options && options.markersInheritOptions && options);\r\n}\r\n\r\n// @function coordsToLatLng(coords: Array): LatLng\r\n// Creates a `LatLng` object from an array of 2 numbers (longitude, latitude)\r\n// or 3 numbers (longitude, latitude, altitude) used in GeoJSON for points.\r\nexport function coordsToLatLng(coords) {\r\n\treturn new LatLng(coords[1], coords[0], coords[2]);\r\n}\r\n\r\n// @function coordsToLatLngs(coords: Array, levelsDeep?: Number, coordsToLatLng?: Function): Array\r\n// Creates a multidimensional array of `LatLng`s from a GeoJSON coordinates array.\r\n// `levelsDeep` specifies the nesting level (0 is for an array of points, 1 for an array of arrays of points, etc., 0 by default).\r\n// Can use a custom [`coordsToLatLng`](#geojson-coordstolatlng) function.\r\nexport function coordsToLatLngs(coords, levelsDeep, _coordsToLatLng) {\r\n\tvar latlngs = [];\r\n\r\n\tfor (var i = 0, len = coords.length, latlng; i < len; i++) {\r\n\t\tlatlng = levelsDeep ?\r\n\t\t\tcoordsToLatLngs(coords[i], levelsDeep - 1, _coordsToLatLng) :\r\n\t\t\t(_coordsToLatLng || coordsToLatLng)(coords[i]);\r\n\r\n\t\tlatlngs.push(latlng);\r\n\t}\r\n\r\n\treturn latlngs;\r\n}\r\n\r\n// @function latLngToCoords(latlng: LatLng, precision?: Number|false): Array\r\n// Reverse of [`coordsToLatLng`](#geojson-coordstolatlng)\r\n// Coordinates values are rounded with [`formatNum`](#util-formatnum) function.\r\nexport function latLngToCoords(latlng, precision) {\r\n\tlatlng = toLatLng(latlng);\r\n\treturn latlng.alt !== undefined ?\r\n\t\t[Util.formatNum(latlng.lng, precision), Util.formatNum(latlng.lat, precision), Util.formatNum(latlng.alt, precision)] :\r\n\t\t[Util.formatNum(latlng.lng, precision), Util.formatNum(latlng.lat, precision)];\r\n}\r\n\r\n// @function latLngsToCoords(latlngs: Array, levelsDeep?: Number, closed?: Boolean, precision?: Number|false): Array\r\n// Reverse of [`coordsToLatLngs`](#geojson-coordstolatlngs)\r\n// `closed` determines whether the first point should be appended to the end of the array to close the feature, only used when `levelsDeep` is 0. False by default.\r\n// Coordinates values are rounded with [`formatNum`](#util-formatnum) function.\r\nexport function latLngsToCoords(latlngs, levelsDeep, closed, precision) {\r\n\tvar coords = [];\r\n\r\n\tfor (var i = 0, len = latlngs.length; i < len; i++) {\r\n\t\t// Check for flat arrays required to ensure unbalanced arrays are correctly converted in recursion\r\n\t\tcoords.push(levelsDeep ?\r\n\t\t\tlatLngsToCoords(latlngs[i], LineUtil.isFlat(latlngs[i]) ? 0 : levelsDeep - 1, closed, precision) :\r\n\t\t\tlatLngToCoords(latlngs[i], precision));\r\n\t}\r\n\r\n\tif (!levelsDeep && closed && coords.length > 0) {\r\n\t\tcoords.push(coords[0].slice());\r\n\t}\r\n\r\n\treturn coords;\r\n}\r\n\r\nexport function getFeature(layer, newGeometry) {\r\n\treturn layer.feature ?\r\n\t\tUtil.extend({}, layer.feature, {geometry: newGeometry}) :\r\n\t\tasFeature(newGeometry);\r\n}\r\n\r\n// @function asFeature(geojson: Object): Object\r\n// Normalize GeoJSON geometries/features into GeoJSON features.\r\nexport function asFeature(geojson) {\r\n\tif (geojson.type === 'Feature' || geojson.type === 'FeatureCollection') {\r\n\t\treturn geojson;\r\n\t}\r\n\r\n\treturn {\r\n\t\ttype: 'Feature',\r\n\t\tproperties: {},\r\n\t\tgeometry: geojson\r\n\t};\r\n}\r\n\r\nvar PointToGeoJSON = {\r\n\ttoGeoJSON: function (precision) {\r\n\t\treturn getFeature(this, {\r\n\t\t\ttype: 'Point',\r\n\t\t\tcoordinates: latLngToCoords(this.getLatLng(), precision)\r\n\t\t});\r\n\t}\r\n};\r\n\r\n// @namespace Marker\r\n// @section Other methods\r\n// @method toGeoJSON(precision?: Number|false): Object\r\n// Coordinates values are rounded with [`formatNum`](#util-formatnum) function with given `precision`.\r\n// Returns a [`GeoJSON`](https://en.wikipedia.org/wiki/GeoJSON) representation of the marker (as a GeoJSON `Point` Feature).\r\nMarker.include(PointToGeoJSON);\r\n\r\n// @namespace CircleMarker\r\n// @method toGeoJSON(precision?: Number|false): Object\r\n// Coordinates values are rounded with [`formatNum`](#util-formatnum) function with given `precision`.\r\n// Returns a [`GeoJSON`](https://en.wikipedia.org/wiki/GeoJSON) representation of the circle marker (as a GeoJSON `Point` Feature).\r\nCircle.include(PointToGeoJSON);\r\nCircleMarker.include(PointToGeoJSON);\r\n\r\n\r\n// @namespace Polyline\r\n// @method toGeoJSON(precision?: Number|false): Object\r\n// Coordinates values are rounded with [`formatNum`](#util-formatnum) function with given `precision`.\r\n// Returns a [`GeoJSON`](https://en.wikipedia.org/wiki/GeoJSON) representation of the polyline (as a GeoJSON `LineString` or `MultiLineString` Feature).\r\nPolyline.include({\r\n\ttoGeoJSON: function (precision) {\r\n\t\tvar multi = !LineUtil.isFlat(this._latlngs);\r\n\r\n\t\tvar coords = latLngsToCoords(this._latlngs, multi ? 1 : 0, false, precision);\r\n\r\n\t\treturn getFeature(this, {\r\n\t\t\ttype: (multi ? 'Multi' : '') + 'LineString',\r\n\t\t\tcoordinates: coords\r\n\t\t});\r\n\t}\r\n});\r\n\r\n// @namespace Polygon\r\n// @method toGeoJSON(precision?: Number|false): Object\r\n// Coordinates values are rounded with [`formatNum`](#util-formatnum) function with given `precision`.\r\n// Returns a [`GeoJSON`](https://en.wikipedia.org/wiki/GeoJSON) representation of the polygon (as a GeoJSON `Polygon` or `MultiPolygon` Feature).\r\nPolygon.include({\r\n\ttoGeoJSON: function (precision) {\r\n\t\tvar holes = !LineUtil.isFlat(this._latlngs),\r\n\t\t multi = holes && !LineUtil.isFlat(this._latlngs[0]);\r\n\r\n\t\tvar coords = latLngsToCoords(this._latlngs, multi ? 2 : holes ? 1 : 0, true, precision);\r\n\r\n\t\tif (!holes) {\r\n\t\t\tcoords = [coords];\r\n\t\t}\r\n\r\n\t\treturn getFeature(this, {\r\n\t\t\ttype: (multi ? 'Multi' : '') + 'Polygon',\r\n\t\t\tcoordinates: coords\r\n\t\t});\r\n\t}\r\n});\r\n\r\n\r\n// @namespace LayerGroup\r\nLayerGroup.include({\r\n\ttoMultiPoint: function (precision) {\r\n\t\tvar coords = [];\r\n\r\n\t\tthis.eachLayer(function (layer) {\r\n\t\t\tcoords.push(layer.toGeoJSON(precision).geometry.coordinates);\r\n\t\t});\r\n\r\n\t\treturn getFeature(this, {\r\n\t\t\ttype: 'MultiPoint',\r\n\t\t\tcoordinates: coords\r\n\t\t});\r\n\t},\r\n\r\n\t// @method toGeoJSON(precision?: Number|false): Object\r\n\t// Coordinates values are rounded with [`formatNum`](#util-formatnum) function with given `precision`.\r\n\t// Returns a [`GeoJSON`](https://en.wikipedia.org/wiki/GeoJSON) representation of the layer group (as a GeoJSON `FeatureCollection`, `GeometryCollection`, or `MultiPoint`).\r\n\ttoGeoJSON: function (precision) {\r\n\r\n\t\tvar type = this.feature && this.feature.geometry && this.feature.geometry.type;\r\n\r\n\t\tif (type === 'MultiPoint') {\r\n\t\t\treturn this.toMultiPoint(precision);\r\n\t\t}\r\n\r\n\t\tvar isGeometryCollection = type === 'GeometryCollection',\r\n\t\t jsons = [];\r\n\r\n\t\tthis.eachLayer(function (layer) {\r\n\t\t\tif (layer.toGeoJSON) {\r\n\t\t\t\tvar json = layer.toGeoJSON(precision);\r\n\t\t\t\tif (isGeometryCollection) {\r\n\t\t\t\t\tjsons.push(json.geometry);\r\n\t\t\t\t} else {\r\n\t\t\t\t\tvar feature = asFeature(json);\r\n\t\t\t\t\t// Squash nested feature collections\r\n\t\t\t\t\tif (feature.type === 'FeatureCollection') {\r\n\t\t\t\t\t\tjsons.push.apply(jsons, feature.features);\r\n\t\t\t\t\t} else {\r\n\t\t\t\t\t\tjsons.push(feature);\r\n\t\t\t\t\t}\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\t});\r\n\r\n\t\tif (isGeometryCollection) {\r\n\t\t\treturn getFeature(this, {\r\n\t\t\t\tgeometries: jsons,\r\n\t\t\t\ttype: 'GeometryCollection'\r\n\t\t\t});\r\n\t\t}\r\n\r\n\t\treturn {\r\n\t\t\ttype: 'FeatureCollection',\r\n\t\t\tfeatures: jsons\r\n\t\t};\r\n\t}\r\n});\r\n\r\n// @namespace GeoJSON\r\n// @factory L.geoJSON(geojson?: Object, options?: GeoJSON options)\r\n// Creates a GeoJSON layer. Optionally accepts an object in\r\n// [GeoJSON format](https://tools.ietf.org/html/rfc7946) to display on the map\r\n// (you can alternatively add it later with `addData` method) and an `options` object.\r\nexport function geoJSON(geojson, options) {\r\n\treturn new GeoJSON(geojson, options);\r\n}\r\n\r\n// Backward compatibility.\r\nexport var geoJson = geoJSON;\r\n", "import {Layer} from './Layer';\r\nimport * as Util from '../core/Util';\r\nimport {toLatLngBounds} from '../geo/LatLngBounds';\r\nimport {Bounds} from '../geometry/Bounds';\r\nimport * as DomUtil from '../dom/DomUtil';\r\n\r\n/*\r\n * @class ImageOverlay\r\n * @aka L.ImageOverlay\r\n * @inherits Interactive layer\r\n *\r\n * Used to load and display a single image over specific bounds of the map. Extends `Layer`.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * var imageUrl = 'https://maps.lib.utexas.edu/maps/historical/newark_nj_1922.jpg',\r\n * \timageBounds = [[40.712216, -74.22655], [40.773941, -74.12544]];\r\n * L.imageOverlay(imageUrl, imageBounds).addTo(map);\r\n * ```\r\n */\r\n\r\nexport var ImageOverlay = Layer.extend({\r\n\r\n\t// @section\r\n\t// @aka ImageOverlay options\r\n\toptions: {\r\n\t\t// @option opacity: Number = 1.0\r\n\t\t// The opacity of the image overlay.\r\n\t\topacity: 1,\r\n\r\n\t\t// @option alt: String = ''\r\n\t\t// Text for the `alt` attribute of the image (useful for accessibility).\r\n\t\talt: '',\r\n\r\n\t\t// @option interactive: Boolean = false\r\n\t\t// If `true`, the image overlay will emit [mouse events](#interactive-layer) when clicked or hovered.\r\n\t\tinteractive: false,\r\n\r\n\t\t// @option crossOrigin: Boolean|String = false\r\n\t\t// Whether the crossOrigin attribute will be added to the image.\r\n\t\t// If a String is provided, the image will have its crossOrigin attribute set to the String provided. This is needed if you want to access image pixel data.\r\n\t\t// Refer to [CORS Settings](https://developer.mozilla.org/en-US/docs/Web/HTML/CORS_settings_attributes) for valid String values.\r\n\t\tcrossOrigin: false,\r\n\r\n\t\t// @option errorOverlayUrl: String = ''\r\n\t\t// URL to the overlay image to show in place of the overlay that failed to load.\r\n\t\terrorOverlayUrl: '',\r\n\r\n\t\t// @option zIndex: Number = 1\r\n\t\t// The explicit [zIndex](https://developer.mozilla.org/docs/Web/CSS/CSS_Positioning/Understanding_z_index) of the overlay layer.\r\n\t\tzIndex: 1,\r\n\r\n\t\t// @option className: String = ''\r\n\t\t// A custom class name to assign to the image. Empty by default.\r\n\t\tclassName: ''\r\n\t},\r\n\r\n\tinitialize: function (url, bounds, options) { // (String, LatLngBounds, Object)\r\n\t\tthis._url = url;\r\n\t\tthis._bounds = toLatLngBounds(bounds);\r\n\r\n\t\tUtil.setOptions(this, options);\r\n\t},\r\n\r\n\tonAdd: function () {\r\n\t\tif (!this._image) {\r\n\t\t\tthis._initImage();\r\n\r\n\t\t\tif (this.options.opacity < 1) {\r\n\t\t\t\tthis._updateOpacity();\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\tif (this.options.interactive) {\r\n\t\t\tDomUtil.addClass(this._image, 'leaflet-interactive');\r\n\t\t\tthis.addInteractiveTarget(this._image);\r\n\t\t}\r\n\r\n\t\tthis.getPane().appendChild(this._image);\r\n\t\tthis._reset();\r\n\t},\r\n\r\n\tonRemove: function () {\r\n\t\tDomUtil.remove(this._image);\r\n\t\tif (this.options.interactive) {\r\n\t\t\tthis.removeInteractiveTarget(this._image);\r\n\t\t}\r\n\t},\r\n\r\n\t// @method setOpacity(opacity: Number): this\r\n\t// Sets the opacity of the overlay.\r\n\tsetOpacity: function (opacity) {\r\n\t\tthis.options.opacity = opacity;\r\n\r\n\t\tif (this._image) {\r\n\t\t\tthis._updateOpacity();\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\tsetStyle: function (styleOpts) {\r\n\t\tif (styleOpts.opacity) {\r\n\t\t\tthis.setOpacity(styleOpts.opacity);\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method bringToFront(): this\r\n\t// Brings the layer to the top of all overlays.\r\n\tbringToFront: function () {\r\n\t\tif (this._map) {\r\n\t\t\tDomUtil.toFront(this._image);\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method bringToBack(): this\r\n\t// Brings the layer to the bottom of all overlays.\r\n\tbringToBack: function () {\r\n\t\tif (this._map) {\r\n\t\t\tDomUtil.toBack(this._image);\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method setUrl(url: String): this\r\n\t// Changes the URL of the image.\r\n\tsetUrl: function (url) {\r\n\t\tthis._url = url;\r\n\r\n\t\tif (this._image) {\r\n\t\t\tthis._image.src = url;\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method setBounds(bounds: LatLngBounds): this\r\n\t// Update the bounds that this ImageOverlay covers\r\n\tsetBounds: function (bounds) {\r\n\t\tthis._bounds = toLatLngBounds(bounds);\r\n\r\n\t\tif (this._map) {\r\n\t\t\tthis._reset();\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\tgetEvents: function () {\r\n\t\tvar events = {\r\n\t\t\tzoom: this._reset,\r\n\t\t\tviewreset: this._reset\r\n\t\t};\r\n\r\n\t\tif (this._zoomAnimated) {\r\n\t\t\tevents.zoomanim = this._animateZoom;\r\n\t\t}\r\n\r\n\t\treturn events;\r\n\t},\r\n\r\n\t// @method setZIndex(value: Number): this\r\n\t// Changes the [zIndex](#imageoverlay-zindex) of the image overlay.\r\n\tsetZIndex: function (value) {\r\n\t\tthis.options.zIndex = value;\r\n\t\tthis._updateZIndex();\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method getBounds(): LatLngBounds\r\n\t// Get the bounds that this ImageOverlay covers\r\n\tgetBounds: function () {\r\n\t\treturn this._bounds;\r\n\t},\r\n\r\n\t// @method getElement(): HTMLElement\r\n\t// Returns the instance of [`HTMLImageElement`](https://developer.mozilla.org/docs/Web/API/HTMLImageElement)\r\n\t// used by this overlay.\r\n\tgetElement: function () {\r\n\t\treturn this._image;\r\n\t},\r\n\r\n\t_initImage: function () {\r\n\t\tvar wasElementSupplied = this._url.tagName === 'IMG';\r\n\t\tvar img = this._image = wasElementSupplied ? this._url : DomUtil.create('img');\r\n\r\n\t\tDomUtil.addClass(img, 'leaflet-image-layer');\r\n\t\tif (this._zoomAnimated) { DomUtil.addClass(img, 'leaflet-zoom-animated'); }\r\n\t\tif (this.options.className) { DomUtil.addClass(img, this.options.className); }\r\n\r\n\t\timg.onselectstart = Util.falseFn;\r\n\t\timg.onmousemove = Util.falseFn;\r\n\r\n\t\t// @event load: Event\r\n\t\t// Fired when the ImageOverlay layer has loaded its image\r\n\t\timg.onload = Util.bind(this.fire, this, 'load');\r\n\t\timg.onerror = Util.bind(this._overlayOnError, this, 'error');\r\n\r\n\t\tif (this.options.crossOrigin || this.options.crossOrigin === '') {\r\n\t\t\timg.crossOrigin = this.options.crossOrigin === true ? '' : this.options.crossOrigin;\r\n\t\t}\r\n\r\n\t\tif (this.options.zIndex) {\r\n\t\t\tthis._updateZIndex();\r\n\t\t}\r\n\r\n\t\tif (wasElementSupplied) {\r\n\t\t\tthis._url = img.src;\r\n\t\t\treturn;\r\n\t\t}\r\n\r\n\t\timg.src = this._url;\r\n\t\timg.alt = this.options.alt;\r\n\t},\r\n\r\n\t_animateZoom: function (e) {\r\n\t\tvar scale = this._map.getZoomScale(e.zoom),\r\n\t\t offset = this._map._latLngBoundsToNewLayerBounds(this._bounds, e.zoom, e.center).min;\r\n\r\n\t\tDomUtil.setTransform(this._image, offset, scale);\r\n\t},\r\n\r\n\t_reset: function () {\r\n\t\tvar image = this._image,\r\n\t\t bounds = new Bounds(\r\n\t\t this._map.latLngToLayerPoint(this._bounds.getNorthWest()),\r\n\t\t this._map.latLngToLayerPoint(this._bounds.getSouthEast())),\r\n\t\t size = bounds.getSize();\r\n\r\n\t\tDomUtil.setPosition(image, bounds.min);\r\n\r\n\t\timage.style.width = size.x + 'px';\r\n\t\timage.style.height = size.y + 'px';\r\n\t},\r\n\r\n\t_updateOpacity: function () {\r\n\t\tDomUtil.setOpacity(this._image, this.options.opacity);\r\n\t},\r\n\r\n\t_updateZIndex: function () {\r\n\t\tif (this._image && this.options.zIndex !== undefined && this.options.zIndex !== null) {\r\n\t\t\tthis._image.style.zIndex = this.options.zIndex;\r\n\t\t}\r\n\t},\r\n\r\n\t_overlayOnError: function () {\r\n\t\t// @event error: Event\r\n\t\t// Fired when the ImageOverlay layer fails to load its image\r\n\t\tthis.fire('error');\r\n\r\n\t\tvar errorUrl = this.options.errorOverlayUrl;\r\n\t\tif (errorUrl && this._url !== errorUrl) {\r\n\t\t\tthis._url = errorUrl;\r\n\t\t\tthis._image.src = errorUrl;\r\n\t\t}\r\n\t},\r\n\r\n\t// @method getCenter(): LatLng\r\n\t// Returns the center of the ImageOverlay.\r\n\tgetCenter: function () {\r\n\t\treturn this._bounds.getCenter();\r\n\t}\r\n});\r\n\r\n// @factory L.imageOverlay(imageUrl: String, bounds: LatLngBounds, options?: ImageOverlay options)\r\n// Instantiates an image overlay object given the URL of the image and the\r\n// geographical bounds it is tied to.\r\nexport var imageOverlay = function (url, bounds, options) {\r\n\treturn new ImageOverlay(url, bounds, options);\r\n};\r\n", "import {ImageOverlay} from './ImageOverlay';\r\nimport * as DomUtil from '../dom/DomUtil';\r\nimport * as Util from '../core/Util';\r\n\r\n/*\r\n * @class VideoOverlay\r\n * @aka L.VideoOverlay\r\n * @inherits ImageOverlay\r\n *\r\n * Used to load and display a video player over specific bounds of the map. Extends `ImageOverlay`.\r\n *\r\n * A video overlay uses the [`<video>`](https://developer.mozilla.org/docs/Web/HTML/Element/video)\r\n * HTML5 element.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * var videoUrl = 'https://www.mapbox.com/bites/00188/patricia_nasa.webm',\r\n * \tvideoBounds = [[ 32, -130], [ 13, -100]];\r\n * L.videoOverlay(videoUrl, videoBounds ).addTo(map);\r\n * ```\r\n */\r\n\r\nexport var VideoOverlay = ImageOverlay.extend({\r\n\r\n\t// @section\r\n\t// @aka VideoOverlay options\r\n\toptions: {\r\n\t\t// @option autoplay: Boolean = true\r\n\t\t// Whether the video starts playing automatically when loaded.\r\n\t\t// On some browsers autoplay will only work with `muted: true`\r\n\t\tautoplay: true,\r\n\r\n\t\t// @option loop: Boolean = true\r\n\t\t// Whether the video will loop back to the beginning when played.\r\n\t\tloop: true,\r\n\r\n\t\t// @option keepAspectRatio: Boolean = true\r\n\t\t// Whether the video will save aspect ratio after the projection.\r\n\t\t// Relevant for supported browsers. See [browser compatibility](https://developer.mozilla.org/en-US/docs/Web/CSS/object-fit)\r\n\t\tkeepAspectRatio: true,\r\n\r\n\t\t// @option muted: Boolean = false\r\n\t\t// Whether the video starts on mute when loaded.\r\n\t\tmuted: false,\r\n\r\n\t\t// @option playsInline: Boolean = true\r\n\t\t// Mobile browsers will play the video right where it is instead of open it up in fullscreen mode.\r\n\t\tplaysInline: true\r\n\t},\r\n\r\n\t_initImage: function () {\r\n\t\tvar wasElementSupplied = this._url.tagName === 'VIDEO';\r\n\t\tvar vid = this._image = wasElementSupplied ? this._url : DomUtil.create('video');\r\n\r\n\t\tDomUtil.addClass(vid, 'leaflet-image-layer');\r\n\t\tif (this._zoomAnimated) { DomUtil.addClass(vid, 'leaflet-zoom-animated'); }\r\n\t\tif (this.options.className) { DomUtil.addClass(vid, this.options.className); }\r\n\r\n\t\tvid.onselectstart = Util.falseFn;\r\n\t\tvid.onmousemove = Util.falseFn;\r\n\r\n\t\t// @event load: Event\r\n\t\t// Fired when the video has finished loading the first frame\r\n\t\tvid.onloadeddata = Util.bind(this.fire, this, 'load');\r\n\r\n\t\tif (wasElementSupplied) {\r\n\t\t\tvar sourceElements = vid.getElementsByTagName('source');\r\n\t\t\tvar sources = [];\r\n\t\t\tfor (var j = 0; j < sourceElements.length; j++) {\r\n\t\t\t\tsources.push(sourceElements[j].src);\r\n\t\t\t}\r\n\r\n\t\t\tthis._url = (sourceElements.length > 0) ? sources : [vid.src];\r\n\t\t\treturn;\r\n\t\t}\r\n\r\n\t\tif (!Util.isArray(this._url)) { this._url = [this._url]; }\r\n\r\n\t\tif (!this.options.keepAspectRatio && Object.prototype.hasOwnProperty.call(vid.style, 'objectFit')) {\r\n\t\t\tvid.style['objectFit'] = 'fill';\r\n\t\t}\r\n\t\tvid.autoplay = !!this.options.autoplay;\r\n\t\tvid.loop = !!this.options.loop;\r\n\t\tvid.muted = !!this.options.muted;\r\n\t\tvid.playsInline = !!this.options.playsInline;\r\n\t\tfor (var i = 0; i < this._url.length; i++) {\r\n\t\t\tvar source = DomUtil.create('source');\r\n\t\t\tsource.src = this._url[i];\r\n\t\t\tvid.appendChild(source);\r\n\t\t}\r\n\t}\r\n\r\n\t// @method getElement(): HTMLVideoElement\r\n\t// Returns the instance of [`HTMLVideoElement`](https://developer.mozilla.org/docs/Web/API/HTMLVideoElement)\r\n\t// used by this overlay.\r\n});\r\n\r\n\r\n// @factory L.videoOverlay(video: String|Array|HTMLVideoElement, bounds: LatLngBounds, options?: VideoOverlay options)\r\n// Instantiates an image overlay object given the URL of the video (or array of URLs, or even a video element) and the\r\n// geographical bounds it is tied to.\r\n\r\nexport function videoOverlay(video, bounds, options) {\r\n\treturn new VideoOverlay(video, bounds, options);\r\n}\r\n", "import {ImageOverlay} from './ImageOverlay';\nimport * as DomUtil from '../dom/DomUtil';\nimport * as Util from '../core/Util';\n\n/*\n * @class SVGOverlay\n * @aka L.SVGOverlay\n * @inherits ImageOverlay\n *\n * Used to load, display and provide DOM access to an SVG file over specific bounds of the map. Extends `ImageOverlay`.\n *\n * An SVG overlay uses the [`<svg>`](https://developer.mozilla.org/docs/Web/SVG/Element/svg) element.\n *\n * @example\n *\n * ```js\n * var svgElement = document.createElementNS(\"http://www.w3.org/2000/svg\", \"svg\");\n * svgElement.setAttribute('xmlns', \"http://www.w3.org/2000/svg\");\n * svgElement.setAttribute('viewBox', \"0 0 200 200\");\n * svgElement.innerHTML = '<rect width=\"200\" height=\"200\"/><rect x=\"75\" y=\"23\" width=\"50\" height=\"50\" style=\"fill:red\"/><rect x=\"75\" y=\"123\" width=\"50\" height=\"50\" style=\"fill:#0013ff\"/>';\n * var svgElementBounds = [ [ 32, -130 ], [ 13, -100 ] ];\n * L.svgOverlay(svgElement, svgElementBounds).addTo(map);\n * ```\n */\n\nexport var SVGOverlay = ImageOverlay.extend({\n\t_initImage: function () {\n\t\tvar el = this._image = this._url;\n\n\t\tDomUtil.addClass(el, 'leaflet-image-layer');\n\t\tif (this._zoomAnimated) { DomUtil.addClass(el, 'leaflet-zoom-animated'); }\n\t\tif (this.options.className) { DomUtil.addClass(el, this.options.className); }\n\n\t\tel.onselectstart = Util.falseFn;\n\t\tel.onmousemove = Util.falseFn;\n\t}\n\n\t// @method getElement(): SVGElement\n\t// Returns the instance of [`SVGElement`](https://developer.mozilla.org/docs/Web/API/SVGElement)\n\t// used by this overlay.\n});\n\n\n// @factory L.svgOverlay(svg: String|SVGElement, bounds: LatLngBounds, options?: SVGOverlay options)\n// Instantiates an image overlay object given an SVG element and the geographical bounds it is tied to.\n// A viewBox attribute is required on the SVG element to zoom in and out properly.\n\nexport function svgOverlay(el, bounds, options) {\n\treturn new SVGOverlay(el, bounds, options);\n}\n", "import {Map} from '../map/Map';\r\nimport {Layer} from './Layer';\r\nimport {FeatureGroup} from './FeatureGroup';\r\nimport * as Util from '../core/Util';\r\nimport {toLatLng, LatLng} from '../geo/LatLng';\r\nimport {toPoint} from '../geometry/Point';\r\nimport * as DomUtil from '../dom/DomUtil';\r\n\r\n/*\r\n * @class DivOverlay\r\n * @inherits Interactive layer\r\n * @aka L.DivOverlay\r\n * Base model for L.Popup and L.Tooltip. Inherit from it for custom overlays like plugins.\r\n */\r\n\r\n// @namespace DivOverlay\r\nexport var DivOverlay = Layer.extend({\r\n\r\n\t// @section\r\n\t// @aka DivOverlay options\r\n\toptions: {\r\n\t\t// @option interactive: Boolean = false\r\n\t\t// If true, the popup/tooltip will listen to the mouse events.\r\n\t\tinteractive: false,\r\n\r\n\t\t// @option offset: Point = Point(0, 0)\r\n\t\t// The offset of the overlay position.\r\n\t\toffset: [0, 0],\r\n\r\n\t\t// @option className: String = ''\r\n\t\t// A custom CSS class name to assign to the overlay.\r\n\t\tclassName: '',\r\n\r\n\t\t// @option pane: String = undefined\r\n\t\t// `Map pane` where the overlay will be added.\r\n\t\tpane: undefined,\r\n\r\n\t\t// @option content: String|HTMLElement|Function = ''\r\n\t\t// Sets the HTML content of the overlay while initializing. If a function is passed the source layer will be\r\n\t\t// passed to the function. The function should return a `String` or `HTMLElement` to be used in the overlay.\r\n\t\tcontent: ''\r\n\t},\r\n\r\n\tinitialize: function (options, source) {\r\n\t\tif (options && (options instanceof LatLng || Util.isArray(options))) {\r\n\t\t\tthis._latlng = toLatLng(options);\r\n\t\t\tUtil.setOptions(this, source);\r\n\t\t} else {\r\n\t\t\tUtil.setOptions(this, options);\r\n\t\t\tthis._source = source;\r\n\t\t}\r\n\t\tif (this.options.content) {\r\n\t\t\tthis._content = this.options.content;\r\n\t\t}\r\n\t},\r\n\r\n\t// @method openOn(map: Map): this\r\n\t// Adds the overlay to the map.\r\n\t// Alternative to `map.openPopup(popup)`/`.openTooltip(tooltip)`.\r\n\topenOn: function (map) {\r\n\t\tmap = arguments.length ? map : this._source._map; // experimental, not the part of public api\r\n\t\tif (!map.hasLayer(this)) {\r\n\t\t\tmap.addLayer(this);\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method close(): this\r\n\t// Closes the overlay.\r\n\t// Alternative to `map.closePopup(popup)`/`.closeTooltip(tooltip)`\r\n\t// and `layer.closePopup()`/`.closeTooltip()`.\r\n\tclose: function () {\r\n\t\tif (this._map) {\r\n\t\t\tthis._map.removeLayer(this);\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method toggle(layer?: Layer): this\r\n\t// Opens or closes the overlay bound to layer depending on its current state.\r\n\t// Argument may be omitted only for overlay bound to layer.\r\n\t// Alternative to `layer.togglePopup()`/`.toggleTooltip()`.\r\n\ttoggle: function (layer) {\r\n\t\tif (this._map) {\r\n\t\t\tthis.close();\r\n\t\t} else {\r\n\t\t\tif (arguments.length) {\r\n\t\t\t\tthis._source = layer;\r\n\t\t\t} else {\r\n\t\t\t\tlayer = this._source;\r\n\t\t\t}\r\n\t\t\tthis._prepareOpen();\r\n\r\n\t\t\t// open the overlay on the map\r\n\t\t\tthis.openOn(layer._map);\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\tonAdd: function (map) {\r\n\t\tthis._zoomAnimated = map._zoomAnimated;\r\n\r\n\t\tif (!this._container) {\r\n\t\t\tthis._initLayout();\r\n\t\t}\r\n\r\n\t\tif (map._fadeAnimated) {\r\n\t\t\tDomUtil.setOpacity(this._container, 0);\r\n\t\t}\r\n\r\n\t\tclearTimeout(this._removeTimeout);\r\n\t\tthis.getPane().appendChild(this._container);\r\n\t\tthis.update();\r\n\r\n\t\tif (map._fadeAnimated) {\r\n\t\t\tDomUtil.setOpacity(this._container, 1);\r\n\t\t}\r\n\r\n\t\tthis.bringToFront();\r\n\r\n\t\tif (this.options.interactive) {\r\n\t\t\tDomUtil.addClass(this._container, 'leaflet-interactive');\r\n\t\t\tthis.addInteractiveTarget(this._container);\r\n\t\t}\r\n\t},\r\n\r\n\tonRemove: function (map) {\r\n\t\tif (map._fadeAnimated) {\r\n\t\t\tDomUtil.setOpacity(this._container, 0);\r\n\t\t\tthis._removeTimeout = setTimeout(Util.bind(DomUtil.remove, undefined, this._container), 200);\r\n\t\t} else {\r\n\t\t\tDomUtil.remove(this._container);\r\n\t\t}\r\n\r\n\t\tif (this.options.interactive) {\r\n\t\t\tDomUtil.removeClass(this._container, 'leaflet-interactive');\r\n\t\t\tthis.removeInteractiveTarget(this._container);\r\n\t\t}\r\n\t},\r\n\r\n\t// @namespace DivOverlay\r\n\t// @method getLatLng: LatLng\r\n\t// Returns the geographical point of the overlay.\r\n\tgetLatLng: function () {\r\n\t\treturn this._latlng;\r\n\t},\r\n\r\n\t// @method setLatLng(latlng: LatLng): this\r\n\t// Sets the geographical point where the overlay will open.\r\n\tsetLatLng: function (latlng) {\r\n\t\tthis._latlng = toLatLng(latlng);\r\n\t\tif (this._map) {\r\n\t\t\tthis._updatePosition();\r\n\t\t\tthis._adjustPan();\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method getContent: String|HTMLElement\r\n\t// Returns the content of the overlay.\r\n\tgetContent: function () {\r\n\t\treturn this._content;\r\n\t},\r\n\r\n\t// @method setContent(htmlContent: String|HTMLElement|Function): this\r\n\t// Sets the HTML content of the overlay. If a function is passed the source layer will be passed to the function.\r\n\t// The function should return a `String` or `HTMLElement` to be used in the overlay.\r\n\tsetContent: function (content) {\r\n\t\tthis._content = content;\r\n\t\tthis.update();\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method getElement: String|HTMLElement\r\n\t// Returns the HTML container of the overlay.\r\n\tgetElement: function () {\r\n\t\treturn this._container;\r\n\t},\r\n\r\n\t// @method update: null\r\n\t// Updates the overlay content, layout and position. Useful for updating the overlay after something inside changed, e.g. image loaded.\r\n\tupdate: function () {\r\n\t\tif (!this._map) { return; }\r\n\r\n\t\tthis._container.style.visibility = 'hidden';\r\n\r\n\t\tthis._updateContent();\r\n\t\tthis._updateLayout();\r\n\t\tthis._updatePosition();\r\n\r\n\t\tthis._container.style.visibility = '';\r\n\r\n\t\tthis._adjustPan();\r\n\t},\r\n\r\n\tgetEvents: function () {\r\n\t\tvar events = {\r\n\t\t\tzoom: this._updatePosition,\r\n\t\t\tviewreset: this._updatePosition\r\n\t\t};\r\n\r\n\t\tif (this._zoomAnimated) {\r\n\t\t\tevents.zoomanim = this._animateZoom;\r\n\t\t}\r\n\t\treturn events;\r\n\t},\r\n\r\n\t// @method isOpen: Boolean\r\n\t// Returns `true` when the overlay is visible on the map.\r\n\tisOpen: function () {\r\n\t\treturn !!this._map && this._map.hasLayer(this);\r\n\t},\r\n\r\n\t// @method bringToFront: this\r\n\t// Brings this overlay in front of other overlays (in the same map pane).\r\n\tbringToFront: function () {\r\n\t\tif (this._map) {\r\n\t\t\tDomUtil.toFront(this._container);\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method bringToBack: this\r\n\t// Brings this overlay to the back of other overlays (in the same map pane).\r\n\tbringToBack: function () {\r\n\t\tif (this._map) {\r\n\t\t\tDomUtil.toBack(this._container);\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// prepare bound overlay to open: update latlng pos / content source (for FeatureGroup)\r\n\t_prepareOpen: function (latlng) {\r\n\t\tvar source = this._source;\r\n\t\tif (!source._map) { return false; }\r\n\r\n\t\tif (source instanceof FeatureGroup) {\r\n\t\t\tsource = null;\r\n\t\t\tvar layers = this._source._layers;\r\n\t\t\tfor (var id in layers) {\r\n\t\t\t\tif (layers[id]._map) {\r\n\t\t\t\t\tsource = layers[id];\r\n\t\t\t\t\tbreak;\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\t\tif (!source) { return false; } // Unable to get source layer.\r\n\r\n\t\t\t// set overlay source to this layer\r\n\t\t\tthis._source = source;\r\n\t\t}\r\n\r\n\t\tif (!latlng) {\r\n\t\t\tif (source.getCenter) {\r\n\t\t\t\tlatlng = source.getCenter();\r\n\t\t\t} else if (source.getLatLng) {\r\n\t\t\t\tlatlng = source.getLatLng();\r\n\t\t\t} else if (source.getBounds) {\r\n\t\t\t\tlatlng = source.getBounds().getCenter();\r\n\t\t\t} else {\r\n\t\t\t\tthrow new Error('Unable to get source layer LatLng.');\r\n\t\t\t}\r\n\t\t}\r\n\t\tthis.setLatLng(latlng);\r\n\r\n\t\tif (this._map) {\r\n\t\t\t// update the overlay (content, layout, etc...)\r\n\t\t\tthis.update();\r\n\t\t}\r\n\r\n\t\treturn true;\r\n\t},\r\n\r\n\t_updateContent: function () {\r\n\t\tif (!this._content) { return; }\r\n\r\n\t\tvar node = this._contentNode;\r\n\t\tvar content = (typeof this._content === 'function') ? this._content(this._source || this) : this._content;\r\n\r\n\t\tif (typeof content === 'string') {\r\n\t\t\tnode.innerHTML = content;\r\n\t\t} else {\r\n\t\t\twhile (node.hasChildNodes()) {\r\n\t\t\t\tnode.removeChild(node.firstChild);\r\n\t\t\t}\r\n\t\t\tnode.appendChild(content);\r\n\t\t}\r\n\r\n\t\t// @namespace DivOverlay\r\n\t\t// @section DivOverlay events\r\n\t\t// @event contentupdate: Event\r\n\t\t// Fired when the content of the overlay is updated\r\n\t\tthis.fire('contentupdate');\r\n\t},\r\n\r\n\t_updatePosition: function () {\r\n\t\tif (!this._map) { return; }\r\n\r\n\t\tvar pos = this._map.latLngToLayerPoint(this._latlng),\r\n\t\t offset = toPoint(this.options.offset),\r\n\t\t anchor = this._getAnchor();\r\n\r\n\t\tif (this._zoomAnimated) {\r\n\t\t\tDomUtil.setPosition(this._container, pos.add(anchor));\r\n\t\t} else {\r\n\t\t\toffset = offset.add(pos).add(anchor);\r\n\t\t}\r\n\r\n\t\tvar bottom = this._containerBottom = -offset.y,\r\n\t\t left = this._containerLeft = -Math.round(this._containerWidth / 2) + offset.x;\r\n\r\n\t\t// bottom position the overlay in case the height of the overlay changes (images loading etc)\r\n\t\tthis._container.style.bottom = bottom + 'px';\r\n\t\tthis._container.style.left = left + 'px';\r\n\t},\r\n\r\n\t_getAnchor: function () {\r\n\t\treturn [0, 0];\r\n\t}\r\n\r\n});\r\n\r\nMap.include({\r\n\t_initOverlay: function (OverlayClass, content, latlng, options) {\r\n\t\tvar overlay = content;\r\n\t\tif (!(overlay instanceof OverlayClass)) {\r\n\t\t\toverlay = new OverlayClass(options).setContent(content);\r\n\t\t}\r\n\t\tif (latlng) {\r\n\t\t\toverlay.setLatLng(latlng);\r\n\t\t}\r\n\t\treturn overlay;\r\n\t}\r\n});\r\n\r\n\r\nLayer.include({\r\n\t_initOverlay: function (OverlayClass, old, content, options) {\r\n\t\tvar overlay = content;\r\n\t\tif (overlay instanceof OverlayClass) {\r\n\t\t\tUtil.setOptions(overlay, options);\r\n\t\t\toverlay._source = this;\r\n\t\t} else {\r\n\t\t\toverlay = (old && !options) ? old : new OverlayClass(options, this);\r\n\t\t\toverlay.setContent(content);\r\n\t\t}\r\n\t\treturn overlay;\r\n\t}\r\n});\r\n", "import {DivOverlay} from './DivOverlay';\r\nimport * as DomEvent from '../dom/DomEvent';\r\nimport * as DomUtil from '../dom/DomUtil';\r\nimport {Point, toPoint} from '../geometry/Point';\r\nimport {Map} from '../map/Map';\r\nimport {Layer} from './Layer';\r\nimport {Path} from './vector/Path';\r\nimport {FeatureGroup} from './FeatureGroup';\r\n\r\n/*\r\n * @class Popup\r\n * @inherits DivOverlay\r\n * @aka L.Popup\r\n * Used to open popups in certain places of the map. Use [Map.openPopup](#map-openpopup) to\r\n * open popups while making sure that only one popup is open at one time\r\n * (recommended for usability), or use [Map.addLayer](#map-addlayer) to open as many as you want.\r\n *\r\n * @example\r\n *\r\n * If you want to just bind a popup to marker click and then open it, it's really easy:\r\n *\r\n * ```js\r\n * marker.bindPopup(popupContent).openPopup();\r\n * ```\r\n * Path overlays like polylines also have a `bindPopup` method.\r\n *\r\n * A popup can be also standalone:\r\n *\r\n * ```js\r\n * var popup = L.popup()\r\n * \t.setLatLng(latlng)\r\n * \t.setContent('<p>Hello world!<br />This is a nice popup.</p>')\r\n * \t.openOn(map);\r\n * ```\r\n * or\r\n * ```js\r\n * var popup = L.popup(latlng, {content: '<p>Hello world!<br />This is a nice popup.</p>')\r\n * \t.openOn(map);\r\n * ```\r\n */\r\n\r\n\r\n// @namespace Popup\r\nexport var Popup = DivOverlay.extend({\r\n\r\n\t// @section\r\n\t// @aka Popup options\r\n\toptions: {\r\n\t\t// @option pane: String = 'popupPane'\r\n\t\t// `Map pane` where the popup will be added.\r\n\t\tpane: 'popupPane',\r\n\r\n\t\t// @option offset: Point = Point(0, 7)\r\n\t\t// The offset of the popup position.\r\n\t\toffset: [0, 7],\r\n\r\n\t\t// @option maxWidth: Number = 300\r\n\t\t// Max width of the popup, in pixels.\r\n\t\tmaxWidth: 300,\r\n\r\n\t\t// @option minWidth: Number = 50\r\n\t\t// Min width of the popup, in pixels.\r\n\t\tminWidth: 50,\r\n\r\n\t\t// @option maxHeight: Number = null\r\n\t\t// If set, creates a scrollable container of the given height\r\n\t\t// inside a popup if its content exceeds it.\r\n\t\t// The scrollable container can be styled using the\r\n\t\t// `leaflet-popup-scrolled` CSS class selector.\r\n\t\tmaxHeight: null,\r\n\r\n\t\t// @option autoPan: Boolean = true\r\n\t\t// Set it to `false` if you don't want the map to do panning animation\r\n\t\t// to fit the opened popup.\r\n\t\tautoPan: true,\r\n\r\n\t\t// @option autoPanPaddingTopLeft: Point = null\r\n\t\t// The margin between the popup and the top left corner of the map\r\n\t\t// view after autopanning was performed.\r\n\t\tautoPanPaddingTopLeft: null,\r\n\r\n\t\t// @option autoPanPaddingBottomRight: Point = null\r\n\t\t// The margin between the popup and the bottom right corner of the map\r\n\t\t// view after autopanning was performed.\r\n\t\tautoPanPaddingBottomRight: null,\r\n\r\n\t\t// @option autoPanPadding: Point = Point(5, 5)\r\n\t\t// Equivalent of setting both top left and bottom right autopan padding to the same value.\r\n\t\tautoPanPadding: [5, 5],\r\n\r\n\t\t// @option keepInView: Boolean = false\r\n\t\t// Set it to `true` if you want to prevent users from panning the popup\r\n\t\t// off of the screen while it is open.\r\n\t\tkeepInView: false,\r\n\r\n\t\t// @option closeButton: Boolean = true\r\n\t\t// Controls the presence of a close button in the popup.\r\n\t\tcloseButton: true,\r\n\r\n\t\t// @option autoClose: Boolean = true\r\n\t\t// Set it to `false` if you want to override the default behavior of\r\n\t\t// the popup closing when another popup is opened.\r\n\t\tautoClose: true,\r\n\r\n\t\t// @option closeOnEscapeKey: Boolean = true\r\n\t\t// Set it to `false` if you want to override the default behavior of\r\n\t\t// the ESC key for closing of the popup.\r\n\t\tcloseOnEscapeKey: true,\r\n\r\n\t\t// @option closeOnClick: Boolean = *\r\n\t\t// Set it if you want to override the default behavior of the popup closing when user clicks\r\n\t\t// on the map. Defaults to the map's [`closePopupOnClick`](#map-closepopuponclick) option.\r\n\r\n\t\t// @option className: String = ''\r\n\t\t// A custom CSS class name to assign to the popup.\r\n\t\tclassName: ''\r\n\t},\r\n\r\n\t// @namespace Popup\r\n\t// @method openOn(map: Map): this\r\n\t// Alternative to `map.openPopup(popup)`.\r\n\t// Adds the popup to the map and closes the previous one.\r\n\topenOn: function (map) {\r\n\t\tmap = arguments.length ? map : this._source._map; // experimental, not the part of public api\r\n\r\n\t\tif (!map.hasLayer(this) && map._popup && map._popup.options.autoClose) {\r\n\t\t\tmap.removeLayer(map._popup);\r\n\t\t}\r\n\t\tmap._popup = this;\r\n\r\n\t\treturn DivOverlay.prototype.openOn.call(this, map);\r\n\t},\r\n\r\n\tonAdd: function (map) {\r\n\t\tDivOverlay.prototype.onAdd.call(this, map);\r\n\r\n\t\t// @namespace Map\r\n\t\t// @section Popup events\r\n\t\t// @event popupopen: PopupEvent\r\n\t\t// Fired when a popup is opened in the map\r\n\t\tmap.fire('popupopen', {popup: this});\r\n\r\n\t\tif (this._source) {\r\n\t\t\t// @namespace Layer\r\n\t\t\t// @section Popup events\r\n\t\t\t// @event popupopen: PopupEvent\r\n\t\t\t// Fired when a popup bound to this layer is opened\r\n\t\t\tthis._source.fire('popupopen', {popup: this}, true);\r\n\t\t\t// For non-path layers, we toggle the popup when clicking\r\n\t\t\t// again the layer, so prevent the map to reopen it.\r\n\t\t\tif (!(this._source instanceof Path)) {\r\n\t\t\t\tthis._source.on('preclick', DomEvent.stopPropagation);\r\n\t\t\t}\r\n\t\t}\r\n\t},\r\n\r\n\tonRemove: function (map) {\r\n\t\tDivOverlay.prototype.onRemove.call(this, map);\r\n\r\n\t\t// @namespace Map\r\n\t\t// @section Popup events\r\n\t\t// @event popupclose: PopupEvent\r\n\t\t// Fired when a popup in the map is closed\r\n\t\tmap.fire('popupclose', {popup: this});\r\n\r\n\t\tif (this._source) {\r\n\t\t\t// @namespace Layer\r\n\t\t\t// @section Popup events\r\n\t\t\t// @event popupclose: PopupEvent\r\n\t\t\t// Fired when a popup bound to this layer is closed\r\n\t\t\tthis._source.fire('popupclose', {popup: this}, true);\r\n\t\t\tif (!(this._source instanceof Path)) {\r\n\t\t\t\tthis._source.off('preclick', DomEvent.stopPropagation);\r\n\t\t\t}\r\n\t\t}\r\n\t},\r\n\r\n\tgetEvents: function () {\r\n\t\tvar events = DivOverlay.prototype.getEvents.call(this);\r\n\r\n\t\tif (this.options.closeOnClick !== undefined ? this.options.closeOnClick : this._map.options.closePopupOnClick) {\r\n\t\t\tevents.preclick = this.close;\r\n\t\t}\r\n\r\n\t\tif (this.options.keepInView) {\r\n\t\t\tevents.moveend = this._adjustPan;\r\n\t\t}\r\n\r\n\t\treturn events;\r\n\t},\r\n\r\n\t_initLayout: function () {\r\n\t\tvar prefix = 'leaflet-popup',\r\n\t\t container = this._container = DomUtil.create('div',\r\n\t\t\tprefix + ' ' + (this.options.className || '') +\r\n\t\t\t' leaflet-zoom-animated');\r\n\r\n\t\tvar wrapper = this._wrapper = DomUtil.create('div', prefix + '-content-wrapper', container);\r\n\t\tthis._contentNode = DomUtil.create('div', prefix + '-content', wrapper);\r\n\r\n\t\tDomEvent.disableClickPropagation(container);\r\n\t\tDomEvent.disableScrollPropagation(this._contentNode);\r\n\t\tDomEvent.on(container, 'contextmenu', DomEvent.stopPropagation);\r\n\r\n\t\tthis._tipContainer = DomUtil.create('div', prefix + '-tip-container', container);\r\n\t\tthis._tip = DomUtil.create('div', prefix + '-tip', this._tipContainer);\r\n\r\n\t\tif (this.options.closeButton) {\r\n\t\t\tvar closeButton = this._closeButton = DomUtil.create('a', prefix + '-close-button', container);\r\n\t\t\tcloseButton.setAttribute('role', 'button'); // overrides the implicit role=link of <a> elements #7399\r\n\t\t\tcloseButton.setAttribute('aria-label', 'Close popup');\r\n\t\t\tcloseButton.href = '#close';\r\n\t\t\tcloseButton.innerHTML = '<span aria-hidden=\"true\">&#215;</span>';\r\n\r\n\t\t\tDomEvent.on(closeButton, 'click', function (ev) {\r\n\t\t\t\tDomEvent.preventDefault(ev);\r\n\t\t\t\tthis.close();\r\n\t\t\t}, this);\r\n\t\t}\r\n\t},\r\n\r\n\t_updateLayout: function () {\r\n\t\tvar container = this._contentNode,\r\n\t\t style = container.style;\r\n\r\n\t\tstyle.width = '';\r\n\t\tstyle.whiteSpace = 'nowrap';\r\n\r\n\t\tvar width = container.offsetWidth;\r\n\t\twidth = Math.min(width, this.options.maxWidth);\r\n\t\twidth = Math.max(width, this.options.minWidth);\r\n\r\n\t\tstyle.width = (width + 1) + 'px';\r\n\t\tstyle.whiteSpace = '';\r\n\r\n\t\tstyle.height = '';\r\n\r\n\t\tvar height = container.offsetHeight,\r\n\t\t maxHeight = this.options.maxHeight,\r\n\t\t scrolledClass = 'leaflet-popup-scrolled';\r\n\r\n\t\tif (maxHeight && height > maxHeight) {\r\n\t\t\tstyle.height = maxHeight + 'px';\r\n\t\t\tDomUtil.addClass(container, scrolledClass);\r\n\t\t} else {\r\n\t\t\tDomUtil.removeClass(container, scrolledClass);\r\n\t\t}\r\n\r\n\t\tthis._containerWidth = this._container.offsetWidth;\r\n\t},\r\n\r\n\t_animateZoom: function (e) {\r\n\t\tvar pos = this._map._latLngToNewLayerPoint(this._latlng, e.zoom, e.center),\r\n\t\t anchor = this._getAnchor();\r\n\t\tDomUtil.setPosition(this._container, pos.add(anchor));\r\n\t},\r\n\r\n\t_adjustPan: function () {\r\n\t\tif (!this.options.autoPan) { return; }\r\n\t\tif (this._map._panAnim) { this._map._panAnim.stop(); }\r\n\r\n\t\t// We can endlessly recurse if keepInView is set and the view resets.\r\n\t\t// Let's guard against that by exiting early if we're responding to our own autopan.\r\n\t\tif (this._autopanning) {\r\n\t\t\tthis._autopanning = false;\r\n\t\t\treturn;\r\n\t\t}\r\n\r\n\t\tvar map = this._map,\r\n\t\t marginBottom = parseInt(DomUtil.getStyle(this._container, 'marginBottom'), 10) || 0,\r\n\t\t containerHeight = this._container.offsetHeight + marginBottom,\r\n\t\t containerWidth = this._containerWidth,\r\n\t\t layerPos = new Point(this._containerLeft, -containerHeight - this._containerBottom);\r\n\r\n\t\tlayerPos._add(DomUtil.getPosition(this._container));\r\n\r\n\t\tvar containerPos = map.layerPointToContainerPoint(layerPos),\r\n\t\t padding = toPoint(this.options.autoPanPadding),\r\n\t\t paddingTL = toPoint(this.options.autoPanPaddingTopLeft || padding),\r\n\t\t paddingBR = toPoint(this.options.autoPanPaddingBottomRight || padding),\r\n\t\t size = map.getSize(),\r\n\t\t dx = 0,\r\n\t\t dy = 0;\r\n\r\n\t\tif (containerPos.x + containerWidth + paddingBR.x > size.x) { // right\r\n\t\t\tdx = containerPos.x + containerWidth - size.x + paddingBR.x;\r\n\t\t}\r\n\t\tif (containerPos.x - dx - paddingTL.x < 0) { // left\r\n\t\t\tdx = containerPos.x - paddingTL.x;\r\n\t\t}\r\n\t\tif (containerPos.y + containerHeight + paddingBR.y > size.y) { // bottom\r\n\t\t\tdy = containerPos.y + containerHeight - size.y + paddingBR.y;\r\n\t\t}\r\n\t\tif (containerPos.y - dy - paddingTL.y < 0) { // top\r\n\t\t\tdy = containerPos.y - paddingTL.y;\r\n\t\t}\r\n\r\n\t\t// @namespace Map\r\n\t\t// @section Popup events\r\n\t\t// @event autopanstart: Event\r\n\t\t// Fired when the map starts autopanning when opening a popup.\r\n\t\tif (dx || dy) {\r\n\t\t\t// Track that we're autopanning, as this function will be re-ran on moveend\r\n\t\t\tif (this.options.keepInView) {\r\n\t\t\t\tthis._autopanning = true;\r\n\t\t\t}\r\n\r\n\t\t\tmap\r\n\t\t\t .fire('autopanstart')\r\n\t\t\t .panBy([dx, dy]);\r\n\t\t}\r\n\t},\r\n\r\n\t_getAnchor: function () {\r\n\t\t// Where should we anchor the popup on the source layer?\r\n\t\treturn toPoint(this._source && this._source._getPopupAnchor ? this._source._getPopupAnchor() : [0, 0]);\r\n\t}\r\n\r\n});\r\n\r\n// @namespace Popup\r\n// @factory L.popup(options?: Popup options, source?: Layer)\r\n// Instantiates a `Popup` object given an optional `options` object that describes its appearance and location and an optional `source` object that is used to tag the popup with a reference to the Layer to which it refers.\r\n// @alternative\r\n// @factory L.popup(latlng: LatLng, options?: Popup options)\r\n// Instantiates a `Popup` object given `latlng` where the popup will open and an optional `options` object that describes its appearance and location.\r\nexport var popup = function (options, source) {\r\n\treturn new Popup(options, source);\r\n};\r\n\r\n\r\n/* @namespace Map\r\n * @section Interaction Options\r\n * @option closePopupOnClick: Boolean = true\r\n * Set it to `false` if you don't want popups to close when user clicks the map.\r\n */\r\nMap.mergeOptions({\r\n\tclosePopupOnClick: true\r\n});\r\n\r\n\r\n// @namespace Map\r\n// @section Methods for Layers and Controls\r\nMap.include({\r\n\t// @method openPopup(popup: Popup): this\r\n\t// Opens the specified popup while closing the previously opened (to make sure only one is opened at one time for usability).\r\n\t// @alternative\r\n\t// @method openPopup(content: String|HTMLElement, latlng: LatLng, options?: Popup options): this\r\n\t// Creates a popup with the specified content and options and opens it in the given point on a map.\r\n\topenPopup: function (popup, latlng, options) {\r\n\t\tthis._initOverlay(Popup, popup, latlng, options)\r\n\t\t .openOn(this);\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method closePopup(popup?: Popup): this\r\n\t// Closes the popup previously opened with [openPopup](#map-openpopup) (or the given one).\r\n\tclosePopup: function (popup) {\r\n\t\tpopup = arguments.length ? popup : this._popup;\r\n\t\tif (popup) {\r\n\t\t\tpopup.close();\r\n\t\t}\r\n\t\treturn this;\r\n\t}\r\n});\r\n\r\n/*\r\n * @namespace Layer\r\n * @section Popup methods example\r\n *\r\n * All layers share a set of methods convenient for binding popups to it.\r\n *\r\n * ```js\r\n * var layer = L.Polygon(latlngs).bindPopup('Hi There!').addTo(map);\r\n * layer.openPopup();\r\n * layer.closePopup();\r\n * ```\r\n *\r\n * Popups will also be automatically opened when the layer is clicked on and closed when the layer is removed from the map or another popup is opened.\r\n */\r\n\r\n// @section Popup methods\r\nLayer.include({\r\n\r\n\t// @method bindPopup(content: String|HTMLElement|Function|Popup, options?: Popup options): this\r\n\t// Binds a popup to the layer with the passed `content` and sets up the\r\n\t// necessary event listeners. If a `Function` is passed it will receive\r\n\t// the layer as the first argument and should return a `String` or `HTMLElement`.\r\n\tbindPopup: function (content, options) {\r\n\t\tthis._popup = this._initOverlay(Popup, this._popup, content, options);\r\n\t\tif (!this._popupHandlersAdded) {\r\n\t\t\tthis.on({\r\n\t\t\t\tclick: this._openPopup,\r\n\t\t\t\tkeypress: this._onKeyPress,\r\n\t\t\t\tremove: this.closePopup,\r\n\t\t\t\tmove: this._movePopup\r\n\t\t\t});\r\n\t\t\tthis._popupHandlersAdded = true;\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method unbindPopup(): this\r\n\t// Removes the popup previously bound with `bindPopup`.\r\n\tunbindPopup: function () {\r\n\t\tif (this._popup) {\r\n\t\t\tthis.off({\r\n\t\t\t\tclick: this._openPopup,\r\n\t\t\t\tkeypress: this._onKeyPress,\r\n\t\t\t\tremove: this.closePopup,\r\n\t\t\t\tmove: this._movePopup\r\n\t\t\t});\r\n\t\t\tthis._popupHandlersAdded = false;\r\n\t\t\tthis._popup = null;\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method openPopup(latlng?: LatLng): this\r\n\t// Opens the bound popup at the specified `latlng` or at the default popup anchor if no `latlng` is passed.\r\n\topenPopup: function (latlng) {\r\n\t\tif (this._popup) {\r\n\t\t\tif (!(this instanceof FeatureGroup)) {\r\n\t\t\t\tthis._popup._source = this;\r\n\t\t\t}\r\n\t\t\tif (this._popup._prepareOpen(latlng || this._latlng)) {\r\n\t\t\t\t// open the popup on the map\r\n\t\t\t\tthis._popup.openOn(this._map);\r\n\t\t\t}\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method closePopup(): this\r\n\t// Closes the popup bound to this layer if it is open.\r\n\tclosePopup: function () {\r\n\t\tif (this._popup) {\r\n\t\t\tthis._popup.close();\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method togglePopup(): this\r\n\t// Opens or closes the popup bound to this layer depending on its current state.\r\n\ttogglePopup: function () {\r\n\t\tif (this._popup) {\r\n\t\t\tthis._popup.toggle(this);\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method isPopupOpen(): boolean\r\n\t// Returns `true` if the popup bound to this layer is currently open.\r\n\tisPopupOpen: function () {\r\n\t\treturn (this._popup ? this._popup.isOpen() : false);\r\n\t},\r\n\r\n\t// @method setPopupContent(content: String|HTMLElement|Popup): this\r\n\t// Sets the content of the popup bound to this layer.\r\n\tsetPopupContent: function (content) {\r\n\t\tif (this._popup) {\r\n\t\t\tthis._popup.setContent(content);\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method getPopup(): Popup\r\n\t// Returns the popup bound to this layer.\r\n\tgetPopup: function () {\r\n\t\treturn this._popup;\r\n\t},\r\n\r\n\t_openPopup: function (e) {\r\n\t\tif (!this._popup || !this._map) {\r\n\t\t\treturn;\r\n\t\t}\r\n\t\t// prevent map click\r\n\t\tDomEvent.stop(e);\r\n\r\n\t\tvar target = e.layer || e.target;\r\n\t\tif (this._popup._source === target && !(target instanceof Path)) {\r\n\t\t\t// treat it like a marker and figure out\r\n\t\t\t// if we should toggle it open/closed\r\n\t\t\tif (this._map.hasLayer(this._popup)) {\r\n\t\t\t\tthis.closePopup();\r\n\t\t\t} else {\r\n\t\t\t\tthis.openPopup(e.latlng);\r\n\t\t\t}\r\n\t\t\treturn;\r\n\t\t}\r\n\t\tthis._popup._source = target;\r\n\t\tthis.openPopup(e.latlng);\r\n\t},\r\n\r\n\t_movePopup: function (e) {\r\n\t\tthis._popup.setLatLng(e.latlng);\r\n\t},\r\n\r\n\t_onKeyPress: function (e) {\r\n\t\tif (e.originalEvent.keyCode === 13) {\r\n\t\t\tthis._openPopup(e);\r\n\t\t}\r\n\t}\r\n});\r\n", "import {DivOverlay} from './DivOverlay';\nimport {toPoint} from '../geometry/Point';\nimport {Map} from '../map/Map';\nimport {Layer} from './Layer';\nimport * as DomUtil from '../dom/DomUtil';\nimport * as DomEvent from '../dom/DomEvent';\nimport * as Util from '../core/Util';\nimport {FeatureGroup} from './FeatureGroup';\n\n/*\n * @class Tooltip\n * @inherits DivOverlay\n * @aka L.Tooltip\n * Used to display small texts on top of map layers.\n *\n * @example\n * If you want to just bind a tooltip to marker:\n *\n * ```js\n * marker.bindTooltip(\"my tooltip text\").openTooltip();\n * ```\n * Path overlays like polylines also have a `bindTooltip` method.\n *\n * A tooltip can be also standalone:\n *\n * ```js\n * var tooltip = L.tooltip()\n * \t.setLatLng(latlng)\n * \t.setContent('Hello world!<br />This is a nice tooltip.')\n * \t.addTo(map);\n * ```\n * or\n * ```js\n * var tooltip = L.tooltip(latlng, {content: 'Hello world!<br />This is a nice tooltip.'})\n * \t.addTo(map);\n * ```\n *\n *\n * Note about tooltip offset. Leaflet takes two options in consideration\n * for computing tooltip offsetting:\n * - the `offset` Tooltip option: it defaults to [0, 0], and it's specific to one tooltip.\n * Add a positive x offset to move the tooltip to the right, and a positive y offset to\n * move it to the bottom. Negatives will move to the left and top.\n * - the `tooltipAnchor` Icon option: this will only be considered for Marker. You\n * should adapt this value if you use a custom icon.\n */\n\n\n// @namespace Tooltip\nexport var Tooltip = DivOverlay.extend({\n\n\t// @section\n\t// @aka Tooltip options\n\toptions: {\n\t\t// @option pane: String = 'tooltipPane'\n\t\t// `Map pane` where the tooltip will be added.\n\t\tpane: 'tooltipPane',\n\n\t\t// @option offset: Point = Point(0, 0)\n\t\t// Optional offset of the tooltip position.\n\t\toffset: [0, 0],\n\n\t\t// @option direction: String = 'auto'\n\t\t// Direction where to open the tooltip. Possible values are: `right`, `left`,\n\t\t// `top`, `bottom`, `center`, `auto`.\n\t\t// `auto` will dynamically switch between `right` and `left` according to the tooltip\n\t\t// position on the map.\n\t\tdirection: 'auto',\n\n\t\t// @option permanent: Boolean = false\n\t\t// Whether to open the tooltip permanently or only on mouseover.\n\t\tpermanent: false,\n\n\t\t// @option sticky: Boolean = false\n\t\t// If true, the tooltip will follow the mouse instead of being fixed at the feature center.\n\t\tsticky: false,\n\n\t\t// @option opacity: Number = 0.9\n\t\t// Tooltip container opacity.\n\t\topacity: 0.9\n\t},\n\n\tonAdd: function (map) {\n\t\tDivOverlay.prototype.onAdd.call(this, map);\n\t\tthis.setOpacity(this.options.opacity);\n\n\t\t// @namespace Map\n\t\t// @section Tooltip events\n\t\t// @event tooltipopen: TooltipEvent\n\t\t// Fired when a tooltip is opened in the map.\n\t\tmap.fire('tooltipopen', {tooltip: this});\n\n\t\tif (this._source) {\n\t\t\tthis.addEventParent(this._source);\n\n\t\t\t// @namespace Layer\n\t\t\t// @section Tooltip events\n\t\t\t// @event tooltipopen: TooltipEvent\n\t\t\t// Fired when a tooltip bound to this layer is opened.\n\t\t\tthis._source.fire('tooltipopen', {tooltip: this}, true);\n\t\t}\n\t},\n\n\tonRemove: function (map) {\n\t\tDivOverlay.prototype.onRemove.call(this, map);\n\n\t\t// @namespace Map\n\t\t// @section Tooltip events\n\t\t// @event tooltipclose: TooltipEvent\n\t\t// Fired when a tooltip in the map is closed.\n\t\tmap.fire('tooltipclose', {tooltip: this});\n\n\t\tif (this._source) {\n\t\t\tthis.removeEventParent(this._source);\n\n\t\t\t// @namespace Layer\n\t\t\t// @section Tooltip events\n\t\t\t// @event tooltipclose: TooltipEvent\n\t\t\t// Fired when a tooltip bound to this layer is closed.\n\t\t\tthis._source.fire('tooltipclose', {tooltip: this}, true);\n\t\t}\n\t},\n\n\tgetEvents: function () {\n\t\tvar events = DivOverlay.prototype.getEvents.call(this);\n\n\t\tif (!this.options.permanent) {\n\t\t\tevents.preclick = this.close;\n\t\t}\n\n\t\treturn events;\n\t},\n\n\t_initLayout: function () {\n\t\tvar prefix = 'leaflet-tooltip',\n\t\t className = prefix + ' ' + (this.options.className || '') + ' leaflet-zoom-' + (this._zoomAnimated ? 'animated' : 'hide');\n\n\t\tthis._contentNode = this._container = DomUtil.create('div', className);\n\n\t\tthis._container.setAttribute('role', 'tooltip');\n\t\tthis._container.setAttribute('id', 'leaflet-tooltip-' + Util.stamp(this));\n\t},\n\n\t_updateLayout: function () {},\n\n\t_adjustPan: function () {},\n\n\t_setPosition: function (pos) {\n\t\tvar subX, subY,\n\t\t map = this._map,\n\t\t container = this._container,\n\t\t centerPoint = map.latLngToContainerPoint(map.getCenter()),\n\t\t tooltipPoint = map.layerPointToContainerPoint(pos),\n\t\t direction = this.options.direction,\n\t\t tooltipWidth = container.offsetWidth,\n\t\t tooltipHeight = container.offsetHeight,\n\t\t offset = toPoint(this.options.offset),\n\t\t anchor = this._getAnchor();\n\n\t\tif (direction === 'top') {\n\t\t\tsubX = tooltipWidth / 2;\n\t\t\tsubY = tooltipHeight;\n\t\t} else if (direction === 'bottom') {\n\t\t\tsubX = tooltipWidth / 2;\n\t\t\tsubY = 0;\n\t\t} else if (direction === 'center') {\n\t\t\tsubX = tooltipWidth / 2;\n\t\t\tsubY = tooltipHeight / 2;\n\t\t} else if (direction === 'right') {\n\t\t\tsubX = 0;\n\t\t\tsubY = tooltipHeight / 2;\n\t\t} else if (direction === 'left') {\n\t\t\tsubX = tooltipWidth;\n\t\t\tsubY = tooltipHeight / 2;\n\t\t} else if (tooltipPoint.x < centerPoint.x) {\n\t\t\tdirection = 'right';\n\t\t\tsubX = 0;\n\t\t\tsubY = tooltipHeight / 2;\n\t\t} else {\n\t\t\tdirection = 'left';\n\t\t\tsubX = tooltipWidth + (offset.x + anchor.x) * 2;\n\t\t\tsubY = tooltipHeight / 2;\n\t\t}\n\n\t\tpos = pos.subtract(toPoint(subX, subY, true)).add(offset).add(anchor);\n\n\t\tDomUtil.removeClass(container, 'leaflet-tooltip-right');\n\t\tDomUtil.removeClass(container, 'leaflet-tooltip-left');\n\t\tDomUtil.removeClass(container, 'leaflet-tooltip-top');\n\t\tDomUtil.removeClass(container, 'leaflet-tooltip-bottom');\n\t\tDomUtil.addClass(container, 'leaflet-tooltip-' + direction);\n\t\tDomUtil.setPosition(container, pos);\n\t},\n\n\t_updatePosition: function () {\n\t\tvar pos = this._map.latLngToLayerPoint(this._latlng);\n\t\tthis._setPosition(pos);\n\t},\n\n\tsetOpacity: function (opacity) {\n\t\tthis.options.opacity = opacity;\n\n\t\tif (this._container) {\n\t\t\tDomUtil.setOpacity(this._container, opacity);\n\t\t}\n\t},\n\n\t_animateZoom: function (e) {\n\t\tvar pos = this._map._latLngToNewLayerPoint(this._latlng, e.zoom, e.center);\n\t\tthis._setPosition(pos);\n\t},\n\n\t_getAnchor: function () {\n\t\t// Where should we anchor the tooltip on the source layer?\n\t\treturn toPoint(this._source && this._source._getTooltipAnchor && !this.options.sticky ? this._source._getTooltipAnchor() : [0, 0]);\n\t}\n\n});\n\n// @namespace Tooltip\n// @factory L.tooltip(options?: Tooltip options, source?: Layer)\n// Instantiates a `Tooltip` object given an optional `options` object that describes its appearance and location and an optional `source` object that is used to tag the tooltip with a reference to the Layer to which it refers.\n// @alternative\n// @factory L.tooltip(latlng: LatLng, options?: Tooltip options)\n// Instantiates a `Tooltip` object given `latlng` where the tooltip will open and an optional `options` object that describes its appearance and location.\nexport var tooltip = function (options, source) {\n\treturn new Tooltip(options, source);\n};\n\n// @namespace Map\n// @section Methods for Layers and Controls\nMap.include({\n\n\t// @method openTooltip(tooltip: Tooltip): this\n\t// Opens the specified tooltip.\n\t// @alternative\n\t// @method openTooltip(content: String|HTMLElement, latlng: LatLng, options?: Tooltip options): this\n\t// Creates a tooltip with the specified content and options and open it.\n\topenTooltip: function (tooltip, latlng, options) {\n\t\tthis._initOverlay(Tooltip, tooltip, latlng, options)\n\t\t .openOn(this);\n\n\t\treturn this;\n\t},\n\n\t// @method closeTooltip(tooltip: Tooltip): this\n\t// Closes the tooltip given as parameter.\n\tcloseTooltip: function (tooltip) {\n\t\ttooltip.close();\n\t\treturn this;\n\t}\n\n});\n\n/*\n * @namespace Layer\n * @section Tooltip methods example\n *\n * All layers share a set of methods convenient for binding tooltips to it.\n *\n * ```js\n * var layer = L.Polygon(latlngs).bindTooltip('Hi There!').addTo(map);\n * layer.openTooltip();\n * layer.closeTooltip();\n * ```\n */\n\n// @section Tooltip methods\nLayer.include({\n\n\t// @method bindTooltip(content: String|HTMLElement|Function|Tooltip, options?: Tooltip options): this\n\t// Binds a tooltip to the layer with the passed `content` and sets up the\n\t// necessary event listeners. If a `Function` is passed it will receive\n\t// the layer as the first argument and should return a `String` or `HTMLElement`.\n\tbindTooltip: function (content, options) {\n\n\t\tif (this._tooltip && this.isTooltipOpen()) {\n\t\t\tthis.unbindTooltip();\n\t\t}\n\n\t\tthis._tooltip = this._initOverlay(Tooltip, this._tooltip, content, options);\n\t\tthis._initTooltipInteractions();\n\n\t\tif (this._tooltip.options.permanent && this._map && this._map.hasLayer(this)) {\n\t\t\tthis.openTooltip();\n\t\t}\n\n\t\treturn this;\n\t},\n\n\t// @method unbindTooltip(): this\n\t// Removes the tooltip previously bound with `bindTooltip`.\n\tunbindTooltip: function () {\n\t\tif (this._tooltip) {\n\t\t\tthis._initTooltipInteractions(true);\n\t\t\tthis.closeTooltip();\n\t\t\tthis._tooltip = null;\n\t\t}\n\t\treturn this;\n\t},\n\n\t_initTooltipInteractions: function (remove) {\n\t\tif (!remove && this._tooltipHandlersAdded) { return; }\n\t\tvar onOff = remove ? 'off' : 'on',\n\t\t events = {\n\t\t\tremove: this.closeTooltip,\n\t\t\tmove: this._moveTooltip\n\t\t };\n\t\tif (!this._tooltip.options.permanent) {\n\t\t\tevents.mouseover = this._openTooltip;\n\t\t\tevents.mouseout = this.closeTooltip;\n\t\t\tevents.click = this._openTooltip;\n\t\t\tif (this._map) {\n\t\t\t\tthis._addFocusListeners();\n\t\t\t} else {\n\t\t\t\tevents.add = this._addFocusListeners;\n\t\t\t}\n\t\t} else {\n\t\t\tevents.add = this._openTooltip;\n\t\t}\n\t\tif (this._tooltip.options.sticky) {\n\t\t\tevents.mousemove = this._moveTooltip;\n\t\t}\n\t\tthis[onOff](events);\n\t\tthis._tooltipHandlersAdded = !remove;\n\t},\n\n\t// @method openTooltip(latlng?: LatLng): this\n\t// Opens the bound tooltip at the specified `latlng` or at the default tooltip anchor if no `latlng` is passed.\n\topenTooltip: function (latlng) {\n\t\tif (this._tooltip) {\n\t\t\tif (!(this instanceof FeatureGroup)) {\n\t\t\t\tthis._tooltip._source = this;\n\t\t\t}\n\t\t\tif (this._tooltip._prepareOpen(latlng)) {\n\t\t\t\t// open the tooltip on the map\n\t\t\t\tthis._tooltip.openOn(this._map);\n\n\t\t\t\tif (this.getElement) {\n\t\t\t\t\tthis._setAriaDescribedByOnLayer(this);\n\t\t\t\t} else if (this.eachLayer) {\n\t\t\t\t\tthis.eachLayer(this._setAriaDescribedByOnLayer, this);\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t\treturn this;\n\t},\n\n\t// @method closeTooltip(): this\n\t// Closes the tooltip bound to this layer if it is open.\n\tcloseTooltip: function () {\n\t\tif (this._tooltip) {\n\t\t\treturn this._tooltip.close();\n\t\t}\n\t},\n\n\t// @method toggleTooltip(): this\n\t// Opens or closes the tooltip bound to this layer depending on its current state.\n\ttoggleTooltip: function () {\n\t\tif (this._tooltip) {\n\t\t\tthis._tooltip.toggle(this);\n\t\t}\n\t\treturn this;\n\t},\n\n\t// @method isTooltipOpen(): boolean\n\t// Returns `true` if the tooltip bound to this layer is currently open.\n\tisTooltipOpen: function () {\n\t\treturn this._tooltip.isOpen();\n\t},\n\n\t// @method setTooltipContent(content: String|HTMLElement|Tooltip): this\n\t// Sets the content of the tooltip bound to this layer.\n\tsetTooltipContent: function (content) {\n\t\tif (this._tooltip) {\n\t\t\tthis._tooltip.setContent(content);\n\t\t}\n\t\treturn this;\n\t},\n\n\t// @method getTooltip(): Tooltip\n\t// Returns the tooltip bound to this layer.\n\tgetTooltip: function () {\n\t\treturn this._tooltip;\n\t},\n\n\t_addFocusListeners: function () {\n\t\tif (this.getElement) {\n\t\t\tthis._addFocusListenersOnLayer(this);\n\t\t} else if (this.eachLayer) {\n\t\t\tthis.eachLayer(this._addFocusListenersOnLayer, this);\n\t\t}\n\t},\n\n\t_addFocusListenersOnLayer: function (layer) {\n\t\tvar el = typeof layer.getElement === 'function' && layer.getElement();\n\t\tif (el) {\n\t\t\tDomEvent.on(el, 'focus', function () {\n\t\t\t\tthis._tooltip._source = layer;\n\t\t\t\tthis.openTooltip();\n\t\t\t}, this);\n\t\t\tDomEvent.on(el, 'blur', this.closeTooltip, this);\n\t\t}\n\t},\n\n\t_setAriaDescribedByOnLayer: function (layer) {\n\t\tvar el = typeof layer.getElement === 'function' && layer.getElement();\n\t\tif (el) {\n\t\t\tel.setAttribute('aria-describedby', this._tooltip._container.id);\n\t\t}\n\t},\n\n\n\t_openTooltip: function (e) {\n\t\tif (!this._tooltip || !this._map) {\n\t\t\treturn;\n\t\t}\n\n\t\t// If the map is moving, we will show the tooltip after it's done.\n\t\tif (this._map.dragging && this._map.dragging.moving() && !this._openOnceFlag) {\n\t\t\tthis._openOnceFlag = true;\n\t\t\tvar that = this;\n\t\t\tthis._map.once('moveend', function () {\n\t\t\t\tthat._openOnceFlag = false;\n\t\t\t\tthat._openTooltip(e);\n\t\t\t});\n\t\t\treturn;\n\t\t}\n\n\t\tthis._tooltip._source = e.layer || e.target;\n\n\t\tthis.openTooltip(this._tooltip.options.sticky ? e.latlng : undefined);\n\t},\n\n\t_moveTooltip: function (e) {\n\t\tvar latlng = e.latlng, containerPoint, layerPoint;\n\t\tif (this._tooltip.options.sticky && e.originalEvent) {\n\t\t\tcontainerPoint = this._map.mouseEventToContainerPoint(e.originalEvent);\n\t\t\tlayerPoint = this._map.containerPointToLayerPoint(containerPoint);\n\t\t\tlatlng = this._map.layerPointToLatLng(layerPoint);\n\t\t}\n\t\tthis._tooltip.setLatLng(latlng);\n\t}\n});\n", "import {Icon} from './Icon';\nimport {toPoint as point} from '../../geometry/Point';\nimport {empty} from '../../dom/DomUtil';\n\n/*\n * @class DivIcon\n * @aka L.DivIcon\n * @inherits Icon\n *\n * Represents a lightweight icon for markers that uses a simple `<div>`\n * element instead of an image. Inherits from `Icon` but ignores the `iconUrl` and shadow options.\n *\n * @example\n * ```js\n * var myIcon = L.divIcon({className: 'my-div-icon'});\n * // you can set .my-div-icon styles in CSS\n *\n * L.marker([50.505, 30.57], {icon: myIcon}).addTo(map);\n * ```\n *\n * By default, it has a 'leaflet-div-icon' CSS class and is styled as a little white square with a shadow.\n */\n\nexport var DivIcon = Icon.extend({\n\toptions: {\n\t\t// @section\n\t\t// @aka DivIcon options\n\t\ticonSize: [12, 12], // also can be set through CSS\n\n\t\t// iconAnchor: (Point),\n\t\t// popupAnchor: (Point),\n\n\t\t// @option html: String|HTMLElement = ''\n\t\t// Custom HTML code to put inside the div element, empty by default. Alternatively,\n\t\t// an instance of `HTMLElement`.\n\t\thtml: false,\n\n\t\t// @option bgPos: Point = [0, 0]\n\t\t// Optional relative position of the background, in pixels\n\t\tbgPos: null,\n\n\t\tclassName: 'leaflet-div-icon'\n\t},\n\n\tcreateIcon: function (oldIcon) {\n\t\tvar div = (oldIcon && oldIcon.tagName === 'DIV') ? oldIcon : document.createElement('div'),\n\t\t options = this.options;\n\n\t\tif (options.html instanceof Element) {\n\t\t\tempty(div);\n\t\t\tdiv.appendChild(options.html);\n\t\t} else {\n\t\t\tdiv.innerHTML = options.html !== false ? options.html : '';\n\t\t}\n\n\t\tif (options.bgPos) {\n\t\t\tvar bgPos = point(options.bgPos);\n\t\t\tdiv.style.backgroundPosition = (-bgPos.x) + 'px ' + (-bgPos.y) + 'px';\n\t\t}\n\t\tthis._setIconStyles(div, 'icon');\n\n\t\treturn div;\n\t},\n\n\tcreateShadow: function () {\n\t\treturn null;\n\t}\n});\n\n// @factory L.divIcon(options: DivIcon options)\n// Creates a `DivIcon` instance with the given options.\nexport function divIcon(options) {\n\treturn new DivIcon(options);\n}\n", "import {Icon} from './Icon';\nexport {icon} from './Icon';\nimport {IconDefault} from './Icon.Default';\nIcon.Default = IconDefault;\nexport {Icon};\n\nexport {DivIcon, divIcon} from './DivIcon';\nexport {Marker, marker} from './Marker';\n", "import {Layer} from '../Layer';\nimport Browser from '../../core/Browser';\nimport * as Util from '../../core/Util';\nimport * as DomUtil from '../../dom/DomUtil';\nimport {Point} from '../../geometry/Point';\nimport {Bounds} from '../../geometry/Bounds';\nimport {LatLngBounds, toLatLngBounds as latLngBounds} from '../../geo/LatLngBounds';\n\n/*\n * @class GridLayer\n * @inherits Layer\n * @aka L.GridLayer\n *\n * Generic class for handling a tiled grid of HTML elements. This is the base class for all tile layers and replaces `TileLayer.Canvas`.\n * GridLayer can be extended to create a tiled grid of HTML elements like `<canvas>`, `<img>` or `<div>`. GridLayer will handle creating and animating these DOM elements for you.\n *\n *\n * @section Synchronous usage\n * @example\n *\n * To create a custom layer, extend GridLayer and implement the `createTile()` method, which will be passed a `Point` object with the `x`, `y`, and `z` (zoom level) coordinates to draw your tile.\n *\n * ```js\n * var CanvasLayer = L.GridLayer.extend({\n * createTile: function(coords){\n * // create a <canvas> element for drawing\n * var tile = L.DomUtil.create('canvas', 'leaflet-tile');\n *\n * // setup tile width and height according to the options\n * var size = this.getTileSize();\n * tile.width = size.x;\n * tile.height = size.y;\n *\n * // get a canvas context and draw something on it using coords.x, coords.y and coords.z\n * var ctx = tile.getContext('2d');\n *\n * // return the tile so it can be rendered on screen\n * return tile;\n * }\n * });\n * ```\n *\n * @section Asynchronous usage\n * @example\n *\n * Tile creation can also be asynchronous, this is useful when using a third-party drawing library. Once the tile is finished drawing it can be passed to the `done()` callback.\n *\n * ```js\n * var CanvasLayer = L.GridLayer.extend({\n * createTile: function(coords, done){\n * var error;\n *\n * // create a <canvas> element for drawing\n * var tile = L.DomUtil.create('canvas', 'leaflet-tile');\n *\n * // setup tile width and height according to the options\n * var size = this.getTileSize();\n * tile.width = size.x;\n * tile.height = size.y;\n *\n * // draw something asynchronously and pass the tile to the done() callback\n * setTimeout(function() {\n * done(error, tile);\n * }, 1000);\n *\n * return tile;\n * }\n * });\n * ```\n *\n * @section\n */\n\n\nexport var GridLayer = Layer.extend({\n\n\t// @section\n\t// @aka GridLayer options\n\toptions: {\n\t\t// @option tileSize: Number|Point = 256\n\t\t// Width and height of tiles in the grid. Use a number if width and height are equal, or `L.point(width, height)` otherwise.\n\t\ttileSize: 256,\n\n\t\t// @option opacity: Number = 1.0\n\t\t// Opacity of the tiles. Can be used in the `createTile()` function.\n\t\topacity: 1,\n\n\t\t// @option updateWhenIdle: Boolean = (depends)\n\t\t// Load new tiles only when panning ends.\n\t\t// `true` by default on mobile browsers, in order to avoid too many requests and keep smooth navigation.\n\t\t// `false` otherwise in order to display new tiles _during_ panning, since it is easy to pan outside the\n\t\t// [`keepBuffer`](#gridlayer-keepbuffer) option in desktop browsers.\n\t\tupdateWhenIdle: Browser.mobile,\n\n\t\t// @option updateWhenZooming: Boolean = true\n\t\t// By default, a smooth zoom animation (during a [touch zoom](#map-touchzoom) or a [`flyTo()`](#map-flyto)) will update grid layers every integer zoom level. Setting this option to `false` will update the grid layer only when the smooth animation ends.\n\t\tupdateWhenZooming: true,\n\n\t\t// @option updateInterval: Number = 200\n\t\t// Tiles will not update more than once every `updateInterval` milliseconds when panning.\n\t\tupdateInterval: 200,\n\n\t\t// @option zIndex: Number = 1\n\t\t// The explicit zIndex of the tile layer.\n\t\tzIndex: 1,\n\n\t\t// @option bounds: LatLngBounds = undefined\n\t\t// If set, tiles will only be loaded inside the set `LatLngBounds`.\n\t\tbounds: null,\n\n\t\t// @option minZoom: Number = 0\n\t\t// The minimum zoom level down to which this layer will be displayed (inclusive).\n\t\tminZoom: 0,\n\n\t\t// @option maxZoom: Number = undefined\n\t\t// The maximum zoom level up to which this layer will be displayed (inclusive).\n\t\tmaxZoom: undefined,\n\n\t\t// @option maxNativeZoom: Number = undefined\n\t\t// Maximum zoom number the tile source has available. If it is specified,\n\t\t// the tiles on all zoom levels higher than `maxNativeZoom` will be loaded\n\t\t// from `maxNativeZoom` level and auto-scaled.\n\t\tmaxNativeZoom: undefined,\n\n\t\t// @option minNativeZoom: Number = undefined\n\t\t// Minimum zoom number the tile source has available. If it is specified,\n\t\t// the tiles on all zoom levels lower than `minNativeZoom` will be loaded\n\t\t// from `minNativeZoom` level and auto-scaled.\n\t\tminNativeZoom: undefined,\n\n\t\t// @option noWrap: Boolean = false\n\t\t// Whether the layer is wrapped around the antimeridian. If `true`, the\n\t\t// GridLayer will only be displayed once at low zoom levels. Has no\n\t\t// effect when the [map CRS](#map-crs) doesn't wrap around. Can be used\n\t\t// in combination with [`bounds`](#gridlayer-bounds) to prevent requesting\n\t\t// tiles outside the CRS limits.\n\t\tnoWrap: false,\n\n\t\t// @option pane: String = 'tilePane'\n\t\t// `Map pane` where the grid layer will be added.\n\t\tpane: 'tilePane',\n\n\t\t// @option className: String = ''\n\t\t// A custom class name to assign to the tile layer. Empty by default.\n\t\tclassName: '',\n\n\t\t// @option keepBuffer: Number = 2\n\t\t// When panning the map, keep this many rows and columns of tiles before unloading them.\n\t\tkeepBuffer: 2\n\t},\n\n\tinitialize: function (options) {\n\t\tUtil.setOptions(this, options);\n\t},\n\n\tonAdd: function () {\n\t\tthis._initContainer();\n\n\t\tthis._levels = {};\n\t\tthis._tiles = {};\n\n\t\tthis._resetView(); // implicit _update() call\n\t},\n\n\tbeforeAdd: function (map) {\n\t\tmap._addZoomLimit(this);\n\t},\n\n\tonRemove: function (map) {\n\t\tthis._removeAllTiles();\n\t\tDomUtil.remove(this._container);\n\t\tmap._removeZoomLimit(this);\n\t\tthis._container = null;\n\t\tthis._tileZoom = undefined;\n\t},\n\n\t// @method bringToFront: this\n\t// Brings the tile layer to the top of all tile layers.\n\tbringToFront: function () {\n\t\tif (this._map) {\n\t\t\tDomUtil.toFront(this._container);\n\t\t\tthis._setAutoZIndex(Math.max);\n\t\t}\n\t\treturn this;\n\t},\n\n\t// @method bringToBack: this\n\t// Brings the tile layer to the bottom of all tile layers.\n\tbringToBack: function () {\n\t\tif (this._map) {\n\t\t\tDomUtil.toBack(this._container);\n\t\t\tthis._setAutoZIndex(Math.min);\n\t\t}\n\t\treturn this;\n\t},\n\n\t// @method getContainer: HTMLElement\n\t// Returns the HTML element that contains the tiles for this layer.\n\tgetContainer: function () {\n\t\treturn this._container;\n\t},\n\n\t// @method setOpacity(opacity: Number): this\n\t// Changes the [opacity](#gridlayer-opacity) of the grid layer.\n\tsetOpacity: function (opacity) {\n\t\tthis.options.opacity = opacity;\n\t\tthis._updateOpacity();\n\t\treturn this;\n\t},\n\n\t// @method setZIndex(zIndex: Number): this\n\t// Changes the [zIndex](#gridlayer-zindex) of the grid layer.\n\tsetZIndex: function (zIndex) {\n\t\tthis.options.zIndex = zIndex;\n\t\tthis._updateZIndex();\n\n\t\treturn this;\n\t},\n\n\t// @method isLoading: Boolean\n\t// Returns `true` if any tile in the grid layer has not finished loading.\n\tisLoading: function () {\n\t\treturn this._loading;\n\t},\n\n\t// @method redraw: this\n\t// Causes the layer to clear all the tiles and request them again.\n\tredraw: function () {\n\t\tif (this._map) {\n\t\t\tthis._removeAllTiles();\n\t\t\tvar tileZoom = this._clampZoom(this._map.getZoom());\n\t\t\tif (tileZoom !== this._tileZoom) {\n\t\t\t\tthis._tileZoom = tileZoom;\n\t\t\t\tthis._updateLevels();\n\t\t\t}\n\t\t\tthis._update();\n\t\t}\n\t\treturn this;\n\t},\n\n\tgetEvents: function () {\n\t\tvar events = {\n\t\t\tviewprereset: this._invalidateAll,\n\t\t\tviewreset: this._resetView,\n\t\t\tzoom: this._resetView,\n\t\t\tmoveend: this._onMoveEnd\n\t\t};\n\n\t\tif (!this.options.updateWhenIdle) {\n\t\t\t// update tiles on move, but not more often than once per given interval\n\t\t\tif (!this._onMove) {\n\t\t\t\tthis._onMove = Util.throttle(this._onMoveEnd, this.options.updateInterval, this);\n\t\t\t}\n\n\t\t\tevents.move = this._onMove;\n\t\t}\n\n\t\tif (this._zoomAnimated) {\n\t\t\tevents.zoomanim = this._animateZoom;\n\t\t}\n\n\t\treturn events;\n\t},\n\n\t// @section Extension methods\n\t// Layers extending `GridLayer` shall reimplement the following method.\n\t// @method createTile(coords: Object, done?: Function): HTMLElement\n\t// Called only internally, must be overridden by classes extending `GridLayer`.\n\t// Returns the `HTMLElement` corresponding to the given `coords`. If the `done` callback\n\t// is specified, it must be called when the tile has finished loading and drawing.\n\tcreateTile: function () {\n\t\treturn document.createElement('div');\n\t},\n\n\t// @section\n\t// @method getTileSize: Point\n\t// Normalizes the [tileSize option](#gridlayer-tilesize) into a point. Used by the `createTile()` method.\n\tgetTileSize: function () {\n\t\tvar s = this.options.tileSize;\n\t\treturn s instanceof Point ? s : new Point(s, s);\n\t},\n\n\t_updateZIndex: function () {\n\t\tif (this._container && this.options.zIndex !== undefined && this.options.zIndex !== null) {\n\t\t\tthis._container.style.zIndex = this.options.zIndex;\n\t\t}\n\t},\n\n\t_setAutoZIndex: function (compare) {\n\t\t// go through all other layers of the same pane, set zIndex to max + 1 (front) or min - 1 (back)\n\n\t\tvar layers = this.getPane().children,\n\t\t edgeZIndex = -compare(-Infinity, Infinity); // -Infinity for max, Infinity for min\n\n\t\tfor (var i = 0, len = layers.length, zIndex; i < len; i++) {\n\n\t\t\tzIndex = layers[i].style.zIndex;\n\n\t\t\tif (layers[i] !== this._container && zIndex) {\n\t\t\t\tedgeZIndex = compare(edgeZIndex, +zIndex);\n\t\t\t}\n\t\t}\n\n\t\tif (isFinite(edgeZIndex)) {\n\t\t\tthis.options.zIndex = edgeZIndex + compare(-1, 1);\n\t\t\tthis._updateZIndex();\n\t\t}\n\t},\n\n\t_updateOpacity: function () {\n\t\tif (!this._map) { return; }\n\n\t\t// IE doesn't inherit filter opacity properly, so we're forced to set it on tiles\n\t\tif (Browser.ielt9) { return; }\n\n\t\tDomUtil.setOpacity(this._container, this.options.opacity);\n\n\t\tvar now = +new Date(),\n\t\t nextFrame = false,\n\t\t willPrune = false;\n\n\t\tfor (var key in this._tiles) {\n\t\t\tvar tile = this._tiles[key];\n\t\t\tif (!tile.current || !tile.loaded) { continue; }\n\n\t\t\tvar fade = Math.min(1, (now - tile.loaded) / 200);\n\n\t\t\tDomUtil.setOpacity(tile.el, fade);\n\t\t\tif (fade < 1) {\n\t\t\t\tnextFrame = true;\n\t\t\t} else {\n\t\t\t\tif (tile.active) {\n\t\t\t\t\twillPrune = true;\n\t\t\t\t} else {\n\t\t\t\t\tthis._onOpaqueTile(tile);\n\t\t\t\t}\n\t\t\t\ttile.active = true;\n\t\t\t}\n\t\t}\n\n\t\tif (willPrune && !this._noPrune) { this._pruneTiles(); }\n\n\t\tif (nextFrame) {\n\t\t\tUtil.cancelAnimFrame(this._fadeFrame);\n\t\t\tthis._fadeFrame = Util.requestAnimFrame(this._updateOpacity, this);\n\t\t}\n\t},\n\n\t_onOpaqueTile: Util.falseFn,\n\n\t_initContainer: function () {\n\t\tif (this._container) { return; }\n\n\t\tthis._container = DomUtil.create('div', 'leaflet-layer ' + (this.options.className || ''));\n\t\tthis._updateZIndex();\n\n\t\tif (this.options.opacity < 1) {\n\t\t\tthis._updateOpacity();\n\t\t}\n\n\t\tthis.getPane().appendChild(this._container);\n\t},\n\n\t_updateLevels: function () {\n\n\t\tvar zoom = this._tileZoom,\n\t\t maxZoom = this.options.maxZoom;\n\n\t\tif (zoom === undefined) { return undefined; }\n\n\t\tfor (var z in this._levels) {\n\t\t\tz = Number(z);\n\t\t\tif (this._levels[z].el.children.length || z === zoom) {\n\t\t\t\tthis._levels[z].el.style.zIndex = maxZoom - Math.abs(zoom - z);\n\t\t\t\tthis._onUpdateLevel(z);\n\t\t\t} else {\n\t\t\t\tDomUtil.remove(this._levels[z].el);\n\t\t\t\tthis._removeTilesAtZoom(z);\n\t\t\t\tthis._onRemoveLevel(z);\n\t\t\t\tdelete this._levels[z];\n\t\t\t}\n\t\t}\n\n\t\tvar level = this._levels[zoom],\n\t\t map = this._map;\n\n\t\tif (!level) {\n\t\t\tlevel = this._levels[zoom] = {};\n\n\t\t\tlevel.el = DomUtil.create('div', 'leaflet-tile-container leaflet-zoom-animated', this._container);\n\t\t\tlevel.el.style.zIndex = maxZoom;\n\n\t\t\tlevel.origin = map.project(map.unproject(map.getPixelOrigin()), zoom).round();\n\t\t\tlevel.zoom = zoom;\n\n\t\t\tthis._setZoomTransform(level, map.getCenter(), map.getZoom());\n\n\t\t\t// force the browser to consider the newly added element for transition\n\t\t\tUtil.falseFn(level.el.offsetWidth);\n\n\t\t\tthis._onCreateLevel(level);\n\t\t}\n\n\t\tthis._level = level;\n\n\t\treturn level;\n\t},\n\n\t_onUpdateLevel: Util.falseFn,\n\n\t_onRemoveLevel: Util.falseFn,\n\n\t_onCreateLevel: Util.falseFn,\n\n\t_pruneTiles: function () {\n\t\tif (!this._map) {\n\t\t\treturn;\n\t\t}\n\n\t\tvar key, tile;\n\n\t\tvar zoom = this._map.getZoom();\n\t\tif (zoom > this.options.maxZoom ||\n\t\t\tzoom < this.options.minZoom) {\n\t\t\tthis._removeAllTiles();\n\t\t\treturn;\n\t\t}\n\n\t\tfor (key in this._tiles) {\n\t\t\ttile = this._tiles[key];\n\t\t\ttile.retain = tile.current;\n\t\t}\n\n\t\tfor (key in this._tiles) {\n\t\t\ttile = this._tiles[key];\n\t\t\tif (tile.current && !tile.active) {\n\t\t\t\tvar coords = tile.coords;\n\t\t\t\tif (!this._retainParent(coords.x, coords.y, coords.z, coords.z - 5)) {\n\t\t\t\t\tthis._retainChildren(coords.x, coords.y, coords.z, coords.z + 2);\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\tfor (key in this._tiles) {\n\t\t\tif (!this._tiles[key].retain) {\n\t\t\t\tthis._removeTile(key);\n\t\t\t}\n\t\t}\n\t},\n\n\t_removeTilesAtZoom: function (zoom) {\n\t\tfor (var key in this._tiles) {\n\t\t\tif (this._tiles[key].coords.z !== zoom) {\n\t\t\t\tcontinue;\n\t\t\t}\n\t\t\tthis._removeTile(key);\n\t\t}\n\t},\n\n\t_removeAllTiles: function () {\n\t\tfor (var key in this._tiles) {\n\t\t\tthis._removeTile(key);\n\t\t}\n\t},\n\n\t_invalidateAll: function () {\n\t\tfor (var z in this._levels) {\n\t\t\tDomUtil.remove(this._levels[z].el);\n\t\t\tthis._onRemoveLevel(Number(z));\n\t\t\tdelete this._levels[z];\n\t\t}\n\t\tthis._removeAllTiles();\n\n\t\tthis._tileZoom = undefined;\n\t},\n\n\t_retainParent: function (x, y, z, minZoom) {\n\t\tvar x2 = Math.floor(x / 2),\n\t\t y2 = Math.floor(y / 2),\n\t\t z2 = z - 1,\n\t\t coords2 = new Point(+x2, +y2);\n\t\tcoords2.z = +z2;\n\n\t\tvar key = this._tileCoordsToKey(coords2),\n\t\t tile = this._tiles[key];\n\n\t\tif (tile && tile.active) {\n\t\t\ttile.retain = true;\n\t\t\treturn true;\n\n\t\t} else if (tile && tile.loaded) {\n\t\t\ttile.retain = true;\n\t\t}\n\n\t\tif (z2 > minZoom) {\n\t\t\treturn this._retainParent(x2, y2, z2, minZoom);\n\t\t}\n\n\t\treturn false;\n\t},\n\n\t_retainChildren: function (x, y, z, maxZoom) {\n\n\t\tfor (var i = 2 * x; i < 2 * x + 2; i++) {\n\t\t\tfor (var j = 2 * y; j < 2 * y + 2; j++) {\n\n\t\t\t\tvar coords = new Point(i, j);\n\t\t\t\tcoords.z = z + 1;\n\n\t\t\t\tvar key = this._tileCoordsToKey(coords),\n\t\t\t\t tile = this._tiles[key];\n\n\t\t\t\tif (tile && tile.active) {\n\t\t\t\t\ttile.retain = true;\n\t\t\t\t\tcontinue;\n\n\t\t\t\t} else if (tile && tile.loaded) {\n\t\t\t\t\ttile.retain = true;\n\t\t\t\t}\n\n\t\t\t\tif (z + 1 < maxZoom) {\n\t\t\t\t\tthis._retainChildren(i, j, z + 1, maxZoom);\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t},\n\n\t_resetView: function (e) {\n\t\tvar animating = e && (e.pinch || e.flyTo);\n\t\tthis._setView(this._map.getCenter(), this._map.getZoom(), animating, animating);\n\t},\n\n\t_animateZoom: function (e) {\n\t\tthis._setView(e.center, e.zoom, true, e.noUpdate);\n\t},\n\n\t_clampZoom: function (zoom) {\n\t\tvar options = this.options;\n\n\t\tif (undefined !== options.minNativeZoom && zoom < options.minNativeZoom) {\n\t\t\treturn options.minNativeZoom;\n\t\t}\n\n\t\tif (undefined !== options.maxNativeZoom && options.maxNativeZoom < zoom) {\n\t\t\treturn options.maxNativeZoom;\n\t\t}\n\n\t\treturn zoom;\n\t},\n\n\t_setView: function (center, zoom, noPrune, noUpdate) {\n\t\tvar tileZoom = Math.round(zoom);\n\t\tif ((this.options.maxZoom !== undefined && tileZoom > this.options.maxZoom) ||\n\t\t (this.options.minZoom !== undefined && tileZoom < this.options.minZoom)) {\n\t\t\ttileZoom = undefined;\n\t\t} else {\n\t\t\ttileZoom = this._clampZoom(tileZoom);\n\t\t}\n\n\t\tvar tileZoomChanged = this.options.updateWhenZooming && (tileZoom !== this._tileZoom);\n\n\t\tif (!noUpdate || tileZoomChanged) {\n\n\t\t\tthis._tileZoom = tileZoom;\n\n\t\t\tif (this._abortLoading) {\n\t\t\t\tthis._abortLoading();\n\t\t\t}\n\n\t\t\tthis._updateLevels();\n\t\t\tthis._resetGrid();\n\n\t\t\tif (tileZoom !== undefined) {\n\t\t\t\tthis._update(center);\n\t\t\t}\n\n\t\t\tif (!noPrune) {\n\t\t\t\tthis._pruneTiles();\n\t\t\t}\n\n\t\t\t// Flag to prevent _updateOpacity from pruning tiles during\n\t\t\t// a zoom anim or a pinch gesture\n\t\t\tthis._noPrune = !!noPrune;\n\t\t}\n\n\t\tthis._setZoomTransforms(center, zoom);\n\t},\n\n\t_setZoomTransforms: function (center, zoom) {\n\t\tfor (var i in this._levels) {\n\t\t\tthis._setZoomTransform(this._levels[i], center, zoom);\n\t\t}\n\t},\n\n\t_setZoomTransform: function (level, center, zoom) {\n\t\tvar scale = this._map.getZoomScale(zoom, level.zoom),\n\t\t translate = level.origin.multiplyBy(scale)\n\t\t .subtract(this._map._getNewPixelOrigin(center, zoom)).round();\n\n\t\tif (Browser.any3d) {\n\t\t\tDomUtil.setTransform(level.el, translate, scale);\n\t\t} else {\n\t\t\tDomUtil.setPosition(level.el, translate);\n\t\t}\n\t},\n\n\t_resetGrid: function () {\n\t\tvar map = this._map,\n\t\t crs = map.options.crs,\n\t\t tileSize = this._tileSize = this.getTileSize(),\n\t\t tileZoom = this._tileZoom;\n\n\t\tvar bounds = this._map.getPixelWorldBounds(this._tileZoom);\n\t\tif (bounds) {\n\t\t\tthis._globalTileRange = this._pxBoundsToTileRange(bounds);\n\t\t}\n\n\t\tthis._wrapX = crs.wrapLng && !this.options.noWrap && [\n\t\t\tMath.floor(map.project([0, crs.wrapLng[0]], tileZoom).x / tileSize.x),\n\t\t\tMath.ceil(map.project([0, crs.wrapLng[1]], tileZoom).x / tileSize.y)\n\t\t];\n\t\tthis._wrapY = crs.wrapLat && !this.options.noWrap && [\n\t\t\tMath.floor(map.project([crs.wrapLat[0], 0], tileZoom).y / tileSize.x),\n\t\t\tMath.ceil(map.project([crs.wrapLat[1], 0], tileZoom).y / tileSize.y)\n\t\t];\n\t},\n\n\t_onMoveEnd: function () {\n\t\tif (!this._map || this._map._animatingZoom) { return; }\n\n\t\tthis._update();\n\t},\n\n\t_getTiledPixelBounds: function (center) {\n\t\tvar map = this._map,\n\t\t mapZoom = map._animatingZoom ? Math.max(map._animateToZoom, map.getZoom()) : map.getZoom(),\n\t\t scale = map.getZoomScale(mapZoom, this._tileZoom),\n\t\t pixelCenter = map.project(center, this._tileZoom).floor(),\n\t\t halfSize = map.getSize().divideBy(scale * 2);\n\n\t\treturn new Bounds(pixelCenter.subtract(halfSize), pixelCenter.add(halfSize));\n\t},\n\n\t// Private method to load tiles in the grid's active zoom level according to map bounds\n\t_update: function (center) {\n\t\tvar map = this._map;\n\t\tif (!map) { return; }\n\t\tvar zoom = this._clampZoom(map.getZoom());\n\n\t\tif (center === undefined) { center = map.getCenter(); }\n\t\tif (this._tileZoom === undefined) { return; }\t// if out of minzoom/maxzoom\n\n\t\tvar pixelBounds = this._getTiledPixelBounds(center),\n\t\t tileRange = this._pxBoundsToTileRange(pixelBounds),\n\t\t tileCenter = tileRange.getCenter(),\n\t\t queue = [],\n\t\t margin = this.options.keepBuffer,\n\t\t noPruneRange = new Bounds(tileRange.getBottomLeft().subtract([margin, -margin]),\n\t\t tileRange.getTopRight().add([margin, -margin]));\n\n\t\t// Sanity check: panic if the tile range contains Infinity somewhere.\n\t\tif (!(isFinite(tileRange.min.x) &&\n\t\t isFinite(tileRange.min.y) &&\n\t\t isFinite(tileRange.max.x) &&\n\t\t isFinite(tileRange.max.y))) { throw new Error('Attempted to load an infinite number of tiles'); }\n\n\t\tfor (var key in this._tiles) {\n\t\t\tvar c = this._tiles[key].coords;\n\t\t\tif (c.z !== this._tileZoom || !noPruneRange.contains(new Point(c.x, c.y))) {\n\t\t\t\tthis._tiles[key].current = false;\n\t\t\t}\n\t\t}\n\n\t\t// _update just loads more tiles. If the tile zoom level differs too much\n\t\t// from the map's, let _setView reset levels and prune old tiles.\n\t\tif (Math.abs(zoom - this._tileZoom) > 1) { this._setView(center, zoom); return; }\n\n\t\t// create a queue of coordinates to load tiles from\n\t\tfor (var j = tileRange.min.y; j <= tileRange.max.y; j++) {\n\t\t\tfor (var i = tileRange.min.x; i <= tileRange.max.x; i++) {\n\t\t\t\tvar coords = new Point(i, j);\n\t\t\t\tcoords.z = this._tileZoom;\n\n\t\t\t\tif (!this._isValidTile(coords)) { continue; }\n\n\t\t\t\tvar tile = this._tiles[this._tileCoordsToKey(coords)];\n\t\t\t\tif (tile) {\n\t\t\t\t\ttile.current = true;\n\t\t\t\t} else {\n\t\t\t\t\tqueue.push(coords);\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\t// sort tile queue to load tiles in order of their distance to center\n\t\tqueue.sort(function (a, b) {\n\t\t\treturn a.distanceTo(tileCenter) - b.distanceTo(tileCenter);\n\t\t});\n\n\t\tif (queue.length !== 0) {\n\t\t\t// if it's the first batch of tiles to load\n\t\t\tif (!this._loading) {\n\t\t\t\tthis._loading = true;\n\t\t\t\t// @event loading: Event\n\t\t\t\t// Fired when the grid layer starts loading tiles.\n\t\t\t\tthis.fire('loading');\n\t\t\t}\n\n\t\t\t// create DOM fragment to append tiles in one batch\n\t\t\tvar fragment = document.createDocumentFragment();\n\n\t\t\tfor (i = 0; i < queue.length; i++) {\n\t\t\t\tthis._addTile(queue[i], fragment);\n\t\t\t}\n\n\t\t\tthis._level.el.appendChild(fragment);\n\t\t}\n\t},\n\n\t_isValidTile: function (coords) {\n\t\tvar crs = this._map.options.crs;\n\n\t\tif (!crs.infinite) {\n\t\t\t// don't load tile if it's out of bounds and not wrapped\n\t\t\tvar bounds = this._globalTileRange;\n\t\t\tif ((!crs.wrapLng && (coords.x < bounds.min.x || coords.x > bounds.max.x)) ||\n\t\t\t (!crs.wrapLat && (coords.y < bounds.min.y || coords.y > bounds.max.y))) { return false; }\n\t\t}\n\n\t\tif (!this.options.bounds) { return true; }\n\n\t\t// don't load tile if it doesn't intersect the bounds in options\n\t\tvar tileBounds = this._tileCoordsToBounds(coords);\n\t\treturn latLngBounds(this.options.bounds).overlaps(tileBounds);\n\t},\n\n\t_keyToBounds: function (key) {\n\t\treturn this._tileCoordsToBounds(this._keyToTileCoords(key));\n\t},\n\n\t_tileCoordsToNwSe: function (coords) {\n\t\tvar map = this._map,\n\t\t tileSize = this.getTileSize(),\n\t\t nwPoint = coords.scaleBy(tileSize),\n\t\t sePoint = nwPoint.add(tileSize),\n\t\t nw = map.unproject(nwPoint, coords.z),\n\t\t se = map.unproject(sePoint, coords.z);\n\t\treturn [nw, se];\n\t},\n\n\t// converts tile coordinates to its geographical bounds\n\t_tileCoordsToBounds: function (coords) {\n\t\tvar bp = this._tileCoordsToNwSe(coords),\n\t\t bounds = new LatLngBounds(bp[0], bp[1]);\n\n\t\tif (!this.options.noWrap) {\n\t\t\tbounds = this._map.wrapLatLngBounds(bounds);\n\t\t}\n\t\treturn bounds;\n\t},\n\t// converts tile coordinates to key for the tile cache\n\t_tileCoordsToKey: function (coords) {\n\t\treturn coords.x + ':' + coords.y + ':' + coords.z;\n\t},\n\n\t// converts tile cache key to coordinates\n\t_keyToTileCoords: function (key) {\n\t\tvar k = key.split(':'),\n\t\t coords = new Point(+k[0], +k[1]);\n\t\tcoords.z = +k[2];\n\t\treturn coords;\n\t},\n\n\t_removeTile: function (key) {\n\t\tvar tile = this._tiles[key];\n\t\tif (!tile) { return; }\n\n\t\tDomUtil.remove(tile.el);\n\n\t\tdelete this._tiles[key];\n\n\t\t// @event tileunload: TileEvent\n\t\t// Fired when a tile is removed (e.g. when a tile goes off the screen).\n\t\tthis.fire('tileunload', {\n\t\t\ttile: tile.el,\n\t\t\tcoords: this._keyToTileCoords(key)\n\t\t});\n\t},\n\n\t_initTile: function (tile) {\n\t\tDomUtil.addClass(tile, 'leaflet-tile');\n\n\t\tvar tileSize = this.getTileSize();\n\t\ttile.style.width = tileSize.x + 'px';\n\t\ttile.style.height = tileSize.y + 'px';\n\n\t\ttile.onselectstart = Util.falseFn;\n\t\ttile.onmousemove = Util.falseFn;\n\n\t\t// update opacity on tiles in IE7-8 because of filter inheritance problems\n\t\tif (Browser.ielt9 && this.options.opacity < 1) {\n\t\t\tDomUtil.setOpacity(tile, this.options.opacity);\n\t\t}\n\t},\n\n\t_addTile: function (coords, container) {\n\t\tvar tilePos = this._getTilePos(coords),\n\t\t key = this._tileCoordsToKey(coords);\n\n\t\tvar tile = this.createTile(this._wrapCoords(coords), Util.bind(this._tileReady, this, coords));\n\n\t\tthis._initTile(tile);\n\n\t\t// if createTile is defined with a second argument (\"done\" callback),\n\t\t// we know that tile is async and will be ready later; otherwise\n\t\tif (this.createTile.length < 2) {\n\t\t\t// mark tile as ready, but delay one frame for opacity animation to happen\n\t\t\tUtil.requestAnimFrame(Util.bind(this._tileReady, this, coords, null, tile));\n\t\t}\n\n\t\tDomUtil.setPosition(tile, tilePos);\n\n\t\t// save tile in cache\n\t\tthis._tiles[key] = {\n\t\t\tel: tile,\n\t\t\tcoords: coords,\n\t\t\tcurrent: true\n\t\t};\n\n\t\tcontainer.appendChild(tile);\n\t\t// @event tileloadstart: TileEvent\n\t\t// Fired when a tile is requested and starts loading.\n\t\tthis.fire('tileloadstart', {\n\t\t\ttile: tile,\n\t\t\tcoords: coords\n\t\t});\n\t},\n\n\t_tileReady: function (coords, err, tile) {\n\t\tif (err) {\n\t\t\t// @event tileerror: TileErrorEvent\n\t\t\t// Fired when there is an error loading a tile.\n\t\t\tthis.fire('tileerror', {\n\t\t\t\terror: err,\n\t\t\t\ttile: tile,\n\t\t\t\tcoords: coords\n\t\t\t});\n\t\t}\n\n\t\tvar key = this._tileCoordsToKey(coords);\n\n\t\ttile = this._tiles[key];\n\t\tif (!tile) { return; }\n\n\t\ttile.loaded = +new Date();\n\t\tif (this._map._fadeAnimated) {\n\t\t\tDomUtil.setOpacity(tile.el, 0);\n\t\t\tUtil.cancelAnimFrame(this._fadeFrame);\n\t\t\tthis._fadeFrame = Util.requestAnimFrame(this._updateOpacity, this);\n\t\t} else {\n\t\t\ttile.active = true;\n\t\t\tthis._pruneTiles();\n\t\t}\n\n\t\tif (!err) {\n\t\t\tDomUtil.addClass(tile.el, 'leaflet-tile-loaded');\n\n\t\t\t// @event tileload: TileEvent\n\t\t\t// Fired when a tile loads.\n\t\t\tthis.fire('tileload', {\n\t\t\t\ttile: tile.el,\n\t\t\t\tcoords: coords\n\t\t\t});\n\t\t}\n\n\t\tif (this._noTilesToLoad()) {\n\t\t\tthis._loading = false;\n\t\t\t// @event load: Event\n\t\t\t// Fired when the grid layer loaded all visible tiles.\n\t\t\tthis.fire('load');\n\n\t\t\tif (Browser.ielt9 || !this._map._fadeAnimated) {\n\t\t\t\tUtil.requestAnimFrame(this._pruneTiles, this);\n\t\t\t} else {\n\t\t\t\t// Wait a bit more than 0.2 secs (the duration of the tile fade-in)\n\t\t\t\t// to trigger a pruning.\n\t\t\t\tsetTimeout(Util.bind(this._pruneTiles, this), 250);\n\t\t\t}\n\t\t}\n\t},\n\n\t_getTilePos: function (coords) {\n\t\treturn coords.scaleBy(this.getTileSize()).subtract(this._level.origin);\n\t},\n\n\t_wrapCoords: function (coords) {\n\t\tvar newCoords = new Point(\n\t\t\tthis._wrapX ? Util.wrapNum(coords.x, this._wrapX) : coords.x,\n\t\t\tthis._wrapY ? Util.wrapNum(coords.y, this._wrapY) : coords.y);\n\t\tnewCoords.z = coords.z;\n\t\treturn newCoords;\n\t},\n\n\t_pxBoundsToTileRange: function (bounds) {\n\t\tvar tileSize = this.getTileSize();\n\t\treturn new Bounds(\n\t\t\tbounds.min.unscaleBy(tileSize).floor(),\n\t\t\tbounds.max.unscaleBy(tileSize).ceil().subtract([1, 1]));\n\t},\n\n\t_noTilesToLoad: function () {\n\t\tfor (var key in this._tiles) {\n\t\t\tif (!this._tiles[key].loaded) { return false; }\n\t\t}\n\t\treturn true;\n\t}\n});\n\n// @factory L.gridLayer(options?: GridLayer options)\n// Creates a new instance of GridLayer with the supplied options.\nexport function gridLayer(options) {\n\treturn new GridLayer(options);\n}\n", "import {GridLayer} from './GridLayer';\r\nimport Browser from '../../core/Browser';\r\nimport * as Util from '../../core/Util';\r\nimport * as DomEvent from '../../dom/DomEvent';\r\nimport * as DomUtil from '../../dom/DomUtil';\r\n\r\n\r\n/*\r\n * @class TileLayer\r\n * @inherits GridLayer\r\n * @aka L.TileLayer\r\n * Used to load and display tile layers on the map. Note that most tile servers require attribution, which you can set under `Layer`. Extends `GridLayer`.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * L.tileLayer('https://tile.openstreetmap.org/{z}/{x}/{y}.png?{foo}', {foo: 'bar', attribution: '&copy; <a href=\"https://www.openstreetmap.org/copyright\">OpenStreetMap</a> contributors'}).addTo(map);\n * ```\r\n *\r\n * @section URL template\r\n * @example\r\n *\r\n * A string of the following form:\r\n *\r\n * ```\r\n * 'https://{s}.somedomain.com/blabla/{z}/{x}/{y}{r}.png'\r\n * ```\r\n *\r\n * `{s}` means one of the available subdomains (used sequentially to help with browser parallel requests per domain limitation; subdomain values are specified in options; `a`, `b` or `c` by default, can be omitted), `{z}` — zoom level, `{x}` and `{y}` — tile coordinates. `{r}` can be used to add \"&commat;2x\" to the URL to load retina tiles.\r\n *\r\n * You can use custom keys in the template, which will be [evaluated](#util-template) from TileLayer options, like this:\r\n *\r\n * ```\r\n * L.tileLayer('https://{s}.somedomain.com/{foo}/{z}/{x}/{y}.png', {foo: 'bar'});\r\n * ```\r\n */\r\n\r\n\r\nexport var TileLayer = GridLayer.extend({\r\n\r\n\t// @section\r\n\t// @aka TileLayer options\r\n\toptions: {\r\n\t\t// @option minZoom: Number = 0\r\n\t\t// The minimum zoom level down to which this layer will be displayed (inclusive).\r\n\t\tminZoom: 0,\r\n\r\n\t\t// @option maxZoom: Number = 18\r\n\t\t// The maximum zoom level up to which this layer will be displayed (inclusive).\r\n\t\tmaxZoom: 18,\r\n\r\n\t\t// @option subdomains: String|String[] = 'abc'\r\n\t\t// Subdomains of the tile service. Can be passed in the form of one string (where each letter is a subdomain name) or an array of strings.\r\n\t\tsubdomains: 'abc',\r\n\r\n\t\t// @option errorTileUrl: String = ''\r\n\t\t// URL to the tile image to show in place of the tile that failed to load.\r\n\t\terrorTileUrl: '',\r\n\r\n\t\t// @option zoomOffset: Number = 0\r\n\t\t// The zoom number used in tile URLs will be offset with this value.\r\n\t\tzoomOffset: 0,\r\n\r\n\t\t// @option tms: Boolean = false\r\n\t\t// If `true`, inverses Y axis numbering for tiles (turn this on for [TMS](https://en.wikipedia.org/wiki/Tile_Map_Service) services).\r\n\t\ttms: false,\r\n\r\n\t\t// @option zoomReverse: Boolean = false\r\n\t\t// If set to true, the zoom number used in tile URLs will be reversed (`maxZoom - zoom` instead of `zoom`)\r\n\t\tzoomReverse: false,\r\n\r\n\t\t// @option detectRetina: Boolean = false\r\n\t\t// If `true` and user is on a retina display, it will request four tiles of half the specified size and a bigger zoom level in place of one to utilize the high resolution.\r\n\t\tdetectRetina: false,\r\n\r\n\t\t// @option crossOrigin: Boolean|String = false\r\n\t\t// Whether the crossOrigin attribute will be added to the tiles.\r\n\t\t// If a String is provided, all tiles will have their crossOrigin attribute set to the String provided. This is needed if you want to access tile pixel data.\r\n\t\t// Refer to [CORS Settings](https://developer.mozilla.org/en-US/docs/Web/HTML/CORS_settings_attributes) for valid String values.\r\n\t\tcrossOrigin: false,\r\n\r\n\t\t// @option referrerPolicy: Boolean|String = false\r\n\t\t// Whether the referrerPolicy attribute will be added to the tiles.\r\n\t\t// If a String is provided, all tiles will have their referrerPolicy attribute set to the String provided.\r\n\t\t// This may be needed if your map's rendering context has a strict default but your tile provider expects a valid referrer\r\n\t\t// (e.g. to validate an API token).\r\n\t\t// Refer to [HTMLImageElement.referrerPolicy](https://developer.mozilla.org/en-US/docs/Web/API/HTMLImageElement/referrerPolicy) for valid String values.\r\n\t\treferrerPolicy: false\r\n\t},\r\n\r\n\tinitialize: function (url, options) {\r\n\r\n\t\tthis._url = url;\r\n\r\n\t\toptions = Util.setOptions(this, options);\r\n\r\n\t\t// detecting retina displays, adjusting tileSize and zoom levels\r\n\t\tif (options.detectRetina && Browser.retina && options.maxZoom > 0) {\r\n\r\n\t\t\toptions.tileSize = Math.floor(options.tileSize / 2);\r\n\r\n\t\t\tif (!options.zoomReverse) {\r\n\t\t\t\toptions.zoomOffset++;\r\n\t\t\t\toptions.maxZoom = Math.max(options.minZoom, options.maxZoom - 1);\r\n\t\t\t} else {\r\n\t\t\t\toptions.zoomOffset--;\r\n\t\t\t\toptions.minZoom = Math.min(options.maxZoom, options.minZoom + 1);\r\n\t\t\t}\r\n\r\n\t\t\toptions.minZoom = Math.max(0, options.minZoom);\r\n\t\t} else if (!options.zoomReverse) {\r\n\t\t\t// make sure maxZoom is gte minZoom\r\n\t\t\toptions.maxZoom = Math.max(options.minZoom, options.maxZoom);\r\n\t\t} else {\r\n\t\t\t// make sure minZoom is lte maxZoom\r\n\t\t\toptions.minZoom = Math.min(options.maxZoom, options.minZoom);\r\n\t\t}\r\n\r\n\t\tif (typeof options.subdomains === 'string') {\r\n\t\t\toptions.subdomains = options.subdomains.split('');\r\n\t\t}\r\n\r\n\t\tthis.on('tileunload', this._onTileRemove);\r\n\t},\r\n\r\n\t// @method setUrl(url: String, noRedraw?: Boolean): this\r\n\t// Updates the layer's URL template and redraws it (unless `noRedraw` is set to `true`).\r\n\t// If the URL does not change, the layer will not be redrawn unless\r\n\t// the noRedraw parameter is set to false.\r\n\tsetUrl: function (url, noRedraw) {\r\n\t\tif (this._url === url && noRedraw === undefined) {\r\n\t\t\tnoRedraw = true;\r\n\t\t}\r\n\r\n\t\tthis._url = url;\r\n\r\n\t\tif (!noRedraw) {\r\n\t\t\tthis.redraw();\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method createTile(coords: Object, done?: Function): HTMLElement\r\n\t// Called only internally, overrides GridLayer's [`createTile()`](#gridlayer-createtile)\r\n\t// to return an `<img>` HTML element with the appropriate image URL given `coords`. The `done`\r\n\t// callback is called when the tile has been loaded.\r\n\tcreateTile: function (coords, done) {\r\n\t\tvar tile = document.createElement('img');\r\n\r\n\t\tDomEvent.on(tile, 'load', Util.bind(this._tileOnLoad, this, done, tile));\r\n\t\tDomEvent.on(tile, 'error', Util.bind(this._tileOnError, this, done, tile));\r\n\r\n\t\tif (this.options.crossOrigin || this.options.crossOrigin === '') {\r\n\t\t\ttile.crossOrigin = this.options.crossOrigin === true ? '' : this.options.crossOrigin;\r\n\t\t}\r\n\r\n\t\t// for this new option we follow the documented behavior\r\n\t\t// more closely by only setting the property when string\r\n\t\tif (typeof this.options.referrerPolicy === 'string') {\r\n\t\t\ttile.referrerPolicy = this.options.referrerPolicy;\r\n\t\t}\r\n\r\n\t\t// The alt attribute is set to the empty string,\r\n\t\t// allowing screen readers to ignore the decorative image tiles.\r\n\t\t// https://www.w3.org/WAI/tutorials/images/decorative/\r\n\t\t// https://www.w3.org/TR/html-aria/#el-img-empty-alt\r\n\t\ttile.alt = '';\r\n\r\n\t\ttile.src = this.getTileUrl(coords);\r\n\r\n\t\treturn tile;\r\n\t},\r\n\r\n\t// @section Extension methods\r\n\t// @uninheritable\r\n\t// Layers extending `TileLayer` might reimplement the following method.\r\n\t// @method getTileUrl(coords: Object): String\r\n\t// Called only internally, returns the URL for a tile given its coordinates.\r\n\t// Classes extending `TileLayer` can override this function to provide custom tile URL naming schemes.\r\n\tgetTileUrl: function (coords) {\r\n\t\tvar data = {\r\n\t\t\tr: Browser.retina ? '@2x' : '',\r\n\t\t\ts: this._getSubdomain(coords),\r\n\t\t\tx: coords.x,\r\n\t\t\ty: coords.y,\r\n\t\t\tz: this._getZoomForUrl()\r\n\t\t};\r\n\t\tif (this._map && !this._map.options.crs.infinite) {\r\n\t\t\tvar invertedY = this._globalTileRange.max.y - coords.y;\r\n\t\t\tif (this.options.tms) {\r\n\t\t\t\tdata['y'] = invertedY;\r\n\t\t\t}\r\n\t\t\tdata['-y'] = invertedY;\r\n\t\t}\r\n\r\n\t\treturn Util.template(this._url, Util.extend(data, this.options));\r\n\t},\r\n\r\n\t_tileOnLoad: function (done, tile) {\r\n\t\t// For https://github.com/Leaflet/Leaflet/issues/3332\r\n\t\tif (Browser.ielt9) {\r\n\t\t\tsetTimeout(Util.bind(done, this, null, tile), 0);\r\n\t\t} else {\r\n\t\t\tdone(null, tile);\r\n\t\t}\r\n\t},\r\n\r\n\t_tileOnError: function (done, tile, e) {\r\n\t\tvar errorUrl = this.options.errorTileUrl;\r\n\t\tif (errorUrl && tile.getAttribute('src') !== errorUrl) {\r\n\t\t\ttile.src = errorUrl;\r\n\t\t}\r\n\t\tdone(e, tile);\r\n\t},\r\n\r\n\t_onTileRemove: function (e) {\r\n\t\te.tile.onload = null;\r\n\t},\r\n\r\n\t_getZoomForUrl: function () {\r\n\t\tvar zoom = this._tileZoom,\r\n\t\tmaxZoom = this.options.maxZoom,\r\n\t\tzoomReverse = this.options.zoomReverse,\r\n\t\tzoomOffset = this.options.zoomOffset;\r\n\r\n\t\tif (zoomReverse) {\r\n\t\t\tzoom = maxZoom - zoom;\r\n\t\t}\r\n\r\n\t\treturn zoom + zoomOffset;\r\n\t},\r\n\r\n\t_getSubdomain: function (tilePoint) {\r\n\t\tvar index = Math.abs(tilePoint.x + tilePoint.y) % this.options.subdomains.length;\r\n\t\treturn this.options.subdomains[index];\r\n\t},\r\n\r\n\t// stops loading all tiles in the background layer\r\n\t_abortLoading: function () {\r\n\t\tvar i, tile;\r\n\t\tfor (i in this._tiles) {\r\n\t\t\tif (this._tiles[i].coords.z !== this._tileZoom) {\r\n\t\t\t\ttile = this._tiles[i].el;\r\n\r\n\t\t\t\ttile.onload = Util.falseFn;\r\n\t\t\t\ttile.onerror = Util.falseFn;\r\n\r\n\t\t\t\tif (!tile.complete) {\r\n\t\t\t\t\ttile.src = Util.emptyImageUrl;\r\n\t\t\t\t\tvar coords = this._tiles[i].coords;\r\n\t\t\t\t\tDomUtil.remove(tile);\r\n\t\t\t\t\tdelete this._tiles[i];\r\n\t\t\t\t\t// @event tileabort: TileEvent\r\n\t\t\t\t\t// Fired when a tile was loading but is now not wanted.\r\n\t\t\t\t\tthis.fire('tileabort', {\r\n\t\t\t\t\t\ttile: tile,\r\n\t\t\t\t\t\tcoords: coords\r\n\t\t\t\t\t});\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\t}\r\n\t},\r\n\r\n\t_removeTile: function (key) {\r\n\t\tvar tile = this._tiles[key];\r\n\t\tif (!tile) { return; }\r\n\r\n\t\t// Cancels any pending http requests associated with the tile\r\n\t\ttile.el.setAttribute('src', Util.emptyImageUrl);\r\n\r\n\t\treturn GridLayer.prototype._removeTile.call(this, key);\r\n\t},\r\n\r\n\t_tileReady: function (coords, err, tile) {\r\n\t\tif (!this._map || (tile && tile.getAttribute('src') === Util.emptyImageUrl)) {\r\n\t\t\treturn;\r\n\t\t}\r\n\r\n\t\treturn GridLayer.prototype._tileReady.call(this, coords, err, tile);\r\n\t}\r\n});\r\n\r\n\r\n// @factory L.tilelayer(urlTemplate: String, options?: TileLayer options)\r\n// Instantiates a tile layer object given a `URL template` and optionally an options object.\r\n\r\nexport function tileLayer(url, options) {\r\n\treturn new TileLayer(url, options);\r\n}\r\n", "import {TileLayer} from './TileLayer';\r\nimport {extend, setOptions, getParamString} from '../../core/Util';\r\nimport Browser from '../../core/Browser';\r\nimport {EPSG4326} from '../../geo/crs/CRS.EPSG4326';\r\nimport {toBounds} from '../../geometry/Bounds';\r\n\r\n/*\r\n * @class TileLayer.WMS\r\n * @inherits TileLayer\r\n * @aka L.TileLayer.WMS\r\n * Used to display [WMS](https://en.wikipedia.org/wiki/Web_Map_Service) services as tile layers on the map. Extends `TileLayer`.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * var nexrad = L.tileLayer.wms(\"http://mesonet.agron.iastate.edu/cgi-bin/wms/nexrad/n0r.cgi\", {\r\n * \tlayers: 'nexrad-n0r-900913',\r\n * \tformat: 'image/png',\r\n * \ttransparent: true,\r\n * \tattribution: \"Weather data © 2012 IEM Nexrad\"\r\n * });\r\n * ```\r\n */\r\n\r\nexport var TileLayerWMS = TileLayer.extend({\r\n\r\n\t// @section\r\n\t// @aka TileLayer.WMS options\r\n\t// If any custom options not documented here are used, they will be sent to the\r\n\t// WMS server as extra parameters in each request URL. This can be useful for\r\n\t// [non-standard vendor WMS parameters](https://docs.geoserver.org/stable/en/user/services/wms/vendor.html).\r\n\tdefaultWmsParams: {\r\n\t\tservice: 'WMS',\r\n\t\trequest: 'GetMap',\r\n\r\n\t\t// @option layers: String = ''\r\n\t\t// **(required)** Comma-separated list of WMS layers to show.\r\n\t\tlayers: '',\r\n\r\n\t\t// @option styles: String = ''\r\n\t\t// Comma-separated list of WMS styles.\r\n\t\tstyles: '',\r\n\r\n\t\t// @option format: String = 'image/jpeg'\r\n\t\t// WMS image format (use `'image/png'` for layers with transparency).\r\n\t\tformat: 'image/jpeg',\r\n\r\n\t\t// @option transparent: Boolean = false\r\n\t\t// If `true`, the WMS service will return images with transparency.\r\n\t\ttransparent: false,\r\n\r\n\t\t// @option version: String = '1.1.1'\r\n\t\t// Version of the WMS service to use\r\n\t\tversion: '1.1.1'\r\n\t},\r\n\r\n\toptions: {\r\n\t\t// @option crs: CRS = null\r\n\t\t// Coordinate Reference System to use for the WMS requests, defaults to\r\n\t\t// map CRS. Don't change this if you're not sure what it means.\r\n\t\tcrs: null,\r\n\r\n\t\t// @option uppercase: Boolean = false\r\n\t\t// If `true`, WMS request parameter keys will be uppercase.\r\n\t\tuppercase: false\r\n\t},\r\n\r\n\tinitialize: function (url, options) {\r\n\r\n\t\tthis._url = url;\r\n\r\n\t\tvar wmsParams = extend({}, this.defaultWmsParams);\r\n\r\n\t\t// all keys that are not TileLayer options go to WMS params\r\n\t\tfor (var i in options) {\r\n\t\t\tif (!(i in this.options)) {\r\n\t\t\t\twmsParams[i] = options[i];\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\toptions = setOptions(this, options);\r\n\r\n\t\tvar realRetina = options.detectRetina && Browser.retina ? 2 : 1;\r\n\t\tvar tileSize = this.getTileSize();\r\n\t\twmsParams.width = tileSize.x * realRetina;\r\n\t\twmsParams.height = tileSize.y * realRetina;\r\n\r\n\t\tthis.wmsParams = wmsParams;\r\n\t},\r\n\r\n\tonAdd: function (map) {\r\n\r\n\t\tthis._crs = this.options.crs || map.options.crs;\r\n\t\tthis._wmsVersion = parseFloat(this.wmsParams.version);\r\n\r\n\t\tvar projectionKey = this._wmsVersion >= 1.3 ? 'crs' : 'srs';\r\n\t\tthis.wmsParams[projectionKey] = this._crs.code;\r\n\r\n\t\tTileLayer.prototype.onAdd.call(this, map);\r\n\t},\r\n\r\n\tgetTileUrl: function (coords) {\r\n\r\n\t\tvar tileBounds = this._tileCoordsToNwSe(coords),\r\n\t\t crs = this._crs,\r\n\t\t bounds = toBounds(crs.project(tileBounds[0]), crs.project(tileBounds[1])),\r\n\t\t min = bounds.min,\r\n\t\t max = bounds.max,\r\n\t\t bbox = (this._wmsVersion >= 1.3 && this._crs === EPSG4326 ?\r\n\t\t [min.y, min.x, max.y, max.x] :\r\n\t\t [min.x, min.y, max.x, max.y]).join(','),\r\n\t\t url = TileLayer.prototype.getTileUrl.call(this, coords);\r\n\t\treturn url +\r\n\t\t\tgetParamString(this.wmsParams, url, this.options.uppercase) +\r\n\t\t\t(this.options.uppercase ? '&BBOX=' : '&bbox=') + bbox;\r\n\t},\r\n\r\n\t// @method setParams(params: Object, noRedraw?: Boolean): this\r\n\t// Merges an object with the new parameters and re-requests tiles on the current screen (unless `noRedraw` was set to true).\r\n\tsetParams: function (params, noRedraw) {\r\n\r\n\t\textend(this.wmsParams, params);\r\n\r\n\t\tif (!noRedraw) {\r\n\t\t\tthis.redraw();\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t}\r\n});\r\n\r\n\r\n// @factory L.tileLayer.wms(baseUrl: String, options: TileLayer.WMS options)\r\n// Instantiates a WMS tile layer object given a base URL of the WMS service and a WMS parameters/options object.\r\nexport function tileLayerWMS(url, options) {\r\n\treturn new TileLayerWMS(url, options);\r\n}\r\n", "export {GridLayer, gridLayer} from './GridLayer';\nimport {TileLayer, tileLayer} from './TileLayer';\nimport {TileLayerWMS, tileLayerWMS} from './TileLayer.WMS';\nTileLayer.WMS = TileLayerWMS;\ntileLayer.wms = tileLayerWMS;\nexport {TileLayer, tileLayer};\n", "import {Layer} from '../Layer';\nimport * as DomUtil from '../../dom/DomUtil';\nimport * as Util from '../../core/Util';\nimport Browser from '../../core/Browser';\nimport {Bounds} from '../../geometry/Bounds';\n\n\n\n/*\n * @class Renderer\n * @inherits Layer\n * @aka L.Renderer\n *\n * Base class for vector renderer implementations (`SVG`, `Canvas`). Handles the\n * DOM container of the renderer, its bounds, and its zoom animation.\n *\n * A `Renderer` works as an implicit layer group for all `Path`s - the renderer\n * itself can be added or removed to the map. All paths use a renderer, which can\n * be implicit (the map will decide the type of renderer and use it automatically)\n * or explicit (using the [`renderer`](#path-renderer) option of the path).\n *\n * Do not use this class directly, use `SVG` and `Canvas` instead.\n *\n * @event update: Event\n * Fired when the renderer updates its bounds, center and zoom, for example when\n * its map has moved\n */\n\nexport var Renderer = Layer.extend({\n\n\t// @section\n\t// @aka Renderer options\n\toptions: {\n\t\t// @option padding: Number = 0.1\n\t\t// How much to extend the clip area around the map view (relative to its size)\n\t\t// e.g. 0.1 would be 10% of map view in each direction\n\t\tpadding: 0.1\n\t},\n\n\tinitialize: function (options) {\n\t\tUtil.setOptions(this, options);\n\t\tUtil.stamp(this);\n\t\tthis._layers = this._layers || {};\n\t},\n\n\tonAdd: function () {\n\t\tif (!this._container) {\n\t\t\tthis._initContainer(); // defined by renderer implementations\n\n\t\t\t// always keep transform-origin as 0 0\n\t\t\tDomUtil.addClass(this._container, 'leaflet-zoom-animated');\n\t\t}\n\n\t\tthis.getPane().appendChild(this._container);\n\t\tthis._update();\n\t\tthis.on('update', this._updatePaths, this);\n\t},\n\n\tonRemove: function () {\n\t\tthis.off('update', this._updatePaths, this);\n\t\tthis._destroyContainer();\n\t},\n\n\tgetEvents: function () {\n\t\tvar events = {\n\t\t\tviewreset: this._reset,\n\t\t\tzoom: this._onZoom,\n\t\t\tmoveend: this._update,\n\t\t\tzoomend: this._onZoomEnd\n\t\t};\n\t\tif (this._zoomAnimated) {\n\t\t\tevents.zoomanim = this._onAnimZoom;\n\t\t}\n\t\treturn events;\n\t},\n\n\t_onAnimZoom: function (ev) {\n\t\tthis._updateTransform(ev.center, ev.zoom);\n\t},\n\n\t_onZoom: function () {\n\t\tthis._updateTransform(this._map.getCenter(), this._map.getZoom());\n\t},\n\n\t_updateTransform: function (center, zoom) {\n\t\tvar scale = this._map.getZoomScale(zoom, this._zoom),\n\t\t viewHalf = this._map.getSize().multiplyBy(0.5 + this.options.padding),\n\t\t currentCenterPoint = this._map.project(this._center, zoom),\n\n\t\t topLeftOffset = viewHalf.multiplyBy(-scale).add(currentCenterPoint)\n\t\t\t\t .subtract(this._map._getNewPixelOrigin(center, zoom));\n\n\t\tif (Browser.any3d) {\n\t\t\tDomUtil.setTransform(this._container, topLeftOffset, scale);\n\t\t} else {\n\t\t\tDomUtil.setPosition(this._container, topLeftOffset);\n\t\t}\n\t},\n\n\t_reset: function () {\n\t\tthis._update();\n\t\tthis._updateTransform(this._center, this._zoom);\n\n\t\tfor (var id in this._layers) {\n\t\t\tthis._layers[id]._reset();\n\t\t}\n\t},\n\n\t_onZoomEnd: function () {\n\t\tfor (var id in this._layers) {\n\t\t\tthis._layers[id]._project();\n\t\t}\n\t},\n\n\t_updatePaths: function () {\n\t\tfor (var id in this._layers) {\n\t\t\tthis._layers[id]._update();\n\t\t}\n\t},\n\n\t_update: function () {\n\t\t// Update pixel bounds of renderer container (for positioning/sizing/clipping later)\n\t\t// Subclasses are responsible of firing the 'update' event.\n\t\tvar p = this.options.padding,\n\t\t size = this._map.getSize(),\n\t\t min = this._map.containerPointToLayerPoint(size.multiplyBy(-p)).round();\n\n\t\tthis._bounds = new Bounds(min, min.add(size.multiplyBy(1 + p * 2)).round());\n\n\t\tthis._center = this._map.getCenter();\n\t\tthis._zoom = this._map.getZoom();\n\t}\n});\n", "import {Renderer} from './Renderer';\nimport * as DomUtil from '../../dom/DomUtil';\nimport * as DomEvent from '../../dom/DomEvent';\nimport Browser from '../../core/Browser';\nimport * as Util from '../../core/Util';\nimport {Bounds} from '../../geometry/Bounds';\n\n/*\n * @class Canvas\n * @inherits Renderer\n * @aka L.Canvas\n *\n * Allows vector layers to be displayed with [`<canvas>`](https://developer.mozilla.org/docs/Web/API/Canvas_API).\n * Inherits `Renderer`.\n *\n * Due to [technical limitations](https://caniuse.com/canvas), Canvas is not\n * available in all web browsers, notably IE8, and overlapping geometries might\n * not display properly in some edge cases.\n *\n * @example\n *\n * Use Canvas by default for all paths in the map:\n *\n * ```js\n * var map = L.map('map', {\n * \trenderer: L.canvas()\n * });\n * ```\n *\n * Use a Canvas renderer with extra padding for specific vector geometries:\n *\n * ```js\n * var map = L.map('map');\n * var myRenderer = L.canvas({ padding: 0.5 });\n * var line = L.polyline( coordinates, { renderer: myRenderer } );\n * var circle = L.circle( center, { renderer: myRenderer } );\n * ```\n */\n\nexport var Canvas = Renderer.extend({\n\n\t// @section\n\t// @aka Canvas options\n\toptions: {\n\t\t// @option tolerance: Number = 0\n\t\t// How much to extend the click tolerance around a path/object on the map.\n\t\ttolerance: 0\n\t},\n\n\tgetEvents: function () {\n\t\tvar events = Renderer.prototype.getEvents.call(this);\n\t\tevents.viewprereset = this._onViewPreReset;\n\t\treturn events;\n\t},\n\n\t_onViewPreReset: function () {\n\t\t// Set a flag so that a viewprereset+moveend+viewreset only updates&redraws once\n\t\tthis._postponeUpdatePaths = true;\n\t},\n\n\tonAdd: function () {\n\t\tRenderer.prototype.onAdd.call(this);\n\n\t\t// Redraw vectors since canvas is cleared upon removal,\n\t\t// in case of removing the renderer itself from the map.\n\t\tthis._draw();\n\t},\n\n\t_initContainer: function () {\n\t\tvar container = this._container = document.createElement('canvas');\n\n\t\tDomEvent.on(container, 'mousemove', this._onMouseMove, this);\n\t\tDomEvent.on(container, 'click dblclick mousedown mouseup contextmenu', this._onClick, this);\n\t\tDomEvent.on(container, 'mouseout', this._handleMouseOut, this);\n\t\tcontainer['_leaflet_disable_events'] = true;\n\n\t\tthis._ctx = container.getContext('2d');\n\t},\n\n\t_destroyContainer: function () {\n\t\tUtil.cancelAnimFrame(this._redrawRequest);\n\t\tdelete this._ctx;\n\t\tDomUtil.remove(this._container);\n\t\tDomEvent.off(this._container);\n\t\tdelete this._container;\n\t},\n\n\t_updatePaths: function () {\n\t\tif (this._postponeUpdatePaths) { return; }\n\n\t\tvar layer;\n\t\tthis._redrawBounds = null;\n\t\tfor (var id in this._layers) {\n\t\t\tlayer = this._layers[id];\n\t\t\tlayer._update();\n\t\t}\n\t\tthis._redraw();\n\t},\n\n\t_update: function () {\n\t\tif (this._map._animatingZoom && this._bounds) { return; }\n\n\t\tRenderer.prototype._update.call(this);\n\n\t\tvar b = this._bounds,\n\t\t container = this._container,\n\t\t size = b.getSize(),\n\t\t m = Browser.retina ? 2 : 1;\n\n\t\tDomUtil.setPosition(container, b.min);\n\n\t\t// set canvas size (also clearing it); use double size on retina\n\t\tcontainer.width = m * size.x;\n\t\tcontainer.height = m * size.y;\n\t\tcontainer.style.width = size.x + 'px';\n\t\tcontainer.style.height = size.y + 'px';\n\n\t\tif (Browser.retina) {\n\t\t\tthis._ctx.scale(2, 2);\n\t\t}\n\n\t\t// translate so we use the same path coordinates after canvas element moves\n\t\tthis._ctx.translate(-b.min.x, -b.min.y);\n\n\t\t// Tell paths to redraw themselves\n\t\tthis.fire('update');\n\t},\n\n\t_reset: function () {\n\t\tRenderer.prototype._reset.call(this);\n\n\t\tif (this._postponeUpdatePaths) {\n\t\t\tthis._postponeUpdatePaths = false;\n\t\t\tthis._updatePaths();\n\t\t}\n\t},\n\n\t_initPath: function (layer) {\n\t\tthis._updateDashArray(layer);\n\t\tthis._layers[Util.stamp(layer)] = layer;\n\n\t\tvar order = layer._order = {\n\t\t\tlayer: layer,\n\t\t\tprev: this._drawLast,\n\t\t\tnext: null\n\t\t};\n\t\tif (this._drawLast) { this._drawLast.next = order; }\n\t\tthis._drawLast = order;\n\t\tthis._drawFirst = this._drawFirst || this._drawLast;\n\t},\n\n\t_addPath: function (layer) {\n\t\tthis._requestRedraw(layer);\n\t},\n\n\t_removePath: function (layer) {\n\t\tvar order = layer._order;\n\t\tvar next = order.next;\n\t\tvar prev = order.prev;\n\n\t\tif (next) {\n\t\t\tnext.prev = prev;\n\t\t} else {\n\t\t\tthis._drawLast = prev;\n\t\t}\n\t\tif (prev) {\n\t\t\tprev.next = next;\n\t\t} else {\n\t\t\tthis._drawFirst = next;\n\t\t}\n\n\t\tdelete layer._order;\n\n\t\tdelete this._layers[Util.stamp(layer)];\n\n\t\tthis._requestRedraw(layer);\n\t},\n\n\t_updatePath: function (layer) {\n\t\t// Redraw the union of the layer's old pixel\n\t\t// bounds and the new pixel bounds.\n\t\tthis._extendRedrawBounds(layer);\n\t\tlayer._project();\n\t\tlayer._update();\n\t\t// The redraw will extend the redraw bounds\n\t\t// with the new pixel bounds.\n\t\tthis._requestRedraw(layer);\n\t},\n\n\t_updateStyle: function (layer) {\n\t\tthis._updateDashArray(layer);\n\t\tthis._requestRedraw(layer);\n\t},\n\n\t_updateDashArray: function (layer) {\n\t\tif (typeof layer.options.dashArray === 'string') {\n\t\t\tvar parts = layer.options.dashArray.split(/[, ]+/),\n\t\t\t dashArray = [],\n\t\t\t dashValue,\n\t\t\t i;\n\t\t\tfor (i = 0; i < parts.length; i++) {\n\t\t\t\tdashValue = Number(parts[i]);\n\t\t\t\t// Ignore dash array containing invalid lengths\n\t\t\t\tif (isNaN(dashValue)) { return; }\n\t\t\t\tdashArray.push(dashValue);\n\t\t\t}\n\t\t\tlayer.options._dashArray = dashArray;\n\t\t} else {\n\t\t\tlayer.options._dashArray = layer.options.dashArray;\n\t\t}\n\t},\n\n\t_requestRedraw: function (layer) {\n\t\tif (!this._map) { return; }\n\n\t\tthis._extendRedrawBounds(layer);\n\t\tthis._redrawRequest = this._redrawRequest || Util.requestAnimFrame(this._redraw, this);\n\t},\n\n\t_extendRedrawBounds: function (layer) {\n\t\tif (layer._pxBounds) {\n\t\t\tvar padding = (layer.options.weight || 0) + 1;\n\t\t\tthis._redrawBounds = this._redrawBounds || new Bounds();\n\t\t\tthis._redrawBounds.extend(layer._pxBounds.min.subtract([padding, padding]));\n\t\t\tthis._redrawBounds.extend(layer._pxBounds.max.add([padding, padding]));\n\t\t}\n\t},\n\n\t_redraw: function () {\n\t\tthis._redrawRequest = null;\n\n\t\tif (this._redrawBounds) {\n\t\t\tthis._redrawBounds.min._floor();\n\t\t\tthis._redrawBounds.max._ceil();\n\t\t}\n\n\t\tthis._clear(); // clear layers in redraw bounds\n\t\tthis._draw(); // draw layers\n\n\t\tthis._redrawBounds = null;\n\t},\n\n\t_clear: function () {\n\t\tvar bounds = this._redrawBounds;\n\t\tif (bounds) {\n\t\t\tvar size = bounds.getSize();\n\t\t\tthis._ctx.clearRect(bounds.min.x, bounds.min.y, size.x, size.y);\n\t\t} else {\n\t\t\tthis._ctx.save();\n\t\t\tthis._ctx.setTransform(1, 0, 0, 1, 0, 0);\n\t\t\tthis._ctx.clearRect(0, 0, this._container.width, this._container.height);\n\t\t\tthis._ctx.restore();\n\t\t}\n\t},\n\n\t_draw: function () {\n\t\tvar layer, bounds = this._redrawBounds;\n\t\tthis._ctx.save();\n\t\tif (bounds) {\n\t\t\tvar size = bounds.getSize();\n\t\t\tthis._ctx.beginPath();\n\t\t\tthis._ctx.rect(bounds.min.x, bounds.min.y, size.x, size.y);\n\t\t\tthis._ctx.clip();\n\t\t}\n\n\t\tthis._drawing = true;\n\n\t\tfor (var order = this._drawFirst; order; order = order.next) {\n\t\t\tlayer = order.layer;\n\t\t\tif (!bounds || (layer._pxBounds && layer._pxBounds.intersects(bounds))) {\n\t\t\t\tlayer._updatePath();\n\t\t\t}\n\t\t}\n\n\t\tthis._drawing = false;\n\n\t\tthis._ctx.restore(); // Restore state before clipping.\n\t},\n\n\t_updatePoly: function (layer, closed) {\n\t\tif (!this._drawing) { return; }\n\n\t\tvar i, j, len2, p,\n\t\t parts = layer._parts,\n\t\t len = parts.length,\n\t\t ctx = this._ctx;\n\n\t\tif (!len) { return; }\n\n\t\tctx.beginPath();\n\n\t\tfor (i = 0; i < len; i++) {\n\t\t\tfor (j = 0, len2 = parts[i].length; j < len2; j++) {\n\t\t\t\tp = parts[i][j];\n\t\t\t\tctx[j ? 'lineTo' : 'moveTo'](p.x, p.y);\n\t\t\t}\n\t\t\tif (closed) {\n\t\t\t\tctx.closePath();\n\t\t\t}\n\t\t}\n\n\t\tthis._fillStroke(ctx, layer);\n\n\t\t// TODO optimization: 1 fill/stroke for all features with equal style instead of 1 for each feature\n\t},\n\n\t_updateCircle: function (layer) {\n\n\t\tif (!this._drawing || layer._empty()) { return; }\n\n\t\tvar p = layer._point,\n\t\t ctx = this._ctx,\n\t\t r = Math.max(Math.round(layer._radius), 1),\n\t\t s = (Math.max(Math.round(layer._radiusY), 1) || r) / r;\n\n\t\tif (s !== 1) {\n\t\t\tctx.save();\n\t\t\tctx.scale(1, s);\n\t\t}\n\n\t\tctx.beginPath();\n\t\tctx.arc(p.x, p.y / s, r, 0, Math.PI * 2, false);\n\n\t\tif (s !== 1) {\n\t\t\tctx.restore();\n\t\t}\n\n\t\tthis._fillStroke(ctx, layer);\n\t},\n\n\t_fillStroke: function (ctx, layer) {\n\t\tvar options = layer.options;\n\n\t\tif (options.fill) {\n\t\t\tctx.globalAlpha = options.fillOpacity;\n\t\t\tctx.fillStyle = options.fillColor || options.color;\n\t\t\tctx.fill(options.fillRule || 'evenodd');\n\t\t}\n\n\t\tif (options.stroke && options.weight !== 0) {\n\t\t\tif (ctx.setLineDash) {\n\t\t\t\tctx.setLineDash(layer.options && layer.options._dashArray || []);\n\t\t\t}\n\t\t\tctx.globalAlpha = options.opacity;\n\t\t\tctx.lineWidth = options.weight;\n\t\t\tctx.strokeStyle = options.color;\n\t\t\tctx.lineCap = options.lineCap;\n\t\t\tctx.lineJoin = options.lineJoin;\n\t\t\tctx.stroke();\n\t\t}\n\t},\n\n\t// Canvas obviously doesn't have mouse events for individual drawn objects,\n\t// so we emulate that by calculating what's under the mouse on mousemove/click manually\n\n\t_onClick: function (e) {\n\t\tvar point = this._map.mouseEventToLayerPoint(e), layer, clickedLayer;\n\n\t\tfor (var order = this._drawFirst; order; order = order.next) {\n\t\t\tlayer = order.layer;\n\t\t\tif (layer.options.interactive && layer._containsPoint(point)) {\n\t\t\t\tif (!(e.type === 'click' || e.type === 'preclick') || !this._map._draggableMoved(layer)) {\n\t\t\t\t\tclickedLayer = layer;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t\tthis._fireEvent(clickedLayer ? [clickedLayer] : false, e);\n\t},\n\n\t_onMouseMove: function (e) {\n\t\tif (!this._map || this._map.dragging.moving() || this._map._animatingZoom) { return; }\n\n\t\tvar point = this._map.mouseEventToLayerPoint(e);\n\t\tthis._handleMouseHover(e, point);\n\t},\n\n\n\t_handleMouseOut: function (e) {\n\t\tvar layer = this._hoveredLayer;\n\t\tif (layer) {\n\t\t\t// if we're leaving the layer, fire mouseout\n\t\t\tDomUtil.removeClass(this._container, 'leaflet-interactive');\n\t\t\tthis._fireEvent([layer], e, 'mouseout');\n\t\t\tthis._hoveredLayer = null;\n\t\t\tthis._mouseHoverThrottled = false;\n\t\t}\n\t},\n\n\t_handleMouseHover: function (e, point) {\n\t\tif (this._mouseHoverThrottled) {\n\t\t\treturn;\n\t\t}\n\n\t\tvar layer, candidateHoveredLayer;\n\n\t\tfor (var order = this._drawFirst; order; order = order.next) {\n\t\t\tlayer = order.layer;\n\t\t\tif (layer.options.interactive && layer._containsPoint(point)) {\n\t\t\t\tcandidateHoveredLayer = layer;\n\t\t\t}\n\t\t}\n\n\t\tif (candidateHoveredLayer !== this._hoveredLayer) {\n\t\t\tthis._handleMouseOut(e);\n\n\t\t\tif (candidateHoveredLayer) {\n\t\t\t\tDomUtil.addClass(this._container, 'leaflet-interactive'); // change cursor\n\t\t\t\tthis._fireEvent([candidateHoveredLayer], e, 'mouseover');\n\t\t\t\tthis._hoveredLayer = candidateHoveredLayer;\n\t\t\t}\n\t\t}\n\n\t\tthis._fireEvent(this._hoveredLayer ? [this._hoveredLayer] : false, e);\n\n\t\tthis._mouseHoverThrottled = true;\n\t\tsetTimeout(Util.bind(function () {\n\t\t\tthis._mouseHoverThrottled = false;\n\t\t}, this), 32);\n\t},\n\n\t_fireEvent: function (layers, e, type) {\n\t\tthis._map._fireDOMEvent(e, type || e.type, layers);\n\t},\n\n\t_bringToFront: function (layer) {\n\t\tvar order = layer._order;\n\n\t\tif (!order) { return; }\n\n\t\tvar next = order.next;\n\t\tvar prev = order.prev;\n\n\t\tif (next) {\n\t\t\tnext.prev = prev;\n\t\t} else {\n\t\t\t// Already last\n\t\t\treturn;\n\t\t}\n\t\tif (prev) {\n\t\t\tprev.next = next;\n\t\t} else if (next) {\n\t\t\t// Update first entry unless this is the\n\t\t\t// single entry\n\t\t\tthis._drawFirst = next;\n\t\t}\n\n\t\torder.prev = this._drawLast;\n\t\tthis._drawLast.next = order;\n\n\t\torder.next = null;\n\t\tthis._drawLast = order;\n\n\t\tthis._requestRedraw(layer);\n\t},\n\n\t_bringToBack: function (layer) {\n\t\tvar order = layer._order;\n\n\t\tif (!order) { return; }\n\n\t\tvar next = order.next;\n\t\tvar prev = order.prev;\n\n\t\tif (prev) {\n\t\t\tprev.next = next;\n\t\t} else {\n\t\t\t// Already first\n\t\t\treturn;\n\t\t}\n\t\tif (next) {\n\t\t\tnext.prev = prev;\n\t\t} else if (prev) {\n\t\t\t// Update last entry unless this is the\n\t\t\t// single entry\n\t\t\tthis._drawLast = prev;\n\t\t}\n\n\t\torder.prev = null;\n\n\t\torder.next = this._drawFirst;\n\t\tthis._drawFirst.prev = order;\n\t\tthis._drawFirst = order;\n\n\t\tthis._requestRedraw(layer);\n\t}\n});\n\n// @factory L.canvas(options?: Renderer options)\n// Creates a Canvas renderer with the given options.\nexport function canvas(options) {\n\treturn Browser.canvas ? new Canvas(options) : null;\n}\n", "import * as DomUtil from '../../dom/DomUtil';\nimport * as Util from '../../core/Util';\nimport {Renderer} from './Renderer';\n\n/*\n * Thanks to Dmitry Baranovsky and his Raphael library for inspiration!\n */\n\n\nexport var vmlCreate = (function () {\n\ttry {\n\t\tdocument.namespaces.add('lvml', 'urn:schemas-microsoft-com:vml');\n\t\treturn function (name) {\n\t\t\treturn document.createElement('<lvml:' + name + ' class=\"lvml\">');\n\t\t};\n\t} catch (e) {\n\t\t// Do not return fn from catch block so `e` can be garbage collected\n\t\t// See https://github.com/Leaflet/Leaflet/pull/7279\n\t}\n\treturn function (name) {\n\t\treturn document.createElement('<' + name + ' xmlns=\"urn:schemas-microsoft.com:vml\" class=\"lvml\">');\n\t};\n})();\n\n\n/*\n * @class SVG\n *\n *\n * VML was deprecated in 2012, which means VML functionality exists only for backwards compatibility\n * with old versions of Internet Explorer.\n */\n\n// mixin to redefine some SVG methods to handle VML syntax which is similar but with some differences\nexport var vmlMixin = {\n\n\t_initContainer: function () {\n\t\tthis._container = DomUtil.create('div', 'leaflet-vml-container');\n\t},\n\n\t_update: function () {\n\t\tif (this._map._animatingZoom) { return; }\n\t\tRenderer.prototype._update.call(this);\n\t\tthis.fire('update');\n\t},\n\n\t_initPath: function (layer) {\n\t\tvar container = layer._container = vmlCreate('shape');\n\n\t\tDomUtil.addClass(container, 'leaflet-vml-shape ' + (this.options.className || ''));\n\n\t\tcontainer.coordsize = '1 1';\n\n\t\tlayer._path = vmlCreate('path');\n\t\tcontainer.appendChild(layer._path);\n\n\t\tthis._updateStyle(layer);\n\t\tthis._layers[Util.stamp(layer)] = layer;\n\t},\n\n\t_addPath: function (layer) {\n\t\tvar container = layer._container;\n\t\tthis._container.appendChild(container);\n\n\t\tif (layer.options.interactive) {\n\t\t\tlayer.addInteractiveTarget(container);\n\t\t}\n\t},\n\n\t_removePath: function (layer) {\n\t\tvar container = layer._container;\n\t\tDomUtil.remove(container);\n\t\tlayer.removeInteractiveTarget(container);\n\t\tdelete this._layers[Util.stamp(layer)];\n\t},\n\n\t_updateStyle: function (layer) {\n\t\tvar stroke = layer._stroke,\n\t\t fill = layer._fill,\n\t\t options = layer.options,\n\t\t container = layer._container;\n\n\t\tcontainer.stroked = !!options.stroke;\n\t\tcontainer.filled = !!options.fill;\n\n\t\tif (options.stroke) {\n\t\t\tif (!stroke) {\n\t\t\t\tstroke = layer._stroke = vmlCreate('stroke');\n\t\t\t}\n\t\t\tcontainer.appendChild(stroke);\n\t\t\tstroke.weight = options.weight + 'px';\n\t\t\tstroke.color = options.color;\n\t\t\tstroke.opacity = options.opacity;\n\n\t\t\tif (options.dashArray) {\n\t\t\t\tstroke.dashStyle = Util.isArray(options.dashArray) ?\n\t\t\t\t options.dashArray.join(' ') :\n\t\t\t\t options.dashArray.replace(/( *, *)/g, ' ');\n\t\t\t} else {\n\t\t\t\tstroke.dashStyle = '';\n\t\t\t}\n\t\t\tstroke.endcap = options.lineCap.replace('butt', 'flat');\n\t\t\tstroke.joinstyle = options.lineJoin;\n\n\t\t} else if (stroke) {\n\t\t\tcontainer.removeChild(stroke);\n\t\t\tlayer._stroke = null;\n\t\t}\n\n\t\tif (options.fill) {\n\t\t\tif (!fill) {\n\t\t\t\tfill = layer._fill = vmlCreate('fill');\n\t\t\t}\n\t\t\tcontainer.appendChild(fill);\n\t\t\tfill.color = options.fillColor || options.color;\n\t\t\tfill.opacity = options.fillOpacity;\n\n\t\t} else if (fill) {\n\t\t\tcontainer.removeChild(fill);\n\t\t\tlayer._fill = null;\n\t\t}\n\t},\n\n\t_updateCircle: function (layer) {\n\t\tvar p = layer._point.round(),\n\t\t r = Math.round(layer._radius),\n\t\t r2 = Math.round(layer._radiusY || r);\n\n\t\tthis._setPath(layer, layer._empty() ? 'M0 0' :\n\t\t\t'AL ' + p.x + ',' + p.y + ' ' + r + ',' + r2 + ' 0,' + (65535 * 360));\n\t},\n\n\t_setPath: function (layer, path) {\n\t\tlayer._path.v = path;\n\t},\n\n\t_bringToFront: function (layer) {\n\t\tDomUtil.toFront(layer._container);\n\t},\n\n\t_bringToBack: function (layer) {\n\t\tDomUtil.toBack(layer._container);\n\t}\n};\n", "import {Renderer} from './Renderer';\nimport * as DomUtil from '../../dom/DomUtil';\nimport * as DomEvent from '../../dom/DomEvent';\nimport Browser from '../../core/Browser';\nimport {stamp} from '../../core/Util';\nimport {svgCreate, pointsToPath} from './SVG.Util';\nexport {pointsToPath};\nimport {vmlMixin, vmlCreate} from './SVG.VML';\n\nexport var create = Browser.vml ? vmlCreate : svgCreate;\n\n/*\n * @class SVG\n * @inherits Renderer\n * @aka L.SVG\n *\n * Allows vector layers to be displayed with [SVG](https://developer.mozilla.org/docs/Web/SVG).\n * Inherits `Renderer`.\n *\n * Due to [technical limitations](https://caniuse.com/svg), SVG is not\n * available in all web browsers, notably Android 2.x and 3.x.\n *\n * Although SVG is not available on IE7 and IE8, these browsers support\n * [VML](https://en.wikipedia.org/wiki/Vector_Markup_Language)\n * (a now deprecated technology), and the SVG renderer will fall back to VML in\n * this case.\n *\n * @example\n *\n * Use SVG by default for all paths in the map:\n *\n * ```js\n * var map = L.map('map', {\n * \trenderer: L.svg()\n * });\n * ```\n *\n * Use a SVG renderer with extra padding for specific vector geometries:\n *\n * ```js\n * var map = L.map('map');\n * var myRenderer = L.svg({ padding: 0.5 });\n * var line = L.polyline( coordinates, { renderer: myRenderer } );\n * var circle = L.circle( center, { renderer: myRenderer } );\n * ```\n */\n\nexport var SVG = Renderer.extend({\n\n\t_initContainer: function () {\n\t\tthis._container = create('svg');\n\n\t\t// makes it possible to click through svg root; we'll reset it back in individual paths\n\t\tthis._container.setAttribute('pointer-events', 'none');\n\n\t\tthis._rootGroup = create('g');\n\t\tthis._container.appendChild(this._rootGroup);\n\t},\n\n\t_destroyContainer: function () {\n\t\tDomUtil.remove(this._container);\n\t\tDomEvent.off(this._container);\n\t\tdelete this._container;\n\t\tdelete this._rootGroup;\n\t\tdelete this._svgSize;\n\t},\n\n\t_update: function () {\n\t\tif (this._map._animatingZoom && this._bounds) { return; }\n\n\t\tRenderer.prototype._update.call(this);\n\n\t\tvar b = this._bounds,\n\t\t size = b.getSize(),\n\t\t container = this._container;\n\n\t\t// set size of svg-container if changed\n\t\tif (!this._svgSize || !this._svgSize.equals(size)) {\n\t\t\tthis._svgSize = size;\n\t\t\tcontainer.setAttribute('width', size.x);\n\t\t\tcontainer.setAttribute('height', size.y);\n\t\t}\n\n\t\t// movement: update container viewBox so that we don't have to change coordinates of individual layers\n\t\tDomUtil.setPosition(container, b.min);\n\t\tcontainer.setAttribute('viewBox', [b.min.x, b.min.y, size.x, size.y].join(' '));\n\n\t\tthis.fire('update');\n\t},\n\n\t// methods below are called by vector layers implementations\n\n\t_initPath: function (layer) {\n\t\tvar path = layer._path = create('path');\n\n\t\t// @namespace Path\n\t\t// @option className: String = null\n\t\t// Custom class name set on an element. Only for SVG renderer.\n\t\tif (layer.options.className) {\n\t\t\tDomUtil.addClass(path, layer.options.className);\n\t\t}\n\n\t\tif (layer.options.interactive) {\n\t\t\tDomUtil.addClass(path, 'leaflet-interactive');\n\t\t}\n\n\t\tthis._updateStyle(layer);\n\t\tthis._layers[stamp(layer)] = layer;\n\t},\n\n\t_addPath: function (layer) {\n\t\tif (!this._rootGroup) { this._initContainer(); }\n\t\tthis._rootGroup.appendChild(layer._path);\n\t\tlayer.addInteractiveTarget(layer._path);\n\t},\n\n\t_removePath: function (layer) {\n\t\tDomUtil.remove(layer._path);\n\t\tlayer.removeInteractiveTarget(layer._path);\n\t\tdelete this._layers[stamp(layer)];\n\t},\n\n\t_updatePath: function (layer) {\n\t\tlayer._project();\n\t\tlayer._update();\n\t},\n\n\t_updateStyle: function (layer) {\n\t\tvar path = layer._path,\n\t\t options = layer.options;\n\n\t\tif (!path) { return; }\n\n\t\tif (options.stroke) {\n\t\t\tpath.setAttribute('stroke', options.color);\n\t\t\tpath.setAttribute('stroke-opacity', options.opacity);\n\t\t\tpath.setAttribute('stroke-width', options.weight);\n\t\t\tpath.setAttribute('stroke-linecap', options.lineCap);\n\t\t\tpath.setAttribute('stroke-linejoin', options.lineJoin);\n\n\t\t\tif (options.dashArray) {\n\t\t\t\tpath.setAttribute('stroke-dasharray', options.dashArray);\n\t\t\t} else {\n\t\t\t\tpath.removeAttribute('stroke-dasharray');\n\t\t\t}\n\n\t\t\tif (options.dashOffset) {\n\t\t\t\tpath.setAttribute('stroke-dashoffset', options.dashOffset);\n\t\t\t} else {\n\t\t\t\tpath.removeAttribute('stroke-dashoffset');\n\t\t\t}\n\t\t} else {\n\t\t\tpath.setAttribute('stroke', 'none');\n\t\t}\n\n\t\tif (options.fill) {\n\t\t\tpath.setAttribute('fill', options.fillColor || options.color);\n\t\t\tpath.setAttribute('fill-opacity', options.fillOpacity);\n\t\t\tpath.setAttribute('fill-rule', options.fillRule || 'evenodd');\n\t\t} else {\n\t\t\tpath.setAttribute('fill', 'none');\n\t\t}\n\t},\n\n\t_updatePoly: function (layer, closed) {\n\t\tthis._setPath(layer, pointsToPath(layer._parts, closed));\n\t},\n\n\t_updateCircle: function (layer) {\n\t\tvar p = layer._point,\n\t\t r = Math.max(Math.round(layer._radius), 1),\n\t\t r2 = Math.max(Math.round(layer._radiusY), 1) || r,\n\t\t arc = 'a' + r + ',' + r2 + ' 0 1,0 ';\n\n\t\t// drawing a circle with two half-arcs\n\t\tvar d = layer._empty() ? 'M0 0' :\n\t\t\t'M' + (p.x - r) + ',' + p.y +\n\t\t\tarc + (r * 2) + ',0 ' +\n\t\t\tarc + (-r * 2) + ',0 ';\n\n\t\tthis._setPath(layer, d);\n\t},\n\n\t_setPath: function (layer, path) {\n\t\tlayer._path.setAttribute('d', path);\n\t},\n\n\t// SVG does not have the concept of zIndex so we resort to changing the DOM order of elements\n\t_bringToFront: function (layer) {\n\t\tDomUtil.toFront(layer._path);\n\t},\n\n\t_bringToBack: function (layer) {\n\t\tDomUtil.toBack(layer._path);\n\t}\n});\n\nif (Browser.vml) {\n\tSVG.include(vmlMixin);\n}\n\n// @namespace SVG\n// @factory L.svg(options?: Renderer options)\n// Creates a SVG renderer with the given options.\nexport function svg(options) {\n\treturn Browser.svg || Browser.vml ? new SVG(options) : null;\n}\n", "import {Map} from '../../map/Map';\nimport {canvas} from './Canvas';\nimport {svg} from './SVG';\n\nMap.include({\n\t// @namespace Map; @method getRenderer(layer: Path): Renderer\n\t// Returns the instance of `Renderer` that should be used to render the given\n\t// `Path`. It will ensure that the `renderer` options of the map and paths\n\t// are respected, and that the renderers do exist on the map.\n\tgetRenderer: function (layer) {\n\t\t// @namespace Path; @option renderer: Renderer\n\t\t// Use this specific instance of `Renderer` for this path. Takes\n\t\t// precedence over the map's [default renderer](#map-renderer).\n\t\tvar renderer = layer.options.renderer || this._getPaneRenderer(layer.options.pane) || this.options.renderer || this._renderer;\n\n\t\tif (!renderer) {\n\t\t\trenderer = this._renderer = this._createRenderer();\n\t\t}\n\n\t\tif (!this.hasLayer(renderer)) {\n\t\t\tthis.addLayer(renderer);\n\t\t}\n\t\treturn renderer;\n\t},\n\n\t_getPaneRenderer: function (name) {\n\t\tif (name === 'overlayPane' || name === undefined) {\n\t\t\treturn false;\n\t\t}\n\n\t\tvar renderer = this._paneRenderers[name];\n\t\tif (renderer === undefined) {\n\t\t\trenderer = this._createRenderer({pane: name});\n\t\t\tthis._paneRenderers[name] = renderer;\n\t\t}\n\t\treturn renderer;\n\t},\n\n\t_createRenderer: function (options) {\n\t\t// @namespace Map; @option preferCanvas: Boolean = false\n\t\t// Whether `Path`s should be rendered on a `Canvas` renderer.\n\t\t// By default, all `Path`s are rendered in a `SVG` renderer.\n\t\treturn (this.options.preferCanvas && canvas(options)) || svg(options);\n\t}\n});\n", "import {Polygon} from './Polygon';\nimport {toLatLngBounds} from '../../geo/LatLngBounds';\n\n/*\n * L.Rectangle extends Polygon and creates a rectangle when passed a LatLngBounds object.\n */\n\n/*\n * @class Rectangle\n * @aka L.Rectangle\n * @inherits Polygon\n *\n * A class for drawing rectangle overlays on a map. Extends `Polygon`.\n *\n * @example\n *\n * ```js\n * // define rectangle geographical bounds\n * var bounds = [[54.559322, -5.767822], [56.1210604, -3.021240]];\n *\n * // create an orange rectangle\n * L.rectangle(bounds, {color: \"#ff7800\", weight: 1}).addTo(map);\n *\n * // zoom the map to the rectangle bounds\n * map.fitBounds(bounds);\n * ```\n *\n */\n\n\nexport var Rectangle = Polygon.extend({\n\tinitialize: function (latLngBounds, options) {\n\t\tPolygon.prototype.initialize.call(this, this._boundsToLatLngs(latLngBounds), options);\n\t},\n\n\t// @method setBounds(latLngBounds: LatLngBounds): this\n\t// Redraws the rectangle with the passed bounds.\n\tsetBounds: function (latLngBounds) {\n\t\treturn this.setLatLngs(this._boundsToLatLngs(latLngBounds));\n\t},\n\n\t_boundsToLatLngs: function (latLngBounds) {\n\t\tlatLngBounds = toLatLngBounds(latLngBounds);\n\t\treturn [\n\t\t\tlatLngBounds.getSouthWest(),\n\t\t\tlatLngBounds.getNorthWest(),\n\t\t\tlatLngBounds.getNorthEast(),\n\t\t\tlatLngBounds.getSouthEast()\n\t\t];\n\t}\n});\n\n\n// @factory L.rectangle(latLngBounds: LatLngBounds, options?: Polyline options)\nexport function rectangle(latLngBounds, options) {\n\treturn new Rectangle(latLngBounds, options);\n}\n", "export {Renderer} from './Renderer';\nexport {Canvas, canvas} from './Canvas';\nimport {SVG, create, pointsToPath, svg} from './SVG';\nSVG.create = create;\nSVG.pointsToPath = pointsToPath;\nexport {SVG, svg};\nimport './Renderer.getRenderer';\t// This is a bit of a hack, but needed because circular dependencies\n\nexport {Path} from './Path';\nexport {CircleMarker, circleMarker} from './CircleMarker';\nexport {Circle, circle} from './Circle';\nexport {Polyline, polyline} from './Polyline';\nexport {Polygon, polygon} from './Polygon';\nexport {Rectangle, rectangle} from './Rectangle';\n", "export {Layer} from './Layer';\nexport {LayerGroup, layerGroup} from './LayerGroup';\nexport {FeatureGroup, featureGroup} from './FeatureGroup';\nimport {GeoJSON, geoJSON, geoJson, geometryToLayer, coordsToLatLng, coordsToLatLngs, latLngToCoords, latLngsToCoords, getFeature, asFeature} from './GeoJSON';\nGeoJSON.geometryToLayer = geometryToLayer;\nGeoJSON.coordsToLatLng = coordsToLatLng;\nGeoJSON.coordsToLatLngs = coordsToLatLngs;\nGeoJSON.latLngToCoords = latLngToCoords;\nGeoJSON.latLngsToCoords = latLngsToCoords;\nGeoJSON.getFeature = getFeature;\nGeoJSON.asFeature = asFeature;\nexport {GeoJSON, geoJSON, geoJson};\n\nexport {ImageOverlay, imageOverlay} from './ImageOverlay';\nexport {VideoOverlay, videoOverlay} from './VideoOverlay';\nexport {SVGOverlay, svgOverlay} from './SVGOverlay';\n\nexport {DivOverlay} from './DivOverlay';\nexport {Popup, popup} from './Popup';\nexport {Tooltip, tooltip} from './Tooltip';\n\nexport * from './marker/index';\nexport * from './tile/index';\nexport * from './vector/index';\n", "import {Map} from '../Map';\nimport {Handler} from '../../core/Handler';\nimport * as Util from '../../core/Util';\nimport * as DomUtil from '../../dom/DomUtil';\nimport * as DomEvent from '../../dom/DomEvent';\nimport {LatLngBounds} from '../../geo/LatLngBounds';\nimport {Bounds} from '../../geometry/Bounds';\n\n/*\n * L.Handler.BoxZoom is used to add shift-drag zoom interaction to the map\n * (zoom to a selected bounding box), enabled by default.\n */\n\n// @namespace Map\n// @section Interaction Options\nMap.mergeOptions({\n\t// @option boxZoom: Boolean = true\n\t// Whether the map can be zoomed to a rectangular area specified by\n\t// dragging the mouse while pressing the shift key.\n\tboxZoom: true\n});\n\nexport var BoxZoom = Handler.extend({\n\tinitialize: function (map) {\n\t\tthis._map = map;\n\t\tthis._container = map._container;\n\t\tthis._pane = map._panes.overlayPane;\n\t\tthis._resetStateTimeout = 0;\n\t\tmap.on('unload', this._destroy, this);\n\t},\n\n\taddHooks: function () {\n\t\tDomEvent.on(this._container, 'mousedown', this._onMouseDown, this);\n\t},\n\n\tremoveHooks: function () {\n\t\tDomEvent.off(this._container, 'mousedown', this._onMouseDown, this);\n\t},\n\n\tmoved: function () {\n\t\treturn this._moved;\n\t},\n\n\t_destroy: function () {\n\t\tDomUtil.remove(this._pane);\n\t\tdelete this._pane;\n\t},\n\n\t_resetState: function () {\n\t\tthis._resetStateTimeout = 0;\n\t\tthis._moved = false;\n\t},\n\n\t_clearDeferredResetState: function () {\n\t\tif (this._resetStateTimeout !== 0) {\n\t\t\tclearTimeout(this._resetStateTimeout);\n\t\t\tthis._resetStateTimeout = 0;\n\t\t}\n\t},\n\n\t_onMouseDown: function (e) {\n\t\tif (!e.shiftKey || ((e.which !== 1) && (e.button !== 1))) { return false; }\n\n\t\t// Clear the deferred resetState if it hasn't executed yet, otherwise it\n\t\t// will interrupt the interaction and orphan a box element in the container.\n\t\tthis._clearDeferredResetState();\n\t\tthis._resetState();\n\n\t\tDomUtil.disableTextSelection();\n\t\tDomUtil.disableImageDrag();\n\n\t\tthis._startPoint = this._map.mouseEventToContainerPoint(e);\n\n\t\tDomEvent.on(document, {\n\t\t\tcontextmenu: DomEvent.stop,\n\t\t\tmousemove: this._onMouseMove,\n\t\t\tmouseup: this._onMouseUp,\n\t\t\tkeydown: this._onKeyDown\n\t\t}, this);\n\t},\n\n\t_onMouseMove: function (e) {\n\t\tif (!this._moved) {\n\t\t\tthis._moved = true;\n\n\t\t\tthis._box = DomUtil.create('div', 'leaflet-zoom-box', this._container);\n\t\t\tDomUtil.addClass(this._container, 'leaflet-crosshair');\n\n\t\t\tthis._map.fire('boxzoomstart');\n\t\t}\n\n\t\tthis._point = this._map.mouseEventToContainerPoint(e);\n\n\t\tvar bounds = new Bounds(this._point, this._startPoint),\n\t\t size = bounds.getSize();\n\n\t\tDomUtil.setPosition(this._box, bounds.min);\n\n\t\tthis._box.style.width = size.x + 'px';\n\t\tthis._box.style.height = size.y + 'px';\n\t},\n\n\t_finish: function () {\n\t\tif (this._moved) {\n\t\t\tDomUtil.remove(this._box);\n\t\t\tDomUtil.removeClass(this._container, 'leaflet-crosshair');\n\t\t}\n\n\t\tDomUtil.enableTextSelection();\n\t\tDomUtil.enableImageDrag();\n\n\t\tDomEvent.off(document, {\n\t\t\tcontextmenu: DomEvent.stop,\n\t\t\tmousemove: this._onMouseMove,\n\t\t\tmouseup: this._onMouseUp,\n\t\t\tkeydown: this._onKeyDown\n\t\t}, this);\n\t},\n\n\t_onMouseUp: function (e) {\n\t\tif ((e.which !== 1) && (e.button !== 1)) { return; }\n\n\t\tthis._finish();\n\n\t\tif (!this._moved) { return; }\n\t\t// Postpone to next JS tick so internal click event handling\n\t\t// still see it as \"moved\".\n\t\tthis._clearDeferredResetState();\n\t\tthis._resetStateTimeout = setTimeout(Util.bind(this._resetState, this), 0);\n\n\t\tvar bounds = new LatLngBounds(\n\t\t this._map.containerPointToLatLng(this._startPoint),\n\t\t this._map.containerPointToLatLng(this._point));\n\n\t\tthis._map\n\t\t\t.fitBounds(bounds)\n\t\t\t.fire('boxzoomend', {boxZoomBounds: bounds});\n\t},\n\n\t_onKeyDown: function (e) {\n\t\tif (e.keyCode === 27) {\n\t\t\tthis._finish();\n\t\t\tthis._clearDeferredResetState();\n\t\t\tthis._resetState();\n\t\t}\n\t}\n});\n\n// @section Handlers\n// @property boxZoom: Handler\n// Box (shift-drag with mouse) zoom handler.\nMap.addInitHook('addHandler', 'boxZoom', BoxZoom);\n", "import {Map} from '../Map';\nimport {Handler} from '../../core/Handler';\n\n/*\n * L.Handler.DoubleClickZoom is used to handle double-click zoom on the map, enabled by default.\n */\n\n// @namespace Map\n// @section Interaction Options\n\nMap.mergeOptions({\n\t// @option doubleClickZoom: Boolean|String = true\n\t// Whether the map can be zoomed in by double clicking on it and\n\t// zoomed out by double clicking while holding shift. If passed\n\t// `'center'`, double-click zoom will zoom to the center of the\n\t// view regardless of where the mouse was.\n\tdoubleClickZoom: true\n});\n\nexport var DoubleClickZoom = Handler.extend({\n\taddHooks: function () {\n\t\tthis._map.on('dblclick', this._onDoubleClick, this);\n\t},\n\n\tremoveHooks: function () {\n\t\tthis._map.off('dblclick', this._onDoubleClick, this);\n\t},\n\n\t_onDoubleClick: function (e) {\n\t\tvar map = this._map,\n\t\t oldZoom = map.getZoom(),\n\t\t delta = map.options.zoomDelta,\n\t\t zoom = e.originalEvent.shiftKey ? oldZoom - delta : oldZoom + delta;\n\n\t\tif (map.options.doubleClickZoom === 'center') {\n\t\t\tmap.setZoom(zoom);\n\t\t} else {\n\t\t\tmap.setZoomAround(e.containerPoint, zoom);\n\t\t}\n\t}\n});\n\n// @section Handlers\n//\n// Map properties include interaction handlers that allow you to control\n// interaction behavior in runtime, enabling or disabling certain features such\n// as dragging or touch zoom (see `Handler` methods). For example:\n//\n// ```js\n// map.doubleClickZoom.disable();\n// ```\n//\n// @property doubleClickZoom: Handler\n// Double click zoom handler.\nMap.addInitHook('addHandler', 'doubleClickZoom', DoubleClickZoom);\n", "import {Map} from '../Map';\nimport {Handler} from '../../core/Handler';\nimport {Draggable} from '../../dom/Draggable';\nimport * as Util from '../../core/Util';\nimport * as DomUtil from '../../dom/DomUtil';\nimport {toLatLngBounds as latLngBounds} from '../../geo/LatLngBounds';\nimport {toBounds} from '../../geometry/Bounds';\n\n/*\n * L.Handler.MapDrag is used to make the map draggable (with panning inertia), enabled by default.\n */\n\n// @namespace Map\n// @section Interaction Options\nMap.mergeOptions({\n\t// @option dragging: Boolean = true\n\t// Whether the map is draggable with mouse/touch or not.\n\tdragging: true,\n\n\t// @section Panning Inertia Options\n\t// @option inertia: Boolean = *\n\t// If enabled, panning of the map will have an inertia effect where\n\t// the map builds momentum while dragging and continues moving in\n\t// the same direction for some time. Feels especially nice on touch\n\t// devices. Enabled by default.\n\tinertia: true,\n\n\t// @option inertiaDeceleration: Number = 3000\n\t// The rate with which the inertial movement slows down, in pixels/second².\n\tinertiaDeceleration: 3400, // px/s^2\n\n\t// @option inertiaMaxSpeed: Number = Infinity\n\t// Max speed of the inertial movement, in pixels/second.\n\tinertiaMaxSpeed: Infinity, // px/s\n\n\t// @option easeLinearity: Number = 0.2\n\teaseLinearity: 0.2,\n\n\t// TODO refactor, move to CRS\n\t// @option worldCopyJump: Boolean = false\n\t// With this option enabled, the map tracks when you pan to another \"copy\"\n\t// of the world and seamlessly jumps to the original one so that all overlays\n\t// like markers and vector layers are still visible.\n\tworldCopyJump: false,\n\n\t// @option maxBoundsViscosity: Number = 0.0\n\t// If `maxBounds` is set, this option will control how solid the bounds\n\t// are when dragging the map around. The default value of `0.0` allows the\n\t// user to drag outside the bounds at normal speed, higher values will\n\t// slow down map dragging outside bounds, and `1.0` makes the bounds fully\n\t// solid, preventing the user from dragging outside the bounds.\n\tmaxBoundsViscosity: 0.0\n});\n\nexport var Drag = Handler.extend({\n\taddHooks: function () {\n\t\tif (!this._draggable) {\n\t\t\tvar map = this._map;\n\n\t\t\tthis._draggable = new Draggable(map._mapPane, map._container);\n\n\t\t\tthis._draggable.on({\n\t\t\t\tdragstart: this._onDragStart,\n\t\t\t\tdrag: this._onDrag,\n\t\t\t\tdragend: this._onDragEnd\n\t\t\t}, this);\n\n\t\t\tthis._draggable.on('predrag', this._onPreDragLimit, this);\n\t\t\tif (map.options.worldCopyJump) {\n\t\t\t\tthis._draggable.on('predrag', this._onPreDragWrap, this);\n\t\t\t\tmap.on('zoomend', this._onZoomEnd, this);\n\n\t\t\t\tmap.whenReady(this._onZoomEnd, this);\n\t\t\t}\n\t\t}\n\t\tDomUtil.addClass(this._map._container, 'leaflet-grab leaflet-touch-drag');\n\t\tthis._draggable.enable();\n\t\tthis._positions = [];\n\t\tthis._times = [];\n\t},\n\n\tremoveHooks: function () {\n\t\tDomUtil.removeClass(this._map._container, 'leaflet-grab');\n\t\tDomUtil.removeClass(this._map._container, 'leaflet-touch-drag');\n\t\tthis._draggable.disable();\n\t},\n\n\tmoved: function () {\n\t\treturn this._draggable && this._draggable._moved;\n\t},\n\n\tmoving: function () {\n\t\treturn this._draggable && this._draggable._moving;\n\t},\n\n\t_onDragStart: function () {\n\t\tvar map = this._map;\n\n\t\tmap._stop();\n\t\tif (this._map.options.maxBounds && this._map.options.maxBoundsViscosity) {\n\t\t\tvar bounds = latLngBounds(this._map.options.maxBounds);\n\n\t\t\tthis._offsetLimit = toBounds(\n\t\t\t\tthis._map.latLngToContainerPoint(bounds.getNorthWest()).multiplyBy(-1),\n\t\t\t\tthis._map.latLngToContainerPoint(bounds.getSouthEast()).multiplyBy(-1)\n\t\t\t\t\t.add(this._map.getSize()));\n\n\t\t\tthis._viscosity = Math.min(1.0, Math.max(0.0, this._map.options.maxBoundsViscosity));\n\t\t} else {\n\t\t\tthis._offsetLimit = null;\n\t\t}\n\n\t\tmap\n\t\t .fire('movestart')\n\t\t .fire('dragstart');\n\n\t\tif (map.options.inertia) {\n\t\t\tthis._positions = [];\n\t\t\tthis._times = [];\n\t\t}\n\t},\n\n\t_onDrag: function (e) {\n\t\tif (this._map.options.inertia) {\n\t\t\tvar time = this._lastTime = +new Date(),\n\t\t\t pos = this._lastPos = this._draggable._absPos || this._draggable._newPos;\n\n\t\t\tthis._positions.push(pos);\n\t\t\tthis._times.push(time);\n\n\t\t\tthis._prunePositions(time);\n\t\t}\n\n\t\tthis._map\n\t\t .fire('move', e)\n\t\t .fire('drag', e);\n\t},\n\n\t_prunePositions: function (time) {\n\t\twhile (this._positions.length > 1 && time - this._times[0] > 50) {\n\t\t\tthis._positions.shift();\n\t\t\tthis._times.shift();\n\t\t}\n\t},\n\n\t_onZoomEnd: function () {\n\t\tvar pxCenter = this._map.getSize().divideBy(2),\n\t\t pxWorldCenter = this._map.latLngToLayerPoint([0, 0]);\n\n\t\tthis._initialWorldOffset = pxWorldCenter.subtract(pxCenter).x;\n\t\tthis._worldWidth = this._map.getPixelWorldBounds().getSize().x;\n\t},\n\n\t_viscousLimit: function (value, threshold) {\n\t\treturn value - (value - threshold) * this._viscosity;\n\t},\n\n\t_onPreDragLimit: function () {\n\t\tif (!this._viscosity || !this._offsetLimit) { return; }\n\n\t\tvar offset = this._draggable._newPos.subtract(this._draggable._startPos);\n\n\t\tvar limit = this._offsetLimit;\n\t\tif (offset.x < limit.min.x) { offset.x = this._viscousLimit(offset.x, limit.min.x); }\n\t\tif (offset.y < limit.min.y) { offset.y = this._viscousLimit(offset.y, limit.min.y); }\n\t\tif (offset.x > limit.max.x) { offset.x = this._viscousLimit(offset.x, limit.max.x); }\n\t\tif (offset.y > limit.max.y) { offset.y = this._viscousLimit(offset.y, limit.max.y); }\n\n\t\tthis._draggable._newPos = this._draggable._startPos.add(offset);\n\t},\n\n\t_onPreDragWrap: function () {\n\t\t// TODO refactor to be able to adjust map pane position after zoom\n\t\tvar worldWidth = this._worldWidth,\n\t\t halfWidth = Math.round(worldWidth / 2),\n\t\t dx = this._initialWorldOffset,\n\t\t x = this._draggable._newPos.x,\n\t\t newX1 = (x - halfWidth + dx) % worldWidth + halfWidth - dx,\n\t\t newX2 = (x + halfWidth + dx) % worldWidth - halfWidth - dx,\n\t\t newX = Math.abs(newX1 + dx) < Math.abs(newX2 + dx) ? newX1 : newX2;\n\n\t\tthis._draggable._absPos = this._draggable._newPos.clone();\n\t\tthis._draggable._newPos.x = newX;\n\t},\n\n\t_onDragEnd: function (e) {\n\t\tvar map = this._map,\n\t\t options = map.options,\n\n\t\t noInertia = !options.inertia || e.noInertia || this._times.length < 2;\n\n\t\tmap.fire('dragend', e);\n\n\t\tif (noInertia) {\n\t\t\tmap.fire('moveend');\n\n\t\t} else {\n\t\t\tthis._prunePositions(+new Date());\n\n\t\t\tvar direction = this._lastPos.subtract(this._positions[0]),\n\t\t\t duration = (this._lastTime - this._times[0]) / 1000,\n\t\t\t ease = options.easeLinearity,\n\n\t\t\t speedVector = direction.multiplyBy(ease / duration),\n\t\t\t speed = speedVector.distanceTo([0, 0]),\n\n\t\t\t limitedSpeed = Math.min(options.inertiaMaxSpeed, speed),\n\t\t\t limitedSpeedVector = speedVector.multiplyBy(limitedSpeed / speed),\n\n\t\t\t decelerationDuration = limitedSpeed / (options.inertiaDeceleration * ease),\n\t\t\t offset = limitedSpeedVector.multiplyBy(-decelerationDuration / 2).round();\n\n\t\t\tif (!offset.x && !offset.y) {\n\t\t\t\tmap.fire('moveend');\n\n\t\t\t} else {\n\t\t\t\toffset = map._limitOffset(offset, map.options.maxBounds);\n\n\t\t\t\tUtil.requestAnimFrame(function () {\n\t\t\t\t\tmap.panBy(offset, {\n\t\t\t\t\t\tduration: decelerationDuration,\n\t\t\t\t\t\teaseLinearity: ease,\n\t\t\t\t\t\tnoMoveStart: true,\n\t\t\t\t\t\tanimate: true\n\t\t\t\t\t});\n\t\t\t\t});\n\t\t\t}\n\t\t}\n\t}\n});\n\n// @section Handlers\n// @property dragging: Handler\n// Map dragging handler (by both mouse and touch).\nMap.addInitHook('addHandler', 'dragging', Drag);\n", "import {Map} from '../Map';\nimport {Handler} from '../../core/Handler';\nimport {on, off, stop} from '../../dom/DomEvent';\nimport {toPoint} from '../../geometry/Point';\n\n\n/*\n * L.Map.Keyboard is handling keyboard interaction with the map, enabled by default.\n */\n\n// @namespace Map\n// @section Keyboard Navigation Options\nMap.mergeOptions({\n\t// @option keyboard: Boolean = true\n\t// Makes the map focusable and allows users to navigate the map with keyboard\n\t// arrows and `+`/`-` keys.\n\tkeyboard: true,\n\n\t// @option keyboardPanDelta: Number = 80\n\t// Amount of pixels to pan when pressing an arrow key.\n\tkeyboardPanDelta: 80\n});\n\nexport var Keyboard = Handler.extend({\n\n\tkeyCodes: {\n\t\tleft: [37],\n\t\tright: [39],\n\t\tdown: [40],\n\t\tup: [38],\n\t\tzoomIn: [187, 107, 61, 171],\n\t\tzoomOut: [189, 109, 54, 173]\n\t},\n\n\tinitialize: function (map) {\n\t\tthis._map = map;\n\n\t\tthis._setPanDelta(map.options.keyboardPanDelta);\n\t\tthis._setZoomDelta(map.options.zoomDelta);\n\t},\n\n\taddHooks: function () {\n\t\tvar container = this._map._container;\n\n\t\t// make the container focusable by tabbing\n\t\tif (container.tabIndex <= 0) {\n\t\t\tcontainer.tabIndex = '0';\n\t\t}\n\n\t\ton(container, {\n\t\t\tfocus: this._onFocus,\n\t\t\tblur: this._onBlur,\n\t\t\tmousedown: this._onMouseDown\n\t\t}, this);\n\n\t\tthis._map.on({\n\t\t\tfocus: this._addHooks,\n\t\t\tblur: this._removeHooks\n\t\t}, this);\n\t},\n\n\tremoveHooks: function () {\n\t\tthis._removeHooks();\n\n\t\toff(this._map._container, {\n\t\t\tfocus: this._onFocus,\n\t\t\tblur: this._onBlur,\n\t\t\tmousedown: this._onMouseDown\n\t\t}, this);\n\n\t\tthis._map.off({\n\t\t\tfocus: this._addHooks,\n\t\t\tblur: this._removeHooks\n\t\t}, this);\n\t},\n\n\t_onMouseDown: function () {\n\t\tif (this._focused) { return; }\n\n\t\tvar body = document.body,\n\t\t docEl = document.documentElement,\n\t\t top = body.scrollTop || docEl.scrollTop,\n\t\t left = body.scrollLeft || docEl.scrollLeft;\n\n\t\tthis._map._container.focus();\n\n\t\twindow.scrollTo(left, top);\n\t},\n\n\t_onFocus: function () {\n\t\tthis._focused = true;\n\t\tthis._map.fire('focus');\n\t},\n\n\t_onBlur: function () {\n\t\tthis._focused = false;\n\t\tthis._map.fire('blur');\n\t},\n\n\t_setPanDelta: function (panDelta) {\n\t\tvar keys = this._panKeys = {},\n\t\t codes = this.keyCodes,\n\t\t i, len;\n\n\t\tfor (i = 0, len = codes.left.length; i < len; i++) {\n\t\t\tkeys[codes.left[i]] = [-1 * panDelta, 0];\n\t\t}\n\t\tfor (i = 0, len = codes.right.length; i < len; i++) {\n\t\t\tkeys[codes.right[i]] = [panDelta, 0];\n\t\t}\n\t\tfor (i = 0, len = codes.down.length; i < len; i++) {\n\t\t\tkeys[codes.down[i]] = [0, panDelta];\n\t\t}\n\t\tfor (i = 0, len = codes.up.length; i < len; i++) {\n\t\t\tkeys[codes.up[i]] = [0, -1 * panDelta];\n\t\t}\n\t},\n\n\t_setZoomDelta: function (zoomDelta) {\n\t\tvar keys = this._zoomKeys = {},\n\t\t codes = this.keyCodes,\n\t\t i, len;\n\n\t\tfor (i = 0, len = codes.zoomIn.length; i < len; i++) {\n\t\t\tkeys[codes.zoomIn[i]] = zoomDelta;\n\t\t}\n\t\tfor (i = 0, len = codes.zoomOut.length; i < len; i++) {\n\t\t\tkeys[codes.zoomOut[i]] = -zoomDelta;\n\t\t}\n\t},\n\n\t_addHooks: function () {\n\t\ton(document, 'keydown', this._onKeyDown, this);\n\t},\n\n\t_removeHooks: function () {\n\t\toff(document, 'keydown', this._onKeyDown, this);\n\t},\n\n\t_onKeyDown: function (e) {\n\t\tif (e.altKey || e.ctrlKey || e.metaKey) { return; }\n\n\t\tvar key = e.keyCode,\n\t\t map = this._map,\n\t\t offset;\n\n\t\tif (key in this._panKeys) {\n\t\t\tif (!map._panAnim || !map._panAnim._inProgress) {\n\t\t\t\toffset = this._panKeys[key];\n\t\t\t\tif (e.shiftKey) {\n\t\t\t\t\toffset = toPoint(offset).multiplyBy(3);\n\t\t\t\t}\n\n\t\t\t\tif (map.options.maxBounds) {\n\t\t\t\t\toffset = map._limitOffset(toPoint(offset), map.options.maxBounds);\n\t\t\t\t}\n\n\t\t\t\tif (map.options.worldCopyJump) {\n\t\t\t\t\tvar newLatLng = map.wrapLatLng(map.unproject(map.project(map.getCenter()).add(offset)));\n\t\t\t\t\tmap.panTo(newLatLng);\n\t\t\t\t} else {\n\t\t\t\t\tmap.panBy(offset);\n\t\t\t\t}\n\t\t\t}\n\t\t} else if (key in this._zoomKeys) {\n\t\t\tmap.setZoom(map.getZoom() + (e.shiftKey ? 3 : 1) * this._zoomKeys[key]);\n\n\t\t} else if (key === 27 && map._popup && map._popup.options.closeOnEscapeKey) {\n\t\t\tmap.closePopup();\n\n\t\t} else {\n\t\t\treturn;\n\t\t}\n\n\t\tstop(e);\n\t}\n});\n\n// @section Handlers\n// @section Handlers\n// @property keyboard: Handler\n// Keyboard navigation handler.\nMap.addInitHook('addHandler', 'keyboard', Keyboard);\n", "import {Map} from '../Map';\nimport {Handler} from '../../core/Handler';\nimport * as DomEvent from '../../dom/DomEvent';\nimport * as Util from '../../core/Util';\n\n/*\n * L.Handler.ScrollWheelZoom is used by L.Map to enable mouse scroll wheel zoom on the map.\n */\n\n// @namespace Map\n// @section Interaction Options\nMap.mergeOptions({\n\t// @section Mouse wheel options\n\t// @option scrollWheelZoom: Boolean|String = true\n\t// Whether the map can be zoomed by using the mouse wheel. If passed `'center'`,\n\t// it will zoom to the center of the view regardless of where the mouse was.\n\tscrollWheelZoom: true,\n\n\t// @option wheelDebounceTime: Number = 40\n\t// Limits the rate at which a wheel can fire (in milliseconds). By default\n\t// user can't zoom via wheel more often than once per 40 ms.\n\twheelDebounceTime: 40,\n\n\t// @option wheelPxPerZoomLevel: Number = 60\n\t// How many scroll pixels (as reported by [L.DomEvent.getWheelDelta](#domevent-getwheeldelta))\n\t// mean a change of one full zoom level. Smaller values will make wheel-zooming\n\t// faster (and vice versa).\n\twheelPxPerZoomLevel: 60\n});\n\nexport var ScrollWheelZoom = Handler.extend({\n\taddHooks: function () {\n\t\tDomEvent.on(this._map._container, 'wheel', this._onWheelScroll, this);\n\n\t\tthis._delta = 0;\n\t},\n\n\tremoveHooks: function () {\n\t\tDomEvent.off(this._map._container, 'wheel', this._onWheelScroll, this);\n\t},\n\n\t_onWheelScroll: function (e) {\n\t\tvar delta = DomEvent.getWheelDelta(e);\n\n\t\tvar debounce = this._map.options.wheelDebounceTime;\n\n\t\tthis._delta += delta;\n\t\tthis._lastMousePos = this._map.mouseEventToContainerPoint(e);\n\n\t\tif (!this._startTime) {\n\t\t\tthis._startTime = +new Date();\n\t\t}\n\n\t\tvar left = Math.max(debounce - (+new Date() - this._startTime), 0);\n\n\t\tclearTimeout(this._timer);\n\t\tthis._timer = setTimeout(Util.bind(this._performZoom, this), left);\n\n\t\tDomEvent.stop(e);\n\t},\n\n\t_performZoom: function () {\n\t\tvar map = this._map,\n\t\t zoom = map.getZoom(),\n\t\t snap = this._map.options.zoomSnap || 0;\n\n\t\tmap._stop(); // stop panning and fly animations if any\n\n\t\t// map the delta with a sigmoid function to -4..4 range leaning on -1..1\n\t\tvar d2 = this._delta / (this._map.options.wheelPxPerZoomLevel * 4),\n\t\t d3 = 4 * Math.log(2 / (1 + Math.exp(-Math.abs(d2)))) / Math.LN2,\n\t\t d4 = snap ? Math.ceil(d3 / snap) * snap : d3,\n\t\t delta = map._limitZoom(zoom + (this._delta > 0 ? d4 : -d4)) - zoom;\n\n\t\tthis._delta = 0;\n\t\tthis._startTime = null;\n\n\t\tif (!delta) { return; }\n\n\t\tif (map.options.scrollWheelZoom === 'center') {\n\t\t\tmap.setZoom(zoom + delta);\n\t\t} else {\n\t\t\tmap.setZoomAround(this._lastMousePos, zoom + delta);\n\t\t}\n\t}\n});\n\n// @section Handlers\n// @property scrollWheelZoom: Handler\n// Scroll wheel zoom handler.\nMap.addInitHook('addHandler', 'scrollWheelZoom', ScrollWheelZoom);\n", "import {Map} from '../Map';\nimport {Handler} from '../../core/Handler';\nimport * as DomEvent from '../../dom/DomEvent';\nimport {Point} from '../../geometry/Point';\nimport * as Util from '../../core/Util';\nimport Browser from '../../core/Browser';\n\n/*\n * L.Map.TapHold is used to simulate `contextmenu` event on long hold,\n * which otherwise is not fired by mobile Safari.\n */\n\nvar tapHoldDelay = 600;\n\n// @namespace Map\n// @section Interaction Options\nMap.mergeOptions({\n\t// @section Touch interaction options\n\t// @option tapHold: Boolean\n\t// Enables simulation of `contextmenu` event, default is `true` for mobile Safari.\n\ttapHold: Browser.touchNative && Browser.safari && Browser.mobile,\n\n\t// @option tapTolerance: Number = 15\n\t// The max number of pixels a user can shift his finger during touch\n\t// for it to be considered a valid tap.\n\ttapTolerance: 15\n});\n\nexport var TapHold = Handler.extend({\n\taddHooks: function () {\n\t\tDomEvent.on(this._map._container, 'touchstart', this._onDown, this);\n\t},\n\n\tremoveHooks: function () {\n\t\tDomEvent.off(this._map._container, 'touchstart', this._onDown, this);\n\t},\n\n\t_onDown: function (e) {\n\t\tclearTimeout(this._holdTimeout);\n\t\tif (e.touches.length !== 1) { return; }\n\n\t\tvar first = e.touches[0];\n\t\tthis._startPos = this._newPos = new Point(first.clientX, first.clientY);\n\n\t\tthis._holdTimeout = setTimeout(Util.bind(function () {\n\t\t\tthis._cancel();\n\t\t\tif (!this._isTapValid()) { return; }\n\n\t\t\t// prevent simulated mouse events https://w3c.github.io/touch-events/#mouse-events\n\t\t\tDomEvent.on(document, 'touchend', DomEvent.preventDefault);\n\t\t\tDomEvent.on(document, 'touchend touchcancel', this._cancelClickPrevent);\n\t\t\tthis._simulateEvent('contextmenu', first);\n\t\t}, this), tapHoldDelay);\n\n\t\tDomEvent.on(document, 'touchend touchcancel contextmenu', this._cancel, this);\n\t\tDomEvent.on(document, 'touchmove', this._onMove, this);\n\t},\n\n\t_cancelClickPrevent: function cancelClickPrevent() {\n\t\tDomEvent.off(document, 'touchend', DomEvent.preventDefault);\n\t\tDomEvent.off(document, 'touchend touchcancel', cancelClickPrevent);\n\t},\n\n\t_cancel: function () {\n\t\tclearTimeout(this._holdTimeout);\n\t\tDomEvent.off(document, 'touchend touchcancel contextmenu', this._cancel, this);\n\t\tDomEvent.off(document, 'touchmove', this._onMove, this);\n\t},\n\n\t_onMove: function (e) {\n\t\tvar first = e.touches[0];\n\t\tthis._newPos = new Point(first.clientX, first.clientY);\n\t},\n\n\t_isTapValid: function () {\n\t\treturn this._newPos.distanceTo(this._startPos) <= this._map.options.tapTolerance;\n\t},\n\n\t_simulateEvent: function (type, e) {\n\t\tvar simulatedEvent = new MouseEvent(type, {\n\t\t\tbubbles: true,\n\t\t\tcancelable: true,\n\t\t\tview: window,\n\t\t\t// detail: 1,\n\t\t\tscreenX: e.screenX,\n\t\t\tscreenY: e.screenY,\n\t\t\tclientX: e.clientX,\n\t\t\tclientY: e.clientY,\n\t\t\t// button: 2,\n\t\t\t// buttons: 2\n\t\t});\n\n\t\tsimulatedEvent._simulated = true;\n\n\t\te.target.dispatchEvent(simulatedEvent);\n\t}\n});\n\n// @section Handlers\n// @property tapHold: Handler\n// Long tap handler to simulate `contextmenu` event (useful in mobile Safari).\nMap.addInitHook('addHandler', 'tapHold', TapHold);\n", "import {Map} from '../Map';\nimport {Handler} from '../../core/Handler';\nimport * as DomEvent from '../../dom/DomEvent';\nimport * as Util from '../../core/Util';\nimport * as DomUtil from '../../dom/DomUtil';\nimport Browser from '../../core/Browser';\n\n/*\n * L.Handler.TouchZoom is used by L.Map to add pinch zoom on supported mobile browsers.\n */\n\n// @namespace Map\n// @section Interaction Options\nMap.mergeOptions({\n\t// @section Touch interaction options\n\t// @option touchZoom: Boolean|String = *\n\t// Whether the map can be zoomed by touch-dragging with two fingers. If\n\t// passed `'center'`, it will zoom to the center of the view regardless of\n\t// where the touch events (fingers) were. Enabled for touch-capable web\n\t// browsers.\n\ttouchZoom: Browser.touch,\n\n\t// @option bounceAtZoomLimits: Boolean = true\n\t// Set it to false if you don't want the map to zoom beyond min/max zoom\n\t// and then bounce back when pinch-zooming.\n\tbounceAtZoomLimits: true\n});\n\nexport var TouchZoom = Handler.extend({\n\taddHooks: function () {\n\t\tDomUtil.addClass(this._map._container, 'leaflet-touch-zoom');\n\t\tDomEvent.on(this._map._container, 'touchstart', this._onTouchStart, this);\n\t},\n\n\tremoveHooks: function () {\n\t\tDomUtil.removeClass(this._map._container, 'leaflet-touch-zoom');\n\t\tDomEvent.off(this._map._container, 'touchstart', this._onTouchStart, this);\n\t},\n\n\t_onTouchStart: function (e) {\n\t\tvar map = this._map;\n\t\tif (!e.touches || e.touches.length !== 2 || map._animatingZoom || this._zooming) { return; }\n\n\t\tvar p1 = map.mouseEventToContainerPoint(e.touches[0]),\n\t\t p2 = map.mouseEventToContainerPoint(e.touches[1]);\n\n\t\tthis._centerPoint = map.getSize()._divideBy(2);\n\t\tthis._startLatLng = map.containerPointToLatLng(this._centerPoint);\n\t\tif (map.options.touchZoom !== 'center') {\n\t\t\tthis._pinchStartLatLng = map.containerPointToLatLng(p1.add(p2)._divideBy(2));\n\t\t}\n\n\t\tthis._startDist = p1.distanceTo(p2);\n\t\tthis._startZoom = map.getZoom();\n\n\t\tthis._moved = false;\n\t\tthis._zooming = true;\n\n\t\tmap._stop();\n\n\t\tDomEvent.on(document, 'touchmove', this._onTouchMove, this);\n\t\tDomEvent.on(document, 'touchend touchcancel', this._onTouchEnd, this);\n\n\t\tDomEvent.preventDefault(e);\n\t},\n\n\t_onTouchMove: function (e) {\n\t\tif (!e.touches || e.touches.length !== 2 || !this._zooming) { return; }\n\n\t\tvar map = this._map,\n\t\t p1 = map.mouseEventToContainerPoint(e.touches[0]),\n\t\t p2 = map.mouseEventToContainerPoint(e.touches[1]),\n\t\t scale = p1.distanceTo(p2) / this._startDist;\n\n\t\tthis._zoom = map.getScaleZoom(scale, this._startZoom);\n\n\t\tif (!map.options.bounceAtZoomLimits && (\n\t\t\t(this._zoom < map.getMinZoom() && scale < 1) ||\n\t\t\t(this._zoom > map.getMaxZoom() && scale > 1))) {\n\t\t\tthis._zoom = map._limitZoom(this._zoom);\n\t\t}\n\n\t\tif (map.options.touchZoom === 'center') {\n\t\t\tthis._center = this._startLatLng;\n\t\t\tif (scale === 1) { return; }\n\t\t} else {\n\t\t\t// Get delta from pinch to center, so centerLatLng is delta applied to initial pinchLatLng\n\t\t\tvar delta = p1._add(p2)._divideBy(2)._subtract(this._centerPoint);\n\t\t\tif (scale === 1 && delta.x === 0 && delta.y === 0) { return; }\n\t\t\tthis._center = map.unproject(map.project(this._pinchStartLatLng, this._zoom).subtract(delta), this._zoom);\n\t\t}\n\n\t\tif (!this._moved) {\n\t\t\tmap._moveStart(true, false);\n\t\t\tthis._moved = true;\n\t\t}\n\n\t\tUtil.cancelAnimFrame(this._animRequest);\n\n\t\tvar moveFn = Util.bind(map._move, map, this._center, this._zoom, {pinch: true, round: false}, undefined);\n\t\tthis._animRequest = Util.requestAnimFrame(moveFn, this, true);\n\n\t\tDomEvent.preventDefault(e);\n\t},\n\n\t_onTouchEnd: function () {\n\t\tif (!this._moved || !this._zooming) {\n\t\t\tthis._zooming = false;\n\t\t\treturn;\n\t\t}\n\n\t\tthis._zooming = false;\n\t\tUtil.cancelAnimFrame(this._animRequest);\n\n\t\tDomEvent.off(document, 'touchmove', this._onTouchMove, this);\n\t\tDomEvent.off(document, 'touchend touchcancel', this._onTouchEnd, this);\n\n\t\t// Pinch updates GridLayers' levels only when zoomSnap is off, so zoomSnap becomes noUpdate.\n\t\tif (this._map.options.zoomAnimation) {\n\t\t\tthis._map._animateZoom(this._center, this._map._limitZoom(this._zoom), true, this._map.options.zoomSnap);\n\t\t} else {\n\t\t\tthis._map._resetView(this._center, this._map._limitZoom(this._zoom));\n\t\t}\n\t}\n});\n\n// @section Handlers\n// @property touchZoom: Handler\n// Touch zoom handler.\nMap.addInitHook('addHandler', 'touchZoom', TouchZoom);\n", "import {Map} from './Map';\nimport {BoxZoom} from './handler/Map.BoxZoom';\nMap.BoxZoom = BoxZoom;\nimport {DoubleClickZoom} from './handler/Map.DoubleClickZoom';\nMap.DoubleClickZoom = DoubleClickZoom;\nimport {Drag} from './handler/Map.Drag';\nMap.Drag = Drag;\nimport {Keyboard} from './handler/Map.Keyboard';\nMap.Keyboard = Keyboard;\nimport {ScrollWheelZoom} from './handler/Map.ScrollWheelZoom';\nMap.ScrollWheelZoom = ScrollWheelZoom;\nimport {TapHold} from './handler/Map.TapHold';\nMap.TapHold = TapHold;\nimport {TouchZoom} from './handler/Map.TouchZoom';\nMap.TouchZoom = TouchZoom;\n\nexport {Map, createMap as map} from './Map';\n", "import DeviceDetector from \"device-detector-js\";\nimport { Notifier } from \"@airbrake/browser\";\n\nwindow.deviceDetector = new DeviceDetector();\nwindow.device = window.deviceDetector.parse(navigator.userAgent);\n\nif (!window.device.bot && window.env.JEKYLL_ENV === \"production\") {\n try {\n window.airbrake = new Notifier({\n projectId: window.env.AIRBRAKE_PROJECT_ID,\n projectKey: window.env.AIRBRAKE_PROJECT_KEY,\n host: \"https://panel.sutty.nl\",\n });\n\n console.originalError = console.error;\n console.error = (...e) => {\n window.airbrake.notify(e.join(\" \"));\n return console.originalError(...e);\n };\n } catch (e) {\n console.error(e);\n }\n}\n\nimport * as Turbo from \"@hotwired/turbo\";\nTurbo.start();\n\nimport { Application } from \"@hotwired/stimulus\";\nwindow.Stimulus = Application.start();\n\nimport ContactController from \"./controllers/contact_controller\";\nimport DeviceDetectorController from \"./controllers/device_detector_controller\";\nimport DropController from \"./controllers/drop_controller\";\nimport NonGeographicalMapController from \"./controllers/non_geographical_map_controller\";\nimport LoadProfileController from \"./controllers/load_profile_controller\";\nimport LoginController from \"./controllers/login_controller\";\nimport AutofillProfileController from \"./controllers/autofill_profile_controller\";\nimport LogoutController from \"./controllers/logout_controller\";\n\nStimulus.debug = window.env.JEKYLL_ENV !== \"production\";\nStimulus.register(\"contact\", ContactController);\nStimulus.register(\"device-detector\", DeviceDetectorController);\nStimulus.register(\"drop\", DropController);\nStimulus.register(\"non-geographical-map\", NonGeographicalMapController);\nStimulus.register(\"load-profile\", LoadProfileController);\nStimulus.register(\"autofill-profile\", AutofillProfileController);\nStimulus.register(\"login\", LoginController);\nStimulus.register(\"logout\", LogoutController);\n\ndocument.addEventListener(\"turbo:load\", (event) => {\n document\n .querySelectorAll(\"a[href^='http://'],a[href^='https://'],a[href^='//']\")\n .forEach((a) => {\n a.rel = \"noopener\";\n a.target = \"_blank\";\n });\n});\n", "/**\n * @this {Promise}\n */\nfunction finallyConstructor(callback) {\n var constructor = this.constructor;\n return this.then(\n function(value) {\n // @ts-ignore\n return constructor.resolve(callback()).then(function() {\n return value;\n });\n },\n function(reason) {\n // @ts-ignore\n return constructor.resolve(callback()).then(function() {\n // @ts-ignore\n return constructor.reject(reason);\n });\n }\n );\n}\n\nexport default finallyConstructor;\n", "function allSettled(arr) {\n var P = this;\n return new P(function(resolve, reject) {\n if (!(arr && typeof arr.length !== 'undefined')) {\n return reject(\n new TypeError(\n typeof arr +\n ' ' +\n arr +\n ' is not iterable(cannot read property Symbol(Symbol.iterator))'\n )\n );\n }\n var args = Array.prototype.slice.call(arr);\n if (args.length === 0) return resolve([]);\n var remaining = args.length;\n\n function res(i, val) {\n if (val && (typeof val === 'object' || typeof val === 'function')) {\n var then = val.then;\n if (typeof then === 'function') {\n then.call(\n val,\n function(val) {\n res(i, val);\n },\n function(e) {\n args[i] = { status: 'rejected', reason: e };\n if (--remaining === 0) {\n resolve(args);\n }\n }\n );\n return;\n }\n }\n args[i] = { status: 'fulfilled', value: val };\n if (--remaining === 0) {\n resolve(args);\n }\n }\n\n for (var i = 0; i < args.length; i++) {\n res(i, args[i]);\n }\n });\n}\n\nexport default allSettled;\n", "import promiseFinally from './finally';\nimport allSettled from './allSettled';\n\n// Store setTimeout reference so promise-polyfill will be unaffected by\n// other code modifying setTimeout (like sinon.useFakeTimers())\nvar setTimeoutFunc = setTimeout;\n\nfunction isArray(x) {\n return Boolean(x && typeof x.length !== 'undefined');\n}\n\nfunction noop() {}\n\n// Polyfill for Function.prototype.bind\nfunction bind(fn, thisArg) {\n return function() {\n fn.apply(thisArg, arguments);\n };\n}\n\n/**\n * @constructor\n * @param {Function} fn\n */\nfunction Promise(fn) {\n if (!(this instanceof Promise))\n throw new TypeError('Promises must be constructed via new');\n if (typeof fn !== 'function') throw new TypeError('not a function');\n /** @type {!number} */\n this._state = 0;\n /** @type {!boolean} */\n this._handled = false;\n /** @type {Promise|undefined} */\n this._value = undefined;\n /** @type {!Array<!Function>} */\n this._deferreds = [];\n\n doResolve(fn, this);\n}\n\nfunction handle(self, deferred) {\n while (self._state === 3) {\n self = self._value;\n }\n if (self._state === 0) {\n self._deferreds.push(deferred);\n return;\n }\n self._handled = true;\n Promise._immediateFn(function() {\n var cb = self._state === 1 ? deferred.onFulfilled : deferred.onRejected;\n if (cb === null) {\n (self._state === 1 ? resolve : reject)(deferred.promise, self._value);\n return;\n }\n var ret;\n try {\n ret = cb(self._value);\n } catch (e) {\n reject(deferred.promise, e);\n return;\n }\n resolve(deferred.promise, ret);\n });\n}\n\nfunction resolve(self, newValue) {\n try {\n // Promise Resolution Procedure: https://github.com/promises-aplus/promises-spec#the-promise-resolution-procedure\n if (newValue === self)\n throw new TypeError('A promise cannot be resolved with itself.');\n if (\n newValue &&\n (typeof newValue === 'object' || typeof newValue === 'function')\n ) {\n var then = newValue.then;\n if (newValue instanceof Promise) {\n self._state = 3;\n self._value = newValue;\n finale(self);\n return;\n } else if (typeof then === 'function') {\n doResolve(bind(then, newValue), self);\n return;\n }\n }\n self._state = 1;\n self._value = newValue;\n finale(self);\n } catch (e) {\n reject(self, e);\n }\n}\n\nfunction reject(self, newValue) {\n self._state = 2;\n self._value = newValue;\n finale(self);\n}\n\nfunction finale(self) {\n if (self._state === 2 && self._deferreds.length === 0) {\n Promise._immediateFn(function() {\n if (!self._handled) {\n Promise._unhandledRejectionFn(self._value);\n }\n });\n }\n\n for (var i = 0, len = self._deferreds.length; i < len; i++) {\n handle(self, self._deferreds[i]);\n }\n self._deferreds = null;\n}\n\n/**\n * @constructor\n */\nfunction Handler(onFulfilled, onRejected, promise) {\n this.onFulfilled = typeof onFulfilled === 'function' ? onFulfilled : null;\n this.onRejected = typeof onRejected === 'function' ? onRejected : null;\n this.promise = promise;\n}\n\n/**\n * Take a potentially misbehaving resolver function and make sure\n * onFulfilled and onRejected are only called once.\n *\n * Makes no guarantees about asynchrony.\n */\nfunction doResolve(fn, self) {\n var done = false;\n try {\n fn(\n function(value) {\n if (done) return;\n done = true;\n resolve(self, value);\n },\n function(reason) {\n if (done) return;\n done = true;\n reject(self, reason);\n }\n );\n } catch (ex) {\n if (done) return;\n done = true;\n reject(self, ex);\n }\n}\n\nPromise.prototype['catch'] = function(onRejected) {\n return this.then(null, onRejected);\n};\n\nPromise.prototype.then = function(onFulfilled, onRejected) {\n // @ts-ignore\n var prom = new this.constructor(noop);\n\n handle(this, new Handler(onFulfilled, onRejected, prom));\n return prom;\n};\n\nPromise.prototype['finally'] = promiseFinally;\n\nPromise.all = function(arr) {\n return new Promise(function(resolve, reject) {\n if (!isArray(arr)) {\n return reject(new TypeError('Promise.all accepts an array'));\n }\n\n var args = Array.prototype.slice.call(arr);\n if (args.length === 0) return resolve([]);\n var remaining = args.length;\n\n function res(i, val) {\n try {\n if (val && (typeof val === 'object' || typeof val === 'function')) {\n var then = val.then;\n if (typeof then === 'function') {\n then.call(\n val,\n function(val) {\n res(i, val);\n },\n reject\n );\n return;\n }\n }\n args[i] = val;\n if (--remaining === 0) {\n resolve(args);\n }\n } catch (ex) {\n reject(ex);\n }\n }\n\n for (var i = 0; i < args.length; i++) {\n res(i, args[i]);\n }\n });\n};\n\nPromise.allSettled = allSettled;\n\nPromise.resolve = function(value) {\n if (value && typeof value === 'object' && value.constructor === Promise) {\n return value;\n }\n\n return new Promise(function(resolve) {\n resolve(value);\n });\n};\n\nPromise.reject = function(value) {\n return new Promise(function(resolve, reject) {\n reject(value);\n });\n};\n\nPromise.race = function(arr) {\n return new Promise(function(resolve, reject) {\n if (!isArray(arr)) {\n return reject(new TypeError('Promise.race accepts an array'));\n }\n\n for (var i = 0, len = arr.length; i < len; i++) {\n Promise.resolve(arr[i]).then(resolve, reject);\n }\n });\n};\n\n// Use polyfill for setImmediate for performance gains\nPromise._immediateFn =\n // @ts-ignore\n (typeof setImmediate === 'function' &&\n function(fn) {\n // @ts-ignore\n setImmediate(fn);\n }) ||\n function(fn) {\n setTimeoutFunc(fn, 0);\n };\n\nPromise._unhandledRejectionFn = function _unhandledRejectionFn(err) {\n if (typeof console !== 'undefined' && console) {\n console.warn('Possible Unhandled Promise Rejection:', err); // eslint-disable-line no-console\n }\n};\n\nexport default Promise;\n", null, null, null, null, null, null, null, null, null, null, null, null, null, null, null, null, null, null, null, null, null, null, null, null, null, "/*\nTurbo 7.2.4\nCopyright \u00A9 2022 37signals LLC\n */\n(function () {\n if (window.Reflect === undefined ||\n window.customElements === undefined ||\n window.customElements.polyfillWrapFlushCallback) {\n return;\n }\n const BuiltInHTMLElement = HTMLElement;\n const wrapperForTheName = {\n HTMLElement: function HTMLElement() {\n return Reflect.construct(BuiltInHTMLElement, [], this.constructor);\n },\n };\n window.HTMLElement = wrapperForTheName[\"HTMLElement\"];\n HTMLElement.prototype = BuiltInHTMLElement.prototype;\n HTMLElement.prototype.constructor = HTMLElement;\n Object.setPrototypeOf(HTMLElement, BuiltInHTMLElement);\n})();\n\n/**\n * The MIT License (MIT)\n * \n * Copyright (c) 2019 Javan Makhmali\n * \n * Permission is hereby granted, free of charge, to any person obtaining a copy\n * of this software and associated documentation files (the \"Software\"), to deal\n * in the Software without restriction, including without limitation the rights\n * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell\n * copies of the Software, and to permit persons to whom the Software is\n * furnished to do so, subject to the following conditions:\n * \n * The above copyright notice and this permission notice shall be included in\n * all copies or substantial portions of the Software.\n * \n * THE SOFTWARE IS PROVIDED \"AS IS\", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR\n * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,\n * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE\n * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER\n * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,\n * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN\n * THE SOFTWARE.\n */\n\n(function(prototype) {\n if (typeof prototype.requestSubmit == \"function\") return\n\n prototype.requestSubmit = function(submitter) {\n if (submitter) {\n validateSubmitter(submitter, this);\n submitter.click();\n } else {\n submitter = document.createElement(\"input\");\n submitter.type = \"submit\";\n submitter.hidden = true;\n this.appendChild(submitter);\n submitter.click();\n this.removeChild(submitter);\n }\n };\n\n function validateSubmitter(submitter, form) {\n submitter instanceof HTMLElement || raise(TypeError, \"parameter 1 is not of type 'HTMLElement'\");\n submitter.type == \"submit\" || raise(TypeError, \"The specified element is not a submit button\");\n submitter.form == form || raise(DOMException, \"The specified element is not owned by this form element\", \"NotFoundError\");\n }\n\n function raise(errorConstructor, message, name) {\n throw new errorConstructor(\"Failed to execute 'requestSubmit' on 'HTMLFormElement': \" + message + \".\", name)\n }\n})(HTMLFormElement.prototype);\n\nconst submittersByForm = new WeakMap();\nfunction findSubmitterFromClickTarget(target) {\n const element = target instanceof Element ? target : target instanceof Node ? target.parentElement : null;\n const candidate = element ? element.closest(\"input, button\") : null;\n return (candidate === null || candidate === void 0 ? void 0 : candidate.type) == \"submit\" ? candidate : null;\n}\nfunction clickCaptured(event) {\n const submitter = findSubmitterFromClickTarget(event.target);\n if (submitter && submitter.form) {\n submittersByForm.set(submitter.form, submitter);\n }\n}\n(function () {\n if (\"submitter\" in Event.prototype)\n return;\n let prototype;\n if (\"SubmitEvent\" in window && /Apple Computer/.test(navigator.vendor)) {\n prototype = window.SubmitEvent.prototype;\n }\n else if (\"SubmitEvent\" in window) {\n return;\n }\n else {\n prototype = window.Event.prototype;\n }\n addEventListener(\"click\", clickCaptured, true);\n Object.defineProperty(prototype, \"submitter\", {\n get() {\n if (this.type == \"submit\" && this.target instanceof HTMLFormElement) {\n return submittersByForm.get(this.target);\n }\n },\n });\n})();\n\nvar FrameLoadingStyle;\n(function (FrameLoadingStyle) {\n FrameLoadingStyle[\"eager\"] = \"eager\";\n FrameLoadingStyle[\"lazy\"] = \"lazy\";\n})(FrameLoadingStyle || (FrameLoadingStyle = {}));\nclass FrameElement extends HTMLElement {\n constructor() {\n super();\n this.loaded = Promise.resolve();\n this.delegate = new FrameElement.delegateConstructor(this);\n }\n static get observedAttributes() {\n return [\"disabled\", \"complete\", \"loading\", \"src\"];\n }\n connectedCallback() {\n this.delegate.connect();\n }\n disconnectedCallback() {\n this.delegate.disconnect();\n }\n reload() {\n return this.delegate.sourceURLReloaded();\n }\n attributeChangedCallback(name) {\n if (name == \"loading\") {\n this.delegate.loadingStyleChanged();\n }\n else if (name == \"complete\") {\n this.delegate.completeChanged();\n }\n else if (name == \"src\") {\n this.delegate.sourceURLChanged();\n }\n else {\n this.delegate.disabledChanged();\n }\n }\n get src() {\n return this.getAttribute(\"src\");\n }\n set src(value) {\n if (value) {\n this.setAttribute(\"src\", value);\n }\n else {\n this.removeAttribute(\"src\");\n }\n }\n get loading() {\n return frameLoadingStyleFromString(this.getAttribute(\"loading\") || \"\");\n }\n set loading(value) {\n if (value) {\n this.setAttribute(\"loading\", value);\n }\n else {\n this.removeAttribute(\"loading\");\n }\n }\n get disabled() {\n return this.hasAttribute(\"disabled\");\n }\n set disabled(value) {\n if (value) {\n this.setAttribute(\"disabled\", \"\");\n }\n else {\n this.removeAttribute(\"disabled\");\n }\n }\n get autoscroll() {\n return this.hasAttribute(\"autoscroll\");\n }\n set autoscroll(value) {\n if (value) {\n this.setAttribute(\"autoscroll\", \"\");\n }\n else {\n this.removeAttribute(\"autoscroll\");\n }\n }\n get complete() {\n return !this.delegate.isLoading;\n }\n get isActive() {\n return this.ownerDocument === document && !this.isPreview;\n }\n get isPreview() {\n var _a, _b;\n return (_b = (_a = this.ownerDocument) === null || _a === void 0 ? void 0 : _a.documentElement) === null || _b === void 0 ? void 0 : _b.hasAttribute(\"data-turbo-preview\");\n }\n}\nfunction frameLoadingStyleFromString(style) {\n switch (style.toLowerCase()) {\n case \"lazy\":\n return FrameLoadingStyle.lazy;\n default:\n return FrameLoadingStyle.eager;\n }\n}\n\nfunction expandURL(locatable) {\n return new URL(locatable.toString(), document.baseURI);\n}\nfunction getAnchor(url) {\n let anchorMatch;\n if (url.hash) {\n return url.hash.slice(1);\n }\n else if ((anchorMatch = url.href.match(/#(.*)$/))) {\n return anchorMatch[1];\n }\n}\nfunction getAction(form, submitter) {\n const action = (submitter === null || submitter === void 0 ? void 0 : submitter.getAttribute(\"formaction\")) || form.getAttribute(\"action\") || form.action;\n return expandURL(action);\n}\nfunction getExtension(url) {\n return (getLastPathComponent(url).match(/\\.[^.]*$/) || [])[0] || \"\";\n}\nfunction isHTML(url) {\n return !!getExtension(url).match(/^(?:|\\.(?:htm|html|xhtml|php))$/);\n}\nfunction isPrefixedBy(baseURL, url) {\n const prefix = getPrefix(url);\n return baseURL.href === expandURL(prefix).href || baseURL.href.startsWith(prefix);\n}\nfunction locationIsVisitable(location, rootLocation) {\n return isPrefixedBy(location, rootLocation) && isHTML(location);\n}\nfunction getRequestURL(url) {\n const anchor = getAnchor(url);\n return anchor != null ? url.href.slice(0, -(anchor.length + 1)) : url.href;\n}\nfunction toCacheKey(url) {\n return getRequestURL(url);\n}\nfunction urlsAreEqual(left, right) {\n return expandURL(left).href == expandURL(right).href;\n}\nfunction getPathComponents(url) {\n return url.pathname.split(\"/\").slice(1);\n}\nfunction getLastPathComponent(url) {\n return getPathComponents(url).slice(-1)[0];\n}\nfunction getPrefix(url) {\n return addTrailingSlash(url.origin + url.pathname);\n}\nfunction addTrailingSlash(value) {\n return value.endsWith(\"/\") ? value : value + \"/\";\n}\n\nclass FetchResponse {\n constructor(response) {\n this.response = response;\n }\n get succeeded() {\n return this.response.ok;\n }\n get failed() {\n return !this.succeeded;\n }\n get clientError() {\n return this.statusCode >= 400 && this.statusCode <= 499;\n }\n get serverError() {\n return this.statusCode >= 500 && this.statusCode <= 599;\n }\n get redirected() {\n return this.response.redirected;\n }\n get location() {\n return expandURL(this.response.url);\n }\n get isHTML() {\n return this.contentType && this.contentType.match(/^(?:text\\/([^\\s;,]+\\b)?html|application\\/xhtml\\+xml)\\b/);\n }\n get statusCode() {\n return this.response.status;\n }\n get contentType() {\n return this.header(\"Content-Type\");\n }\n get responseText() {\n return this.response.clone().text();\n }\n get responseHTML() {\n if (this.isHTML) {\n return this.response.clone().text();\n }\n else {\n return Promise.resolve(undefined);\n }\n }\n header(name) {\n return this.response.headers.get(name);\n }\n}\n\nfunction isAction(action) {\n return action == \"advance\" || action == \"replace\" || action == \"restore\";\n}\n\nfunction activateScriptElement(element) {\n if (element.getAttribute(\"data-turbo-eval\") == \"false\") {\n return element;\n }\n else {\n const createdScriptElement = document.createElement(\"script\");\n const cspNonce = getMetaContent(\"csp-nonce\");\n if (cspNonce) {\n createdScriptElement.nonce = cspNonce;\n }\n createdScriptElement.textContent = element.textContent;\n createdScriptElement.async = false;\n copyElementAttributes(createdScriptElement, element);\n return createdScriptElement;\n }\n}\nfunction copyElementAttributes(destinationElement, sourceElement) {\n for (const { name, value } of sourceElement.attributes) {\n destinationElement.setAttribute(name, value);\n }\n}\nfunction createDocumentFragment(html) {\n const template = document.createElement(\"template\");\n template.innerHTML = html;\n return template.content;\n}\nfunction dispatch(eventName, { target, cancelable, detail } = {}) {\n const event = new CustomEvent(eventName, {\n cancelable,\n bubbles: true,\n detail,\n });\n if (target && target.isConnected) {\n target.dispatchEvent(event);\n }\n else {\n document.documentElement.dispatchEvent(event);\n }\n return event;\n}\nfunction nextAnimationFrame() {\n return new Promise((resolve) => requestAnimationFrame(() => resolve()));\n}\nfunction nextEventLoopTick() {\n return new Promise((resolve) => setTimeout(() => resolve(), 0));\n}\nfunction nextMicrotask() {\n return Promise.resolve();\n}\nfunction parseHTMLDocument(html = \"\") {\n return new DOMParser().parseFromString(html, \"text/html\");\n}\nfunction unindent(strings, ...values) {\n const lines = interpolate(strings, values).replace(/^\\n/, \"\").split(\"\\n\");\n const match = lines[0].match(/^\\s+/);\n const indent = match ? match[0].length : 0;\n return lines.map((line) => line.slice(indent)).join(\"\\n\");\n}\nfunction interpolate(strings, values) {\n return strings.reduce((result, string, i) => {\n const value = values[i] == undefined ? \"\" : values[i];\n return result + string + value;\n }, \"\");\n}\nfunction uuid() {\n return Array.from({ length: 36 })\n .map((_, i) => {\n if (i == 8 || i == 13 || i == 18 || i == 23) {\n return \"-\";\n }\n else if (i == 14) {\n return \"4\";\n }\n else if (i == 19) {\n return (Math.floor(Math.random() * 4) + 8).toString(16);\n }\n else {\n return Math.floor(Math.random() * 15).toString(16);\n }\n })\n .join(\"\");\n}\nfunction getAttribute(attributeName, ...elements) {\n for (const value of elements.map((element) => element === null || element === void 0 ? void 0 : element.getAttribute(attributeName))) {\n if (typeof value == \"string\")\n return value;\n }\n return null;\n}\nfunction hasAttribute(attributeName, ...elements) {\n return elements.some((element) => element && element.hasAttribute(attributeName));\n}\nfunction markAsBusy(...elements) {\n for (const element of elements) {\n if (element.localName == \"turbo-frame\") {\n element.setAttribute(\"busy\", \"\");\n }\n element.setAttribute(\"aria-busy\", \"true\");\n }\n}\nfunction clearBusyState(...elements) {\n for (const element of elements) {\n if (element.localName == \"turbo-frame\") {\n element.removeAttribute(\"busy\");\n }\n element.removeAttribute(\"aria-busy\");\n }\n}\nfunction waitForLoad(element, timeoutInMilliseconds = 2000) {\n return new Promise((resolve) => {\n const onComplete = () => {\n element.removeEventListener(\"error\", onComplete);\n element.removeEventListener(\"load\", onComplete);\n resolve();\n };\n element.addEventListener(\"load\", onComplete, { once: true });\n element.addEventListener(\"error\", onComplete, { once: true });\n setTimeout(resolve, timeoutInMilliseconds);\n });\n}\nfunction getHistoryMethodForAction(action) {\n switch (action) {\n case \"replace\":\n return history.replaceState;\n case \"advance\":\n case \"restore\":\n return history.pushState;\n }\n}\nfunction getVisitAction(...elements) {\n const action = getAttribute(\"data-turbo-action\", ...elements);\n return isAction(action) ? action : null;\n}\nfunction getMetaElement(name) {\n return document.querySelector(`meta[name=\"${name}\"]`);\n}\nfunction getMetaContent(name) {\n const element = getMetaElement(name);\n return element && element.content;\n}\nfunction setMetaContent(name, content) {\n let element = getMetaElement(name);\n if (!element) {\n element = document.createElement(\"meta\");\n element.setAttribute(\"name\", name);\n document.head.appendChild(element);\n }\n element.setAttribute(\"content\", content);\n return element;\n}\n\nvar FetchMethod;\n(function (FetchMethod) {\n FetchMethod[FetchMethod[\"get\"] = 0] = \"get\";\n FetchMethod[FetchMethod[\"post\"] = 1] = \"post\";\n FetchMethod[FetchMethod[\"put\"] = 2] = \"put\";\n FetchMethod[FetchMethod[\"patch\"] = 3] = \"patch\";\n FetchMethod[FetchMethod[\"delete\"] = 4] = \"delete\";\n})(FetchMethod || (FetchMethod = {}));\nfunction fetchMethodFromString(method) {\n switch (method.toLowerCase()) {\n case \"get\":\n return FetchMethod.get;\n case \"post\":\n return FetchMethod.post;\n case \"put\":\n return FetchMethod.put;\n case \"patch\":\n return FetchMethod.patch;\n case \"delete\":\n return FetchMethod.delete;\n }\n}\nclass FetchRequest {\n constructor(delegate, method, location, body = new URLSearchParams(), target = null) {\n this.abortController = new AbortController();\n this.resolveRequestPromise = (_value) => { };\n this.delegate = delegate;\n this.method = method;\n this.headers = this.defaultHeaders;\n this.body = body;\n this.url = location;\n this.target = target;\n }\n get location() {\n return this.url;\n }\n get params() {\n return this.url.searchParams;\n }\n get entries() {\n return this.body ? Array.from(this.body.entries()) : [];\n }\n cancel() {\n this.abortController.abort();\n }\n async perform() {\n var _a, _b;\n const { fetchOptions } = this;\n (_b = (_a = this.delegate).prepareHeadersForRequest) === null || _b === void 0 ? void 0 : _b.call(_a, this.headers, this);\n await this.allowRequestToBeIntercepted(fetchOptions);\n try {\n this.delegate.requestStarted(this);\n const response = await fetch(this.url.href, fetchOptions);\n return await this.receive(response);\n }\n catch (error) {\n if (error.name !== \"AbortError\") {\n if (this.willDelegateErrorHandling(error)) {\n this.delegate.requestErrored(this, error);\n }\n throw error;\n }\n }\n finally {\n this.delegate.requestFinished(this);\n }\n }\n async receive(response) {\n const fetchResponse = new FetchResponse(response);\n const event = dispatch(\"turbo:before-fetch-response\", {\n cancelable: true,\n detail: { fetchResponse },\n target: this.target,\n });\n if (event.defaultPrevented) {\n this.delegate.requestPreventedHandlingResponse(this, fetchResponse);\n }\n else if (fetchResponse.succeeded) {\n this.delegate.requestSucceededWithResponse(this, fetchResponse);\n }\n else {\n this.delegate.requestFailedWithResponse(this, fetchResponse);\n }\n return fetchResponse;\n }\n get fetchOptions() {\n var _a;\n return {\n method: FetchMethod[this.method].toUpperCase(),\n credentials: \"same-origin\",\n headers: this.headers,\n redirect: \"follow\",\n body: this.isIdempotent ? null : this.body,\n signal: this.abortSignal,\n referrer: (_a = this.delegate.referrer) === null || _a === void 0 ? void 0 : _a.href,\n };\n }\n get defaultHeaders() {\n return {\n Accept: \"text/html, application/xhtml+xml\",\n };\n }\n get isIdempotent() {\n return this.method == FetchMethod.get;\n }\n get abortSignal() {\n return this.abortController.signal;\n }\n acceptResponseType(mimeType) {\n this.headers[\"Accept\"] = [mimeType, this.headers[\"Accept\"]].join(\", \");\n }\n async allowRequestToBeIntercepted(fetchOptions) {\n const requestInterception = new Promise((resolve) => (this.resolveRequestPromise = resolve));\n const event = dispatch(\"turbo:before-fetch-request\", {\n cancelable: true,\n detail: {\n fetchOptions,\n url: this.url,\n resume: this.resolveRequestPromise,\n },\n target: this.target,\n });\n if (event.defaultPrevented)\n await requestInterception;\n }\n willDelegateErrorHandling(error) {\n const event = dispatch(\"turbo:fetch-request-error\", {\n target: this.target,\n cancelable: true,\n detail: { request: this, error: error },\n });\n return !event.defaultPrevented;\n }\n}\n\nclass AppearanceObserver {\n constructor(delegate, element) {\n this.started = false;\n this.intersect = (entries) => {\n const lastEntry = entries.slice(-1)[0];\n if (lastEntry === null || lastEntry === void 0 ? void 0 : lastEntry.isIntersecting) {\n this.delegate.elementAppearedInViewport(this.element);\n }\n };\n this.delegate = delegate;\n this.element = element;\n this.intersectionObserver = new IntersectionObserver(this.intersect);\n }\n start() {\n if (!this.started) {\n this.started = true;\n this.intersectionObserver.observe(this.element);\n }\n }\n stop() {\n if (this.started) {\n this.started = false;\n this.intersectionObserver.unobserve(this.element);\n }\n }\n}\n\nclass StreamMessage {\n constructor(fragment) {\n this.fragment = importStreamElements(fragment);\n }\n static wrap(message) {\n if (typeof message == \"string\") {\n return new this(createDocumentFragment(message));\n }\n else {\n return message;\n }\n }\n}\nStreamMessage.contentType = \"text/vnd.turbo-stream.html\";\nfunction importStreamElements(fragment) {\n for (const element of fragment.querySelectorAll(\"turbo-stream\")) {\n const streamElement = document.importNode(element, true);\n for (const inertScriptElement of streamElement.templateElement.content.querySelectorAll(\"script\")) {\n inertScriptElement.replaceWith(activateScriptElement(inertScriptElement));\n }\n element.replaceWith(streamElement);\n }\n return fragment;\n}\n\nvar FormSubmissionState;\n(function (FormSubmissionState) {\n FormSubmissionState[FormSubmissionState[\"initialized\"] = 0] = \"initialized\";\n FormSubmissionState[FormSubmissionState[\"requesting\"] = 1] = \"requesting\";\n FormSubmissionState[FormSubmissionState[\"waiting\"] = 2] = \"waiting\";\n FormSubmissionState[FormSubmissionState[\"receiving\"] = 3] = \"receiving\";\n FormSubmissionState[FormSubmissionState[\"stopping\"] = 4] = \"stopping\";\n FormSubmissionState[FormSubmissionState[\"stopped\"] = 5] = \"stopped\";\n})(FormSubmissionState || (FormSubmissionState = {}));\nvar FormEnctype;\n(function (FormEnctype) {\n FormEnctype[\"urlEncoded\"] = \"application/x-www-form-urlencoded\";\n FormEnctype[\"multipart\"] = \"multipart/form-data\";\n FormEnctype[\"plain\"] = \"text/plain\";\n})(FormEnctype || (FormEnctype = {}));\nfunction formEnctypeFromString(encoding) {\n switch (encoding.toLowerCase()) {\n case FormEnctype.multipart:\n return FormEnctype.multipart;\n case FormEnctype.plain:\n return FormEnctype.plain;\n default:\n return FormEnctype.urlEncoded;\n }\n}\nclass FormSubmission {\n constructor(delegate, formElement, submitter, mustRedirect = false) {\n this.state = FormSubmissionState.initialized;\n this.delegate = delegate;\n this.formElement = formElement;\n this.submitter = submitter;\n this.formData = buildFormData(formElement, submitter);\n this.location = expandURL(this.action);\n if (this.method == FetchMethod.get) {\n mergeFormDataEntries(this.location, [...this.body.entries()]);\n }\n this.fetchRequest = new FetchRequest(this, this.method, this.location, this.body, this.formElement);\n this.mustRedirect = mustRedirect;\n }\n static confirmMethod(message, _element, _submitter) {\n return Promise.resolve(confirm(message));\n }\n get method() {\n var _a;\n const method = ((_a = this.submitter) === null || _a === void 0 ? void 0 : _a.getAttribute(\"formmethod\")) || this.formElement.getAttribute(\"method\") || \"\";\n return fetchMethodFromString(method.toLowerCase()) || FetchMethod.get;\n }\n get action() {\n var _a;\n const formElementAction = typeof this.formElement.action === \"string\" ? this.formElement.action : null;\n if ((_a = this.submitter) === null || _a === void 0 ? void 0 : _a.hasAttribute(\"formaction\")) {\n return this.submitter.getAttribute(\"formaction\") || \"\";\n }\n else {\n return this.formElement.getAttribute(\"action\") || formElementAction || \"\";\n }\n }\n get body() {\n if (this.enctype == FormEnctype.urlEncoded || this.method == FetchMethod.get) {\n return new URLSearchParams(this.stringFormData);\n }\n else {\n return this.formData;\n }\n }\n get enctype() {\n var _a;\n return formEnctypeFromString(((_a = this.submitter) === null || _a === void 0 ? void 0 : _a.getAttribute(\"formenctype\")) || this.formElement.enctype);\n }\n get isIdempotent() {\n return this.fetchRequest.isIdempotent;\n }\n get stringFormData() {\n return [...this.formData].reduce((entries, [name, value]) => {\n return entries.concat(typeof value == \"string\" ? [[name, value]] : []);\n }, []);\n }\n async start() {\n const { initialized, requesting } = FormSubmissionState;\n const confirmationMessage = getAttribute(\"data-turbo-confirm\", this.submitter, this.formElement);\n if (typeof confirmationMessage === \"string\") {\n const answer = await FormSubmission.confirmMethod(confirmationMessage, this.formElement, this.submitter);\n if (!answer) {\n return;\n }\n }\n if (this.state == initialized) {\n this.state = requesting;\n return this.fetchRequest.perform();\n }\n }\n stop() {\n const { stopping, stopped } = FormSubmissionState;\n if (this.state != stopping && this.state != stopped) {\n this.state = stopping;\n this.fetchRequest.cancel();\n return true;\n }\n }\n prepareHeadersForRequest(headers, request) {\n if (!request.isIdempotent) {\n const token = getCookieValue(getMetaContent(\"csrf-param\")) || getMetaContent(\"csrf-token\");\n if (token) {\n headers[\"X-CSRF-Token\"] = token;\n }\n }\n if (this.requestAcceptsTurboStreamResponse(request)) {\n request.acceptResponseType(StreamMessage.contentType);\n }\n }\n requestStarted(_request) {\n var _a;\n this.state = FormSubmissionState.waiting;\n (_a = this.submitter) === null || _a === void 0 ? void 0 : _a.setAttribute(\"disabled\", \"\");\n dispatch(\"turbo:submit-start\", {\n target: this.formElement,\n detail: { formSubmission: this },\n });\n this.delegate.formSubmissionStarted(this);\n }\n requestPreventedHandlingResponse(request, response) {\n this.result = { success: response.succeeded, fetchResponse: response };\n }\n requestSucceededWithResponse(request, response) {\n if (response.clientError || response.serverError) {\n this.delegate.formSubmissionFailedWithResponse(this, response);\n }\n else if (this.requestMustRedirect(request) && responseSucceededWithoutRedirect(response)) {\n const error = new Error(\"Form responses must redirect to another location\");\n this.delegate.formSubmissionErrored(this, error);\n }\n else {\n this.state = FormSubmissionState.receiving;\n this.result = { success: true, fetchResponse: response };\n this.delegate.formSubmissionSucceededWithResponse(this, response);\n }\n }\n requestFailedWithResponse(request, response) {\n this.result = { success: false, fetchResponse: response };\n this.delegate.formSubmissionFailedWithResponse(this, response);\n }\n requestErrored(request, error) {\n this.result = { success: false, error };\n this.delegate.formSubmissionErrored(this, error);\n }\n requestFinished(_request) {\n var _a;\n this.state = FormSubmissionState.stopped;\n (_a = this.submitter) === null || _a === void 0 ? void 0 : _a.removeAttribute(\"disabled\");\n dispatch(\"turbo:submit-end\", {\n target: this.formElement,\n detail: Object.assign({ formSubmission: this }, this.result),\n });\n this.delegate.formSubmissionFinished(this);\n }\n requestMustRedirect(request) {\n return !request.isIdempotent && this.mustRedirect;\n }\n requestAcceptsTurboStreamResponse(request) {\n return !request.isIdempotent || hasAttribute(\"data-turbo-stream\", this.submitter, this.formElement);\n }\n}\nfunction buildFormData(formElement, submitter) {\n const formData = new FormData(formElement);\n const name = submitter === null || submitter === void 0 ? void 0 : submitter.getAttribute(\"name\");\n const value = submitter === null || submitter === void 0 ? void 0 : submitter.getAttribute(\"value\");\n if (name) {\n formData.append(name, value || \"\");\n }\n return formData;\n}\nfunction getCookieValue(cookieName) {\n if (cookieName != null) {\n const cookies = document.cookie ? document.cookie.split(\"; \") : [];\n const cookie = cookies.find((cookie) => cookie.startsWith(cookieName));\n if (cookie) {\n const value = cookie.split(\"=\").slice(1).join(\"=\");\n return value ? decodeURIComponent(value) : undefined;\n }\n }\n}\nfunction responseSucceededWithoutRedirect(response) {\n return response.statusCode == 200 && !response.redirected;\n}\nfunction mergeFormDataEntries(url, entries) {\n const searchParams = new URLSearchParams();\n for (const [name, value] of entries) {\n if (value instanceof File)\n continue;\n searchParams.append(name, value);\n }\n url.search = searchParams.toString();\n return url;\n}\n\nclass Snapshot {\n constructor(element) {\n this.element = element;\n }\n get activeElement() {\n return this.element.ownerDocument.activeElement;\n }\n get children() {\n return [...this.element.children];\n }\n hasAnchor(anchor) {\n return this.getElementForAnchor(anchor) != null;\n }\n getElementForAnchor(anchor) {\n return anchor ? this.element.querySelector(`[id='${anchor}'], a[name='${anchor}']`) : null;\n }\n get isConnected() {\n return this.element.isConnected;\n }\n get firstAutofocusableElement() {\n const inertDisabledOrHidden = \"[inert], :disabled, [hidden], details:not([open]), dialog:not([open])\";\n for (const element of this.element.querySelectorAll(\"[autofocus]\")) {\n if (element.closest(inertDisabledOrHidden) == null)\n return element;\n else\n continue;\n }\n return null;\n }\n get permanentElements() {\n return queryPermanentElementsAll(this.element);\n }\n getPermanentElementById(id) {\n return getPermanentElementById(this.element, id);\n }\n getPermanentElementMapForSnapshot(snapshot) {\n const permanentElementMap = {};\n for (const currentPermanentElement of this.permanentElements) {\n const { id } = currentPermanentElement;\n const newPermanentElement = snapshot.getPermanentElementById(id);\n if (newPermanentElement) {\n permanentElementMap[id] = [currentPermanentElement, newPermanentElement];\n }\n }\n return permanentElementMap;\n }\n}\nfunction getPermanentElementById(node, id) {\n return node.querySelector(`#${id}[data-turbo-permanent]`);\n}\nfunction queryPermanentElementsAll(node) {\n return node.querySelectorAll(\"[id][data-turbo-permanent]\");\n}\n\nclass FormSubmitObserver {\n constructor(delegate, eventTarget) {\n this.started = false;\n this.submitCaptured = () => {\n this.eventTarget.removeEventListener(\"submit\", this.submitBubbled, false);\n this.eventTarget.addEventListener(\"submit\", this.submitBubbled, false);\n };\n this.submitBubbled = ((event) => {\n if (!event.defaultPrevented) {\n const form = event.target instanceof HTMLFormElement ? event.target : undefined;\n const submitter = event.submitter || undefined;\n if (form &&\n submissionDoesNotDismissDialog(form, submitter) &&\n submissionDoesNotTargetIFrame(form, submitter) &&\n this.delegate.willSubmitForm(form, submitter)) {\n event.preventDefault();\n event.stopImmediatePropagation();\n this.delegate.formSubmitted(form, submitter);\n }\n }\n });\n this.delegate = delegate;\n this.eventTarget = eventTarget;\n }\n start() {\n if (!this.started) {\n this.eventTarget.addEventListener(\"submit\", this.submitCaptured, true);\n this.started = true;\n }\n }\n stop() {\n if (this.started) {\n this.eventTarget.removeEventListener(\"submit\", this.submitCaptured, true);\n this.started = false;\n }\n }\n}\nfunction submissionDoesNotDismissDialog(form, submitter) {\n const method = (submitter === null || submitter === void 0 ? void 0 : submitter.getAttribute(\"formmethod\")) || form.getAttribute(\"method\");\n return method != \"dialog\";\n}\nfunction submissionDoesNotTargetIFrame(form, submitter) {\n const target = (submitter === null || submitter === void 0 ? void 0 : submitter.getAttribute(\"formtarget\")) || form.target;\n for (const element of document.getElementsByName(target)) {\n if (element instanceof HTMLIFrameElement)\n return false;\n }\n return true;\n}\n\nclass View {\n constructor(delegate, element) {\n this.resolveRenderPromise = (_value) => { };\n this.resolveInterceptionPromise = (_value) => { };\n this.delegate = delegate;\n this.element = element;\n }\n scrollToAnchor(anchor) {\n const element = this.snapshot.getElementForAnchor(anchor);\n if (element) {\n this.scrollToElement(element);\n this.focusElement(element);\n }\n else {\n this.scrollToPosition({ x: 0, y: 0 });\n }\n }\n scrollToAnchorFromLocation(location) {\n this.scrollToAnchor(getAnchor(location));\n }\n scrollToElement(element) {\n element.scrollIntoView();\n }\n focusElement(element) {\n if (element instanceof HTMLElement) {\n if (element.hasAttribute(\"tabindex\")) {\n element.focus();\n }\n else {\n element.setAttribute(\"tabindex\", \"-1\");\n element.focus();\n element.removeAttribute(\"tabindex\");\n }\n }\n }\n scrollToPosition({ x, y }) {\n this.scrollRoot.scrollTo(x, y);\n }\n scrollToTop() {\n this.scrollToPosition({ x: 0, y: 0 });\n }\n get scrollRoot() {\n return window;\n }\n async render(renderer) {\n const { isPreview, shouldRender, newSnapshot: snapshot } = renderer;\n if (shouldRender) {\n try {\n this.renderPromise = new Promise((resolve) => (this.resolveRenderPromise = resolve));\n this.renderer = renderer;\n await this.prepareToRenderSnapshot(renderer);\n const renderInterception = new Promise((resolve) => (this.resolveInterceptionPromise = resolve));\n const options = { resume: this.resolveInterceptionPromise, render: this.renderer.renderElement };\n const immediateRender = this.delegate.allowsImmediateRender(snapshot, options);\n if (!immediateRender)\n await renderInterception;\n await this.renderSnapshot(renderer);\n this.delegate.viewRenderedSnapshot(snapshot, isPreview);\n this.delegate.preloadOnLoadLinksForView(this.element);\n this.finishRenderingSnapshot(renderer);\n }\n finally {\n delete this.renderer;\n this.resolveRenderPromise(undefined);\n delete this.renderPromise;\n }\n }\n else {\n this.invalidate(renderer.reloadReason);\n }\n }\n invalidate(reason) {\n this.delegate.viewInvalidated(reason);\n }\n async prepareToRenderSnapshot(renderer) {\n this.markAsPreview(renderer.isPreview);\n await renderer.prepareToRender();\n }\n markAsPreview(isPreview) {\n if (isPreview) {\n this.element.setAttribute(\"data-turbo-preview\", \"\");\n }\n else {\n this.element.removeAttribute(\"data-turbo-preview\");\n }\n }\n async renderSnapshot(renderer) {\n await renderer.render();\n }\n finishRenderingSnapshot(renderer) {\n renderer.finishRendering();\n }\n}\n\nclass FrameView extends View {\n invalidate() {\n this.element.innerHTML = \"\";\n }\n get snapshot() {\n return new Snapshot(this.element);\n }\n}\n\nclass LinkInterceptor {\n constructor(delegate, element) {\n this.clickBubbled = (event) => {\n if (this.respondsToEventTarget(event.target)) {\n this.clickEvent = event;\n }\n else {\n delete this.clickEvent;\n }\n };\n this.linkClicked = ((event) => {\n if (this.clickEvent && this.respondsToEventTarget(event.target) && event.target instanceof Element) {\n if (this.delegate.shouldInterceptLinkClick(event.target, event.detail.url, event.detail.originalEvent)) {\n this.clickEvent.preventDefault();\n event.preventDefault();\n this.delegate.linkClickIntercepted(event.target, event.detail.url, event.detail.originalEvent);\n }\n }\n delete this.clickEvent;\n });\n this.willVisit = ((_event) => {\n delete this.clickEvent;\n });\n this.delegate = delegate;\n this.element = element;\n }\n start() {\n this.element.addEventListener(\"click\", this.clickBubbled);\n document.addEventListener(\"turbo:click\", this.linkClicked);\n document.addEventListener(\"turbo:before-visit\", this.willVisit);\n }\n stop() {\n this.element.removeEventListener(\"click\", this.clickBubbled);\n document.removeEventListener(\"turbo:click\", this.linkClicked);\n document.removeEventListener(\"turbo:before-visit\", this.willVisit);\n }\n respondsToEventTarget(target) {\n const element = target instanceof Element ? target : target instanceof Node ? target.parentElement : null;\n return element && element.closest(\"turbo-frame, html\") == this.element;\n }\n}\n\nclass LinkClickObserver {\n constructor(delegate, eventTarget) {\n this.started = false;\n this.clickCaptured = () => {\n this.eventTarget.removeEventListener(\"click\", this.clickBubbled, false);\n this.eventTarget.addEventListener(\"click\", this.clickBubbled, false);\n };\n this.clickBubbled = (event) => {\n if (event instanceof MouseEvent && this.clickEventIsSignificant(event)) {\n const target = (event.composedPath && event.composedPath()[0]) || event.target;\n const link = this.findLinkFromClickTarget(target);\n if (link && doesNotTargetIFrame(link)) {\n const location = this.getLocationForLink(link);\n if (this.delegate.willFollowLinkToLocation(link, location, event)) {\n event.preventDefault();\n this.delegate.followedLinkToLocation(link, location);\n }\n }\n }\n };\n this.delegate = delegate;\n this.eventTarget = eventTarget;\n }\n start() {\n if (!this.started) {\n this.eventTarget.addEventListener(\"click\", this.clickCaptured, true);\n this.started = true;\n }\n }\n stop() {\n if (this.started) {\n this.eventTarget.removeEventListener(\"click\", this.clickCaptured, true);\n this.started = false;\n }\n }\n clickEventIsSignificant(event) {\n return !((event.target && event.target.isContentEditable) ||\n event.defaultPrevented ||\n event.which > 1 ||\n event.altKey ||\n event.ctrlKey ||\n event.metaKey ||\n event.shiftKey);\n }\n findLinkFromClickTarget(target) {\n if (target instanceof Element) {\n return target.closest(\"a[href]:not([target^=_]):not([download])\");\n }\n }\n getLocationForLink(link) {\n return expandURL(link.getAttribute(\"href\") || \"\");\n }\n}\nfunction doesNotTargetIFrame(anchor) {\n for (const element of document.getElementsByName(anchor.target)) {\n if (element instanceof HTMLIFrameElement)\n return false;\n }\n return true;\n}\n\nclass FormLinkClickObserver {\n constructor(delegate, element) {\n this.delegate = delegate;\n this.linkInterceptor = new LinkClickObserver(this, element);\n }\n start() {\n this.linkInterceptor.start();\n }\n stop() {\n this.linkInterceptor.stop();\n }\n willFollowLinkToLocation(link, location, originalEvent) {\n return (this.delegate.willSubmitFormLinkToLocation(link, location, originalEvent) &&\n link.hasAttribute(\"data-turbo-method\"));\n }\n followedLinkToLocation(link, location) {\n const action = location.href;\n const form = document.createElement(\"form\");\n form.setAttribute(\"data-turbo\", \"true\");\n form.setAttribute(\"action\", action);\n form.setAttribute(\"hidden\", \"\");\n const method = link.getAttribute(\"data-turbo-method\");\n if (method)\n form.setAttribute(\"method\", method);\n const turboFrame = link.getAttribute(\"data-turbo-frame\");\n if (turboFrame)\n form.setAttribute(\"data-turbo-frame\", turboFrame);\n const turboAction = link.getAttribute(\"data-turbo-action\");\n if (turboAction)\n form.setAttribute(\"data-turbo-action\", turboAction);\n const turboConfirm = link.getAttribute(\"data-turbo-confirm\");\n if (turboConfirm)\n form.setAttribute(\"data-turbo-confirm\", turboConfirm);\n const turboStream = link.hasAttribute(\"data-turbo-stream\");\n if (turboStream)\n form.setAttribute(\"data-turbo-stream\", \"\");\n this.delegate.submittedFormLinkToLocation(link, location, form);\n document.body.appendChild(form);\n form.addEventListener(\"turbo:submit-end\", () => form.remove(), { once: true });\n requestAnimationFrame(() => form.requestSubmit());\n }\n}\n\nclass Bardo {\n constructor(delegate, permanentElementMap) {\n this.delegate = delegate;\n this.permanentElementMap = permanentElementMap;\n }\n static preservingPermanentElements(delegate, permanentElementMap, callback) {\n const bardo = new this(delegate, permanentElementMap);\n bardo.enter();\n callback();\n bardo.leave();\n }\n enter() {\n for (const id in this.permanentElementMap) {\n const [currentPermanentElement, newPermanentElement] = this.permanentElementMap[id];\n this.delegate.enteringBardo(currentPermanentElement, newPermanentElement);\n this.replaceNewPermanentElementWithPlaceholder(newPermanentElement);\n }\n }\n leave() {\n for (const id in this.permanentElementMap) {\n const [currentPermanentElement] = this.permanentElementMap[id];\n this.replaceCurrentPermanentElementWithClone(currentPermanentElement);\n this.replacePlaceholderWithPermanentElement(currentPermanentElement);\n this.delegate.leavingBardo(currentPermanentElement);\n }\n }\n replaceNewPermanentElementWithPlaceholder(permanentElement) {\n const placeholder = createPlaceholderForPermanentElement(permanentElement);\n permanentElement.replaceWith(placeholder);\n }\n replaceCurrentPermanentElementWithClone(permanentElement) {\n const clone = permanentElement.cloneNode(true);\n permanentElement.replaceWith(clone);\n }\n replacePlaceholderWithPermanentElement(permanentElement) {\n const placeholder = this.getPlaceholderById(permanentElement.id);\n placeholder === null || placeholder === void 0 ? void 0 : placeholder.replaceWith(permanentElement);\n }\n getPlaceholderById(id) {\n return this.placeholders.find((element) => element.content == id);\n }\n get placeholders() {\n return [...document.querySelectorAll(\"meta[name=turbo-permanent-placeholder][content]\")];\n }\n}\nfunction createPlaceholderForPermanentElement(permanentElement) {\n const element = document.createElement(\"meta\");\n element.setAttribute(\"name\", \"turbo-permanent-placeholder\");\n element.setAttribute(\"content\", permanentElement.id);\n return element;\n}\n\nclass Renderer {\n constructor(currentSnapshot, newSnapshot, renderElement, isPreview, willRender = true) {\n this.activeElement = null;\n this.currentSnapshot = currentSnapshot;\n this.newSnapshot = newSnapshot;\n this.isPreview = isPreview;\n this.willRender = willRender;\n this.renderElement = renderElement;\n this.promise = new Promise((resolve, reject) => (this.resolvingFunctions = { resolve, reject }));\n }\n get shouldRender() {\n return true;\n }\n get reloadReason() {\n return;\n }\n prepareToRender() {\n return;\n }\n finishRendering() {\n if (this.resolvingFunctions) {\n this.resolvingFunctions.resolve();\n delete this.resolvingFunctions;\n }\n }\n preservingPermanentElements(callback) {\n Bardo.preservingPermanentElements(this, this.permanentElementMap, callback);\n }\n focusFirstAutofocusableElement() {\n const element = this.connectedSnapshot.firstAutofocusableElement;\n if (elementIsFocusable(element)) {\n element.focus();\n }\n }\n enteringBardo(currentPermanentElement) {\n if (this.activeElement)\n return;\n if (currentPermanentElement.contains(this.currentSnapshot.activeElement)) {\n this.activeElement = this.currentSnapshot.activeElement;\n }\n }\n leavingBardo(currentPermanentElement) {\n if (currentPermanentElement.contains(this.activeElement) && this.activeElement instanceof HTMLElement) {\n this.activeElement.focus();\n this.activeElement = null;\n }\n }\n get connectedSnapshot() {\n return this.newSnapshot.isConnected ? this.newSnapshot : this.currentSnapshot;\n }\n get currentElement() {\n return this.currentSnapshot.element;\n }\n get newElement() {\n return this.newSnapshot.element;\n }\n get permanentElementMap() {\n return this.currentSnapshot.getPermanentElementMapForSnapshot(this.newSnapshot);\n }\n}\nfunction elementIsFocusable(element) {\n return element && typeof element.focus == \"function\";\n}\n\nclass FrameRenderer extends Renderer {\n constructor(delegate, currentSnapshot, newSnapshot, renderElement, isPreview, willRender = true) {\n super(currentSnapshot, newSnapshot, renderElement, isPreview, willRender);\n this.delegate = delegate;\n }\n static renderElement(currentElement, newElement) {\n var _a;\n const destinationRange = document.createRange();\n destinationRange.selectNodeContents(currentElement);\n destinationRange.deleteContents();\n const frameElement = newElement;\n const sourceRange = (_a = frameElement.ownerDocument) === null || _a === void 0 ? void 0 : _a.createRange();\n if (sourceRange) {\n sourceRange.selectNodeContents(frameElement);\n currentElement.appendChild(sourceRange.extractContents());\n }\n }\n get shouldRender() {\n return true;\n }\n async render() {\n await nextAnimationFrame();\n this.preservingPermanentElements(() => {\n this.loadFrameElement();\n });\n this.scrollFrameIntoView();\n await nextAnimationFrame();\n this.focusFirstAutofocusableElement();\n await nextAnimationFrame();\n this.activateScriptElements();\n }\n loadFrameElement() {\n this.delegate.willRenderFrame(this.currentElement, this.newElement);\n this.renderElement(this.currentElement, this.newElement);\n }\n scrollFrameIntoView() {\n if (this.currentElement.autoscroll || this.newElement.autoscroll) {\n const element = this.currentElement.firstElementChild;\n const block = readScrollLogicalPosition(this.currentElement.getAttribute(\"data-autoscroll-block\"), \"end\");\n const behavior = readScrollBehavior(this.currentElement.getAttribute(\"data-autoscroll-behavior\"), \"auto\");\n if (element) {\n element.scrollIntoView({ block, behavior });\n return true;\n }\n }\n return false;\n }\n activateScriptElements() {\n for (const inertScriptElement of this.newScriptElements) {\n const activatedScriptElement = activateScriptElement(inertScriptElement);\n inertScriptElement.replaceWith(activatedScriptElement);\n }\n }\n get newScriptElements() {\n return this.currentElement.querySelectorAll(\"script\");\n }\n}\nfunction readScrollLogicalPosition(value, defaultValue) {\n if (value == \"end\" || value == \"start\" || value == \"center\" || value == \"nearest\") {\n return value;\n }\n else {\n return defaultValue;\n }\n}\nfunction readScrollBehavior(value, defaultValue) {\n if (value == \"auto\" || value == \"smooth\") {\n return value;\n }\n else {\n return defaultValue;\n }\n}\n\nclass ProgressBar {\n constructor() {\n this.hiding = false;\n this.value = 0;\n this.visible = false;\n this.trickle = () => {\n this.setValue(this.value + Math.random() / 100);\n };\n this.stylesheetElement = this.createStylesheetElement();\n this.progressElement = this.createProgressElement();\n this.installStylesheetElement();\n this.setValue(0);\n }\n static get defaultCSS() {\n return unindent `\n .turbo-progress-bar {\n position: fixed;\n display: block;\n top: 0;\n left: 0;\n height: 3px;\n background: #0076ff;\n z-index: 2147483647;\n transition:\n width ${ProgressBar.animationDuration}ms ease-out,\n opacity ${ProgressBar.animationDuration / 2}ms ${ProgressBar.animationDuration / 2}ms ease-in;\n transform: translate3d(0, 0, 0);\n }\n `;\n }\n show() {\n if (!this.visible) {\n this.visible = true;\n this.installProgressElement();\n this.startTrickling();\n }\n }\n hide() {\n if (this.visible && !this.hiding) {\n this.hiding = true;\n this.fadeProgressElement(() => {\n this.uninstallProgressElement();\n this.stopTrickling();\n this.visible = false;\n this.hiding = false;\n });\n }\n }\n setValue(value) {\n this.value = value;\n this.refresh();\n }\n installStylesheetElement() {\n document.head.insertBefore(this.stylesheetElement, document.head.firstChild);\n }\n installProgressElement() {\n this.progressElement.style.width = \"0\";\n this.progressElement.style.opacity = \"1\";\n document.documentElement.insertBefore(this.progressElement, document.body);\n this.refresh();\n }\n fadeProgressElement(callback) {\n this.progressElement.style.opacity = \"0\";\n setTimeout(callback, ProgressBar.animationDuration * 1.5);\n }\n uninstallProgressElement() {\n if (this.progressElement.parentNode) {\n document.documentElement.removeChild(this.progressElement);\n }\n }\n startTrickling() {\n if (!this.trickleInterval) {\n this.trickleInterval = window.setInterval(this.trickle, ProgressBar.animationDuration);\n }\n }\n stopTrickling() {\n window.clearInterval(this.trickleInterval);\n delete this.trickleInterval;\n }\n refresh() {\n requestAnimationFrame(() => {\n this.progressElement.style.width = `${10 + this.value * 90}%`;\n });\n }\n createStylesheetElement() {\n const element = document.createElement(\"style\");\n element.type = \"text/css\";\n element.textContent = ProgressBar.defaultCSS;\n if (this.cspNonce) {\n element.nonce = this.cspNonce;\n }\n return element;\n }\n createProgressElement() {\n const element = document.createElement(\"div\");\n element.className = \"turbo-progress-bar\";\n return element;\n }\n get cspNonce() {\n return getMetaContent(\"csp-nonce\");\n }\n}\nProgressBar.animationDuration = 300;\n\nclass HeadSnapshot extends Snapshot {\n constructor() {\n super(...arguments);\n this.detailsByOuterHTML = this.children\n .filter((element) => !elementIsNoscript(element))\n .map((element) => elementWithoutNonce(element))\n .reduce((result, element) => {\n const { outerHTML } = element;\n const details = outerHTML in result\n ? result[outerHTML]\n : {\n type: elementType(element),\n tracked: elementIsTracked(element),\n elements: [],\n };\n return Object.assign(Object.assign({}, result), { [outerHTML]: Object.assign(Object.assign({}, details), { elements: [...details.elements, element] }) });\n }, {});\n }\n get trackedElementSignature() {\n return Object.keys(this.detailsByOuterHTML)\n .filter((outerHTML) => this.detailsByOuterHTML[outerHTML].tracked)\n .join(\"\");\n }\n getScriptElementsNotInSnapshot(snapshot) {\n return this.getElementsMatchingTypeNotInSnapshot(\"script\", snapshot);\n }\n getStylesheetElementsNotInSnapshot(snapshot) {\n return this.getElementsMatchingTypeNotInSnapshot(\"stylesheet\", snapshot);\n }\n getElementsMatchingTypeNotInSnapshot(matchedType, snapshot) {\n return Object.keys(this.detailsByOuterHTML)\n .filter((outerHTML) => !(outerHTML in snapshot.detailsByOuterHTML))\n .map((outerHTML) => this.detailsByOuterHTML[outerHTML])\n .filter(({ type }) => type == matchedType)\n .map(({ elements: [element] }) => element);\n }\n get provisionalElements() {\n return Object.keys(this.detailsByOuterHTML).reduce((result, outerHTML) => {\n const { type, tracked, elements } = this.detailsByOuterHTML[outerHTML];\n if (type == null && !tracked) {\n return [...result, ...elements];\n }\n else if (elements.length > 1) {\n return [...result, ...elements.slice(1)];\n }\n else {\n return result;\n }\n }, []);\n }\n getMetaValue(name) {\n const element = this.findMetaElementByName(name);\n return element ? element.getAttribute(\"content\") : null;\n }\n findMetaElementByName(name) {\n return Object.keys(this.detailsByOuterHTML).reduce((result, outerHTML) => {\n const { elements: [element], } = this.detailsByOuterHTML[outerHTML];\n return elementIsMetaElementWithName(element, name) ? element : result;\n }, undefined);\n }\n}\nfunction elementType(element) {\n if (elementIsScript(element)) {\n return \"script\";\n }\n else if (elementIsStylesheet(element)) {\n return \"stylesheet\";\n }\n}\nfunction elementIsTracked(element) {\n return element.getAttribute(\"data-turbo-track\") == \"reload\";\n}\nfunction elementIsScript(element) {\n const tagName = element.localName;\n return tagName == \"script\";\n}\nfunction elementIsNoscript(element) {\n const tagName = element.localName;\n return tagName == \"noscript\";\n}\nfunction elementIsStylesheet(element) {\n const tagName = element.localName;\n return tagName == \"style\" || (tagName == \"link\" && element.getAttribute(\"rel\") == \"stylesheet\");\n}\nfunction elementIsMetaElementWithName(element, name) {\n const tagName = element.localName;\n return tagName == \"meta\" && element.getAttribute(\"name\") == name;\n}\nfunction elementWithoutNonce(element) {\n if (element.hasAttribute(\"nonce\")) {\n element.setAttribute(\"nonce\", \"\");\n }\n return element;\n}\n\nclass PageSnapshot extends Snapshot {\n constructor(element, headSnapshot) {\n super(element);\n this.headSnapshot = headSnapshot;\n }\n static fromHTMLString(html = \"\") {\n return this.fromDocument(parseHTMLDocument(html));\n }\n static fromElement(element) {\n return this.fromDocument(element.ownerDocument);\n }\n static fromDocument({ head, body }) {\n return new this(body, new HeadSnapshot(head));\n }\n clone() {\n const clonedElement = this.element.cloneNode(true);\n const selectElements = this.element.querySelectorAll(\"select\");\n const clonedSelectElements = clonedElement.querySelectorAll(\"select\");\n for (const [index, source] of selectElements.entries()) {\n const clone = clonedSelectElements[index];\n for (const option of clone.selectedOptions)\n option.selected = false;\n for (const option of source.selectedOptions)\n clone.options[option.index].selected = true;\n }\n for (const clonedPasswordInput of clonedElement.querySelectorAll('input[type=\"password\"]')) {\n clonedPasswordInput.value = \"\";\n }\n return new PageSnapshot(clonedElement, this.headSnapshot);\n }\n get headElement() {\n return this.headSnapshot.element;\n }\n get rootLocation() {\n var _a;\n const root = (_a = this.getSetting(\"root\")) !== null && _a !== void 0 ? _a : \"/\";\n return expandURL(root);\n }\n get cacheControlValue() {\n return this.getSetting(\"cache-control\");\n }\n get isPreviewable() {\n return this.cacheControlValue != \"no-preview\";\n }\n get isCacheable() {\n return this.cacheControlValue != \"no-cache\";\n }\n get isVisitable() {\n return this.getSetting(\"visit-control\") != \"reload\";\n }\n getSetting(name) {\n return this.headSnapshot.getMetaValue(`turbo-${name}`);\n }\n}\n\nvar TimingMetric;\n(function (TimingMetric) {\n TimingMetric[\"visitStart\"] = \"visitStart\";\n TimingMetric[\"requestStart\"] = \"requestStart\";\n TimingMetric[\"requestEnd\"] = \"requestEnd\";\n TimingMetric[\"visitEnd\"] = \"visitEnd\";\n})(TimingMetric || (TimingMetric = {}));\nvar VisitState;\n(function (VisitState) {\n VisitState[\"initialized\"] = \"initialized\";\n VisitState[\"started\"] = \"started\";\n VisitState[\"canceled\"] = \"canceled\";\n VisitState[\"failed\"] = \"failed\";\n VisitState[\"completed\"] = \"completed\";\n})(VisitState || (VisitState = {}));\nconst defaultOptions = {\n action: \"advance\",\n historyChanged: false,\n visitCachedSnapshot: () => { },\n willRender: true,\n updateHistory: true,\n shouldCacheSnapshot: true,\n acceptsStreamResponse: false,\n};\nvar SystemStatusCode;\n(function (SystemStatusCode) {\n SystemStatusCode[SystemStatusCode[\"networkFailure\"] = 0] = \"networkFailure\";\n SystemStatusCode[SystemStatusCode[\"timeoutFailure\"] = -1] = \"timeoutFailure\";\n SystemStatusCode[SystemStatusCode[\"contentTypeMismatch\"] = -2] = \"contentTypeMismatch\";\n})(SystemStatusCode || (SystemStatusCode = {}));\nclass Visit {\n constructor(delegate, location, restorationIdentifier, options = {}) {\n this.identifier = uuid();\n this.timingMetrics = {};\n this.followedRedirect = false;\n this.historyChanged = false;\n this.scrolled = false;\n this.shouldCacheSnapshot = true;\n this.acceptsStreamResponse = false;\n this.snapshotCached = false;\n this.state = VisitState.initialized;\n this.delegate = delegate;\n this.location = location;\n this.restorationIdentifier = restorationIdentifier || uuid();\n const { action, historyChanged, referrer, snapshot, snapshotHTML, response, visitCachedSnapshot, willRender, updateHistory, shouldCacheSnapshot, acceptsStreamResponse, } = Object.assign(Object.assign({}, defaultOptions), options);\n this.action = action;\n this.historyChanged = historyChanged;\n this.referrer = referrer;\n this.snapshot = snapshot;\n this.snapshotHTML = snapshotHTML;\n this.response = response;\n this.isSamePage = this.delegate.locationWithActionIsSamePage(this.location, this.action);\n this.visitCachedSnapshot = visitCachedSnapshot;\n this.willRender = willRender;\n this.updateHistory = updateHistory;\n this.scrolled = !willRender;\n this.shouldCacheSnapshot = shouldCacheSnapshot;\n this.acceptsStreamResponse = acceptsStreamResponse;\n }\n get adapter() {\n return this.delegate.adapter;\n }\n get view() {\n return this.delegate.view;\n }\n get history() {\n return this.delegate.history;\n }\n get restorationData() {\n return this.history.getRestorationDataForIdentifier(this.restorationIdentifier);\n }\n get silent() {\n return this.isSamePage;\n }\n start() {\n if (this.state == VisitState.initialized) {\n this.recordTimingMetric(TimingMetric.visitStart);\n this.state = VisitState.started;\n this.adapter.visitStarted(this);\n this.delegate.visitStarted(this);\n }\n }\n cancel() {\n if (this.state == VisitState.started) {\n if (this.request) {\n this.request.cancel();\n }\n this.cancelRender();\n this.state = VisitState.canceled;\n }\n }\n complete() {\n if (this.state == VisitState.started) {\n this.recordTimingMetric(TimingMetric.visitEnd);\n this.state = VisitState.completed;\n this.followRedirect();\n if (!this.followedRedirect) {\n this.adapter.visitCompleted(this);\n this.delegate.visitCompleted(this);\n }\n }\n }\n fail() {\n if (this.state == VisitState.started) {\n this.state = VisitState.failed;\n this.adapter.visitFailed(this);\n }\n }\n changeHistory() {\n var _a;\n if (!this.historyChanged && this.updateHistory) {\n const actionForHistory = this.location.href === ((_a = this.referrer) === null || _a === void 0 ? void 0 : _a.href) ? \"replace\" : this.action;\n const method = getHistoryMethodForAction(actionForHistory);\n this.history.update(method, this.location, this.restorationIdentifier);\n this.historyChanged = true;\n }\n }\n issueRequest() {\n if (this.hasPreloadedResponse()) {\n this.simulateRequest();\n }\n else if (this.shouldIssueRequest() && !this.request) {\n this.request = new FetchRequest(this, FetchMethod.get, this.location);\n this.request.perform();\n }\n }\n simulateRequest() {\n if (this.response) {\n this.startRequest();\n this.recordResponse();\n this.finishRequest();\n }\n }\n startRequest() {\n this.recordTimingMetric(TimingMetric.requestStart);\n this.adapter.visitRequestStarted(this);\n }\n recordResponse(response = this.response) {\n this.response = response;\n if (response) {\n const { statusCode } = response;\n if (isSuccessful(statusCode)) {\n this.adapter.visitRequestCompleted(this);\n }\n else {\n this.adapter.visitRequestFailedWithStatusCode(this, statusCode);\n }\n }\n }\n finishRequest() {\n this.recordTimingMetric(TimingMetric.requestEnd);\n this.adapter.visitRequestFinished(this);\n }\n loadResponse() {\n if (this.response) {\n const { statusCode, responseHTML } = this.response;\n this.render(async () => {\n if (this.shouldCacheSnapshot)\n this.cacheSnapshot();\n if (this.view.renderPromise)\n await this.view.renderPromise;\n if (isSuccessful(statusCode) && responseHTML != null) {\n await this.view.renderPage(PageSnapshot.fromHTMLString(responseHTML), false, this.willRender, this);\n this.performScroll();\n this.adapter.visitRendered(this);\n this.complete();\n }\n else {\n await this.view.renderError(PageSnapshot.fromHTMLString(responseHTML), this);\n this.adapter.visitRendered(this);\n this.fail();\n }\n });\n }\n }\n getCachedSnapshot() {\n const snapshot = this.view.getCachedSnapshotForLocation(this.location) || this.getPreloadedSnapshot();\n if (snapshot && (!getAnchor(this.location) || snapshot.hasAnchor(getAnchor(this.location)))) {\n if (this.action == \"restore\" || snapshot.isPreviewable) {\n return snapshot;\n }\n }\n }\n getPreloadedSnapshot() {\n if (this.snapshotHTML) {\n return PageSnapshot.fromHTMLString(this.snapshotHTML);\n }\n }\n hasCachedSnapshot() {\n return this.getCachedSnapshot() != null;\n }\n loadCachedSnapshot() {\n const snapshot = this.getCachedSnapshot();\n if (snapshot) {\n const isPreview = this.shouldIssueRequest();\n this.render(async () => {\n this.cacheSnapshot();\n if (this.isSamePage) {\n this.adapter.visitRendered(this);\n }\n else {\n if (this.view.renderPromise)\n await this.view.renderPromise;\n await this.view.renderPage(snapshot, isPreview, this.willRender, this);\n this.performScroll();\n this.adapter.visitRendered(this);\n if (!isPreview) {\n this.complete();\n }\n }\n });\n }\n }\n followRedirect() {\n var _a;\n if (this.redirectedToLocation && !this.followedRedirect && ((_a = this.response) === null || _a === void 0 ? void 0 : _a.redirected)) {\n this.adapter.visitProposedToLocation(this.redirectedToLocation, {\n action: \"replace\",\n response: this.response,\n });\n this.followedRedirect = true;\n }\n }\n goToSamePageAnchor() {\n if (this.isSamePage) {\n this.render(async () => {\n this.cacheSnapshot();\n this.performScroll();\n this.changeHistory();\n this.adapter.visitRendered(this);\n });\n }\n }\n prepareHeadersForRequest(headers, request) {\n if (this.acceptsStreamResponse) {\n request.acceptResponseType(StreamMessage.contentType);\n }\n }\n requestStarted() {\n this.startRequest();\n }\n requestPreventedHandlingResponse(_request, _response) { }\n async requestSucceededWithResponse(request, response) {\n const responseHTML = await response.responseHTML;\n const { redirected, statusCode } = response;\n if (responseHTML == undefined) {\n this.recordResponse({\n statusCode: SystemStatusCode.contentTypeMismatch,\n redirected,\n });\n }\n else {\n this.redirectedToLocation = response.redirected ? response.location : undefined;\n this.recordResponse({ statusCode: statusCode, responseHTML, redirected });\n }\n }\n async requestFailedWithResponse(request, response) {\n const responseHTML = await response.responseHTML;\n const { redirected, statusCode } = response;\n if (responseHTML == undefined) {\n this.recordResponse({\n statusCode: SystemStatusCode.contentTypeMismatch,\n redirected,\n });\n }\n else {\n this.recordResponse({ statusCode: statusCode, responseHTML, redirected });\n }\n }\n requestErrored(_request, _error) {\n this.recordResponse({\n statusCode: SystemStatusCode.networkFailure,\n redirected: false,\n });\n }\n requestFinished() {\n this.finishRequest();\n }\n performScroll() {\n if (!this.scrolled && !this.view.forceReloaded) {\n if (this.action == \"restore\") {\n this.scrollToRestoredPosition() || this.scrollToAnchor() || this.view.scrollToTop();\n }\n else {\n this.scrollToAnchor() || this.view.scrollToTop();\n }\n if (this.isSamePage) {\n this.delegate.visitScrolledToSamePageLocation(this.view.lastRenderedLocation, this.location);\n }\n this.scrolled = true;\n }\n }\n scrollToRestoredPosition() {\n const { scrollPosition } = this.restorationData;\n if (scrollPosition) {\n this.view.scrollToPosition(scrollPosition);\n return true;\n }\n }\n scrollToAnchor() {\n const anchor = getAnchor(this.location);\n if (anchor != null) {\n this.view.scrollToAnchor(anchor);\n return true;\n }\n }\n recordTimingMetric(metric) {\n this.timingMetrics[metric] = new Date().getTime();\n }\n getTimingMetrics() {\n return Object.assign({}, this.timingMetrics);\n }\n getHistoryMethodForAction(action) {\n switch (action) {\n case \"replace\":\n return history.replaceState;\n case \"advance\":\n case \"restore\":\n return history.pushState;\n }\n }\n hasPreloadedResponse() {\n return typeof this.response == \"object\";\n }\n shouldIssueRequest() {\n if (this.isSamePage) {\n return false;\n }\n else if (this.action == \"restore\") {\n return !this.hasCachedSnapshot();\n }\n else {\n return this.willRender;\n }\n }\n cacheSnapshot() {\n if (!this.snapshotCached) {\n this.view.cacheSnapshot(this.snapshot).then((snapshot) => snapshot && this.visitCachedSnapshot(snapshot));\n this.snapshotCached = true;\n }\n }\n async render(callback) {\n this.cancelRender();\n await new Promise((resolve) => {\n this.frame = requestAnimationFrame(() => resolve());\n });\n await callback();\n delete this.frame;\n }\n cancelRender() {\n if (this.frame) {\n cancelAnimationFrame(this.frame);\n delete this.frame;\n }\n }\n}\nfunction isSuccessful(statusCode) {\n return statusCode >= 200 && statusCode < 300;\n}\n\nclass BrowserAdapter {\n constructor(session) {\n this.progressBar = new ProgressBar();\n this.showProgressBar = () => {\n this.progressBar.show();\n };\n this.session = session;\n }\n visitProposedToLocation(location, options) {\n this.navigator.startVisit(location, (options === null || options === void 0 ? void 0 : options.restorationIdentifier) || uuid(), options);\n }\n visitStarted(visit) {\n this.location = visit.location;\n visit.loadCachedSnapshot();\n visit.issueRequest();\n visit.goToSamePageAnchor();\n }\n visitRequestStarted(visit) {\n this.progressBar.setValue(0);\n if (visit.hasCachedSnapshot() || visit.action != \"restore\") {\n this.showVisitProgressBarAfterDelay();\n }\n else {\n this.showProgressBar();\n }\n }\n visitRequestCompleted(visit) {\n visit.loadResponse();\n }\n visitRequestFailedWithStatusCode(visit, statusCode) {\n switch (statusCode) {\n case SystemStatusCode.networkFailure:\n case SystemStatusCode.timeoutFailure:\n case SystemStatusCode.contentTypeMismatch:\n return this.reload({\n reason: \"request_failed\",\n context: {\n statusCode,\n },\n });\n default:\n return visit.loadResponse();\n }\n }\n visitRequestFinished(_visit) {\n this.progressBar.setValue(1);\n this.hideVisitProgressBar();\n }\n visitCompleted(_visit) { }\n pageInvalidated(reason) {\n this.reload(reason);\n }\n visitFailed(_visit) { }\n visitRendered(_visit) { }\n formSubmissionStarted(_formSubmission) {\n this.progressBar.setValue(0);\n this.showFormProgressBarAfterDelay();\n }\n formSubmissionFinished(_formSubmission) {\n this.progressBar.setValue(1);\n this.hideFormProgressBar();\n }\n showVisitProgressBarAfterDelay() {\n this.visitProgressBarTimeout = window.setTimeout(this.showProgressBar, this.session.progressBarDelay);\n }\n hideVisitProgressBar() {\n this.progressBar.hide();\n if (this.visitProgressBarTimeout != null) {\n window.clearTimeout(this.visitProgressBarTimeout);\n delete this.visitProgressBarTimeout;\n }\n }\n showFormProgressBarAfterDelay() {\n if (this.formProgressBarTimeout == null) {\n this.formProgressBarTimeout = window.setTimeout(this.showProgressBar, this.session.progressBarDelay);\n }\n }\n hideFormProgressBar() {\n this.progressBar.hide();\n if (this.formProgressBarTimeout != null) {\n window.clearTimeout(this.formProgressBarTimeout);\n delete this.formProgressBarTimeout;\n }\n }\n reload(reason) {\n var _a;\n dispatch(\"turbo:reload\", { detail: reason });\n window.location.href = ((_a = this.location) === null || _a === void 0 ? void 0 : _a.toString()) || window.location.href;\n }\n get navigator() {\n return this.session.navigator;\n }\n}\n\nclass CacheObserver {\n constructor() {\n this.started = false;\n this.removeStaleElements = ((_event) => {\n const staleElements = [...document.querySelectorAll('[data-turbo-cache=\"false\"]')];\n for (const element of staleElements) {\n element.remove();\n }\n });\n }\n start() {\n if (!this.started) {\n this.started = true;\n addEventListener(\"turbo:before-cache\", this.removeStaleElements, false);\n }\n }\n stop() {\n if (this.started) {\n this.started = false;\n removeEventListener(\"turbo:before-cache\", this.removeStaleElements, false);\n }\n }\n}\n\nclass FrameRedirector {\n constructor(session, element) {\n this.session = session;\n this.element = element;\n this.linkInterceptor = new LinkInterceptor(this, element);\n this.formSubmitObserver = new FormSubmitObserver(this, element);\n }\n start() {\n this.linkInterceptor.start();\n this.formSubmitObserver.start();\n }\n stop() {\n this.linkInterceptor.stop();\n this.formSubmitObserver.stop();\n }\n shouldInterceptLinkClick(element, _location, _event) {\n return this.shouldRedirect(element);\n }\n linkClickIntercepted(element, url, event) {\n const frame = this.findFrameElement(element);\n if (frame) {\n frame.delegate.linkClickIntercepted(element, url, event);\n }\n }\n willSubmitForm(element, submitter) {\n return (element.closest(\"turbo-frame\") == null &&\n this.shouldSubmit(element, submitter) &&\n this.shouldRedirect(element, submitter));\n }\n formSubmitted(element, submitter) {\n const frame = this.findFrameElement(element, submitter);\n if (frame) {\n frame.delegate.formSubmitted(element, submitter);\n }\n }\n shouldSubmit(form, submitter) {\n var _a;\n const action = getAction(form, submitter);\n const meta = this.element.ownerDocument.querySelector(`meta[name=\"turbo-root\"]`);\n const rootLocation = expandURL((_a = meta === null || meta === void 0 ? void 0 : meta.content) !== null && _a !== void 0 ? _a : \"/\");\n return this.shouldRedirect(form, submitter) && locationIsVisitable(action, rootLocation);\n }\n shouldRedirect(element, submitter) {\n const isNavigatable = element instanceof HTMLFormElement\n ? this.session.submissionIsNavigatable(element, submitter)\n : this.session.elementIsNavigatable(element);\n if (isNavigatable) {\n const frame = this.findFrameElement(element, submitter);\n return frame ? frame != element.closest(\"turbo-frame\") : false;\n }\n else {\n return false;\n }\n }\n findFrameElement(element, submitter) {\n const id = (submitter === null || submitter === void 0 ? void 0 : submitter.getAttribute(\"data-turbo-frame\")) || element.getAttribute(\"data-turbo-frame\");\n if (id && id != \"_top\") {\n const frame = this.element.querySelector(`#${id}:not([disabled])`);\n if (frame instanceof FrameElement) {\n return frame;\n }\n }\n }\n}\n\nclass History {\n constructor(delegate) {\n this.restorationIdentifier = uuid();\n this.restorationData = {};\n this.started = false;\n this.pageLoaded = false;\n this.onPopState = (event) => {\n if (this.shouldHandlePopState()) {\n const { turbo } = event.state || {};\n if (turbo) {\n this.location = new URL(window.location.href);\n const { restorationIdentifier } = turbo;\n this.restorationIdentifier = restorationIdentifier;\n this.delegate.historyPoppedToLocationWithRestorationIdentifier(this.location, restorationIdentifier);\n }\n }\n };\n this.onPageLoad = async (_event) => {\n await nextMicrotask();\n this.pageLoaded = true;\n };\n this.delegate = delegate;\n }\n start() {\n if (!this.started) {\n addEventListener(\"popstate\", this.onPopState, false);\n addEventListener(\"load\", this.onPageLoad, false);\n this.started = true;\n this.replace(new URL(window.location.href));\n }\n }\n stop() {\n if (this.started) {\n removeEventListener(\"popstate\", this.onPopState, false);\n removeEventListener(\"load\", this.onPageLoad, false);\n this.started = false;\n }\n }\n push(location, restorationIdentifier) {\n this.update(history.pushState, location, restorationIdentifier);\n }\n replace(location, restorationIdentifier) {\n this.update(history.replaceState, location, restorationIdentifier);\n }\n update(method, location, restorationIdentifier = uuid()) {\n const state = { turbo: { restorationIdentifier } };\n method.call(history, state, \"\", location.href);\n this.location = location;\n this.restorationIdentifier = restorationIdentifier;\n }\n getRestorationDataForIdentifier(restorationIdentifier) {\n return this.restorationData[restorationIdentifier] || {};\n }\n updateRestorationData(additionalData) {\n const { restorationIdentifier } = this;\n const restorationData = this.restorationData[restorationIdentifier];\n this.restorationData[restorationIdentifier] = Object.assign(Object.assign({}, restorationData), additionalData);\n }\n assumeControlOfScrollRestoration() {\n var _a;\n if (!this.previousScrollRestoration) {\n this.previousScrollRestoration = (_a = history.scrollRestoration) !== null && _a !== void 0 ? _a : \"auto\";\n history.scrollRestoration = \"manual\";\n }\n }\n relinquishControlOfScrollRestoration() {\n if (this.previousScrollRestoration) {\n history.scrollRestoration = this.previousScrollRestoration;\n delete this.previousScrollRestoration;\n }\n }\n shouldHandlePopState() {\n return this.pageIsLoaded();\n }\n pageIsLoaded() {\n return this.pageLoaded || document.readyState == \"complete\";\n }\n}\n\nclass Navigator {\n constructor(delegate) {\n this.delegate = delegate;\n }\n proposeVisit(location, options = {}) {\n if (this.delegate.allowsVisitingLocationWithAction(location, options.action)) {\n if (locationIsVisitable(location, this.view.snapshot.rootLocation)) {\n this.delegate.visitProposedToLocation(location, options);\n }\n else {\n window.location.href = location.toString();\n }\n }\n }\n startVisit(locatable, restorationIdentifier, options = {}) {\n this.stop();\n this.currentVisit = new Visit(this, expandURL(locatable), restorationIdentifier, Object.assign({ referrer: this.location }, options));\n this.currentVisit.start();\n }\n submitForm(form, submitter) {\n this.stop();\n this.formSubmission = new FormSubmission(this, form, submitter, true);\n this.formSubmission.start();\n }\n stop() {\n if (this.formSubmission) {\n this.formSubmission.stop();\n delete this.formSubmission;\n }\n if (this.currentVisit) {\n this.currentVisit.cancel();\n delete this.currentVisit;\n }\n }\n get adapter() {\n return this.delegate.adapter;\n }\n get view() {\n return this.delegate.view;\n }\n get history() {\n return this.delegate.history;\n }\n formSubmissionStarted(formSubmission) {\n if (typeof this.adapter.formSubmissionStarted === \"function\") {\n this.adapter.formSubmissionStarted(formSubmission);\n }\n }\n async formSubmissionSucceededWithResponse(formSubmission, fetchResponse) {\n if (formSubmission == this.formSubmission) {\n const responseHTML = await fetchResponse.responseHTML;\n if (responseHTML) {\n const shouldCacheSnapshot = formSubmission.method == FetchMethod.get;\n if (!shouldCacheSnapshot) {\n this.view.clearSnapshotCache();\n }\n const { statusCode, redirected } = fetchResponse;\n const action = this.getActionForFormSubmission(formSubmission);\n const visitOptions = {\n action,\n shouldCacheSnapshot,\n response: { statusCode, responseHTML, redirected },\n };\n this.proposeVisit(fetchResponse.location, visitOptions);\n }\n }\n }\n async formSubmissionFailedWithResponse(formSubmission, fetchResponse) {\n const responseHTML = await fetchResponse.responseHTML;\n if (responseHTML) {\n const snapshot = PageSnapshot.fromHTMLString(responseHTML);\n if (fetchResponse.serverError) {\n await this.view.renderError(snapshot, this.currentVisit);\n }\n else {\n await this.view.renderPage(snapshot, false, true, this.currentVisit);\n }\n this.view.scrollToTop();\n this.view.clearSnapshotCache();\n }\n }\n formSubmissionErrored(formSubmission, error) {\n console.error(error);\n }\n formSubmissionFinished(formSubmission) {\n if (typeof this.adapter.formSubmissionFinished === \"function\") {\n this.adapter.formSubmissionFinished(formSubmission);\n }\n }\n visitStarted(visit) {\n this.delegate.visitStarted(visit);\n }\n visitCompleted(visit) {\n this.delegate.visitCompleted(visit);\n }\n locationWithActionIsSamePage(location, action) {\n const anchor = getAnchor(location);\n const currentAnchor = getAnchor(this.view.lastRenderedLocation);\n const isRestorationToTop = action === \"restore\" && typeof anchor === \"undefined\";\n return (action !== \"replace\" &&\n getRequestURL(location) === getRequestURL(this.view.lastRenderedLocation) &&\n (isRestorationToTop || (anchor != null && anchor !== currentAnchor)));\n }\n visitScrolledToSamePageLocation(oldURL, newURL) {\n this.delegate.visitScrolledToSamePageLocation(oldURL, newURL);\n }\n get location() {\n return this.history.location;\n }\n get restorationIdentifier() {\n return this.history.restorationIdentifier;\n }\n getActionForFormSubmission(formSubmission) {\n const { formElement, submitter } = formSubmission;\n const action = getAttribute(\"data-turbo-action\", submitter, formElement);\n return isAction(action) ? action : \"advance\";\n }\n}\n\nvar PageStage;\n(function (PageStage) {\n PageStage[PageStage[\"initial\"] = 0] = \"initial\";\n PageStage[PageStage[\"loading\"] = 1] = \"loading\";\n PageStage[PageStage[\"interactive\"] = 2] = \"interactive\";\n PageStage[PageStage[\"complete\"] = 3] = \"complete\";\n})(PageStage || (PageStage = {}));\nclass PageObserver {\n constructor(delegate) {\n this.stage = PageStage.initial;\n this.started = false;\n this.interpretReadyState = () => {\n const { readyState } = this;\n if (readyState == \"interactive\") {\n this.pageIsInteractive();\n }\n else if (readyState == \"complete\") {\n this.pageIsComplete();\n }\n };\n this.pageWillUnload = () => {\n this.delegate.pageWillUnload();\n };\n this.delegate = delegate;\n }\n start() {\n if (!this.started) {\n if (this.stage == PageStage.initial) {\n this.stage = PageStage.loading;\n }\n document.addEventListener(\"readystatechange\", this.interpretReadyState, false);\n addEventListener(\"pagehide\", this.pageWillUnload, false);\n this.started = true;\n }\n }\n stop() {\n if (this.started) {\n document.removeEventListener(\"readystatechange\", this.interpretReadyState, false);\n removeEventListener(\"pagehide\", this.pageWillUnload, false);\n this.started = false;\n }\n }\n pageIsInteractive() {\n if (this.stage == PageStage.loading) {\n this.stage = PageStage.interactive;\n this.delegate.pageBecameInteractive();\n }\n }\n pageIsComplete() {\n this.pageIsInteractive();\n if (this.stage == PageStage.interactive) {\n this.stage = PageStage.complete;\n this.delegate.pageLoaded();\n }\n }\n get readyState() {\n return document.readyState;\n }\n}\n\nclass ScrollObserver {\n constructor(delegate) {\n this.started = false;\n this.onScroll = () => {\n this.updatePosition({ x: window.pageXOffset, y: window.pageYOffset });\n };\n this.delegate = delegate;\n }\n start() {\n if (!this.started) {\n addEventListener(\"scroll\", this.onScroll, false);\n this.onScroll();\n this.started = true;\n }\n }\n stop() {\n if (this.started) {\n removeEventListener(\"scroll\", this.onScroll, false);\n this.started = false;\n }\n }\n updatePosition(position) {\n this.delegate.scrollPositionChanged(position);\n }\n}\n\nclass StreamMessageRenderer {\n render({ fragment }) {\n Bardo.preservingPermanentElements(this, getPermanentElementMapForFragment(fragment), () => document.documentElement.appendChild(fragment));\n }\n enteringBardo(currentPermanentElement, newPermanentElement) {\n newPermanentElement.replaceWith(currentPermanentElement.cloneNode(true));\n }\n leavingBardo() { }\n}\nfunction getPermanentElementMapForFragment(fragment) {\n const permanentElementsInDocument = queryPermanentElementsAll(document.documentElement);\n const permanentElementMap = {};\n for (const permanentElementInDocument of permanentElementsInDocument) {\n const { id } = permanentElementInDocument;\n for (const streamElement of fragment.querySelectorAll(\"turbo-stream\")) {\n const elementInStream = getPermanentElementById(streamElement.templateElement.content, id);\n if (elementInStream) {\n permanentElementMap[id] = [permanentElementInDocument, elementInStream];\n }\n }\n }\n return permanentElementMap;\n}\n\nclass StreamObserver {\n constructor(delegate) {\n this.sources = new Set();\n this.started = false;\n this.inspectFetchResponse = ((event) => {\n const response = fetchResponseFromEvent(event);\n if (response && fetchResponseIsStream(response)) {\n event.preventDefault();\n this.receiveMessageResponse(response);\n }\n });\n this.receiveMessageEvent = (event) => {\n if (this.started && typeof event.data == \"string\") {\n this.receiveMessageHTML(event.data);\n }\n };\n this.delegate = delegate;\n }\n start() {\n if (!this.started) {\n this.started = true;\n addEventListener(\"turbo:before-fetch-response\", this.inspectFetchResponse, false);\n }\n }\n stop() {\n if (this.started) {\n this.started = false;\n removeEventListener(\"turbo:before-fetch-response\", this.inspectFetchResponse, false);\n }\n }\n connectStreamSource(source) {\n if (!this.streamSourceIsConnected(source)) {\n this.sources.add(source);\n source.addEventListener(\"message\", this.receiveMessageEvent, false);\n }\n }\n disconnectStreamSource(source) {\n if (this.streamSourceIsConnected(source)) {\n this.sources.delete(source);\n source.removeEventListener(\"message\", this.receiveMessageEvent, false);\n }\n }\n streamSourceIsConnected(source) {\n return this.sources.has(source);\n }\n async receiveMessageResponse(response) {\n const html = await response.responseHTML;\n if (html) {\n this.receiveMessageHTML(html);\n }\n }\n receiveMessageHTML(html) {\n this.delegate.receivedMessageFromStream(StreamMessage.wrap(html));\n }\n}\nfunction fetchResponseFromEvent(event) {\n var _a;\n const fetchResponse = (_a = event.detail) === null || _a === void 0 ? void 0 : _a.fetchResponse;\n if (fetchResponse instanceof FetchResponse) {\n return fetchResponse;\n }\n}\nfunction fetchResponseIsStream(response) {\n var _a;\n const contentType = (_a = response.contentType) !== null && _a !== void 0 ? _a : \"\";\n return contentType.startsWith(StreamMessage.contentType);\n}\n\nclass ErrorRenderer extends Renderer {\n static renderElement(currentElement, newElement) {\n const { documentElement, body } = document;\n documentElement.replaceChild(newElement, body);\n }\n async render() {\n this.replaceHeadAndBody();\n this.activateScriptElements();\n }\n replaceHeadAndBody() {\n const { documentElement, head } = document;\n documentElement.replaceChild(this.newHead, head);\n this.renderElement(this.currentElement, this.newElement);\n }\n activateScriptElements() {\n for (const replaceableElement of this.scriptElements) {\n const parentNode = replaceableElement.parentNode;\n if (parentNode) {\n const element = activateScriptElement(replaceableElement);\n parentNode.replaceChild(element, replaceableElement);\n }\n }\n }\n get newHead() {\n return this.newSnapshot.headSnapshot.element;\n }\n get scriptElements() {\n return document.documentElement.querySelectorAll(\"script\");\n }\n}\n\nclass PageRenderer extends Renderer {\n static renderElement(currentElement, newElement) {\n if (document.body && newElement instanceof HTMLBodyElement) {\n document.body.replaceWith(newElement);\n }\n else {\n document.documentElement.appendChild(newElement);\n }\n }\n get shouldRender() {\n return this.newSnapshot.isVisitable && this.trackedElementsAreIdentical;\n }\n get reloadReason() {\n if (!this.newSnapshot.isVisitable) {\n return {\n reason: \"turbo_visit_control_is_reload\",\n };\n }\n if (!this.trackedElementsAreIdentical) {\n return {\n reason: \"tracked_element_mismatch\",\n };\n }\n }\n async prepareToRender() {\n await this.mergeHead();\n }\n async render() {\n if (this.willRender) {\n this.replaceBody();\n }\n }\n finishRendering() {\n super.finishRendering();\n if (!this.isPreview) {\n this.focusFirstAutofocusableElement();\n }\n }\n get currentHeadSnapshot() {\n return this.currentSnapshot.headSnapshot;\n }\n get newHeadSnapshot() {\n return this.newSnapshot.headSnapshot;\n }\n get newElement() {\n return this.newSnapshot.element;\n }\n async mergeHead() {\n const newStylesheetElements = this.copyNewHeadStylesheetElements();\n this.copyNewHeadScriptElements();\n this.removeCurrentHeadProvisionalElements();\n this.copyNewHeadProvisionalElements();\n await newStylesheetElements;\n }\n replaceBody() {\n this.preservingPermanentElements(() => {\n this.activateNewBody();\n this.assignNewBody();\n });\n }\n get trackedElementsAreIdentical() {\n return this.currentHeadSnapshot.trackedElementSignature == this.newHeadSnapshot.trackedElementSignature;\n }\n async copyNewHeadStylesheetElements() {\n const loadingElements = [];\n for (const element of this.newHeadStylesheetElements) {\n loadingElements.push(waitForLoad(element));\n document.head.appendChild(element);\n }\n await Promise.all(loadingElements);\n }\n copyNewHeadScriptElements() {\n for (const element of this.newHeadScriptElements) {\n document.head.appendChild(activateScriptElement(element));\n }\n }\n removeCurrentHeadProvisionalElements() {\n for (const element of this.currentHeadProvisionalElements) {\n document.head.removeChild(element);\n }\n }\n copyNewHeadProvisionalElements() {\n for (const element of this.newHeadProvisionalElements) {\n document.head.appendChild(element);\n }\n }\n activateNewBody() {\n document.adoptNode(this.newElement);\n this.activateNewBodyScriptElements();\n }\n activateNewBodyScriptElements() {\n for (const inertScriptElement of this.newBodyScriptElements) {\n const activatedScriptElement = activateScriptElement(inertScriptElement);\n inertScriptElement.replaceWith(activatedScriptElement);\n }\n }\n assignNewBody() {\n this.renderElement(this.currentElement, this.newElement);\n }\n get newHeadStylesheetElements() {\n return this.newHeadSnapshot.getStylesheetElementsNotInSnapshot(this.currentHeadSnapshot);\n }\n get newHeadScriptElements() {\n return this.newHeadSnapshot.getScriptElementsNotInSnapshot(this.currentHeadSnapshot);\n }\n get currentHeadProvisionalElements() {\n return this.currentHeadSnapshot.provisionalElements;\n }\n get newHeadProvisionalElements() {\n return this.newHeadSnapshot.provisionalElements;\n }\n get newBodyScriptElements() {\n return this.newElement.querySelectorAll(\"script\");\n }\n}\n\nclass SnapshotCache {\n constructor(size) {\n this.keys = [];\n this.snapshots = {};\n this.size = size;\n }\n has(location) {\n return toCacheKey(location) in this.snapshots;\n }\n get(location) {\n if (this.has(location)) {\n const snapshot = this.read(location);\n this.touch(location);\n return snapshot;\n }\n }\n put(location, snapshot) {\n this.write(location, snapshot);\n this.touch(location);\n return snapshot;\n }\n clear() {\n this.snapshots = {};\n }\n read(location) {\n return this.snapshots[toCacheKey(location)];\n }\n write(location, snapshot) {\n this.snapshots[toCacheKey(location)] = snapshot;\n }\n touch(location) {\n const key = toCacheKey(location);\n const index = this.keys.indexOf(key);\n if (index > -1)\n this.keys.splice(index, 1);\n this.keys.unshift(key);\n this.trim();\n }\n trim() {\n for (const key of this.keys.splice(this.size)) {\n delete this.snapshots[key];\n }\n }\n}\n\nclass PageView extends View {\n constructor() {\n super(...arguments);\n this.snapshotCache = new SnapshotCache(10);\n this.lastRenderedLocation = new URL(location.href);\n this.forceReloaded = false;\n }\n renderPage(snapshot, isPreview = false, willRender = true, visit) {\n const renderer = new PageRenderer(this.snapshot, snapshot, PageRenderer.renderElement, isPreview, willRender);\n if (!renderer.shouldRender) {\n this.forceReloaded = true;\n }\n else {\n visit === null || visit === void 0 ? void 0 : visit.changeHistory();\n }\n return this.render(renderer);\n }\n renderError(snapshot, visit) {\n visit === null || visit === void 0 ? void 0 : visit.changeHistory();\n const renderer = new ErrorRenderer(this.snapshot, snapshot, ErrorRenderer.renderElement, false);\n return this.render(renderer);\n }\n clearSnapshotCache() {\n this.snapshotCache.clear();\n }\n async cacheSnapshot(snapshot = this.snapshot) {\n if (snapshot.isCacheable) {\n this.delegate.viewWillCacheSnapshot();\n const { lastRenderedLocation: location } = this;\n await nextEventLoopTick();\n const cachedSnapshot = snapshot.clone();\n this.snapshotCache.put(location, cachedSnapshot);\n return cachedSnapshot;\n }\n }\n getCachedSnapshotForLocation(location) {\n return this.snapshotCache.get(location);\n }\n get snapshot() {\n return PageSnapshot.fromElement(this.element);\n }\n}\n\nclass Preloader {\n constructor(delegate) {\n this.selector = \"a[data-turbo-preload]\";\n this.delegate = delegate;\n }\n get snapshotCache() {\n return this.delegate.navigator.view.snapshotCache;\n }\n start() {\n if (document.readyState === \"loading\") {\n return document.addEventListener(\"DOMContentLoaded\", () => {\n this.preloadOnLoadLinksForView(document.body);\n });\n }\n else {\n this.preloadOnLoadLinksForView(document.body);\n }\n }\n preloadOnLoadLinksForView(element) {\n for (const link of element.querySelectorAll(this.selector)) {\n this.preloadURL(link);\n }\n }\n async preloadURL(link) {\n const location = new URL(link.href);\n if (this.snapshotCache.has(location)) {\n return;\n }\n try {\n const response = await fetch(location.toString(), { headers: { \"VND.PREFETCH\": \"true\", Accept: \"text/html\" } });\n const responseText = await response.text();\n const snapshot = PageSnapshot.fromHTMLString(responseText);\n this.snapshotCache.put(location, snapshot);\n }\n catch (_) {\n }\n }\n}\n\nclass Session {\n constructor() {\n this.navigator = new Navigator(this);\n this.history = new History(this);\n this.preloader = new Preloader(this);\n this.view = new PageView(this, document.documentElement);\n this.adapter = new BrowserAdapter(this);\n this.pageObserver = new PageObserver(this);\n this.cacheObserver = new CacheObserver();\n this.linkClickObserver = new LinkClickObserver(this, window);\n this.formSubmitObserver = new FormSubmitObserver(this, document);\n this.scrollObserver = new ScrollObserver(this);\n this.streamObserver = new StreamObserver(this);\n this.formLinkClickObserver = new FormLinkClickObserver(this, document.documentElement);\n this.frameRedirector = new FrameRedirector(this, document.documentElement);\n this.streamMessageRenderer = new StreamMessageRenderer();\n this.drive = true;\n this.enabled = true;\n this.progressBarDelay = 500;\n this.started = false;\n this.formMode = \"on\";\n }\n start() {\n if (!this.started) {\n this.pageObserver.start();\n this.cacheObserver.start();\n this.formLinkClickObserver.start();\n this.linkClickObserver.start();\n this.formSubmitObserver.start();\n this.scrollObserver.start();\n this.streamObserver.start();\n this.frameRedirector.start();\n this.history.start();\n this.preloader.start();\n this.started = true;\n this.enabled = true;\n }\n }\n disable() {\n this.enabled = false;\n }\n stop() {\n if (this.started) {\n this.pageObserver.stop();\n this.cacheObserver.stop();\n this.formLinkClickObserver.stop();\n this.linkClickObserver.stop();\n this.formSubmitObserver.stop();\n this.scrollObserver.stop();\n this.streamObserver.stop();\n this.frameRedirector.stop();\n this.history.stop();\n this.started = false;\n }\n }\n registerAdapter(adapter) {\n this.adapter = adapter;\n }\n visit(location, options = {}) {\n const frameElement = options.frame ? document.getElementById(options.frame) : null;\n if (frameElement instanceof FrameElement) {\n frameElement.src = location.toString();\n frameElement.loaded;\n }\n else {\n this.navigator.proposeVisit(expandURL(location), options);\n }\n }\n connectStreamSource(source) {\n this.streamObserver.connectStreamSource(source);\n }\n disconnectStreamSource(source) {\n this.streamObserver.disconnectStreamSource(source);\n }\n renderStreamMessage(message) {\n this.streamMessageRenderer.render(StreamMessage.wrap(message));\n }\n clearCache() {\n this.view.clearSnapshotCache();\n }\n setProgressBarDelay(delay) {\n this.progressBarDelay = delay;\n }\n setFormMode(mode) {\n this.formMode = mode;\n }\n get location() {\n return this.history.location;\n }\n get restorationIdentifier() {\n return this.history.restorationIdentifier;\n }\n historyPoppedToLocationWithRestorationIdentifier(location, restorationIdentifier) {\n if (this.enabled) {\n this.navigator.startVisit(location, restorationIdentifier, {\n action: \"restore\",\n historyChanged: true,\n });\n }\n else {\n this.adapter.pageInvalidated({\n reason: \"turbo_disabled\",\n });\n }\n }\n scrollPositionChanged(position) {\n this.history.updateRestorationData({ scrollPosition: position });\n }\n willSubmitFormLinkToLocation(link, location) {\n return this.elementIsNavigatable(link) && locationIsVisitable(location, this.snapshot.rootLocation);\n }\n submittedFormLinkToLocation() { }\n willFollowLinkToLocation(link, location, event) {\n return (this.elementIsNavigatable(link) &&\n locationIsVisitable(location, this.snapshot.rootLocation) &&\n this.applicationAllowsFollowingLinkToLocation(link, location, event));\n }\n followedLinkToLocation(link, location) {\n const action = this.getActionForLink(link);\n const acceptsStreamResponse = link.hasAttribute(\"data-turbo-stream\");\n this.visit(location.href, { action, acceptsStreamResponse });\n }\n allowsVisitingLocationWithAction(location, action) {\n return this.locationWithActionIsSamePage(location, action) || this.applicationAllowsVisitingLocation(location);\n }\n visitProposedToLocation(location, options) {\n extendURLWithDeprecatedProperties(location);\n this.adapter.visitProposedToLocation(location, options);\n }\n visitStarted(visit) {\n if (!visit.acceptsStreamResponse) {\n markAsBusy(document.documentElement);\n }\n extendURLWithDeprecatedProperties(visit.location);\n if (!visit.silent) {\n this.notifyApplicationAfterVisitingLocation(visit.location, visit.action);\n }\n }\n visitCompleted(visit) {\n clearBusyState(document.documentElement);\n this.notifyApplicationAfterPageLoad(visit.getTimingMetrics());\n }\n locationWithActionIsSamePage(location, action) {\n return this.navigator.locationWithActionIsSamePage(location, action);\n }\n visitScrolledToSamePageLocation(oldURL, newURL) {\n this.notifyApplicationAfterVisitingSamePageLocation(oldURL, newURL);\n }\n willSubmitForm(form, submitter) {\n const action = getAction(form, submitter);\n return (this.submissionIsNavigatable(form, submitter) &&\n locationIsVisitable(expandURL(action), this.snapshot.rootLocation));\n }\n formSubmitted(form, submitter) {\n this.navigator.submitForm(form, submitter);\n }\n pageBecameInteractive() {\n this.view.lastRenderedLocation = this.location;\n this.notifyApplicationAfterPageLoad();\n }\n pageLoaded() {\n this.history.assumeControlOfScrollRestoration();\n }\n pageWillUnload() {\n this.history.relinquishControlOfScrollRestoration();\n }\n receivedMessageFromStream(message) {\n this.renderStreamMessage(message);\n }\n viewWillCacheSnapshot() {\n var _a;\n if (!((_a = this.navigator.currentVisit) === null || _a === void 0 ? void 0 : _a.silent)) {\n this.notifyApplicationBeforeCachingSnapshot();\n }\n }\n allowsImmediateRender({ element }, options) {\n const event = this.notifyApplicationBeforeRender(element, options);\n const { defaultPrevented, detail: { render }, } = event;\n if (this.view.renderer && render) {\n this.view.renderer.renderElement = render;\n }\n return !defaultPrevented;\n }\n viewRenderedSnapshot(_snapshot, _isPreview) {\n this.view.lastRenderedLocation = this.history.location;\n this.notifyApplicationAfterRender();\n }\n preloadOnLoadLinksForView(element) {\n this.preloader.preloadOnLoadLinksForView(element);\n }\n viewInvalidated(reason) {\n this.adapter.pageInvalidated(reason);\n }\n frameLoaded(frame) {\n this.notifyApplicationAfterFrameLoad(frame);\n }\n frameRendered(fetchResponse, frame) {\n this.notifyApplicationAfterFrameRender(fetchResponse, frame);\n }\n applicationAllowsFollowingLinkToLocation(link, location, ev) {\n const event = this.notifyApplicationAfterClickingLinkToLocation(link, location, ev);\n return !event.defaultPrevented;\n }\n applicationAllowsVisitingLocation(location) {\n const event = this.notifyApplicationBeforeVisitingLocation(location);\n return !event.defaultPrevented;\n }\n notifyApplicationAfterClickingLinkToLocation(link, location, event) {\n return dispatch(\"turbo:click\", {\n target: link,\n detail: { url: location.href, originalEvent: event },\n cancelable: true,\n });\n }\n notifyApplicationBeforeVisitingLocation(location) {\n return dispatch(\"turbo:before-visit\", {\n detail: { url: location.href },\n cancelable: true,\n });\n }\n notifyApplicationAfterVisitingLocation(location, action) {\n return dispatch(\"turbo:visit\", { detail: { url: location.href, action } });\n }\n notifyApplicationBeforeCachingSnapshot() {\n return dispatch(\"turbo:before-cache\");\n }\n notifyApplicationBeforeRender(newBody, options) {\n return dispatch(\"turbo:before-render\", {\n detail: Object.assign({ newBody }, options),\n cancelable: true,\n });\n }\n notifyApplicationAfterRender() {\n return dispatch(\"turbo:render\");\n }\n notifyApplicationAfterPageLoad(timing = {}) {\n return dispatch(\"turbo:load\", {\n detail: { url: this.location.href, timing },\n });\n }\n notifyApplicationAfterVisitingSamePageLocation(oldURL, newURL) {\n dispatchEvent(new HashChangeEvent(\"hashchange\", {\n oldURL: oldURL.toString(),\n newURL: newURL.toString(),\n }));\n }\n notifyApplicationAfterFrameLoad(frame) {\n return dispatch(\"turbo:frame-load\", { target: frame });\n }\n notifyApplicationAfterFrameRender(fetchResponse, frame) {\n return dispatch(\"turbo:frame-render\", {\n detail: { fetchResponse },\n target: frame,\n cancelable: true,\n });\n }\n submissionIsNavigatable(form, submitter) {\n if (this.formMode == \"off\") {\n return false;\n }\n else {\n const submitterIsNavigatable = submitter ? this.elementIsNavigatable(submitter) : true;\n if (this.formMode == \"optin\") {\n return submitterIsNavigatable && form.closest('[data-turbo=\"true\"]') != null;\n }\n else {\n return submitterIsNavigatable && this.elementIsNavigatable(form);\n }\n }\n }\n elementIsNavigatable(element) {\n const container = element.closest(\"[data-turbo]\");\n const withinFrame = element.closest(\"turbo-frame\");\n if (this.drive || withinFrame) {\n if (container) {\n return container.getAttribute(\"data-turbo\") != \"false\";\n }\n else {\n return true;\n }\n }\n else {\n if (container) {\n return container.getAttribute(\"data-turbo\") == \"true\";\n }\n else {\n return false;\n }\n }\n }\n getActionForLink(link) {\n const action = link.getAttribute(\"data-turbo-action\");\n return isAction(action) ? action : \"advance\";\n }\n get snapshot() {\n return this.view.snapshot;\n }\n}\nfunction extendURLWithDeprecatedProperties(url) {\n Object.defineProperties(url, deprecatedLocationPropertyDescriptors);\n}\nconst deprecatedLocationPropertyDescriptors = {\n absoluteURL: {\n get() {\n return this.toString();\n },\n },\n};\n\nclass Cache {\n constructor(session) {\n this.session = session;\n }\n clear() {\n this.session.clearCache();\n }\n resetCacheControl() {\n this.setCacheControl(\"\");\n }\n exemptPageFromCache() {\n this.setCacheControl(\"no-cache\");\n }\n exemptPageFromPreview() {\n this.setCacheControl(\"no-preview\");\n }\n setCacheControl(value) {\n setMetaContent(\"turbo-cache-control\", value);\n }\n}\n\nconst StreamActions = {\n after() {\n this.targetElements.forEach((e) => { var _a; return (_a = e.parentElement) === null || _a === void 0 ? void 0 : _a.insertBefore(this.templateContent, e.nextSibling); });\n },\n append() {\n this.removeDuplicateTargetChildren();\n this.targetElements.forEach((e) => e.append(this.templateContent));\n },\n before() {\n this.targetElements.forEach((e) => { var _a; return (_a = e.parentElement) === null || _a === void 0 ? void 0 : _a.insertBefore(this.templateContent, e); });\n },\n prepend() {\n this.removeDuplicateTargetChildren();\n this.targetElements.forEach((e) => e.prepend(this.templateContent));\n },\n remove() {\n this.targetElements.forEach((e) => e.remove());\n },\n replace() {\n this.targetElements.forEach((e) => e.replaceWith(this.templateContent));\n },\n update() {\n this.targetElements.forEach((e) => e.replaceChildren(this.templateContent));\n },\n};\n\nconst session = new Session();\nconst cache = new Cache(session);\nconst { navigator: navigator$1 } = session;\nfunction start() {\n session.start();\n}\nfunction registerAdapter(adapter) {\n session.registerAdapter(adapter);\n}\nfunction visit(location, options) {\n session.visit(location, options);\n}\nfunction connectStreamSource(source) {\n session.connectStreamSource(source);\n}\nfunction disconnectStreamSource(source) {\n session.disconnectStreamSource(source);\n}\nfunction renderStreamMessage(message) {\n session.renderStreamMessage(message);\n}\nfunction clearCache() {\n console.warn(\"Please replace `Turbo.clearCache()` with `Turbo.cache.clear()`. The top-level function is deprecated and will be removed in a future version of Turbo.`\");\n session.clearCache();\n}\nfunction setProgressBarDelay(delay) {\n session.setProgressBarDelay(delay);\n}\nfunction setConfirmMethod(confirmMethod) {\n FormSubmission.confirmMethod = confirmMethod;\n}\nfunction setFormMode(mode) {\n session.setFormMode(mode);\n}\n\nvar Turbo = /*#__PURE__*/Object.freeze({\n __proto__: null,\n navigator: navigator$1,\n session: session,\n cache: cache,\n PageRenderer: PageRenderer,\n PageSnapshot: PageSnapshot,\n FrameRenderer: FrameRenderer,\n start: start,\n registerAdapter: registerAdapter,\n visit: visit,\n connectStreamSource: connectStreamSource,\n disconnectStreamSource: disconnectStreamSource,\n renderStreamMessage: renderStreamMessage,\n clearCache: clearCache,\n setProgressBarDelay: setProgressBarDelay,\n setConfirmMethod: setConfirmMethod,\n setFormMode: setFormMode,\n StreamActions: StreamActions\n});\n\nclass FrameController {\n constructor(element) {\n this.fetchResponseLoaded = (_fetchResponse) => { };\n this.currentFetchRequest = null;\n this.resolveVisitPromise = () => { };\n this.connected = false;\n this.hasBeenLoaded = false;\n this.ignoredAttributes = new Set();\n this.action = null;\n this.visitCachedSnapshot = ({ element }) => {\n const frame = element.querySelector(\"#\" + this.element.id);\n if (frame && this.previousFrameElement) {\n frame.replaceChildren(...this.previousFrameElement.children);\n }\n delete this.previousFrameElement;\n };\n this.element = element;\n this.view = new FrameView(this, this.element);\n this.appearanceObserver = new AppearanceObserver(this, this.element);\n this.formLinkClickObserver = new FormLinkClickObserver(this, this.element);\n this.linkInterceptor = new LinkInterceptor(this, this.element);\n this.restorationIdentifier = uuid();\n this.formSubmitObserver = new FormSubmitObserver(this, this.element);\n }\n connect() {\n if (!this.connected) {\n this.connected = true;\n if (this.loadingStyle == FrameLoadingStyle.lazy) {\n this.appearanceObserver.start();\n }\n else {\n this.loadSourceURL();\n }\n this.formLinkClickObserver.start();\n this.linkInterceptor.start();\n this.formSubmitObserver.start();\n }\n }\n disconnect() {\n if (this.connected) {\n this.connected = false;\n this.appearanceObserver.stop();\n this.formLinkClickObserver.stop();\n this.linkInterceptor.stop();\n this.formSubmitObserver.stop();\n }\n }\n disabledChanged() {\n if (this.loadingStyle == FrameLoadingStyle.eager) {\n this.loadSourceURL();\n }\n }\n sourceURLChanged() {\n if (this.isIgnoringChangesTo(\"src\"))\n return;\n if (this.element.isConnected) {\n this.complete = false;\n }\n if (this.loadingStyle == FrameLoadingStyle.eager || this.hasBeenLoaded) {\n this.loadSourceURL();\n }\n }\n sourceURLReloaded() {\n const { src } = this.element;\n this.ignoringChangesToAttribute(\"complete\", () => {\n this.element.removeAttribute(\"complete\");\n });\n this.element.src = null;\n this.element.src = src;\n return this.element.loaded;\n }\n completeChanged() {\n if (this.isIgnoringChangesTo(\"complete\"))\n return;\n this.loadSourceURL();\n }\n loadingStyleChanged() {\n if (this.loadingStyle == FrameLoadingStyle.lazy) {\n this.appearanceObserver.start();\n }\n else {\n this.appearanceObserver.stop();\n this.loadSourceURL();\n }\n }\n async loadSourceURL() {\n if (this.enabled && this.isActive && !this.complete && this.sourceURL) {\n this.element.loaded = this.visit(expandURL(this.sourceURL));\n this.appearanceObserver.stop();\n await this.element.loaded;\n this.hasBeenLoaded = true;\n }\n }\n async loadResponse(fetchResponse) {\n if (fetchResponse.redirected || (fetchResponse.succeeded && fetchResponse.isHTML)) {\n this.sourceURL = fetchResponse.response.url;\n }\n try {\n const html = await fetchResponse.responseHTML;\n if (html) {\n const { body } = parseHTMLDocument(html);\n const newFrameElement = await this.extractForeignFrameElement(body);\n if (newFrameElement) {\n const snapshot = new Snapshot(newFrameElement);\n const renderer = new FrameRenderer(this, this.view.snapshot, snapshot, FrameRenderer.renderElement, false, false);\n if (this.view.renderPromise)\n await this.view.renderPromise;\n this.changeHistory();\n await this.view.render(renderer);\n this.complete = true;\n session.frameRendered(fetchResponse, this.element);\n session.frameLoaded(this.element);\n this.fetchResponseLoaded(fetchResponse);\n }\n else if (this.willHandleFrameMissingFromResponse(fetchResponse)) {\n console.warn(`A matching frame for #${this.element.id} was missing from the response, transforming into full-page Visit.`);\n this.visitResponse(fetchResponse.response);\n }\n }\n }\n catch (error) {\n console.error(error);\n this.view.invalidate();\n }\n finally {\n this.fetchResponseLoaded = () => { };\n }\n }\n elementAppearedInViewport(_element) {\n this.loadSourceURL();\n }\n willSubmitFormLinkToLocation(link) {\n return this.shouldInterceptNavigation(link);\n }\n submittedFormLinkToLocation(link, _location, form) {\n const frame = this.findFrameElement(link);\n if (frame)\n form.setAttribute(\"data-turbo-frame\", frame.id);\n }\n shouldInterceptLinkClick(element, _location, _event) {\n return this.shouldInterceptNavigation(element);\n }\n linkClickIntercepted(element, location) {\n this.navigateFrame(element, location);\n }\n willSubmitForm(element, submitter) {\n return element.closest(\"turbo-frame\") == this.element && this.shouldInterceptNavigation(element, submitter);\n }\n formSubmitted(element, submitter) {\n if (this.formSubmission) {\n this.formSubmission.stop();\n }\n this.formSubmission = new FormSubmission(this, element, submitter);\n const { fetchRequest } = this.formSubmission;\n this.prepareHeadersForRequest(fetchRequest.headers, fetchRequest);\n this.formSubmission.start();\n }\n prepareHeadersForRequest(headers, request) {\n var _a;\n headers[\"Turbo-Frame\"] = this.id;\n if ((_a = this.currentNavigationElement) === null || _a === void 0 ? void 0 : _a.hasAttribute(\"data-turbo-stream\")) {\n request.acceptResponseType(StreamMessage.contentType);\n }\n }\n requestStarted(_request) {\n markAsBusy(this.element);\n }\n requestPreventedHandlingResponse(_request, _response) {\n this.resolveVisitPromise();\n }\n async requestSucceededWithResponse(request, response) {\n await this.loadResponse(response);\n this.resolveVisitPromise();\n }\n async requestFailedWithResponse(request, response) {\n console.error(response);\n await this.loadResponse(response);\n this.resolveVisitPromise();\n }\n requestErrored(request, error) {\n console.error(error);\n this.resolveVisitPromise();\n }\n requestFinished(_request) {\n clearBusyState(this.element);\n }\n formSubmissionStarted({ formElement }) {\n markAsBusy(formElement, this.findFrameElement(formElement));\n }\n formSubmissionSucceededWithResponse(formSubmission, response) {\n const frame = this.findFrameElement(formSubmission.formElement, formSubmission.submitter);\n frame.delegate.proposeVisitIfNavigatedWithAction(frame, formSubmission.formElement, formSubmission.submitter);\n frame.delegate.loadResponse(response);\n }\n formSubmissionFailedWithResponse(formSubmission, fetchResponse) {\n this.element.delegate.loadResponse(fetchResponse);\n }\n formSubmissionErrored(formSubmission, error) {\n console.error(error);\n }\n formSubmissionFinished({ formElement }) {\n clearBusyState(formElement, this.findFrameElement(formElement));\n }\n allowsImmediateRender({ element: newFrame }, options) {\n const event = dispatch(\"turbo:before-frame-render\", {\n target: this.element,\n detail: Object.assign({ newFrame }, options),\n cancelable: true,\n });\n const { defaultPrevented, detail: { render }, } = event;\n if (this.view.renderer && render) {\n this.view.renderer.renderElement = render;\n }\n return !defaultPrevented;\n }\n viewRenderedSnapshot(_snapshot, _isPreview) { }\n preloadOnLoadLinksForView(element) {\n session.preloadOnLoadLinksForView(element);\n }\n viewInvalidated() { }\n willRenderFrame(currentElement, _newElement) {\n this.previousFrameElement = currentElement.cloneNode(true);\n }\n async visit(url) {\n var _a;\n const request = new FetchRequest(this, FetchMethod.get, url, new URLSearchParams(), this.element);\n (_a = this.currentFetchRequest) === null || _a === void 0 ? void 0 : _a.cancel();\n this.currentFetchRequest = request;\n return new Promise((resolve) => {\n this.resolveVisitPromise = () => {\n this.resolveVisitPromise = () => { };\n this.currentFetchRequest = null;\n resolve();\n };\n request.perform();\n });\n }\n navigateFrame(element, url, submitter) {\n const frame = this.findFrameElement(element, submitter);\n this.pageSnapshot = PageSnapshot.fromElement(frame).clone();\n frame.delegate.proposeVisitIfNavigatedWithAction(frame, element, submitter);\n this.withCurrentNavigationElement(element, () => {\n frame.src = url;\n });\n }\n proposeVisitIfNavigatedWithAction(frame, element, submitter) {\n this.action = getVisitAction(submitter, element, frame);\n if (isAction(this.action)) {\n const { visitCachedSnapshot } = frame.delegate;\n frame.delegate.fetchResponseLoaded = (fetchResponse) => {\n if (frame.src) {\n const { statusCode, redirected } = fetchResponse;\n const responseHTML = frame.ownerDocument.documentElement.outerHTML;\n const response = { statusCode, redirected, responseHTML };\n const options = {\n response,\n visitCachedSnapshot,\n willRender: false,\n updateHistory: false,\n restorationIdentifier: this.restorationIdentifier,\n snapshot: this.pageSnapshot,\n };\n if (this.action)\n options.action = this.action;\n session.visit(frame.src, options);\n }\n };\n }\n }\n changeHistory() {\n if (this.action) {\n const method = getHistoryMethodForAction(this.action);\n session.history.update(method, expandURL(this.element.src || \"\"), this.restorationIdentifier);\n }\n }\n willHandleFrameMissingFromResponse(fetchResponse) {\n this.element.setAttribute(\"complete\", \"\");\n const response = fetchResponse.response;\n const visit = async (url, options = {}) => {\n if (url instanceof Response) {\n this.visitResponse(url);\n }\n else {\n session.visit(url, options);\n }\n };\n const event = dispatch(\"turbo:frame-missing\", {\n target: this.element,\n detail: { response, visit },\n cancelable: true,\n });\n return !event.defaultPrevented;\n }\n async visitResponse(response) {\n const wrapped = new FetchResponse(response);\n const responseHTML = await wrapped.responseHTML;\n const { location, redirected, statusCode } = wrapped;\n return session.visit(location, { response: { redirected, statusCode, responseHTML } });\n }\n findFrameElement(element, submitter) {\n var _a;\n const id = getAttribute(\"data-turbo-frame\", submitter, element) || this.element.getAttribute(\"target\");\n return (_a = getFrameElementById(id)) !== null && _a !== void 0 ? _a : this.element;\n }\n async extractForeignFrameElement(container) {\n let element;\n const id = CSS.escape(this.id);\n try {\n element = activateElement(container.querySelector(`turbo-frame#${id}`), this.sourceURL);\n if (element) {\n return element;\n }\n element = activateElement(container.querySelector(`turbo-frame[src][recurse~=${id}]`), this.sourceURL);\n if (element) {\n await element.loaded;\n return await this.extractForeignFrameElement(element);\n }\n }\n catch (error) {\n console.error(error);\n return new FrameElement();\n }\n return null;\n }\n formActionIsVisitable(form, submitter) {\n const action = getAction(form, submitter);\n return locationIsVisitable(expandURL(action), this.rootLocation);\n }\n shouldInterceptNavigation(element, submitter) {\n const id = getAttribute(\"data-turbo-frame\", submitter, element) || this.element.getAttribute(\"target\");\n if (element instanceof HTMLFormElement && !this.formActionIsVisitable(element, submitter)) {\n return false;\n }\n if (!this.enabled || id == \"_top\") {\n return false;\n }\n if (id) {\n const frameElement = getFrameElementById(id);\n if (frameElement) {\n return !frameElement.disabled;\n }\n }\n if (!session.elementIsNavigatable(element)) {\n return false;\n }\n if (submitter && !session.elementIsNavigatable(submitter)) {\n return false;\n }\n return true;\n }\n get id() {\n return this.element.id;\n }\n get enabled() {\n return !this.element.disabled;\n }\n get sourceURL() {\n if (this.element.src) {\n return this.element.src;\n }\n }\n set sourceURL(sourceURL) {\n this.ignoringChangesToAttribute(\"src\", () => {\n this.element.src = sourceURL !== null && sourceURL !== void 0 ? sourceURL : null;\n });\n }\n get loadingStyle() {\n return this.element.loading;\n }\n get isLoading() {\n return this.formSubmission !== undefined || this.resolveVisitPromise() !== undefined;\n }\n get complete() {\n return this.element.hasAttribute(\"complete\");\n }\n set complete(value) {\n this.ignoringChangesToAttribute(\"complete\", () => {\n if (value) {\n this.element.setAttribute(\"complete\", \"\");\n }\n else {\n this.element.removeAttribute(\"complete\");\n }\n });\n }\n get isActive() {\n return this.element.isActive && this.connected;\n }\n get rootLocation() {\n var _a;\n const meta = this.element.ownerDocument.querySelector(`meta[name=\"turbo-root\"]`);\n const root = (_a = meta === null || meta === void 0 ? void 0 : meta.content) !== null && _a !== void 0 ? _a : \"/\";\n return expandURL(root);\n }\n isIgnoringChangesTo(attributeName) {\n return this.ignoredAttributes.has(attributeName);\n }\n ignoringChangesToAttribute(attributeName, callback) {\n this.ignoredAttributes.add(attributeName);\n callback();\n this.ignoredAttributes.delete(attributeName);\n }\n withCurrentNavigationElement(element, callback) {\n this.currentNavigationElement = element;\n callback();\n delete this.currentNavigationElement;\n }\n}\nfunction getFrameElementById(id) {\n if (id != null) {\n const element = document.getElementById(id);\n if (element instanceof FrameElement) {\n return element;\n }\n }\n}\nfunction activateElement(element, currentURL) {\n if (element) {\n const src = element.getAttribute(\"src\");\n if (src != null && currentURL != null && urlsAreEqual(src, currentURL)) {\n throw new Error(`Matching <turbo-frame id=\"${element.id}\"> element has a source URL which references itself`);\n }\n if (element.ownerDocument !== document) {\n element = document.importNode(element, true);\n }\n if (element instanceof FrameElement) {\n element.connectedCallback();\n element.disconnectedCallback();\n return element;\n }\n }\n}\n\nclass StreamElement extends HTMLElement {\n static async renderElement(newElement) {\n await newElement.performAction();\n }\n async connectedCallback() {\n try {\n await this.render();\n }\n catch (error) {\n console.error(error);\n }\n finally {\n this.disconnect();\n }\n }\n async render() {\n var _a;\n return ((_a = this.renderPromise) !== null && _a !== void 0 ? _a : (this.renderPromise = (async () => {\n const event = this.beforeRenderEvent;\n if (this.dispatchEvent(event)) {\n await nextAnimationFrame();\n await event.detail.render(this);\n }\n })()));\n }\n disconnect() {\n try {\n this.remove();\n }\n catch (_a) { }\n }\n removeDuplicateTargetChildren() {\n this.duplicateChildren.forEach((c) => c.remove());\n }\n get duplicateChildren() {\n var _a;\n const existingChildren = this.targetElements.flatMap((e) => [...e.children]).filter((c) => !!c.id);\n const newChildrenIds = [...(((_a = this.templateContent) === null || _a === void 0 ? void 0 : _a.children) || [])].filter((c) => !!c.id).map((c) => c.id);\n return existingChildren.filter((c) => newChildrenIds.includes(c.id));\n }\n get performAction() {\n if (this.action) {\n const actionFunction = StreamActions[this.action];\n if (actionFunction) {\n return actionFunction;\n }\n this.raise(\"unknown action\");\n }\n this.raise(\"action attribute is missing\");\n }\n get targetElements() {\n if (this.target) {\n return this.targetElementsById;\n }\n else if (this.targets) {\n return this.targetElementsByQuery;\n }\n else {\n this.raise(\"target or targets attribute is missing\");\n }\n }\n get templateContent() {\n return this.templateElement.content.cloneNode(true);\n }\n get templateElement() {\n if (this.firstElementChild === null) {\n const template = this.ownerDocument.createElement(\"template\");\n this.appendChild(template);\n return template;\n }\n else if (this.firstElementChild instanceof HTMLTemplateElement) {\n return this.firstElementChild;\n }\n this.raise(\"first child element must be a <template> element\");\n }\n get action() {\n return this.getAttribute(\"action\");\n }\n get target() {\n return this.getAttribute(\"target\");\n }\n get targets() {\n return this.getAttribute(\"targets\");\n }\n raise(message) {\n throw new Error(`${this.description}: ${message}`);\n }\n get description() {\n var _a, _b;\n return (_b = ((_a = this.outerHTML.match(/<[^>]+>/)) !== null && _a !== void 0 ? _a : [])[0]) !== null && _b !== void 0 ? _b : \"<turbo-stream>\";\n }\n get beforeRenderEvent() {\n return new CustomEvent(\"turbo:before-stream-render\", {\n bubbles: true,\n cancelable: true,\n detail: { newStream: this, render: StreamElement.renderElement },\n });\n }\n get targetElementsById() {\n var _a;\n const element = (_a = this.ownerDocument) === null || _a === void 0 ? void 0 : _a.getElementById(this.target);\n if (element !== null) {\n return [element];\n }\n else {\n return [];\n }\n }\n get targetElementsByQuery() {\n var _a;\n const elements = (_a = this.ownerDocument) === null || _a === void 0 ? void 0 : _a.querySelectorAll(this.targets);\n if (elements.length !== 0) {\n return Array.prototype.slice.call(elements);\n }\n else {\n return [];\n }\n }\n}\n\nclass StreamSourceElement extends HTMLElement {\n constructor() {\n super(...arguments);\n this.streamSource = null;\n }\n connectedCallback() {\n this.streamSource = this.src.match(/^ws{1,2}:/) ? new WebSocket(this.src) : new EventSource(this.src);\n connectStreamSource(this.streamSource);\n }\n disconnectedCallback() {\n if (this.streamSource) {\n disconnectStreamSource(this.streamSource);\n }\n }\n get src() {\n return this.getAttribute(\"src\") || \"\";\n }\n}\n\nFrameElement.delegateConstructor = FrameController;\nif (customElements.get(\"turbo-frame\") === undefined) {\n customElements.define(\"turbo-frame\", FrameElement);\n}\nif (customElements.get(\"turbo-stream\") === undefined) {\n customElements.define(\"turbo-stream\", StreamElement);\n}\nif (customElements.get(\"turbo-stream-source\") === undefined) {\n customElements.define(\"turbo-stream-source\", StreamSourceElement);\n}\n\n(() => {\n let element = document.currentScript;\n if (!element)\n return;\n if (element.hasAttribute(\"data-turbo-suppress-warning\"))\n return;\n element = element.parentElement;\n while (element) {\n if (element == document.body) {\n return console.warn(unindent `\n You are loading Turbo from a <script> element inside the <body> element. This is probably not what you meant to do!\n\n Load your application\u2019s JavaScript bundle inside the <head> element instead. <script> elements in <body> are evaluated with each page change.\n\n For more information, see: https://turbo.hotwired.dev/handbook/building#working-with-script-elements\n\n \u2014\u2014\n Suppress this warning by adding a \"data-turbo-suppress-warning\" attribute to: %s\n `, element.outerHTML);\n }\n element = element.parentElement;\n }\n})();\n\nwindow.Turbo = Turbo;\nstart();\n\nexport { FrameElement, FrameLoadingStyle, FrameRenderer, PageRenderer, PageSnapshot, StreamActions, StreamElement, StreamSourceElement, cache, clearCache, connectStreamSource, disconnectStreamSource, navigator$1 as navigator, registerAdapter, renderStreamMessage, session, setConfirmMethod, setFormMode, setProgressBarDelay, start, visit };\n", "/*\nStimulus 3.2.1\nCopyright \u00A9 2022 Basecamp, LLC\n */\nclass EventListener {\n constructor(eventTarget, eventName, eventOptions) {\n this.eventTarget = eventTarget;\n this.eventName = eventName;\n this.eventOptions = eventOptions;\n this.unorderedBindings = new Set();\n }\n connect() {\n this.eventTarget.addEventListener(this.eventName, this, this.eventOptions);\n }\n disconnect() {\n this.eventTarget.removeEventListener(this.eventName, this, this.eventOptions);\n }\n bindingConnected(binding) {\n this.unorderedBindings.add(binding);\n }\n bindingDisconnected(binding) {\n this.unorderedBindings.delete(binding);\n }\n handleEvent(event) {\n const extendedEvent = extendEvent(event);\n for (const binding of this.bindings) {\n if (extendedEvent.immediatePropagationStopped) {\n break;\n }\n else {\n binding.handleEvent(extendedEvent);\n }\n }\n }\n hasBindings() {\n return this.unorderedBindings.size > 0;\n }\n get bindings() {\n return Array.from(this.unorderedBindings).sort((left, right) => {\n const leftIndex = left.index, rightIndex = right.index;\n return leftIndex < rightIndex ? -1 : leftIndex > rightIndex ? 1 : 0;\n });\n }\n}\nfunction extendEvent(event) {\n if (\"immediatePropagationStopped\" in event) {\n return event;\n }\n else {\n const { stopImmediatePropagation } = event;\n return Object.assign(event, {\n immediatePropagationStopped: false,\n stopImmediatePropagation() {\n this.immediatePropagationStopped = true;\n stopImmediatePropagation.call(this);\n },\n });\n }\n}\n\nclass Dispatcher {\n constructor(application) {\n this.application = application;\n this.eventListenerMaps = new Map();\n this.started = false;\n }\n start() {\n if (!this.started) {\n this.started = true;\n this.eventListeners.forEach((eventListener) => eventListener.connect());\n }\n }\n stop() {\n if (this.started) {\n this.started = false;\n this.eventListeners.forEach((eventListener) => eventListener.disconnect());\n }\n }\n get eventListeners() {\n return Array.from(this.eventListenerMaps.values()).reduce((listeners, map) => listeners.concat(Array.from(map.values())), []);\n }\n bindingConnected(binding) {\n this.fetchEventListenerForBinding(binding).bindingConnected(binding);\n }\n bindingDisconnected(binding, clearEventListeners = false) {\n this.fetchEventListenerForBinding(binding).bindingDisconnected(binding);\n if (clearEventListeners)\n this.clearEventListenersForBinding(binding);\n }\n handleError(error, message, detail = {}) {\n this.application.handleError(error, `Error ${message}`, detail);\n }\n clearEventListenersForBinding(binding) {\n const eventListener = this.fetchEventListenerForBinding(binding);\n if (!eventListener.hasBindings()) {\n eventListener.disconnect();\n this.removeMappedEventListenerFor(binding);\n }\n }\n removeMappedEventListenerFor(binding) {\n const { eventTarget, eventName, eventOptions } = binding;\n const eventListenerMap = this.fetchEventListenerMapForEventTarget(eventTarget);\n const cacheKey = this.cacheKey(eventName, eventOptions);\n eventListenerMap.delete(cacheKey);\n if (eventListenerMap.size == 0)\n this.eventListenerMaps.delete(eventTarget);\n }\n fetchEventListenerForBinding(binding) {\n const { eventTarget, eventName, eventOptions } = binding;\n return this.fetchEventListener(eventTarget, eventName, eventOptions);\n }\n fetchEventListener(eventTarget, eventName, eventOptions) {\n const eventListenerMap = this.fetchEventListenerMapForEventTarget(eventTarget);\n const cacheKey = this.cacheKey(eventName, eventOptions);\n let eventListener = eventListenerMap.get(cacheKey);\n if (!eventListener) {\n eventListener = this.createEventListener(eventTarget, eventName, eventOptions);\n eventListenerMap.set(cacheKey, eventListener);\n }\n return eventListener;\n }\n createEventListener(eventTarget, eventName, eventOptions) {\n const eventListener = new EventListener(eventTarget, eventName, eventOptions);\n if (this.started) {\n eventListener.connect();\n }\n return eventListener;\n }\n fetchEventListenerMapForEventTarget(eventTarget) {\n let eventListenerMap = this.eventListenerMaps.get(eventTarget);\n if (!eventListenerMap) {\n eventListenerMap = new Map();\n this.eventListenerMaps.set(eventTarget, eventListenerMap);\n }\n return eventListenerMap;\n }\n cacheKey(eventName, eventOptions) {\n const parts = [eventName];\n Object.keys(eventOptions)\n .sort()\n .forEach((key) => {\n parts.push(`${eventOptions[key] ? \"\" : \"!\"}${key}`);\n });\n return parts.join(\":\");\n }\n}\n\nconst defaultActionDescriptorFilters = {\n stop({ event, value }) {\n if (value)\n event.stopPropagation();\n return true;\n },\n prevent({ event, value }) {\n if (value)\n event.preventDefault();\n return true;\n },\n self({ event, value, element }) {\n if (value) {\n return element === event.target;\n }\n else {\n return true;\n }\n },\n};\nconst descriptorPattern = /^(?:(.+?)(?:\\.(.+?))?(?:@(window|document))?->)?(.+?)(?:#([^:]+?))(?::(.+))?$/;\nfunction parseActionDescriptorString(descriptorString) {\n const source = descriptorString.trim();\n const matches = source.match(descriptorPattern) || [];\n let eventName = matches[1];\n let keyFilter = matches[2];\n if (keyFilter && ![\"keydown\", \"keyup\", \"keypress\"].includes(eventName)) {\n eventName += `.${keyFilter}`;\n keyFilter = \"\";\n }\n return {\n eventTarget: parseEventTarget(matches[3]),\n eventName,\n eventOptions: matches[6] ? parseEventOptions(matches[6]) : {},\n identifier: matches[4],\n methodName: matches[5],\n keyFilter,\n };\n}\nfunction parseEventTarget(eventTargetName) {\n if (eventTargetName == \"window\") {\n return window;\n }\n else if (eventTargetName == \"document\") {\n return document;\n }\n}\nfunction parseEventOptions(eventOptions) {\n return eventOptions\n .split(\":\")\n .reduce((options, token) => Object.assign(options, { [token.replace(/^!/, \"\")]: !/^!/.test(token) }), {});\n}\nfunction stringifyEventTarget(eventTarget) {\n if (eventTarget == window) {\n return \"window\";\n }\n else if (eventTarget == document) {\n return \"document\";\n }\n}\n\nfunction camelize(value) {\n return value.replace(/(?:[_-])([a-z0-9])/g, (_, char) => char.toUpperCase());\n}\nfunction namespaceCamelize(value) {\n return camelize(value.replace(/--/g, \"-\").replace(/__/g, \"_\"));\n}\nfunction capitalize(value) {\n return value.charAt(0).toUpperCase() + value.slice(1);\n}\nfunction dasherize(value) {\n return value.replace(/([A-Z])/g, (_, char) => `-${char.toLowerCase()}`);\n}\nfunction tokenize(value) {\n return value.match(/[^\\s]+/g) || [];\n}\n\nclass Action {\n constructor(element, index, descriptor, schema) {\n this.element = element;\n this.index = index;\n this.eventTarget = descriptor.eventTarget || element;\n this.eventName = descriptor.eventName || getDefaultEventNameForElement(element) || error(\"missing event name\");\n this.eventOptions = descriptor.eventOptions || {};\n this.identifier = descriptor.identifier || error(\"missing identifier\");\n this.methodName = descriptor.methodName || error(\"missing method name\");\n this.keyFilter = descriptor.keyFilter || \"\";\n this.schema = schema;\n }\n static forToken(token, schema) {\n return new this(token.element, token.index, parseActionDescriptorString(token.content), schema);\n }\n toString() {\n const eventFilter = this.keyFilter ? `.${this.keyFilter}` : \"\";\n const eventTarget = this.eventTargetName ? `@${this.eventTargetName}` : \"\";\n return `${this.eventName}${eventFilter}${eventTarget}->${this.identifier}#${this.methodName}`;\n }\n isFilterTarget(event) {\n if (!this.keyFilter) {\n return false;\n }\n const filteres = this.keyFilter.split(\"+\");\n const modifiers = [\"meta\", \"ctrl\", \"alt\", \"shift\"];\n const [meta, ctrl, alt, shift] = modifiers.map((modifier) => filteres.includes(modifier));\n if (event.metaKey !== meta || event.ctrlKey !== ctrl || event.altKey !== alt || event.shiftKey !== shift) {\n return true;\n }\n const standardFilter = filteres.filter((key) => !modifiers.includes(key))[0];\n if (!standardFilter) {\n return false;\n }\n if (!Object.prototype.hasOwnProperty.call(this.keyMappings, standardFilter)) {\n error(`contains unknown key filter: ${this.keyFilter}`);\n }\n return this.keyMappings[standardFilter].toLowerCase() !== event.key.toLowerCase();\n }\n get params() {\n const params = {};\n const pattern = new RegExp(`^data-${this.identifier}-(.+)-param$`, \"i\");\n for (const { name, value } of Array.from(this.element.attributes)) {\n const match = name.match(pattern);\n const key = match && match[1];\n if (key) {\n params[camelize(key)] = typecast(value);\n }\n }\n return params;\n }\n get eventTargetName() {\n return stringifyEventTarget(this.eventTarget);\n }\n get keyMappings() {\n return this.schema.keyMappings;\n }\n}\nconst defaultEventNames = {\n a: () => \"click\",\n button: () => \"click\",\n form: () => \"submit\",\n details: () => \"toggle\",\n input: (e) => (e.getAttribute(\"type\") == \"submit\" ? \"click\" : \"input\"),\n select: () => \"change\",\n textarea: () => \"input\",\n};\nfunction getDefaultEventNameForElement(element) {\n const tagName = element.tagName.toLowerCase();\n if (tagName in defaultEventNames) {\n return defaultEventNames[tagName](element);\n }\n}\nfunction error(message) {\n throw new Error(message);\n}\nfunction typecast(value) {\n try {\n return JSON.parse(value);\n }\n catch (o_O) {\n return value;\n }\n}\n\nclass Binding {\n constructor(context, action) {\n this.context = context;\n this.action = action;\n }\n get index() {\n return this.action.index;\n }\n get eventTarget() {\n return this.action.eventTarget;\n }\n get eventOptions() {\n return this.action.eventOptions;\n }\n get identifier() {\n return this.context.identifier;\n }\n handleEvent(event) {\n if (this.willBeInvokedByEvent(event) && this.applyEventModifiers(event)) {\n this.invokeWithEvent(event);\n }\n }\n get eventName() {\n return this.action.eventName;\n }\n get method() {\n const method = this.controller[this.methodName];\n if (typeof method == \"function\") {\n return method;\n }\n throw new Error(`Action \"${this.action}\" references undefined method \"${this.methodName}\"`);\n }\n applyEventModifiers(event) {\n const { element } = this.action;\n const { actionDescriptorFilters } = this.context.application;\n let passes = true;\n for (const [name, value] of Object.entries(this.eventOptions)) {\n if (name in actionDescriptorFilters) {\n const filter = actionDescriptorFilters[name];\n passes = passes && filter({ name, value, event, element });\n }\n else {\n continue;\n }\n }\n return passes;\n }\n invokeWithEvent(event) {\n const { target, currentTarget } = event;\n try {\n const { params } = this.action;\n const actionEvent = Object.assign(event, { params });\n this.method.call(this.controller, actionEvent);\n this.context.logDebugActivity(this.methodName, { event, target, currentTarget, action: this.methodName });\n }\n catch (error) {\n const { identifier, controller, element, index } = this;\n const detail = { identifier, controller, element, index, event };\n this.context.handleError(error, `invoking action \"${this.action}\"`, detail);\n }\n }\n willBeInvokedByEvent(event) {\n const eventTarget = event.target;\n if (event instanceof KeyboardEvent && this.action.isFilterTarget(event)) {\n return false;\n }\n if (this.element === eventTarget) {\n return true;\n }\n else if (eventTarget instanceof Element && this.element.contains(eventTarget)) {\n return this.scope.containsElement(eventTarget);\n }\n else {\n return this.scope.containsElement(this.action.element);\n }\n }\n get controller() {\n return this.context.controller;\n }\n get methodName() {\n return this.action.methodName;\n }\n get element() {\n return this.scope.element;\n }\n get scope() {\n return this.context.scope;\n }\n}\n\nclass ElementObserver {\n constructor(element, delegate) {\n this.mutationObserverInit = { attributes: true, childList: true, subtree: true };\n this.element = element;\n this.started = false;\n this.delegate = delegate;\n this.elements = new Set();\n this.mutationObserver = new MutationObserver((mutations) => this.processMutations(mutations));\n }\n start() {\n if (!this.started) {\n this.started = true;\n this.mutationObserver.observe(this.element, this.mutationObserverInit);\n this.refresh();\n }\n }\n pause(callback) {\n if (this.started) {\n this.mutationObserver.disconnect();\n this.started = false;\n }\n callback();\n if (!this.started) {\n this.mutationObserver.observe(this.element, this.mutationObserverInit);\n this.started = true;\n }\n }\n stop() {\n if (this.started) {\n this.mutationObserver.takeRecords();\n this.mutationObserver.disconnect();\n this.started = false;\n }\n }\n refresh() {\n if (this.started) {\n const matches = new Set(this.matchElementsInTree());\n for (const element of Array.from(this.elements)) {\n if (!matches.has(element)) {\n this.removeElement(element);\n }\n }\n for (const element of Array.from(matches)) {\n this.addElement(element);\n }\n }\n }\n processMutations(mutations) {\n if (this.started) {\n for (const mutation of mutations) {\n this.processMutation(mutation);\n }\n }\n }\n processMutation(mutation) {\n if (mutation.type == \"attributes\") {\n this.processAttributeChange(mutation.target, mutation.attributeName);\n }\n else if (mutation.type == \"childList\") {\n this.processRemovedNodes(mutation.removedNodes);\n this.processAddedNodes(mutation.addedNodes);\n }\n }\n processAttributeChange(node, attributeName) {\n const element = node;\n if (this.elements.has(element)) {\n if (this.delegate.elementAttributeChanged && this.matchElement(element)) {\n this.delegate.elementAttributeChanged(element, attributeName);\n }\n else {\n this.removeElement(element);\n }\n }\n else if (this.matchElement(element)) {\n this.addElement(element);\n }\n }\n processRemovedNodes(nodes) {\n for (const node of Array.from(nodes)) {\n const element = this.elementFromNode(node);\n if (element) {\n this.processTree(element, this.removeElement);\n }\n }\n }\n processAddedNodes(nodes) {\n for (const node of Array.from(nodes)) {\n const element = this.elementFromNode(node);\n if (element && this.elementIsActive(element)) {\n this.processTree(element, this.addElement);\n }\n }\n }\n matchElement(element) {\n return this.delegate.matchElement(element);\n }\n matchElementsInTree(tree = this.element) {\n return this.delegate.matchElementsInTree(tree);\n }\n processTree(tree, processor) {\n for (const element of this.matchElementsInTree(tree)) {\n processor.call(this, element);\n }\n }\n elementFromNode(node) {\n if (node.nodeType == Node.ELEMENT_NODE) {\n return node;\n }\n }\n elementIsActive(element) {\n if (element.isConnected != this.element.isConnected) {\n return false;\n }\n else {\n return this.element.contains(element);\n }\n }\n addElement(element) {\n if (!this.elements.has(element)) {\n if (this.elementIsActive(element)) {\n this.elements.add(element);\n if (this.delegate.elementMatched) {\n this.delegate.elementMatched(element);\n }\n }\n }\n }\n removeElement(element) {\n if (this.elements.has(element)) {\n this.elements.delete(element);\n if (this.delegate.elementUnmatched) {\n this.delegate.elementUnmatched(element);\n }\n }\n }\n}\n\nclass AttributeObserver {\n constructor(element, attributeName, delegate) {\n this.attributeName = attributeName;\n this.delegate = delegate;\n this.elementObserver = new ElementObserver(element, this);\n }\n get element() {\n return this.elementObserver.element;\n }\n get selector() {\n return `[${this.attributeName}]`;\n }\n start() {\n this.elementObserver.start();\n }\n pause(callback) {\n this.elementObserver.pause(callback);\n }\n stop() {\n this.elementObserver.stop();\n }\n refresh() {\n this.elementObserver.refresh();\n }\n get started() {\n return this.elementObserver.started;\n }\n matchElement(element) {\n return element.hasAttribute(this.attributeName);\n }\n matchElementsInTree(tree) {\n const match = this.matchElement(tree) ? [tree] : [];\n const matches = Array.from(tree.querySelectorAll(this.selector));\n return match.concat(matches);\n }\n elementMatched(element) {\n if (this.delegate.elementMatchedAttribute) {\n this.delegate.elementMatchedAttribute(element, this.attributeName);\n }\n }\n elementUnmatched(element) {\n if (this.delegate.elementUnmatchedAttribute) {\n this.delegate.elementUnmatchedAttribute(element, this.attributeName);\n }\n }\n elementAttributeChanged(element, attributeName) {\n if (this.delegate.elementAttributeValueChanged && this.attributeName == attributeName) {\n this.delegate.elementAttributeValueChanged(element, attributeName);\n }\n }\n}\n\nfunction add(map, key, value) {\n fetch(map, key).add(value);\n}\nfunction del(map, key, value) {\n fetch(map, key).delete(value);\n prune(map, key);\n}\nfunction fetch(map, key) {\n let values = map.get(key);\n if (!values) {\n values = new Set();\n map.set(key, values);\n }\n return values;\n}\nfunction prune(map, key) {\n const values = map.get(key);\n if (values != null && values.size == 0) {\n map.delete(key);\n }\n}\n\nclass Multimap {\n constructor() {\n this.valuesByKey = new Map();\n }\n get keys() {\n return Array.from(this.valuesByKey.keys());\n }\n get values() {\n const sets = Array.from(this.valuesByKey.values());\n return sets.reduce((values, set) => values.concat(Array.from(set)), []);\n }\n get size() {\n const sets = Array.from(this.valuesByKey.values());\n return sets.reduce((size, set) => size + set.size, 0);\n }\n add(key, value) {\n add(this.valuesByKey, key, value);\n }\n delete(key, value) {\n del(this.valuesByKey, key, value);\n }\n has(key, value) {\n const values = this.valuesByKey.get(key);\n return values != null && values.has(value);\n }\n hasKey(key) {\n return this.valuesByKey.has(key);\n }\n hasValue(value) {\n const sets = Array.from(this.valuesByKey.values());\n return sets.some((set) => set.has(value));\n }\n getValuesForKey(key) {\n const values = this.valuesByKey.get(key);\n return values ? Array.from(values) : [];\n }\n getKeysForValue(value) {\n return Array.from(this.valuesByKey)\n .filter(([_key, values]) => values.has(value))\n .map(([key, _values]) => key);\n }\n}\n\nclass IndexedMultimap extends Multimap {\n constructor() {\n super();\n this.keysByValue = new Map();\n }\n get values() {\n return Array.from(this.keysByValue.keys());\n }\n add(key, value) {\n super.add(key, value);\n add(this.keysByValue, value, key);\n }\n delete(key, value) {\n super.delete(key, value);\n del(this.keysByValue, value, key);\n }\n hasValue(value) {\n return this.keysByValue.has(value);\n }\n getKeysForValue(value) {\n const set = this.keysByValue.get(value);\n return set ? Array.from(set) : [];\n }\n}\n\nclass SelectorObserver {\n constructor(element, selector, delegate, details = {}) {\n this.selector = selector;\n this.details = details;\n this.elementObserver = new ElementObserver(element, this);\n this.delegate = delegate;\n this.matchesByElement = new Multimap();\n }\n get started() {\n return this.elementObserver.started;\n }\n start() {\n this.elementObserver.start();\n }\n pause(callback) {\n this.elementObserver.pause(callback);\n }\n stop() {\n this.elementObserver.stop();\n }\n refresh() {\n this.elementObserver.refresh();\n }\n get element() {\n return this.elementObserver.element;\n }\n matchElement(element) {\n const matches = element.matches(this.selector);\n if (this.delegate.selectorMatchElement) {\n return matches && this.delegate.selectorMatchElement(element, this.details);\n }\n return matches;\n }\n matchElementsInTree(tree) {\n const match = this.matchElement(tree) ? [tree] : [];\n const matches = Array.from(tree.querySelectorAll(this.selector)).filter((match) => this.matchElement(match));\n return match.concat(matches);\n }\n elementMatched(element) {\n this.selectorMatched(element);\n }\n elementUnmatched(element) {\n this.selectorUnmatched(element);\n }\n elementAttributeChanged(element, _attributeName) {\n const matches = this.matchElement(element);\n const matchedBefore = this.matchesByElement.has(this.selector, element);\n if (!matches && matchedBefore) {\n this.selectorUnmatched(element);\n }\n }\n selectorMatched(element) {\n if (this.delegate.selectorMatched) {\n this.delegate.selectorMatched(element, this.selector, this.details);\n this.matchesByElement.add(this.selector, element);\n }\n }\n selectorUnmatched(element) {\n this.delegate.selectorUnmatched(element, this.selector, this.details);\n this.matchesByElement.delete(this.selector, element);\n }\n}\n\nclass StringMapObserver {\n constructor(element, delegate) {\n this.element = element;\n this.delegate = delegate;\n this.started = false;\n this.stringMap = new Map();\n this.mutationObserver = new MutationObserver((mutations) => this.processMutations(mutations));\n }\n start() {\n if (!this.started) {\n this.started = true;\n this.mutationObserver.observe(this.element, { attributes: true, attributeOldValue: true });\n this.refresh();\n }\n }\n stop() {\n if (this.started) {\n this.mutationObserver.takeRecords();\n this.mutationObserver.disconnect();\n this.started = false;\n }\n }\n refresh() {\n if (this.started) {\n for (const attributeName of this.knownAttributeNames) {\n this.refreshAttribute(attributeName, null);\n }\n }\n }\n processMutations(mutations) {\n if (this.started) {\n for (const mutation of mutations) {\n this.processMutation(mutation);\n }\n }\n }\n processMutation(mutation) {\n const attributeName = mutation.attributeName;\n if (attributeName) {\n this.refreshAttribute(attributeName, mutation.oldValue);\n }\n }\n refreshAttribute(attributeName, oldValue) {\n const key = this.delegate.getStringMapKeyForAttribute(attributeName);\n if (key != null) {\n if (!this.stringMap.has(attributeName)) {\n this.stringMapKeyAdded(key, attributeName);\n }\n const value = this.element.getAttribute(attributeName);\n if (this.stringMap.get(attributeName) != value) {\n this.stringMapValueChanged(value, key, oldValue);\n }\n if (value == null) {\n const oldValue = this.stringMap.get(attributeName);\n this.stringMap.delete(attributeName);\n if (oldValue)\n this.stringMapKeyRemoved(key, attributeName, oldValue);\n }\n else {\n this.stringMap.set(attributeName, value);\n }\n }\n }\n stringMapKeyAdded(key, attributeName) {\n if (this.delegate.stringMapKeyAdded) {\n this.delegate.stringMapKeyAdded(key, attributeName);\n }\n }\n stringMapValueChanged(value, key, oldValue) {\n if (this.delegate.stringMapValueChanged) {\n this.delegate.stringMapValueChanged(value, key, oldValue);\n }\n }\n stringMapKeyRemoved(key, attributeName, oldValue) {\n if (this.delegate.stringMapKeyRemoved) {\n this.delegate.stringMapKeyRemoved(key, attributeName, oldValue);\n }\n }\n get knownAttributeNames() {\n return Array.from(new Set(this.currentAttributeNames.concat(this.recordedAttributeNames)));\n }\n get currentAttributeNames() {\n return Array.from(this.element.attributes).map((attribute) => attribute.name);\n }\n get recordedAttributeNames() {\n return Array.from(this.stringMap.keys());\n }\n}\n\nclass TokenListObserver {\n constructor(element, attributeName, delegate) {\n this.attributeObserver = new AttributeObserver(element, attributeName, this);\n this.delegate = delegate;\n this.tokensByElement = new Multimap();\n }\n get started() {\n return this.attributeObserver.started;\n }\n start() {\n this.attributeObserver.start();\n }\n pause(callback) {\n this.attributeObserver.pause(callback);\n }\n stop() {\n this.attributeObserver.stop();\n }\n refresh() {\n this.attributeObserver.refresh();\n }\n get element() {\n return this.attributeObserver.element;\n }\n get attributeName() {\n return this.attributeObserver.attributeName;\n }\n elementMatchedAttribute(element) {\n this.tokensMatched(this.readTokensForElement(element));\n }\n elementAttributeValueChanged(element) {\n const [unmatchedTokens, matchedTokens] = this.refreshTokensForElement(element);\n this.tokensUnmatched(unmatchedTokens);\n this.tokensMatched(matchedTokens);\n }\n elementUnmatchedAttribute(element) {\n this.tokensUnmatched(this.tokensByElement.getValuesForKey(element));\n }\n tokensMatched(tokens) {\n tokens.forEach((token) => this.tokenMatched(token));\n }\n tokensUnmatched(tokens) {\n tokens.forEach((token) => this.tokenUnmatched(token));\n }\n tokenMatched(token) {\n this.delegate.tokenMatched(token);\n this.tokensByElement.add(token.element, token);\n }\n tokenUnmatched(token) {\n this.delegate.tokenUnmatched(token);\n this.tokensByElement.delete(token.element, token);\n }\n refreshTokensForElement(element) {\n const previousTokens = this.tokensByElement.getValuesForKey(element);\n const currentTokens = this.readTokensForElement(element);\n const firstDifferingIndex = zip(previousTokens, currentTokens).findIndex(([previousToken, currentToken]) => !tokensAreEqual(previousToken, currentToken));\n if (firstDifferingIndex == -1) {\n return [[], []];\n }\n else {\n return [previousTokens.slice(firstDifferingIndex), currentTokens.slice(firstDifferingIndex)];\n }\n }\n readTokensForElement(element) {\n const attributeName = this.attributeName;\n const tokenString = element.getAttribute(attributeName) || \"\";\n return parseTokenString(tokenString, element, attributeName);\n }\n}\nfunction parseTokenString(tokenString, element, attributeName) {\n return tokenString\n .trim()\n .split(/\\s+/)\n .filter((content) => content.length)\n .map((content, index) => ({ element, attributeName, content, index }));\n}\nfunction zip(left, right) {\n const length = Math.max(left.length, right.length);\n return Array.from({ length }, (_, index) => [left[index], right[index]]);\n}\nfunction tokensAreEqual(left, right) {\n return left && right && left.index == right.index && left.content == right.content;\n}\n\nclass ValueListObserver {\n constructor(element, attributeName, delegate) {\n this.tokenListObserver = new TokenListObserver(element, attributeName, this);\n this.delegate = delegate;\n this.parseResultsByToken = new WeakMap();\n this.valuesByTokenByElement = new WeakMap();\n }\n get started() {\n return this.tokenListObserver.started;\n }\n start() {\n this.tokenListObserver.start();\n }\n stop() {\n this.tokenListObserver.stop();\n }\n refresh() {\n this.tokenListObserver.refresh();\n }\n get element() {\n return this.tokenListObserver.element;\n }\n get attributeName() {\n return this.tokenListObserver.attributeName;\n }\n tokenMatched(token) {\n const { element } = token;\n const { value } = this.fetchParseResultForToken(token);\n if (value) {\n this.fetchValuesByTokenForElement(element).set(token, value);\n this.delegate.elementMatchedValue(element, value);\n }\n }\n tokenUnmatched(token) {\n const { element } = token;\n const { value } = this.fetchParseResultForToken(token);\n if (value) {\n this.fetchValuesByTokenForElement(element).delete(token);\n this.delegate.elementUnmatchedValue(element, value);\n }\n }\n fetchParseResultForToken(token) {\n let parseResult = this.parseResultsByToken.get(token);\n if (!parseResult) {\n parseResult = this.parseToken(token);\n this.parseResultsByToken.set(token, parseResult);\n }\n return parseResult;\n }\n fetchValuesByTokenForElement(element) {\n let valuesByToken = this.valuesByTokenByElement.get(element);\n if (!valuesByToken) {\n valuesByToken = new Map();\n this.valuesByTokenByElement.set(element, valuesByToken);\n }\n return valuesByToken;\n }\n parseToken(token) {\n try {\n const value = this.delegate.parseValueForToken(token);\n return { value };\n }\n catch (error) {\n return { error };\n }\n }\n}\n\nclass BindingObserver {\n constructor(context, delegate) {\n this.context = context;\n this.delegate = delegate;\n this.bindingsByAction = new Map();\n }\n start() {\n if (!this.valueListObserver) {\n this.valueListObserver = new ValueListObserver(this.element, this.actionAttribute, this);\n this.valueListObserver.start();\n }\n }\n stop() {\n if (this.valueListObserver) {\n this.valueListObserver.stop();\n delete this.valueListObserver;\n this.disconnectAllActions();\n }\n }\n get element() {\n return this.context.element;\n }\n get identifier() {\n return this.context.identifier;\n }\n get actionAttribute() {\n return this.schema.actionAttribute;\n }\n get schema() {\n return this.context.schema;\n }\n get bindings() {\n return Array.from(this.bindingsByAction.values());\n }\n connectAction(action) {\n const binding = new Binding(this.context, action);\n this.bindingsByAction.set(action, binding);\n this.delegate.bindingConnected(binding);\n }\n disconnectAction(action) {\n const binding = this.bindingsByAction.get(action);\n if (binding) {\n this.bindingsByAction.delete(action);\n this.delegate.bindingDisconnected(binding);\n }\n }\n disconnectAllActions() {\n this.bindings.forEach((binding) => this.delegate.bindingDisconnected(binding, true));\n this.bindingsByAction.clear();\n }\n parseValueForToken(token) {\n const action = Action.forToken(token, this.schema);\n if (action.identifier == this.identifier) {\n return action;\n }\n }\n elementMatchedValue(element, action) {\n this.connectAction(action);\n }\n elementUnmatchedValue(element, action) {\n this.disconnectAction(action);\n }\n}\n\nclass ValueObserver {\n constructor(context, receiver) {\n this.context = context;\n this.receiver = receiver;\n this.stringMapObserver = new StringMapObserver(this.element, this);\n this.valueDescriptorMap = this.controller.valueDescriptorMap;\n }\n start() {\n this.stringMapObserver.start();\n this.invokeChangedCallbacksForDefaultValues();\n }\n stop() {\n this.stringMapObserver.stop();\n }\n get element() {\n return this.context.element;\n }\n get controller() {\n return this.context.controller;\n }\n getStringMapKeyForAttribute(attributeName) {\n if (attributeName in this.valueDescriptorMap) {\n return this.valueDescriptorMap[attributeName].name;\n }\n }\n stringMapKeyAdded(key, attributeName) {\n const descriptor = this.valueDescriptorMap[attributeName];\n if (!this.hasValue(key)) {\n this.invokeChangedCallback(key, descriptor.writer(this.receiver[key]), descriptor.writer(descriptor.defaultValue));\n }\n }\n stringMapValueChanged(value, name, oldValue) {\n const descriptor = this.valueDescriptorNameMap[name];\n if (value === null)\n return;\n if (oldValue === null) {\n oldValue = descriptor.writer(descriptor.defaultValue);\n }\n this.invokeChangedCallback(name, value, oldValue);\n }\n stringMapKeyRemoved(key, attributeName, oldValue) {\n const descriptor = this.valueDescriptorNameMap[key];\n if (this.hasValue(key)) {\n this.invokeChangedCallback(key, descriptor.writer(this.receiver[key]), oldValue);\n }\n else {\n this.invokeChangedCallback(key, descriptor.writer(descriptor.defaultValue), oldValue);\n }\n }\n invokeChangedCallbacksForDefaultValues() {\n for (const { key, name, defaultValue, writer } of this.valueDescriptors) {\n if (defaultValue != undefined && !this.controller.data.has(key)) {\n this.invokeChangedCallback(name, writer(defaultValue), undefined);\n }\n }\n }\n invokeChangedCallback(name, rawValue, rawOldValue) {\n const changedMethodName = `${name}Changed`;\n const changedMethod = this.receiver[changedMethodName];\n if (typeof changedMethod == \"function\") {\n const descriptor = this.valueDescriptorNameMap[name];\n try {\n const value = descriptor.reader(rawValue);\n let oldValue = rawOldValue;\n if (rawOldValue) {\n oldValue = descriptor.reader(rawOldValue);\n }\n changedMethod.call(this.receiver, value, oldValue);\n }\n catch (error) {\n if (error instanceof TypeError) {\n error.message = `Stimulus Value \"${this.context.identifier}.${descriptor.name}\" - ${error.message}`;\n }\n throw error;\n }\n }\n }\n get valueDescriptors() {\n const { valueDescriptorMap } = this;\n return Object.keys(valueDescriptorMap).map((key) => valueDescriptorMap[key]);\n }\n get valueDescriptorNameMap() {\n const descriptors = {};\n Object.keys(this.valueDescriptorMap).forEach((key) => {\n const descriptor = this.valueDescriptorMap[key];\n descriptors[descriptor.name] = descriptor;\n });\n return descriptors;\n }\n hasValue(attributeName) {\n const descriptor = this.valueDescriptorNameMap[attributeName];\n const hasMethodName = `has${capitalize(descriptor.name)}`;\n return this.receiver[hasMethodName];\n }\n}\n\nclass TargetObserver {\n constructor(context, delegate) {\n this.context = context;\n this.delegate = delegate;\n this.targetsByName = new Multimap();\n }\n start() {\n if (!this.tokenListObserver) {\n this.tokenListObserver = new TokenListObserver(this.element, this.attributeName, this);\n this.tokenListObserver.start();\n }\n }\n stop() {\n if (this.tokenListObserver) {\n this.disconnectAllTargets();\n this.tokenListObserver.stop();\n delete this.tokenListObserver;\n }\n }\n tokenMatched({ element, content: name }) {\n if (this.scope.containsElement(element)) {\n this.connectTarget(element, name);\n }\n }\n tokenUnmatched({ element, content: name }) {\n this.disconnectTarget(element, name);\n }\n connectTarget(element, name) {\n var _a;\n if (!this.targetsByName.has(name, element)) {\n this.targetsByName.add(name, element);\n (_a = this.tokenListObserver) === null || _a === void 0 ? void 0 : _a.pause(() => this.delegate.targetConnected(element, name));\n }\n }\n disconnectTarget(element, name) {\n var _a;\n if (this.targetsByName.has(name, element)) {\n this.targetsByName.delete(name, element);\n (_a = this.tokenListObserver) === null || _a === void 0 ? void 0 : _a.pause(() => this.delegate.targetDisconnected(element, name));\n }\n }\n disconnectAllTargets() {\n for (const name of this.targetsByName.keys) {\n for (const element of this.targetsByName.getValuesForKey(name)) {\n this.disconnectTarget(element, name);\n }\n }\n }\n get attributeName() {\n return `data-${this.context.identifier}-target`;\n }\n get element() {\n return this.context.element;\n }\n get scope() {\n return this.context.scope;\n }\n}\n\nfunction readInheritableStaticArrayValues(constructor, propertyName) {\n const ancestors = getAncestorsForConstructor(constructor);\n return Array.from(ancestors.reduce((values, constructor) => {\n getOwnStaticArrayValues(constructor, propertyName).forEach((name) => values.add(name));\n return values;\n }, new Set()));\n}\nfunction readInheritableStaticObjectPairs(constructor, propertyName) {\n const ancestors = getAncestorsForConstructor(constructor);\n return ancestors.reduce((pairs, constructor) => {\n pairs.push(...getOwnStaticObjectPairs(constructor, propertyName));\n return pairs;\n }, []);\n}\nfunction getAncestorsForConstructor(constructor) {\n const ancestors = [];\n while (constructor) {\n ancestors.push(constructor);\n constructor = Object.getPrototypeOf(constructor);\n }\n return ancestors.reverse();\n}\nfunction getOwnStaticArrayValues(constructor, propertyName) {\n const definition = constructor[propertyName];\n return Array.isArray(definition) ? definition : [];\n}\nfunction getOwnStaticObjectPairs(constructor, propertyName) {\n const definition = constructor[propertyName];\n return definition ? Object.keys(definition).map((key) => [key, definition[key]]) : [];\n}\n\nclass OutletObserver {\n constructor(context, delegate) {\n this.context = context;\n this.delegate = delegate;\n this.outletsByName = new Multimap();\n this.outletElementsByName = new Multimap();\n this.selectorObserverMap = new Map();\n }\n start() {\n if (this.selectorObserverMap.size === 0) {\n this.outletDefinitions.forEach((outletName) => {\n const selector = this.selector(outletName);\n const details = { outletName };\n if (selector) {\n this.selectorObserverMap.set(outletName, new SelectorObserver(document.body, selector, this, details));\n }\n });\n this.selectorObserverMap.forEach((observer) => observer.start());\n }\n this.dependentContexts.forEach((context) => context.refresh());\n }\n stop() {\n if (this.selectorObserverMap.size > 0) {\n this.disconnectAllOutlets();\n this.selectorObserverMap.forEach((observer) => observer.stop());\n this.selectorObserverMap.clear();\n }\n }\n refresh() {\n this.selectorObserverMap.forEach((observer) => observer.refresh());\n }\n selectorMatched(element, _selector, { outletName }) {\n const outlet = this.getOutlet(element, outletName);\n if (outlet) {\n this.connectOutlet(outlet, element, outletName);\n }\n }\n selectorUnmatched(element, _selector, { outletName }) {\n const outlet = this.getOutletFromMap(element, outletName);\n if (outlet) {\n this.disconnectOutlet(outlet, element, outletName);\n }\n }\n selectorMatchElement(element, { outletName }) {\n return (this.hasOutlet(element, outletName) &&\n element.matches(`[${this.context.application.schema.controllerAttribute}~=${outletName}]`));\n }\n connectOutlet(outlet, element, outletName) {\n var _a;\n if (!this.outletElementsByName.has(outletName, element)) {\n this.outletsByName.add(outletName, outlet);\n this.outletElementsByName.add(outletName, element);\n (_a = this.selectorObserverMap.get(outletName)) === null || _a === void 0 ? void 0 : _a.pause(() => this.delegate.outletConnected(outlet, element, outletName));\n }\n }\n disconnectOutlet(outlet, element, outletName) {\n var _a;\n if (this.outletElementsByName.has(outletName, element)) {\n this.outletsByName.delete(outletName, outlet);\n this.outletElementsByName.delete(outletName, element);\n (_a = this.selectorObserverMap\n .get(outletName)) === null || _a === void 0 ? void 0 : _a.pause(() => this.delegate.outletDisconnected(outlet, element, outletName));\n }\n }\n disconnectAllOutlets() {\n for (const outletName of this.outletElementsByName.keys) {\n for (const element of this.outletElementsByName.getValuesForKey(outletName)) {\n for (const outlet of this.outletsByName.getValuesForKey(outletName)) {\n this.disconnectOutlet(outlet, element, outletName);\n }\n }\n }\n }\n selector(outletName) {\n return this.scope.outlets.getSelectorForOutletName(outletName);\n }\n get outletDependencies() {\n const dependencies = new Multimap();\n this.router.modules.forEach((module) => {\n const constructor = module.definition.controllerConstructor;\n const outlets = readInheritableStaticArrayValues(constructor, \"outlets\");\n outlets.forEach((outlet) => dependencies.add(outlet, module.identifier));\n });\n return dependencies;\n }\n get outletDefinitions() {\n return this.outletDependencies.getKeysForValue(this.identifier);\n }\n get dependentControllerIdentifiers() {\n return this.outletDependencies.getValuesForKey(this.identifier);\n }\n get dependentContexts() {\n const identifiers = this.dependentControllerIdentifiers;\n return this.router.contexts.filter((context) => identifiers.includes(context.identifier));\n }\n hasOutlet(element, outletName) {\n return !!this.getOutlet(element, outletName) || !!this.getOutletFromMap(element, outletName);\n }\n getOutlet(element, outletName) {\n return this.application.getControllerForElementAndIdentifier(element, outletName);\n }\n getOutletFromMap(element, outletName) {\n return this.outletsByName.getValuesForKey(outletName).find((outlet) => outlet.element === element);\n }\n get scope() {\n return this.context.scope;\n }\n get identifier() {\n return this.context.identifier;\n }\n get application() {\n return this.context.application;\n }\n get router() {\n return this.application.router;\n }\n}\n\nclass Context {\n constructor(module, scope) {\n this.logDebugActivity = (functionName, detail = {}) => {\n const { identifier, controller, element } = this;\n detail = Object.assign({ identifier, controller, element }, detail);\n this.application.logDebugActivity(this.identifier, functionName, detail);\n };\n this.module = module;\n this.scope = scope;\n this.controller = new module.controllerConstructor(this);\n this.bindingObserver = new BindingObserver(this, this.dispatcher);\n this.valueObserver = new ValueObserver(this, this.controller);\n this.targetObserver = new TargetObserver(this, this);\n this.outletObserver = new OutletObserver(this, this);\n try {\n this.controller.initialize();\n this.logDebugActivity(\"initialize\");\n }\n catch (error) {\n this.handleError(error, \"initializing controller\");\n }\n }\n connect() {\n this.bindingObserver.start();\n this.valueObserver.start();\n this.targetObserver.start();\n this.outletObserver.start();\n try {\n this.controller.connect();\n this.logDebugActivity(\"connect\");\n }\n catch (error) {\n this.handleError(error, \"connecting controller\");\n }\n }\n refresh() {\n this.outletObserver.refresh();\n }\n disconnect() {\n try {\n this.controller.disconnect();\n this.logDebugActivity(\"disconnect\");\n }\n catch (error) {\n this.handleError(error, \"disconnecting controller\");\n }\n this.outletObserver.stop();\n this.targetObserver.stop();\n this.valueObserver.stop();\n this.bindingObserver.stop();\n }\n get application() {\n return this.module.application;\n }\n get identifier() {\n return this.module.identifier;\n }\n get schema() {\n return this.application.schema;\n }\n get dispatcher() {\n return this.application.dispatcher;\n }\n get element() {\n return this.scope.element;\n }\n get parentElement() {\n return this.element.parentElement;\n }\n handleError(error, message, detail = {}) {\n const { identifier, controller, element } = this;\n detail = Object.assign({ identifier, controller, element }, detail);\n this.application.handleError(error, `Error ${message}`, detail);\n }\n targetConnected(element, name) {\n this.invokeControllerMethod(`${name}TargetConnected`, element);\n }\n targetDisconnected(element, name) {\n this.invokeControllerMethod(`${name}TargetDisconnected`, element);\n }\n outletConnected(outlet, element, name) {\n this.invokeControllerMethod(`${namespaceCamelize(name)}OutletConnected`, outlet, element);\n }\n outletDisconnected(outlet, element, name) {\n this.invokeControllerMethod(`${namespaceCamelize(name)}OutletDisconnected`, outlet, element);\n }\n invokeControllerMethod(methodName, ...args) {\n const controller = this.controller;\n if (typeof controller[methodName] == \"function\") {\n controller[methodName](...args);\n }\n }\n}\n\nfunction bless(constructor) {\n return shadow(constructor, getBlessedProperties(constructor));\n}\nfunction shadow(constructor, properties) {\n const shadowConstructor = extend(constructor);\n const shadowProperties = getShadowProperties(constructor.prototype, properties);\n Object.defineProperties(shadowConstructor.prototype, shadowProperties);\n return shadowConstructor;\n}\nfunction getBlessedProperties(constructor) {\n const blessings = readInheritableStaticArrayValues(constructor, \"blessings\");\n return blessings.reduce((blessedProperties, blessing) => {\n const properties = blessing(constructor);\n for (const key in properties) {\n const descriptor = blessedProperties[key] || {};\n blessedProperties[key] = Object.assign(descriptor, properties[key]);\n }\n return blessedProperties;\n }, {});\n}\nfunction getShadowProperties(prototype, properties) {\n return getOwnKeys(properties).reduce((shadowProperties, key) => {\n const descriptor = getShadowedDescriptor(prototype, properties, key);\n if (descriptor) {\n Object.assign(shadowProperties, { [key]: descriptor });\n }\n return shadowProperties;\n }, {});\n}\nfunction getShadowedDescriptor(prototype, properties, key) {\n const shadowingDescriptor = Object.getOwnPropertyDescriptor(prototype, key);\n const shadowedByValue = shadowingDescriptor && \"value\" in shadowingDescriptor;\n if (!shadowedByValue) {\n const descriptor = Object.getOwnPropertyDescriptor(properties, key).value;\n if (shadowingDescriptor) {\n descriptor.get = shadowingDescriptor.get || descriptor.get;\n descriptor.set = shadowingDescriptor.set || descriptor.set;\n }\n return descriptor;\n }\n}\nconst getOwnKeys = (() => {\n if (typeof Object.getOwnPropertySymbols == \"function\") {\n return (object) => [...Object.getOwnPropertyNames(object), ...Object.getOwnPropertySymbols(object)];\n }\n else {\n return Object.getOwnPropertyNames;\n }\n})();\nconst extend = (() => {\n function extendWithReflect(constructor) {\n function extended() {\n return Reflect.construct(constructor, arguments, new.target);\n }\n extended.prototype = Object.create(constructor.prototype, {\n constructor: { value: extended },\n });\n Reflect.setPrototypeOf(extended, constructor);\n return extended;\n }\n function testReflectExtension() {\n const a = function () {\n this.a.call(this);\n };\n const b = extendWithReflect(a);\n b.prototype.a = function () { };\n return new b();\n }\n try {\n testReflectExtension();\n return extendWithReflect;\n }\n catch (error) {\n return (constructor) => class extended extends constructor {\n };\n }\n})();\n\nfunction blessDefinition(definition) {\n return {\n identifier: definition.identifier,\n controllerConstructor: bless(definition.controllerConstructor),\n };\n}\n\nclass Module {\n constructor(application, definition) {\n this.application = application;\n this.definition = blessDefinition(definition);\n this.contextsByScope = new WeakMap();\n this.connectedContexts = new Set();\n }\n get identifier() {\n return this.definition.identifier;\n }\n get controllerConstructor() {\n return this.definition.controllerConstructor;\n }\n get contexts() {\n return Array.from(this.connectedContexts);\n }\n connectContextForScope(scope) {\n const context = this.fetchContextForScope(scope);\n this.connectedContexts.add(context);\n context.connect();\n }\n disconnectContextForScope(scope) {\n const context = this.contextsByScope.get(scope);\n if (context) {\n this.connectedContexts.delete(context);\n context.disconnect();\n }\n }\n fetchContextForScope(scope) {\n let context = this.contextsByScope.get(scope);\n if (!context) {\n context = new Context(this, scope);\n this.contextsByScope.set(scope, context);\n }\n return context;\n }\n}\n\nclass ClassMap {\n constructor(scope) {\n this.scope = scope;\n }\n has(name) {\n return this.data.has(this.getDataKey(name));\n }\n get(name) {\n return this.getAll(name)[0];\n }\n getAll(name) {\n const tokenString = this.data.get(this.getDataKey(name)) || \"\";\n return tokenize(tokenString);\n }\n getAttributeName(name) {\n return this.data.getAttributeNameForKey(this.getDataKey(name));\n }\n getDataKey(name) {\n return `${name}-class`;\n }\n get data() {\n return this.scope.data;\n }\n}\n\nclass DataMap {\n constructor(scope) {\n this.scope = scope;\n }\n get element() {\n return this.scope.element;\n }\n get identifier() {\n return this.scope.identifier;\n }\n get(key) {\n const name = this.getAttributeNameForKey(key);\n return this.element.getAttribute(name);\n }\n set(key, value) {\n const name = this.getAttributeNameForKey(key);\n this.element.setAttribute(name, value);\n return this.get(key);\n }\n has(key) {\n const name = this.getAttributeNameForKey(key);\n return this.element.hasAttribute(name);\n }\n delete(key) {\n if (this.has(key)) {\n const name = this.getAttributeNameForKey(key);\n this.element.removeAttribute(name);\n return true;\n }\n else {\n return false;\n }\n }\n getAttributeNameForKey(key) {\n return `data-${this.identifier}-${dasherize(key)}`;\n }\n}\n\nclass Guide {\n constructor(logger) {\n this.warnedKeysByObject = new WeakMap();\n this.logger = logger;\n }\n warn(object, key, message) {\n let warnedKeys = this.warnedKeysByObject.get(object);\n if (!warnedKeys) {\n warnedKeys = new Set();\n this.warnedKeysByObject.set(object, warnedKeys);\n }\n if (!warnedKeys.has(key)) {\n warnedKeys.add(key);\n this.logger.warn(message, object);\n }\n }\n}\n\nfunction attributeValueContainsToken(attributeName, token) {\n return `[${attributeName}~=\"${token}\"]`;\n}\n\nclass TargetSet {\n constructor(scope) {\n this.scope = scope;\n }\n get element() {\n return this.scope.element;\n }\n get identifier() {\n return this.scope.identifier;\n }\n get schema() {\n return this.scope.schema;\n }\n has(targetName) {\n return this.find(targetName) != null;\n }\n find(...targetNames) {\n return targetNames.reduce((target, targetName) => target || this.findTarget(targetName) || this.findLegacyTarget(targetName), undefined);\n }\n findAll(...targetNames) {\n return targetNames.reduce((targets, targetName) => [\n ...targets,\n ...this.findAllTargets(targetName),\n ...this.findAllLegacyTargets(targetName),\n ], []);\n }\n findTarget(targetName) {\n const selector = this.getSelectorForTargetName(targetName);\n return this.scope.findElement(selector);\n }\n findAllTargets(targetName) {\n const selector = this.getSelectorForTargetName(targetName);\n return this.scope.findAllElements(selector);\n }\n getSelectorForTargetName(targetName) {\n const attributeName = this.schema.targetAttributeForScope(this.identifier);\n return attributeValueContainsToken(attributeName, targetName);\n }\n findLegacyTarget(targetName) {\n const selector = this.getLegacySelectorForTargetName(targetName);\n return this.deprecate(this.scope.findElement(selector), targetName);\n }\n findAllLegacyTargets(targetName) {\n const selector = this.getLegacySelectorForTargetName(targetName);\n return this.scope.findAllElements(selector).map((element) => this.deprecate(element, targetName));\n }\n getLegacySelectorForTargetName(targetName) {\n const targetDescriptor = `${this.identifier}.${targetName}`;\n return attributeValueContainsToken(this.schema.targetAttribute, targetDescriptor);\n }\n deprecate(element, targetName) {\n if (element) {\n const { identifier } = this;\n const attributeName = this.schema.targetAttribute;\n const revisedAttributeName = this.schema.targetAttributeForScope(identifier);\n this.guide.warn(element, `target:${targetName}`, `Please replace ${attributeName}=\"${identifier}.${targetName}\" with ${revisedAttributeName}=\"${targetName}\". ` +\n `The ${attributeName} attribute is deprecated and will be removed in a future version of Stimulus.`);\n }\n return element;\n }\n get guide() {\n return this.scope.guide;\n }\n}\n\nclass OutletSet {\n constructor(scope, controllerElement) {\n this.scope = scope;\n this.controllerElement = controllerElement;\n }\n get element() {\n return this.scope.element;\n }\n get identifier() {\n return this.scope.identifier;\n }\n get schema() {\n return this.scope.schema;\n }\n has(outletName) {\n return this.find(outletName) != null;\n }\n find(...outletNames) {\n return outletNames.reduce((outlet, outletName) => outlet || this.findOutlet(outletName), undefined);\n }\n findAll(...outletNames) {\n return outletNames.reduce((outlets, outletName) => [...outlets, ...this.findAllOutlets(outletName)], []);\n }\n getSelectorForOutletName(outletName) {\n const attributeName = this.schema.outletAttributeForScope(this.identifier, outletName);\n return this.controllerElement.getAttribute(attributeName);\n }\n findOutlet(outletName) {\n const selector = this.getSelectorForOutletName(outletName);\n if (selector)\n return this.findElement(selector, outletName);\n }\n findAllOutlets(outletName) {\n const selector = this.getSelectorForOutletName(outletName);\n return selector ? this.findAllElements(selector, outletName) : [];\n }\n findElement(selector, outletName) {\n const elements = this.scope.queryElements(selector);\n return elements.filter((element) => this.matchesElement(element, selector, outletName))[0];\n }\n findAllElements(selector, outletName) {\n const elements = this.scope.queryElements(selector);\n return elements.filter((element) => this.matchesElement(element, selector, outletName));\n }\n matchesElement(element, selector, outletName) {\n const controllerAttribute = element.getAttribute(this.scope.schema.controllerAttribute) || \"\";\n return element.matches(selector) && controllerAttribute.split(\" \").includes(outletName);\n }\n}\n\nclass Scope {\n constructor(schema, element, identifier, logger) {\n this.targets = new TargetSet(this);\n this.classes = new ClassMap(this);\n this.data = new DataMap(this);\n this.containsElement = (element) => {\n return element.closest(this.controllerSelector) === this.element;\n };\n this.schema = schema;\n this.element = element;\n this.identifier = identifier;\n this.guide = new Guide(logger);\n this.outlets = new OutletSet(this.documentScope, element);\n }\n findElement(selector) {\n return this.element.matches(selector) ? this.element : this.queryElements(selector).find(this.containsElement);\n }\n findAllElements(selector) {\n return [\n ...(this.element.matches(selector) ? [this.element] : []),\n ...this.queryElements(selector).filter(this.containsElement),\n ];\n }\n queryElements(selector) {\n return Array.from(this.element.querySelectorAll(selector));\n }\n get controllerSelector() {\n return attributeValueContainsToken(this.schema.controllerAttribute, this.identifier);\n }\n get isDocumentScope() {\n return this.element === document.documentElement;\n }\n get documentScope() {\n return this.isDocumentScope\n ? this\n : new Scope(this.schema, document.documentElement, this.identifier, this.guide.logger);\n }\n}\n\nclass ScopeObserver {\n constructor(element, schema, delegate) {\n this.element = element;\n this.schema = schema;\n this.delegate = delegate;\n this.valueListObserver = new ValueListObserver(this.element, this.controllerAttribute, this);\n this.scopesByIdentifierByElement = new WeakMap();\n this.scopeReferenceCounts = new WeakMap();\n }\n start() {\n this.valueListObserver.start();\n }\n stop() {\n this.valueListObserver.stop();\n }\n get controllerAttribute() {\n return this.schema.controllerAttribute;\n }\n parseValueForToken(token) {\n const { element, content: identifier } = token;\n const scopesByIdentifier = this.fetchScopesByIdentifierForElement(element);\n let scope = scopesByIdentifier.get(identifier);\n if (!scope) {\n scope = this.delegate.createScopeForElementAndIdentifier(element, identifier);\n scopesByIdentifier.set(identifier, scope);\n }\n return scope;\n }\n elementMatchedValue(element, value) {\n const referenceCount = (this.scopeReferenceCounts.get(value) || 0) + 1;\n this.scopeReferenceCounts.set(value, referenceCount);\n if (referenceCount == 1) {\n this.delegate.scopeConnected(value);\n }\n }\n elementUnmatchedValue(element, value) {\n const referenceCount = this.scopeReferenceCounts.get(value);\n if (referenceCount) {\n this.scopeReferenceCounts.set(value, referenceCount - 1);\n if (referenceCount == 1) {\n this.delegate.scopeDisconnected(value);\n }\n }\n }\n fetchScopesByIdentifierForElement(element) {\n let scopesByIdentifier = this.scopesByIdentifierByElement.get(element);\n if (!scopesByIdentifier) {\n scopesByIdentifier = new Map();\n this.scopesByIdentifierByElement.set(element, scopesByIdentifier);\n }\n return scopesByIdentifier;\n }\n}\n\nclass Router {\n constructor(application) {\n this.application = application;\n this.scopeObserver = new ScopeObserver(this.element, this.schema, this);\n this.scopesByIdentifier = new Multimap();\n this.modulesByIdentifier = new Map();\n }\n get element() {\n return this.application.element;\n }\n get schema() {\n return this.application.schema;\n }\n get logger() {\n return this.application.logger;\n }\n get controllerAttribute() {\n return this.schema.controllerAttribute;\n }\n get modules() {\n return Array.from(this.modulesByIdentifier.values());\n }\n get contexts() {\n return this.modules.reduce((contexts, module) => contexts.concat(module.contexts), []);\n }\n start() {\n this.scopeObserver.start();\n }\n stop() {\n this.scopeObserver.stop();\n }\n loadDefinition(definition) {\n this.unloadIdentifier(definition.identifier);\n const module = new Module(this.application, definition);\n this.connectModule(module);\n const afterLoad = definition.controllerConstructor.afterLoad;\n if (afterLoad) {\n afterLoad(definition.identifier, this.application);\n }\n }\n unloadIdentifier(identifier) {\n const module = this.modulesByIdentifier.get(identifier);\n if (module) {\n this.disconnectModule(module);\n }\n }\n getContextForElementAndIdentifier(element, identifier) {\n const module = this.modulesByIdentifier.get(identifier);\n if (module) {\n return module.contexts.find((context) => context.element == element);\n }\n }\n handleError(error, message, detail) {\n this.application.handleError(error, message, detail);\n }\n createScopeForElementAndIdentifier(element, identifier) {\n return new Scope(this.schema, element, identifier, this.logger);\n }\n scopeConnected(scope) {\n this.scopesByIdentifier.add(scope.identifier, scope);\n const module = this.modulesByIdentifier.get(scope.identifier);\n if (module) {\n module.connectContextForScope(scope);\n }\n }\n scopeDisconnected(scope) {\n this.scopesByIdentifier.delete(scope.identifier, scope);\n const module = this.modulesByIdentifier.get(scope.identifier);\n if (module) {\n module.disconnectContextForScope(scope);\n }\n }\n connectModule(module) {\n this.modulesByIdentifier.set(module.identifier, module);\n const scopes = this.scopesByIdentifier.getValuesForKey(module.identifier);\n scopes.forEach((scope) => module.connectContextForScope(scope));\n }\n disconnectModule(module) {\n this.modulesByIdentifier.delete(module.identifier);\n const scopes = this.scopesByIdentifier.getValuesForKey(module.identifier);\n scopes.forEach((scope) => module.disconnectContextForScope(scope));\n }\n}\n\nconst defaultSchema = {\n controllerAttribute: \"data-controller\",\n actionAttribute: \"data-action\",\n targetAttribute: \"data-target\",\n targetAttributeForScope: (identifier) => `data-${identifier}-target`,\n outletAttributeForScope: (identifier, outlet) => `data-${identifier}-${outlet}-outlet`,\n keyMappings: Object.assign(Object.assign({ enter: \"Enter\", tab: \"Tab\", esc: \"Escape\", space: \" \", up: \"ArrowUp\", down: \"ArrowDown\", left: \"ArrowLeft\", right: \"ArrowRight\", home: \"Home\", end: \"End\" }, objectFromEntries(\"abcdefghijklmnopqrstuvwxyz\".split(\"\").map((c) => [c, c]))), objectFromEntries(\"0123456789\".split(\"\").map((n) => [n, n]))),\n};\nfunction objectFromEntries(array) {\n return array.reduce((memo, [k, v]) => (Object.assign(Object.assign({}, memo), { [k]: v })), {});\n}\n\nclass Application {\n constructor(element = document.documentElement, schema = defaultSchema) {\n this.logger = console;\n this.debug = false;\n this.logDebugActivity = (identifier, functionName, detail = {}) => {\n if (this.debug) {\n this.logFormattedMessage(identifier, functionName, detail);\n }\n };\n this.element = element;\n this.schema = schema;\n this.dispatcher = new Dispatcher(this);\n this.router = new Router(this);\n this.actionDescriptorFilters = Object.assign({}, defaultActionDescriptorFilters);\n }\n static start(element, schema) {\n const application = new this(element, schema);\n application.start();\n return application;\n }\n async start() {\n await domReady();\n this.logDebugActivity(\"application\", \"starting\");\n this.dispatcher.start();\n this.router.start();\n this.logDebugActivity(\"application\", \"start\");\n }\n stop() {\n this.logDebugActivity(\"application\", \"stopping\");\n this.dispatcher.stop();\n this.router.stop();\n this.logDebugActivity(\"application\", \"stop\");\n }\n register(identifier, controllerConstructor) {\n this.load({ identifier, controllerConstructor });\n }\n registerActionOption(name, filter) {\n this.actionDescriptorFilters[name] = filter;\n }\n load(head, ...rest) {\n const definitions = Array.isArray(head) ? head : [head, ...rest];\n definitions.forEach((definition) => {\n if (definition.controllerConstructor.shouldLoad) {\n this.router.loadDefinition(definition);\n }\n });\n }\n unload(head, ...rest) {\n const identifiers = Array.isArray(head) ? head : [head, ...rest];\n identifiers.forEach((identifier) => this.router.unloadIdentifier(identifier));\n }\n get controllers() {\n return this.router.contexts.map((context) => context.controller);\n }\n getControllerForElementAndIdentifier(element, identifier) {\n const context = this.router.getContextForElementAndIdentifier(element, identifier);\n return context ? context.controller : null;\n }\n handleError(error, message, detail) {\n var _a;\n this.logger.error(`%s\\n\\n%o\\n\\n%o`, message, error, detail);\n (_a = window.onerror) === null || _a === void 0 ? void 0 : _a.call(window, message, \"\", 0, 0, error);\n }\n logFormattedMessage(identifier, functionName, detail = {}) {\n detail = Object.assign({ application: this }, detail);\n this.logger.groupCollapsed(`${identifier} #${functionName}`);\n this.logger.log(\"details:\", Object.assign({}, detail));\n this.logger.groupEnd();\n }\n}\nfunction domReady() {\n return new Promise((resolve) => {\n if (document.readyState == \"loading\") {\n document.addEventListener(\"DOMContentLoaded\", () => resolve());\n }\n else {\n resolve();\n }\n });\n}\n\nfunction ClassPropertiesBlessing(constructor) {\n const classes = readInheritableStaticArrayValues(constructor, \"classes\");\n return classes.reduce((properties, classDefinition) => {\n return Object.assign(properties, propertiesForClassDefinition(classDefinition));\n }, {});\n}\nfunction propertiesForClassDefinition(key) {\n return {\n [`${key}Class`]: {\n get() {\n const { classes } = this;\n if (classes.has(key)) {\n return classes.get(key);\n }\n else {\n const attribute = classes.getAttributeName(key);\n throw new Error(`Missing attribute \"${attribute}\"`);\n }\n },\n },\n [`${key}Classes`]: {\n get() {\n return this.classes.getAll(key);\n },\n },\n [`has${capitalize(key)}Class`]: {\n get() {\n return this.classes.has(key);\n },\n },\n };\n}\n\nfunction OutletPropertiesBlessing(constructor) {\n const outlets = readInheritableStaticArrayValues(constructor, \"outlets\");\n return outlets.reduce((properties, outletDefinition) => {\n return Object.assign(properties, propertiesForOutletDefinition(outletDefinition));\n }, {});\n}\nfunction propertiesForOutletDefinition(name) {\n const camelizedName = namespaceCamelize(name);\n return {\n [`${camelizedName}Outlet`]: {\n get() {\n const outlet = this.outlets.find(name);\n if (outlet) {\n const outletController = this.application.getControllerForElementAndIdentifier(outlet, name);\n if (outletController) {\n return outletController;\n }\n else {\n throw new Error(`Missing \"data-controller=${name}\" attribute on outlet element for \"${this.identifier}\" controller`);\n }\n }\n throw new Error(`Missing outlet element \"${name}\" for \"${this.identifier}\" controller`);\n },\n },\n [`${camelizedName}Outlets`]: {\n get() {\n const outlets = this.outlets.findAll(name);\n if (outlets.length > 0) {\n return outlets\n .map((outlet) => {\n const controller = this.application.getControllerForElementAndIdentifier(outlet, name);\n if (controller) {\n return controller;\n }\n else {\n console.warn(`The provided outlet element is missing the outlet controller \"${name}\" for \"${this.identifier}\"`, outlet);\n }\n })\n .filter((controller) => controller);\n }\n return [];\n },\n },\n [`${camelizedName}OutletElement`]: {\n get() {\n const outlet = this.outlets.find(name);\n if (outlet) {\n return outlet;\n }\n else {\n throw new Error(`Missing outlet element \"${name}\" for \"${this.identifier}\" controller`);\n }\n },\n },\n [`${camelizedName}OutletElements`]: {\n get() {\n return this.outlets.findAll(name);\n },\n },\n [`has${capitalize(camelizedName)}Outlet`]: {\n get() {\n return this.outlets.has(name);\n },\n },\n };\n}\n\nfunction TargetPropertiesBlessing(constructor) {\n const targets = readInheritableStaticArrayValues(constructor, \"targets\");\n return targets.reduce((properties, targetDefinition) => {\n return Object.assign(properties, propertiesForTargetDefinition(targetDefinition));\n }, {});\n}\nfunction propertiesForTargetDefinition(name) {\n return {\n [`${name}Target`]: {\n get() {\n const target = this.targets.find(name);\n if (target) {\n return target;\n }\n else {\n throw new Error(`Missing target element \"${name}\" for \"${this.identifier}\" controller`);\n }\n },\n },\n [`${name}Targets`]: {\n get() {\n return this.targets.findAll(name);\n },\n },\n [`has${capitalize(name)}Target`]: {\n get() {\n return this.targets.has(name);\n },\n },\n };\n}\n\nfunction ValuePropertiesBlessing(constructor) {\n const valueDefinitionPairs = readInheritableStaticObjectPairs(constructor, \"values\");\n const propertyDescriptorMap = {\n valueDescriptorMap: {\n get() {\n return valueDefinitionPairs.reduce((result, valueDefinitionPair) => {\n const valueDescriptor = parseValueDefinitionPair(valueDefinitionPair, this.identifier);\n const attributeName = this.data.getAttributeNameForKey(valueDescriptor.key);\n return Object.assign(result, { [attributeName]: valueDescriptor });\n }, {});\n },\n },\n };\n return valueDefinitionPairs.reduce((properties, valueDefinitionPair) => {\n return Object.assign(properties, propertiesForValueDefinitionPair(valueDefinitionPair));\n }, propertyDescriptorMap);\n}\nfunction propertiesForValueDefinitionPair(valueDefinitionPair, controller) {\n const definition = parseValueDefinitionPair(valueDefinitionPair, controller);\n const { key, name, reader: read, writer: write } = definition;\n return {\n [name]: {\n get() {\n const value = this.data.get(key);\n if (value !== null) {\n return read(value);\n }\n else {\n return definition.defaultValue;\n }\n },\n set(value) {\n if (value === undefined) {\n this.data.delete(key);\n }\n else {\n this.data.set(key, write(value));\n }\n },\n },\n [`has${capitalize(name)}`]: {\n get() {\n return this.data.has(key) || definition.hasCustomDefaultValue;\n },\n },\n };\n}\nfunction parseValueDefinitionPair([token, typeDefinition], controller) {\n return valueDescriptorForTokenAndTypeDefinition({\n controller,\n token,\n typeDefinition,\n });\n}\nfunction parseValueTypeConstant(constant) {\n switch (constant) {\n case Array:\n return \"array\";\n case Boolean:\n return \"boolean\";\n case Number:\n return \"number\";\n case Object:\n return \"object\";\n case String:\n return \"string\";\n }\n}\nfunction parseValueTypeDefault(defaultValue) {\n switch (typeof defaultValue) {\n case \"boolean\":\n return \"boolean\";\n case \"number\":\n return \"number\";\n case \"string\":\n return \"string\";\n }\n if (Array.isArray(defaultValue))\n return \"array\";\n if (Object.prototype.toString.call(defaultValue) === \"[object Object]\")\n return \"object\";\n}\nfunction parseValueTypeObject(payload) {\n const typeFromObject = parseValueTypeConstant(payload.typeObject.type);\n if (!typeFromObject)\n return;\n const defaultValueType = parseValueTypeDefault(payload.typeObject.default);\n if (typeFromObject !== defaultValueType) {\n const propertyPath = payload.controller ? `${payload.controller}.${payload.token}` : payload.token;\n throw new Error(`The specified default value for the Stimulus Value \"${propertyPath}\" must match the defined type \"${typeFromObject}\". The provided default value of \"${payload.typeObject.default}\" is of type \"${defaultValueType}\".`);\n }\n return typeFromObject;\n}\nfunction parseValueTypeDefinition(payload) {\n const typeFromObject = parseValueTypeObject({\n controller: payload.controller,\n token: payload.token,\n typeObject: payload.typeDefinition,\n });\n const typeFromDefaultValue = parseValueTypeDefault(payload.typeDefinition);\n const typeFromConstant = parseValueTypeConstant(payload.typeDefinition);\n const type = typeFromObject || typeFromDefaultValue || typeFromConstant;\n if (type)\n return type;\n const propertyPath = payload.controller ? `${payload.controller}.${payload.typeDefinition}` : payload.token;\n throw new Error(`Unknown value type \"${propertyPath}\" for \"${payload.token}\" value`);\n}\nfunction defaultValueForDefinition(typeDefinition) {\n const constant = parseValueTypeConstant(typeDefinition);\n if (constant)\n return defaultValuesByType[constant];\n const defaultValue = typeDefinition.default;\n if (defaultValue !== undefined)\n return defaultValue;\n return typeDefinition;\n}\nfunction valueDescriptorForTokenAndTypeDefinition(payload) {\n const key = `${dasherize(payload.token)}-value`;\n const type = parseValueTypeDefinition(payload);\n return {\n type,\n key,\n name: camelize(key),\n get defaultValue() {\n return defaultValueForDefinition(payload.typeDefinition);\n },\n get hasCustomDefaultValue() {\n return parseValueTypeDefault(payload.typeDefinition) !== undefined;\n },\n reader: readers[type],\n writer: writers[type] || writers.default,\n };\n}\nconst defaultValuesByType = {\n get array() {\n return [];\n },\n boolean: false,\n number: 0,\n get object() {\n return {};\n },\n string: \"\",\n};\nconst readers = {\n array(value) {\n const array = JSON.parse(value);\n if (!Array.isArray(array)) {\n throw new TypeError(`expected value of type \"array\" but instead got value \"${value}\" of type \"${parseValueTypeDefault(array)}\"`);\n }\n return array;\n },\n boolean(value) {\n return !(value == \"0\" || String(value).toLowerCase() == \"false\");\n },\n number(value) {\n return Number(value);\n },\n object(value) {\n const object = JSON.parse(value);\n if (object === null || typeof object != \"object\" || Array.isArray(object)) {\n throw new TypeError(`expected value of type \"object\" but instead got value \"${value}\" of type \"${parseValueTypeDefault(object)}\"`);\n }\n return object;\n },\n string(value) {\n return value;\n },\n};\nconst writers = {\n default: writeString,\n array: writeJSON,\n object: writeJSON,\n};\nfunction writeJSON(value) {\n return JSON.stringify(value);\n}\nfunction writeString(value) {\n return `${value}`;\n}\n\nclass Controller {\n constructor(context) {\n this.context = context;\n }\n static get shouldLoad() {\n return true;\n }\n static afterLoad(_identifier, _application) {\n return;\n }\n get application() {\n return this.context.application;\n }\n get scope() {\n return this.context.scope;\n }\n get element() {\n return this.scope.element;\n }\n get identifier() {\n return this.scope.identifier;\n }\n get targets() {\n return this.scope.targets;\n }\n get outlets() {\n return this.scope.outlets;\n }\n get classes() {\n return this.scope.classes;\n }\n get data() {\n return this.scope.data;\n }\n initialize() {\n }\n connect() {\n }\n disconnect() {\n }\n dispatch(eventName, { target = this.element, detail = {}, prefix = this.identifier, bubbles = true, cancelable = true } = {}) {\n const type = prefix ? `${prefix}:${eventName}` : eventName;\n const event = new CustomEvent(type, { detail, bubbles, cancelable });\n target.dispatchEvent(event);\n return event;\n }\n}\nController.blessings = [\n ClassPropertiesBlessing,\n TargetPropertiesBlessing,\n ValuePropertiesBlessing,\n OutletPropertiesBlessing,\n];\nController.targets = [];\nController.outlets = [];\nController.values = {};\n\nexport { Application, AttributeObserver, Context, Controller, ElementObserver, IndexedMultimap, Multimap, SelectorObserver, StringMapObserver, TokenListObserver, ValueListObserver, add, defaultSchema, del, fetch, prune };\n", "import { Controller } from \"@hotwired/stimulus\";\n\n/*\n * S\u00F3lo permite enviar el formulario de contacto despu\u00E9s de unos\n * segundos, para evitar el spam.\n */\nexport default class extends Controller {\n static targets = [\"submit\"];\n static values = {\n delay: {\n type: Number,\n default: 60,\n },\n submit: String,\n interval: Number,\n };\n\n submitTargetConnected(submitTarget) {\n submitTarget.disabled = true;\n if (!this.submitValue) this.submitValue = submitTarget.value;\n this.originalDelayValue = this.delayValue;\n\n // Esperar un minuto desde que se carga la p\u00E1gina hasta que se\n // permite enviar.\n this.intervalValue = setInterval(() => {\n const delay = this.delayValue;\n\n if (this.delayValue == 0) {\n clearInterval(this.intervalValue);\n submitTarget.disabled = false;\n submitTarget.value = this.submitValue;\n } else {\n this.delayValue = delay - 1;\n }\n }, 1000);\n }\n\n submitTargetDisconnected(submitTarget) {\n this.delayValue = this.originalDelayValue;\n }\n\n delayValueChanged(newValue, oldValue) {\n if (newValue === oldValue) return;\n if (this.intervalValue === 0) return;\n\n this.submitTarget.value = `${this.submitValue} (${newValue})`;\n }\n}\n", "import { Controller } from \"@hotwired/stimulus\";\n\nexport default class extends Controller {\n static targets = [\n \"clientName\",\n \"clientVersion\",\n \"osName\",\n \"osVersion\",\n \"viewportWidth\",\n \"viewportHeight\",\n \"devicePixelRatio\",\n \"deviceType\",\n \"help\",\n ];\n\n connect() {\n this.element.style.zIndex = 10000;\n\n this.clientNameTarget.innerText = window.device.client.name;\n this.clientVersionTarget.innerText = window.device.client.version;\n this.osNameTarget.innerText = window.device.os.name;\n this.osVersionTarget.innerText = window.device.os.version;\n this.deviceTypeTarget.innerText = window.device.device.type;\n\n this.viewportWidthTarget.innerText = window.innerWidth;\n this.viewportHeightTarget.innerText = window.innerHeight;\n this.devicePixelRatioTarget.innerText = window.devicePixelRatio;\n }\n\n resized (event) {\n this.viewportWidthTarget.innerText = window.innerWidth;\n this.viewportHeightTarget.innerText = window.innerHeight;\n }\n\n outline (event) {\n let style = document.head.querySelector('style#outline');\n\n if(style){\n style.remove();\n } else {\n style = document.createElement('style');\n style.id = 'outline';\n style.append(\"* { outline: 1px solid pink }\");\n\n document.head.appendChild(style);\n }\n }\n\n toggleHelp (event) {\n this.helpTarget.hidden = !this.helpTarget.hidden;\n }\n}\n", "import { Controller } from \"@hotwired/stimulus\";\n\nexport default class extends Controller {\n static targets = [\"preview\", \"input\", \"container\"];\n static values = {\n defaultSrc: String,\n };\n\n previewTargetConnected(previewTarget) {\n this.defaultSrcValue = previewTarget.src;\n }\n\n loadFile(event) {\n event?.preventDefault();\n\n const imageRe = /^image\\//;\n const file = [...event.dataTransfer.files].find((f) => imageRe.test(f.type));\n\n if (!file) return;\n\n if (this.hasPreviewTarget) {\n this.previewTarget.src = window.URL.createObjectURL(file);\n }\n\n if (this.hasContainerTarget) {\n this.containerTarget.classList.remove(\"d-none\");\n }\n\n if (this.hasInputTarget) {\n const dataTransfer = new DataTransfer();\n\n dataTransfer.items.add(file);\n\n this.inputTarget.files = dataTransfer.files;\n }\n }\n\n changePreview(event) {\n if (!this.hasPreviewTarget) return;\n\n this.previewTarget.src = window.URL.createObjectURL(this.inputTarget.files[0]);\n\n if (this.hasContainerTarget) {\n this.containerTarget.classList.remove(\"d-none\");\n }\n }\n\n preventDefaultDrag(event) {\n event.preventDefault();\n }\n\n reset(event) {\n if (this.hasPreviewTarget) this.previewTarget.src = this.defaultSrcValue;\n if (this.hasContainerTarget) this.containerTarget.classList.add(\"d-none\");\n }\n}\n", "import { Controller } from \"@hotwired/stimulus\";\nimport L, { LeafletMouseEvent } from \"leaflet\";\nimport { h, render } from \"preact\";\nimport { useEffect, useState } from \"preact/hooks\";\nimport { parseISO, formatRelative } from \"date-fns\";\nimport { es } from \"date-fns/locale\";\nimport { loginGoogle, pb, useUser } from \"../pocketbase\";\n\nconst locationIcon = `<svg xmlns=\"http://www.w3.org/2000/svg\" xml:space=\"preserve\" viewBox=\"-5 -5 400 400\" width=\"32\" height=\"32\"><path fill=\"rgb(20 20 20)\" stroke=\"rgb(237 237 237)\" stroke-width=\"16\" d=\"M197.849 0C122.131 0 60.531 61.609 60.531 137.329c0 72.887 124.591 243.177 129.896 250.388l4.951 6.738a3.064 3.064 0 0 0 2.471 1.255 3.08 3.08 0 0 0 2.486-1.255l4.948-6.738c5.308-7.211 129.896-177.501 129.896-250.388C335.179 61.609 273.569 0 197.849 0m0 88.138c27.13 0 49.191 22.062 49.191 49.191 0 27.115-22.062 49.191-49.191 49.191-27.114 0-49.191-22.076-49.191-49.191 0-27.129 22.076-49.191 49.191-49.191\"/></svg>`;\nconst locationIconUri = `data:image/svg+xml,${locationIcon}`;\n\ninterface Marker {\n id: string;\n image_uuid: string;\n x: number;\n y: number;\n creadorx: string;\n}\ninterface Comment {\n id: string;\n created: string;\n updated: string;\n texto: string;\n creadorx: string;\n expand?: { creadorx?: { name?: string; username: string } };\n}\n\nexport default class NonGraphicalMapController extends Controller {\n static values = {\n layer: String,\n attribution: String,\n uuid: String,\n i18nCreateMarker: String,\n maxZoomLevel: Number,\n width: Number,\n height: Number,\n };\n declare layerValue: string;\n declare attributionValue: string;\n declare uuidValue: string;\n declare i18nCreateMarkerValue: string;\n static targets = [\"map\", \"addingOverlay\"];\n declare readonly mapTarget: HTMLElement;\n declare readonly addingOverlayTarget: HTMLElement;\n private _layer: any;\n private _map: L.Map;\n private lastMarkers: L.Marker[] = [];\n\n connect() {\n this.fetchAndAddMarkers();\n\n render(<CreateMarkerOverlay controller={this} />, this.addingOverlayTarget);\n }\n\n async fetchAndAddMarkers() {\n const { items } = await pb\n .collection<Marker>(\"marcados\")\n .getList(1, 10000, {\n filter: pb.filter(\"imagen_uuid = {:uuid}\", {\n uuid: this.uuidValue,\n }),\n });\n this.lastMarkers.forEach((m) => m.remove());\n this.lastMarkers = items.map((item) => {\n const icon = L.icon({\n iconUrl: locationIconUri,\n iconSize: [32, 32],\n iconAnchor: [16, 32],\n });\n return L.marker([item.x, item.y], { icon })\n .on(\"click\", () => {\n this.openMarkerModal(item);\n })\n .addTo(this.map);\n });\n }\n\n openMarkerModal(marker: Marker) {\n const daddy = document.createElement(\"div\");\n document.body.appendChild(daddy);\n render(\n <MarkerModal marker={marker} selfEl={daddy} controller={this} />,\n daddy\n );\n }\n\n resize(event) {\n this.map.invalidateSize();\n }\n\n get bounds () {\n if (!this._bounds) {\n const start = new L.latLng(0, 0);\n const end = new L.latLng(this.heightValue, this.widthValue);\n\n this._bounds = new L.latLngBounds(start, end);\n }\n\n return this._bounds;\n }\n\n mapTargetConnected(map) {\n this.map;\n }\n\n get crs() {\n if (!this._crs) {\n const factor = 1 / Math.pow(2, this.maxZoomLevelValue);\n\n this._crs = L.extend({}, L.CRS.Simple, {\n transformation: new L.Transformation(factor, 0, factor, 0)\n });\n }\n\n return this._crs;\n }\n\n layerValueChanged() {\n if (this._layer) {\n this.map.removeLayer(this._layer);\n this._layer = undefined;\n }\n\n this.layer;\n }\n\n get height () {\n if (!this._height) {\n this._height = Math.ceil(this.heightValue / 256) * 256;\n }\n\n return this._height;\n }\n\n get width () {\n if (!this._width) {\n this._width = Math.ceil(this.widthValue / 256) * 256;\n }\n\n return this._width;\n }\n\n get map() {\n if (!this._map) {\n this._map = L.map(this.mapTarget, {\n center: this.bounds.getCenter(),\n maxBounds: this.bounds,\n crs: this.crs,\n zoom: this.maxZoomLevelValue,\n minZoom: 0,\n maxZoom: this.maxZoomLevelValue,\n attributionControl: false,\n });\n }\n\n return this._map;\n }\n\n get layer() {\n if (!this._layer) {\n this._layer = L.tileLayer(this.layerValue, {\n minNativeZoom: 0,\n maxNativeZoom: 5,\n noWrap: true,\n bounds: this.bounds,\n }).addTo(this.map);\n\n L.control\n .attribution({ prefix: false })\n .addAttribution(this.attributionValue)\n .addTo(this.map);\n }\n\n return this._layer;\n }\n}\n\nfunction MarkerModal({\n marker,\n selfEl,\n controller,\n}: {\n marker: Marker;\n selfEl: HTMLDivElement;\n controller: NonGraphicalMapController;\n}) {\n const selfDestroy = () => {\n render(null, selfEl);\n selfEl.remove();\n };\n\n const [commentKey, commentRefresher] = useState(0);\n const refreshComments = () => commentRefresher(commentKey + 1);\n\n const [comments, setComments] = useState<null | Comment[]>(null);\n const sortedComments = comments?.sort(\n (a, b) => +parseISO(a.created) - +parseISO(b.created)\n );\n useEffect(() => {\n (async () => {\n const { items } = await pb\n .collection<Comment>(\"comentarios\")\n .getList(1, 10000, {\n filter: pb.filter(\"marcador.id = {:marcador}\", {\n marcador: marker.id,\n }),\n expand: \"creadorx\",\n });\n setComments(items);\n })();\n }, [commentKey]);\n\n const [user] = useUser();\n const userId = user?.id;\n\n async function deleteMarker() {\n if (!confirm(\"\u00A1Atenci\u00F3n! Si eliminas el marcador, se borrar\u00E1n todos los comentarios de tus compa\u00F1eres. \u00BFA\u00FAn quieres eliminar este marcador?\")) return;\n await pb.collection<Marker>(\"marcados\").delete(marker.id);\n await controller.fetchAndAddMarkers();\n selfDestroy();\n }\n\n return (\n <div class=\"toggled position-absolute top-0 left-0 w-100 min-h-100vh background-menu pb-5 z-index-modal background-white border border-black shadow-lg\">\n <div class=\"container\">\n <div class=\"d-flex align-items-center justify-content-between m-0 mt-3 p-2\">\n <div>\n {marker.creadorx === userId && (\n <button\n type=\"button\"\n class=\"btn btn-danger\"\n onClick={deleteMarker}\n >\n Eliminar marcador\n </button>\n )}\n </div>\n <div class=\"d-flex m-0 align-items-center no-gutters justify-content-center\">\n <button\n type=\"button\"\n class=\"close\"\n data-dismiss=\"modal\"\n aria-label=\"Close\"\n onClick={() => selfDestroy()}\n >\n <span aria-hidden=\"true\" class=\"f-40\">\u00D7</span>\n </button>\n </div>\n </div>\n <div class=\"d-flex flex-column align-items-center justify-content-center w-100 mt-3\">\n <PostCommentForm marker={marker} refreshComments={refreshComments} />\n\n <div class=\"flex-wrap overflow-auto w-100\">\n {sortedComments\n ? sortedComments.length > 0\n ? sortedComments.map((c) => (\n <Comment comment={c} refreshComments={refreshComments} />\n ))\n : \"Todav\u00EDa no hay comentarios en este marcador.\"\n : \"Cargando...\"}\n </div>\n </div>\n </div>\n </div>\n );\n}\n\nfunction PostCommentForm({\n marker,\n refreshComments,\n}: {\n marker: Marker;\n refreshComments: () => void;\n}) {\n const [posting, setPosting] = useState(false);\n const [texto, setTexto] = useState(\"\");\n const [user] = useUser();\n async function postComment() {\n setPosting(true);\n if (!pb.authStore.model?.id) await loginGoogle();\n\n try {\n await pb.collection(\"comentarios\").create({\n texto,\n marcador: marker.id,\n creadorx: pb.authStore.model.id,\n });\n setTexto(\"\");\n refreshComments();\n } catch (error) {\n alert(error);\n } finally {\n setPosting(false);\n }\n }\n function _postComment(event: Event) {\n event.preventDefault();\n postComment();\n }\n return (\n <form\n class=\"d-flex align-items-center justify-content-between w-100 mb-4\"\n onSubmit={_postComment}\n >\n <div class=\"input-group margin-bottom-sm\">\n <input\n class=\"form-control\"\n required=\"required\"\n type=\"text\"\n placeholder=\"Escribir descripci\u00F3n o comentario\"\n value={texto}\n onInput={(e) => setTexto((e.target as any).value)}\n disabled={posting}\n />\n {user?.id ? (\n <button class=\"btn bg-primary text-white\" disabled={posting}>\n Enviar\n </button>\n ) : (\n <button class=\"btn bg-info text-white\" disabled={posting}>\n Iniciar sesi\u00F3n y enviar\n </button>\n )}\n </div>\n </form>\n );\n}\n\nfunction Comment({\n comment,\n refreshComments,\n}: {\n comment: Comment;\n refreshComments: () => void;\n}) {\n const [user] = useUser();\n const userId = user?.id;\n const [loading, setLoading] = useState(false);\n const [editing, setEditing] = useState<false | { texto: string }>(false);\n\n const wasEdited = comment.created !== comment.updated;\n\n async function deleteComment() {\n if (!confirm(\"\u00BFEliminar comentario?\")) return;\n setLoading(true);\n try {\n await pb.collection(\"comentarios\").delete(comment.id);\n refreshComments();\n } catch (error) {\n alert(error);\n } finally {\n setLoading(false);\n }\n }\n\n async function saveEdit() {\n if (!editing) return;\n setLoading(true);\n try {\n await pb.collection(\"comentarios\").update(comment.id, editing);\n refreshComments();\n setEditing(false);\n } catch (error) {\n alert(error);\n } finally {\n setLoading(false);\n }\n }\n\n function cancelEditing(): void {\n setEditing(false);\n }\n\n return (\n <div class=\"d-flex flex-column align-items-center justify-content-center w-100 border border-black p-3 mb-2 rounded\">\n <div class=\"d-flex align-items-center justify-content-between w-100\">\n <div class=\"d-flex flex-column\">\n <div class=\"text-uppercase\">\n {comment.expand?.creadorx?.name ||\n comment.expand?.creadorx?.username ||\n comment.creadorx}\n </div>\n <div class=\"text-primary\">\n {formatRelative(parseISO(comment.created), new Date(), {\n locale: es,\n })}\n {wasEdited && (\n <>\n {\" \"}\n (editado{\" \"}\n {formatRelative(parseISO(comment.updated), new Date(), {\n locale: es,\n })}\n )\n </>\n )}\n </div>\n </div>\n {userId && comment.creadorx === userId && (\n <div class=\"d-flex align-items-center\">\n {editing ? (\n <>\n <button\n type=\"button\"\n class=\"btn border-success text-success mx-1\"\n aria-label=\"Guardar\"\n onClick={saveEdit}\n disabled={loading}\n >\n <i class=\"fa fa-check\" aria-hidden=\"true\"></i>\n </button>\n <button\n type=\"button\"\n class=\"btn border-black text-black mx-1\"\n aria-label=\"Cancelar\"\n onClick={cancelEditing}\n disabled={loading}\n >\n <i class=\"fa fa-times\" aria-hidden=\"true\"></i>\n </button>\n </>\n ) : (\n <>\n <button\n type=\"button\"\n class=\"btn border-primary text-primary mx-1\"\n aria-label=\"Editar\"\n onClick={() => setEditing({ texto: comment.texto })}\n disabled={loading}\n >\n <i class=\"fa fa-pencil-square-o\" aria-hidden=\"true\"></i>\n </button>\n <button\n type=\"button\"\n class=\"btn border-danger text-danger mx-1\"\n aria-label=\"Eliminar\"\n onClick={deleteComment}\n disabled={loading}\n >\n <i class=\"fa fa-trash\" aria-hidden=\"true\"></i>\n </button>\n </>\n )}\n </div>\n )}\n </div>\n {editing ? (\n <textarea\n class=\"my-3 w-100\"\n value={editing.texto}\n onInput={(e) => setEditing({ texto: (e.target as any).value })}\n rows={\"7\"}\n />\n ) : (\n <div class=\"my-3 w-100 text-left\">\n {comment.texto}\n </div>\n )}\n </div>\n );\n}\n\nfunction CreateMarkerOverlay({\n controller,\n}: {\n controller: NonGraphicalMapController;\n}) {\n const [isAdding, setIsAdding] = useState(false);\n\n useEffect(() => {\n if (isAdding) {\n controller.mapTarget.style.cursor = \"crosshair\";\n\n const addMarkerListener = async (event: LeafletMouseEvent) => {\n setIsAdding(false);\n\n controller.mapTarget.style.cursor = \"\";\n\n if (!controller.bounds.contains(event.latlng)) return;\n\n try {\n const res = await pb.collection(\"marcados\").create<Marker>({\n imagen_uuid: controller.uuidValue,\n x: event.latlng.lat,\n y: event.latlng.lng,\n creadorx: pb.authStore.model?.id,\n });\n await controller.fetchAndAddMarkers();\n controller.openMarkerModal(res);\n } catch (error) {\n alert(error);\n }\n };\n\n controller.map.on(\"click\", addMarkerListener);\n return () => controller.map.off(\"click\", addMarkerListener);\n }\n }, [isAdding]);\n\n async function startAdding() {\n if (!pb.authStore.model?.id) {\n await loginGoogle();\n }\n setIsAdding(true);\n }\n function stopAdding() {\n setIsAdding(false);\n }\n\n return (\n <>\n {isAdding ? (\n <button\n type=\"button\"\n class=\"position-absolute bottom-0 left-0 w-100 text-white\"\n style=\"background-color: rgba(0,0,0,0.8); font-size: 1em; z-index: 500\"\n onClick={stopAdding}\n >\n \u00A1Apret\u00E1 donde quer\u00E9s crear tu marcador! O apret\u00E1 ac\u00E1 para cancelar\n </button>\n ) : (\n <div class=\"position-absolute bottom-0 right-0 z-index-modal pb-12 pr-12\">\n <button\n class=\"btn btn-primary rounded-5 m-2 px-3\"\n onClick={startAdding}\n >\n <div>\n <div class=\"font-weight-bold f-24\">+</div>\n <div>{controller.i18nCreateMarkerValue}</div>\n </div>\n </button>\n </div>\n )}\n </>\n );\n}\n", "/** Normal hydration that attaches to a DOM tree but does not diff it. */\nexport const MODE_HYDRATE = 1 << 5;\n/** Signifies this VNode suspended on the previous render */\nexport const MODE_SUSPENDED = 1 << 7;\n/** Indicates that this node needs to be inserted while patching children */\nexport const INSERT_VNODE = 1 << 16;\n/** Indicates a VNode has been matched with another VNode in the diff */\nexport const MATCHED = 1 << 17;\n\n/** Reset all mode flags */\nexport const RESET_MODE = ~(MODE_HYDRATE | MODE_SUSPENDED);\n\nexport const EMPTY_OBJ = /** @type {any} */ ({});\nexport const EMPTY_ARR = [];\nexport const IS_NON_DIMENSIONAL =\n\t/acit|ex(?:s|g|n|p|$)|rph|grid|ows|mnc|ntw|ine[ch]|zoo|^ord|itera/i;\n", "import { EMPTY_ARR } from './constants';\n\nexport const isArray = Array.isArray;\n\n/**\n * Assign properties from `props` to `obj`\n * @template O, P The obj and props types\n * @param {O} obj The object to copy properties to\n * @param {P} props The object to copy properties from\n * @returns {O & P}\n */\nexport function assign(obj, props) {\n\t// @ts-expect-error We change the type of `obj` to be `O & P`\n\tfor (let i in props) obj[i] = props[i];\n\treturn /** @type {O & P} */ (obj);\n}\n\n/**\n * Remove a child node from its parent if attached. This is a workaround for\n * IE11 which doesn't support `Element.prototype.remove()`. Using this function\n * is smaller than including a dedicated polyfill.\n * @param {preact.ContainerNode} node The node to remove\n */\nexport function removeNode(node) {\n\tlet parentNode = node.parentNode;\n\tif (parentNode) parentNode.removeChild(node);\n}\n\nexport const slice = EMPTY_ARR.slice;\n", "import { _catchError } from './diff/catch-error';\n\n/**\n * The `option` object can potentially contain callback functions\n * that are called during various stages of our renderer. This is the\n * foundation on which all our addons like `preact/debug`, `preact/compat`,\n * and `preact/hooks` are based on. See the `Options` type in `internal.d.ts`\n * for a full list of available option hooks (most editors/IDEs allow you to\n * ctrl+click or cmd+click on mac the type definition below).\n * @type {Options}\n */\nconst options = {\n\t_catchError\n};\n\nexport default options;\n", "import { slice } from './util';\nimport options from './options';\n\nlet vnodeId = 0;\n\n/**\n * Create an virtual node (used for JSX)\n * @param {VNode[\"type\"]} type The node name or Component constructor for this\n * virtual node\n * @param {object | null | undefined} [props] The properties of the virtual node\n * @param {Array<import('.').ComponentChildren>} [children] The children of the\n * virtual node\n * @returns {VNode}\n */\nexport function createElement(type, props, children) {\n\tlet normalizedProps = {},\n\t\tkey,\n\t\tref,\n\t\ti;\n\tfor (i in props) {\n\t\tif (i == 'key') key = props[i];\n\t\telse if (i == 'ref') ref = props[i];\n\t\telse normalizedProps[i] = props[i];\n\t}\n\n\tif (arguments.length > 2) {\n\t\tnormalizedProps.children =\n\t\t\targuments.length > 3 ? slice.call(arguments, 2) : children;\n\t}\n\n\t// If a Component VNode, check for and apply defaultProps\n\t// Note: type may be undefined in development, must never error here.\n\tif (typeof type == 'function' && type.defaultProps != null) {\n\t\tfor (i in type.defaultProps) {\n\t\t\tif (normalizedProps[i] === undefined) {\n\t\t\t\tnormalizedProps[i] = type.defaultProps[i];\n\t\t\t}\n\t\t}\n\t}\n\n\treturn createVNode(type, normalizedProps, key, ref, null);\n}\n\n/**\n * Create a VNode (used internally by Preact)\n * @param {VNode[\"type\"]} type The node name or Component\n * Constructor for this virtual node\n * @param {object | string | number | null} props The properties of this virtual node.\n * If this virtual node represents a text node, this is the text of the node (string or number).\n * @param {string | number | null} key The key for this virtual node, used when\n * diffing it against its children\n * @param {VNode[\"ref\"]} ref The ref property that will\n * receive a reference to its created child\n * @returns {VNode}\n */\nexport function createVNode(type, props, key, ref, original) {\n\t// V8 seems to be better at detecting type shapes if the object is allocated from the same call site\n\t// Do not inline into createElement and coerceToVNode!\n\t/** @type {VNode} */\n\tconst vnode = {\n\t\ttype,\n\t\tprops,\n\t\tkey,\n\t\tref,\n\t\t_children: null,\n\t\t_parent: null,\n\t\t_depth: 0,\n\t\t_dom: null,\n\t\t// _nextDom must be initialized to undefined b/c it will eventually\n\t\t// be set to dom.nextSibling which can return `null` and it is important\n\t\t// to be able to distinguish between an uninitialized _nextDom and\n\t\t// a _nextDom that has been set to `null`\n\t\t_nextDom: undefined,\n\t\t_component: null,\n\t\tconstructor: undefined,\n\t\t_original: original == null ? ++vnodeId : original,\n\t\t_index: -1,\n\t\t_flags: 0\n\t};\n\n\t// Only invoke the vnode hook if this was *not* a direct copy:\n\tif (original == null && options.vnode != null) options.vnode(vnode);\n\n\treturn vnode;\n}\n\nexport function createRef() {\n\treturn { current: null };\n}\n\nexport function Fragment(props) {\n\treturn props.children;\n}\n\n/**\n * Check if a the argument is a valid Preact VNode.\n * @param {*} vnode\n * @returns {vnode is VNode}\n */\nexport const isValidElement = vnode =>\n\tvnode != null && vnode.constructor == undefined;\n", "import { assign } from './util';\nimport { diff, commitRoot } from './diff/index';\nimport options from './options';\nimport { Fragment } from './create-element';\nimport { MODE_HYDRATE } from './constants';\n\n/**\n * Base Component class. Provides `setState()` and `forceUpdate()`, which\n * trigger rendering\n * @param {object} props The initial component props\n * @param {object} context The initial context from parent components'\n * getChildContext\n */\nexport function BaseComponent(props, context) {\n\tthis.props = props;\n\tthis.context = context;\n}\n\n/**\n * Update component state and schedule a re-render.\n * @this {Component}\n * @param {object | ((s: object, p: object) => object)} update A hash of state\n * properties to update with new values or a function that given the current\n * state and props returns a new partial state\n * @param {() => void} [callback] A function to be called once component state is\n * updated\n */\nBaseComponent.prototype.setState = function (update, callback) {\n\t// only clone state when copying to nextState the first time.\n\tlet s;\n\tif (this._nextState != null && this._nextState !== this.state) {\n\t\ts = this._nextState;\n\t} else {\n\t\ts = this._nextState = assign({}, this.state);\n\t}\n\n\tif (typeof update == 'function') {\n\t\t// Some libraries like `immer` mark the current state as readonly,\n\t\t// preventing us from mutating it, so we need to clone it. See #2716\n\t\tupdate = update(assign({}, s), this.props);\n\t}\n\n\tif (update) {\n\t\tassign(s, update);\n\t}\n\n\t// Skip update if updater function returned null\n\tif (update == null) return;\n\n\tif (this._vnode) {\n\t\tif (callback) {\n\t\t\tthis._stateCallbacks.push(callback);\n\t\t}\n\t\tenqueueRender(this);\n\t}\n};\n\n/**\n * Immediately perform a synchronous re-render of the component\n * @this {Component}\n * @param {() => void} [callback] A function to be called after component is\n * re-rendered\n */\nBaseComponent.prototype.forceUpdate = function (callback) {\n\tif (this._vnode) {\n\t\t// Set render mode so that we can differentiate where the render request\n\t\t// is coming from. We need this because forceUpdate should never call\n\t\t// shouldComponentUpdate\n\t\tthis._force = true;\n\t\tif (callback) this._renderCallbacks.push(callback);\n\t\tenqueueRender(this);\n\t}\n};\n\n/**\n * Accepts `props` and `state`, and returns a new Virtual DOM tree to build.\n * Virtual DOM is generally constructed via [JSX](http://jasonformat.com/wtf-is-jsx).\n * @param {object} props Props (eg: JSX attributes) received from parent\n * element/component\n * @param {object} state The component's current state\n * @param {object} context Context object, as returned by the nearest\n * ancestor's `getChildContext()`\n * @returns {ComponentChildren | void}\n */\nBaseComponent.prototype.render = Fragment;\n\n/**\n * @param {VNode} vnode\n * @param {number | null} [childIndex]\n */\nexport function getDomSibling(vnode, childIndex) {\n\tif (childIndex == null) {\n\t\t// Use childIndex==null as a signal to resume the search from the vnode's sibling\n\t\treturn vnode._parent\n\t\t\t? getDomSibling(vnode._parent, vnode._index + 1)\n\t\t\t: null;\n\t}\n\n\tlet sibling;\n\tfor (; childIndex < vnode._children.length; childIndex++) {\n\t\tsibling = vnode._children[childIndex];\n\n\t\tif (sibling != null && sibling._dom != null) {\n\t\t\t// Since updateParentDomPointers keeps _dom pointer correct,\n\t\t\t// we can rely on _dom to tell us if this subtree contains a\n\t\t\t// rendered DOM node, and what the first rendered DOM node is\n\t\t\treturn sibling._dom;\n\t\t}\n\t}\n\n\t// If we get here, we have not found a DOM node in this vnode's children.\n\t// We must resume from this vnode's sibling (in it's parent _children array)\n\t// Only climb up and search the parent if we aren't searching through a DOM\n\t// VNode (meaning we reached the DOM parent of the original vnode that began\n\t// the search)\n\treturn typeof vnode.type == 'function' ? getDomSibling(vnode) : null;\n}\n\n/**\n * Trigger in-place re-rendering of a component.\n * @param {Component} component The component to rerender\n */\nfunction renderComponent(component) {\n\tlet oldVNode = component._vnode,\n\t\toldDom = oldVNode._dom,\n\t\tparentDom = component._parentDom,\n\t\tcommitQueue = [],\n\t\trefQueue = [];\n\n\tif (parentDom) {\n\t\tconst newVNode = assign({}, oldVNode);\n\t\tnewVNode._original = oldVNode._original + 1;\n\t\tif (options.vnode) options.vnode(newVNode);\n\n\t\tdiff(\n\t\t\tparentDom,\n\t\t\tnewVNode,\n\t\t\toldVNode,\n\t\t\tcomponent._globalContext,\n\t\t\tparentDom.ownerSVGElement !== undefined,\n\t\t\toldVNode._flags & MODE_HYDRATE ? [oldDom] : null,\n\t\t\tcommitQueue,\n\t\t\toldDom == null ? getDomSibling(oldVNode) : oldDom,\n\t\t\t!!(oldVNode._flags & MODE_HYDRATE),\n\t\t\trefQueue\n\t\t);\n\n\t\tnewVNode._parent._children[newVNode._index] = newVNode;\n\t\tcommitRoot(commitQueue, newVNode, refQueue);\n\n\t\tif (newVNode._dom != oldDom) {\n\t\t\tupdateParentDomPointers(newVNode);\n\t\t}\n\t}\n}\n\n/**\n * @param {VNode} vnode\n */\nfunction updateParentDomPointers(vnode) {\n\tif ((vnode = vnode._parent) != null && vnode._component != null) {\n\t\tvnode._dom = vnode._component.base = null;\n\t\tfor (let i = 0; i < vnode._children.length; i++) {\n\t\t\tlet child = vnode._children[i];\n\t\t\tif (child != null && child._dom != null) {\n\t\t\t\tvnode._dom = vnode._component.base = child._dom;\n\t\t\t\tbreak;\n\t\t\t}\n\t\t}\n\n\t\treturn updateParentDomPointers(vnode);\n\t}\n}\n\n/**\n * The render queue\n * @type {Array<Component>}\n */\nlet rerenderQueue = [];\n\n/*\n * The value of `Component.debounce` must asynchronously invoke the passed in callback. It is\n * important that contributors to Preact can consistently reason about what calls to `setState`, etc.\n * do, and when their effects will be applied. See the links below for some further reading on designing\n * asynchronous APIs.\n * * [Designing APIs for Asynchrony](https://blog.izs.me/2013/08/designing-apis-for-asynchrony)\n * * [Callbacks synchronous and asynchronous](https://blog.ometer.com/2011/07/24/callbacks-synchronous-and-asynchronous/)\n */\n\nlet prevDebounce;\n\nconst defer =\n\ttypeof Promise == 'function'\n\t\t? Promise.prototype.then.bind(Promise.resolve())\n\t\t: setTimeout;\n\n/**\n * Enqueue a rerender of a component\n * @param {Component} c The component to rerender\n */\nexport function enqueueRender(c) {\n\tif (\n\t\t(!c._dirty &&\n\t\t\t(c._dirty = true) &&\n\t\t\trerenderQueue.push(c) &&\n\t\t\t!process._rerenderCount++) ||\n\t\tprevDebounce !== options.debounceRendering\n\t) {\n\t\tprevDebounce = options.debounceRendering;\n\t\t(prevDebounce || defer)(process);\n\t}\n}\n\n/**\n * @param {Component} a\n * @param {Component} b\n */\nconst depthSort = (a, b) => a._vnode._depth - b._vnode._depth;\n\n/** Flush the render queue by rerendering all queued components */\nfunction process() {\n\tlet c;\n\trerenderQueue.sort(depthSort);\n\t// Don't update `renderCount` yet. Keep its value non-zero to prevent unnecessary\n\t// process() calls from getting scheduled while `queue` is still being consumed.\n\twhile ((c = rerenderQueue.shift())) {\n\t\tif (c._dirty) {\n\t\t\tlet renderQueueLength = rerenderQueue.length;\n\t\t\trenderComponent(c);\n\t\t\tif (rerenderQueue.length > renderQueueLength) {\n\t\t\t\t// When i.e. rerendering a provider additional new items can be injected, we want to\n\t\t\t\t// keep the order from top to bottom with those new items so we can handle them in a\n\t\t\t\t// single pass\n\t\t\t\trerenderQueue.sort(depthSort);\n\t\t\t}\n\t\t}\n\t}\n\tprocess._rerenderCount = 0;\n}\n\nprocess._rerenderCount = 0;\n", "import { enqueueRender } from './component';\n\nexport let i = 0;\n\nexport function createContext(defaultValue, contextId) {\n\tcontextId = '__cC' + i++;\n\n\tconst context = {\n\t\t_id: contextId,\n\t\t_defaultValue: defaultValue,\n\t\t/** @type {FunctionComponent} */\n\t\tConsumer(props, contextValue) {\n\t\t\t// return props.children(\n\t\t\t// \tcontext[contextId] ? context[contextId].props.value : defaultValue\n\t\t\t// );\n\t\t\treturn props.children(contextValue);\n\t\t},\n\t\t/** @type {FunctionComponent} */\n\t\tProvider(props) {\n\t\t\tif (!this.getChildContext) {\n\t\t\t\t/** @type {Component[]} */\n\t\t\t\tlet subs = [];\n\t\t\t\tlet ctx = {};\n\t\t\t\tctx[contextId] = this;\n\n\t\t\t\tthis.getChildContext = () => ctx;\n\n\t\t\t\tthis.shouldComponentUpdate = function (_props) {\n\t\t\t\t\tif (this.props.value !== _props.value) {\n\t\t\t\t\t\t// I think the forced value propagation here was only needed when `options.debounceRendering` was being bypassed:\n\t\t\t\t\t\t// https://github.com/preactjs/preact/commit/4d339fb803bea09e9f198abf38ca1bf8ea4b7771#diff-54682ce380935a717e41b8bfc54737f6R358\n\t\t\t\t\t\t// In those cases though, even with the value corrected, we're double-rendering all nodes.\n\t\t\t\t\t\t// It might be better to just tell folks not to use force-sync mode.\n\t\t\t\t\t\t// Currently, using `useContext()` in a class component will overwrite its `this.context` value.\n\t\t\t\t\t\t// subs.some(c => {\n\t\t\t\t\t\t// \tc.context = _props.value;\n\t\t\t\t\t\t// \tenqueueRender(c);\n\t\t\t\t\t\t// });\n\n\t\t\t\t\t\t// subs.some(c => {\n\t\t\t\t\t\t// \tc.context[contextId] = _props.value;\n\t\t\t\t\t\t// \tenqueueRender(c);\n\t\t\t\t\t\t// });\n\t\t\t\t\t\tsubs.some(c => {\n\t\t\t\t\t\t\tc._force = true;\n\t\t\t\t\t\t\tenqueueRender(c);\n\t\t\t\t\t\t});\n\t\t\t\t\t}\n\t\t\t\t};\n\n\t\t\t\tthis.sub = c => {\n\t\t\t\t\tsubs.push(c);\n\t\t\t\t\tlet old = c.componentWillUnmount;\n\t\t\t\t\tc.componentWillUnmount = () => {\n\t\t\t\t\t\tsubs.splice(subs.indexOf(c), 1);\n\t\t\t\t\t\tif (old) old.call(c);\n\t\t\t\t\t};\n\t\t\t\t};\n\t\t\t}\n\n\t\t\treturn props.children;\n\t\t}\n\t};\n\n\t// Devtools needs access to the context object when it\n\t// encounters a Provider. This is necessary to support\n\t// setting `displayName` on the context object instead\n\t// of on the component itself. See:\n\t// https://reactjs.org/docs/context.html#contextdisplayname\n\n\treturn (context.Provider._contextRef = context.Consumer.contextType =\n\t\tcontext);\n}\n", "import { diff, unmount, applyRef } from './index';\nimport { createVNode, Fragment } from '../create-element';\nimport { EMPTY_OBJ, EMPTY_ARR, INSERT_VNODE, MATCHED } from '../constants';\nimport { isArray } from '../util';\nimport { getDomSibling } from '../component';\n\n/**\n * Diff the children of a virtual node\n * @param {PreactElement} parentDom The DOM element whose children are being\n * diffed\n * @param {ComponentChildren[]} renderResult\n * @param {VNode} newParentVNode The new virtual node whose children should be\n * diff'ed against oldParentVNode\n * @param {VNode} oldParentVNode The old virtual node whose children should be\n * diff'ed against newParentVNode\n * @param {object} globalContext The current context object - modified by\n * getChildContext\n * @param {boolean} isSvg Whether or not this DOM node is an SVG node\n * @param {Array<PreactElement>} excessDomChildren\n * @param {Array<Component>} commitQueue List of components which have callbacks\n * to invoke in commitRoot\n * @param {PreactElement} oldDom The current attached DOM element any new dom\n * elements should be placed around. Likely `null` on first render (except when\n * hydrating). Can be a sibling DOM element when diffing Fragments that have\n * siblings. In most cases, it starts out as `oldChildren[0]._dom`.\n * @param {boolean} isHydrating Whether or not we are in hydration\n * @param {any[]} refQueue an array of elements needed to invoke refs\n */\nexport function diffChildren(\n\tparentDom,\n\trenderResult,\n\tnewParentVNode,\n\toldParentVNode,\n\tglobalContext,\n\tisSvg,\n\texcessDomChildren,\n\tcommitQueue,\n\toldDom,\n\tisHydrating,\n\trefQueue\n) {\n\tlet i,\n\t\t/** @type {VNode} */\n\t\toldVNode,\n\t\t/** @type {VNode} */\n\t\tchildVNode,\n\t\t/** @type {PreactElement} */\n\t\tnewDom,\n\t\t/** @type {PreactElement} */\n\t\tfirstChildDom;\n\n\t// This is a compression of oldParentVNode!=null && oldParentVNode != EMPTY_OBJ && oldParentVNode._children || EMPTY_ARR\n\t// as EMPTY_OBJ._children should be `undefined`.\n\t/** @type {VNode[]} */\n\tlet oldChildren = (oldParentVNode && oldParentVNode._children) || EMPTY_ARR;\n\n\tlet newChildrenLength = renderResult.length;\n\n\tnewParentVNode._nextDom = oldDom;\n\tconstructNewChildrenArray(newParentVNode, renderResult, oldChildren);\n\toldDom = newParentVNode._nextDom;\n\n\tfor (i = 0; i < newChildrenLength; i++) {\n\t\tchildVNode = newParentVNode._children[i];\n\n\t\tif (\n\t\t\tchildVNode == null ||\n\t\t\ttypeof childVNode == 'boolean' ||\n\t\t\ttypeof childVNode == 'function'\n\t\t) {\n\t\t\tcontinue;\n\t\t}\n\n\t\t// At this point, constructNewChildrenArray has assigned _index to be the\n\t\t// matchingIndex for this VNode's oldVNode (or -1 if there is no oldVNode).\n\t\tif (childVNode._index === -1) {\n\t\t\toldVNode = EMPTY_OBJ;\n\t\t} else {\n\t\t\toldVNode = oldChildren[childVNode._index] || EMPTY_OBJ;\n\t\t}\n\n\t\t// Update childVNode._index to its final index\n\t\tchildVNode._index = i;\n\n\t\t// Morph the old element into the new one, but don't append it to the dom yet\n\t\tdiff(\n\t\t\tparentDom,\n\t\t\tchildVNode,\n\t\t\toldVNode,\n\t\t\tglobalContext,\n\t\t\tisSvg,\n\t\t\texcessDomChildren,\n\t\t\tcommitQueue,\n\t\t\toldDom,\n\t\t\tisHydrating,\n\t\t\trefQueue\n\t\t);\n\n\t\t// Adjust DOM nodes\n\t\tnewDom = childVNode._dom;\n\t\tif (childVNode.ref && oldVNode.ref != childVNode.ref) {\n\t\t\tif (oldVNode.ref) {\n\t\t\t\tapplyRef(oldVNode.ref, null, childVNode);\n\t\t\t}\n\t\t\trefQueue.push(\n\t\t\t\tchildVNode.ref,\n\t\t\t\tchildVNode._component || newDom,\n\t\t\t\tchildVNode\n\t\t\t);\n\t\t}\n\n\t\tif (firstChildDom == null && newDom != null) {\n\t\t\tfirstChildDom = newDom;\n\t\t}\n\n\t\tif (\n\t\t\tchildVNode._flags & INSERT_VNODE ||\n\t\t\toldVNode._children === childVNode._children\n\t\t) {\n\t\t\toldDom = insert(childVNode, oldDom, parentDom);\n\t\t} else if (\n\t\t\ttypeof childVNode.type == 'function' &&\n\t\t\tchildVNode._nextDom !== undefined\n\t\t) {\n\t\t\t// Since Fragments or components that return Fragment like VNodes can\n\t\t\t// contain multiple DOM nodes as the same level, continue the diff from\n\t\t\t// the sibling of last DOM child of this child VNode\n\t\t\toldDom = childVNode._nextDom;\n\t\t} else if (newDom) {\n\t\t\toldDom = newDom.nextSibling;\n\t\t}\n\n\t\t// Eagerly cleanup _nextDom. We don't need to persist the value because it\n\t\t// is only used by `diffChildren` to determine where to resume the diff\n\t\t// after diffing Components and Fragments. Once we store it the nextDOM\n\t\t// local var, we can clean up the property. Also prevents us hanging on to\n\t\t// DOM nodes that may have been unmounted.\n\t\tchildVNode._nextDom = undefined;\n\n\t\t// Unset diffing flags\n\t\tchildVNode._flags &= ~(INSERT_VNODE | MATCHED);\n\t}\n\n\t// TODO: With new child diffing algo, consider alt ways to diff Fragments.\n\t// Such as dropping oldDom and moving fragments in place\n\t//\n\t// Because the newParentVNode is Fragment-like, we need to set it's\n\t// _nextDom property to the nextSibling of its last child DOM node.\n\t//\n\t// `oldDom` contains the correct value here because if the last child\n\t// is a Fragment-like, then oldDom has already been set to that child's _nextDom.\n\t// If the last child is a DOM VNode, then oldDom will be set to that DOM\n\t// node's nextSibling.\n\tnewParentVNode._nextDom = oldDom;\n\tnewParentVNode._dom = firstChildDom;\n}\n\n/**\n * @param {VNode} newParentVNode\n * @param {ComponentChildren[]} renderResult\n * @param {VNode[]} oldChildren\n */\nfunction constructNewChildrenArray(newParentVNode, renderResult, oldChildren) {\n\t/** @type {number} */\n\tlet i;\n\t/** @type {VNode} */\n\tlet childVNode;\n\t/** @type {VNode} */\n\tlet oldVNode;\n\n\tconst newChildrenLength = renderResult.length;\n\tlet oldChildrenLength = oldChildren.length,\n\t\tremainingOldChildren = oldChildrenLength;\n\n\tlet skew = 0;\n\n\tnewParentVNode._children = [];\n\tfor (i = 0; i < newChildrenLength; i++) {\n\t\t// @ts-expect-error We are reusing the childVNode variable to hold both the\n\t\t// pre and post normalized childVNode\n\t\tchildVNode = renderResult[i];\n\n\t\tif (\n\t\t\tchildVNode == null ||\n\t\t\ttypeof childVNode == 'boolean' ||\n\t\t\ttypeof childVNode == 'function'\n\t\t) {\n\t\t\tchildVNode = newParentVNode._children[i] = null;\n\t\t}\n\t\t// If this newVNode is being reused (e.g. <div>{reuse}{reuse}</div>) in the same diff,\n\t\t// or we are rendering a component (e.g. setState) copy the oldVNodes so it can have\n\t\t// it's own DOM & etc. pointers\n\t\telse if (\n\t\t\ttypeof childVNode == 'string' ||\n\t\t\ttypeof childVNode == 'number' ||\n\t\t\t// eslint-disable-next-line valid-typeof\n\t\t\ttypeof childVNode == 'bigint' ||\n\t\t\tchildVNode.constructor == String\n\t\t) {\n\t\t\tchildVNode = newParentVNode._children[i] = createVNode(\n\t\t\t\tnull,\n\t\t\t\tchildVNode,\n\t\t\t\tnull,\n\t\t\t\tnull,\n\t\t\t\tchildVNode\n\t\t\t);\n\t\t} else if (isArray(childVNode)) {\n\t\t\tchildVNode = newParentVNode._children[i] = createVNode(\n\t\t\t\tFragment,\n\t\t\t\t{ children: childVNode },\n\t\t\t\tnull,\n\t\t\t\tnull,\n\t\t\t\tnull\n\t\t\t);\n\t\t} else if (childVNode._depth > 0) {\n\t\t\t// VNode is already in use, clone it. This can happen in the following\n\t\t\t// scenario:\n\t\t\t// const reuse = <div />\n\t\t\t// <div>{reuse}<span />{reuse}</div>\n\t\t\tchildVNode = newParentVNode._children[i] = createVNode(\n\t\t\t\tchildVNode.type,\n\t\t\t\tchildVNode.props,\n\t\t\t\tchildVNode.key,\n\t\t\t\tchildVNode.ref ? childVNode.ref : null,\n\t\t\t\tchildVNode._original\n\t\t\t);\n\t\t} else {\n\t\t\tchildVNode = newParentVNode._children[i] = childVNode;\n\t\t}\n\n\t\t// Handle unmounting null placeholders, i.e. VNode => null in unkeyed children\n\t\tif (childVNode == null) {\n\t\t\toldVNode = oldChildren[i];\n\t\t\tif (oldVNode && oldVNode.key == null && oldVNode._dom) {\n\t\t\t\tif (oldVNode._dom == newParentVNode._nextDom) {\n\t\t\t\t\tnewParentVNode._nextDom = getDomSibling(oldVNode);\n\t\t\t\t}\n\n\t\t\t\tunmount(oldVNode, oldVNode, false);\n\n\t\t\t\t// Explicitly nullify this position in oldChildren instead of just\n\t\t\t\t// setting `_match=true` to prevent other routines (e.g.\n\t\t\t\t// `findMatchingIndex` or `getDomSibling`) from thinking VNodes or DOM\n\t\t\t\t// nodes in this position are still available to be used in diffing when\n\t\t\t\t// they have actually already been unmounted. For example, by only\n\t\t\t\t// setting `_match=true` here, the unmounting loop later would attempt\n\t\t\t\t// to unmount this VNode again seeing `_match==true`. Further,\n\t\t\t\t// getDomSibling doesn't know about _match and so would incorrectly\n\t\t\t\t// assume DOM nodes in this subtree are mounted and usable.\n\t\t\t\toldChildren[i] = null;\n\t\t\t\tremainingOldChildren--;\n\t\t\t}\n\n\t\t\tcontinue;\n\t\t}\n\n\t\tchildVNode._parent = newParentVNode;\n\t\tchildVNode._depth = newParentVNode._depth + 1;\n\n\t\tconst skewedIndex = i + skew;\n\t\tconst matchingIndex = findMatchingIndex(\n\t\t\tchildVNode,\n\t\t\toldChildren,\n\t\t\tskewedIndex,\n\t\t\tremainingOldChildren\n\t\t);\n\n\t\t// Temporarily store the matchingIndex on the _index property so we can pull\n\t\t// out the oldVNode in diffChildren. We'll override this to the VNode's\n\t\t// final index after using this property to get the oldVNode\n\t\tchildVNode._index = matchingIndex;\n\n\t\toldVNode = null;\n\t\tif (matchingIndex !== -1) {\n\t\t\toldVNode = oldChildren[matchingIndex];\n\t\t\tremainingOldChildren--;\n\t\t\tif (oldVNode) {\n\t\t\t\toldVNode._flags |= MATCHED;\n\t\t\t}\n\t\t}\n\n\t\t// Here, we define isMounting for the purposes of the skew diffing\n\t\t// algorithm. Nodes that are unsuspending are considered mounting and we detect\n\t\t// this by checking if oldVNode._original === null\n\t\tconst isMounting = oldVNode == null || oldVNode._original === null;\n\n\t\tif (isMounting) {\n\t\t\tif (matchingIndex == -1) {\n\t\t\t\tskew--;\n\t\t\t}\n\n\t\t\t// If we are mounting a DOM VNode, mark it for insertion\n\t\t\tif (typeof childVNode.type != 'function') {\n\t\t\t\tchildVNode._flags |= INSERT_VNODE;\n\t\t\t}\n\t\t} else if (matchingIndex !== skewedIndex) {\n\t\t\tif (matchingIndex === skewedIndex + 1) {\n\t\t\t\tskew++;\n\t\t\t} else if (matchingIndex > skewedIndex) {\n\t\t\t\tif (remainingOldChildren > newChildrenLength - skewedIndex) {\n\t\t\t\t\tskew += matchingIndex - skewedIndex;\n\t\t\t\t} else {\n\t\t\t\t\t// ### Change from keyed: I think this was missing from the algo...\n\t\t\t\t\tskew--;\n\t\t\t\t}\n\t\t\t} else if (matchingIndex < skewedIndex) {\n\t\t\t\tif (matchingIndex == skewedIndex - 1) {\n\t\t\t\t\tskew = matchingIndex - skewedIndex;\n\t\t\t\t} else {\n\t\t\t\t\tskew = 0;\n\t\t\t\t}\n\t\t\t} else {\n\t\t\t\tskew = 0;\n\t\t\t}\n\n\t\t\t// Move this VNode's DOM if the original index (matchingIndex) doesn't\n\t\t\t// match the new skew index (i + new skew)\n\t\t\tif (matchingIndex !== i + skew) {\n\t\t\t\tchildVNode._flags |= INSERT_VNODE;\n\t\t\t}\n\t\t}\n\t}\n\n\t// Remove remaining oldChildren if there are any. Loop forwards so that as we\n\t// unmount DOM from the beginning of the oldChildren, we can adjust oldDom to\n\t// point to the next child, which needs to be the first DOM node that won't be\n\t// unmounted.\n\tif (remainingOldChildren) {\n\t\tfor (i = 0; i < oldChildrenLength; i++) {\n\t\t\toldVNode = oldChildren[i];\n\t\t\tif (oldVNode != null && (oldVNode._flags & MATCHED) === 0) {\n\t\t\t\tif (oldVNode._dom == newParentVNode._nextDom) {\n\t\t\t\t\tnewParentVNode._nextDom = getDomSibling(oldVNode);\n\t\t\t\t}\n\n\t\t\t\tunmount(oldVNode, oldVNode);\n\t\t\t}\n\t\t}\n\t}\n}\n\n/**\n * @param {VNode} parentVNode\n * @param {PreactElement} oldDom\n * @param {PreactElement} parentDom\n * @returns {PreactElement}\n */\nfunction insert(parentVNode, oldDom, parentDom) {\n\t// Note: VNodes in nested suspended trees may be missing _children.\n\n\tif (typeof parentVNode.type == 'function') {\n\t\tlet children = parentVNode._children;\n\t\tfor (let i = 0; children && i < children.length; i++) {\n\t\t\tif (children[i]) {\n\t\t\t\t// If we enter this code path on sCU bailout, where we copy\n\t\t\t\t// oldVNode._children to newVNode._children, we need to update the old\n\t\t\t\t// children's _parent pointer to point to the newVNode (parentVNode\n\t\t\t\t// here).\n\t\t\t\tchildren[i]._parent = parentVNode;\n\t\t\t\toldDom = insert(children[i], oldDom, parentDom);\n\t\t\t}\n\t\t}\n\n\t\treturn oldDom;\n\t} else if (parentVNode._dom != oldDom) {\n\t\tparentDom.insertBefore(parentVNode._dom, oldDom || null);\n\t\toldDom = parentVNode._dom;\n\t}\n\n\treturn oldDom && oldDom.nextSibling;\n}\n\n/**\n * Flatten and loop through the children of a virtual node\n * @param {ComponentChildren} children The unflattened children of a virtual\n * node\n * @returns {VNode[]}\n */\nexport function toChildArray(children, out) {\n\tout = out || [];\n\tif (children == null || typeof children == 'boolean') {\n\t} else if (isArray(children)) {\n\t\tchildren.some(child => {\n\t\t\ttoChildArray(child, out);\n\t\t});\n\t} else {\n\t\tout.push(children);\n\t}\n\treturn out;\n}\n\n/**\n * @param {VNode} childVNode\n * @param {VNode[]} oldChildren\n * @param {number} skewedIndex\n * @param {number} remainingOldChildren\n * @returns {number}\n */\nfunction findMatchingIndex(\n\tchildVNode,\n\toldChildren,\n\tskewedIndex,\n\tremainingOldChildren\n) {\n\tconst key = childVNode.key;\n\tconst type = childVNode.type;\n\tlet x = skewedIndex - 1;\n\tlet y = skewedIndex + 1;\n\tlet oldVNode = oldChildren[skewedIndex];\n\n\t// We only need to perform a search if there are more children\n\t// (remainingOldChildren) to search. However, if the oldVNode we just looked\n\t// at skewedIndex was not already used in this diff, then there must be at\n\t// least 1 other (so greater than 1) remainingOldChildren to attempt to match\n\t// against. So the following condition checks that ensuring\n\t// remainingOldChildren > 1 if the oldVNode is not already used/matched. Else\n\t// if the oldVNode was null or matched, then there could needs to be at least\n\t// 1 (aka `remainingOldChildren > 0`) children to find and compare against.\n\tlet shouldSearch =\n\t\tremainingOldChildren >\n\t\t(oldVNode != null && (oldVNode._flags & MATCHED) === 0 ? 1 : 0);\n\n\tif (\n\t\toldVNode === null ||\n\t\t(oldVNode && key == oldVNode.key && type === oldVNode.type)\n\t) {\n\t\treturn skewedIndex;\n\t} else if (shouldSearch) {\n\t\twhile (x >= 0 || y < oldChildren.length) {\n\t\t\tif (x >= 0) {\n\t\t\t\toldVNode = oldChildren[x];\n\t\t\t\tif (\n\t\t\t\t\toldVNode &&\n\t\t\t\t\t(oldVNode._flags & MATCHED) === 0 &&\n\t\t\t\t\tkey == oldVNode.key &&\n\t\t\t\t\ttype === oldVNode.type\n\t\t\t\t) {\n\t\t\t\t\treturn x;\n\t\t\t\t}\n\t\t\t\tx--;\n\t\t\t}\n\n\t\t\tif (y < oldChildren.length) {\n\t\t\t\toldVNode = oldChildren[y];\n\t\t\t\tif (\n\t\t\t\t\toldVNode &&\n\t\t\t\t\t(oldVNode._flags & MATCHED) === 0 &&\n\t\t\t\t\tkey == oldVNode.key &&\n\t\t\t\t\ttype === oldVNode.type\n\t\t\t\t) {\n\t\t\t\t\treturn y;\n\t\t\t\t}\n\t\t\t\ty++;\n\t\t\t}\n\t\t}\n\t}\n\n\treturn -1;\n}\n", "import { IS_NON_DIMENSIONAL } from '../constants';\nimport options from '../options';\n\nfunction setStyle(style, key, value) {\n\tif (key[0] === '-') {\n\t\tstyle.setProperty(key, value == null ? '' : value);\n\t} else if (value == null) {\n\t\tstyle[key] = '';\n\t} else if (typeof value != 'number' || IS_NON_DIMENSIONAL.test(key)) {\n\t\tstyle[key] = value;\n\t} else {\n\t\tstyle[key] = value + 'px';\n\t}\n}\n\n/**\n * Set a property value on a DOM node\n * @param {PreactElement} dom The DOM node to modify\n * @param {string} name The name of the property to set\n * @param {*} value The value to set the property to\n * @param {*} oldValue The old value the property had\n * @param {boolean} isSvg Whether or not this DOM node is an SVG node or not\n */\nexport function setProperty(dom, name, value, oldValue, isSvg) {\n\tlet useCapture;\n\n\to: if (name === 'style') {\n\t\tif (typeof value == 'string') {\n\t\t\tdom.style.cssText = value;\n\t\t} else {\n\t\t\tif (typeof oldValue == 'string') {\n\t\t\t\tdom.style.cssText = oldValue = '';\n\t\t\t}\n\n\t\t\tif (oldValue) {\n\t\t\t\tfor (name in oldValue) {\n\t\t\t\t\tif (!(value && name in value)) {\n\t\t\t\t\t\tsetStyle(dom.style, name, '');\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\n\t\t\tif (value) {\n\t\t\t\tfor (name in value) {\n\t\t\t\t\tif (!oldValue || value[name] !== oldValue[name]) {\n\t\t\t\t\t\tsetStyle(dom.style, name, value[name]);\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t}\n\t// Benchmark for comparison: https://esbench.com/bench/574c954bdb965b9a00965ac6\n\telse if (name[0] === 'o' && name[1] === 'n') {\n\t\tuseCapture =\n\t\t\tname !== (name = name.replace(/(PointerCapture)$|Capture$/, '$1'));\n\n\t\t// Infer correct casing for DOM built-in events:\n\t\tif (name.toLowerCase() in dom) name = name.toLowerCase().slice(2);\n\t\telse name = name.slice(2);\n\n\t\tif (!dom._listeners) dom._listeners = {};\n\t\tdom._listeners[name + useCapture] = value;\n\n\t\tif (value) {\n\t\t\tif (!oldValue) {\n\t\t\t\tvalue._attached = Date.now();\n\t\t\t\tconst handler = useCapture ? eventProxyCapture : eventProxy;\n\t\t\t\tdom.addEventListener(name, handler, useCapture);\n\t\t\t} else {\n\t\t\t\tvalue._attached = oldValue._attached;\n\t\t\t}\n\t\t} else {\n\t\t\tconst handler = useCapture ? eventProxyCapture : eventProxy;\n\t\t\tdom.removeEventListener(name, handler, useCapture);\n\t\t}\n\t} else {\n\t\tif (isSvg) {\n\t\t\t// Normalize incorrect prop usage for SVG:\n\t\t\t// - xlink:href / xlinkHref --> href (xlink:href was removed from SVG and isn't needed)\n\t\t\t// - className --> class\n\t\t\tname = name.replace(/xlink(H|:h)/, 'h').replace(/sName$/, 's');\n\t\t} else if (\n\t\t\tname !== 'width' &&\n\t\t\tname !== 'height' &&\n\t\t\tname !== 'href' &&\n\t\t\tname !== 'list' &&\n\t\t\tname !== 'form' &&\n\t\t\t// Default value in browsers is `-1` and an empty string is\n\t\t\t// cast to `0` instead\n\t\t\tname !== 'tabIndex' &&\n\t\t\tname !== 'download' &&\n\t\t\tname !== 'rowSpan' &&\n\t\t\tname !== 'colSpan' &&\n\t\t\tname !== 'role' &&\n\t\t\tname in dom\n\t\t) {\n\t\t\ttry {\n\t\t\t\tdom[name] = value == null ? '' : value;\n\t\t\t\t// labelled break is 1b smaller here than a return statement (sorry)\n\t\t\t\tbreak o;\n\t\t\t} catch (e) {}\n\t\t}\n\n\t\t// aria- and data- attributes have no boolean representation.\n\t\t// A `false` value is different from the attribute not being\n\t\t// present, so we can't remove it. For non-boolean aria\n\t\t// attributes we could treat false as a removal, but the\n\t\t// amount of exceptions would cost too many bytes. On top of\n\t\t// that other frameworks generally stringify `false`.\n\n\t\tif (typeof value == 'function') {\n\t\t\t// never serialize functions as attribute values\n\t\t} else if (value != null && (value !== false || name[4] === '-')) {\n\t\t\tdom.setAttribute(name, value);\n\t\t} else {\n\t\t\tdom.removeAttribute(name);\n\t\t}\n\t}\n}\n\n/**\n * Proxy an event to hooked event handlers\n * @param {PreactEvent} e The event object from the browser\n * @private\n */\nfunction eventProxy(e) {\n\tconst eventHandler = this._listeners[e.type + false];\n\t/**\n\t * This trick is inspired by Vue https://github.com/vuejs/core/blob/main/packages/runtime-dom/src/modules/events.ts#L90-L101\n\t * when the dom performs an event it leaves micro-ticks in between bubbling up which means that an event can trigger on a newly\n\t * created DOM-node while the event bubbles up, this can cause quirky behavior as seen in https://github.com/preactjs/preact/issues/3927\n\t */\n\tif (!e._dispatched) {\n\t\t// When an event has no _dispatched we know this is the first event-target in the chain\n\t\t// so we set the initial dispatched time.\n\t\te._dispatched = Date.now();\n\t\t// When the _dispatched is smaller than the time when the targetted event handler was attached\n\t\t// we know we have bubbled up to an element that was added during patching the dom.\n\t} else if (e._dispatched <= eventHandler._attached) {\n\t\treturn;\n\t}\n\treturn eventHandler(options.event ? options.event(e) : e);\n}\n\n/**\n * Proxy an event to hooked event handlers\n * @param {PreactEvent} e The event object from the browser\n * @private\n */\nfunction eventProxyCapture(e) {\n\treturn this._listeners[e.type + true](options.event ? options.event(e) : e);\n}\n", "import {\n\tEMPTY_OBJ,\n\tMODE_HYDRATE,\n\tMODE_SUSPENDED,\n\tRESET_MODE\n} from '../constants';\nimport { BaseComponent, getDomSibling } from '../component';\nimport { Fragment } from '../create-element';\nimport { diffChildren } from './children';\nimport { setProperty } from './props';\nimport { assign, isArray, removeNode, slice } from '../util';\nimport options from '../options';\n\n/**\n * Diff two virtual nodes and apply proper changes to the DOM\n * @param {PreactElement} parentDom The parent of the DOM element\n * @param {VNode} newVNode The new virtual node\n * @param {VNode} oldVNode The old virtual node\n * @param {object} globalContext The current context object. Modified by\n * getChildContext\n * @param {boolean} isSvg Whether or not this element is an SVG node\n * @param {Array<PreactElement>} excessDomChildren\n * @param {Array<Component>} commitQueue List of components which have callbacks\n * to invoke in commitRoot\n * @param {PreactElement} oldDom The current attached DOM element any new dom\n * elements should be placed around. Likely `null` on first render (except when\n * hydrating). Can be a sibling DOM element when diffing Fragments that have\n * siblings. In most cases, it starts out as `oldChildren[0]._dom`.\n * @param {boolean} isHydrating Whether or not we are in hydration\n * @param {any[]} refQueue an array of elements needed to invoke refs\n */\nexport function diff(\n\tparentDom,\n\tnewVNode,\n\toldVNode,\n\tglobalContext,\n\tisSvg,\n\texcessDomChildren,\n\tcommitQueue,\n\toldDom,\n\tisHydrating,\n\trefQueue\n) {\n\t/** @type {any} */\n\tlet tmp,\n\t\tnewType = newVNode.type;\n\n\t// When passing through createElement it assigns the object\n\t// constructor as undefined. This to prevent JSON-injection.\n\tif (newVNode.constructor !== undefined) return null;\n\n\t// If the previous diff bailed out, resume creating/hydrating.\n\tif (oldVNode._flags & MODE_SUSPENDED) {\n\t\tisHydrating = !!(oldVNode._flags & MODE_HYDRATE);\n\t\toldDom = newVNode._dom = oldVNode._dom;\n\t\texcessDomChildren = [oldDom];\n\t}\n\n\tif ((tmp = options._diff)) tmp(newVNode);\n\n\touter: if (typeof newType == 'function') {\n\t\ttry {\n\t\t\tlet c, isNew, oldProps, oldState, snapshot, clearProcessingException;\n\t\t\tlet newProps = newVNode.props;\n\n\t\t\t// Necessary for createContext api. Setting this property will pass\n\t\t\t// the context value as `this.context` just for this component.\n\t\t\ttmp = newType.contextType;\n\t\t\tlet provider = tmp && globalContext[tmp._id];\n\t\t\tlet componentContext = tmp\n\t\t\t\t? provider\n\t\t\t\t\t? provider.props.value\n\t\t\t\t\t: tmp._defaultValue\n\t\t\t\t: globalContext;\n\n\t\t\t// Get component and set it to `c`\n\t\t\tif (oldVNode._component) {\n\t\t\t\tc = newVNode._component = oldVNode._component;\n\t\t\t\tclearProcessingException = c._processingException = c._pendingError;\n\t\t\t} else {\n\t\t\t\t// Instantiate the new component\n\t\t\t\tif ('prototype' in newType && newType.prototype.render) {\n\t\t\t\t\t// @ts-expect-error The check above verifies that newType is suppose to be constructed\n\t\t\t\t\tnewVNode._component = c = new newType(newProps, componentContext); // eslint-disable-line new-cap\n\t\t\t\t} else {\n\t\t\t\t\t// @ts-expect-error Trust me, Component implements the interface we want\n\t\t\t\t\tnewVNode._component = c = new BaseComponent(\n\t\t\t\t\t\tnewProps,\n\t\t\t\t\t\tcomponentContext\n\t\t\t\t\t);\n\t\t\t\t\tc.constructor = newType;\n\t\t\t\t\tc.render = doRender;\n\t\t\t\t}\n\t\t\t\tif (provider) provider.sub(c);\n\n\t\t\t\tc.props = newProps;\n\t\t\t\tif (!c.state) c.state = {};\n\t\t\t\tc.context = componentContext;\n\t\t\t\tc._globalContext = globalContext;\n\t\t\t\tisNew = c._dirty = true;\n\t\t\t\tc._renderCallbacks = [];\n\t\t\t\tc._stateCallbacks = [];\n\t\t\t}\n\n\t\t\t// Invoke getDerivedStateFromProps\n\t\t\tif (c._nextState == null) {\n\t\t\t\tc._nextState = c.state;\n\t\t\t}\n\n\t\t\tif (newType.getDerivedStateFromProps != null) {\n\t\t\t\tif (c._nextState == c.state) {\n\t\t\t\t\tc._nextState = assign({}, c._nextState);\n\t\t\t\t}\n\n\t\t\t\tassign(\n\t\t\t\t\tc._nextState,\n\t\t\t\t\tnewType.getDerivedStateFromProps(newProps, c._nextState)\n\t\t\t\t);\n\t\t\t}\n\n\t\t\toldProps = c.props;\n\t\t\toldState = c.state;\n\t\t\tc._vnode = newVNode;\n\n\t\t\t// Invoke pre-render lifecycle methods\n\t\t\tif (isNew) {\n\t\t\t\tif (\n\t\t\t\t\tnewType.getDerivedStateFromProps == null &&\n\t\t\t\t\tc.componentWillMount != null\n\t\t\t\t) {\n\t\t\t\t\tc.componentWillMount();\n\t\t\t\t}\n\n\t\t\t\tif (c.componentDidMount != null) {\n\t\t\t\t\tc._renderCallbacks.push(c.componentDidMount);\n\t\t\t\t}\n\t\t\t} else {\n\t\t\t\tif (\n\t\t\t\t\tnewType.getDerivedStateFromProps == null &&\n\t\t\t\t\tnewProps !== oldProps &&\n\t\t\t\t\tc.componentWillReceiveProps != null\n\t\t\t\t) {\n\t\t\t\t\tc.componentWillReceiveProps(newProps, componentContext);\n\t\t\t\t}\n\n\t\t\t\tif (\n\t\t\t\t\t!c._force &&\n\t\t\t\t\t((c.shouldComponentUpdate != null &&\n\t\t\t\t\t\tc.shouldComponentUpdate(\n\t\t\t\t\t\t\tnewProps,\n\t\t\t\t\t\t\tc._nextState,\n\t\t\t\t\t\t\tcomponentContext\n\t\t\t\t\t\t) === false) ||\n\t\t\t\t\t\tnewVNode._original === oldVNode._original)\n\t\t\t\t) {\n\t\t\t\t\t// More info about this here: https://gist.github.com/JoviDeCroock/bec5f2ce93544d2e6070ef8e0036e4e8\n\t\t\t\t\tif (newVNode._original !== oldVNode._original) {\n\t\t\t\t\t\t// When we are dealing with a bail because of sCU we have to update\n\t\t\t\t\t\t// the props, state and dirty-state.\n\t\t\t\t\t\t// when we are dealing with strict-equality we don't as the child could still\n\t\t\t\t\t\t// be dirtied see #3883\n\t\t\t\t\t\tc.props = newProps;\n\t\t\t\t\t\tc.state = c._nextState;\n\t\t\t\t\t\tc._dirty = false;\n\t\t\t\t\t}\n\n\t\t\t\t\tnewVNode._dom = oldVNode._dom;\n\t\t\t\t\tnewVNode._children = oldVNode._children;\n\t\t\t\t\tnewVNode._children.forEach(vnode => {\n\t\t\t\t\t\tif (vnode) vnode._parent = newVNode;\n\t\t\t\t\t});\n\n\t\t\t\t\tfor (let i = 0; i < c._stateCallbacks.length; i++) {\n\t\t\t\t\t\tc._renderCallbacks.push(c._stateCallbacks[i]);\n\t\t\t\t\t}\n\t\t\t\t\tc._stateCallbacks = [];\n\n\t\t\t\t\tif (c._renderCallbacks.length) {\n\t\t\t\t\t\tcommitQueue.push(c);\n\t\t\t\t\t}\n\n\t\t\t\t\tbreak outer;\n\t\t\t\t}\n\n\t\t\t\tif (c.componentWillUpdate != null) {\n\t\t\t\t\tc.componentWillUpdate(newProps, c._nextState, componentContext);\n\t\t\t\t}\n\n\t\t\t\tif (c.componentDidUpdate != null) {\n\t\t\t\t\tc._renderCallbacks.push(() => {\n\t\t\t\t\t\tc.componentDidUpdate(oldProps, oldState, snapshot);\n\t\t\t\t\t});\n\t\t\t\t}\n\t\t\t}\n\n\t\t\tc.context = componentContext;\n\t\t\tc.props = newProps;\n\t\t\tc._parentDom = parentDom;\n\t\t\tc._force = false;\n\n\t\t\tlet renderHook = options._render,\n\t\t\t\tcount = 0;\n\t\t\tif ('prototype' in newType && newType.prototype.render) {\n\t\t\t\tc.state = c._nextState;\n\t\t\t\tc._dirty = false;\n\n\t\t\t\tif (renderHook) renderHook(newVNode);\n\n\t\t\t\ttmp = c.render(c.props, c.state, c.context);\n\n\t\t\t\tfor (let i = 0; i < c._stateCallbacks.length; i++) {\n\t\t\t\t\tc._renderCallbacks.push(c._stateCallbacks[i]);\n\t\t\t\t}\n\t\t\t\tc._stateCallbacks = [];\n\t\t\t} else {\n\t\t\t\tdo {\n\t\t\t\t\tc._dirty = false;\n\t\t\t\t\tif (renderHook) renderHook(newVNode);\n\n\t\t\t\t\ttmp = c.render(c.props, c.state, c.context);\n\n\t\t\t\t\t// Handle setState called in render, see #2553\n\t\t\t\t\tc.state = c._nextState;\n\t\t\t\t} while (c._dirty && ++count < 25);\n\t\t\t}\n\n\t\t\t// Handle setState called in render, see #2553\n\t\t\tc.state = c._nextState;\n\n\t\t\tif (c.getChildContext != null) {\n\t\t\t\tglobalContext = assign(assign({}, globalContext), c.getChildContext());\n\t\t\t}\n\n\t\t\tif (!isNew && c.getSnapshotBeforeUpdate != null) {\n\t\t\t\tsnapshot = c.getSnapshotBeforeUpdate(oldProps, oldState);\n\t\t\t}\n\n\t\t\tlet isTopLevelFragment =\n\t\t\t\ttmp != null && tmp.type === Fragment && tmp.key == null;\n\t\t\tlet renderResult = isTopLevelFragment ? tmp.props.children : tmp;\n\n\t\t\tdiffChildren(\n\t\t\t\tparentDom,\n\t\t\t\tisArray(renderResult) ? renderResult : [renderResult],\n\t\t\t\tnewVNode,\n\t\t\t\toldVNode,\n\t\t\t\tglobalContext,\n\t\t\t\tisSvg,\n\t\t\t\texcessDomChildren,\n\t\t\t\tcommitQueue,\n\t\t\t\toldDom,\n\t\t\t\tisHydrating,\n\t\t\t\trefQueue\n\t\t\t);\n\n\t\t\tc.base = newVNode._dom;\n\n\t\t\t// We successfully rendered this VNode, unset any stored hydration/bailout state:\n\t\t\tnewVNode._flags &= RESET_MODE;\n\n\t\t\tif (c._renderCallbacks.length) {\n\t\t\t\tcommitQueue.push(c);\n\t\t\t}\n\n\t\t\tif (clearProcessingException) {\n\t\t\t\tc._pendingError = c._processingException = null;\n\t\t\t}\n\t\t} catch (e) {\n\t\t\tnewVNode._original = null;\n\t\t\t// if hydrating or creating initial tree, bailout preserves DOM:\n\t\t\tif (isHydrating || excessDomChildren != null) {\n\t\t\t\tnewVNode._dom = oldDom;\n\t\t\t\tnewVNode._flags |= isHydrating\n\t\t\t\t\t? MODE_HYDRATE | MODE_SUSPENDED\n\t\t\t\t\t: MODE_HYDRATE;\n\t\t\t\texcessDomChildren[excessDomChildren.indexOf(oldDom)] = null;\n\t\t\t\t// ^ could possibly be simplified to:\n\t\t\t\t// excessDomChildren.length = 0;\n\t\t\t} else {\n\t\t\t\tnewVNode._dom = oldVNode._dom;\n\t\t\t\tnewVNode._children = oldVNode._children;\n\t\t\t}\n\t\t\toptions._catchError(e, newVNode, oldVNode);\n\t\t}\n\t} else if (\n\t\texcessDomChildren == null &&\n\t\tnewVNode._original === oldVNode._original\n\t) {\n\t\tnewVNode._children = oldVNode._children;\n\t\tnewVNode._dom = oldVNode._dom;\n\t} else {\n\t\tnewVNode._dom = diffElementNodes(\n\t\t\toldVNode._dom,\n\t\t\tnewVNode,\n\t\t\toldVNode,\n\t\t\tglobalContext,\n\t\t\tisSvg,\n\t\t\texcessDomChildren,\n\t\t\tcommitQueue,\n\t\t\tisHydrating,\n\t\t\trefQueue\n\t\t);\n\t}\n\n\tif ((tmp = options.diffed)) tmp(newVNode);\n}\n\n/**\n * @param {Array<Component>} commitQueue List of components\n * which have callbacks to invoke in commitRoot\n * @param {VNode} root\n */\nexport function commitRoot(commitQueue, root, refQueue) {\n\troot._nextDom = undefined;\n\n\tfor (let i = 0; i < refQueue.length; i++) {\n\t\tapplyRef(refQueue[i], refQueue[++i], refQueue[++i]);\n\t}\n\n\tif (options._commit) options._commit(root, commitQueue);\n\n\tcommitQueue.some(c => {\n\t\ttry {\n\t\t\t// @ts-expect-error Reuse the commitQueue variable here so the type changes\n\t\t\tcommitQueue = c._renderCallbacks;\n\t\t\tc._renderCallbacks = [];\n\t\t\tcommitQueue.some(cb => {\n\t\t\t\t// @ts-expect-error See above comment on commitQueue\n\t\t\t\tcb.call(c);\n\t\t\t});\n\t\t} catch (e) {\n\t\t\toptions._catchError(e, c._vnode);\n\t\t}\n\t});\n}\n\n/**\n * Diff two virtual nodes representing DOM element\n * @param {PreactElement} dom The DOM element representing the virtual nodes\n * being diffed\n * @param {VNode} newVNode The new virtual node\n * @param {VNode} oldVNode The old virtual node\n * @param {object} globalContext The current context object\n * @param {boolean} isSvg Whether or not this DOM node is an SVG node\n * @param {Array<PreactElement>} excessDomChildren\n * @param {Array<Component>} commitQueue List of components which have callbacks\n * to invoke in commitRoot\n * @param {boolean} isHydrating Whether or not we are in hydration\n * @param {any[]} refQueue an array of elements needed to invoke refs\n * @returns {PreactElement}\n */\nfunction diffElementNodes(\n\tdom,\n\tnewVNode,\n\toldVNode,\n\tglobalContext,\n\tisSvg,\n\texcessDomChildren,\n\tcommitQueue,\n\tisHydrating,\n\trefQueue\n) {\n\tlet oldProps = oldVNode.props;\n\tlet newProps = newVNode.props;\n\tlet nodeType = /** @type {string} */ (newVNode.type);\n\t/** @type {any} */\n\tlet i;\n\t/** @type {{ __html?: string }} */\n\tlet newHtml;\n\t/** @type {{ __html?: string }} */\n\tlet oldHtml;\n\t/** @type {ComponentChildren} */\n\tlet newChildren;\n\tlet value;\n\tlet inputValue;\n\tlet checked;\n\n\t// Tracks entering and exiting SVG namespace when descending through the tree.\n\tif (nodeType === 'svg') isSvg = true;\n\n\tif (excessDomChildren != null) {\n\t\tfor (i = 0; i < excessDomChildren.length; i++) {\n\t\t\tvalue = excessDomChildren[i];\n\n\t\t\t// if newVNode matches an element in excessDomChildren or the `dom`\n\t\t\t// argument matches an element in excessDomChildren, remove it from\n\t\t\t// excessDomChildren so it isn't later removed in diffChildren\n\t\t\tif (\n\t\t\t\tvalue &&\n\t\t\t\t'setAttribute' in value === !!nodeType &&\n\t\t\t\t(nodeType ? value.localName === nodeType : value.nodeType === 3)\n\t\t\t) {\n\t\t\t\tdom = value;\n\t\t\t\texcessDomChildren[i] = null;\n\t\t\t\tbreak;\n\t\t\t}\n\t\t}\n\t}\n\n\tif (dom == null) {\n\t\tif (nodeType === null) {\n\t\t\treturn document.createTextNode(newProps);\n\t\t}\n\n\t\tif (isSvg) {\n\t\t\tdom = document.createElementNS('http://www.w3.org/2000/svg', nodeType);\n\t\t} else {\n\t\t\tdom = document.createElement(nodeType, newProps.is && newProps);\n\t\t}\n\n\t\t// we created a new parent, so none of the previously attached children can be reused:\n\t\texcessDomChildren = null;\n\t\t// we are creating a new node, so we can assume this is a new subtree (in\n\t\t// case we are hydrating), this deopts the hydrate\n\t\tisHydrating = false;\n\t}\n\n\tif (nodeType === null) {\n\t\t// During hydration, we still have to split merged text from SSR'd HTML.\n\t\tif (oldProps !== newProps && (!isHydrating || dom.data !== newProps)) {\n\t\t\tdom.data = newProps;\n\t\t}\n\t} else {\n\t\t// If excessDomChildren was not null, repopulate it with the current element's children:\n\t\texcessDomChildren = excessDomChildren && slice.call(dom.childNodes);\n\n\t\toldProps = oldVNode.props || EMPTY_OBJ;\n\n\t\t// If we are in a situation where we are not hydrating but are using\n\t\t// existing DOM (e.g. replaceNode) we should read the existing DOM\n\t\t// attributes to diff them\n\t\tif (!isHydrating && excessDomChildren != null) {\n\t\t\toldProps = {};\n\t\t\tfor (i = 0; i < dom.attributes.length; i++) {\n\t\t\t\tvalue = dom.attributes[i];\n\t\t\t\toldProps[value.name] = value.value;\n\t\t\t}\n\t\t}\n\n\t\tfor (i in oldProps) {\n\t\t\tvalue = oldProps[i];\n\t\t\tif (i == 'children') {\n\t\t\t} else if (i == 'dangerouslySetInnerHTML') {\n\t\t\t\toldHtml = value;\n\t\t\t} else if (i !== 'key' && !(i in newProps)) {\n\t\t\t\tsetProperty(dom, i, null, value, isSvg);\n\t\t\t}\n\t\t}\n\n\t\t// During hydration, props are not diffed at all (including dangerouslySetInnerHTML)\n\t\t// @TODO we should warn in debug mode when props don't match here.\n\t\tfor (i in newProps) {\n\t\t\tvalue = newProps[i];\n\t\t\tif (i == 'children') {\n\t\t\t\tnewChildren = value;\n\t\t\t} else if (i == 'dangerouslySetInnerHTML') {\n\t\t\t\tnewHtml = value;\n\t\t\t} else if (i == 'value') {\n\t\t\t\tinputValue = value;\n\t\t\t} else if (i == 'checked') {\n\t\t\t\tchecked = value;\n\t\t\t} else if (\n\t\t\t\ti !== 'key' &&\n\t\t\t\t(!isHydrating || typeof value == 'function') &&\n\t\t\t\toldProps[i] !== value\n\t\t\t) {\n\t\t\t\tsetProperty(dom, i, value, oldProps[i], isSvg);\n\t\t\t}\n\t\t}\n\n\t\t// If the new vnode didn't have dangerouslySetInnerHTML, diff its children\n\t\tif (newHtml) {\n\t\t\t// Avoid re-applying the same '__html' if it did not changed between re-render\n\t\t\tif (\n\t\t\t\t!isHydrating &&\n\t\t\t\t(!oldHtml ||\n\t\t\t\t\t(newHtml.__html !== oldHtml.__html &&\n\t\t\t\t\t\tnewHtml.__html !== dom.innerHTML))\n\t\t\t) {\n\t\t\t\tdom.innerHTML = newHtml.__html;\n\t\t\t}\n\n\t\t\tnewVNode._children = [];\n\t\t} else {\n\t\t\tif (oldHtml) dom.innerHTML = '';\n\n\t\t\tdiffChildren(\n\t\t\t\tdom,\n\t\t\t\tisArray(newChildren) ? newChildren : [newChildren],\n\t\t\t\tnewVNode,\n\t\t\t\toldVNode,\n\t\t\t\tglobalContext,\n\t\t\t\tisSvg && nodeType !== 'foreignObject',\n\t\t\t\texcessDomChildren,\n\t\t\t\tcommitQueue,\n\t\t\t\texcessDomChildren\n\t\t\t\t\t? excessDomChildren[0]\n\t\t\t\t\t: oldVNode._children && getDomSibling(oldVNode, 0),\n\t\t\t\tisHydrating,\n\t\t\t\trefQueue\n\t\t\t);\n\n\t\t\t// Remove children that are not part of any vnode.\n\t\t\tif (excessDomChildren != null) {\n\t\t\t\tfor (i = excessDomChildren.length; i--; ) {\n\t\t\t\t\tif (excessDomChildren[i] != null) removeNode(excessDomChildren[i]);\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\t// As above, don't diff props during hydration\n\t\tif (!isHydrating) {\n\t\t\ti = 'value';\n\t\t\tif (\n\t\t\t\tinputValue !== undefined &&\n\t\t\t\t// #2756 For the <progress>-element the initial value is 0,\n\t\t\t\t// despite the attribute not being present. When the attribute\n\t\t\t\t// is missing the progress bar is treated as indeterminate.\n\t\t\t\t// To fix that we'll always update it when it is 0 for progress elements\n\t\t\t\t(inputValue !== dom[i] ||\n\t\t\t\t\t(nodeType === 'progress' && !inputValue) ||\n\t\t\t\t\t// This is only for IE 11 to fix <select> value not being updated.\n\t\t\t\t\t// To avoid a stale select value we need to set the option.value\n\t\t\t\t\t// again, which triggers IE11 to re-evaluate the select value\n\t\t\t\t\t(nodeType === 'option' && inputValue !== oldProps[i]))\n\t\t\t) {\n\t\t\t\tsetProperty(dom, i, inputValue, oldProps[i], false);\n\t\t\t}\n\n\t\t\ti = 'checked';\n\t\t\tif (checked !== undefined && checked !== dom[i]) {\n\t\t\t\tsetProperty(dom, i, checked, oldProps[i], false);\n\t\t\t}\n\t\t}\n\t}\n\n\treturn dom;\n}\n\n/**\n * Invoke or update a ref, depending on whether it is a function or object ref.\n * @param {Ref<any>} ref\n * @param {any} value\n * @param {VNode} vnode\n */\nexport function applyRef(ref, value, vnode) {\n\ttry {\n\t\tif (typeof ref == 'function') ref(value);\n\t\telse ref.current = value;\n\t} catch (e) {\n\t\toptions._catchError(e, vnode);\n\t}\n}\n\n/**\n * Unmount a virtual node from the tree and apply DOM changes\n * @param {VNode} vnode The virtual node to unmount\n * @param {VNode} parentVNode The parent of the VNode that initiated the unmount\n * @param {boolean} [skipRemove] Flag that indicates that a parent node of the\n * current element is already detached from the DOM.\n */\nexport function unmount(vnode, parentVNode, skipRemove) {\n\tlet r;\n\tif (options.unmount) options.unmount(vnode);\n\n\tif ((r = vnode.ref)) {\n\t\tif (!r.current || r.current === vnode._dom) {\n\t\t\tapplyRef(r, null, parentVNode);\n\t\t}\n\t}\n\n\tif ((r = vnode._component) != null) {\n\t\tif (r.componentWillUnmount) {\n\t\t\ttry {\n\t\t\t\tr.componentWillUnmount();\n\t\t\t} catch (e) {\n\t\t\t\toptions._catchError(e, parentVNode);\n\t\t\t}\n\t\t}\n\n\t\tr.base = r._parentDom = null;\n\t\tvnode._component = undefined;\n\t}\n\n\tif ((r = vnode._children)) {\n\t\tfor (let i = 0; i < r.length; i++) {\n\t\t\tif (r[i]) {\n\t\t\t\tunmount(\n\t\t\t\t\tr[i],\n\t\t\t\t\tparentVNode,\n\t\t\t\t\tskipRemove || typeof vnode.type !== 'function'\n\t\t\t\t);\n\t\t\t}\n\t\t}\n\t}\n\n\tif (!skipRemove && vnode._dom != null) {\n\t\tremoveNode(vnode._dom);\n\t}\n\n\t// Must be set to `undefined` to properly clean up `_nextDom`\n\t// for which `null` is a valid value. See comment in `create-element.js`\n\tvnode._parent = vnode._dom = vnode._nextDom = undefined;\n}\n\n/** The `.render()` method for a PFC backing instance. */\nfunction doRender(props, state, context) {\n\treturn this.constructor(props, context);\n}\n", "import { EMPTY_OBJ } from './constants';\nimport { commitRoot, diff } from './diff/index';\nimport { createElement, Fragment } from './create-element';\nimport options from './options';\nimport { slice } from './util';\n\n/**\n * Render a Preact virtual node into a DOM element\n * @param {ComponentChild} vnode The virtual node to render\n * @param {PreactElement} parentDom The DOM element to render into\n * @param {PreactElement | object} [replaceNode] Optional: Attempt to re-use an\n * existing DOM tree rooted at `replaceNode`\n */\nexport function render(vnode, parentDom, replaceNode) {\n\tif (options._root) options._root(vnode, parentDom);\n\n\t// We abuse the `replaceNode` parameter in `hydrate()` to signal if we are in\n\t// hydration mode or not by passing the `hydrate` function instead of a DOM\n\t// element..\n\tlet isHydrating = typeof replaceNode == 'function';\n\n\t// To be able to support calling `render()` multiple times on the same\n\t// DOM node, we need to obtain a reference to the previous tree. We do\n\t// this by assigning a new `_children` property to DOM nodes which points\n\t// to the last rendered tree. By default this property is not present, which\n\t// means that we are mounting a new tree for the first time.\n\tlet oldVNode = isHydrating\n\t\t? null\n\t\t: (replaceNode && replaceNode._children) || parentDom._children;\n\n\tvnode = ((!isHydrating && replaceNode) || parentDom)._children =\n\t\tcreateElement(Fragment, null, [vnode]);\n\n\t// List of effects that need to be called after diffing.\n\tlet commitQueue = [],\n\t\trefQueue = [];\n\tdiff(\n\t\tparentDom,\n\t\t// Determine the new vnode tree and store it on the DOM element on\n\t\t// our custom `_children` property.\n\t\tvnode,\n\t\toldVNode || EMPTY_OBJ,\n\t\tEMPTY_OBJ,\n\t\tparentDom.ownerSVGElement !== undefined,\n\t\t!isHydrating && replaceNode\n\t\t\t? [replaceNode]\n\t\t\t: oldVNode\n\t\t\t? null\n\t\t\t: parentDom.firstChild\n\t\t\t? slice.call(parentDom.childNodes)\n\t\t\t: null,\n\t\tcommitQueue,\n\t\t!isHydrating && replaceNode\n\t\t\t? replaceNode\n\t\t\t: oldVNode\n\t\t\t? oldVNode._dom\n\t\t\t: parentDom.firstChild,\n\t\tisHydrating,\n\t\trefQueue\n\t);\n\n\t// Flush all queued effects\n\tcommitRoot(commitQueue, vnode, refQueue);\n}\n\n/**\n * Update an existing DOM element with data from a Preact virtual node\n * @param {ComponentChild} vnode The virtual node to render\n * @param {PreactElement} parentDom The DOM element to update\n */\nexport function hydrate(vnode, parentDom) {\n\trender(vnode, parentDom, hydrate);\n}\n", "import { assign, slice } from './util';\nimport { createVNode } from './create-element';\n\n/**\n * Clones the given VNode, optionally adding attributes/props and replacing its\n * children.\n * @param {VNode} vnode The virtual DOM element to clone\n * @param {object} props Attributes/props to add when cloning\n * @param {Array<ComponentChildren>} rest Any additional arguments will be used\n * as replacement children.\n * @returns {VNode}\n */\nexport function cloneElement(vnode, props, children) {\n\tlet normalizedProps = assign({}, vnode.props),\n\t\tkey,\n\t\tref,\n\t\ti;\n\n\tlet defaultProps;\n\n\tif (vnode.type && vnode.type.defaultProps) {\n\t\tdefaultProps = vnode.type.defaultProps;\n\t}\n\n\tfor (i in props) {\n\t\tif (i == 'key') key = props[i];\n\t\telse if (i == 'ref') ref = props[i];\n\t\telse if (props[i] === undefined && defaultProps !== undefined) {\n\t\t\tnormalizedProps[i] = defaultProps[i];\n\t\t} else {\n\t\t\tnormalizedProps[i] = props[i];\n\t\t}\n\t}\n\n\tif (arguments.length > 2) {\n\t\tnormalizedProps.children =\n\t\t\targuments.length > 3 ? slice.call(arguments, 2) : children;\n\t}\n\n\treturn createVNode(\n\t\tvnode.type,\n\t\tnormalizedProps,\n\t\tkey || vnode.key,\n\t\tref || vnode.ref,\n\t\tnull\n\t);\n}\n", "/**\n * Find the closest error boundary to a thrown error and call it\n * @param {object} error The thrown value\n * @param {VNode} vnode The vnode that threw the error that was caught (except\n * for unmounting when this parameter is the highest parent that was being\n * unmounted)\n * @param {VNode} [oldVNode]\n * @param {ErrorInfo} [errorInfo]\n */\nexport function _catchError(error, vnode, oldVNode, errorInfo) {\n\t/** @type {Component} */\n\tlet component,\n\t\t/** @type {ComponentType} */\n\t\tctor,\n\t\t/** @type {boolean} */\n\t\thandled;\n\n\tfor (; (vnode = vnode._parent); ) {\n\t\tif ((component = vnode._component) && !component._processingException) {\n\t\t\ttry {\n\t\t\t\tctor = component.constructor;\n\n\t\t\t\tif (ctor && ctor.getDerivedStateFromError != null) {\n\t\t\t\t\tcomponent.setState(ctor.getDerivedStateFromError(error));\n\t\t\t\t\thandled = component._dirty;\n\t\t\t\t}\n\n\t\t\t\tif (component.componentDidCatch != null) {\n\t\t\t\t\tcomponent.componentDidCatch(error, errorInfo || {});\n\t\t\t\t\thandled = component._dirty;\n\t\t\t\t}\n\n\t\t\t\t// This is an error boundary. Mark it as having bailed out, and whether it was mid-hydration.\n\t\t\t\tif (handled) {\n\t\t\t\t\treturn (component._pendingError = component);\n\t\t\t\t}\n\t\t\t} catch (e) {\n\t\t\t\terror = e;\n\t\t\t}\n\t\t}\n\t}\n\n\tthrow error;\n}\n", "import { options } from 'preact';\n\n/** @type {number} */\nlet currentIndex;\n\n/** @type {import('./internal').Component} */\nlet currentComponent;\n\n/** @type {import('./internal').Component} */\nlet previousComponent;\n\n/** @type {number} */\nlet currentHook = 0;\n\n/** @type {Array<import('./internal').Component>} */\nlet afterPaintEffects = [];\n\nlet EMPTY = [];\n\nlet oldBeforeDiff = options._diff;\nlet oldBeforeRender = options._render;\nlet oldAfterDiff = options.diffed;\nlet oldCommit = options._commit;\nlet oldBeforeUnmount = options.unmount;\n\nconst RAF_TIMEOUT = 100;\nlet prevRaf;\n\noptions._diff = vnode => {\n\tcurrentComponent = null;\n\tif (oldBeforeDiff) oldBeforeDiff(vnode);\n};\n\noptions._render = vnode => {\n\tif (oldBeforeRender) oldBeforeRender(vnode);\n\n\tcurrentComponent = vnode._component;\n\tcurrentIndex = 0;\n\n\tconst hooks = currentComponent.__hooks;\n\tif (hooks) {\n\t\tif (previousComponent === currentComponent) {\n\t\t\thooks._pendingEffects = [];\n\t\t\tcurrentComponent._renderCallbacks = [];\n\t\t\thooks._list.forEach(hookItem => {\n\t\t\t\tif (hookItem._nextValue) {\n\t\t\t\t\thookItem._value = hookItem._nextValue;\n\t\t\t\t}\n\t\t\t\thookItem._pendingValue = EMPTY;\n\t\t\t\thookItem._nextValue = hookItem._pendingArgs = undefined;\n\t\t\t});\n\t\t} else {\n\t\t\thooks._pendingEffects.forEach(invokeCleanup);\n\t\t\thooks._pendingEffects.forEach(invokeEffect);\n\t\t\thooks._pendingEffects = [];\n\t\t\tcurrentIndex = 0;\n\t\t}\n\t}\n\tpreviousComponent = currentComponent;\n};\n\noptions.diffed = vnode => {\n\tif (oldAfterDiff) oldAfterDiff(vnode);\n\n\tconst c = vnode._component;\n\tif (c && c.__hooks) {\n\t\tif (c.__hooks._pendingEffects.length) afterPaint(afterPaintEffects.push(c));\n\t\tc.__hooks._list.forEach(hookItem => {\n\t\t\tif (hookItem._pendingArgs) {\n\t\t\t\thookItem._args = hookItem._pendingArgs;\n\t\t\t}\n\t\t\tif (hookItem._pendingValue !== EMPTY) {\n\t\t\t\thookItem._value = hookItem._pendingValue;\n\t\t\t}\n\t\t\thookItem._pendingArgs = undefined;\n\t\t\thookItem._pendingValue = EMPTY;\n\t\t});\n\t}\n\tpreviousComponent = currentComponent = null;\n};\n\noptions._commit = (vnode, commitQueue) => {\n\tcommitQueue.some(component => {\n\t\ttry {\n\t\t\tcomponent._renderCallbacks.forEach(invokeCleanup);\n\t\t\tcomponent._renderCallbacks = component._renderCallbacks.filter(cb =>\n\t\t\t\tcb._value ? invokeEffect(cb) : true\n\t\t\t);\n\t\t} catch (e) {\n\t\t\tcommitQueue.some(c => {\n\t\t\t\tif (c._renderCallbacks) c._renderCallbacks = [];\n\t\t\t});\n\t\t\tcommitQueue = [];\n\t\t\toptions._catchError(e, component._vnode);\n\t\t}\n\t});\n\n\tif (oldCommit) oldCommit(vnode, commitQueue);\n};\n\noptions.unmount = vnode => {\n\tif (oldBeforeUnmount) oldBeforeUnmount(vnode);\n\n\tconst c = vnode._component;\n\tif (c && c.__hooks) {\n\t\tlet hasErrored;\n\t\tc.__hooks._list.forEach(s => {\n\t\t\ttry {\n\t\t\t\tinvokeCleanup(s);\n\t\t\t} catch (e) {\n\t\t\t\thasErrored = e;\n\t\t\t}\n\t\t});\n\t\tc.__hooks = undefined;\n\t\tif (hasErrored) options._catchError(hasErrored, c._vnode);\n\t}\n};\n\n/**\n * Get a hook's state from the currentComponent\n * @param {number} index The index of the hook to get\n * @param {number} type The index of the hook to get\n * @returns {any}\n */\nfunction getHookState(index, type) {\n\tif (options._hook) {\n\t\toptions._hook(currentComponent, index, currentHook || type);\n\t}\n\tcurrentHook = 0;\n\n\t// Largely inspired by:\n\t// * https://github.com/michael-klein/funcy.js/blob/f6be73468e6ec46b0ff5aa3cc4c9baf72a29025a/src/hooks/core_hooks.mjs\n\t// * https://github.com/michael-klein/funcy.js/blob/650beaa58c43c33a74820a3c98b3c7079cf2e333/src/renderer.mjs\n\t// Other implementations to look at:\n\t// * https://codesandbox.io/s/mnox05qp8\n\tconst hooks =\n\t\tcurrentComponent.__hooks ||\n\t\t(currentComponent.__hooks = {\n\t\t\t_list: [],\n\t\t\t_pendingEffects: []\n\t\t});\n\n\tif (index >= hooks._list.length) {\n\t\thooks._list.push({ _pendingValue: EMPTY });\n\t}\n\treturn hooks._list[index];\n}\n\n/**\n * @param {import('./index').StateUpdater<any>} [initialState]\n */\nexport function useState(initialState) {\n\tcurrentHook = 1;\n\treturn useReducer(invokeOrReturn, initialState);\n}\n\n/**\n * @param {import('./index').Reducer<any, any>} reducer\n * @param {import('./index').StateUpdater<any>} initialState\n * @param {(initialState: any) => void} [init]\n * @returns {[ any, (state: any) => void ]}\n */\nexport function useReducer(reducer, initialState, init) {\n\t/** @type {import('./internal').ReducerHookState} */\n\tconst hookState = getHookState(currentIndex++, 2);\n\thookState._reducer = reducer;\n\tif (!hookState._component) {\n\t\thookState._value = [\n\t\t\t!init ? invokeOrReturn(undefined, initialState) : init(initialState),\n\n\t\t\taction => {\n\t\t\t\tconst currentValue = hookState._nextValue\n\t\t\t\t\t? hookState._nextValue[0]\n\t\t\t\t\t: hookState._value[0];\n\t\t\t\tconst nextValue = hookState._reducer(currentValue, action);\n\n\t\t\t\tif (currentValue !== nextValue) {\n\t\t\t\t\thookState._nextValue = [nextValue, hookState._value[1]];\n\t\t\t\t\thookState._component.setState({});\n\t\t\t\t}\n\t\t\t}\n\t\t];\n\n\t\thookState._component = currentComponent;\n\n\t\tif (!currentComponent._hasScuFromHooks) {\n\t\t\tcurrentComponent._hasScuFromHooks = true;\n\t\t\tlet prevScu = currentComponent.shouldComponentUpdate;\n\t\t\tconst prevCWU = currentComponent.componentWillUpdate;\n\n\t\t\t// If we're dealing with a forced update `shouldComponentUpdate` will\n\t\t\t// not be called. But we use that to update the hook values, so we\n\t\t\t// need to call it.\n\t\t\tcurrentComponent.componentWillUpdate = function (p, s, c) {\n\t\t\t\tif (this._force) {\n\t\t\t\t\tlet tmp = prevScu;\n\t\t\t\t\t// Clear to avoid other sCU hooks from being called\n\t\t\t\t\tprevScu = undefined;\n\t\t\t\t\tupdateHookState(p, s, c);\n\t\t\t\t\tprevScu = tmp;\n\t\t\t\t}\n\n\t\t\t\tif (prevCWU) prevCWU.call(this, p, s, c);\n\t\t\t};\n\n\t\t\t// This SCU has the purpose of bailing out after repeated updates\n\t\t\t// to stateful hooks.\n\t\t\t// we store the next value in _nextValue[0] and keep doing that for all\n\t\t\t// state setters, if we have next states and\n\t\t\t// all next states within a component end up being equal to their original state\n\t\t\t// we are safe to bail out for this specific component.\n\t\t\t/**\n\t\t\t *\n\t\t\t * @type {import('./internal').Component[\"shouldComponentUpdate\"]}\n\t\t\t */\n\t\t\t// @ts-ignore - We don't use TS to downtranspile\n\t\t\t// eslint-disable-next-line no-inner-declarations\n\t\t\tfunction updateHookState(p, s, c) {\n\t\t\t\tif (!hookState._component.__hooks) return true;\n\n\t\t\t\tconst stateHooks = hookState._component.__hooks._list.filter(\n\t\t\t\t\tx => x._component\n\t\t\t\t);\n\t\t\t\tconst allHooksEmpty = stateHooks.every(x => !x._nextValue);\n\t\t\t\t// When we have no updated hooks in the component we invoke the previous SCU or\n\t\t\t\t// traverse the VDOM tree further.\n\t\t\t\tif (allHooksEmpty) {\n\t\t\t\t\treturn prevScu ? prevScu.call(this, p, s, c) : true;\n\t\t\t\t}\n\n\t\t\t\t// We check whether we have components with a nextValue set that\n\t\t\t\t// have values that aren't equal to one another this pushes\n\t\t\t\t// us to update further down the tree\n\t\t\t\tlet shouldUpdate = false;\n\t\t\t\tstateHooks.forEach(hookItem => {\n\t\t\t\t\tif (hookItem._nextValue) {\n\t\t\t\t\t\tconst currentValue = hookItem._value[0];\n\t\t\t\t\t\thookItem._value = hookItem._nextValue;\n\t\t\t\t\t\thookItem._nextValue = undefined;\n\t\t\t\t\t\tif (currentValue !== hookItem._value[0]) shouldUpdate = true;\n\t\t\t\t\t}\n\t\t\t\t});\n\n\t\t\t\treturn shouldUpdate || hookState._component.props !== p\n\t\t\t\t\t? prevScu\n\t\t\t\t\t\t? prevScu.call(this, p, s, c)\n\t\t\t\t\t\t: true\n\t\t\t\t\t: false;\n\t\t\t}\n\n\t\t\tcurrentComponent.shouldComponentUpdate = updateHookState;\n\t\t}\n\t}\n\n\treturn hookState._nextValue || hookState._value;\n}\n\n/**\n * @param {import('./internal').Effect} callback\n * @param {any[]} args\n */\nexport function useEffect(callback, args) {\n\t/** @type {import('./internal').EffectHookState} */\n\tconst state = getHookState(currentIndex++, 3);\n\tif (!options._skipEffects && argsChanged(state._args, args)) {\n\t\tstate._value = callback;\n\t\tstate._pendingArgs = args;\n\n\t\tcurrentComponent.__hooks._pendingEffects.push(state);\n\t}\n}\n\n/**\n * @param {import('./internal').Effect} callback\n * @param {any[]} args\n */\nexport function useLayoutEffect(callback, args) {\n\t/** @type {import('./internal').EffectHookState} */\n\tconst state = getHookState(currentIndex++, 4);\n\tif (!options._skipEffects && argsChanged(state._args, args)) {\n\t\tstate._value = callback;\n\t\tstate._pendingArgs = args;\n\n\t\tcurrentComponent._renderCallbacks.push(state);\n\t}\n}\n\nexport function useRef(initialValue) {\n\tcurrentHook = 5;\n\treturn useMemo(() => ({ current: initialValue }), []);\n}\n\n/**\n * @param {object} ref\n * @param {() => object} createHandle\n * @param {any[]} args\n */\nexport function useImperativeHandle(ref, createHandle, args) {\n\tcurrentHook = 6;\n\tuseLayoutEffect(\n\t\t() => {\n\t\t\tif (typeof ref == 'function') {\n\t\t\t\tref(createHandle());\n\t\t\t\treturn () => ref(null);\n\t\t\t} else if (ref) {\n\t\t\t\tref.current = createHandle();\n\t\t\t\treturn () => (ref.current = null);\n\t\t\t}\n\t\t},\n\t\targs == null ? args : args.concat(ref)\n\t);\n}\n\n/**\n * @param {() => any} factory\n * @param {any[]} args\n */\nexport function useMemo(factory, args) {\n\t/** @type {import('./internal').MemoHookState} */\n\tconst state = getHookState(currentIndex++, 7);\n\tif (argsChanged(state._args, args)) {\n\t\tstate._pendingValue = factory();\n\t\tstate._pendingArgs = args;\n\t\tstate._factory = factory;\n\t\treturn state._pendingValue;\n\t}\n\n\treturn state._value;\n}\n\n/**\n * @param {() => void} callback\n * @param {any[]} args\n */\nexport function useCallback(callback, args) {\n\tcurrentHook = 8;\n\treturn useMemo(() => callback, args);\n}\n\n/**\n * @param {import('./internal').PreactContext} context\n */\nexport function useContext(context) {\n\tconst provider = currentComponent.context[context._id];\n\t// We could skip this call here, but than we'd not call\n\t// `options._hook`. We need to do that in order to make\n\t// the devtools aware of this hook.\n\t/** @type {import('./internal').ContextHookState} */\n\tconst state = getHookState(currentIndex++, 9);\n\t// The devtools needs access to the context object to\n\t// be able to pull of the default value when no provider\n\t// is present in the tree.\n\tstate._context = context;\n\tif (!provider) return context._defaultValue;\n\t// This is probably not safe to convert to \"!\"\n\tif (state._value == null) {\n\t\tstate._value = true;\n\t\tprovider.sub(currentComponent);\n\t}\n\treturn provider.props.value;\n}\n\n/**\n * Display a custom label for a custom hook for the devtools panel\n * @type {<T>(value: T, cb?: (value: T) => string | number) => void}\n */\nexport function useDebugValue(value, formatter) {\n\tif (options.useDebugValue) {\n\t\toptions.useDebugValue(formatter ? formatter(value) : value);\n\t}\n}\n\n/**\n * @param {(error: any, errorInfo: import('preact').ErrorInfo) => void} cb\n */\nexport function useErrorBoundary(cb) {\n\t/** @type {import('./internal').ErrorBoundaryHookState} */\n\tconst state = getHookState(currentIndex++, 10);\n\tconst errState = useState();\n\tstate._value = cb;\n\tif (!currentComponent.componentDidCatch) {\n\t\tcurrentComponent.componentDidCatch = (err, errorInfo) => {\n\t\t\tif (state._value) state._value(err, errorInfo);\n\t\t\terrState[1](err);\n\t\t};\n\t}\n\treturn [\n\t\terrState[0],\n\t\t() => {\n\t\t\terrState[1](undefined);\n\t\t}\n\t];\n}\n\nexport function useId() {\n\tconst state = getHookState(currentIndex++, 11);\n\tif (!state._value) {\n\t\t// Grab either the root node or the nearest async boundary node.\n\t\t/** @type {import('./internal.d').VNode} */\n\t\tlet root = currentComponent._vnode;\n\t\twhile (root !== null && !root._mask && root._parent !== null) {\n\t\t\troot = root._parent;\n\t\t}\n\n\t\tlet mask = root._mask || (root._mask = [0, 0]);\n\t\tstate._value = 'P' + mask[0] + '-' + mask[1]++;\n\t}\n\n\treturn state._value;\n}\n/**\n * After paint effects consumer.\n */\nfunction flushAfterPaintEffects() {\n\tlet component;\n\twhile ((component = afterPaintEffects.shift())) {\n\t\tif (!component._parentDom || !component.__hooks) continue;\n\t\ttry {\n\t\t\tcomponent.__hooks._pendingEffects.forEach(invokeCleanup);\n\t\t\tcomponent.__hooks._pendingEffects.forEach(invokeEffect);\n\t\t\tcomponent.__hooks._pendingEffects = [];\n\t\t} catch (e) {\n\t\t\tcomponent.__hooks._pendingEffects = [];\n\t\t\toptions._catchError(e, component._vnode);\n\t\t}\n\t}\n}\n\nlet HAS_RAF = typeof requestAnimationFrame == 'function';\n\n/**\n * Schedule a callback to be invoked after the browser has a chance to paint a new frame.\n * Do this by combining requestAnimationFrame (rAF) + setTimeout to invoke a callback after\n * the next browser frame.\n *\n * Also, schedule a timeout in parallel to the the rAF to ensure the callback is invoked\n * even if RAF doesn't fire (for example if the browser tab is not visible)\n *\n * @param {() => void} callback\n */\nfunction afterNextFrame(callback) {\n\tconst done = () => {\n\t\tclearTimeout(timeout);\n\t\tif (HAS_RAF) cancelAnimationFrame(raf);\n\t\tsetTimeout(callback);\n\t};\n\tconst timeout = setTimeout(done, RAF_TIMEOUT);\n\n\tlet raf;\n\tif (HAS_RAF) {\n\t\traf = requestAnimationFrame(done);\n\t}\n}\n\n// Note: if someone used options.debounceRendering = requestAnimationFrame,\n// then effects will ALWAYS run on the NEXT frame instead of the current one, incurring a ~16ms delay.\n// Perhaps this is not such a big deal.\n/**\n * Schedule afterPaintEffects flush after the browser paints\n * @param {number} newQueueLength\n */\nfunction afterPaint(newQueueLength) {\n\tif (newQueueLength === 1 || prevRaf !== options.requestAnimationFrame) {\n\t\tprevRaf = options.requestAnimationFrame;\n\t\t(prevRaf || afterNextFrame)(flushAfterPaintEffects);\n\t}\n}\n\n/**\n * @param {import('./internal').EffectHookState} hook\n */\nfunction invokeCleanup(hook) {\n\t// A hook cleanup can introduce a call to render which creates a new root, this will call options.vnode\n\t// and move the currentComponent away.\n\tconst comp = currentComponent;\n\tlet cleanup = hook._cleanup;\n\tif (typeof cleanup == 'function') {\n\t\thook._cleanup = undefined;\n\t\tcleanup();\n\t}\n\n\tcurrentComponent = comp;\n}\n\n/**\n * Invoke a Hook's effect\n * @param {import('./internal').EffectHookState} hook\n */\nfunction invokeEffect(hook) {\n\t// A hook call can introduce a call to render which creates a new root, this will call options.vnode\n\t// and move the currentComponent away.\n\tconst comp = currentComponent;\n\thook._cleanup = hook._value();\n\tcurrentComponent = comp;\n}\n\n/**\n * @param {any[]} oldArgs\n * @param {any[]} newArgs\n */\nfunction argsChanged(oldArgs, newArgs) {\n\treturn (\n\t\t!oldArgs ||\n\t\toldArgs.length !== newArgs.length ||\n\t\tnewArgs.some((arg, index) => arg !== oldArgs[index])\n\t);\n}\n\nfunction invokeOrReturn(arg, f) {\n\treturn typeof f == 'function' ? f(arg) : f;\n}\n", "export default function _typeof(o) {\n \"@babel/helpers - typeof\";\n\n return _typeof = \"function\" == typeof Symbol && \"symbol\" == typeof Symbol.iterator ? function (o) {\n return typeof o;\n } : function (o) {\n return o && \"function\" == typeof Symbol && o.constructor === Symbol && o !== Symbol.prototype ? \"symbol\" : typeof o;\n }, _typeof(o);\n}", "export default function toInteger(dirtyNumber) {\n if (dirtyNumber === null || dirtyNumber === true || dirtyNumber === false) {\n return NaN;\n }\n var number = Number(dirtyNumber);\n if (isNaN(number)) {\n return number;\n }\n return number < 0 ? Math.ceil(number) : Math.floor(number);\n}", "export default function requiredArgs(required, args) {\n if (args.length < required) {\n throw new TypeError(required + ' argument' + (required > 1 ? 's' : '') + ' required, but only ' + args.length + ' present');\n }\n}", "import _typeof from \"@babel/runtime/helpers/esm/typeof\";\nimport requiredArgs from \"../_lib/requiredArgs/index.js\";\n/**\n * @name toDate\n * @category Common Helpers\n * @summary Convert the given argument to an instance of Date.\n *\n * @description\n * Convert the given argument to an instance of Date.\n *\n * If the argument is an instance of Date, the function returns its clone.\n *\n * If the argument is a number, it is treated as a timestamp.\n *\n * If the argument is none of the above, the function returns Invalid Date.\n *\n * **Note**: *all* Date arguments passed to any *date-fns* function is processed by `toDate`.\n *\n * @param {Date|Number} argument - the value to convert\n * @returns {Date} the parsed date in the local time zone\n * @throws {TypeError} 1 argument required\n *\n * @example\n * // Clone the date:\n * const result = toDate(new Date(2014, 1, 11, 11, 30, 30))\n * //=> Tue Feb 11 2014 11:30:30\n *\n * @example\n * // Convert the timestamp to date:\n * const result = toDate(1392098430000)\n * //=> Tue Feb 11 2014 11:30:30\n */\nexport default function toDate(argument) {\n requiredArgs(1, arguments);\n var argStr = Object.prototype.toString.call(argument);\n\n // Clone the date\n if (argument instanceof Date || _typeof(argument) === 'object' && argStr === '[object Date]') {\n // Prevent the date to lose the milliseconds when passed to new Date() in IE10\n return new Date(argument.getTime());\n } else if (typeof argument === 'number' || argStr === '[object Number]') {\n return new Date(argument);\n } else {\n if ((typeof argument === 'string' || argStr === '[object String]') && typeof console !== 'undefined') {\n // eslint-disable-next-line no-console\n console.warn(\"Starting with v2.0.0-beta.1 date-fns doesn't accept strings as date arguments. Please use `parseISO` to parse strings. See: https://github.com/date-fns/date-fns/blob/master/docs/upgradeGuide.md#string-arguments\");\n // eslint-disable-next-line no-console\n console.warn(new Error().stack);\n }\n return new Date(NaN);\n }\n}", "import toInteger from \"../_lib/toInteger/index.js\";\nimport toDate from \"../toDate/index.js\";\nimport requiredArgs from \"../_lib/requiredArgs/index.js\";\n/**\n * @name addMilliseconds\n * @category Millisecond Helpers\n * @summary Add the specified number of milliseconds to the given date.\n *\n * @description\n * Add the specified number of milliseconds to the given date.\n *\n * @param {Date|Number} date - the date to be changed\n * @param {Number} amount - the amount of milliseconds to be added. Positive decimals will be rounded using `Math.floor`, decimals less than zero will be rounded using `Math.ceil`.\n * @returns {Date} the new date with the milliseconds added\n * @throws {TypeError} 2 arguments required\n *\n * @example\n * // Add 750 milliseconds to 10 July 2014 12:45:30.000:\n * const result = addMilliseconds(new Date(2014, 6, 10, 12, 45, 30, 0), 750)\n * //=> Thu Jul 10 2014 12:45:30.750\n */\nexport default function addMilliseconds(dirtyDate, dirtyAmount) {\n requiredArgs(2, arguments);\n var timestamp = toDate(dirtyDate).getTime();\n var amount = toInteger(dirtyAmount);\n return new Date(timestamp + amount);\n}", "var defaultOptions = {};\nexport function getDefaultOptions() {\n return defaultOptions;\n}\nexport function setDefaultOptions(newOptions) {\n defaultOptions = newOptions;\n}", "/**\n * Google Chrome as of 67.0.3396.87 introduced timezones with offset that includes seconds.\n * They usually appear for dates that denote time before the timezones were introduced\n * (e.g. for 'Europe/Prague' timezone the offset is GMT+00:57:44 before 1 October 1891\n * and GMT+01:00:00 after that date)\n *\n * Date#getTimezoneOffset returns the offset in minutes and would return 57 for the example above,\n * which would lead to incorrect calculations.\n *\n * This function returns the timezone offset in milliseconds that takes seconds in account.\n */\nexport default function getTimezoneOffsetInMilliseconds(date) {\n var utcDate = new Date(Date.UTC(date.getFullYear(), date.getMonth(), date.getDate(), date.getHours(), date.getMinutes(), date.getSeconds(), date.getMilliseconds()));\n utcDate.setUTCFullYear(date.getFullYear());\n return date.getTime() - utcDate.getTime();\n}", "import toDate from \"../toDate/index.js\";\nimport requiredArgs from \"../_lib/requiredArgs/index.js\";\n/**\n * @name startOfDay\n * @category Day Helpers\n * @summary Return the start of a day for the given date.\n *\n * @description\n * Return the start of a day for the given date.\n * The result will be in the local timezone.\n *\n * @param {Date|Number} date - the original date\n * @returns {Date} the start of a day\n * @throws {TypeError} 1 argument required\n *\n * @example\n * // The start of a day for 2 September 2014 11:55:00:\n * const result = startOfDay(new Date(2014, 8, 2, 11, 55, 0))\n * //=> Tue Sep 02 2014 00:00:00\n */\nexport default function startOfDay(dirtyDate) {\n requiredArgs(1, arguments);\n var date = toDate(dirtyDate);\n date.setHours(0, 0, 0, 0);\n return date;\n}", "import getTimezoneOffsetInMilliseconds from \"../_lib/getTimezoneOffsetInMilliseconds/index.js\";\nimport startOfDay from \"../startOfDay/index.js\";\nimport requiredArgs from \"../_lib/requiredArgs/index.js\";\nvar MILLISECONDS_IN_DAY = 86400000;\n\n/**\n * @name differenceInCalendarDays\n * @category Day Helpers\n * @summary Get the number of calendar days between the given dates.\n *\n * @description\n * Get the number of calendar days between the given dates. This means that the times are removed\n * from the dates and then the difference in days is calculated.\n *\n * @param {Date|Number} dateLeft - the later date\n * @param {Date|Number} dateRight - the earlier date\n * @returns {Number} the number of calendar days\n * @throws {TypeError} 2 arguments required\n *\n * @example\n * // How many calendar days are between\n * // 2 July 2011 23:00:00 and 2 July 2012 00:00:00?\n * const result = differenceInCalendarDays(\n * new Date(2012, 6, 2, 0, 0),\n * new Date(2011, 6, 2, 23, 0)\n * )\n * //=> 366\n * // How many calendar days are between\n * // 2 July 2011 23:59:00 and 3 July 2011 00:01:00?\n * const result = differenceInCalendarDays(\n * new Date(2011, 6, 3, 0, 1),\n * new Date(2011, 6, 2, 23, 59)\n * )\n * //=> 1\n */\nexport default function differenceInCalendarDays(dirtyDateLeft, dirtyDateRight) {\n requiredArgs(2, arguments);\n var startOfDayLeft = startOfDay(dirtyDateLeft);\n var startOfDayRight = startOfDay(dirtyDateRight);\n var timestampLeft = startOfDayLeft.getTime() - getTimezoneOffsetInMilliseconds(startOfDayLeft);\n var timestampRight = startOfDayRight.getTime() - getTimezoneOffsetInMilliseconds(startOfDayRight);\n\n // Round the number of days to the nearest integer\n // because the number of milliseconds in a day is not constant\n // (e.g. it's different in the day of the daylight saving time clock shift)\n return Math.round((timestampLeft - timestampRight) / MILLISECONDS_IN_DAY);\n}", "/**\n * Days in 1 week.\n *\n * @name daysInWeek\n * @constant\n * @type {number}\n * @default\n */\nexport var daysInWeek = 7;\n\n/**\n * Days in 1 year\n * One years equals 365.2425 days according to the formula:\n *\n * > Leap year occures every 4 years, except for years that are divisable by 100 and not divisable by 400.\n * > 1 mean year = (365+1/4-1/100+1/400) days = 365.2425 days\n *\n * @name daysInYear\n * @constant\n * @type {number}\n * @default\n */\nexport var daysInYear = 365.2425;\n\n/**\n * Maximum allowed time.\n *\n * @name maxTime\n * @constant\n * @type {number}\n * @default\n */\nexport var maxTime = Math.pow(10, 8) * 24 * 60 * 60 * 1000;\n\n/**\n * Milliseconds in 1 minute\n *\n * @name millisecondsInMinute\n * @constant\n * @type {number}\n * @default\n */\nexport var millisecondsInMinute = 60000;\n\n/**\n * Milliseconds in 1 hour\n *\n * @name millisecondsInHour\n * @constant\n * @type {number}\n * @default\n */\nexport var millisecondsInHour = 3600000;\n\n/**\n * Milliseconds in 1 second\n *\n * @name millisecondsInSecond\n * @constant\n * @type {number}\n * @default\n */\nexport var millisecondsInSecond = 1000;\n\n/**\n * Minimum allowed time.\n *\n * @name minTime\n * @constant\n * @type {number}\n * @default\n */\nexport var minTime = -maxTime;\n\n/**\n * Minutes in 1 hour\n *\n * @name minutesInHour\n * @constant\n * @type {number}\n * @default\n */\nexport var minutesInHour = 60;\n\n/**\n * Months in 1 quarter\n *\n * @name monthsInQuarter\n * @constant\n * @type {number}\n * @default\n */\nexport var monthsInQuarter = 3;\n\n/**\n * Months in 1 year\n *\n * @name monthsInYear\n * @constant\n * @type {number}\n * @default\n */\nexport var monthsInYear = 12;\n\n/**\n * Quarters in 1 year\n *\n * @name quartersInYear\n * @constant\n * @type {number}\n * @default\n */\nexport var quartersInYear = 4;\n\n/**\n * Seconds in 1 hour\n *\n * @name secondsInHour\n * @constant\n * @type {number}\n * @default\n */\nexport var secondsInHour = 3600;\n\n/**\n * Seconds in 1 minute\n *\n * @name secondsInMinute\n * @constant\n * @type {number}\n * @default\n */\nexport var secondsInMinute = 60;\n\n/**\n * Seconds in 1 day\n *\n * @name secondsInDay\n * @constant\n * @type {number}\n * @default\n */\nexport var secondsInDay = secondsInHour * 24;\n\n/**\n * Seconds in 1 week\n *\n * @name secondsInWeek\n * @constant\n * @type {number}\n * @default\n */\nexport var secondsInWeek = secondsInDay * 7;\n\n/**\n * Seconds in 1 year\n *\n * @name secondsInYear\n * @constant\n * @type {number}\n * @default\n */\nexport var secondsInYear = secondsInDay * daysInYear;\n\n/**\n * Seconds in 1 month\n *\n * @name secondsInMonth\n * @constant\n * @type {number}\n * @default\n */\nexport var secondsInMonth = secondsInYear / 12;\n\n/**\n * Seconds in 1 quarter\n *\n * @name secondsInQuarter\n * @constant\n * @type {number}\n * @default\n */\nexport var secondsInQuarter = secondsInMonth * 3;", "import _typeof from \"@babel/runtime/helpers/esm/typeof\";\nimport requiredArgs from \"../_lib/requiredArgs/index.js\";\n/**\n * @name isDate\n * @category Common Helpers\n * @summary Is the given value a date?\n *\n * @description\n * Returns true if the given value is an instance of Date. The function works for dates transferred across iframes.\n *\n * @param {*} value - the value to check\n * @returns {boolean} true if the given value is a date\n * @throws {TypeError} 1 arguments required\n *\n * @example\n * // For a valid date:\n * const result = isDate(new Date())\n * //=> true\n *\n * @example\n * // For an invalid date:\n * const result = isDate(new Date(NaN))\n * //=> true\n *\n * @example\n * // For some value:\n * const result = isDate('2014-02-31')\n * //=> false\n *\n * @example\n * // For an object:\n * const result = isDate({})\n * //=> false\n */\nexport default function isDate(value) {\n requiredArgs(1, arguments);\n return value instanceof Date || _typeof(value) === 'object' && Object.prototype.toString.call(value) === '[object Date]';\n}", "import isDate from \"../isDate/index.js\";\nimport toDate from \"../toDate/index.js\";\nimport requiredArgs from \"../_lib/requiredArgs/index.js\";\n/**\n * @name isValid\n * @category Common Helpers\n * @summary Is the given date valid?\n *\n * @description\n * Returns false if argument is Invalid Date and true otherwise.\n * Argument is converted to Date using `toDate`. See [toDate]{@link https://date-fns.org/docs/toDate}\n * Invalid Date is a Date, whose time value is NaN.\n *\n * Time value of Date: http://es5.github.io/#x15.9.1.1\n *\n * @param {*} date - the date to check\n * @returns {Boolean} the date is valid\n * @throws {TypeError} 1 argument required\n *\n * @example\n * // For the valid date:\n * const result = isValid(new Date(2014, 1, 31))\n * //=> true\n *\n * @example\n * // For the value, convertable into a date:\n * const result = isValid(1393804800000)\n * //=> true\n *\n * @example\n * // For the invalid date:\n * const result = isValid(new Date(''))\n * //=> false\n */\nexport default function isValid(dirtyDate) {\n requiredArgs(1, arguments);\n if (!isDate(dirtyDate) && typeof dirtyDate !== 'number') {\n return false;\n }\n var date = toDate(dirtyDate);\n return !isNaN(Number(date));\n}", "import addMilliseconds from \"../addMilliseconds/index.js\";\nimport requiredArgs from \"../_lib/requiredArgs/index.js\";\nimport toInteger from \"../_lib/toInteger/index.js\";\n/**\n * @name subMilliseconds\n * @category Millisecond Helpers\n * @summary Subtract the specified number of milliseconds from the given date.\n *\n * @description\n * Subtract the specified number of milliseconds from the given date.\n *\n * @param {Date|Number} date - the date to be changed\n * @param {Number} amount - the amount of milliseconds to be subtracted. Positive decimals will be rounded using `Math.floor`, decimals less than zero will be rounded using `Math.ceil`.\n * @returns {Date} the new date with the milliseconds subtracted\n * @throws {TypeError} 2 arguments required\n *\n * @example\n * // Subtract 750 milliseconds from 10 July 2014 12:45:30.000:\n * const result = subMilliseconds(new Date(2014, 6, 10, 12, 45, 30, 0), 750)\n * //=> Thu Jul 10 2014 12:45:29.250\n */\nexport default function subMilliseconds(dirtyDate, dirtyAmount) {\n requiredArgs(2, arguments);\n var amount = toInteger(dirtyAmount);\n return addMilliseconds(dirtyDate, -amount);\n}", "import toDate from \"../../toDate/index.js\";\nimport requiredArgs from \"../requiredArgs/index.js\";\nvar MILLISECONDS_IN_DAY = 86400000;\nexport default function getUTCDayOfYear(dirtyDate) {\n requiredArgs(1, arguments);\n var date = toDate(dirtyDate);\n var timestamp = date.getTime();\n date.setUTCMonth(0, 1);\n date.setUTCHours(0, 0, 0, 0);\n var startOfYearTimestamp = date.getTime();\n var difference = timestamp - startOfYearTimestamp;\n return Math.floor(difference / MILLISECONDS_IN_DAY) + 1;\n}", "import toDate from \"../../toDate/index.js\";\nimport requiredArgs from \"../requiredArgs/index.js\";\nexport default function startOfUTCISOWeek(dirtyDate) {\n requiredArgs(1, arguments);\n var weekStartsOn = 1;\n var date = toDate(dirtyDate);\n var day = date.getUTCDay();\n var diff = (day < weekStartsOn ? 7 : 0) + day - weekStartsOn;\n date.setUTCDate(date.getUTCDate() - diff);\n date.setUTCHours(0, 0, 0, 0);\n return date;\n}", "import toDate from \"../../toDate/index.js\";\nimport requiredArgs from \"../requiredArgs/index.js\";\nimport startOfUTCISOWeek from \"../startOfUTCISOWeek/index.js\";\nexport default function getUTCISOWeekYear(dirtyDate) {\n requiredArgs(1, arguments);\n var date = toDate(dirtyDate);\n var year = date.getUTCFullYear();\n var fourthOfJanuaryOfNextYear = new Date(0);\n fourthOfJanuaryOfNextYear.setUTCFullYear(year + 1, 0, 4);\n fourthOfJanuaryOfNextYear.setUTCHours(0, 0, 0, 0);\n var startOfNextYear = startOfUTCISOWeek(fourthOfJanuaryOfNextYear);\n var fourthOfJanuaryOfThisYear = new Date(0);\n fourthOfJanuaryOfThisYear.setUTCFullYear(year, 0, 4);\n fourthOfJanuaryOfThisYear.setUTCHours(0, 0, 0, 0);\n var startOfThisYear = startOfUTCISOWeek(fourthOfJanuaryOfThisYear);\n if (date.getTime() >= startOfNextYear.getTime()) {\n return year + 1;\n } else if (date.getTime() >= startOfThisYear.getTime()) {\n return year;\n } else {\n return year - 1;\n }\n}", "import getUTCISOWeekYear from \"../getUTCISOWeekYear/index.js\";\nimport startOfUTCISOWeek from \"../startOfUTCISOWeek/index.js\";\nimport requiredArgs from \"../requiredArgs/index.js\";\nexport default function startOfUTCISOWeekYear(dirtyDate) {\n requiredArgs(1, arguments);\n var year = getUTCISOWeekYear(dirtyDate);\n var fourthOfJanuary = new Date(0);\n fourthOfJanuary.setUTCFullYear(year, 0, 4);\n fourthOfJanuary.setUTCHours(0, 0, 0, 0);\n var date = startOfUTCISOWeek(fourthOfJanuary);\n return date;\n}", "import toDate from \"../../toDate/index.js\";\nimport startOfUTCISOWeek from \"../startOfUTCISOWeek/index.js\";\nimport startOfUTCISOWeekYear from \"../startOfUTCISOWeekYear/index.js\";\nimport requiredArgs from \"../requiredArgs/index.js\";\nvar MILLISECONDS_IN_WEEK = 604800000;\nexport default function getUTCISOWeek(dirtyDate) {\n requiredArgs(1, arguments);\n var date = toDate(dirtyDate);\n var diff = startOfUTCISOWeek(date).getTime() - startOfUTCISOWeekYear(date).getTime();\n\n // Round the number of days to the nearest integer\n // because the number of milliseconds in a week is not constant\n // (e.g. it's different in the week of the daylight saving time clock shift)\n return Math.round(diff / MILLISECONDS_IN_WEEK) + 1;\n}", "import toDate from \"../../toDate/index.js\";\nimport requiredArgs from \"../requiredArgs/index.js\";\nimport toInteger from \"../toInteger/index.js\";\nimport { getDefaultOptions } from \"../defaultOptions/index.js\";\nexport default function startOfUTCWeek(dirtyDate, options) {\n var _ref, _ref2, _ref3, _options$weekStartsOn, _options$locale, _options$locale$optio, _defaultOptions$local, _defaultOptions$local2;\n requiredArgs(1, arguments);\n var defaultOptions = getDefaultOptions();\n var weekStartsOn = toInteger((_ref = (_ref2 = (_ref3 = (_options$weekStartsOn = options === null || options === void 0 ? void 0 : options.weekStartsOn) !== null && _options$weekStartsOn !== void 0 ? _options$weekStartsOn : options === null || options === void 0 ? void 0 : (_options$locale = options.locale) === null || _options$locale === void 0 ? void 0 : (_options$locale$optio = _options$locale.options) === null || _options$locale$optio === void 0 ? void 0 : _options$locale$optio.weekStartsOn) !== null && _ref3 !== void 0 ? _ref3 : defaultOptions.weekStartsOn) !== null && _ref2 !== void 0 ? _ref2 : (_defaultOptions$local = defaultOptions.locale) === null || _defaultOptions$local === void 0 ? void 0 : (_defaultOptions$local2 = _defaultOptions$local.options) === null || _defaultOptions$local2 === void 0 ? void 0 : _defaultOptions$local2.weekStartsOn) !== null && _ref !== void 0 ? _ref : 0);\n\n // Test if weekStartsOn is between 0 and 6 _and_ is not NaN\n if (!(weekStartsOn >= 0 && weekStartsOn <= 6)) {\n throw new RangeError('weekStartsOn must be between 0 and 6 inclusively');\n }\n var date = toDate(dirtyDate);\n var day = date.getUTCDay();\n var diff = (day < weekStartsOn ? 7 : 0) + day - weekStartsOn;\n date.setUTCDate(date.getUTCDate() - diff);\n date.setUTCHours(0, 0, 0, 0);\n return date;\n}", "import toDate from \"../../toDate/index.js\";\nimport requiredArgs from \"../requiredArgs/index.js\";\nimport startOfUTCWeek from \"../startOfUTCWeek/index.js\";\nimport toInteger from \"../toInteger/index.js\";\nimport { getDefaultOptions } from \"../defaultOptions/index.js\";\nexport default function getUTCWeekYear(dirtyDate, options) {\n var _ref, _ref2, _ref3, _options$firstWeekCon, _options$locale, _options$locale$optio, _defaultOptions$local, _defaultOptions$local2;\n requiredArgs(1, arguments);\n var date = toDate(dirtyDate);\n var year = date.getUTCFullYear();\n var defaultOptions = getDefaultOptions();\n var firstWeekContainsDate = toInteger((_ref = (_ref2 = (_ref3 = (_options$firstWeekCon = options === null || options === void 0 ? void 0 : options.firstWeekContainsDate) !== null && _options$firstWeekCon !== void 0 ? _options$firstWeekCon : options === null || options === void 0 ? void 0 : (_options$locale = options.locale) === null || _options$locale === void 0 ? void 0 : (_options$locale$optio = _options$locale.options) === null || _options$locale$optio === void 0 ? void 0 : _options$locale$optio.firstWeekContainsDate) !== null && _ref3 !== void 0 ? _ref3 : defaultOptions.firstWeekContainsDate) !== null && _ref2 !== void 0 ? _ref2 : (_defaultOptions$local = defaultOptions.locale) === null || _defaultOptions$local === void 0 ? void 0 : (_defaultOptions$local2 = _defaultOptions$local.options) === null || _defaultOptions$local2 === void 0 ? void 0 : _defaultOptions$local2.firstWeekContainsDate) !== null && _ref !== void 0 ? _ref : 1);\n\n // Test if weekStartsOn is between 1 and 7 _and_ is not NaN\n if (!(firstWeekContainsDate >= 1 && firstWeekContainsDate <= 7)) {\n throw new RangeError('firstWeekContainsDate must be between 1 and 7 inclusively');\n }\n var firstWeekOfNextYear = new Date(0);\n firstWeekOfNextYear.setUTCFullYear(year + 1, 0, firstWeekContainsDate);\n firstWeekOfNextYear.setUTCHours(0, 0, 0, 0);\n var startOfNextYear = startOfUTCWeek(firstWeekOfNextYear, options);\n var firstWeekOfThisYear = new Date(0);\n firstWeekOfThisYear.setUTCFullYear(year, 0, firstWeekContainsDate);\n firstWeekOfThisYear.setUTCHours(0, 0, 0, 0);\n var startOfThisYear = startOfUTCWeek(firstWeekOfThisYear, options);\n if (date.getTime() >= startOfNextYear.getTime()) {\n return year + 1;\n } else if (date.getTime() >= startOfThisYear.getTime()) {\n return year;\n } else {\n return year - 1;\n }\n}", "import getUTCWeekYear from \"../getUTCWeekYear/index.js\";\nimport requiredArgs from \"../requiredArgs/index.js\";\nimport startOfUTCWeek from \"../startOfUTCWeek/index.js\";\nimport toInteger from \"../toInteger/index.js\";\nimport { getDefaultOptions } from \"../defaultOptions/index.js\";\nexport default function startOfUTCWeekYear(dirtyDate, options) {\n var _ref, _ref2, _ref3, _options$firstWeekCon, _options$locale, _options$locale$optio, _defaultOptions$local, _defaultOptions$local2;\n requiredArgs(1, arguments);\n var defaultOptions = getDefaultOptions();\n var firstWeekContainsDate = toInteger((_ref = (_ref2 = (_ref3 = (_options$firstWeekCon = options === null || options === void 0 ? void 0 : options.firstWeekContainsDate) !== null && _options$firstWeekCon !== void 0 ? _options$firstWeekCon : options === null || options === void 0 ? void 0 : (_options$locale = options.locale) === null || _options$locale === void 0 ? void 0 : (_options$locale$optio = _options$locale.options) === null || _options$locale$optio === void 0 ? void 0 : _options$locale$optio.firstWeekContainsDate) !== null && _ref3 !== void 0 ? _ref3 : defaultOptions.firstWeekContainsDate) !== null && _ref2 !== void 0 ? _ref2 : (_defaultOptions$local = defaultOptions.locale) === null || _defaultOptions$local === void 0 ? void 0 : (_defaultOptions$local2 = _defaultOptions$local.options) === null || _defaultOptions$local2 === void 0 ? void 0 : _defaultOptions$local2.firstWeekContainsDate) !== null && _ref !== void 0 ? _ref : 1);\n var year = getUTCWeekYear(dirtyDate, options);\n var firstWeek = new Date(0);\n firstWeek.setUTCFullYear(year, 0, firstWeekContainsDate);\n firstWeek.setUTCHours(0, 0, 0, 0);\n var date = startOfUTCWeek(firstWeek, options);\n return date;\n}", "import toDate from \"../../toDate/index.js\";\nimport startOfUTCWeek from \"../startOfUTCWeek/index.js\";\nimport startOfUTCWeekYear from \"../startOfUTCWeekYear/index.js\";\nimport requiredArgs from \"../requiredArgs/index.js\";\nvar MILLISECONDS_IN_WEEK = 604800000;\nexport default function getUTCWeek(dirtyDate, options) {\n requiredArgs(1, arguments);\n var date = toDate(dirtyDate);\n var diff = startOfUTCWeek(date, options).getTime() - startOfUTCWeekYear(date, options).getTime();\n\n // Round the number of days to the nearest integer\n // because the number of milliseconds in a week is not constant\n // (e.g. it's different in the week of the daylight saving time clock shift)\n return Math.round(diff / MILLISECONDS_IN_WEEK) + 1;\n}", "export default function addLeadingZeros(number, targetLength) {\n var sign = number < 0 ? '-' : '';\n var output = Math.abs(number).toString();\n while (output.length < targetLength) {\n output = '0' + output;\n }\n return sign + output;\n}", "import addLeadingZeros from \"../../addLeadingZeros/index.js\";\n/*\n * | | Unit | | Unit |\n * |-----|--------------------------------|-----|--------------------------------|\n * | a | AM, PM | A* | |\n * | d | Day of month | D | |\n * | h | Hour [1-12] | H | Hour [0-23] |\n * | m | Minute | M | Month |\n * | s | Second | S | Fraction of second |\n * | y | Year (abs) | Y | |\n *\n * Letters marked by * are not implemented but reserved by Unicode standard.\n */\nvar formatters = {\n // Year\n y: function y(date, token) {\n // From http://www.unicode.org/reports/tr35/tr35-31/tr35-dates.html#Date_Format_tokens\n // | Year | y | yy | yyy | yyyy | yyyyy |\n // |----------|-------|----|-------|-------|-------|\n // | AD 1 | 1 | 01 | 001 | 0001 | 00001 |\n // | AD 12 | 12 | 12 | 012 | 0012 | 00012 |\n // | AD 123 | 123 | 23 | 123 | 0123 | 00123 |\n // | AD 1234 | 1234 | 34 | 1234 | 1234 | 01234 |\n // | AD 12345 | 12345 | 45 | 12345 | 12345 | 12345 |\n\n var signedYear = date.getUTCFullYear();\n // Returns 1 for 1 BC (which is year 0 in JavaScript)\n var year = signedYear > 0 ? signedYear : 1 - signedYear;\n return addLeadingZeros(token === 'yy' ? year % 100 : year, token.length);\n },\n // Month\n M: function M(date, token) {\n var month = date.getUTCMonth();\n return token === 'M' ? String(month + 1) : addLeadingZeros(month + 1, 2);\n },\n // Day of the month\n d: function d(date, token) {\n return addLeadingZeros(date.getUTCDate(), token.length);\n },\n // AM or PM\n a: function a(date, token) {\n var dayPeriodEnumValue = date.getUTCHours() / 12 >= 1 ? 'pm' : 'am';\n switch (token) {\n case 'a':\n case 'aa':\n return dayPeriodEnumValue.toUpperCase();\n case 'aaa':\n return dayPeriodEnumValue;\n case 'aaaaa':\n return dayPeriodEnumValue[0];\n case 'aaaa':\n default:\n return dayPeriodEnumValue === 'am' ? 'a.m.' : 'p.m.';\n }\n },\n // Hour [1-12]\n h: function h(date, token) {\n return addLeadingZeros(date.getUTCHours() % 12 || 12, token.length);\n },\n // Hour [0-23]\n H: function H(date, token) {\n return addLeadingZeros(date.getUTCHours(), token.length);\n },\n // Minute\n m: function m(date, token) {\n return addLeadingZeros(date.getUTCMinutes(), token.length);\n },\n // Second\n s: function s(date, token) {\n return addLeadingZeros(date.getUTCSeconds(), token.length);\n },\n // Fraction of second\n S: function S(date, token) {\n var numberOfDigits = token.length;\n var milliseconds = date.getUTCMilliseconds();\n var fractionalSeconds = Math.floor(milliseconds * Math.pow(10, numberOfDigits - 3));\n return addLeadingZeros(fractionalSeconds, token.length);\n }\n};\nexport default formatters;", "import getUTCDayOfYear from \"../../../_lib/getUTCDayOfYear/index.js\";\nimport getUTCISOWeek from \"../../../_lib/getUTCISOWeek/index.js\";\nimport getUTCISOWeekYear from \"../../../_lib/getUTCISOWeekYear/index.js\";\nimport getUTCWeek from \"../../../_lib/getUTCWeek/index.js\";\nimport getUTCWeekYear from \"../../../_lib/getUTCWeekYear/index.js\";\nimport addLeadingZeros from \"../../addLeadingZeros/index.js\";\nimport lightFormatters from \"../lightFormatters/index.js\";\nvar dayPeriodEnum = {\n am: 'am',\n pm: 'pm',\n midnight: 'midnight',\n noon: 'noon',\n morning: 'morning',\n afternoon: 'afternoon',\n evening: 'evening',\n night: 'night'\n};\n/*\n * | | Unit | | Unit |\n * |-----|--------------------------------|-----|--------------------------------|\n * | a | AM, PM | A* | Milliseconds in day |\n * | b | AM, PM, noon, midnight | B | Flexible day period |\n * | c | Stand-alone local day of week | C* | Localized hour w/ day period |\n * | d | Day of month | D | Day of year |\n * | e | Local day of week | E | Day of week |\n * | f | | F* | Day of week in month |\n * | g* | Modified Julian day | G | Era |\n * | h | Hour [1-12] | H | Hour [0-23] |\n * | i! | ISO day of week | I! | ISO week of year |\n * | j* | Localized hour w/ day period | J* | Localized hour w/o day period |\n * | k | Hour [1-24] | K | Hour [0-11] |\n * | l* | (deprecated) | L | Stand-alone month |\n * | m | Minute | M | Month |\n * | n | | N | |\n * | o! | Ordinal number modifier | O | Timezone (GMT) |\n * | p! | Long localized time | P! | Long localized date |\n * | q | Stand-alone quarter | Q | Quarter |\n * | r* | Related Gregorian year | R! | ISO week-numbering year |\n * | s | Second | S | Fraction of second |\n * | t! | Seconds timestamp | T! | Milliseconds timestamp |\n * | u | Extended year | U* | Cyclic year |\n * | v* | Timezone (generic non-locat.) | V* | Timezone (location) |\n * | w | Local week of year | W* | Week of month |\n * | x | Timezone (ISO-8601 w/o Z) | X | Timezone (ISO-8601) |\n * | y | Year (abs) | Y | Local week-numbering year |\n * | z | Timezone (specific non-locat.) | Z* | Timezone (aliases) |\n *\n * Letters marked by * are not implemented but reserved by Unicode standard.\n *\n * Letters marked by ! are non-standard, but implemented by date-fns:\n * - `o` modifies the previous token to turn it into an ordinal (see `format` docs)\n * - `i` is ISO day of week. For `i` and `ii` is returns numeric ISO week days,\n * i.e. 7 for Sunday, 1 for Monday, etc.\n * - `I` is ISO week of year, as opposed to `w` which is local week of year.\n * - `R` is ISO week-numbering year, as opposed to `Y` which is local week-numbering year.\n * `R` is supposed to be used in conjunction with `I` and `i`\n * for universal ISO week-numbering date, whereas\n * `Y` is supposed to be used in conjunction with `w` and `e`\n * for week-numbering date specific to the locale.\n * - `P` is long localized date format\n * - `p` is long localized time format\n */\n\nvar formatters = {\n // Era\n G: function G(date, token, localize) {\n var era = date.getUTCFullYear() > 0 ? 1 : 0;\n switch (token) {\n // AD, BC\n case 'G':\n case 'GG':\n case 'GGG':\n return localize.era(era, {\n width: 'abbreviated'\n });\n // A, B\n case 'GGGGG':\n return localize.era(era, {\n width: 'narrow'\n });\n // Anno Domini, Before Christ\n case 'GGGG':\n default:\n return localize.era(era, {\n width: 'wide'\n });\n }\n },\n // Year\n y: function y(date, token, localize) {\n // Ordinal number\n if (token === 'yo') {\n var signedYear = date.getUTCFullYear();\n // Returns 1 for 1 BC (which is year 0 in JavaScript)\n var year = signedYear > 0 ? signedYear : 1 - signedYear;\n return localize.ordinalNumber(year, {\n unit: 'year'\n });\n }\n return lightFormatters.y(date, token);\n },\n // Local week-numbering year\n Y: function Y(date, token, localize, options) {\n var signedWeekYear = getUTCWeekYear(date, options);\n // Returns 1 for 1 BC (which is year 0 in JavaScript)\n var weekYear = signedWeekYear > 0 ? signedWeekYear : 1 - signedWeekYear;\n\n // Two digit year\n if (token === 'YY') {\n var twoDigitYear = weekYear % 100;\n return addLeadingZeros(twoDigitYear, 2);\n }\n\n // Ordinal number\n if (token === 'Yo') {\n return localize.ordinalNumber(weekYear, {\n unit: 'year'\n });\n }\n\n // Padding\n return addLeadingZeros(weekYear, token.length);\n },\n // ISO week-numbering year\n R: function R(date, token) {\n var isoWeekYear = getUTCISOWeekYear(date);\n\n // Padding\n return addLeadingZeros(isoWeekYear, token.length);\n },\n // Extended year. This is a single number designating the year of this calendar system.\n // The main difference between `y` and `u` localizers are B.C. years:\n // | Year | `y` | `u` |\n // |------|-----|-----|\n // | AC 1 | 1 | 1 |\n // | BC 1 | 1 | 0 |\n // | BC 2 | 2 | -1 |\n // Also `yy` always returns the last two digits of a year,\n // while `uu` pads single digit years to 2 characters and returns other years unchanged.\n u: function u(date, token) {\n var year = date.getUTCFullYear();\n return addLeadingZeros(year, token.length);\n },\n // Quarter\n Q: function Q(date, token, localize) {\n var quarter = Math.ceil((date.getUTCMonth() + 1) / 3);\n switch (token) {\n // 1, 2, 3, 4\n case 'Q':\n return String(quarter);\n // 01, 02, 03, 04\n case 'QQ':\n return addLeadingZeros(quarter, 2);\n // 1st, 2nd, 3rd, 4th\n case 'Qo':\n return localize.ordinalNumber(quarter, {\n unit: 'quarter'\n });\n // Q1, Q2, Q3, Q4\n case 'QQQ':\n return localize.quarter(quarter, {\n width: 'abbreviated',\n context: 'formatting'\n });\n // 1, 2, 3, 4 (narrow quarter; could be not numerical)\n case 'QQQQQ':\n return localize.quarter(quarter, {\n width: 'narrow',\n context: 'formatting'\n });\n // 1st quarter, 2nd quarter, ...\n case 'QQQQ':\n default:\n return localize.quarter(quarter, {\n width: 'wide',\n context: 'formatting'\n });\n }\n },\n // Stand-alone quarter\n q: function q(date, token, localize) {\n var quarter = Math.ceil((date.getUTCMonth() + 1) / 3);\n switch (token) {\n // 1, 2, 3, 4\n case 'q':\n return String(quarter);\n // 01, 02, 03, 04\n case 'qq':\n return addLeadingZeros(quarter, 2);\n // 1st, 2nd, 3rd, 4th\n case 'qo':\n return localize.ordinalNumber(quarter, {\n unit: 'quarter'\n });\n // Q1, Q2, Q3, Q4\n case 'qqq':\n return localize.quarter(quarter, {\n width: 'abbreviated',\n context: 'standalone'\n });\n // 1, 2, 3, 4 (narrow quarter; could be not numerical)\n case 'qqqqq':\n return localize.quarter(quarter, {\n width: 'narrow',\n context: 'standalone'\n });\n // 1st quarter, 2nd quarter, ...\n case 'qqqq':\n default:\n return localize.quarter(quarter, {\n width: 'wide',\n context: 'standalone'\n });\n }\n },\n // Month\n M: function M(date, token, localize) {\n var month = date.getUTCMonth();\n switch (token) {\n case 'M':\n case 'MM':\n return lightFormatters.M(date, token);\n // 1st, 2nd, ..., 12th\n case 'Mo':\n return localize.ordinalNumber(month + 1, {\n unit: 'month'\n });\n // Jan, Feb, ..., Dec\n case 'MMM':\n return localize.month(month, {\n width: 'abbreviated',\n context: 'formatting'\n });\n // J, F, ..., D\n case 'MMMMM':\n return localize.month(month, {\n width: 'narrow',\n context: 'formatting'\n });\n // January, February, ..., December\n case 'MMMM':\n default:\n return localize.month(month, {\n width: 'wide',\n context: 'formatting'\n });\n }\n },\n // Stand-alone month\n L: function L(date, token, localize) {\n var month = date.getUTCMonth();\n switch (token) {\n // 1, 2, ..., 12\n case 'L':\n return String(month + 1);\n // 01, 02, ..., 12\n case 'LL':\n return addLeadingZeros(month + 1, 2);\n // 1st, 2nd, ..., 12th\n case 'Lo':\n return localize.ordinalNumber(month + 1, {\n unit: 'month'\n });\n // Jan, Feb, ..., Dec\n case 'LLL':\n return localize.month(month, {\n width: 'abbreviated',\n context: 'standalone'\n });\n // J, F, ..., D\n case 'LLLLL':\n return localize.month(month, {\n width: 'narrow',\n context: 'standalone'\n });\n // January, February, ..., December\n case 'LLLL':\n default:\n return localize.month(month, {\n width: 'wide',\n context: 'standalone'\n });\n }\n },\n // Local week of year\n w: function w(date, token, localize, options) {\n var week = getUTCWeek(date, options);\n if (token === 'wo') {\n return localize.ordinalNumber(week, {\n unit: 'week'\n });\n }\n return addLeadingZeros(week, token.length);\n },\n // ISO week of year\n I: function I(date, token, localize) {\n var isoWeek = getUTCISOWeek(date);\n if (token === 'Io') {\n return localize.ordinalNumber(isoWeek, {\n unit: 'week'\n });\n }\n return addLeadingZeros(isoWeek, token.length);\n },\n // Day of the month\n d: function d(date, token, localize) {\n if (token === 'do') {\n return localize.ordinalNumber(date.getUTCDate(), {\n unit: 'date'\n });\n }\n return lightFormatters.d(date, token);\n },\n // Day of year\n D: function D(date, token, localize) {\n var dayOfYear = getUTCDayOfYear(date);\n if (token === 'Do') {\n return localize.ordinalNumber(dayOfYear, {\n unit: 'dayOfYear'\n });\n }\n return addLeadingZeros(dayOfYear, token.length);\n },\n // Day of week\n E: function E(date, token, localize) {\n var dayOfWeek = date.getUTCDay();\n switch (token) {\n // Tue\n case 'E':\n case 'EE':\n case 'EEE':\n return localize.day(dayOfWeek, {\n width: 'abbreviated',\n context: 'formatting'\n });\n // T\n case 'EEEEE':\n return localize.day(dayOfWeek, {\n width: 'narrow',\n context: 'formatting'\n });\n // Tu\n case 'EEEEEE':\n return localize.day(dayOfWeek, {\n width: 'short',\n context: 'formatting'\n });\n // Tuesday\n case 'EEEE':\n default:\n return localize.day(dayOfWeek, {\n width: 'wide',\n context: 'formatting'\n });\n }\n },\n // Local day of week\n e: function e(date, token, localize, options) {\n var dayOfWeek = date.getUTCDay();\n var localDayOfWeek = (dayOfWeek - options.weekStartsOn + 8) % 7 || 7;\n switch (token) {\n // Numerical value (Nth day of week with current locale or weekStartsOn)\n case 'e':\n return String(localDayOfWeek);\n // Padded numerical value\n case 'ee':\n return addLeadingZeros(localDayOfWeek, 2);\n // 1st, 2nd, ..., 7th\n case 'eo':\n return localize.ordinalNumber(localDayOfWeek, {\n unit: 'day'\n });\n case 'eee':\n return localize.day(dayOfWeek, {\n width: 'abbreviated',\n context: 'formatting'\n });\n // T\n case 'eeeee':\n return localize.day(dayOfWeek, {\n width: 'narrow',\n context: 'formatting'\n });\n // Tu\n case 'eeeeee':\n return localize.day(dayOfWeek, {\n width: 'short',\n context: 'formatting'\n });\n // Tuesday\n case 'eeee':\n default:\n return localize.day(dayOfWeek, {\n width: 'wide',\n context: 'formatting'\n });\n }\n },\n // Stand-alone local day of week\n c: function c(date, token, localize, options) {\n var dayOfWeek = date.getUTCDay();\n var localDayOfWeek = (dayOfWeek - options.weekStartsOn + 8) % 7 || 7;\n switch (token) {\n // Numerical value (same as in `e`)\n case 'c':\n return String(localDayOfWeek);\n // Padded numerical value\n case 'cc':\n return addLeadingZeros(localDayOfWeek, token.length);\n // 1st, 2nd, ..., 7th\n case 'co':\n return localize.ordinalNumber(localDayOfWeek, {\n unit: 'day'\n });\n case 'ccc':\n return localize.day(dayOfWeek, {\n width: 'abbreviated',\n context: 'standalone'\n });\n // T\n case 'ccccc':\n return localize.day(dayOfWeek, {\n width: 'narrow',\n context: 'standalone'\n });\n // Tu\n case 'cccccc':\n return localize.day(dayOfWeek, {\n width: 'short',\n context: 'standalone'\n });\n // Tuesday\n case 'cccc':\n default:\n return localize.day(dayOfWeek, {\n width: 'wide',\n context: 'standalone'\n });\n }\n },\n // ISO day of week\n i: function i(date, token, localize) {\n var dayOfWeek = date.getUTCDay();\n var isoDayOfWeek = dayOfWeek === 0 ? 7 : dayOfWeek;\n switch (token) {\n // 2\n case 'i':\n return String(isoDayOfWeek);\n // 02\n case 'ii':\n return addLeadingZeros(isoDayOfWeek, token.length);\n // 2nd\n case 'io':\n return localize.ordinalNumber(isoDayOfWeek, {\n unit: 'day'\n });\n // Tue\n case 'iii':\n return localize.day(dayOfWeek, {\n width: 'abbreviated',\n context: 'formatting'\n });\n // T\n case 'iiiii':\n return localize.day(dayOfWeek, {\n width: 'narrow',\n context: 'formatting'\n });\n // Tu\n case 'iiiiii':\n return localize.day(dayOfWeek, {\n width: 'short',\n context: 'formatting'\n });\n // Tuesday\n case 'iiii':\n default:\n return localize.day(dayOfWeek, {\n width: 'wide',\n context: 'formatting'\n });\n }\n },\n // AM or PM\n a: function a(date, token, localize) {\n var hours = date.getUTCHours();\n var dayPeriodEnumValue = hours / 12 >= 1 ? 'pm' : 'am';\n switch (token) {\n case 'a':\n case 'aa':\n return localize.dayPeriod(dayPeriodEnumValue, {\n width: 'abbreviated',\n context: 'formatting'\n });\n case 'aaa':\n return localize.dayPeriod(dayPeriodEnumValue, {\n width: 'abbreviated',\n context: 'formatting'\n }).toLowerCase();\n case 'aaaaa':\n return localize.dayPeriod(dayPeriodEnumValue, {\n width: 'narrow',\n context: 'formatting'\n });\n case 'aaaa':\n default:\n return localize.dayPeriod(dayPeriodEnumValue, {\n width: 'wide',\n context: 'formatting'\n });\n }\n },\n // AM, PM, midnight, noon\n b: function b(date, token, localize) {\n var hours = date.getUTCHours();\n var dayPeriodEnumValue;\n if (hours === 12) {\n dayPeriodEnumValue = dayPeriodEnum.noon;\n } else if (hours === 0) {\n dayPeriodEnumValue = dayPeriodEnum.midnight;\n } else {\n dayPeriodEnumValue = hours / 12 >= 1 ? 'pm' : 'am';\n }\n switch (token) {\n case 'b':\n case 'bb':\n return localize.dayPeriod(dayPeriodEnumValue, {\n width: 'abbreviated',\n context: 'formatting'\n });\n case 'bbb':\n return localize.dayPeriod(dayPeriodEnumValue, {\n width: 'abbreviated',\n context: 'formatting'\n }).toLowerCase();\n case 'bbbbb':\n return localize.dayPeriod(dayPeriodEnumValue, {\n width: 'narrow',\n context: 'formatting'\n });\n case 'bbbb':\n default:\n return localize.dayPeriod(dayPeriodEnumValue, {\n width: 'wide',\n context: 'formatting'\n });\n }\n },\n // in the morning, in the afternoon, in the evening, at night\n B: function B(date, token, localize) {\n var hours = date.getUTCHours();\n var dayPeriodEnumValue;\n if (hours >= 17) {\n dayPeriodEnumValue = dayPeriodEnum.evening;\n } else if (hours >= 12) {\n dayPeriodEnumValue = dayPeriodEnum.afternoon;\n } else if (hours >= 4) {\n dayPeriodEnumValue = dayPeriodEnum.morning;\n } else {\n dayPeriodEnumValue = dayPeriodEnum.night;\n }\n switch (token) {\n case 'B':\n case 'BB':\n case 'BBB':\n return localize.dayPeriod(dayPeriodEnumValue, {\n width: 'abbreviated',\n context: 'formatting'\n });\n case 'BBBBB':\n return localize.dayPeriod(dayPeriodEnumValue, {\n width: 'narrow',\n context: 'formatting'\n });\n case 'BBBB':\n default:\n return localize.dayPeriod(dayPeriodEnumValue, {\n width: 'wide',\n context: 'formatting'\n });\n }\n },\n // Hour [1-12]\n h: function h(date, token, localize) {\n if (token === 'ho') {\n var hours = date.getUTCHours() % 12;\n if (hours === 0) hours = 12;\n return localize.ordinalNumber(hours, {\n unit: 'hour'\n });\n }\n return lightFormatters.h(date, token);\n },\n // Hour [0-23]\n H: function H(date, token, localize) {\n if (token === 'Ho') {\n return localize.ordinalNumber(date.getUTCHours(), {\n unit: 'hour'\n });\n }\n return lightFormatters.H(date, token);\n },\n // Hour [0-11]\n K: function K(date, token, localize) {\n var hours = date.getUTCHours() % 12;\n if (token === 'Ko') {\n return localize.ordinalNumber(hours, {\n unit: 'hour'\n });\n }\n return addLeadingZeros(hours, token.length);\n },\n // Hour [1-24]\n k: function k(date, token, localize) {\n var hours = date.getUTCHours();\n if (hours === 0) hours = 24;\n if (token === 'ko') {\n return localize.ordinalNumber(hours, {\n unit: 'hour'\n });\n }\n return addLeadingZeros(hours, token.length);\n },\n // Minute\n m: function m(date, token, localize) {\n if (token === 'mo') {\n return localize.ordinalNumber(date.getUTCMinutes(), {\n unit: 'minute'\n });\n }\n return lightFormatters.m(date, token);\n },\n // Second\n s: function s(date, token, localize) {\n if (token === 'so') {\n return localize.ordinalNumber(date.getUTCSeconds(), {\n unit: 'second'\n });\n }\n return lightFormatters.s(date, token);\n },\n // Fraction of second\n S: function S(date, token) {\n return lightFormatters.S(date, token);\n },\n // Timezone (ISO-8601. If offset is 0, output is always `'Z'`)\n X: function X(date, token, _localize, options) {\n var originalDate = options._originalDate || date;\n var timezoneOffset = originalDate.getTimezoneOffset();\n if (timezoneOffset === 0) {\n return 'Z';\n }\n switch (token) {\n // Hours and optional minutes\n case 'X':\n return formatTimezoneWithOptionalMinutes(timezoneOffset);\n\n // Hours, minutes and optional seconds without `:` delimiter\n // Note: neither ISO-8601 nor JavaScript supports seconds in timezone offsets\n // so this token always has the same output as `XX`\n case 'XXXX':\n case 'XX':\n // Hours and minutes without `:` delimiter\n return formatTimezone(timezoneOffset);\n\n // Hours, minutes and optional seconds with `:` delimiter\n // Note: neither ISO-8601 nor JavaScript supports seconds in timezone offsets\n // so this token always has the same output as `XXX`\n case 'XXXXX':\n case 'XXX': // Hours and minutes with `:` delimiter\n default:\n return formatTimezone(timezoneOffset, ':');\n }\n },\n // Timezone (ISO-8601. If offset is 0, output is `'+00:00'` or equivalent)\n x: function x(date, token, _localize, options) {\n var originalDate = options._originalDate || date;\n var timezoneOffset = originalDate.getTimezoneOffset();\n switch (token) {\n // Hours and optional minutes\n case 'x':\n return formatTimezoneWithOptionalMinutes(timezoneOffset);\n\n // Hours, minutes and optional seconds without `:` delimiter\n // Note: neither ISO-8601 nor JavaScript supports seconds in timezone offsets\n // so this token always has the same output as `xx`\n case 'xxxx':\n case 'xx':\n // Hours and minutes without `:` delimiter\n return formatTimezone(timezoneOffset);\n\n // Hours, minutes and optional seconds with `:` delimiter\n // Note: neither ISO-8601 nor JavaScript supports seconds in timezone offsets\n // so this token always has the same output as `xxx`\n case 'xxxxx':\n case 'xxx': // Hours and minutes with `:` delimiter\n default:\n return formatTimezone(timezoneOffset, ':');\n }\n },\n // Timezone (GMT)\n O: function O(date, token, _localize, options) {\n var originalDate = options._originalDate || date;\n var timezoneOffset = originalDate.getTimezoneOffset();\n switch (token) {\n // Short\n case 'O':\n case 'OO':\n case 'OOO':\n return 'GMT' + formatTimezoneShort(timezoneOffset, ':');\n // Long\n case 'OOOO':\n default:\n return 'GMT' + formatTimezone(timezoneOffset, ':');\n }\n },\n // Timezone (specific non-location)\n z: function z(date, token, _localize, options) {\n var originalDate = options._originalDate || date;\n var timezoneOffset = originalDate.getTimezoneOffset();\n switch (token) {\n // Short\n case 'z':\n case 'zz':\n case 'zzz':\n return 'GMT' + formatTimezoneShort(timezoneOffset, ':');\n // Long\n case 'zzzz':\n default:\n return 'GMT' + formatTimezone(timezoneOffset, ':');\n }\n },\n // Seconds timestamp\n t: function t(date, token, _localize, options) {\n var originalDate = options._originalDate || date;\n var timestamp = Math.floor(originalDate.getTime() / 1000);\n return addLeadingZeros(timestamp, token.length);\n },\n // Milliseconds timestamp\n T: function T(date, token, _localize, options) {\n var originalDate = options._originalDate || date;\n var timestamp = originalDate.getTime();\n return addLeadingZeros(timestamp, token.length);\n }\n};\nfunction formatTimezoneShort(offset, dirtyDelimiter) {\n var sign = offset > 0 ? '-' : '+';\n var absOffset = Math.abs(offset);\n var hours = Math.floor(absOffset / 60);\n var minutes = absOffset % 60;\n if (minutes === 0) {\n return sign + String(hours);\n }\n var delimiter = dirtyDelimiter || '';\n return sign + String(hours) + delimiter + addLeadingZeros(minutes, 2);\n}\nfunction formatTimezoneWithOptionalMinutes(offset, dirtyDelimiter) {\n if (offset % 60 === 0) {\n var sign = offset > 0 ? '-' : '+';\n return sign + addLeadingZeros(Math.abs(offset) / 60, 2);\n }\n return formatTimezone(offset, dirtyDelimiter);\n}\nfunction formatTimezone(offset, dirtyDelimiter) {\n var delimiter = dirtyDelimiter || '';\n var sign = offset > 0 ? '-' : '+';\n var absOffset = Math.abs(offset);\n var hours = addLeadingZeros(Math.floor(absOffset / 60), 2);\n var minutes = addLeadingZeros(absOffset % 60, 2);\n return sign + hours + delimiter + minutes;\n}\nexport default formatters;", "var dateLongFormatter = function dateLongFormatter(pattern, formatLong) {\n switch (pattern) {\n case 'P':\n return formatLong.date({\n width: 'short'\n });\n case 'PP':\n return formatLong.date({\n width: 'medium'\n });\n case 'PPP':\n return formatLong.date({\n width: 'long'\n });\n case 'PPPP':\n default:\n return formatLong.date({\n width: 'full'\n });\n }\n};\nvar timeLongFormatter = function timeLongFormatter(pattern, formatLong) {\n switch (pattern) {\n case 'p':\n return formatLong.time({\n width: 'short'\n });\n case 'pp':\n return formatLong.time({\n width: 'medium'\n });\n case 'ppp':\n return formatLong.time({\n width: 'long'\n });\n case 'pppp':\n default:\n return formatLong.time({\n width: 'full'\n });\n }\n};\nvar dateTimeLongFormatter = function dateTimeLongFormatter(pattern, formatLong) {\n var matchResult = pattern.match(/(P+)(p+)?/) || [];\n var datePattern = matchResult[1];\n var timePattern = matchResult[2];\n if (!timePattern) {\n return dateLongFormatter(pattern, formatLong);\n }\n var dateTimeFormat;\n switch (datePattern) {\n case 'P':\n dateTimeFormat = formatLong.dateTime({\n width: 'short'\n });\n break;\n case 'PP':\n dateTimeFormat = formatLong.dateTime({\n width: 'medium'\n });\n break;\n case 'PPP':\n dateTimeFormat = formatLong.dateTime({\n width: 'long'\n });\n break;\n case 'PPPP':\n default:\n dateTimeFormat = formatLong.dateTime({\n width: 'full'\n });\n break;\n }\n return dateTimeFormat.replace('{{date}}', dateLongFormatter(datePattern, formatLong)).replace('{{time}}', timeLongFormatter(timePattern, formatLong));\n};\nvar longFormatters = {\n p: timeLongFormatter,\n P: dateTimeLongFormatter\n};\nexport default longFormatters;", "var protectedDayOfYearTokens = ['D', 'DD'];\nvar protectedWeekYearTokens = ['YY', 'YYYY'];\nexport function isProtectedDayOfYearToken(token) {\n return protectedDayOfYearTokens.indexOf(token) !== -1;\n}\nexport function isProtectedWeekYearToken(token) {\n return protectedWeekYearTokens.indexOf(token) !== -1;\n}\nexport function throwProtectedError(token, format, input) {\n if (token === 'YYYY') {\n throw new RangeError(\"Use `yyyy` instead of `YYYY` (in `\".concat(format, \"`) for formatting years to the input `\").concat(input, \"`; see: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\"));\n } else if (token === 'YY') {\n throw new RangeError(\"Use `yy` instead of `YY` (in `\".concat(format, \"`) for formatting years to the input `\").concat(input, \"`; see: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\"));\n } else if (token === 'D') {\n throw new RangeError(\"Use `d` instead of `D` (in `\".concat(format, \"`) for formatting days of the month to the input `\").concat(input, \"`; see: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\"));\n } else if (token === 'DD') {\n throw new RangeError(\"Use `dd` instead of `DD` (in `\".concat(format, \"`) for formatting days of the month to the input `\").concat(input, \"`; see: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\"));\n }\n}", "var formatDistanceLocale = {\n lessThanXSeconds: {\n one: 'less than a second',\n other: 'less than {{count}} seconds'\n },\n xSeconds: {\n one: '1 second',\n other: '{{count}} seconds'\n },\n halfAMinute: 'half a minute',\n lessThanXMinutes: {\n one: 'less than a minute',\n other: 'less than {{count}} minutes'\n },\n xMinutes: {\n one: '1 minute',\n other: '{{count}} minutes'\n },\n aboutXHours: {\n one: 'about 1 hour',\n other: 'about {{count}} hours'\n },\n xHours: {\n one: '1 hour',\n other: '{{count}} hours'\n },\n xDays: {\n one: '1 day',\n other: '{{count}} days'\n },\n aboutXWeeks: {\n one: 'about 1 week',\n other: 'about {{count}} weeks'\n },\n xWeeks: {\n one: '1 week',\n other: '{{count}} weeks'\n },\n aboutXMonths: {\n one: 'about 1 month',\n other: 'about {{count}} months'\n },\n xMonths: {\n one: '1 month',\n other: '{{count}} months'\n },\n aboutXYears: {\n one: 'about 1 year',\n other: 'about {{count}} years'\n },\n xYears: {\n one: '1 year',\n other: '{{count}} years'\n },\n overXYears: {\n one: 'over 1 year',\n other: 'over {{count}} years'\n },\n almostXYears: {\n one: 'almost 1 year',\n other: 'almost {{count}} years'\n }\n};\nvar formatDistance = function formatDistance(token, count, options) {\n var result;\n var tokenValue = formatDistanceLocale[token];\n if (typeof tokenValue === 'string') {\n result = tokenValue;\n } else if (count === 1) {\n result = tokenValue.one;\n } else {\n result = tokenValue.other.replace('{{count}}', count.toString());\n }\n if (options !== null && options !== void 0 && options.addSuffix) {\n if (options.comparison && options.comparison > 0) {\n return 'in ' + result;\n } else {\n return result + ' ago';\n }\n }\n return result;\n};\nexport default formatDistance;", "export default function buildFormatLongFn(args) {\n return function () {\n var options = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};\n // TODO: Remove String()\n var width = options.width ? String(options.width) : args.defaultWidth;\n var format = args.formats[width] || args.formats[args.defaultWidth];\n return format;\n };\n}", "import buildFormatLongFn from \"../../../_lib/buildFormatLongFn/index.js\";\nvar dateFormats = {\n full: 'EEEE, MMMM do, y',\n long: 'MMMM do, y',\n medium: 'MMM d, y',\n short: 'MM/dd/yyyy'\n};\nvar timeFormats = {\n full: 'h:mm:ss a zzzz',\n long: 'h:mm:ss a z',\n medium: 'h:mm:ss a',\n short: 'h:mm a'\n};\nvar dateTimeFormats = {\n full: \"{{date}} 'at' {{time}}\",\n long: \"{{date}} 'at' {{time}}\",\n medium: '{{date}}, {{time}}',\n short: '{{date}}, {{time}}'\n};\nvar formatLong = {\n date: buildFormatLongFn({\n formats: dateFormats,\n defaultWidth: 'full'\n }),\n time: buildFormatLongFn({\n formats: timeFormats,\n defaultWidth: 'full'\n }),\n dateTime: buildFormatLongFn({\n formats: dateTimeFormats,\n defaultWidth: 'full'\n })\n};\nexport default formatLong;", "var formatRelativeLocale = {\n lastWeek: \"'last' eeee 'at' p\",\n yesterday: \"'yesterday at' p\",\n today: \"'today at' p\",\n tomorrow: \"'tomorrow at' p\",\n nextWeek: \"eeee 'at' p\",\n other: 'P'\n};\nvar formatRelative = function formatRelative(token, _date, _baseDate, _options) {\n return formatRelativeLocale[token];\n};\nexport default formatRelative;", "export default function buildLocalizeFn(args) {\n return function (dirtyIndex, options) {\n var context = options !== null && options !== void 0 && options.context ? String(options.context) : 'standalone';\n var valuesArray;\n if (context === 'formatting' && args.formattingValues) {\n var defaultWidth = args.defaultFormattingWidth || args.defaultWidth;\n var width = options !== null && options !== void 0 && options.width ? String(options.width) : defaultWidth;\n valuesArray = args.formattingValues[width] || args.formattingValues[defaultWidth];\n } else {\n var _defaultWidth = args.defaultWidth;\n var _width = options !== null && options !== void 0 && options.width ? String(options.width) : args.defaultWidth;\n valuesArray = args.values[_width] || args.values[_defaultWidth];\n }\n var index = args.argumentCallback ? args.argumentCallback(dirtyIndex) : dirtyIndex;\n // @ts-ignore: For some reason TypeScript just don't want to match it, no matter how hard we try. I challenge you to try to remove it!\n return valuesArray[index];\n };\n}", "import buildLocalizeFn from \"../../../_lib/buildLocalizeFn/index.js\";\nvar eraValues = {\n narrow: ['B', 'A'],\n abbreviated: ['BC', 'AD'],\n wide: ['Before Christ', 'Anno Domini']\n};\nvar quarterValues = {\n narrow: ['1', '2', '3', '4'],\n abbreviated: ['Q1', 'Q2', 'Q3', 'Q4'],\n wide: ['1st quarter', '2nd quarter', '3rd quarter', '4th quarter']\n};\n\n// Note: in English, the names of days of the week and months are capitalized.\n// If you are making a new locale based on this one, check if the same is true for the language you're working on.\n// Generally, formatted dates should look like they are in the middle of a sentence,\n// e.g. in Spanish language the weekdays and months should be in the lowercase.\nvar monthValues = {\n narrow: ['J', 'F', 'M', 'A', 'M', 'J', 'J', 'A', 'S', 'O', 'N', 'D'],\n abbreviated: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],\n wide: ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December']\n};\nvar dayValues = {\n narrow: ['S', 'M', 'T', 'W', 'T', 'F', 'S'],\n short: ['Su', 'Mo', 'Tu', 'We', 'Th', 'Fr', 'Sa'],\n abbreviated: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'],\n wide: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday']\n};\nvar dayPeriodValues = {\n narrow: {\n am: 'a',\n pm: 'p',\n midnight: 'mi',\n noon: 'n',\n morning: 'morning',\n afternoon: 'afternoon',\n evening: 'evening',\n night: 'night'\n },\n abbreviated: {\n am: 'AM',\n pm: 'PM',\n midnight: 'midnight',\n noon: 'noon',\n morning: 'morning',\n afternoon: 'afternoon',\n evening: 'evening',\n night: 'night'\n },\n wide: {\n am: 'a.m.',\n pm: 'p.m.',\n midnight: 'midnight',\n noon: 'noon',\n morning: 'morning',\n afternoon: 'afternoon',\n evening: 'evening',\n night: 'night'\n }\n};\nvar formattingDayPeriodValues = {\n narrow: {\n am: 'a',\n pm: 'p',\n midnight: 'mi',\n noon: 'n',\n morning: 'in the morning',\n afternoon: 'in the afternoon',\n evening: 'in the evening',\n night: 'at night'\n },\n abbreviated: {\n am: 'AM',\n pm: 'PM',\n midnight: 'midnight',\n noon: 'noon',\n morning: 'in the morning',\n afternoon: 'in the afternoon',\n evening: 'in the evening',\n night: 'at night'\n },\n wide: {\n am: 'a.m.',\n pm: 'p.m.',\n midnight: 'midnight',\n noon: 'noon',\n morning: 'in the morning',\n afternoon: 'in the afternoon',\n evening: 'in the evening',\n night: 'at night'\n }\n};\nvar ordinalNumber = function ordinalNumber(dirtyNumber, _options) {\n var number = Number(dirtyNumber);\n\n // If ordinal numbers depend on context, for example,\n // if they are different for different grammatical genders,\n // use `options.unit`.\n //\n // `unit` can be 'year', 'quarter', 'month', 'week', 'date', 'dayOfYear',\n // 'day', 'hour', 'minute', 'second'.\n\n var rem100 = number % 100;\n if (rem100 > 20 || rem100 < 10) {\n switch (rem100 % 10) {\n case 1:\n return number + 'st';\n case 2:\n return number + 'nd';\n case 3:\n return number + 'rd';\n }\n }\n return number + 'th';\n};\nvar localize = {\n ordinalNumber: ordinalNumber,\n era: buildLocalizeFn({\n values: eraValues,\n defaultWidth: 'wide'\n }),\n quarter: buildLocalizeFn({\n values: quarterValues,\n defaultWidth: 'wide',\n argumentCallback: function argumentCallback(quarter) {\n return quarter - 1;\n }\n }),\n month: buildLocalizeFn({\n values: monthValues,\n defaultWidth: 'wide'\n }),\n day: buildLocalizeFn({\n values: dayValues,\n defaultWidth: 'wide'\n }),\n dayPeriod: buildLocalizeFn({\n values: dayPeriodValues,\n defaultWidth: 'wide',\n formattingValues: formattingDayPeriodValues,\n defaultFormattingWidth: 'wide'\n })\n};\nexport default localize;", "export default function buildMatchFn(args) {\n return function (string) {\n var options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};\n var width = options.width;\n var matchPattern = width && args.matchPatterns[width] || args.matchPatterns[args.defaultMatchWidth];\n var matchResult = string.match(matchPattern);\n if (!matchResult) {\n return null;\n }\n var matchedString = matchResult[0];\n var parsePatterns = width && args.parsePatterns[width] || args.parsePatterns[args.defaultParseWidth];\n var key = Array.isArray(parsePatterns) ? findIndex(parsePatterns, function (pattern) {\n return pattern.test(matchedString);\n }) : findKey(parsePatterns, function (pattern) {\n return pattern.test(matchedString);\n });\n var value;\n value = args.valueCallback ? args.valueCallback(key) : key;\n value = options.valueCallback ? options.valueCallback(value) : value;\n var rest = string.slice(matchedString.length);\n return {\n value: value,\n rest: rest\n };\n };\n}\nfunction findKey(object, predicate) {\n for (var key in object) {\n if (object.hasOwnProperty(key) && predicate(object[key])) {\n return key;\n }\n }\n return undefined;\n}\nfunction findIndex(array, predicate) {\n for (var key = 0; key < array.length; key++) {\n if (predicate(array[key])) {\n return key;\n }\n }\n return undefined;\n}", "export default function buildMatchPatternFn(args) {\n return function (string) {\n var options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};\n var matchResult = string.match(args.matchPattern);\n if (!matchResult) return null;\n var matchedString = matchResult[0];\n var parseResult = string.match(args.parsePattern);\n if (!parseResult) return null;\n var value = args.valueCallback ? args.valueCallback(parseResult[0]) : parseResult[0];\n value = options.valueCallback ? options.valueCallback(value) : value;\n var rest = string.slice(matchedString.length);\n return {\n value: value,\n rest: rest\n };\n };\n}", "import buildMatchFn from \"../../../_lib/buildMatchFn/index.js\";\nimport buildMatchPatternFn from \"../../../_lib/buildMatchPatternFn/index.js\";\nvar matchOrdinalNumberPattern = /^(\\d+)(th|st|nd|rd)?/i;\nvar parseOrdinalNumberPattern = /\\d+/i;\nvar matchEraPatterns = {\n narrow: /^(b|a)/i,\n abbreviated: /^(b\\.?\\s?c\\.?|b\\.?\\s?c\\.?\\s?e\\.?|a\\.?\\s?d\\.?|c\\.?\\s?e\\.?)/i,\n wide: /^(before christ|before common era|anno domini|common era)/i\n};\nvar parseEraPatterns = {\n any: [/^b/i, /^(a|c)/i]\n};\nvar matchQuarterPatterns = {\n narrow: /^[1234]/i,\n abbreviated: /^q[1234]/i,\n wide: /^[1234](th|st|nd|rd)? quarter/i\n};\nvar parseQuarterPatterns = {\n any: [/1/i, /2/i, /3/i, /4/i]\n};\nvar matchMonthPatterns = {\n narrow: /^[jfmasond]/i,\n abbreviated: /^(jan|feb|mar|apr|may|jun|jul|aug|sep|oct|nov|dec)/i,\n wide: /^(january|february|march|april|may|june|july|august|september|october|november|december)/i\n};\nvar parseMonthPatterns = {\n narrow: [/^j/i, /^f/i, /^m/i, /^a/i, /^m/i, /^j/i, /^j/i, /^a/i, /^s/i, /^o/i, /^n/i, /^d/i],\n any: [/^ja/i, /^f/i, /^mar/i, /^ap/i, /^may/i, /^jun/i, /^jul/i, /^au/i, /^s/i, /^o/i, /^n/i, /^d/i]\n};\nvar matchDayPatterns = {\n narrow: /^[smtwf]/i,\n short: /^(su|mo|tu|we|th|fr|sa)/i,\n abbreviated: /^(sun|mon|tue|wed|thu|fri|sat)/i,\n wide: /^(sunday|monday|tuesday|wednesday|thursday|friday|saturday)/i\n};\nvar parseDayPatterns = {\n narrow: [/^s/i, /^m/i, /^t/i, /^w/i, /^t/i, /^f/i, /^s/i],\n any: [/^su/i, /^m/i, /^tu/i, /^w/i, /^th/i, /^f/i, /^sa/i]\n};\nvar matchDayPeriodPatterns = {\n narrow: /^(a|p|mi|n|(in the|at) (morning|afternoon|evening|night))/i,\n any: /^([ap]\\.?\\s?m\\.?|midnight|noon|(in the|at) (morning|afternoon|evening|night))/i\n};\nvar parseDayPeriodPatterns = {\n any: {\n am: /^a/i,\n pm: /^p/i,\n midnight: /^mi/i,\n noon: /^no/i,\n morning: /morning/i,\n afternoon: /afternoon/i,\n evening: /evening/i,\n night: /night/i\n }\n};\nvar match = {\n ordinalNumber: buildMatchPatternFn({\n matchPattern: matchOrdinalNumberPattern,\n parsePattern: parseOrdinalNumberPattern,\n valueCallback: function valueCallback(value) {\n return parseInt(value, 10);\n }\n }),\n era: buildMatchFn({\n matchPatterns: matchEraPatterns,\n defaultMatchWidth: 'wide',\n parsePatterns: parseEraPatterns,\n defaultParseWidth: 'any'\n }),\n quarter: buildMatchFn({\n matchPatterns: matchQuarterPatterns,\n defaultMatchWidth: 'wide',\n parsePatterns: parseQuarterPatterns,\n defaultParseWidth: 'any',\n valueCallback: function valueCallback(index) {\n return index + 1;\n }\n }),\n month: buildMatchFn({\n matchPatterns: matchMonthPatterns,\n defaultMatchWidth: 'wide',\n parsePatterns: parseMonthPatterns,\n defaultParseWidth: 'any'\n }),\n day: buildMatchFn({\n matchPatterns: matchDayPatterns,\n defaultMatchWidth: 'wide',\n parsePatterns: parseDayPatterns,\n defaultParseWidth: 'any'\n }),\n dayPeriod: buildMatchFn({\n matchPatterns: matchDayPeriodPatterns,\n defaultMatchWidth: 'any',\n parsePatterns: parseDayPeriodPatterns,\n defaultParseWidth: 'any'\n })\n};\nexport default match;", "import formatDistance from \"./_lib/formatDistance/index.js\";\nimport formatLong from \"./_lib/formatLong/index.js\";\nimport formatRelative from \"./_lib/formatRelative/index.js\";\nimport localize from \"./_lib/localize/index.js\";\nimport match from \"./_lib/match/index.js\";\n/**\n * @type {Locale}\n * @category Locales\n * @summary English locale (United States).\n * @language English\n * @iso-639-2 eng\n * @author Sasha Koss [@kossnocorp]{@link https://github.com/kossnocorp}\n * @author Lesha Koss [@leshakoss]{@link https://github.com/leshakoss}\n */\nvar locale = {\n code: 'en-US',\n formatDistance: formatDistance,\n formatLong: formatLong,\n formatRelative: formatRelative,\n localize: localize,\n match: match,\n options: {\n weekStartsOn: 0 /* Sunday */,\n firstWeekContainsDate: 1\n }\n};\nexport default locale;", "import defaultLocale from \"../../locale/en-US/index.js\";\nexport default defaultLocale;", "import isValid from \"../isValid/index.js\";\nimport subMilliseconds from \"../subMilliseconds/index.js\";\nimport toDate from \"../toDate/index.js\";\nimport formatters from \"../_lib/format/formatters/index.js\";\nimport longFormatters from \"../_lib/format/longFormatters/index.js\";\nimport getTimezoneOffsetInMilliseconds from \"../_lib/getTimezoneOffsetInMilliseconds/index.js\";\nimport { isProtectedDayOfYearToken, isProtectedWeekYearToken, throwProtectedError } from \"../_lib/protectedTokens/index.js\";\nimport toInteger from \"../_lib/toInteger/index.js\";\nimport requiredArgs from \"../_lib/requiredArgs/index.js\";\nimport { getDefaultOptions } from \"../_lib/defaultOptions/index.js\";\nimport defaultLocale from \"../_lib/defaultLocale/index.js\"; // This RegExp consists of three parts separated by `|`:\n// - [yYQqMLwIdDecihHKkms]o matches any available ordinal number token\n// (one of the certain letters followed by `o`)\n// - (\\w)\\1* matches any sequences of the same letter\n// - '' matches two quote characters in a row\n// - '(''|[^'])+('|$) matches anything surrounded by two quote characters ('),\n// except a single quote symbol, which ends the sequence.\n// Two quote characters do not end the sequence.\n// If there is no matching single quote\n// then the sequence will continue until the end of the string.\n// - . matches any single character unmatched by previous parts of the RegExps\nvar formattingTokensRegExp = /[yYQqMLwIdDecihHKkms]o|(\\w)\\1*|''|'(''|[^'])+('|$)|./g;\n\n// This RegExp catches symbols escaped by quotes, and also\n// sequences of symbols P, p, and the combinations like `PPPPPPPppppp`\nvar longFormattingTokensRegExp = /P+p+|P+|p+|''|'(''|[^'])+('|$)|./g;\nvar escapedStringRegExp = /^'([^]*?)'?$/;\nvar doubleQuoteRegExp = /''/g;\nvar unescapedLatinCharacterRegExp = /[a-zA-Z]/;\n\n/**\n * @name format\n * @category Common Helpers\n * @summary Format the date.\n *\n * @description\n * Return the formatted date string in the given format. The result may vary by locale.\n *\n * > \u26A0\uFE0F Please note that the `format` tokens differ from Moment.js and other libraries.\n * > See: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\n *\n * The characters wrapped between two single quotes characters (') are escaped.\n * Two single quotes in a row, whether inside or outside a quoted sequence, represent a 'real' single quote.\n * (see the last example)\n *\n * Format of the string is based on Unicode Technical Standard #35:\n * https://www.unicode.org/reports/tr35/tr35-dates.html#Date_Field_Symbol_Table\n * with a few additions (see note 7 below the table).\n *\n * Accepted patterns:\n * | Unit | Pattern | Result examples | Notes |\n * |---------------------------------|---------|-----------------------------------|-------|\n * | Era | G..GGG | AD, BC | |\n * | | GGGG | Anno Domini, Before Christ | 2 |\n * | | GGGGG | A, B | |\n * | Calendar year | y | 44, 1, 1900, 2017 | 5 |\n * | | yo | 44th, 1st, 0th, 17th | 5,7 |\n * | | yy | 44, 01, 00, 17 | 5 |\n * | | yyy | 044, 001, 1900, 2017 | 5 |\n * | | yyyy | 0044, 0001, 1900, 2017 | 5 |\n * | | yyyyy | ... | 3,5 |\n * | Local week-numbering year | Y | 44, 1, 1900, 2017 | 5 |\n * | | Yo | 44th, 1st, 1900th, 2017th | 5,7 |\n * | | YY | 44, 01, 00, 17 | 5,8 |\n * | | YYY | 044, 001, 1900, 2017 | 5 |\n * | | YYYY | 0044, 0001, 1900, 2017 | 5,8 |\n * | | YYYYY | ... | 3,5 |\n * | ISO week-numbering year | R | -43, 0, 1, 1900, 2017 | 5,7 |\n * | | RR | -43, 00, 01, 1900, 2017 | 5,7 |\n * | | RRR | -043, 000, 001, 1900, 2017 | 5,7 |\n * | | RRRR | -0043, 0000, 0001, 1900, 2017 | 5,7 |\n * | | RRRRR | ... | 3,5,7 |\n * | Extended year | u | -43, 0, 1, 1900, 2017 | 5 |\n * | | uu | -43, 01, 1900, 2017 | 5 |\n * | | uuu | -043, 001, 1900, 2017 | 5 |\n * | | uuuu | -0043, 0001, 1900, 2017 | 5 |\n * | | uuuuu | ... | 3,5 |\n * | Quarter (formatting) | Q | 1, 2, 3, 4 | |\n * | | Qo | 1st, 2nd, 3rd, 4th | 7 |\n * | | QQ | 01, 02, 03, 04 | |\n * | | QQQ | Q1, Q2, Q3, Q4 | |\n * | | QQQQ | 1st quarter, 2nd quarter, ... | 2 |\n * | | QQQQQ | 1, 2, 3, 4 | 4 |\n * | Quarter (stand-alone) | q | 1, 2, 3, 4 | |\n * | | qo | 1st, 2nd, 3rd, 4th | 7 |\n * | | qq | 01, 02, 03, 04 | |\n * | | qqq | Q1, Q2, Q3, Q4 | |\n * | | qqqq | 1st quarter, 2nd quarter, ... | 2 |\n * | | qqqqq | 1, 2, 3, 4 | 4 |\n * | Month (formatting) | M | 1, 2, ..., 12 | |\n * | | Mo | 1st, 2nd, ..., 12th | 7 |\n * | | MM | 01, 02, ..., 12 | |\n * | | MMM | Jan, Feb, ..., Dec | |\n * | | MMMM | January, February, ..., December | 2 |\n * | | MMMMM | J, F, ..., D | |\n * | Month (stand-alone) | L | 1, 2, ..., 12 | |\n * | | Lo | 1st, 2nd, ..., 12th | 7 |\n * | | LL | 01, 02, ..., 12 | |\n * | | LLL | Jan, Feb, ..., Dec | |\n * | | LLLL | January, February, ..., December | 2 |\n * | | LLLLL | J, F, ..., D | |\n * | Local week of year | w | 1, 2, ..., 53 | |\n * | | wo | 1st, 2nd, ..., 53th | 7 |\n * | | ww | 01, 02, ..., 53 | |\n * | ISO week of year | I | 1, 2, ..., 53 | 7 |\n * | | Io | 1st, 2nd, ..., 53th | 7 |\n * | | II | 01, 02, ..., 53 | 7 |\n * | Day of month | d | 1, 2, ..., 31 | |\n * | | do | 1st, 2nd, ..., 31st | 7 |\n * | | dd | 01, 02, ..., 31 | |\n * | Day of year | D | 1, 2, ..., 365, 366 | 9 |\n * | | Do | 1st, 2nd, ..., 365th, 366th | 7 |\n * | | DD | 01, 02, ..., 365, 366 | 9 |\n * | | DDD | 001, 002, ..., 365, 366 | |\n * | | DDDD | ... | 3 |\n * | Day of week (formatting) | E..EEE | Mon, Tue, Wed, ..., Sun | |\n * | | EEEE | Monday, Tuesday, ..., Sunday | 2 |\n * | | EEEEE | M, T, W, T, F, S, S | |\n * | | EEEEEE | Mo, Tu, We, Th, Fr, Sa, Su | |\n * | ISO day of week (formatting) | i | 1, 2, 3, ..., 7 | 7 |\n * | | io | 1st, 2nd, ..., 7th | 7 |\n * | | ii | 01, 02, ..., 07 | 7 |\n * | | iii | Mon, Tue, Wed, ..., Sun | 7 |\n * | | iiii | Monday, Tuesday, ..., Sunday | 2,7 |\n * | | iiiii | M, T, W, T, F, S, S | 7 |\n * | | iiiiii | Mo, Tu, We, Th, Fr, Sa, Su | 7 |\n * | Local day of week (formatting) | e | 2, 3, 4, ..., 1 | |\n * | | eo | 2nd, 3rd, ..., 1st | 7 |\n * | | ee | 02, 03, ..., 01 | |\n * | | eee | Mon, Tue, Wed, ..., Sun | |\n * | | eeee | Monday, Tuesday, ..., Sunday | 2 |\n * | | eeeee | M, T, W, T, F, S, S | |\n * | | eeeeee | Mo, Tu, We, Th, Fr, Sa, Su | |\n * | Local day of week (stand-alone) | c | 2, 3, 4, ..., 1 | |\n * | | co | 2nd, 3rd, ..., 1st | 7 |\n * | | cc | 02, 03, ..., 01 | |\n * | | ccc | Mon, Tue, Wed, ..., Sun | |\n * | | cccc | Monday, Tuesday, ..., Sunday | 2 |\n * | | ccccc | M, T, W, T, F, S, S | |\n * | | cccccc | Mo, Tu, We, Th, Fr, Sa, Su | |\n * | AM, PM | a..aa | AM, PM | |\n * | | aaa | am, pm | |\n * | | aaaa | a.m., p.m. | 2 |\n * | | aaaaa | a, p | |\n * | AM, PM, noon, midnight | b..bb | AM, PM, noon, midnight | |\n * | | bbb | am, pm, noon, midnight | |\n * | | bbbb | a.m., p.m., noon, midnight | 2 |\n * | | bbbbb | a, p, n, mi | |\n * | Flexible day period | B..BBB | at night, in the morning, ... | |\n * | | BBBB | at night, in the morning, ... | 2 |\n * | | BBBBB | at night, in the morning, ... | |\n * | Hour [1-12] | h | 1, 2, ..., 11, 12 | |\n * | | ho | 1st, 2nd, ..., 11th, 12th | 7 |\n * | | hh | 01, 02, ..., 11, 12 | |\n * | Hour [0-23] | H | 0, 1, 2, ..., 23 | |\n * | | Ho | 0th, 1st, 2nd, ..., 23rd | 7 |\n * | | HH | 00, 01, 02, ..., 23 | |\n * | Hour [0-11] | K | 1, 2, ..., 11, 0 | |\n * | | Ko | 1st, 2nd, ..., 11th, 0th | 7 |\n * | | KK | 01, 02, ..., 11, 00 | |\n * | Hour [1-24] | k | 24, 1, 2, ..., 23 | |\n * | | ko | 24th, 1st, 2nd, ..., 23rd | 7 |\n * | | kk | 24, 01, 02, ..., 23 | |\n * | Minute | m | 0, 1, ..., 59 | |\n * | | mo | 0th, 1st, ..., 59th | 7 |\n * | | mm | 00, 01, ..., 59 | |\n * | Second | s | 0, 1, ..., 59 | |\n * | | so | 0th, 1st, ..., 59th | 7 |\n * | | ss | 00, 01, ..., 59 | |\n * | Fraction of second | S | 0, 1, ..., 9 | |\n * | | SS | 00, 01, ..., 99 | |\n * | | SSS | 000, 001, ..., 999 | |\n * | | SSSS | ... | 3 |\n * | Timezone (ISO-8601 w/ Z) | X | -08, +0530, Z | |\n * | | XX | -0800, +0530, Z | |\n * | | XXX | -08:00, +05:30, Z | |\n * | | XXXX | -0800, +0530, Z, +123456 | 2 |\n * | | XXXXX | -08:00, +05:30, Z, +12:34:56 | |\n * | Timezone (ISO-8601 w/o Z) | x | -08, +0530, +00 | |\n * | | xx | -0800, +0530, +0000 | |\n * | | xxx | -08:00, +05:30, +00:00 | 2 |\n * | | xxxx | -0800, +0530, +0000, +123456 | |\n * | | xxxxx | -08:00, +05:30, +00:00, +12:34:56 | |\n * | Timezone (GMT) | O...OOO | GMT-8, GMT+5:30, GMT+0 | |\n * | | OOOO | GMT-08:00, GMT+05:30, GMT+00:00 | 2 |\n * | Timezone (specific non-locat.) | z...zzz | GMT-8, GMT+5:30, GMT+0 | 6 |\n * | | zzzz | GMT-08:00, GMT+05:30, GMT+00:00 | 2,6 |\n * | Seconds timestamp | t | 512969520 | 7 |\n * | | tt | ... | 3,7 |\n * | Milliseconds timestamp | T | 512969520900 | 7 |\n * | | TT | ... | 3,7 |\n * | Long localized date | P | 04/29/1453 | 7 |\n * | | PP | Apr 29, 1453 | 7 |\n * | | PPP | April 29th, 1453 | 7 |\n * | | PPPP | Friday, April 29th, 1453 | 2,7 |\n * | Long localized time | p | 12:00 AM | 7 |\n * | | pp | 12:00:00 AM | 7 |\n * | | ppp | 12:00:00 AM GMT+2 | 7 |\n * | | pppp | 12:00:00 AM GMT+02:00 | 2,7 |\n * | Combination of date and time | Pp | 04/29/1453, 12:00 AM | 7 |\n * | | PPpp | Apr 29, 1453, 12:00:00 AM | 7 |\n * | | PPPppp | April 29th, 1453 at ... | 7 |\n * | | PPPPpppp| Friday, April 29th, 1453 at ... | 2,7 |\n * Notes:\n * 1. \"Formatting\" units (e.g. formatting quarter) in the default en-US locale\n * are the same as \"stand-alone\" units, but are different in some languages.\n * \"Formatting\" units are declined according to the rules of the language\n * in the context of a date. \"Stand-alone\" units are always nominative singular:\n *\n * `format(new Date(2017, 10, 6), 'do LLLL', {locale: cs}) //=> '6. listopad'`\n *\n * `format(new Date(2017, 10, 6), 'do MMMM', {locale: cs}) //=> '6. listopadu'`\n *\n * 2. Any sequence of the identical letters is a pattern, unless it is escaped by\n * the single quote characters (see below).\n * If the sequence is longer than listed in table (e.g. `EEEEEEEEEEE`)\n * the output will be the same as default pattern for this unit, usually\n * the longest one (in case of ISO weekdays, `EEEE`). Default patterns for units\n * are marked with \"2\" in the last column of the table.\n *\n * `format(new Date(2017, 10, 6), 'MMM') //=> 'Nov'`\n *\n * `format(new Date(2017, 10, 6), 'MMMM') //=> 'November'`\n *\n * `format(new Date(2017, 10, 6), 'MMMMM') //=> 'N'`\n *\n * `format(new Date(2017, 10, 6), 'MMMMMM') //=> 'November'`\n *\n * `format(new Date(2017, 10, 6), 'MMMMMMM') //=> 'November'`\n *\n * 3. Some patterns could be unlimited length (such as `yyyyyyyy`).\n * The output will be padded with zeros to match the length of the pattern.\n *\n * `format(new Date(2017, 10, 6), 'yyyyyyyy') //=> '00002017'`\n *\n * 4. `QQQQQ` and `qqqqq` could be not strictly numerical in some locales.\n * These tokens represent the shortest form of the quarter.\n *\n * 5. The main difference between `y` and `u` patterns are B.C. years:\n *\n * | Year | `y` | `u` |\n * |------|-----|-----|\n * | AC 1 | 1 | 1 |\n * | BC 1 | 1 | 0 |\n * | BC 2 | 2 | -1 |\n *\n * Also `yy` always returns the last two digits of a year,\n * while `uu` pads single digit years to 2 characters and returns other years unchanged:\n *\n * | Year | `yy` | `uu` |\n * |------|------|------|\n * | 1 | 01 | 01 |\n * | 14 | 14 | 14 |\n * | 376 | 76 | 376 |\n * | 1453 | 53 | 1453 |\n *\n * The same difference is true for local and ISO week-numbering years (`Y` and `R`),\n * except local week-numbering years are dependent on `options.weekStartsOn`\n * and `options.firstWeekContainsDate` (compare [getISOWeekYear]{@link https://date-fns.org/docs/getISOWeekYear}\n * and [getWeekYear]{@link https://date-fns.org/docs/getWeekYear}).\n *\n * 6. Specific non-location timezones are currently unavailable in `date-fns`,\n * so right now these tokens fall back to GMT timezones.\n *\n * 7. These patterns are not in the Unicode Technical Standard #35:\n * - `i`: ISO day of week\n * - `I`: ISO week of year\n * - `R`: ISO week-numbering year\n * - `t`: seconds timestamp\n * - `T`: milliseconds timestamp\n * - `o`: ordinal number modifier\n * - `P`: long localized date\n * - `p`: long localized time\n *\n * 8. `YY` and `YYYY` tokens represent week-numbering years but they are often confused with years.\n * You should enable `options.useAdditionalWeekYearTokens` to use them. See: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\n *\n * 9. `D` and `DD` tokens represent days of the year but they are often confused with days of the month.\n * You should enable `options.useAdditionalDayOfYearTokens` to use them. See: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\n *\n * @param {Date|Number} date - the original date\n * @param {String} format - the string of tokens\n * @param {Object} [options] - an object with options.\n * @param {Locale} [options.locale=defaultLocale] - the locale object. See [Locale]{@link https://date-fns.org/docs/Locale}\n * @param {0|1|2|3|4|5|6} [options.weekStartsOn=0] - the index of the first day of the week (0 - Sunday)\n * @param {Number} [options.firstWeekContainsDate=1] - the day of January, which is\n * @param {Boolean} [options.useAdditionalWeekYearTokens=false] - if true, allows usage of the week-numbering year tokens `YY` and `YYYY`;\n * see: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\n * @param {Boolean} [options.useAdditionalDayOfYearTokens=false] - if true, allows usage of the day of year tokens `D` and `DD`;\n * see: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\n * @returns {String} the formatted date string\n * @throws {TypeError} 2 arguments required\n * @throws {RangeError} `date` must not be Invalid Date\n * @throws {RangeError} `options.locale` must contain `localize` property\n * @throws {RangeError} `options.locale` must contain `formatLong` property\n * @throws {RangeError} `options.weekStartsOn` must be between 0 and 6\n * @throws {RangeError} `options.firstWeekContainsDate` must be between 1 and 7\n * @throws {RangeError} use `yyyy` instead of `YYYY` for formatting years using [format provided] to the input [input provided]; see: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\n * @throws {RangeError} use `yy` instead of `YY` for formatting years using [format provided] to the input [input provided]; see: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\n * @throws {RangeError} use `d` instead of `D` for formatting days of the month using [format provided] to the input [input provided]; see: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\n * @throws {RangeError} use `dd` instead of `DD` for formatting days of the month using [format provided] to the input [input provided]; see: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\n * @throws {RangeError} format string contains an unescaped latin alphabet character\n *\n * @example\n * // Represent 11 February 2014 in middle-endian format:\n * const result = format(new Date(2014, 1, 11), 'MM/dd/yyyy')\n * //=> '02/11/2014'\n *\n * @example\n * // Represent 2 July 2014 in Esperanto:\n * import { eoLocale } from 'date-fns/locale/eo'\n * const result = format(new Date(2014, 6, 2), \"do 'de' MMMM yyyy\", {\n * locale: eoLocale\n * })\n * //=> '2-a de julio 2014'\n *\n * @example\n * // Escape string by single quote characters:\n * const result = format(new Date(2014, 6, 2, 15), \"h 'o''clock'\")\n * //=> \"3 o'clock\"\n */\n\nexport default function format(dirtyDate, dirtyFormatStr, options) {\n var _ref, _options$locale, _ref2, _ref3, _ref4, _options$firstWeekCon, _options$locale2, _options$locale2$opti, _defaultOptions$local, _defaultOptions$local2, _ref5, _ref6, _ref7, _options$weekStartsOn, _options$locale3, _options$locale3$opti, _defaultOptions$local3, _defaultOptions$local4;\n requiredArgs(2, arguments);\n var formatStr = String(dirtyFormatStr);\n var defaultOptions = getDefaultOptions();\n var locale = (_ref = (_options$locale = options === null || options === void 0 ? void 0 : options.locale) !== null && _options$locale !== void 0 ? _options$locale : defaultOptions.locale) !== null && _ref !== void 0 ? _ref : defaultLocale;\n var firstWeekContainsDate = toInteger((_ref2 = (_ref3 = (_ref4 = (_options$firstWeekCon = options === null || options === void 0 ? void 0 : options.firstWeekContainsDate) !== null && _options$firstWeekCon !== void 0 ? _options$firstWeekCon : options === null || options === void 0 ? void 0 : (_options$locale2 = options.locale) === null || _options$locale2 === void 0 ? void 0 : (_options$locale2$opti = _options$locale2.options) === null || _options$locale2$opti === void 0 ? void 0 : _options$locale2$opti.firstWeekContainsDate) !== null && _ref4 !== void 0 ? _ref4 : defaultOptions.firstWeekContainsDate) !== null && _ref3 !== void 0 ? _ref3 : (_defaultOptions$local = defaultOptions.locale) === null || _defaultOptions$local === void 0 ? void 0 : (_defaultOptions$local2 = _defaultOptions$local.options) === null || _defaultOptions$local2 === void 0 ? void 0 : _defaultOptions$local2.firstWeekContainsDate) !== null && _ref2 !== void 0 ? _ref2 : 1);\n\n // Test if weekStartsOn is between 1 and 7 _and_ is not NaN\n if (!(firstWeekContainsDate >= 1 && firstWeekContainsDate <= 7)) {\n throw new RangeError('firstWeekContainsDate must be between 1 and 7 inclusively');\n }\n var weekStartsOn = toInteger((_ref5 = (_ref6 = (_ref7 = (_options$weekStartsOn = options === null || options === void 0 ? void 0 : options.weekStartsOn) !== null && _options$weekStartsOn !== void 0 ? _options$weekStartsOn : options === null || options === void 0 ? void 0 : (_options$locale3 = options.locale) === null || _options$locale3 === void 0 ? void 0 : (_options$locale3$opti = _options$locale3.options) === null || _options$locale3$opti === void 0 ? void 0 : _options$locale3$opti.weekStartsOn) !== null && _ref7 !== void 0 ? _ref7 : defaultOptions.weekStartsOn) !== null && _ref6 !== void 0 ? _ref6 : (_defaultOptions$local3 = defaultOptions.locale) === null || _defaultOptions$local3 === void 0 ? void 0 : (_defaultOptions$local4 = _defaultOptions$local3.options) === null || _defaultOptions$local4 === void 0 ? void 0 : _defaultOptions$local4.weekStartsOn) !== null && _ref5 !== void 0 ? _ref5 : 0);\n\n // Test if weekStartsOn is between 0 and 6 _and_ is not NaN\n if (!(weekStartsOn >= 0 && weekStartsOn <= 6)) {\n throw new RangeError('weekStartsOn must be between 0 and 6 inclusively');\n }\n if (!locale.localize) {\n throw new RangeError('locale must contain localize property');\n }\n if (!locale.formatLong) {\n throw new RangeError('locale must contain formatLong property');\n }\n var originalDate = toDate(dirtyDate);\n if (!isValid(originalDate)) {\n throw new RangeError('Invalid time value');\n }\n\n // Convert the date in system timezone to the same date in UTC+00:00 timezone.\n // This ensures that when UTC functions will be implemented, locales will be compatible with them.\n // See an issue about UTC functions: https://github.com/date-fns/date-fns/issues/376\n var timezoneOffset = getTimezoneOffsetInMilliseconds(originalDate);\n var utcDate = subMilliseconds(originalDate, timezoneOffset);\n var formatterOptions = {\n firstWeekContainsDate: firstWeekContainsDate,\n weekStartsOn: weekStartsOn,\n locale: locale,\n _originalDate: originalDate\n };\n var result = formatStr.match(longFormattingTokensRegExp).map(function (substring) {\n var firstCharacter = substring[0];\n if (firstCharacter === 'p' || firstCharacter === 'P') {\n var longFormatter = longFormatters[firstCharacter];\n return longFormatter(substring, locale.formatLong);\n }\n return substring;\n }).join('').match(formattingTokensRegExp).map(function (substring) {\n // Replace two single quote characters with one single quote character\n if (substring === \"''\") {\n return \"'\";\n }\n var firstCharacter = substring[0];\n if (firstCharacter === \"'\") {\n return cleanEscapedString(substring);\n }\n var formatter = formatters[firstCharacter];\n if (formatter) {\n if (!(options !== null && options !== void 0 && options.useAdditionalWeekYearTokens) && isProtectedWeekYearToken(substring)) {\n throwProtectedError(substring, dirtyFormatStr, String(dirtyDate));\n }\n if (!(options !== null && options !== void 0 && options.useAdditionalDayOfYearTokens) && isProtectedDayOfYearToken(substring)) {\n throwProtectedError(substring, dirtyFormatStr, String(dirtyDate));\n }\n return formatter(utcDate, substring, locale.localize, formatterOptions);\n }\n if (firstCharacter.match(unescapedLatinCharacterRegExp)) {\n throw new RangeError('Format string contains an unescaped latin alphabet character `' + firstCharacter + '`');\n }\n return substring;\n }).join('');\n return result;\n}\nfunction cleanEscapedString(input) {\n var matched = input.match(escapedStringRegExp);\n if (!matched) {\n return input;\n }\n return matched[1].replace(doubleQuoteRegExp, \"'\");\n}", "import { getDefaultOptions } from \"../_lib/defaultOptions/index.js\";\nimport differenceInCalendarDays from \"../differenceInCalendarDays/index.js\";\nimport format from \"../format/index.js\";\nimport defaultLocale from \"../_lib/defaultLocale/index.js\";\nimport subMilliseconds from \"../subMilliseconds/index.js\";\nimport toDate from \"../toDate/index.js\";\nimport getTimezoneOffsetInMilliseconds from \"../_lib/getTimezoneOffsetInMilliseconds/index.js\";\nimport requiredArgs from \"../_lib/requiredArgs/index.js\";\nimport toInteger from \"../_lib/toInteger/index.js\";\n/**\n * @name formatRelative\n * @category Common Helpers\n * @summary Represent the date in words relative to the given base date.\n *\n * @description\n * Represent the date in words relative to the given base date.\n *\n * | Distance to the base date | Result |\n * |---------------------------|---------------------------|\n * | Previous 6 days | last Sunday at 04:30 AM |\n * | Last day | yesterday at 04:30 AM |\n * | Same day | today at 04:30 AM |\n * | Next day | tomorrow at 04:30 AM |\n * | Next 6 days | Sunday at 04:30 AM |\n * | Other | 12/31/2017 |\n *\n * @param {Date|Number} date - the date to format\n * @param {Date|Number} baseDate - the date to compare with\n * @param {Object} [options] - an object with options.\n * @param {Locale} [options.locale=defaultLocale] - the locale object. See [Locale]{@link https://date-fns.org/docs/Locale}\n * @param {0|1|2|3|4|5|6} [options.weekStartsOn=0] - the index of the first day of the week (0 - Sunday)\n * @returns {String} the date in words\n * @throws {TypeError} 2 arguments required\n * @throws {RangeError} `date` must not be Invalid Date\n * @throws {RangeError} `baseDate` must not be Invalid Date\n * @throws {RangeError} `options.weekStartsOn` must be between 0 and 6\n * @throws {RangeError} `options.locale` must contain `localize` property\n * @throws {RangeError} `options.locale` must contain `formatLong` property\n * @throws {RangeError} `options.locale` must contain `formatRelative` property\n *\n * @example\n * // Represent the date of 6 days ago in words relative to the given base date. In this example, today is Wednesday\n * const result = formatRelative(addDays(new Date(), -6), new Date())\n * //=> \"last Thursday at 12:45 AM\"\n */\nexport default function formatRelative(dirtyDate, dirtyBaseDate, options) {\n var _ref, _options$locale, _ref2, _ref3, _ref4, _options$weekStartsOn, _options$locale2, _options$locale2$opti, _defaultOptions$local, _defaultOptions$local2;\n requiredArgs(2, arguments);\n var date = toDate(dirtyDate);\n var baseDate = toDate(dirtyBaseDate);\n var defaultOptions = getDefaultOptions();\n var locale = (_ref = (_options$locale = options === null || options === void 0 ? void 0 : options.locale) !== null && _options$locale !== void 0 ? _options$locale : defaultOptions.locale) !== null && _ref !== void 0 ? _ref : defaultLocale;\n var weekStartsOn = toInteger((_ref2 = (_ref3 = (_ref4 = (_options$weekStartsOn = options === null || options === void 0 ? void 0 : options.weekStartsOn) !== null && _options$weekStartsOn !== void 0 ? _options$weekStartsOn : options === null || options === void 0 ? void 0 : (_options$locale2 = options.locale) === null || _options$locale2 === void 0 ? void 0 : (_options$locale2$opti = _options$locale2.options) === null || _options$locale2$opti === void 0 ? void 0 : _options$locale2$opti.weekStartsOn) !== null && _ref4 !== void 0 ? _ref4 : defaultOptions.weekStartsOn) !== null && _ref3 !== void 0 ? _ref3 : (_defaultOptions$local = defaultOptions.locale) === null || _defaultOptions$local === void 0 ? void 0 : (_defaultOptions$local2 = _defaultOptions$local.options) === null || _defaultOptions$local2 === void 0 ? void 0 : _defaultOptions$local2.weekStartsOn) !== null && _ref2 !== void 0 ? _ref2 : 0);\n if (!locale.localize) {\n throw new RangeError('locale must contain localize property');\n }\n if (!locale.formatLong) {\n throw new RangeError('locale must contain formatLong property');\n }\n if (!locale.formatRelative) {\n throw new RangeError('locale must contain formatRelative property');\n }\n var diff = differenceInCalendarDays(date, baseDate);\n if (isNaN(diff)) {\n throw new RangeError('Invalid time value');\n }\n var token;\n if (diff < -6) {\n token = 'other';\n } else if (diff < -1) {\n token = 'lastWeek';\n } else if (diff < 0) {\n token = 'yesterday';\n } else if (diff < 1) {\n token = 'today';\n } else if (diff < 2) {\n token = 'tomorrow';\n } else if (diff < 7) {\n token = 'nextWeek';\n } else {\n token = 'other';\n }\n var utcDate = subMilliseconds(date, getTimezoneOffsetInMilliseconds(date));\n var utcBaseDate = subMilliseconds(baseDate, getTimezoneOffsetInMilliseconds(baseDate));\n var formatStr = locale.formatRelative(token, utcDate, utcBaseDate, {\n locale: locale,\n weekStartsOn: weekStartsOn\n });\n return format(date, formatStr, {\n locale: locale,\n weekStartsOn: weekStartsOn\n });\n}", "import { millisecondsInHour, millisecondsInMinute } from \"../constants/index.js\";\nimport requiredArgs from \"../_lib/requiredArgs/index.js\";\nimport toInteger from \"../_lib/toInteger/index.js\";\n/**\n * @name parseISO\n * @category Common Helpers\n * @summary Parse ISO string\n *\n * @description\n * Parse the given string in ISO 8601 format and return an instance of Date.\n *\n * Function accepts complete ISO 8601 formats as well as partial implementations.\n * ISO 8601: http://en.wikipedia.org/wiki/ISO_8601\n *\n * If the argument isn't a string, the function cannot parse the string or\n * the values are invalid, it returns Invalid Date.\n *\n * @param {String} argument - the value to convert\n * @param {Object} [options] - an object with options.\n * @param {0|1|2} [options.additionalDigits=2] - the additional number of digits in the extended year format\n * @returns {Date} the parsed date in the local time zone\n * @throws {TypeError} 1 argument required\n * @throws {RangeError} `options.additionalDigits` must be 0, 1 or 2\n *\n * @example\n * // Convert string '2014-02-11T11:30:30' to date:\n * const result = parseISO('2014-02-11T11:30:30')\n * //=> Tue Feb 11 2014 11:30:30\n *\n * @example\n * // Convert string '+02014101' to date,\n * // if the additional number of digits in the extended year format is 1:\n * const result = parseISO('+02014101', { additionalDigits: 1 })\n * //=> Fri Apr 11 2014 00:00:00\n */\nexport default function parseISO(argument, options) {\n var _options$additionalDi;\n requiredArgs(1, arguments);\n var additionalDigits = toInteger((_options$additionalDi = options === null || options === void 0 ? void 0 : options.additionalDigits) !== null && _options$additionalDi !== void 0 ? _options$additionalDi : 2);\n if (additionalDigits !== 2 && additionalDigits !== 1 && additionalDigits !== 0) {\n throw new RangeError('additionalDigits must be 0, 1 or 2');\n }\n if (!(typeof argument === 'string' || Object.prototype.toString.call(argument) === '[object String]')) {\n return new Date(NaN);\n }\n var dateStrings = splitDateString(argument);\n var date;\n if (dateStrings.date) {\n var parseYearResult = parseYear(dateStrings.date, additionalDigits);\n date = parseDate(parseYearResult.restDateString, parseYearResult.year);\n }\n if (!date || isNaN(date.getTime())) {\n return new Date(NaN);\n }\n var timestamp = date.getTime();\n var time = 0;\n var offset;\n if (dateStrings.time) {\n time = parseTime(dateStrings.time);\n if (isNaN(time)) {\n return new Date(NaN);\n }\n }\n if (dateStrings.timezone) {\n offset = parseTimezone(dateStrings.timezone);\n if (isNaN(offset)) {\n return new Date(NaN);\n }\n } else {\n var dirtyDate = new Date(timestamp + time);\n // js parsed string assuming it's in UTC timezone\n // but we need it to be parsed in our timezone\n // so we use utc values to build date in our timezone.\n // Year values from 0 to 99 map to the years 1900 to 1999\n // so set year explicitly with setFullYear.\n var result = new Date(0);\n result.setFullYear(dirtyDate.getUTCFullYear(), dirtyDate.getUTCMonth(), dirtyDate.getUTCDate());\n result.setHours(dirtyDate.getUTCHours(), dirtyDate.getUTCMinutes(), dirtyDate.getUTCSeconds(), dirtyDate.getUTCMilliseconds());\n return result;\n }\n return new Date(timestamp + time + offset);\n}\nvar patterns = {\n dateTimeDelimiter: /[T ]/,\n timeZoneDelimiter: /[Z ]/i,\n timezone: /([Z+-].*)$/\n};\nvar dateRegex = /^-?(?:(\\d{3})|(\\d{2})(?:-?(\\d{2}))?|W(\\d{2})(?:-?(\\d{1}))?|)$/;\nvar timeRegex = /^(\\d{2}(?:[.,]\\d*)?)(?::?(\\d{2}(?:[.,]\\d*)?))?(?::?(\\d{2}(?:[.,]\\d*)?))?$/;\nvar timezoneRegex = /^([+-])(\\d{2})(?::?(\\d{2}))?$/;\nfunction splitDateString(dateString) {\n var dateStrings = {};\n var array = dateString.split(patterns.dateTimeDelimiter);\n var timeString;\n\n // The regex match should only return at maximum two array elements.\n // [date], [time], or [date, time].\n if (array.length > 2) {\n return dateStrings;\n }\n if (/:/.test(array[0])) {\n timeString = array[0];\n } else {\n dateStrings.date = array[0];\n timeString = array[1];\n if (patterns.timeZoneDelimiter.test(dateStrings.date)) {\n dateStrings.date = dateString.split(patterns.timeZoneDelimiter)[0];\n timeString = dateString.substr(dateStrings.date.length, dateString.length);\n }\n }\n if (timeString) {\n var token = patterns.timezone.exec(timeString);\n if (token) {\n dateStrings.time = timeString.replace(token[1], '');\n dateStrings.timezone = token[1];\n } else {\n dateStrings.time = timeString;\n }\n }\n return dateStrings;\n}\nfunction parseYear(dateString, additionalDigits) {\n var regex = new RegExp('^(?:(\\\\d{4}|[+-]\\\\d{' + (4 + additionalDigits) + '})|(\\\\d{2}|[+-]\\\\d{' + (2 + additionalDigits) + '})$)');\n var captures = dateString.match(regex);\n // Invalid ISO-formatted year\n if (!captures) return {\n year: NaN,\n restDateString: ''\n };\n var year = captures[1] ? parseInt(captures[1]) : null;\n var century = captures[2] ? parseInt(captures[2]) : null;\n\n // either year or century is null, not both\n return {\n year: century === null ? year : century * 100,\n restDateString: dateString.slice((captures[1] || captures[2]).length)\n };\n}\nfunction parseDate(dateString, year) {\n // Invalid ISO-formatted year\n if (year === null) return new Date(NaN);\n var captures = dateString.match(dateRegex);\n // Invalid ISO-formatted string\n if (!captures) return new Date(NaN);\n var isWeekDate = !!captures[4];\n var dayOfYear = parseDateUnit(captures[1]);\n var month = parseDateUnit(captures[2]) - 1;\n var day = parseDateUnit(captures[3]);\n var week = parseDateUnit(captures[4]);\n var dayOfWeek = parseDateUnit(captures[5]) - 1;\n if (isWeekDate) {\n if (!validateWeekDate(year, week, dayOfWeek)) {\n return new Date(NaN);\n }\n return dayOfISOWeekYear(year, week, dayOfWeek);\n } else {\n var date = new Date(0);\n if (!validateDate(year, month, day) || !validateDayOfYearDate(year, dayOfYear)) {\n return new Date(NaN);\n }\n date.setUTCFullYear(year, month, Math.max(dayOfYear, day));\n return date;\n }\n}\nfunction parseDateUnit(value) {\n return value ? parseInt(value) : 1;\n}\nfunction parseTime(timeString) {\n var captures = timeString.match(timeRegex);\n if (!captures) return NaN; // Invalid ISO-formatted time\n\n var hours = parseTimeUnit(captures[1]);\n var minutes = parseTimeUnit(captures[2]);\n var seconds = parseTimeUnit(captures[3]);\n if (!validateTime(hours, minutes, seconds)) {\n return NaN;\n }\n return hours * millisecondsInHour + minutes * millisecondsInMinute + seconds * 1000;\n}\nfunction parseTimeUnit(value) {\n return value && parseFloat(value.replace(',', '.')) || 0;\n}\nfunction parseTimezone(timezoneString) {\n if (timezoneString === 'Z') return 0;\n var captures = timezoneString.match(timezoneRegex);\n if (!captures) return 0;\n var sign = captures[1] === '+' ? -1 : 1;\n var hours = parseInt(captures[2]);\n var minutes = captures[3] && parseInt(captures[3]) || 0;\n if (!validateTimezone(hours, minutes)) {\n return NaN;\n }\n return sign * (hours * millisecondsInHour + minutes * millisecondsInMinute);\n}\nfunction dayOfISOWeekYear(isoWeekYear, week, day) {\n var date = new Date(0);\n date.setUTCFullYear(isoWeekYear, 0, 4);\n var fourthOfJanuaryDay = date.getUTCDay() || 7;\n var diff = (week - 1) * 7 + day + 1 - fourthOfJanuaryDay;\n date.setUTCDate(date.getUTCDate() + diff);\n return date;\n}\n\n// Validation functions\n\n// February is null to handle the leap year (using ||)\nvar daysInMonths = [31, null, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31];\nfunction isLeapYearIndex(year) {\n return year % 400 === 0 || year % 4 === 0 && year % 100 !== 0;\n}\nfunction validateDate(year, month, date) {\n return month >= 0 && month <= 11 && date >= 1 && date <= (daysInMonths[month] || (isLeapYearIndex(year) ? 29 : 28));\n}\nfunction validateDayOfYearDate(year, dayOfYear) {\n return dayOfYear >= 1 && dayOfYear <= (isLeapYearIndex(year) ? 366 : 365);\n}\nfunction validateWeekDate(_year, week, day) {\n return week >= 1 && week <= 53 && day >= 0 && day <= 6;\n}\nfunction validateTime(hours, minutes, seconds) {\n if (hours === 24) {\n return minutes === 0 && seconds === 0;\n }\n return seconds >= 0 && seconds < 60 && minutes >= 0 && minutes < 60 && hours >= 0 && hours < 25;\n}\nfunction validateTimezone(_hours, minutes) {\n return minutes >= 0 && minutes <= 59;\n}", "var formatDistanceLocale = {\n lessThanXSeconds: {\n one: 'menos de un segundo',\n other: 'menos de {{count}} segundos'\n },\n xSeconds: {\n one: '1 segundo',\n other: '{{count}} segundos'\n },\n halfAMinute: 'medio minuto',\n lessThanXMinutes: {\n one: 'menos de un minuto',\n other: 'menos de {{count}} minutos'\n },\n xMinutes: {\n one: '1 minuto',\n other: '{{count}} minutos'\n },\n aboutXHours: {\n one: 'alrededor de 1 hora',\n other: 'alrededor de {{count}} horas'\n },\n xHours: {\n one: '1 hora',\n other: '{{count}} horas'\n },\n xDays: {\n one: '1 d\u00EDa',\n other: '{{count}} d\u00EDas'\n },\n aboutXWeeks: {\n one: 'alrededor de 1 semana',\n other: 'alrededor de {{count}} semanas'\n },\n xWeeks: {\n one: '1 semana',\n other: '{{count}} semanas'\n },\n aboutXMonths: {\n one: 'alrededor de 1 mes',\n other: 'alrededor de {{count}} meses'\n },\n xMonths: {\n one: '1 mes',\n other: '{{count}} meses'\n },\n aboutXYears: {\n one: 'alrededor de 1 a\u00F1o',\n other: 'alrededor de {{count}} a\u00F1os'\n },\n xYears: {\n one: '1 a\u00F1o',\n other: '{{count}} a\u00F1os'\n },\n overXYears: {\n one: 'm\u00E1s de 1 a\u00F1o',\n other: 'm\u00E1s de {{count}} a\u00F1os'\n },\n almostXYears: {\n one: 'casi 1 a\u00F1o',\n other: 'casi {{count}} a\u00F1os'\n }\n};\nvar formatDistance = function formatDistance(token, count, options) {\n var result;\n var tokenValue = formatDistanceLocale[token];\n if (typeof tokenValue === 'string') {\n result = tokenValue;\n } else if (count === 1) {\n result = tokenValue.one;\n } else {\n result = tokenValue.other.replace('{{count}}', count.toString());\n }\n if (options !== null && options !== void 0 && options.addSuffix) {\n if (options.comparison && options.comparison > 0) {\n return 'en ' + result;\n } else {\n return 'hace ' + result;\n }\n }\n return result;\n};\nexport default formatDistance;", "import buildFormatLongFn from \"../../../_lib/buildFormatLongFn/index.js\";\nvar dateFormats = {\n full: \"EEEE, d 'de' MMMM 'de' y\",\n long: \"d 'de' MMMM 'de' y\",\n medium: 'd MMM y',\n short: 'dd/MM/y'\n};\nvar timeFormats = {\n full: 'HH:mm:ss zzzz',\n long: 'HH:mm:ss z',\n medium: 'HH:mm:ss',\n short: 'HH:mm'\n};\nvar dateTimeFormats = {\n full: \"{{date}} 'a las' {{time}}\",\n long: \"{{date}} 'a las' {{time}}\",\n medium: '{{date}}, {{time}}',\n short: '{{date}}, {{time}}'\n};\nvar formatLong = {\n date: buildFormatLongFn({\n formats: dateFormats,\n defaultWidth: 'full'\n }),\n time: buildFormatLongFn({\n formats: timeFormats,\n defaultWidth: 'full'\n }),\n dateTime: buildFormatLongFn({\n formats: dateTimeFormats,\n defaultWidth: 'full'\n })\n};\nexport default formatLong;", "var formatRelativeLocale = {\n lastWeek: \"'el' eeee 'pasado a la' p\",\n yesterday: \"'ayer a la' p\",\n today: \"'hoy a la' p\",\n tomorrow: \"'ma\u00F1ana a la' p\",\n nextWeek: \"eeee 'a la' p\",\n other: 'P'\n};\nvar formatRelativeLocalePlural = {\n lastWeek: \"'el' eeee 'pasado a las' p\",\n yesterday: \"'ayer a las' p\",\n today: \"'hoy a las' p\",\n tomorrow: \"'ma\u00F1ana a las' p\",\n nextWeek: \"eeee 'a las' p\",\n other: 'P'\n};\nvar formatRelative = function formatRelative(token, date, _baseDate, _options) {\n if (date.getUTCHours() !== 1) {\n return formatRelativeLocalePlural[token];\n } else {\n return formatRelativeLocale[token];\n }\n};\nexport default formatRelative;", "import buildLocalizeFn from \"../../../_lib/buildLocalizeFn/index.js\";\nvar eraValues = {\n narrow: ['AC', 'DC'],\n abbreviated: ['AC', 'DC'],\n wide: ['antes de cristo', 'despu\u00E9s de cristo']\n};\nvar quarterValues = {\n narrow: ['1', '2', '3', '4'],\n abbreviated: ['T1', 'T2', 'T3', 'T4'],\n wide: ['1\u00BA trimestre', '2\u00BA trimestre', '3\u00BA trimestre', '4\u00BA trimestre']\n};\nvar monthValues = {\n narrow: ['e', 'f', 'm', 'a', 'm', 'j', 'j', 'a', 's', 'o', 'n', 'd'],\n abbreviated: ['ene', 'feb', 'mar', 'abr', 'may', 'jun', 'jul', 'ago', 'sep', 'oct', 'nov', 'dic'],\n wide: ['enero', 'febrero', 'marzo', 'abril', 'mayo', 'junio', 'julio', 'agosto', 'septiembre', 'octubre', 'noviembre', 'diciembre']\n};\nvar dayValues = {\n narrow: ['d', 'l', 'm', 'm', 'j', 'v', 's'],\n short: ['do', 'lu', 'ma', 'mi', 'ju', 'vi', 's\u00E1'],\n abbreviated: ['dom', 'lun', 'mar', 'mi\u00E9', 'jue', 'vie', 's\u00E1b'],\n wide: ['domingo', 'lunes', 'martes', 'mi\u00E9rcoles', 'jueves', 'viernes', 's\u00E1bado']\n};\nvar dayPeriodValues = {\n narrow: {\n am: 'a',\n pm: 'p',\n midnight: 'mn',\n noon: 'md',\n morning: 'ma\u00F1ana',\n afternoon: 'tarde',\n evening: 'tarde',\n night: 'noche'\n },\n abbreviated: {\n am: 'AM',\n pm: 'PM',\n midnight: 'medianoche',\n noon: 'mediodia',\n morning: 'ma\u00F1ana',\n afternoon: 'tarde',\n evening: 'tarde',\n night: 'noche'\n },\n wide: {\n am: 'a.m.',\n pm: 'p.m.',\n midnight: 'medianoche',\n noon: 'mediodia',\n morning: 'ma\u00F1ana',\n afternoon: 'tarde',\n evening: 'tarde',\n night: 'noche'\n }\n};\nvar formattingDayPeriodValues = {\n narrow: {\n am: 'a',\n pm: 'p',\n midnight: 'mn',\n noon: 'md',\n morning: 'de la ma\u00F1ana',\n afternoon: 'de la tarde',\n evening: 'de la tarde',\n night: 'de la noche'\n },\n abbreviated: {\n am: 'AM',\n pm: 'PM',\n midnight: 'medianoche',\n noon: 'mediodia',\n morning: 'de la ma\u00F1ana',\n afternoon: 'de la tarde',\n evening: 'de la tarde',\n night: 'de la noche'\n },\n wide: {\n am: 'a.m.',\n pm: 'p.m.',\n midnight: 'medianoche',\n noon: 'mediodia',\n morning: 'de la ma\u00F1ana',\n afternoon: 'de la tarde',\n evening: 'de la tarde',\n night: 'de la noche'\n }\n};\nvar ordinalNumber = function ordinalNumber(dirtyNumber, _options) {\n var number = Number(dirtyNumber);\n return number + '\u00BA';\n};\nvar localize = {\n ordinalNumber: ordinalNumber,\n era: buildLocalizeFn({\n values: eraValues,\n defaultWidth: 'wide'\n }),\n quarter: buildLocalizeFn({\n values: quarterValues,\n defaultWidth: 'wide',\n argumentCallback: function argumentCallback(quarter) {\n return Number(quarter) - 1;\n }\n }),\n month: buildLocalizeFn({\n values: monthValues,\n defaultWidth: 'wide'\n }),\n day: buildLocalizeFn({\n values: dayValues,\n defaultWidth: 'wide'\n }),\n dayPeriod: buildLocalizeFn({\n values: dayPeriodValues,\n defaultWidth: 'wide',\n formattingValues: formattingDayPeriodValues,\n defaultFormattingWidth: 'wide'\n })\n};\nexport default localize;", "import buildMatchPatternFn from \"../../../_lib/buildMatchPatternFn/index.js\";\nimport buildMatchFn from \"../../../_lib/buildMatchFn/index.js\";\nvar matchOrdinalNumberPattern = /^(\\d+)(\u00BA)?/i;\nvar parseOrdinalNumberPattern = /\\d+/i;\nvar matchEraPatterns = {\n narrow: /^(ac|dc|a|d)/i,\n abbreviated: /^(a\\.?\\s?c\\.?|a\\.?\\s?e\\.?\\s?c\\.?|d\\.?\\s?c\\.?|e\\.?\\s?c\\.?)/i,\n wide: /^(antes de cristo|antes de la era com[u\u00FA]n|despu[e\u00E9]s de cristo|era com[u\u00FA]n)/i\n};\nvar parseEraPatterns = {\n any: [/^ac/i, /^dc/i],\n wide: [/^(antes de cristo|antes de la era com[u\u00FA]n)/i, /^(despu[e\u00E9]s de cristo|era com[u\u00FA]n)/i]\n};\nvar matchQuarterPatterns = {\n narrow: /^[1234]/i,\n abbreviated: /^T[1234]/i,\n wide: /^[1234](\u00BA)? trimestre/i\n};\nvar parseQuarterPatterns = {\n any: [/1/i, /2/i, /3/i, /4/i]\n};\nvar matchMonthPatterns = {\n narrow: /^[efmajsond]/i,\n abbreviated: /^(ene|feb|mar|abr|may|jun|jul|ago|sep|oct|nov|dic)/i,\n wide: /^(enero|febrero|marzo|abril|mayo|junio|julio|agosto|septiembre|octubre|noviembre|diciembre)/i\n};\nvar parseMonthPatterns = {\n narrow: [/^e/i, /^f/i, /^m/i, /^a/i, /^m/i, /^j/i, /^j/i, /^a/i, /^s/i, /^o/i, /^n/i, /^d/i],\n any: [/^en/i, /^feb/i, /^mar/i, /^abr/i, /^may/i, /^jun/i, /^jul/i, /^ago/i, /^sep/i, /^oct/i, /^nov/i, /^dic/i]\n};\nvar matchDayPatterns = {\n narrow: /^[dlmjvs]/i,\n short: /^(do|lu|ma|mi|ju|vi|s[\u00E1a])/i,\n abbreviated: /^(dom|lun|mar|mi[\u00E9e]|jue|vie|s[\u00E1a]b)/i,\n wide: /^(domingo|lunes|martes|mi[\u00E9e]rcoles|jueves|viernes|s[\u00E1a]bado)/i\n};\nvar parseDayPatterns = {\n narrow: [/^d/i, /^l/i, /^m/i, /^m/i, /^j/i, /^v/i, /^s/i],\n any: [/^do/i, /^lu/i, /^ma/i, /^mi/i, /^ju/i, /^vi/i, /^sa/i]\n};\nvar matchDayPeriodPatterns = {\n narrow: /^(a|p|mn|md|(de la|a las) (ma\u00F1ana|tarde|noche))/i,\n any: /^([ap]\\.?\\s?m\\.?|medianoche|mediodia|(de la|a las) (ma\u00F1ana|tarde|noche))/i\n};\nvar parseDayPeriodPatterns = {\n any: {\n am: /^a/i,\n pm: /^p/i,\n midnight: /^mn/i,\n noon: /^md/i,\n morning: /ma\u00F1ana/i,\n afternoon: /tarde/i,\n evening: /tarde/i,\n night: /noche/i\n }\n};\nvar match = {\n ordinalNumber: buildMatchPatternFn({\n matchPattern: matchOrdinalNumberPattern,\n parsePattern: parseOrdinalNumberPattern,\n valueCallback: function valueCallback(value) {\n return parseInt(value, 10);\n }\n }),\n era: buildMatchFn({\n matchPatterns: matchEraPatterns,\n defaultMatchWidth: 'wide',\n parsePatterns: parseEraPatterns,\n defaultParseWidth: 'any'\n }),\n quarter: buildMatchFn({\n matchPatterns: matchQuarterPatterns,\n defaultMatchWidth: 'wide',\n parsePatterns: parseQuarterPatterns,\n defaultParseWidth: 'any',\n valueCallback: function valueCallback(index) {\n return index + 1;\n }\n }),\n month: buildMatchFn({\n matchPatterns: matchMonthPatterns,\n defaultMatchWidth: 'wide',\n parsePatterns: parseMonthPatterns,\n defaultParseWidth: 'any'\n }),\n day: buildMatchFn({\n matchPatterns: matchDayPatterns,\n defaultMatchWidth: 'wide',\n parsePatterns: parseDayPatterns,\n defaultParseWidth: 'any'\n }),\n dayPeriod: buildMatchFn({\n matchPatterns: matchDayPeriodPatterns,\n defaultMatchWidth: 'any',\n parsePatterns: parseDayPeriodPatterns,\n defaultParseWidth: 'any'\n })\n};\nexport default match;", "import formatDistance from \"./_lib/formatDistance/index.js\";\nimport formatLong from \"./_lib/formatLong/index.js\";\nimport formatRelative from \"./_lib/formatRelative/index.js\";\nimport localize from \"./_lib/localize/index.js\";\nimport match from \"./_lib/match/index.js\";\n/**\n * @type {Locale}\n * @category Locales\n * @summary Spanish locale.\n * @language Spanish\n * @iso-639-2 spa\n * @author Juan Angosto [@juanangosto]{@link https://github.com/juanangosto}\n * @author Guillermo Grau [@guigrpa]{@link https://github.com/guigrpa}\n * @author Fernando Ag\u00FCero [@fjaguero]{@link https://github.com/fjaguero}\n * @author Gast\u00F3n Haro [@harogaston]{@link https://github.com/harogaston}\n * @author Yago Carballo [@YagoCarballo]{@link https://github.com/YagoCarballo}\n */\nvar locale = {\n code: 'es',\n formatDistance: formatDistance,\n formatLong: formatLong,\n formatRelative: formatRelative,\n localize: localize,\n match: match,\n options: {\n weekStartsOn: 1 /* Monday */,\n firstWeekContainsDate: 1\n }\n};\nexport default locale;", "/**\n * ClientResponseError is a custom Error class that is intended to wrap\n * and normalize any error thrown by `Client.send()`.\n */\nexport class ClientResponseError extends Error {\n url: string = '';\n status: number = 0;\n response: {[key: string]: any} = {};\n isAbort: boolean = false;\n originalError: any = null;\n\n constructor(errData?: any) {\n super(\"ClientResponseError\");\n\n // Set the prototype explicitly.\n // https://github.com/Microsoft/TypeScript-wiki/blob/main/Breaking-Changes.md#extending-built-ins-like-error-array-and-map-may-no-longer-work\n Object.setPrototypeOf(this, ClientResponseError.prototype);\n\n if (errData !== null && typeof errData === 'object') {\n this.url = typeof errData.url === 'string' ? errData.url : '';\n this.status = typeof errData.status === 'number' ? errData.status : 0;\n this.isAbort = !!errData.isAbort;\n this.originalError = errData.originalError;\n\n if (errData.response !== null && typeof errData.response === 'object') {\n this.response = errData.response;\n } else if (errData.data !== null && typeof errData.data === 'object') {\n this.response = errData.data;\n } else {\n this.response = {};\n }\n }\n\n if (!this.originalError && !(errData instanceof ClientResponseError)) {\n this.originalError = errData;\n }\n\n if (typeof DOMException !== 'undefined' && errData instanceof DOMException) {\n this.isAbort = true;\n }\n\n this.name = \"ClientResponseError \" + this.status;\n this.message = this.response?.message;\n if (!this.message) {\n if (this.isAbort) {\n this.message = 'The request was autocancelled. You can find more info in https://github.com/pocketbase/js-sdk#auto-cancellation.';\n } else if (this.originalError?.cause?.message?.includes(\"ECONNREFUSED ::1\")) {\n this.message = 'Failed to connect to the PocketBase server. Try changing the SDK URL from localhost to 127.0.0.1 (https://github.com/pocketbase/js-sdk/issues/21).';\n } else {\n this.message = 'Something went wrong while processing your request.';\n }\n }\n }\n\n /**\n * Alias for `this.response` to preserve the backward compatibility.\n */\n get data() {\n return this.response;\n }\n\n /**\n * Make a POJO's copy of the current error class instance.\n * @see https://github.com/vuex-orm/vuex-orm/issues/255\n */\n toJSON() {\n return { ...this };\n }\n}\n", "/**\n * -------------------------------------------------------------------\n * Simple cookie parse and serialize utilities mostly based on the\n * node module https://github.com/jshttp/cookie.\n * -------------------------------------------------------------------\n */\n\n/**\n * RegExp to match field-content in RFC 7230 sec 3.2\n *\n * field-content = field-vchar [ 1*( SP / HTAB ) field-vchar ]\n * field-vchar = VCHAR / obs-text\n * obs-text = %x80-FF\n */\nconst fieldContentRegExp = /^[\\u0009\\u0020-\\u007e\\u0080-\\u00ff]+$/;\n\nexport interface ParseOptions{\n decode?: (val: string) => string,\n}\n\n/**\n* Parses the given cookie header string into an object\n* The object has the various cookies as keys(names) => values\n*/\nexport function cookieParse(str: string, options?: ParseOptions): { [key: string]: any } {\n const result: { [key: string]: any } = {};\n\n if (typeof str !== 'string') {\n return result;\n }\n\n const opt = Object.assign({}, options || {});\n const decode = opt.decode || defaultDecode;\n\n let index = 0;\n while (index < str.length) {\n const eqIdx = str.indexOf('=', index);\n\n // no more cookie pairs\n if (eqIdx === -1) {\n break;\n }\n\n let endIdx = str.indexOf(';', index);\n\n if (endIdx === -1) {\n endIdx = str.length;\n } else if (endIdx < eqIdx) {\n // backtrack on prior semicolon\n index = str.lastIndexOf(';', eqIdx - 1) + 1;\n continue;\n }\n\n const key = str.slice(index, eqIdx).trim();\n\n // only assign once\n if (undefined === result[key]) {\n let val = str.slice(eqIdx + 1, endIdx).trim();\n\n // quoted values\n if (val.charCodeAt(0) === 0x22) {\n val = val.slice(1, -1);\n }\n\n try {\n result[key] = decode(val);\n } catch (_) {\n result[key] = val; // no decoding\n }\n }\n\n index = endIdx + 1;\n }\n\n return result;\n};\n\nexport interface SerializeOptions {\n encode?: (val: string | number | boolean) => string,\n maxAge?: number,\n domain?: string,\n path?: string,\n expires?: Date,\n httpOnly?: boolean,\n secure?: boolean,\n priority?: string,\n sameSite?: boolean|string,\n}\n\n/**\n * Serialize data into a cookie header.\n *\n * Serialize the a name value pair into a cookie string suitable for\n * http headers. An optional options object specified cookie parameters.\n *\n * ```js\n * cookieSerialize('foo', 'bar', { httpOnly: true }) // \"foo=bar; httpOnly\"\n * ```\n */\nexport function cookieSerialize(name: string, val: string, options?: SerializeOptions): string {\n const opt = Object.assign({}, options || {});\n const encode = opt.encode || defaultEncode;\n\n if (!fieldContentRegExp.test(name)) {\n throw new TypeError('argument name is invalid');\n }\n\n const value = encode(val);\n\n if (value && !fieldContentRegExp.test(value)) {\n throw new TypeError('argument val is invalid');\n }\n\n let result = name + '=' + value;\n\n if (opt.maxAge != null) {\n const maxAge = opt.maxAge - 0;\n\n if (isNaN(maxAge) || !isFinite(maxAge)) {\n throw new TypeError('option maxAge is invalid');\n }\n\n result += '; Max-Age=' + Math.floor(maxAge);\n }\n\n if (opt.domain) {\n if (!fieldContentRegExp.test(opt.domain)) {\n throw new TypeError('option domain is invalid');\n }\n\n result += '; Domain=' + opt.domain;\n }\n\n if (opt.path) {\n if (!fieldContentRegExp.test(opt.path)) {\n throw new TypeError('option path is invalid');\n }\n\n result += '; Path=' + opt.path;\n }\n\n if (opt.expires) {\n if (!isDate(opt.expires) || isNaN(opt.expires.valueOf())) {\n throw new TypeError('option expires is invalid');\n }\n\n result += '; Expires=' + opt.expires.toUTCString();\n }\n\n if (opt.httpOnly) {\n result += '; HttpOnly';\n }\n\n if (opt.secure) {\n result += '; Secure';\n }\n\n if (opt.priority) {\n const priority = typeof opt.priority === 'string' ? opt.priority.toLowerCase() : opt.priority;\n\n switch (priority) {\n case 'low':\n result += '; Priority=Low';\n break;\n case 'medium':\n result += '; Priority=Medium';\n break;\n case 'high':\n result += '; Priority=High';\n break;\n default:\n throw new TypeError('option priority is invalid');\n }\n }\n\n if (opt.sameSite) {\n const sameSite = typeof opt.sameSite === 'string' ? opt.sameSite.toLowerCase() : opt.sameSite;\n\n switch (sameSite) {\n case true:\n result += '; SameSite=Strict';\n break;\n case 'lax':\n result += '; SameSite=Lax';\n break;\n case 'strict':\n result += '; SameSite=Strict';\n break;\n case 'none':\n result += '; SameSite=None';\n break;\n default:\n throw new TypeError('option sameSite is invalid');\n }\n }\n\n return result;\n};\n\n/**\n * Default URL-decode string value function.\n * Optimized to skip native call when no `%`.\n */\nfunction defaultDecode(val: string): string {\n return val.indexOf('%') !== -1\n ? decodeURIComponent(val)\n : val;\n}\n\n/**\n * Default URL-encode value function.\n */\nfunction defaultEncode(val: string | number | boolean): string {\n return encodeURIComponent(val);\n}\n\n/**\n * Determines if value is a Date.\n */\nfunction isDate(val: any): boolean {\n return (\n Object.prototype.toString.call(val) === '[object Date]' ||\n val instanceof Date\n );\n}\n", "let atobPolyfill: Function;\nif (typeof atob === 'function') {\n atobPolyfill = atob\n} else {\n /**\n * The code was extracted from:\n * https://github.com/davidchambers/Base64.js\n */\n atobPolyfill = (input: any) => {\n const chars = \"ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=\";\n\n let str = String(input).replace(/=+$/, \"\");\n if (str.length % 4 == 1) {\n throw new Error(\"'atob' failed: The string to be decoded is not correctly encoded.\");\n }\n\n for (\n // initialize result and counters\n var bc = 0, bs, buffer, idx = 0, output = \"\";\n // get next character\n (buffer = str.charAt(idx++));\n // character found in table? initialize bit storage and add its ascii value;\n ~buffer &&\n ((bs = bc % 4 ? (bs as any) * 64 + buffer : buffer),\n // and if not first of each 4 characters,\n // convert the first 8 bits to one ascii character\n bc++ % 4) ?\n (output += String.fromCharCode(255 & (bs >> ((-2 * bc) & 6)))) :\n 0\n ) {\n // try to find character in table (0-63, not found => -1)\n buffer = chars.indexOf(buffer);\n }\n\n return output;\n };\n}\n\n/**\n * Returns JWT token's payload data.\n */\nexport function getTokenPayload(token: string): { [key: string]: any } {\n if (token) {\n try {\n const encodedPayload = decodeURIComponent(atobPolyfill(token.split('.')[1]).split('').map(function (c: string) {\n return '%' + ('00' + c.charCodeAt(0).toString(16)).slice(-2);\n }).join(''));\n\n return JSON.parse(encodedPayload) || {};\n } catch (e) {\n }\n }\n\n return {};\n}\n\n/**\n * Checks whether a JWT token is expired or not.\n * Tokens without `exp` payload key are considered valid.\n * Tokens with empty payload (eg. invalid token strings) are considered expired.\n *\n * @param token The token to check.\n * @param [expirationThreshold] Time in seconds that will be subtracted from the token `exp` property.\n */\nexport function isTokenExpired(token: string, expirationThreshold = 0): boolean {\n let payload = getTokenPayload(token);\n\n if (\n Object.keys(payload).length > 0 &&\n (!payload.exp || (payload.exp - expirationThreshold) > (Date.now() / 1000))\n ) {\n return false;\n }\n\n return true;\n}\n", "import { cookieParse, cookieSerialize, SerializeOptions } from '@/stores/utils/cookie';\nimport { isTokenExpired, getTokenPayload } from '@/stores/utils/jwt';\n\nexport type AuthModel = { [key: string]: any }|null;\n\nexport type OnStoreChangeFunc = (token: string, model: AuthModel) => void;\n\nconst defaultCookieKey = 'pb_auth';\n\n/**\n * Base AuthStore class that is intended to be extended by all other\n * PocketBase AuthStore implementations.\n */\nexport abstract class BaseAuthStore {\n protected baseToken: string = '';\n protected baseModel: AuthModel = null;\n\n private _onChangeCallbacks: Array<OnStoreChangeFunc> = [];\n\n /**\n * Retrieves the stored token (if any).\n */\n get token(): string {\n return this.baseToken;\n }\n\n /**\n * Retrieves the stored model data (if any).\n */\n get model(): AuthModel {\n return this.baseModel;\n }\n\n /**\n * Loosely checks if the store has valid token (aka. existing and unexpired exp claim).\n */\n get isValid(): boolean {\n return !isTokenExpired(this.token);\n }\n\n /**\n * Checks whether the current store state is for admin authentication.\n */\n get isAdmin(): boolean {\n return getTokenPayload(this.token).type === \"admin\";\n }\n\n /**\n * Checks whether the current store state is for auth record authentication.\n */\n get isAuthRecord(): boolean {\n return getTokenPayload(this.token).type === \"authRecord\";\n }\n\n /**\n * Saves the provided new token and model data in the auth store.\n */\n save(token: string, model?: AuthModel): void {\n this.baseToken = token || '';\n this.baseModel = model || null;\n\n this.triggerChange();\n }\n\n /**\n * Removes the stored token and model data form the auth store.\n */\n clear(): void {\n this.baseToken = '';\n this.baseModel = null;\n this.triggerChange();\n }\n\n /**\n * Parses the provided cookie string and updates the store state\n * with the cookie's token and model data.\n *\n * NB! This function doesn't validate the token or its data.\n * Usually this isn't a concern if you are interacting only with the\n * PocketBase API because it has the proper server-side security checks in place,\n * but if you are using the store `isValid` state for permission controls\n * in a node server (eg. SSR), then it is recommended to call `authRefresh()`\n * after loading the cookie to ensure an up-to-date token and model state.\n * For example:\n *\n * ```js\n * pb.authStore.loadFromCookie(\"cookie string...\");\n *\n * try {\n * // get an up-to-date auth store state by veryfing and refreshing the loaded auth model (if any)\n * pb.authStore.isValid && await pb.collection('users').authRefresh();\n * } catch (_) {\n * // clear the auth store on failed refresh\n * pb.authStore.clear();\n * }\n * ```\n */\n loadFromCookie(cookie: string, key = defaultCookieKey): void {\n const rawData = cookieParse(cookie || '')[key] || '';\n\n let data: { [key: string]: any } = {};\n try {\n data = JSON.parse(rawData);\n // normalize\n if (typeof data === null || typeof data !== 'object' || Array.isArray(data)) {\n data = {};\n }\n } catch (_) {}\n\n this.save(data.token || '', data.model || null);\n }\n\n /**\n * Exports the current store state as cookie string.\n *\n * By default the following optional attributes are added:\n * - Secure\n * - HttpOnly\n * - SameSite=Strict\n * - Path=/\n * - Expires={the token expiration date}\n *\n * NB! If the generated cookie exceeds 4096 bytes, this method will\n * strip the model data to the bare minimum to try to fit within the\n * recommended size in https://www.rfc-editor.org/rfc/rfc6265#section-6.1.\n */\n exportToCookie(options?: SerializeOptions, key = defaultCookieKey): string {\n const defaultOptions: SerializeOptions = {\n secure: true,\n sameSite: true,\n httpOnly: true,\n path: \"/\",\n };\n\n // extract the token expiration date\n const payload = getTokenPayload(this.token);\n if (payload?.exp) {\n defaultOptions.expires = new Date(payload.exp * 1000);\n } else {\n defaultOptions.expires = new Date('1970-01-01');\n }\n\n // merge with the user defined options\n options = Object.assign({}, defaultOptions, options);\n\n const rawData = {\n token: this.token,\n model: this.model ? JSON.parse(JSON.stringify(this.model)) : null,\n };\n\n let result = cookieSerialize(key, JSON.stringify(rawData), options);\n\n const resultLength = typeof Blob !== 'undefined' ?\n (new Blob([result])).size : result.length;\n\n // strip down the model data to the bare minimum\n if (rawData.model && resultLength > 4096) {\n rawData.model = {id: rawData?.model?.id, email: rawData?.model?.email};\n const extraProps = [\"collectionId\", \"username\", \"verified\"];\n for (const prop in this.model) {\n if (extraProps.includes(prop)) {\n rawData.model[prop] = this.model[prop];\n }\n }\n result = cookieSerialize(key, JSON.stringify(rawData), options);\n }\n\n return result;\n }\n\n /**\n * Register a callback function that will be called on store change.\n *\n * You can set the `fireImmediately` argument to true in order to invoke\n * the provided callback right after registration.\n *\n * Returns a removal function that you could call to \"unsubscribe\" from the changes.\n */\n onChange(callback: OnStoreChangeFunc, fireImmediately = false): () => void {\n this._onChangeCallbacks.push(callback);\n\n if (fireImmediately) {\n callback(this.token, this.model);\n }\n\n return () => {\n for (let i = this._onChangeCallbacks.length - 1; i >= 0; i--) {\n if (this._onChangeCallbacks[i] == callback) {\n delete this._onChangeCallbacks[i]; // removes the function reference\n this._onChangeCallbacks.splice(i, 1); // reindex the array\n return;\n }\n }\n }\n }\n\n protected triggerChange(): void {\n for (const callback of this._onChangeCallbacks) {\n callback && callback(this.token, this.model);\n }\n }\n}\n", "import { BaseAuthStore, AuthModel } from '@/stores/BaseAuthStore';\n\n/**\n * The default token store for browsers with auto fallback\n * to runtime/memory if local storage is undefined (eg. in node env).\n */\nexport class LocalAuthStore extends BaseAuthStore {\n private storageFallback: { [key: string]: any } = {};\n private storageKey: string\n\n constructor(storageKey = \"pocketbase_auth\") {\n super();\n\n this.storageKey = storageKey;\n\n this._bindStorageEvent();\n }\n\n /**\n * @inheritdoc\n */\n get token(): string {\n const data = this._storageGet(this.storageKey) || {};\n\n return data.token || '';\n }\n\n /**\n * @inheritdoc\n */\n get model(): AuthModel {\n const data = this._storageGet(this.storageKey) || {};\n\n return data.model || null;\n }\n\n /**\n * @inheritdoc\n */\n save(token: string, model?: AuthModel) {\n this._storageSet(this.storageKey, {\n 'token': token,\n 'model': model,\n });\n\n super.save(token, model);\n }\n\n /**\n * @inheritdoc\n */\n clear() {\n this._storageRemove(this.storageKey);\n\n super.clear();\n }\n\n // ---------------------------------------------------------------\n // Internal helpers:\n // ---------------------------------------------------------------\n\n /**\n * Retrieves `key` from the browser's local storage\n * (or runtime/memory if local storage is undefined).\n */\n private _storageGet(key: string): any {\n if (typeof window !== 'undefined' && window?.localStorage) {\n const rawValue = window.localStorage.getItem(key) || '';\n try {\n return JSON.parse(rawValue);\n } catch (e) { // not a json\n return rawValue;\n }\n }\n\n // fallback\n return this.storageFallback[key];\n }\n\n /**\n * Stores a new data in the browser's local storage\n * (or runtime/memory if local storage is undefined).\n */\n private _storageSet(key: string, value: any) {\n if (typeof window !== 'undefined' && window?.localStorage) {\n // store in local storage\n let normalizedVal = value;\n if (typeof value !== 'string') {\n normalizedVal = JSON.stringify(value);\n }\n window.localStorage.setItem(key, normalizedVal);\n } else {\n // store in fallback\n this.storageFallback[key] = value;\n }\n }\n\n /**\n * Removes `key` from the browser's local storage and the runtime/memory.\n */\n private _storageRemove(key: string) {\n // delete from local storage\n if (typeof window !== 'undefined' && window?.localStorage) {\n window.localStorage?.removeItem(key);\n }\n\n // delete from fallback\n delete this.storageFallback[key];\n }\n\n /**\n * Updates the current store state on localStorage change.\n */\n private _bindStorageEvent() {\n if (typeof window === 'undefined' || !window?.localStorage || !window.addEventListener) {\n return;\n }\n\n window.addEventListener('storage', (e) => {\n if (e.key != this.storageKey) {\n return;\n }\n\n const data = this._storageGet(this.storageKey) || {};\n\n super.save(data.token || '', data.model || null);\n });\n }\n}\n", "import Client from '@/Client';\n\n/**\n * BaseService class that should be inherited from all API services.\n */\nexport abstract class BaseService {\n readonly client: Client\n\n constructor(client: Client) {\n this.client = client;\n }\n}\n", "import { BaseService } from '@/services/utils/BaseService';\nimport { CommonOptions } from '@/services/utils/options';\n\ninterface appleClientSecret {\n secret: string;\n}\n\nexport class SettingsService extends BaseService {\n /**\n * Fetch all available app settings.\n */\n getAll(options?: CommonOptions): Promise<{[key: string]:any}> {\n options = Object.assign({\n 'method': 'GET',\n }, options);\n\n return this.client.send('/api/settings', options);\n }\n\n /**\n * Bulk updates app settings.\n */\n update(\n bodyParams?: {[key:string]:any}|FormData,\n options?: CommonOptions,\n ): Promise<{[key: string]:any}> {\n options = Object.assign({\n 'method': 'PATCH',\n 'body': bodyParams,\n }, options);\n\n return this.client.send('/api/settings', options);\n }\n\n /**\n * Performs a S3 filesystem connection test.\n *\n * The currently supported `filesystem` are \"storage\" and \"backups\".\n */\n testS3(filesystem: string = \"storage\", options?: CommonOptions): Promise<boolean> {\n options = Object.assign({\n 'method': 'POST',\n 'body': {\n 'filesystem': filesystem,\n },\n }, options);\n\n return this.client.send('/api/settings/test/s3', options)\n .then(() => true);\n }\n\n /**\n * Sends a test email.\n *\n * The possible `emailTemplate` values are:\n * - verification\n * - password-reset\n * - email-change\n */\n testEmail(toEmail: string, emailTemplate: string, options?: CommonOptions): Promise<boolean> {\n options = Object.assign({\n 'method': 'POST',\n 'body': {\n 'email': toEmail,\n 'template': emailTemplate,\n },\n }, options);\n\n return this.client.send('/api/settings/test/email', options)\n .then(() => true);\n }\n\n /**\n * Generates a new Apple OAuth2 client secret.\n */\n generateAppleClientSecret(\n clientId: string,\n teamId: string,\n keyId: string,\n privateKey: string,\n duration: number,\n options?: CommonOptions,\n ): Promise<appleClientSecret> {\n options = Object.assign({\n 'method': 'POST',\n 'body': {\n clientId,\n teamId,\n keyId,\n privateKey,\n duration,\n },\n }, options);\n\n return this.client.send('/api/settings/apple/generate-client-secret', options);\n }\n}\n", "import { BaseService } from '@/services/utils/BaseService';\nimport { ClientResponseError } from '@/ClientResponseError';\nimport { ListResult } from '@/services/utils/dtos';\nimport {\n CommonOptions,\n ListOptions,\n FullListOptions\n} from '@/services/utils/options';\n\nexport abstract class CrudService<M> extends BaseService {\n /**\n * Base path for the crud actions (without trailing slash, eg. '/admins').\n */\n abstract get baseCrudPath(): string\n\n /**\n * Response data decoder.\n */\n decode<T = M>(data: { [key: string]: any }): T {\n return data as T;\n }\n\n /**\n * Returns a promise with all list items batch fetched at once\n * (by default 500 items per request; to change it set the `batch` query param).\n *\n * You can use the generic T to supply a wrapper type of the crud model.\n */\n getFullList<T = M>(options?: FullListOptions): Promise<Array<T>>\n\n /**\n * Legacy version of getFullList with explicitly specified batch size.\n */\n getFullList<T = M>(batch?: number, options?: ListOptions): Promise<Array<T>>\n\n getFullList<T = M>(batchOrqueryParams?: number|FullListOptions, options?: ListOptions): Promise<Array<T>> {\n if (typeof batchOrqueryParams == \"number\") {\n return this._getFullList<T>(batchOrqueryParams, options);\n }\n\n options = Object.assign({}, batchOrqueryParams, options);\n\n let batch = 500;\n if (options.batch) {\n batch = options.batch;\n delete options.batch;\n }\n\n return this._getFullList<T>(batch, options);\n }\n\n /**\n * Returns paginated items list.\n *\n * You can use the generic T to supply a wrapper type of the crud model.\n */\n getList<T = M>(page = 1, perPage = 30, options?: ListOptions): Promise<ListResult<T>> {\n options = Object.assign({\n method: 'GET'\n }, options);\n\n options.query = Object.assign({\n 'page': page,\n 'perPage': perPage,\n }, options.query);\n\n return this.client.send(this.baseCrudPath, options)\n .then((responseData: any) => {\n responseData.items = responseData.items?.map((item: any) => {\n return this.decode<T>(item);\n }) || [];\n\n return responseData;\n });\n }\n\n /**\n * Returns the first found item by the specified filter.\n *\n * Internally it calls `getList(1, 1, { filter, skipTotal })` and\n * returns the first found item.\n *\n * You can use the generic T to supply a wrapper type of the crud model.\n *\n * For consistency with `getOne`, this method will throw a 404\n * ClientResponseError if no item was found.\n */\n getFirstListItem<T = M>(filter: string, options?: CommonOptions): Promise<T> {\n options = Object.assign({\n 'requestKey': 'one_by_filter_' + this.baseCrudPath + \"_\" + filter,\n }, options);\n\n options.query = Object.assign({\n 'filter': filter,\n 'skipTotal': 1,\n }, options.query);\n\n return this.getList<T>(1, 1, options)\n .then((result) => {\n if (!result?.items?.length) {\n throw new ClientResponseError({\n status: 404,\n data: {\n code: 404,\n message: \"The requested resource wasn't found.\",\n data: {},\n },\n });\n }\n\n return result.items[0];\n });\n }\n\n /**\n * Returns single item by its id.\n *\n * You can use the generic T to supply a wrapper type of the crud model.\n */\n getOne<T = M>(id: string, options?: CommonOptions): Promise<T> {\n options = Object.assign({\n 'method': 'GET',\n }, options);\n\n return this.client.send(this.baseCrudPath + '/' + encodeURIComponent(id), options)\n .then((responseData: any) => this.decode<T>(responseData));\n }\n\n /**\n * Creates a new item.\n *\n * You can use the generic T to supply a wrapper type of the crud model.\n */\n create<T = M>(\n bodyParams?: {[key:string]:any}|FormData,\n options?: CommonOptions,\n ): Promise<T> {\n options = Object.assign({\n 'method': 'POST',\n 'body': bodyParams,\n }, options);\n\n return this.client.send(this.baseCrudPath, options)\n .then((responseData: any) => this.decode<T>(responseData));\n }\n\n /**\n * Updates an existing item by its id.\n *\n * You can use the generic T to supply a wrapper type of the crud model.\n */\n update<T = M>(\n id: string,\n bodyParams?: {[key:string]:any}|FormData,\n options?: CommonOptions,\n ): Promise<T> {\n options = Object.assign({\n 'method': 'PATCH',\n 'body': bodyParams,\n }, options);\n\n return this.client.send(this.baseCrudPath + '/' + encodeURIComponent(id), options)\n .then((responseData: any) => this.decode<T>(responseData));\n }\n\n /**\n * Deletes an existing item by its id.\n */\n delete(id: string, options?: CommonOptions): Promise<boolean> {\n options = Object.assign({\n 'method': 'DELETE',\n }, options);\n\n return this.client.send(this.baseCrudPath + '/' + encodeURIComponent(id), options)\n .then(() => true);\n }\n\n /**\n * Returns a promise with all list items batch fetched at once.\n */\n protected _getFullList<T = M>(batchSize = 500, options?: ListOptions): Promise<Array<T>> {\n options = options || {};\n options.query = Object.assign({\n 'skipTotal': 1,\n }, options.query);\n\n let result: Array<T> = [];\n\n let request = async (page: number): Promise<Array<any>> => {\n return this.getList(page, batchSize || 500, options).then((list) => {\n const castedList = (list as any as ListResult<T>);\n const items = castedList.items;\n\n result = result.concat(items);\n\n if (items.length == list.perPage) {\n return request(page + 1);\n }\n\n return result;\n });\n }\n\n return request(1);\n }\n}\n", "import { SendOptions } from '@/services/utils/options';\n\nexport function normalizeLegacyOptionsArgs(legacyWarn: string, baseOptions: SendOptions, bodyOrOptions?: any, query?: any): SendOptions {\n const hasBodyOrOptions = typeof bodyOrOptions !== 'undefined';\n const hasQuery = typeof query !== 'undefined';\n\n if (!hasQuery && !hasBodyOrOptions) {\n return baseOptions;\n }\n\n if (hasQuery) {\n console.warn(legacyWarn);\n baseOptions.body = Object.assign({}, baseOptions.body, bodyOrOptions);\n baseOptions.query = Object.assign({}, baseOptions.query, query);\n\n return baseOptions;\n }\n\n return Object.assign(baseOptions, bodyOrOptions);\n}\n", "import Client from '@/Client';\nimport { isTokenExpired } from '@/stores/utils/jwt';\n\n// reset previous auto refresh registrations\nexport function resetAutoRefresh(client: Client) {\n (client as any)._resetAutoRefresh?.();\n}\n\nexport function registerAutoRefresh(\n client: Client,\n threshold: number,\n refreshFunc: () => Promise<any>,\n reauthenticateFunc: () => Promise<any>,\n) {\n resetAutoRefresh(client);\n\n const oldBeforeSend = client.beforeSend;\n const oldModel = client.authStore.model;\n\n // unset the auto refresh in case the auth store was cleared\n // OR a new model was authenticated\n const unsubStoreChange = client.authStore.onChange((newToken, model) => {\n if (\n !newToken ||\n model?.id != oldModel?.id ||\n // check the collection id in case an admin and auth record share the same id\n ((model?.collectionId || oldModel?.collectionId) && model?.collectionId != oldModel?.collectionId)\n ) {\n resetAutoRefresh(client);\n }\n });\n\n // initialize a reset function and attach it dynamically to the client\n (client as any)._resetAutoRefresh = function() {\n unsubStoreChange();\n client.beforeSend = oldBeforeSend;\n delete (client as any)._resetAutoRefresh;\n };\n\n client.beforeSend = async (url, sendOptions) => {\n const oldToken = client.authStore.token;\n\n if (sendOptions.query?.autoRefresh) {\n return oldBeforeSend ? oldBeforeSend(url, sendOptions) : { url, sendOptions };\n }\n\n let isValid = client.authStore.isValid;\n if (\n // is loosely valid\n isValid &&\n // but it is going to expire in the next \"threshold\" seconds\n isTokenExpired(client.authStore.token, threshold)\n ) {\n try {\n await refreshFunc();\n } catch (_) {\n isValid = false;\n }\n }\n\n // still invalid -> reauthenticate\n if (!isValid) {\n await reauthenticateFunc();\n }\n\n // the request wasn't sent with a custom token\n const headers = sendOptions.headers || {};\n for (let key in headers) {\n if (\n key.toLowerCase() == \"authorization\" &&\n // the request wasn't sent with a custom token\n oldToken == headers[key] &&\n client.authStore.token\n ) {\n // set the latest store token\n headers[key] = client.authStore.token;\n break;\n }\n }\n sendOptions.headers = headers;\n\n return oldBeforeSend ? oldBeforeSend(url, sendOptions) : { url, sendOptions };\n }\n}\n", "import { CrudService } from '@/services/utils/CrudService';\nimport { AdminModel } from '@/services/utils/dtos';\nimport { AuthOptions, CommonOptions } from '@/services/utils/options';\nimport { normalizeLegacyOptionsArgs } from '@/services/utils/legacy';\nimport { registerAutoRefresh, resetAutoRefresh } from '@/services/utils/refresh';\n\nexport interface AdminAuthResponse {\n [key: string]: any;\n\n token: string;\n admin: AdminModel;\n}\n\nexport class AdminService extends CrudService<AdminModel> {\n /**\n * @inheritdoc\n */\n get baseCrudPath(): string {\n return '/api/admins';\n }\n\n // ---------------------------------------------------------------\n // Post update/delete AuthStore sync\n // ---------------------------------------------------------------\n\n /**\n * @inheritdoc\n *\n * If the current `client.authStore.model` matches with the updated id, then\n * on success the `client.authStore.model` will be updated with the result.\n */\n update<T = AdminModel>(\n id: string,\n bodyParams?: {[key:string]:any}|FormData,\n options?: CommonOptions,\n ): Promise<T> {\n return super.update(id, bodyParams, options).then((item) => {\n // update the store state if the updated item id matches with the stored model\n if (\n this.client.authStore.model?.id === item.id &&\n typeof this.client.authStore.model?.collectionId === 'undefined' // is not record auth\n ) {\n this.client.authStore.save(this.client.authStore.token, item);\n }\n\n return item as any as T;\n });\n }\n\n /**\n * @inheritdoc\n *\n * If the current `client.authStore.model` matches with the deleted id,\n * then on success the `client.authStore` will be cleared.\n */\n delete(id: string, options?: CommonOptions): Promise<boolean> {\n return super.delete(id, options).then((success) => {\n // clear the store state if the deleted item id matches with the stored model\n if (\n success &&\n this.client.authStore.model?.id === id &&\n typeof this.client.authStore.model?.collectionId === 'undefined' // is not record auth\n ) {\n this.client.authStore.clear();\n }\n\n return success;\n });\n }\n\n // ---------------------------------------------------------------\n // Auth handlers\n // ---------------------------------------------------------------\n\n /**\n * Prepare successful authorize response.\n */\n protected authResponse(responseData: any): AdminAuthResponse {\n const admin = this.decode(responseData?.admin || {});\n\n if (responseData?.token && responseData?.admin) {\n this.client.authStore.save(responseData.token, admin);\n }\n\n return Object.assign({}, responseData, {\n // normalize common fields\n 'token': responseData?.token || '',\n 'admin': admin,\n });\n }\n\n /**\n * Authenticate an admin account with its email and password\n * and returns a new admin token and data.\n *\n * On success this method automatically updates the client's AuthStore data.\n */\n authWithPassword(email: string, password: string, options?: AuthOptions): Promise<AdminAuthResponse>\n\n /**\n * @deprecated\n * Consider using authWithPassword(email, password, options?).\n */\n authWithPassword(email: string, password: string, body?: any, query?: any): Promise<AdminAuthResponse>\n\n async authWithPassword(\n email: string,\n password: string,\n bodyOrOptions?: any,\n query?: any,\n ): Promise<AdminAuthResponse> {\n let options: any = {\n 'method': 'POST',\n 'body': {\n 'identity': email,\n 'password': password,\n },\n };\n\n options = normalizeLegacyOptionsArgs(\n 'This form of authWithPassword(email, pass, body?, query?) is deprecated. Consider replacing it with authWithPassword(email, pass, options?).',\n options,\n bodyOrOptions,\n query\n );\n\n const autoRefreshThreshold = options.autoRefreshThreshold;\n delete options.autoRefreshThreshold;\n\n // not from auto refresh reauthentication\n if (!options.autoRefresh) {\n resetAutoRefresh(this.client);\n }\n\n let authData = await this.client.send(this.baseCrudPath + '/auth-with-password', options);\n\n authData = this.authResponse(authData);\n\n if (autoRefreshThreshold) {\n registerAutoRefresh(\n this.client,\n autoRefreshThreshold,\n () => this.authRefresh({autoRefresh: true}),\n () => this.authWithPassword(email, password, Object.assign({autoRefresh: true}, options)),\n );\n }\n\n return authData;\n }\n\n /**\n * Refreshes the current admin authenticated instance and\n * returns a new token and admin data.\n *\n * On success this method automatically updates the client's AuthStore data.\n */\n authRefresh(options?: CommonOptions): Promise<AdminAuthResponse>\n\n /**\n * @deprecated\n * Consider using authRefresh(options?).\n */\n authRefresh(body?: any, query?: any): Promise<AdminAuthResponse>\n\n authRefresh(bodyOrOptions?: any, query?: any): Promise<AdminAuthResponse> {\n let options: any = {\n 'method': 'POST',\n };\n\n options = normalizeLegacyOptionsArgs(\n 'This form of authRefresh(body?, query?) is deprecated. Consider replacing it with authRefresh(options?).',\n options,\n bodyOrOptions,\n query\n );\n\n return this.client.send(this.baseCrudPath + '/auth-refresh', options)\n .then(this.authResponse.bind(this));\n }\n\n /**\n * Sends admin password reset request.\n */\n requestPasswordReset(email: string, options?: CommonOptions): Promise<boolean>\n\n /**\n * @deprecated\n * Consider using requestPasswordReset(email, options?).\n */\n requestPasswordReset(email: string, body?: any, query?: any): Promise<boolean>\n\n requestPasswordReset(email: string, bodyOrOptions?: any, query?: any): Promise<boolean> {\n let options: any = {\n 'method': 'POST',\n 'body': {\n 'email': email,\n },\n };\n\n options = normalizeLegacyOptionsArgs(\n 'This form of requestPasswordReset(email, body?, query?) is deprecated. Consider replacing it with requestPasswordReset(email, options?).',\n options,\n bodyOrOptions,\n query\n );\n\n return this.client.send(this.baseCrudPath + '/request-password-reset', options)\n .then(() => true);\n }\n\n /**\n * Confirms admin password reset request.\n */\n confirmPasswordReset(resetToken: string, password: string, passwordConfirm: string, options?: CommonOptions): Promise<boolean>\n\n /**\n * @deprecated\n * Consider using confirmPasswordReset(resetToken, password, passwordConfirm, options?).\n */\n confirmPasswordReset(resetToken: string, password: string, passwordConfirm: string, body?: any, query?: any): Promise<boolean>\n\n confirmPasswordReset(resetToken: string, password: string, passwordConfirm: string, bodyOrOptions?: any, query?: any): Promise<boolean>{\n let options: any = {\n 'method': 'POST',\n 'body': {\n 'token': resetToken,\n 'password': password,\n 'passwordConfirm': passwordConfirm,\n },\n };\n\n options = normalizeLegacyOptionsArgs(\n 'This form of confirmPasswordReset(resetToken, password, passwordConfirm, body?, query?) is deprecated. Consider replacing it with confirmPasswordReset(resetToken, password, passwordConfirm, options?).',\n options,\n bodyOrOptions,\n query\n );\n\n return this.client.send(this.baseCrudPath + '/confirm-password-reset', options)\n .then(() => true);\n }\n}\n", "import { BaseService } from '@/services/utils/BaseService';\nimport { ClientResponseError } from '@/ClientResponseError';\n\ninterface promiseCallbacks {\n resolve: Function\n reject: Function\n}\n\nexport type UnsubscribeFunc = () => Promise<void>;\n\nexport class RealtimeService extends BaseService {\n clientId: string = \"\";\n\n private eventSource: EventSource | null = null;\n private subscriptions: { [key: string]: Array<EventListener> } = {};\n private lastSentTopics: Array<string> = [];\n private connectTimeoutId: any;\n private maxConnectTimeout: number = 15000;\n private reconnectTimeoutId: any;\n private reconnectAttempts: number = 0;\n private maxReconnectAttempts: number = Infinity;\n private predefinedReconnectIntervals: Array<number> = [\n 200, 300, 500, 1000, 1200, 1500, 2000,\n ];\n private pendingConnects: Array<promiseCallbacks> = [];\n\n /**\n * Returns whether the realtime connection has been established.\n */\n get isConnected(): boolean {\n return !!this.eventSource && !!this.clientId && !this.pendingConnects.length;\n }\n\n /**\n * Register the subscription listener.\n *\n * You can subscribe multiple times to the same topic.\n *\n * If the SSE connection is not started yet,\n * this method will also initialize it.\n */\n async subscribe(topic: string, callback: (data: any) => void): Promise<UnsubscribeFunc> {\n if (!topic) {\n throw new Error('topic must be set.')\n }\n\n const listener = function (e: Event) {\n const msgEvent = (e as MessageEvent);\n\n let data;\n try {\n data = JSON.parse(msgEvent?.data);\n } catch {}\n\n callback(data || {});\n };\n\n // store the listener\n if (!this.subscriptions[topic]) {\n this.subscriptions[topic] = [];\n }\n this.subscriptions[topic].push(listener);\n\n if (!this.isConnected) {\n // initialize sse connection\n await this.connect();\n } else if (this.subscriptions[topic].length === 1) {\n // send the updated subscriptions (if it is the first for the topic)\n await this.submitSubscriptions();\n } else {\n // only register the listener\n this.eventSource?.addEventListener(topic, listener);\n }\n\n return async (): Promise<void> => {\n return this.unsubscribeByTopicAndListener(topic, listener);\n };\n }\n\n /**\n * Unsubscribe from all subscription listeners with the specified topic.\n *\n * If `topic` is not provided, then this method will unsubscribe\n * from all active subscriptions.\n *\n * This method is no-op if there are no active subscriptions.\n *\n * The related sse connection will be autoclosed if after the\n * unsubscribe operation there are no active subscriptions left.\n */\n async unsubscribe(topic?: string): Promise<void> {\n if (!this.hasSubscriptionListeners(topic)) {\n return; // already unsubscribed\n }\n\n if (!topic) {\n // remove all subscriptions\n this.subscriptions = {};\n } else {\n // remove all topic listeners\n for (let listener of this.subscriptions[topic]) {\n this.eventSource?.removeEventListener(topic, listener);\n }\n delete this.subscriptions[topic];\n }\n\n if (!this.hasSubscriptionListeners()) {\n // no other active subscriptions -> close the sse connection\n this.disconnect();\n } else if (!this.hasSubscriptionListeners(topic)) {\n // submit subscriptions change if there are no other active subscriptions related to the topic\n await this.submitSubscriptions();\n }\n }\n\n /**\n * Unsubscribe from all subscription listeners starting with the specified topic prefix.\n *\n * This method is no-op if there are no active subscriptions with the specified topic prefix.\n *\n * The related sse connection will be autoclosed if after the\n * unsubscribe operation there are no active subscriptions left.\n */\n async unsubscribeByPrefix(topicPrefix: string): Promise<void> {\n let hasAtleastOneTopic = false;\n for (let topic in this.subscriptions) {\n if (!topic.startsWith(topicPrefix)) {\n continue;\n }\n\n hasAtleastOneTopic = true;\n for (let listener of this.subscriptions[topic]) {\n this.eventSource?.removeEventListener(topic, listener);\n }\n delete this.subscriptions[topic];\n }\n\n if (!hasAtleastOneTopic) {\n return; // nothing to unsubscribe from\n }\n\n if (this.hasSubscriptionListeners()) {\n // submit the deleted subscriptions\n await this.submitSubscriptions();\n } else {\n // no other active subscriptions -> close the sse connection\n this.disconnect();\n }\n }\n\n /**\n * Unsubscribe from all subscriptions matching the specified topic and listener function.\n *\n * This method is no-op if there are no active subscription with\n * the specified topic and listener.\n *\n * The related sse connection will be autoclosed if after the\n * unsubscribe operation there are no active subscriptions left.\n */\n async unsubscribeByTopicAndListener(topic: string, listener: EventListener): Promise<void> {\n if (!Array.isArray(this.subscriptions[topic]) || !this.subscriptions[topic].length) {\n return; // already unsubscribed\n }\n\n let exist = false;\n for (let i = this.subscriptions[topic].length - 1; i >= 0; i--) {\n if (this.subscriptions[topic][i] !== listener) {\n continue;\n }\n\n exist = true; // has at least one matching listener\n delete this.subscriptions[topic][i]; // removes the function reference\n this.subscriptions[topic].splice(i, 1); // reindex the array\n this.eventSource?.removeEventListener(topic, listener);\n }\n if (!exist) {\n return;\n }\n\n // remove the topic from the subscriptions list if there are no other listeners\n if (!this.subscriptions[topic].length) {\n delete this.subscriptions[topic];\n }\n\n if (!this.hasSubscriptionListeners()) {\n // no other active subscriptions -> close the sse connection\n this.disconnect();\n } else if (!this.hasSubscriptionListeners(topic)) {\n // submit subscriptions change if there are no other active subscriptions related to the topic\n await this.submitSubscriptions();\n }\n }\n\n private hasSubscriptionListeners(topicToCheck?: string): boolean {\n this.subscriptions = this.subscriptions || {};\n\n // check the specified topic\n if (topicToCheck) {\n return !!this.subscriptions[topicToCheck]?.length;\n }\n\n // check for at least one non-empty topic\n for (let topic in this.subscriptions) {\n if (!!this.subscriptions[topic]?.length) {\n return true\n }\n }\n\n return false;\n }\n\n private async submitSubscriptions(): Promise<void> {\n if (!this.clientId) {\n return; // no client/subscriber\n }\n\n // optimistic update\n this.addAllSubscriptionListeners();\n\n this.lastSentTopics = this.getNonEmptySubscriptionTopics();\n\n return this.client.send('/api/realtime', {\n method: 'POST',\n body: {\n 'clientId': this.clientId,\n 'subscriptions': this.lastSentTopics,\n },\n requestKey: this.getSubscriptionsCancelKey(),\n }).catch((err) => {\n if (err?.isAbort) {\n return; // silently ignore aborted pending requests\n }\n throw err;\n });\n }\n\n private getSubscriptionsCancelKey(): string {\n return \"realtime_\" + this.clientId;\n }\n\n private getNonEmptySubscriptionTopics(): Array<string> {\n const result : Array<string> = [];\n\n for (let topic in this.subscriptions) {\n if (this.subscriptions[topic].length) {\n result.push(topic);\n }\n }\n\n return result;\n }\n\n private addAllSubscriptionListeners(): void {\n if (!this.eventSource) {\n return;\n }\n\n this.removeAllSubscriptionListeners();\n\n for (let topic in this.subscriptions) {\n for (let listener of this.subscriptions[topic]) {\n this.eventSource.addEventListener(topic, listener);\n }\n }\n }\n\n private removeAllSubscriptionListeners(): void {\n if (!this.eventSource) {\n return;\n }\n\n for (let topic in this.subscriptions) {\n for (let listener of this.subscriptions[topic]) {\n this.eventSource.removeEventListener(topic, listener);\n }\n }\n }\n\n private async connect(): Promise<void> {\n if (this.reconnectAttempts > 0) {\n // immediately resolve the promise to avoid indefinitely\n // blocking the client during reconnection\n return;\n }\n\n return new Promise((resolve, reject) => {\n this.pendingConnects.push({ resolve, reject });\n\n if (this.pendingConnects.length > 1) {\n // all promises will be resolved once the connection is established\n return;\n }\n\n this.initConnect();\n })\n }\n\n private initConnect() {\n this.disconnect(true);\n\n // wait up to 15s for connect\n clearTimeout(this.connectTimeoutId);\n this.connectTimeoutId = setTimeout(() => {\n this.connectErrorHandler(new Error(\"EventSource connect took too long.\"));\n }, this.maxConnectTimeout);\n\n this.eventSource = new EventSource(this.client.buildUrl('/api/realtime'))\n\n this.eventSource.onerror = (_) => {\n this.connectErrorHandler(new Error(\"Failed to establish realtime connection.\"));\n };\n\n this.eventSource.addEventListener('PB_CONNECT', (e) => {\n const msgEvent = (e as MessageEvent);\n this.clientId = msgEvent?.lastEventId;\n\n this.submitSubscriptions()\n .then(async () => {\n let retries = 3;\n while (this.hasUnsentSubscriptions() && retries > 0) {\n retries--;\n // resubscribe to ensure that the latest topics are submitted\n //\n // This is needed because missed topics could happen on reconnect\n // if after the pending sent `submitSubscriptions()` call another `subscribe()`\n // was made before the submit was able to complete.\n await this.submitSubscriptions();\n }\n }).then(() => {\n for (let p of this.pendingConnects) {\n p.resolve();\n }\n\n // reset connect meta\n this.pendingConnects = [];\n this.reconnectAttempts = 0;\n clearTimeout(this.reconnectTimeoutId);\n clearTimeout(this.connectTimeoutId);\n }).catch((err) => {\n this.clientId = \"\";\n this.connectErrorHandler(err);\n });\n });\n }\n\n private hasUnsentSubscriptions(): boolean {\n const latestTopics = this.getNonEmptySubscriptionTopics();\n if (latestTopics.length != this.lastSentTopics.length) {\n return true;\n }\n\n for (const t of latestTopics) {\n if (!this.lastSentTopics.includes(t)) {\n return true;\n }\n }\n\n return false;\n }\n\n private connectErrorHandler(err: any) {\n clearTimeout(this.connectTimeoutId);\n clearTimeout(this.reconnectTimeoutId);\n\n if (\n // wasn't previously connected -> direct reject\n (!this.clientId && !this.reconnectAttempts) ||\n // was previously connected but the max reconnection limit has been reached\n this.reconnectAttempts > this.maxReconnectAttempts\n ) {\n for (let p of this.pendingConnects) {\n p.reject(new ClientResponseError(err));\n }\n this.pendingConnects = [];\n this.disconnect();\n return;\n }\n\n // otherwise -> reconnect in the background\n this.disconnect(true);\n const timeout = this.predefinedReconnectIntervals[this.reconnectAttempts] || this.predefinedReconnectIntervals[this.predefinedReconnectIntervals.length - 1];\n this.reconnectAttempts++;\n this.reconnectTimeoutId = setTimeout(() => {\n this.initConnect();\n }, timeout);\n }\n\n private disconnect(fromReconnect = false): void {\n clearTimeout(this.connectTimeoutId);\n clearTimeout(this.reconnectTimeoutId);\n this.removeAllSubscriptionListeners();\n this.client.cancelRequest(this.getSubscriptionsCancelKey());\n this.eventSource?.close();\n this.eventSource = null;\n this.clientId = \"\";\n\n if (!fromReconnect) {\n this.reconnectAttempts = 0;\n\n // resolve any remaining connect promises\n //\n // this is done to avoid unnecessary throwing errors in case\n // unsubscribe is called before the pending connect promises complete\n // (see https://github.com/pocketbase/pocketbase/discussions/2897#discussioncomment-6423818)\n for (let p of this.pendingConnects) {\n p.resolve();\n }\n this.pendingConnects = [];\n }\n }\n}\n", "import Client from '@/Client';\nimport { CrudService } from '@/services/utils/CrudService';\nimport { RealtimeService, UnsubscribeFunc } from '@/services/RealtimeService';\nimport { ClientResponseError } from '@/ClientResponseError';\nimport { ListResult, RecordModel, ExternalAuthModel } from '@/services/utils/dtos';\nimport {\n SendOptions,\n CommonOptions,\n RecordOptions,\n RecordListOptions,\n RecordFullListOptions,\n} from '@/services/utils/options';\nimport { normalizeLegacyOptionsArgs } from '@/services/utils/legacy';\n\nexport interface RecordAuthResponse<T = RecordModel> {\n /**\n * The signed PocketBase auth record.\n */\n record: T;\n\n /**\n * The PocketBase record auth token.\n *\n * If you are looking for the OAuth2 access and refresh tokens\n * they are available under the `meta.accessToken` and `meta.refreshToken` props.\n */\n token: string;\n\n /**\n * Auth meta data usually filled when OAuth2 is used.\n */\n meta?: {[key: string]: any};\n}\n\nexport interface AuthProviderInfo {\n name: string;\n state: string;\n codeVerifier: string;\n codeChallenge: string;\n codeChallengeMethod: string;\n authUrl: string;\n}\n\nexport interface AuthMethodsList {\n usernamePassword: boolean;\n emailPassword: boolean;\n authProviders: Array<AuthProviderInfo>;\n}\n\nexport interface RecordSubscription<T = RecordModel> {\n action: string; // eg. create, update, delete\n record: T;\n}\n\nexport type OAuth2UrlCallback = (url: string) => void|Promise<void>;\n\nexport interface OAuth2AuthConfig extends SendOptions {\n // the name of the OAuth2 provider (eg. \"google\")\n provider: string;\n\n // custom scopes to overwrite the default ones\n scopes?: Array<string>;\n\n // optional record create data\n createData?: {[key: string]: any};\n\n // optional callback that is triggered after the OAuth2 sign-in/sign-up url generation\n urlCallback?: OAuth2UrlCallback;\n\n // optional query params to send with the PocketBase auth request (eg. fields, expand, etc.)\n query?: RecordOptions;\n}\n\nexport class RecordService<M = RecordModel> extends CrudService<M> {\n readonly collectionIdOrName: string;\n\n constructor(client: Client, collectionIdOrName: string) {\n super(client);\n\n this.collectionIdOrName = collectionIdOrName;\n }\n\n /**\n * @inheritdoc\n */\n get baseCrudPath(): string {\n return this.baseCollectionPath + '/records';\n }\n\n /**\n * Returns the current collection service base path.\n */\n get baseCollectionPath(): string {\n return '/api/collections/' + encodeURIComponent(this.collectionIdOrName);\n }\n\n // ---------------------------------------------------------------\n // Realtime handlers\n // ---------------------------------------------------------------\n\n /**\n * @deprecated Use subscribe(recordId, callback) instead.\n *\n * Subscribe to the realtime changes of a single record in the collection.\n */\n async subscribeOne<T = M>(recordId: string, callback: (data: RecordSubscription<T>) => void): Promise<UnsubscribeFunc> {\n console.warn(\"PocketBase: subscribeOne(recordId, callback) is deprecated. Please replace it with subscribe(recordId, callback).\");\n return this.client.realtime.subscribe(this.collectionIdOrName + \"/\" + recordId, callback);\n }\n\n /**\n * @deprecated This form of subscribe is deprecated. Please use `subscribe(\"*\", callback)`.\n */\n async subscribe<T = M>(callback: (data: RecordSubscription<T>) => void): Promise<UnsubscribeFunc>\n\n /**\n * Subscribe to realtime changes to the specified topic (\"*\" or record id).\n *\n * If `topic` is the wildcard \"*\", then this method will subscribe to\n * any record changes in the collection.\n *\n * If `topic` is a record id, then this method will subscribe only\n * to changes of the specified record id.\n *\n * It's OK to subscribe multiple times to the same topic.\n * You can use the returned `UnsubscribeFunc` to remove only a single subscription.\n * Or use `unsubscribe(topic)` if you want to remove all subscriptions attached to the topic.\n */\n async subscribe<T = M>(topic: string, callback: (data: RecordSubscription<T>) => void): Promise<UnsubscribeFunc>\n\n async subscribe<T = M>(\n topicOrCallback: string|((data: RecordSubscription<T>) => void),\n callback?: (data: RecordSubscription<T>) => void\n ): Promise<UnsubscribeFunc> {\n if (typeof topicOrCallback === 'function') {\n console.warn(\"PocketBase: subscribe(callback) is deprecated. Please replace it with subscribe('*', callback).\");\n return this.client.realtime.subscribe(this.collectionIdOrName, topicOrCallback);\n }\n\n if (!callback) {\n throw new Error(\"Missing subscription callback.\");\n }\n\n if (topicOrCallback === \"\") {\n throw new Error(\"Missing topic.\");\n }\n\n let topic = this.collectionIdOrName;\n if (topicOrCallback !== \"*\") {\n topic += ('/' + topicOrCallback);\n }\n\n return this.client.realtime.subscribe(topic, callback)\n }\n\n /**\n * Unsubscribe from all subscriptions of the specified topic\n * (\"*\" or record id).\n *\n * If `topic` is not set, then this method will unsubscribe from\n * all subscriptions associated to the current collection.\n */\n async unsubscribe(topic?: string): Promise<void> {\n // unsubscribe wildcard topic\n if (topic === \"*\") {\n return this.client.realtime.unsubscribe(this.collectionIdOrName);\n }\n\n // unsubscribe recordId topic\n if (topic) {\n return this.client.realtime.unsubscribe(this.collectionIdOrName + \"/\" + topic);\n }\n\n // unsubscribe from everything related to the collection\n return this.client.realtime.unsubscribeByPrefix(this.collectionIdOrName);\n }\n\n // ---------------------------------------------------------------\n // Crud handers\n // ---------------------------------------------------------------\n /**\n * @inheritdoc\n */\n getFullList<T = M>(options?: RecordFullListOptions): Promise<Array<T>>\n\n /**\n * @inheritdoc\n */\n getFullList<T = M>(batch?: number, options?: RecordListOptions): Promise<Array<T>>\n\n /**\n * @inheritdoc\n */\n getFullList<T = M>(batchOrOptions?: number|RecordFullListOptions, options?: RecordListOptions): Promise<Array<T>> {\n if (typeof batchOrOptions == \"number\") {\n return super.getFullList<T>(batchOrOptions, options);\n }\n\n const params = Object.assign({}, batchOrOptions, options);\n\n return super.getFullList<T>(params);\n }\n\n /**\n * @inheritdoc\n */\n getList<T = M>(page = 1, perPage = 30, options?: RecordListOptions): Promise<ListResult<T>> {\n return super.getList<T>(page, perPage, options);\n }\n\n /**\n * @inheritdoc\n */\n getFirstListItem<T = M>(filter: string, options?: RecordListOptions): Promise<T> {\n return super.getFirstListItem<T>(filter, options);\n }\n\n /**\n * @inheritdoc\n */\n getOne<T = M>(id: string, options?: RecordOptions): Promise<T> {\n return super.getOne<T>(id, options);\n }\n\n /**\n * @inheritdoc\n */\n create<T = M>(bodyParams?: {[key:string]:any}|FormData, options?: RecordOptions): Promise<T> {\n return super.create<T>(bodyParams, options);\n }\n\n /**\n * @inheritdoc\n *\n * If the current `client.authStore.model` matches with the updated id, then\n * on success the `client.authStore.model` will be updated with the result.\n */\n update<T = M>(id: string, bodyParams?: {[key:string]:any}|FormData, options?: RecordOptions): Promise<T> {\n return super.update<RecordModel>(id, bodyParams, options).then((item) => {\n if (\n // is record auth\n this.client.authStore.model?.id === item?.id &&\n (\n this.client.authStore.model?.collectionId === this.collectionIdOrName ||\n this.client.authStore.model?.collectionName === this.collectionIdOrName\n )\n ) {\n this.client.authStore.save(this.client.authStore.token, item);\n }\n\n return item as any as T;\n });\n }\n\n /**\n * @inheritdoc\n *\n * If the current `client.authStore.model` matches with the deleted id,\n * then on success the `client.authStore` will be cleared.\n */\n delete(id: string, options?: CommonOptions): Promise<boolean> {\n return super.delete(id, options).then((success) => {\n if (\n success &&\n // is record auth\n this.client.authStore.model?.id === id &&\n (\n this.client.authStore.model?.collectionId === this.collectionIdOrName ||\n this.client.authStore.model?.collectionName === this.collectionIdOrName\n )\n ) {\n this.client.authStore.clear();\n }\n\n return success;\n });\n }\n\n // ---------------------------------------------------------------\n // Auth handlers\n // ---------------------------------------------------------------\n\n /**\n * Prepare successful collection authorization response.\n */\n protected authResponse<T = M>(responseData: any): RecordAuthResponse<T> {\n const record = this.decode(responseData?.record || {});\n\n this.client.authStore.save(responseData?.token, record as any);\n\n return Object.assign({}, responseData, {\n // normalize common fields\n 'token': responseData?.token || '',\n 'record': record as any as T,\n });\n }\n\n /**\n * Returns all available collection auth methods.\n */\n listAuthMethods(options?: CommonOptions): Promise<AuthMethodsList> {\n options = Object.assign({\n 'method': 'GET',\n }, options);\n\n return this.client.send(this.baseCollectionPath + '/auth-methods', options)\n .then((responseData: any) => {\n return Object.assign({}, responseData, {\n // normalize common fields\n 'usernamePassword': !!responseData?.usernamePassword,\n 'emailPassword': !!responseData?.emailPassword,\n 'authProviders': Array.isArray(responseData?.authProviders) ? responseData?.authProviders : [],\n });\n });\n }\n\n /**\n * Authenticate a single auth collection record via its username/email and password.\n *\n * On success, this method also automatically updates\n * the client's AuthStore data and returns:\n * - the authentication token\n * - the authenticated record model\n */\n authWithPassword<T = M>(usernameOrEmail: string, password: string, options?: RecordOptions): Promise<RecordAuthResponse<T>>\n\n /**\n * @deprecated\n * Consider using authWithPassword(usernameOrEmail, password, options?).\n */\n authWithPassword<T = M>(usernameOrEmail: string, password: string, body?: any, query?: any): Promise<RecordAuthResponse<T>>\n\n authWithPassword<T = M>(usernameOrEmail: string, password: string, bodyOrOptions?: any, query?: any): Promise<RecordAuthResponse<T>> {\n let options: any = {\n 'method': 'POST',\n 'body': {\n 'identity': usernameOrEmail,\n 'password': password,\n },\n };\n\n options = normalizeLegacyOptionsArgs(\n 'This form of authWithPassword(usernameOrEmail, pass, body?, query?) is deprecated. Consider replacing it with authWithPassword(usernameOrEmail, pass, options?).',\n options,\n bodyOrOptions,\n query\n );\n\n return this.client.send(this.baseCollectionPath + '/auth-with-password', options)\n .then((data) => this.authResponse<T>(data));\n }\n\n /**\n * Authenticate a single auth collection record with OAuth2 code.\n *\n * If you don't have an OAuth2 code you may also want to check `authWithOAuth2` method.\n *\n * On success, this method also automatically updates\n * the client's AuthStore data and returns:\n * - the authentication token\n * - the authenticated record model\n * - the OAuth2 account data (eg. name, email, avatar, etc.)\n */\n authWithOAuth2Code<T = M>(\n provider: string,\n code: string,\n codeVerifier: string,\n redirectUrl: string,\n createData?: {[key:string]:any},\n options?: RecordOptions,\n ): Promise<RecordAuthResponse<T>>\n\n /**\n * @deprecated\n * Consider using authWithOAuth2Code(provider, code, codeVerifier, redirectUrl, createdData, options?).\n */\n authWithOAuth2Code<T = M>(\n provider: string,\n code: string,\n codeVerifier: string,\n redirectUrl: string,\n createData?: {[key:string]:any},\n body?: any,\n query?: any\n ): Promise<RecordAuthResponse<T>>\n\n authWithOAuth2Code<T = M>(\n provider: string,\n code: string,\n codeVerifier: string,\n redirectUrl: string,\n createData?: {[key:string]:any},\n bodyOrOptions?: any,\n query?: any\n ): Promise<RecordAuthResponse<T>> {\n let options: any = {\n 'method': 'POST',\n 'body': {\n 'provider': provider,\n 'code': code,\n 'codeVerifier': codeVerifier,\n 'redirectUrl': redirectUrl,\n 'createData': createData,\n },\n };\n\n options = normalizeLegacyOptionsArgs(\n 'This form of authWithOAuth2Code(provider, code, codeVerifier, redirectUrl, createData?, body?, query?) is deprecated. Consider replacing it with authWithOAuth2Code(provider, code, codeVerifier, redirectUrl, createData?, options?).',\n options,\n bodyOrOptions,\n query\n );\n\n return this.client.send(this.baseCollectionPath + '/auth-with-oauth2', options)\n .then((data) => this.authResponse<T>(data));\n }\n\n /**\n * @deprecated This form of authWithOAuth2 is deprecated.\n *\n * Please use `authWithOAuth2Code()` OR its simplified realtime version\n * as shown in https://pocketbase.io/docs/authentication/#oauth2-integration.\n */\n async authWithOAuth2<T = M>(\n provider: string,\n code: string,\n codeVerifier: string,\n redirectUrl: string,\n createData?: {[key: string]: any},\n bodyParams?: {[key: string]: any},\n queryParams?: RecordOptions,\n ): Promise<RecordAuthResponse<T>>\n\n /**\n * Authenticate a single auth collection record with OAuth2\n * **without custom redirects, deeplinks or even page reload**.\n *\n * This method initializes a one-off realtime subscription and will\n * open a popup window with the OAuth2 vendor page to authenticate.\n * Once the external OAuth2 sign-in/sign-up flow is completed, the popup\n * window will be automatically closed and the OAuth2 data sent back\n * to the user through the previously established realtime connection.\n *\n * You can specify an optional `urlCallback` prop to customize\n * the default url `window.open` behavior.\n *\n * On success, this method also automatically updates\n * the client's AuthStore data and returns:\n * - the authentication token\n * - the authenticated record model\n * - the OAuth2 account data (eg. name, email, avatar, etc.)\n *\n * Example:\n *\n * ```js\n * const authData = await pb.collection(\"users\").authWithOAuth2({\n * provider: \"google\",\n * })\n * ```\n *\n * _Site-note_: when creating the OAuth2 app in the provider dashboard\n * you have to configure `https://yourdomain.com/api/oauth2-redirect`\n * as redirect URL.\n */\n async authWithOAuth2<T = M>(options: OAuth2AuthConfig): Promise<RecordAuthResponse<T>>\n\n async authWithOAuth2<T = M>(...args: any): Promise<RecordAuthResponse<T>> {\n // fallback to legacy format\n if (args.length > 1 || typeof args?.[0] === 'string') {\n console.warn(\"PocketBase: This form of authWithOAuth2() is deprecated and may get removed in the future. Please replace with authWithOAuth2Code() OR use the authWithOAuth2() realtime form as shown in https://pocketbase.io/docs/authentication/#oauth2-integration.\");\n return this.authWithOAuth2Code<T>(\n args?.[0] || '',\n args?.[1] || '',\n args?.[2] || '',\n args?.[3] || '',\n args?.[4] || {},\n args?.[5] || {},\n args?.[6] || {},\n );\n }\n\n const config = args?.[0] || {};\n\n const authMethods = await this.listAuthMethods();\n\n const provider = authMethods.authProviders.find((p) => p.name === config.provider);\n if (!provider) {\n throw new ClientResponseError(new Error(`Missing or invalid provider \"${config.provider}\".`));\n }\n\n const redirectUrl = this.client.buildUrl('/api/oauth2-redirect');\n\n // initialize a one-off realtime service\n const realtime = new RealtimeService(this.client);\n\n // open a new popup window in case config.urlCallback is not set\n //\n // note: it is opened before the async call due to Safari restrictions\n // (see https://github.com/pocketbase/pocketbase/discussions/2429#discussioncomment-5943061)\n let eagerDefaultPopup: Window|null = null;\n if (!config.urlCallback) {\n eagerDefaultPopup = openBrowserPopup(undefined);\n }\n\n function cleanup() {\n eagerDefaultPopup?.close();\n realtime.unsubscribe();\n }\n\n return new Promise(async (resolve, reject) => {\n try {\n await realtime.subscribe('@oauth2', async (e) => {\n const oldState = realtime.clientId;\n\n try {\n if (!e.state || oldState !== e.state) {\n throw new Error(\"State parameters don't match.\");\n }\n\n // clear the non SendOptions props\n const options = Object.assign({}, config);\n delete options.provider;\n delete options.scopes;\n delete options.createData;\n delete options.urlCallback;\n\n const authData = await this.authWithOAuth2Code<T>(\n provider.name,\n e.code,\n provider.codeVerifier,\n redirectUrl,\n config.createData,\n options,\n );\n\n resolve(authData);\n } catch (err) {\n reject(new ClientResponseError(err));\n }\n\n cleanup();\n });\n\n const replacements: {[key: string]: any} = {\n \"state\": realtime.clientId,\n }\n if (config.scopes?.length) {\n replacements[\"scope\"] = config.scopes.join(\" \");\n }\n\n const url = this._replaceQueryParams(provider.authUrl + redirectUrl, replacements);\n\n let urlCallback = config.urlCallback || function (url: string) {\n if (eagerDefaultPopup) {\n eagerDefaultPopup.location.href = url;\n } else {\n // it could have been blocked due to its empty initial url,\n // try again...\n eagerDefaultPopup = openBrowserPopup(url);\n }\n }\n\n await urlCallback(url);\n } catch (err) {\n cleanup();\n reject(new ClientResponseError(err));\n }\n });\n }\n\n /**\n * Refreshes the current authenticated record instance and\n * returns a new token and record data.\n *\n * On success this method also automatically updates the client's AuthStore.\n */\n authRefresh<T = M>(options?: RecordOptions): Promise<RecordAuthResponse<T>>\n\n /**\n * @deprecated\n * Consider using authRefresh(options?).\n */\n authRefresh<T = M>(body?: any, query?: any): Promise<RecordAuthResponse<T>>\n\n authRefresh<T = M>(bodyOrOptions?: any, query?: any): Promise<RecordAuthResponse<T>> {\n let options: any = {\n 'method': 'POST',\n };\n\n options = normalizeLegacyOptionsArgs(\n 'This form of authRefresh(body?, query?) is deprecated. Consider replacing it with authRefresh(options?).',\n options,\n bodyOrOptions,\n query\n );\n\n return this.client.send(this.baseCollectionPath + '/auth-refresh', options)\n .then((data) => this.authResponse<T>(data));\n }\n\n /**\n * Sends auth record password reset request.\n */\n requestPasswordReset(email: string, options?: CommonOptions): Promise<boolean>\n\n /**\n * @deprecated\n * Consider using requestPasswordReset(email, options?).\n */\n requestPasswordReset(email: string, body?: any, query?: any): Promise<boolean>\n\n requestPasswordReset(email: string, bodyOrOptions?: any, query?: any): Promise<boolean> {\n let options: any = {\n 'method': 'POST',\n 'body': {\n 'email': email,\n }\n };\n\n options = normalizeLegacyOptionsArgs(\n 'This form of requestPasswordReset(email, body?, query?) is deprecated. Consider replacing it with requestPasswordReset(email, options?).',\n options,\n bodyOrOptions,\n query\n );\n\n return this.client.send(this.baseCollectionPath + '/request-password-reset', options).then(() => true);\n }\n\n /**\n * Confirms auth record password reset request.\n */\n confirmPasswordReset(\n passwordResetToken: string,\n password: string,\n passwordConfirm: string,\n options?: CommonOptions,\n ): Promise<boolean>\n\n /**\n * @deprecated\n * Consider using confirmPasswordReset(passwordResetToken, password, passwordConfirm, options?).\n */\n confirmPasswordReset(\n passwordResetToken: string,\n password: string,\n passwordConfirm: string,\n body?: any,\n query?: any,\n ): Promise<boolean>\n\n confirmPasswordReset(\n passwordResetToken: string,\n password: string,\n passwordConfirm: string,\n bodyOrOptions?: any,\n query?: any,\n ): Promise<boolean> {\n let options: any = {\n 'method': 'POST',\n 'body': {\n 'token': passwordResetToken,\n 'password': password,\n 'passwordConfirm': passwordConfirm,\n }\n };\n\n options = normalizeLegacyOptionsArgs(\n 'This form of confirmPasswordReset(token, password, passwordConfirm, body?, query?) is deprecated. Consider replacing it with confirmPasswordReset(token, password, passwordConfirm, options?).',\n options,\n bodyOrOptions,\n query\n );\n\n return this.client.send(this.baseCollectionPath + '/confirm-password-reset', options)\n .then(() => true);\n }\n\n /**\n * Sends auth record verification email request.\n */\n requestVerification(email: string, options?: CommonOptions): Promise<boolean>\n\n /**\n * @deprecated\n * Consider using requestVerification(email, options?).\n */\n requestVerification(email: string, body?: any, query?: any): Promise<boolean>\n\n requestVerification(email: string, bodyOrOptions?: any, query?: any): Promise<boolean> {\n let options: any = {\n 'method': 'POST',\n 'body': {\n 'email': email,\n }\n };\n\n options = normalizeLegacyOptionsArgs(\n 'This form of requestVerification(email, body?, query?) is deprecated. Consider replacing it with requestVerification(email, options?).',\n options,\n bodyOrOptions,\n query\n );\n\n return this.client.send(this.baseCollectionPath + '/request-verification', options)\n .then(() => true);\n }\n\n /**\n * Confirms auth record email verification request.\n */\n confirmVerification(verificationToken: string, options?: CommonOptions): Promise<boolean>\n\n /**\n * @deprecated\n * Consider using confirmVerification(verificationToken, options?).\n */\n confirmVerification(verificationToken: string, body?: any, query?: any): Promise<boolean>\n\n confirmVerification(verificationToken: string, bodyOrOptions?: any, query?: any): Promise<boolean> {\n let options: any = {\n 'method': 'POST',\n 'body': {\n 'token': verificationToken,\n }\n };\n\n options = normalizeLegacyOptionsArgs(\n 'This form of confirmVerification(token, body?, query?) is deprecated. Consider replacing it with confirmVerification(token, options?).',\n options,\n bodyOrOptions,\n query\n );\n\n return this.client.send(this.baseCollectionPath + '/confirm-verification', options)\n .then(() => true);\n }\n\n /**\n * Sends an email change request to the authenticated record model.\n */\n requestEmailChange(newEmail: string, options?: CommonOptions): Promise<boolean>\n\n /**\n * @deprecated\n * Consider using requestEmailChange(newEmail, options?).\n */\n requestEmailChange(newEmail: string, body?: any, query?: any): Promise<boolean>\n\n requestEmailChange(newEmail: string, bodyOrOptions?: any, query?: any): Promise<boolean> {\n let options: any = {\n 'method': 'POST',\n 'body': {\n 'newEmail': newEmail,\n }\n };\n\n options = normalizeLegacyOptionsArgs(\n 'This form of requestEmailChange(newEmail, body?, query?) is deprecated. Consider replacing it with requestEmailChange(newEmail, options?).',\n options,\n bodyOrOptions,\n query\n );\n\n return this.client.send(this.baseCollectionPath + '/request-email-change', options)\n .then(() => true);\n }\n\n /**\n * Confirms auth record's new email address.\n */\n confirmEmailChange(emailChangeToken: string, password: string, options?: CommonOptions): Promise<boolean>\n\n\n /**\n * @deprecated\n * Consider using confirmEmailChange(emailChangeToken, password, options?).\n */\n confirmEmailChange(emailChangeToken: string, password: string, body?: any, query?: any): Promise<boolean>\n\n confirmEmailChange(emailChangeToken: string, password: string, bodyOrOptions?: any, query?: any): Promise<boolean> {\n let options: any = {\n 'method': 'POST',\n 'body': {\n 'token': emailChangeToken,\n 'password': password,\n }\n };\n\n options = normalizeLegacyOptionsArgs(\n 'This form of confirmEmailChange(token, password, body?, query?) is deprecated. Consider replacing it with confirmEmailChange(token, password, options?).',\n options,\n bodyOrOptions,\n query\n );\n\n return this.client.send(this.baseCollectionPath + '/confirm-email-change', options)\n .then(() => true);\n }\n\n /**\n * Lists all linked external auth providers for the specified auth record.\n */\n listExternalAuths(recordId: string, options?: CommonOptions): Promise<Array<ExternalAuthModel>> {\n options = Object.assign({\n 'method': 'GET',\n }, options);\n\n return this.client.send(this.baseCrudPath + '/' + encodeURIComponent(recordId) + '/external-auths', options);\n }\n\n /**\n * Unlink a single external auth provider from the specified auth record.\n */\n unlinkExternalAuth(recordId: string, provider: string, options?: CommonOptions): Promise<boolean> {\n options = Object.assign({\n 'method': 'DELETE',\n }, options);\n\n return this.client.send(this.baseCrudPath + '/' + encodeURIComponent(recordId) + '/external-auths/' + encodeURIComponent(provider), options)\n .then(() => true);\n }\n\n // ---------------------------------------------------------------\n\n // very rudimentary url query params replacement because at the moment\n // URL (and URLSearchParams) doesn't seem to be fully supported in React Native\n //\n // note: for details behind some of the decode/encode parsing check https://unixpapa.com/js/querystring.html\n private _replaceQueryParams(url: string, replacements: {[key: string]: any} = {}): string {\n let urlPath = url\n let query = \"\";\n\n const queryIndex = url.indexOf(\"?\");\n if (queryIndex >= 0) {\n urlPath = url.substring(0, url.indexOf(\"?\"));\n query = url.substring(url.indexOf(\"?\") + 1);\n }\n\n const parsedParams: {[key: string]: string} = {};\n\n // parse the query parameters\n const rawParams = query.split(\"&\");\n for (const param of rawParams) {\n if (param == \"\") {\n continue\n }\n\n const pair = param.split(\"=\");\n parsedParams[decodeURIComponent(pair[0].replace(/\\+/g,' '))] = decodeURIComponent((pair[1] || \"\").replace(/\\+/g,' '));\n }\n\n // apply the replacements\n for (let key in replacements) {\n if (!replacements.hasOwnProperty(key)) {\n continue;\n }\n\n if (replacements[key] == null) {\n delete parsedParams[key];\n } else {\n parsedParams[key] = replacements[key];\n }\n }\n\n // construct back the full query string\n query = \"\";\n for (let key in parsedParams) {\n if (!parsedParams.hasOwnProperty(key)) {\n continue;\n }\n\n if (query != \"\") {\n query += \"&\";\n }\n\n query += encodeURIComponent(key.replace(/%20/g,'+')) + \"=\" + encodeURIComponent(parsedParams[key].replace(/%20/g,'+'));\n }\n\n return query != \"\" ? (urlPath + \"?\" + query) : urlPath;\n }\n}\n\nfunction openBrowserPopup(url?: string): Window|null {\n if (typeof window === \"undefined\" || !window?.open) {\n throw new ClientResponseError(new Error(`Not in a browser context - please pass a custom urlCallback function.`));\n }\n\n let width = 1024;\n let height = 768;\n\n let windowWidth = window.innerWidth;\n let windowHeight = window.innerHeight;\n\n // normalize window size\n width = width > windowWidth ? windowWidth : width;\n height = height > windowHeight ? windowHeight : height;\n\n let left = (windowWidth / 2) - (width / 2);\n let top = (windowHeight / 2) - (height / 2);\n\n // note: we don't use the noopener and noreferrer attributes since\n // for some reason browser blocks such windows then url is undefined/blank\n return window.open(\n url,\n 'popup_window',\n 'width='+width+',height='+height+',top='+top+',left='+left+',resizable,menubar=no'\n );\n}\n", "import { CrudService } from '@/services/utils/CrudService';\nimport { CollectionModel } from '@/services/utils/dtos';\nimport { CommonOptions } from '@/services/utils/options';\n\nexport class CollectionService extends CrudService<CollectionModel> {\n /**\n * @inheritdoc\n */\n get baseCrudPath(): string {\n return '/api/collections';\n }\n\n /**\n * Imports the provided collections.\n *\n * If `deleteMissing` is `true`, all local collections and schema fields,\n * that are not present in the imported configuration, WILL BE DELETED\n * (including their related records data)!\n */\n async import(\n collections: Array<CollectionModel>,\n deleteMissing: boolean = false,\n options?: CommonOptions,\n ): Promise<true> {\n options = Object.assign({\n 'method': 'PUT',\n 'body': {\n 'collections': collections,\n 'deleteMissing': deleteMissing,\n }\n }, options);\n\n return this.client.send(this.baseCrudPath + '/import', options)\n .then(() => true);\n }\n}\n", "import { BaseService } from '@/services/utils/BaseService';\nimport { ListResult, LogRequestModel } from '@/services/utils/dtos';\nimport {\n CommonOptions,\n ListOptions,\n LogStatsOptions,\n} from '@/services/utils/options';\n\nexport interface HourlyStats {\n total: number;\n date: string;\n}\n\nexport class LogService extends BaseService {\n /**\n * Returns paginated logged requests list.\n */\n getRequestsList(page = 1, perPage = 30, options?: ListOptions): Promise<ListResult<LogRequestModel>> {\n options = Object.assign({'method': 'GET'}, options);\n\n options.query = Object.assign({\n 'page': page,\n 'perPage': perPage,\n }, options.query);\n\n return this.client.send('/api/logs/requests', options);\n }\n\n /**\n * Returns a single logged request by its id.\n */\n getRequest(id: string, options?: CommonOptions): Promise<LogRequestModel> {\n options = Object.assign({\n 'method': 'GET',\n }, options);\n\n return this.client.send('/api/logs/requests/' + encodeURIComponent(id), options);\n }\n\n /**\n * Returns request logs statistics.\n */\n getRequestsStats(options?: LogStatsOptions): Promise<Array<HourlyStats>> {\n options = Object.assign({\n 'method': 'GET',\n }, options);\n\n return this.client.send('/api/logs/requests/stats', options);\n }\n}\n", "import { BaseService } from '@/services/utils/BaseService';\nimport { CommonOptions } from '@/services/utils/options';\n\nexport interface HealthCheckResponse {\n code: number;\n message: string;\n data: {[key: string]: any};\n}\n\nexport class HealthService extends BaseService {\n /**\n * Checks the health status of the api.\n */\n check(options?: CommonOptions): Promise<HealthCheckResponse> {\n options = Object.assign({\n 'method': 'GET',\n }, options);\n\n return this.client.send('/api/health', options);\n }\n}\n", "import { BaseService } from '@/services/utils/BaseService';\nimport { CommonOptions, FileOptions } from '@/services/utils/options';\n\nexport class FileService extends BaseService {\n /**\n * Builds and returns an absolute record file url for the provided filename.\n */\n getUrl(\n record: {[key:string]:any},\n filename: string,\n queryParams: FileOptions = {}\n ): string {\n if (\n !filename ||\n !record?.id ||\n !(record?.collectionId || record?.collectionName)\n ) {\n return '';\n }\n\n const parts = [];\n parts.push('api')\n parts.push('files')\n parts.push(encodeURIComponent(record.collectionId || record.collectionName))\n parts.push(encodeURIComponent(record.id))\n parts.push(encodeURIComponent(filename))\n\n let result = this.client.buildUrl(parts.join('/'));\n\n if (Object.keys(queryParams).length) {\n // normalize the download query param for consistency with the Dart sdk\n if (queryParams.download === false) {\n delete(queryParams.download);\n }\n\n const params = new URLSearchParams(queryParams);\n\n result += (result.includes('?') ? '&' : '?') + params;\n }\n\n return result\n }\n\n /**\n * Requests a new private file access token for the current auth model (admin or record).\n */\n getToken(options?: CommonOptions): Promise<string> {\n options = Object.assign({\n 'method': 'POST',\n }, options);\n\n return this.client.send('/api/files/token', options)\n .then((data) => data?.token || '');\n }\n}\n", "import { BaseService } from '@/services/utils/BaseService';\nimport { CommonOptions } from '@/services/utils/options';\n\nexport interface BackupFileInfo {\n key: string;\n size: number;\n modified: string;\n}\n\nexport class BackupService extends BaseService {\n /**\n * Returns list with all available backup files.\n */\n getFullList(options?: CommonOptions): Promise<Array<BackupFileInfo>> {\n options = Object.assign({\n 'method': 'GET',\n }, options);\n\n return this.client.send('/api/backups', options);\n }\n\n /**\n * Initializes a new backup.\n */\n create(basename: string, options?: CommonOptions): Promise<boolean> {\n options = Object.assign({\n 'method': 'POST',\n 'body': {\n 'name': basename,\n },\n }, options);\n\n return this.client.send('/api/backups', options)\n .then(() => true);\n }\n\n /**\n * Uploads an existing backup file.\n *\n * Example:\n *\n * ```js\n * await pb.backups.upload({\n * file: new Blob([...]),\n * });\n * ```\n */\n upload(bodyParams: {[key:string]:any}|FormData, options?: CommonOptions): Promise<boolean> {\n options = Object.assign({\n 'method': 'POST',\n 'body': bodyParams,\n }, options);\n\n return this.client.send('/api/backups/upload', options)\n .then(() => true);\n }\n\n /**\n * Deletes a single backup file.\n */\n delete(key: string, options?: CommonOptions): Promise<boolean> {\n options = Object.assign({\n 'method': 'DELETE',\n }, options);\n\n return this.client.send(`/api/backups/${encodeURIComponent(key)}`, options)\n .then(() => true);\n }\n\n /**\n * Initializes an app data restore from an existing backup.\n */\n restore(key: string, options?: CommonOptions): Promise<boolean> {\n options = Object.assign({\n 'method': 'POST',\n }, options);\n\n return this.client.send(`/api/backups/${encodeURIComponent(key)}/restore`, options)\n .then(() => true);\n }\n\n /**\n * Builds a download url for a single existing backup using an\n * admin file token and the backup file key.\n *\n * The file token can be generated via `pb.files.getToken()`.\n */\n getDownloadUrl(token: string, key: string): string {\n return this.client.buildUrl(`/api/backups/${encodeURIComponent(key)}?token=${encodeURIComponent(token)}`);\n }\n}\n", "import { ClientResponseError } from '@/ClientResponseError';\nimport { BaseAuthStore } from '@/stores/BaseAuthStore';\nimport { LocalAuthStore } from '@/stores/LocalAuthStore';\nimport { SettingsService } from '@/services/SettingsService';\nimport { AdminService } from '@/services/AdminService';\nimport { RecordService } from '@/services/RecordService';\nimport { CollectionService } from '@/services/CollectionService';\nimport { LogService } from '@/services/LogService';\nimport { RealtimeService } from '@/services/RealtimeService';\nimport { HealthService } from '@/services/HealthService';\nimport { FileService } from '@/services/FileService';\nimport { BackupService } from '@/services/BackupService';\nimport { SendOptions, FileOptions } from '@/services/utils/options';\nimport { RecordModel } from '@/services/utils/dtos';\n\n// list of known SendOptions keys (everything else is treated as query param)\nconst knownSendOptionsKeys = [\n 'requestKey',\n '$cancelKey',\n '$autoCancel',\n 'fetch',\n 'headers',\n 'body',\n 'query',\n 'params',\n // ---,\n 'cache',\n 'credentials',\n 'headers',\n 'integrity',\n 'keepalive',\n 'method',\n 'mode',\n 'redirect',\n 'referrer',\n 'referrerPolicy',\n 'signal',\n 'window',\n];\n\nexport interface BeforeSendResult {\n [key: string]: any, // for backward compatibility\n url?: string,\n options?: {[key: string]: any}\n}\n\n/**\n * PocketBase JS Client.\n */\nexport default class Client {\n /**\n * The base PocketBase backend url address (eg. 'http://127.0.0.1.8090').\n */\n baseUrl: string;\n\n /**\n * Hook that get triggered right before sending the fetch request,\n * allowing you to inspect and modify the url and request options.\n *\n * For list of the possible options check https://developer.mozilla.org/en-US/docs/Web/API/fetch#options\n *\n * You can return a non-empty result object `{ url, options }` to replace the url and request options entirely.\n *\n * Example:\n * ```js\n * client.beforeSend = function (url, options) {\n * options.headers = Object.assign({}, options.headers, {\n * 'X-Custom-Header': 'example',\n * });\n *\n * return { url, options }\n * };\n * ```\n */\n beforeSend?: (url: string, options: SendOptions) => BeforeSendResult|Promise<BeforeSendResult>;\n\n /**\n * Hook that get triggered after successfully sending the fetch request,\n * allowing you to inspect/modify the response object and its parsed data.\n *\n * Returns the new Promise resolved `data` that will be returned to the client.\n *\n * Example:\n * ```js\n * client.afterSend = function (response, data) {\n * if (response.status != 200) {\n * throw new ClientResponseError({\n * url: response.url,\n * status: response.status,\n * data: data,\n * });\n * }\n *\n * return data;\n * };\n * ```\n */\n afterSend?: (response: Response, data: any) => any;\n\n /**\n * Optional language code (default to `en-US`) that will be sent\n * with the requests to the server as `Accept-Language` header.\n */\n lang: string;\n\n /**\n * A replaceable instance of the local auth store service.\n */\n authStore: BaseAuthStore;\n\n /**\n * An instance of the service that handles the **Settings APIs**.\n */\n readonly settings: SettingsService;\n\n /**\n * An instance of the service that handles the **Admin APIs**.\n */\n readonly admins: AdminService;\n\n /**\n * An instance of the service that handles the **Collection APIs**.\n */\n readonly collections: CollectionService;\n\n /**\n * An instance of the service that handles the **File APIs**.\n */\n readonly files: FileService;\n\n /**\n * An instance of the service that handles the **Log APIs**.\n */\n readonly logs: LogService;\n\n /**\n * An instance of the service that handles the **Realtime APIs**.\n */\n readonly realtime: RealtimeService;\n\n /**\n * An instance of the service that handles the **Health APIs**.\n */\n readonly health: HealthService;\n\n /**\n * An instance of the service that handles the **Backup APIs**.\n */\n readonly backups: BackupService;\n\n private cancelControllers: { [key: string]: AbortController } = {};\n private recordServices: { [key: string]: RecordService } = {};\n private enableAutoCancellation: boolean = true;\n\n constructor(\n baseUrl = '/',\n authStore?: BaseAuthStore | null,\n lang = 'en-US',\n ) {\n this.baseUrl = baseUrl;\n this.lang = lang;\n this.authStore = authStore || new LocalAuthStore();\n\n // services\n this.admins = new AdminService(this);\n this.collections = new CollectionService(this);\n this.files = new FileService(this);\n this.logs = new LogService(this);\n this.settings = new SettingsService(this);\n this.realtime = new RealtimeService(this);\n this.health = new HealthService(this);\n this.backups = new BackupService(this);\n }\n\n /**\n * Returns the RecordService associated to the specified collection.\n *\n * @param {string} idOrName\n * @return {RecordService}\n */\n collection<M = RecordModel>(idOrName: string): RecordService<M> {\n if (!this.recordServices[idOrName]) {\n this.recordServices[idOrName] = new RecordService(this, idOrName);\n }\n\n return this.recordServices[idOrName];\n }\n\n /**\n * Globally enable or disable auto cancellation for pending duplicated requests.\n */\n autoCancellation(enable: boolean): Client {\n this.enableAutoCancellation = !!enable;\n\n return this;\n }\n\n /**\n * Cancels single request by its cancellation key.\n */\n cancelRequest(requestKey: string): Client {\n if (this.cancelControllers[requestKey]) {\n this.cancelControllers[requestKey].abort();\n delete this.cancelControllers[requestKey];\n }\n\n return this;\n }\n\n /**\n * Cancels all pending requests.\n */\n cancelAllRequests(): Client {\n for (let k in this.cancelControllers) {\n this.cancelControllers[k].abort();\n }\n\n this.cancelControllers = {};\n\n return this;\n }\n\n /**\n * Constructs a properly escaped filter expression.\n *\n * Placeholder parameters should be added using the `{:paramName}` notation.\n *\n * - `string` (_single quotes will be autoescaped_)\n * - `number`\n * - `boolean`\n * - `Date` object (_will be stringified into the format expected by PocketBase_)\n * - `null`\n * - anything else is converted to a string using `JSON.stringify()`\n *\n * Example:\n *\n * ```js\n * pb.collection(\"example\").getFirstListItem(pb.filter(\n * 'title ~ {:title} && created >= {:created}',\n * { title: \"example\", created: new Date()}\n * ))\n * ```\n */\n filter(raw: string, params?: {[key:string]:any}): string {\n if (!params) {\n return raw;\n }\n\n for (let key in params) {\n let val = params[key];\n switch (typeof val) {\n case 'boolean':\n case 'number':\n val = '' + val;\n break;\n case 'string':\n val = \"'\" + val.replace(/'/g, \"\\\\'\") + \"'\";\n break;\n default:\n if (val === null) {\n val = \"null\";\n } else if (val instanceof Date) {\n val = \"'\" + val.toISOString().replace('T', ' ') + \"'\";\n } else {\n val = \"'\" + JSON.stringify(val).replace(/'/g, \"\\\\'\") + \"'\";\n }\n }\n raw = raw.replaceAll(\"{:\" + key + \"}\", val)\n }\n\n return raw;\n }\n\n /**\n * Legacy alias of `pb.files.getUrl()`.\n */\n getFileUrl(\n record: {[key:string]:any},\n filename: string,\n queryParams: FileOptions = {}\n ): string {\n return this.files.getUrl(record, filename, queryParams);\n }\n\n /**\n * Builds a full client url by safely concatenating the provided path.\n */\n buildUrl(path: string): string {\n let url = this.baseUrl;\n\n // construct an absolute base url if in a browser environment\n if (\n typeof window !== 'undefined' &&\n !!window.location &&\n !url.startsWith('https://') &&\n !url.startsWith('http://')\n ) {\n url = window.location.origin?.endsWith('/') ?\n window.location.origin.substring(0, window.location.origin.length - 1) :\n (window.location.origin || '');\n\n if (!this.baseUrl.startsWith('/')) {\n url += window.location.pathname || '/';\n url += url.endsWith('/') ? '' : '/';\n }\n\n url += this.baseUrl;\n }\n\n // concatenate the path\n if (path) {\n url += url.endsWith('/') ? '' : '/'; // append trailing slash if missing\n url += path.startsWith('/') ? path.substring(1) : path;\n }\n\n return url;\n }\n\n /**\n * Sends an api http request.\n */\n async send<T = any>(path: string, options: SendOptions): Promise<T> {\n options = this.initSendOptions(path, options);\n\n // build url + path\n let url = this.buildUrl(path);\n\n if (this.beforeSend) {\n const result = Object.assign({}, await this.beforeSend(url, options));\n if (typeof result.url !== 'undefined' || typeof result.options !== 'undefined') {\n url = result.url || url;\n options = result.options || options;\n } else if (Object.keys(result).length) {\n // legacy behavior\n options = result as SendOptions;\n console?.warn && console.warn('Deprecated format of beforeSend return: please use `return { url, options }`, instead of `return options`.');\n }\n }\n\n // serialize the query parameters\n if (typeof options.query !== 'undefined') {\n const query = this.serializeQueryParams(options.query)\n if (query) {\n url += (url.includes('?') ? '&' : '?') + query;\n }\n delete options.query;\n }\n\n // ensures that the json body is serialized\n if (\n this.getHeader(options.headers, 'Content-Type') == 'application/json' &&\n options.body && typeof options.body !== 'string'\n ) {\n options.body = JSON.stringify(options.body);\n }\n\n const fetchFunc = options.fetch || fetch;\n\n // send the request\n return fetchFunc(url, options)\n .then(async (response) => {\n let data : any = {};\n\n try {\n data = await response.json();\n } catch (_) {\n // all api responses are expected to return json\n // with the exception of the realtime event and 204\n }\n\n if (this.afterSend) {\n data = await this.afterSend(response, data);\n }\n\n if (response.status >= 400) {\n throw new ClientResponseError({\n url: response.url,\n status: response.status,\n data: data,\n });\n }\n\n return data as T;\n }).catch((err) => {\n // wrap to normalize all errors\n throw new ClientResponseError(err);\n });\n }\n\n /**\n * Shallow copy the provided object and takes care to initialize\n * any options required to preserve the backward compatability.\n *\n * @param {SendOptions} options\n * @return {SendOptions}\n */\n private initSendOptions(path: string, options: SendOptions): SendOptions {\n options = Object.assign({ method: 'GET' } as SendOptions, options)\n options.query = options.query || {};\n\n // auto convert the body to FormData, if needed\n options.body = this.convertToFormDataIfNeeded(options.body);\n\n // move unknown send options as query parameters\n for (let key in options) {\n if (knownSendOptionsKeys.includes(key)) {\n continue\n }\n\n options.query[key] = options[key];\n delete (options[key]);\n }\n\n // requestKey normalizations for backward-compatibility\n // ---\n options.query = Object.assign({}, options.params, options.query);\n if (typeof options.requestKey === 'undefined') {\n if (options.$autoCancel === false || options.query.$autoCancel === false) {\n options.requestKey = null;\n } else if (options.$cancelKey || options.query.$cancelKey) {\n options.requestKey = options.$cancelKey || options.query.$cancelKey;\n }\n }\n // remove the deprecated special cancellation params from the other query params\n delete options.$autoCancel;\n delete options.query.$autoCancel;\n delete options.$cancelKey;\n delete options.query.$cancelKey;\n // ---\n\n // add the json header, if not explicitly set\n // (for FormData body the Content-Type header should be skipped since the boundary is autogenerated)\n if (\n this.getHeader(options.headers, 'Content-Type') === null &&\n !this.isFormData(options.body)\n ) {\n options.headers = Object.assign({}, options.headers, {\n 'Content-Type': 'application/json',\n });\n }\n\n // add Accept-Language header, if not explicitly set\n if (this.getHeader(options.headers, 'Accept-Language') === null) {\n options.headers = Object.assign({}, options.headers, {\n 'Accept-Language': this.lang,\n });\n }\n\n // check if Authorization header can be added\n if (\n // has valid token\n this.authStore.token &&\n // auth header is not explicitly set\n (this.getHeader(options.headers, 'Authorization') === null)\n ) {\n options.headers = Object.assign({}, options.headers, {\n 'Authorization': this.authStore.token,\n });\n }\n\n // handle auto cancelation for duplicated pending request\n if (this.enableAutoCancellation && options.requestKey !== null) {\n const requestKey = options.requestKey || ((options.method || 'GET') + path);\n\n delete options.requestKey;\n\n // cancel previous pending requests\n this.cancelRequest(requestKey);\n\n const controller = new AbortController();\n this.cancelControllers[requestKey] = controller;\n options.signal = controller.signal;\n }\n\n return options\n }\n\n /**\n * Converts analyzes the provided body and converts it to FormData\n * in case a plain object with File/Blob values is used.\n */\n private convertToFormDataIfNeeded(body: any): any {\n if (\n typeof FormData === 'undefined' ||\n typeof body === \"undefined\" ||\n typeof body !== \"object\" ||\n body === null ||\n this.isFormData(body) ||\n !this.hasBlobField(body)\n ) {\n return body;\n }\n\n const form = new FormData();\n\n for (let key in body) {\n // @todo consider adding a note that `json` array values should be serialized!\n const values = Array.isArray(body[key]) ? body[key] : [body[key]];\n for (let val of values) {\n form.append(key, val);\n }\n }\n\n return form;\n }\n\n /**\n * Checks if the submitted body object has at least one Blob/File field.\n */\n private hasBlobField(body: {[key:string]: any}): boolean {\n for (let key in body) {\n const values = Array.isArray(body[key]) ? body[key] : [body[key]];\n for (let v of values) {\n if (\n (typeof Blob !== 'undefined' && v instanceof Blob) ||\n (typeof File !== 'undefined' && v instanceof File)\n ) {\n return true;\n }\n }\n }\n\n return false;\n }\n\n /**\n * Extracts the header with the provided name in case-insensitive manner.\n * Returns `null` if no header matching the name is found.\n */\n private getHeader(headers: {[key:string]:string}|undefined, name: string): string|null {\n headers = headers || {};\n name = name.toLowerCase();\n\n for (let key in headers) {\n if (key.toLowerCase() == name) {\n return headers[key];\n }\n }\n\n return null;\n }\n\n /**\n * Loosely checks if the specified body is a FormData instance.\n */\n private isFormData(body: any): boolean {\n return body && (\n // we are checking the constructor name because FormData\n // is not available natively in some environments and the\n // polyfill(s) may not be globally accessible\n body.constructor.name === 'FormData' ||\n // fallback to global FormData instance check\n // note: this is needed because the constructor.name could be different in case of\n // custom global FormData implementation, eg. React Native on Android/iOS\n (typeof FormData !== 'undefined' && body instanceof FormData)\n )\n }\n\n /**\n * Serializes the provided query parameters into a query string.\n */\n private serializeQueryParams(params: {[key: string]: any}): string {\n const result: Array<string> = [];\n for (const key in params) {\n if (params[key] === null) {\n // skip null query params\n continue;\n }\n\n const value = params[key];\n const encodedKey = encodeURIComponent(key);\n\n if (Array.isArray(value)) {\n // repeat array params\n for (const v of value) {\n result.push(encodedKey + '=' + encodeURIComponent(v));\n }\n } else if (value instanceof Date) {\n result.push(encodedKey + '=' + encodeURIComponent(value.toISOString()));\n } else if (typeof value !== null && typeof value === 'object') {\n result.push(encodedKey + '=' + encodeURIComponent(JSON.stringify(value)));\n } else {\n result.push(encodedKey + '=' + encodeURIComponent(value));\n }\n }\n\n return result.join('&');\n }\n}\n", "import { BaseAuthStore, AuthModel } from '@/stores/BaseAuthStore';\n\nexport type AsyncSaveFunc = (serializedPayload: string) => Promise<void>;\n\nexport type AsyncClearFunc = () => Promise<void>;\n\ntype queueFunc = () => Promise<void>;\n\n/**\n * AsyncAuthStore is a helper auth store implementation\n * that could be used with any external async persistent layer\n * (key-value db, local file, etc.).\n *\n * Here is an example with the React Native AsyncStorage package:\n *\n * ```\n * import AsyncStorage from \"@react-native-async-storage/async-storage\";\n * import PocketBase, { AsyncAuthStore } from \"pocketbase\";\n *\n * const store = new AsyncAuthStore({\n * save: async (serialized) => AsyncStorage.setItem(\"pb_auth\", serialized),\n * initial: AsyncStorage.getItem(\"pb_auth\"),\n * });\n *\n * const pb = new PocketBase(\"https://example.com\", store)\n * ```\n */\nexport class AsyncAuthStore extends BaseAuthStore {\n private saveFunc: AsyncSaveFunc;\n private clearFunc?: AsyncClearFunc;\n private queue: Array<queueFunc> = [];\n\n constructor(config: {\n // The async function that is called every time\n // when the auth store state needs to be persisted.\n save: AsyncSaveFunc,\n\n /// An *optional* async function that is called every time\n /// when the auth store needs to be cleared.\n ///\n /// If not explicitly set, `saveFunc` with empty data will be used.\n clear?: AsyncClearFunc,\n\n // An *optional* initial data to load into the store.\n initial?: string|Promise<any>,\n }) {\n super();\n\n this.saveFunc = config.save;\n this.clearFunc = config.clear;\n\n this._enqueue(() => this._loadInitial(config.initial));\n }\n\n /**\n * @inheritdoc\n */\n save(token: string, model?: AuthModel): void {\n super.save(token, model);\n\n let value = '';\n try {\n value = JSON.stringify({token, model})\n } catch (err) {\n console.warn('AsyncAuthStore: failed to stringify the new state');\n }\n\n this._enqueue(() => this.saveFunc(value));\n }\n\n /**\n * @inheritdoc\n */\n clear(): void {\n super.clear();\n\n if (this.clearFunc) {\n this._enqueue(() => this.clearFunc!());\n } else {\n this._enqueue(() => this.saveFunc(\"\"));\n }\n }\n\n /**\n * Initializes the auth store state.\n */\n private async _loadInitial(payload?: string|Promise<any>) {\n try {\n payload = await payload;\n\n if (payload) {\n let parsed;\n if (typeof payload === 'string') {\n parsed = JSON.parse(payload) || {};\n } else if (typeof payload === 'object') {\n parsed = payload;\n }\n\n this.save(parsed.token || \"\", parsed.model || null);\n }\n } catch (_) {}\n }\n\n /**\n * Appends an async function to the queue.\n */\n private _enqueue(asyncCallback: () => Promise<void>) {\n this.queue.push(asyncCallback);\n\n if (this.queue.length == 1) {\n this._dequeue();\n }\n }\n\n /**\n * Starts the queue processing.\n */\n private _dequeue() {\n if (!this.queue.length) {\n return;\n }\n\n this.queue[0]().finally(() => {\n this.queue.shift();\n\n if (!this.queue.length) {\n return;\n }\n\n this._dequeue();\n });\n }\n}\n", "import PocketBase from \"pocketbase\";\nimport { useEffect, useState } from \"preact/hooks\";\n\nconst url = new URL(location.origin);\nurl.host = `pocketbase.${url.host}`;\nexport const pb = new PocketBase(url.toString());\nwindow.pb = pb;\n\nexport async function loginGoogle() {\n const res = await pb.collection(\"users\").authWithOAuth2({\n provider: \"google\",\n });\n try {\n // guardar nombre de google en pocketbase\n await pb.collection(\"users\").update(res.record.id, { name: res.meta.name });\n } catch {\n // meh\n }\n}\n\nexport function useUser() {\n const [user, setUser] = useState(pb.authStore.model);\n\n useEffect(() => {\n return pb.authStore.onChange((_, model) => setUser(model));\n });\n\n return [user];\n}\n", "const ENCODED_ENTITIES = /[\"&<]/;\n\n/** @param {string} str */\nexport function encodeEntities(str) {\n\t// Skip all work for strings with no entities needing encoding:\n\tif (str.length === 0 || ENCODED_ENTITIES.test(str) === false) return str;\n\n\tlet last = 0,\n\t\ti = 0,\n\t\tout = '',\n\t\tch = '';\n\n\t// Seek forward in str until the next entity char:\n\tfor (; i < str.length; i++) {\n\t\tswitch (str.charCodeAt(i)) {\n\t\t\tcase 34:\n\t\t\t\tch = '&quot;';\n\t\t\t\tbreak;\n\t\t\tcase 38:\n\t\t\t\tch = '&amp;';\n\t\t\t\tbreak;\n\t\t\tcase 60:\n\t\t\t\tch = '&lt;';\n\t\t\t\tbreak;\n\t\t\tdefault:\n\t\t\t\tcontinue;\n\t\t}\n\t\t// Append skipped/buffered characters and the encoded entity:\n\t\tif (i !== last) out += str.slice(last, i);\n\t\tout += ch;\n\t\t// Start the next seek/buffer after the entity's offset:\n\t\tlast = i + 1;\n\t}\n\tif (i !== last) out += str.slice(last, i);\n\treturn out;\n}\n", "/** Normal hydration that attaches to a DOM tree but does not diff it. */\nexport const MODE_HYDRATE = 1 << 5;\n/** Signifies this VNode suspended on the previous render */\nexport const MODE_SUSPENDED = 1 << 7;\n/** Indicates that this node needs to be inserted while patching children */\nexport const INSERT_VNODE = 1 << 16;\n/** Indicates a VNode has been matched with another VNode in the diff */\nexport const MATCHED = 1 << 17;\n\n/** Reset all mode flags */\nexport const RESET_MODE = ~(MODE_HYDRATE | MODE_SUSPENDED);\n\nexport const EMPTY_OBJ = /** @type {any} */ ({});\nexport const EMPTY_ARR = [];\nexport const IS_NON_DIMENSIONAL =\n\t/acit|ex(?:s|g|n|p|$)|rph|grid|ows|mnc|ntw|ine[ch]|zoo|^ord|itera/i;\n", "import { options, Fragment } from 'preact';\nimport { encodeEntities } from './utils';\nimport { IS_NON_DIMENSIONAL } from '../../src/constants';\n\nlet vnodeId = 0;\n\nconst isArray = Array.isArray;\n\n/**\n * @fileoverview\n * This file exports various methods that implement Babel's \"automatic\" JSX runtime API:\n * - jsx(type, props, key)\n * - jsxs(type, props, key)\n * - jsxDEV(type, props, key, __source, __self)\n *\n * The implementation of createVNode here is optimized for performance.\n * Benchmarks: https://esbench.com/bench/5f6b54a0b4632100a7dcd2b3\n */\n\n/**\n * JSX.Element factory used by Babel's {runtime:\"automatic\"} JSX transform\n * @param {VNode['type']} type\n * @param {VNode['props']} props\n * @param {VNode['key']} [key]\n * @param {unknown} [isStaticChildren]\n * @param {unknown} [__source]\n * @param {unknown} [__self]\n */\nfunction createVNode(type, props, key, isStaticChildren, __source, __self) {\n\t// We'll want to preserve `ref` in props to get rid of the need for\n\t// forwardRef components in the future, but that should happen via\n\t// a separate PR.\n\tlet normalizedProps = {},\n\t\tref,\n\t\ti;\n\tfor (i in props) {\n\t\tif (i == 'ref') {\n\t\t\tref = props[i];\n\t\t} else {\n\t\t\tnormalizedProps[i] = props[i];\n\t\t}\n\t}\n\n\t/** @type {VNode & { __source: any; __self: any }} */\n\tconst vnode = {\n\t\ttype,\n\t\tprops: normalizedProps,\n\t\tkey,\n\t\tref,\n\t\t_children: null,\n\t\t_parent: null,\n\t\t_depth: 0,\n\t\t_dom: null,\n\t\t_nextDom: undefined,\n\t\t_component: null,\n\t\tconstructor: undefined,\n\t\t_original: --vnodeId,\n\t\t_index: -1,\n\t\t_flags: 0,\n\t\t__source,\n\t\t__self\n\t};\n\n\t// If a Component VNode, check for and apply defaultProps.\n\t// Note: `type` is often a String, and can be `undefined` in development.\n\tif (typeof type === 'function' && (ref = type.defaultProps)) {\n\t\tfor (i in ref)\n\t\t\tif (typeof normalizedProps[i] === 'undefined') {\n\t\t\t\tnormalizedProps[i] = ref[i];\n\t\t\t}\n\t}\n\n\tif (options.vnode) options.vnode(vnode);\n\treturn vnode;\n}\n\n/**\n * Create a template vnode. This function is not expected to be\n * used directly, but rather through a precompile JSX transform\n * @param {string[]} templates\n * @param {Array<string | null | VNode>} exprs\n * @returns {VNode}\n */\nfunction jsxTemplate(templates, ...exprs) {\n\tconst vnode = createVNode(Fragment, { tpl: templates, exprs });\n\t// Bypass render to string top level Fragment optimization\n\tvnode.key = vnode._vnode;\n\treturn vnode;\n}\n\nconst JS_TO_CSS = {};\nconst CSS_REGEX = /[A-Z]/g;\n\n/**\n * Serialize an HTML attribute to a string. This function is not\n * expected to be used directly, but rather through a precompile\n * JSX transform\n * @param {string} name The attribute name\n * @param {*} value The attribute value\n * @returns {string}\n */\nfunction jsxAttr(name, value) {\n\tif (options.attr) {\n\t\tconst result = options.attr(name, value);\n\t\tif (typeof result === 'string') return result;\n\t}\n\n\tif (name === 'ref' || name === 'key') return '';\n\tif (name === 'style' && typeof value === 'object') {\n\t\tlet str = '';\n\t\tfor (let prop in value) {\n\t\t\tlet val = value[prop];\n\t\t\tif (val != null && val !== '') {\n\t\t\t\tconst name =\n\t\t\t\t\tprop[0] == '-'\n\t\t\t\t\t\t? prop\n\t\t\t\t\t\t: JS_TO_CSS[prop] ||\n\t\t\t\t\t\t (JS_TO_CSS[prop] = prop.replace(CSS_REGEX, '-$&').toLowerCase());\n\n\t\t\t\tlet suffix = ';';\n\t\t\t\tif (\n\t\t\t\t\ttypeof val === 'number' &&\n\t\t\t\t\t// Exclude custom-attributes\n\t\t\t\t\t!name.startsWith('--') &&\n\t\t\t\t\t!IS_NON_DIMENSIONAL.test(name)\n\t\t\t\t) {\n\t\t\t\t\tsuffix = 'px;';\n\t\t\t\t}\n\t\t\t\tstr = str + name + ':' + val + suffix;\n\t\t\t}\n\t\t}\n\t\treturn name + '=\"' + str + '\"';\n\t}\n\n\tif (\n\t\tvalue == null ||\n\t\tvalue === false ||\n\t\ttypeof value === 'function' ||\n\t\ttypeof value === 'object'\n\t) {\n\t\treturn '';\n\t} else if (value === true) return name;\n\n\treturn name + '=\"' + encodeEntities(value) + '\"';\n}\n\n/**\n * Escape a dynamic child passed to `jsxTemplate`. This function\n * is not expected to be used directly, but rather through a\n * precompile JSX transform\n * @param {*} value\n * @returns {string | null | VNode | Array<string | null | VNode>}\n */\nfunction jsxEscape(value) {\n\tif (\n\t\tvalue == null ||\n\t\ttypeof value === 'boolean' ||\n\t\ttypeof value === 'function'\n\t) {\n\t\treturn null;\n\t}\n\n\tif (typeof value === 'object') {\n\t\t// Check for VNode\n\t\tif (value.constructor === undefined) return value;\n\n\t\tif (isArray(value)) {\n\t\t\tfor (let i = 0; i < value.length; i++) {\n\t\t\t\tvalue[i] = jsxEscape(value[i]);\n\t\t\t}\n\t\t\treturn value;\n\t\t}\n\t}\n\n\treturn encodeEntities('' + value);\n}\n\nexport {\n\tcreateVNode as jsx,\n\tcreateVNode as jsxs,\n\tcreateVNode as jsxDEV,\n\tFragment,\n\t// precompiled JSX transform\n\tjsxTemplate,\n\tjsxAttr,\n\tjsxEscape\n};\n", "import { Controller } from \"@hotwired/stimulus\";\nimport * as Turbo from \"@hotwired/turbo\";\nimport { pb } from \"../pocketbase\";\n\nexport default class extends Controller {\n static targets = [\"name\", \"overlay\"];\n\n connect() {\n if (pb.authStore.model) {\n const name = pb.authStore.model?.name;\n this.nameTarget.textContent = `\u00A1Hola ${name}!`;\n this.overlayTarget.display = \"none\";\n } else {\n const url = new URL(location.origin);\n url.pathname = \"/login/\";\n url.searchParams.set(\"from\", location.pathname);\n Turbo.visit(url);\n }\n }\n}\n", "// @ts-check\nimport { Controller } from \"@hotwired/stimulus\";\nimport * as Turbo from \"@hotwired/turbo\";\nimport { loginGoogle, pb } from \"../pocketbase\";\n\nexport default class extends Controller {\n async loginGoogle() {\n try {\n await loginGoogle();\n const params = new URLSearchParams(location.search);\n let goTo = params.get(\"from\") ?? \"/\";\n Turbo.visit(goTo);\n } catch (error) {\n alert(error);\n }\n }\n}\n", "import { Controller } from \"@hotwired/stimulus\";\nimport * as Turbo from \"@hotwired/turbo\";\nimport { pb } from \"../pocketbase\";\n\nexport default class extends Controller {\n connect() {\n if (pb.authStore.model) {\n const { name, email } = pb.authStore.model;\n if (this.element.estudiante && name) this.element.estudiante.value = name;\n if (this.element.email && email) this.element.email.value = email;\n } else {\n const url = new URL(location.origin);\n url.pathname = \"/login/\";\n url.searchParams.set(\"from\", location.pathname);\n Turbo.visit(url);\n }\n }\n}\n", "import { Controller } from \"@hotwired/stimulus\";\nimport * as Turbo from \"@hotwired/turbo\";\nimport { pb } from \"../pocketbase.js\";\n\nexport default class extends Controller {\n logout() {\n pb.authStore.clear();\n Turbo.visit(\"/\");\n }\n}\n"],
5
+ "mappings": "+qBAAA,IAAAA,GAAAC,EAAAC,IAAA,cACA,OAAO,eAAeA,GAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAC5DA,GAAQ,KAAO,CAACC,EAAKC,IACVD,EAAI,QAAQ,IAAI,OAAO,KAAOC,EAAO,OAASA,EAAO,MAAO,GAAG,EAAG,EAAE,ICH/E,IAAAC,GAAAC,EAAAC,IAAA,cACA,OAAO,eAAeA,GAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAC5D,IAAMC,GAAS,KACfD,GAAQ,cAAgB,CAACE,EAASC,IAAsB,CACpD,GAAID,IAAY,OACZ,MAAO,GACX,IAAME,EAAgBH,GAAO,KAAKC,EAAS,IAAI,EAAE,QAAQ,IAAI,OAAO,IAAK,GAAG,EAAG,GAAG,EAC5EG,EAAeD,EAAc,MAAM,GAAG,EAE5C,MAAK,QAAQ,KAAKC,EAAa,KAAK,EAAE,CAAC,EAGnCF,IAAsB,GAClB,OAAO,UAAU,WAAWC,CAAa,CAAC,EACnC,SAASA,EAAe,EAAE,EAAE,QAAQ,CAAC,EAGhDC,EAAa,OAAS,GAClBF,IAAsB,KACfE,EAAa,MAAM,EAAGF,EAAoB,CAAC,EAAE,KAAK,GAAG,EAG7DC,EAZIA,CAaf,EACAJ,GAAQ,0BAA4B,CAACM,EAAWC,IAAW,CACvD,GAAI,CAACA,EACD,MAAO,GACX,GAAIA,IAAW,QAAS,CACpB,IAAMC,EAAoB,+CACpBC,EAAQH,EAAU,MAAME,CAAiB,EAC/C,GAAIC,EACA,OAAOA,EAAM,IAAI,CAEzB,CACA,IAAMC,EAAQ,IAAI,OAAO,GAAGH,qEAA2E,GAAG,EACpGE,EAAQH,EAAU,MAAMI,CAAK,EACnC,OAAKD,EAEEA,EAAM,IAAI,EADN,EAEf,ICvCA,IAAAE,GAAAC,EAAAC,IAAA,cACA,OAAO,eAAeA,GAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAC5DA,GAAQ,oBAAsB,CAACC,EAAUC,IAAc,CACnD,IAAMC,EAAQ,IAAI,OAAO,SAAU,GAAG,EACtC,OAAIF,GAAa,KACN,GACJA,EAAS,QAAQE,EAAQC,GAAU,CACtC,IAAMC,EAAQ,SAASD,EAAM,OAAO,CAAC,EAAG,EAAE,EAE1C,OADiBF,EAAUG,EAAQ,IAChB,EACvB,CAAC,CACL,ICXA,IAAAC,GAAAC,EAAAC,IAAA,cACA,OAAO,eAAeA,GAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAC5DA,GAAQ,YAAc,IAAM,CACxB,IAAMC,EAAoB,CAAC,EAS3B,MAAO,CACH,IATQ,CAACC,EAAKC,IAAU,CACxBF,EAAkBC,GAAOC,CAC7B,EAQI,IAPSD,GAAQ,CACjB,GAAID,EAAkB,eAAeC,CAAG,EACpC,OAAOD,EAAkBC,EAEjC,CAIA,CACJ,IChBA,IAAAE,GAAAC,EAAAC,IAAA,cACA,OAAO,eAAeA,GAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAC5D,IAAMC,GAAiB,KACjBC,GAAQD,GAAe,YAAY,EACnCE,GAAoBC,GAAa,CACnC,IAAMC,EAAsBH,GAAM,IAAIE,CAAQ,EAC9C,GAAIC,EACA,OAAOA,EAAoB,MAC/B,IAAMC,EAAgB,OAAO,yCAA2CF,KAAa,GAAG,EACxF,OAAAF,GAAM,IAAIE,EAAU,CAChB,MAAOE,CACX,CAAC,EACMA,CACX,EACAN,GAAQ,gBAAkB,CAACI,EAAUG,IAAc,CAE/C,GAAI,CAEA,IAAMC,EADgBL,GAAiBC,CAAQ,EACnB,KAAKG,CAAS,EAC1C,OAAOC,EAAQA,EAAM,MAAM,CAAC,EAAI,IACpC,MACA,CACI,OAAO,IACX,CACJ,g7sCCxBA,IAAAC,GAAAC,EAAAC,IAAA,cACA,IAAIC,GAAmBD,IAAQA,GAAK,iBAAoB,SAAUE,EAAK,CACnE,OAAQA,GAAOA,EAAI,WAAcA,EAAM,CAAE,QAAWA,CAAI,CAC5D,EACA,OAAO,eAAeF,GAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAC5D,IAAMG,GAAY,KACZC,GAAyB,KACzBC,GAAe,KACfC,GAAkBL,GAAgB,IAAsD,EACxFM,GAAwBN,GAAgB,IAA4D,EACpGO,GAA4BP,GAAgB,IAA6C,EACzFQ,GAA8BR,GAAgB,IAA+C,EAC7FS,GAAN,KAAoB,CAChB,YAAYC,EAAS,CACjB,KAAK,QAAU,CACX,kBAAmB,CACvB,EACA,KAAK,MAASC,GAAc,CACxB,IAAMC,EAAS,CACX,KAAM,GACN,KAAM,GACN,QAAS,GACT,OAAQ,GACR,cAAe,EACnB,EACA,QAAWC,KAAWR,GAAgB,QAAS,CAC3C,IAAMS,EAAQV,GAAa,gBAAgBS,EAAQ,MAAOF,CAAS,EACnE,GAAI,CAACG,EACD,SACJ,IAAMC,EAAaZ,GAAuB,oBAAoBU,EAAQ,QAASC,CAAK,EAC9EE,EAAUd,GAAU,cAAca,EAAY,KAAK,QAAQ,iBAAiB,EAC5EE,EAAeD,GAAW,WAAWd,GAAU,cAAca,EAAY,CAAC,CAAC,GAAK,GACtF,GAAIF,EAAQ,SACRD,EAAO,OAASC,EAAQ,OAAO,QAC3BA,EAAQ,QAAUA,EAAQ,OAAO,UAAYI,GAAc,CAC3D,IAAMC,EAAuB,OAAO,QAAQL,EAAQ,OAAO,QAAQ,EAAE,KAAK,CAACM,EAAGC,IACnE,WAAWD,EAAE,EAAE,EAAI,WAAWC,EAAE,EAAE,EAAI,EAAI,EACpD,EACD,OAAW,CAACC,EAAkBC,CAAe,IAAKJ,EAC1C,WAAWG,CAAgB,GAAKJ,IAChCL,EAAO,OAASU,GAAmB,GAG/C,CAEJV,EAAO,KAAO,UACdA,EAAO,KAAOT,GAAuB,oBAAoBU,EAAQ,KAAMC,CAAK,EAC5EF,EAAO,QAAUI,EACjB,KACJ,CACA,GAAI,CAACJ,EAAO,OACR,QAAWW,KAAiBjB,GAAsB,QAAS,CACvD,IAAIQ,EAAQ,KACZ,GAAI,CACAA,EAAQ,OAAOS,EAAc,MAAO,GAAG,EAAE,KAAKZ,CAAS,CAC3D,MACA,CAEA,CACA,GAAKG,EAEL,CAAAF,EAAO,OAASW,EAAc,KAC9B,MACJ,CAEJ,OAAAX,EAAO,cAAgBV,GAAU,cAAcA,GAAU,0BAA0BS,EAAWC,EAAO,MAAM,EAAG,KAAK,QAAQ,iBAAiB,EACrIA,CACX,EACA,KAAK,QAAU,OAAO,OAAO,OAAO,OAAO,CAAC,EAAG,KAAK,OAAO,EAAGF,CAAO,CACzE,CACJ,EACAX,GAAQ,QAAUU,GAClBA,GAAc,oBAAuBe,GAAgB,CACjD,OAAW,CAACC,EAAWC,CAAI,IAAK,OAAO,QAAQnB,GAA0B,OAAO,EAC5E,GAAImB,IAASF,EACT,OAAOC,EAGf,MAAO,EACX,EACAhB,GAAc,oBAAuBe,GAC1BhB,GAA4B,QAAQ,SAASC,GAAc,oBAAoBe,CAAW,CAAC,k/QCjFtG,IAAAG,GAAAC,EAAAC,IAAA,cACA,IAAIC,GAAmBD,IAAQA,GAAK,iBAAoB,SAAUE,EAAK,CACnE,OAAQA,GAAOA,EAAI,WAAcA,EAAM,CAAE,QAAWA,CAAI,CAC5D,EACA,OAAO,eAAeF,GAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAC5D,IAAMG,GAAqBF,GAAgB,IAAyD,EAC9FG,GAAY,KACZC,GAAyB,KACzBC,GAAe,KACfC,GAAN,KAAsB,CAClB,YAAYC,EAAS,CACjB,KAAK,QAAU,CACX,kBAAmB,CACvB,EACA,KAAK,MAASC,GAAc,CACxB,IAAMC,EAAS,CACX,KAAM,GACN,KAAM,GACN,QAAS,EACb,EACA,QAAWC,KAAaR,GAAmB,QAAS,CAChD,IAAMS,EAAQN,GAAa,gBAAgBK,EAAU,MAAOF,CAAS,EACrE,GAAKG,EAEL,CAAAF,EAAO,KAAO,aACdA,EAAO,KAAOL,GAAuB,oBAAoBM,EAAU,KAAMC,CAAK,EAC9EF,EAAO,QAAUN,GAAU,cAAcC,GAAuB,oBAAoBM,EAAU,QAASC,CAAK,EAAG,KAAK,QAAQ,iBAAiB,EAC7I,MACJ,CACA,OAAOF,CACX,EACA,KAAK,QAAU,OAAO,OAAO,OAAO,OAAO,CAAC,EAAG,KAAK,OAAO,EAAGF,CAAO,CACzE,CACJ,EACAR,GAAQ,QAAUO,q/FClClB,IAAAM,GAAAC,EAAAC,IAAA,cACA,IAAIC,GAAmBD,IAAQA,GAAK,iBAAoB,SAAUE,EAAK,CACnE,OAAQA,GAAOA,EAAI,WAAcA,EAAM,CAAE,QAAWA,CAAI,CAC5D,EACA,OAAO,eAAeF,GAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAC5D,IAAMG,GAAsBF,GAAgB,IAA0D,EAChGG,GAAY,KACZC,GAAyB,KACzBC,GAAe,KACfC,GAAN,KAAuB,CACnB,YAAYC,EAAS,CACjB,KAAK,QAAU,CACX,kBAAmB,CACvB,EACA,KAAK,MAASC,GAAc,CACxB,IAAMC,EAAS,CACX,KAAM,GACN,KAAM,GACN,QAAS,GACT,IAAK,EACT,EACA,QAAWC,KAAcR,GAAoB,QAAS,CAClD,IAAMS,EAAQN,GAAa,gBAAgBK,EAAW,MAAOF,CAAS,EACtE,GAAKG,EAEL,CAAAF,EAAO,KAAO,cACdA,EAAO,KAAOL,GAAuB,oBAAoBM,EAAW,KAAMC,CAAK,EAC/EF,EAAO,QAAUN,GAAU,cAAcC,GAAuB,oBAAoBM,EAAW,QAASC,CAAK,EAAG,KAAK,QAAQ,iBAAiB,EAC9IF,EAAO,IAAMC,EAAW,IACxB,MACJ,CACA,OAAOD,CACX,EACA,KAAK,QAAU,OAAO,OAAO,OAAO,OAAO,CAAC,EAAG,KAAK,OAAO,EAAGF,CAAO,CACzE,CACJ,EACAR,GAAQ,QAAUO,kzFCpClB,IAAAM,GAAAC,EAAAC,IAAA,cACA,IAAIC,GAAmBD,IAAQA,GAAK,iBAAoB,SAAUE,EAAK,CACnE,OAAQA,GAAOA,EAAI,WAAcA,EAAM,CAAE,QAAWA,CAAI,CAC5D,EACA,OAAO,eAAeF,GAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAC5D,IAAMG,GAAmBF,GAAgB,IAAuD,EAC1FG,GAAY,KACZC,GAAyB,KACzBC,GAAe,KACfC,GAAN,KAAoB,CAChB,YAAYC,EAAS,CACjB,KAAK,QAAU,CACX,kBAAmB,CACvB,EACA,KAAK,MAASC,GAAc,CACxB,IAAMC,EAAS,CACX,KAAM,GACN,KAAM,GACN,QAAS,GACT,IAAK,EACT,EACA,QAAWC,KAAWR,GAAiB,QAAS,CAC5C,IAAMS,EAAQN,GAAa,gBAAgBK,EAAQ,MAAOF,CAAS,EACnE,GAAKG,EAEL,CAAAF,EAAO,KAAO,UACdA,EAAO,KAAOL,GAAuB,oBAAoBM,EAAQ,KAAMC,CAAK,EAC5EF,EAAO,QAAUN,GAAU,cAAcC,GAAuB,oBAAoBM,EAAQ,QAASC,CAAK,EAAG,KAAK,QAAQ,iBAAiB,EAC3IF,EAAO,IAAMC,EAAQ,KAAO,GAC5B,MACJ,CACA,OAAOD,CACX,EACA,KAAK,QAAU,OAAO,OAAO,OAAO,OAAO,CAAC,EAAG,KAAK,OAAO,EAAGF,CAAO,CACzE,CACJ,EACAR,GAAQ,QAAUO,+wDCpClB,IAAAM,GAAAC,EAAAC,IAAA,cACA,IAAIC,GAAmBD,IAAQA,GAAK,iBAAoB,SAAUE,EAAK,CACnE,OAAQA,GAAOA,EAAI,WAAcA,EAAM,CAAE,QAAWA,CAAI,CAC5D,EACA,OAAO,eAAeF,GAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAC5D,IAAMG,GAAsBF,GAAgB,IAA0D,EAChGG,GAAY,KACZC,GAAyB,KACzBC,GAAe,KACfC,GAAN,KAAwB,CACpB,YAAYC,EAAS,CACjB,KAAK,QAAU,CACX,kBAAmB,CACvB,EACA,KAAK,MAASC,GAAc,CACxB,IAAMC,EAAS,CACX,KAAM,GACN,KAAM,GACN,QAAS,EACb,EACA,QAAWC,KAAeR,GAAoB,QAAS,CACnD,IAAMS,EAAQN,GAAa,gBAAgBK,EAAY,MAAOF,CAAS,EACvE,GAAKG,EAEL,CAAAF,EAAO,KAAO,eACdA,EAAO,KAAOL,GAAuB,oBAAoBM,EAAY,KAAMC,CAAK,EAChFF,EAAO,QAAUN,GAAU,cAAcC,GAAuB,oBAAoBM,EAAY,QAASC,CAAK,EAAG,KAAK,QAAQ,iBAAiB,EAC/I,MACJ,CACA,OAAOF,CACX,EACA,KAAK,QAAU,OAAO,OAAO,OAAO,OAAO,CAAC,EAAG,KAAK,OAAO,EAAGF,CAAO,CACzE,CACJ,EACAR,GAAQ,QAAUO,siCClClB,IAAAM,GAAAC,EAAAC,IAAA,cACA,IAAIC,GAAmBD,IAAQA,GAAK,iBAAoB,SAAUE,EAAK,CACnE,OAAQA,GAAOA,EAAI,WAAcA,EAAM,CAAE,QAAWA,CAAI,CAC5D,EACA,OAAO,eAAeF,GAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAC5D,IAAMG,GAAaF,GAAgB,IAAiD,EAC9EG,GAAY,KACZC,GAAyB,KACzBC,GAAe,KACfC,GAAN,KAAuC,CACnC,YAAYC,EAAS,CACjB,KAAK,QAAU,CACX,kBAAmB,CACvB,EACA,KAAK,MAASC,GAAc,CACxB,IAAMC,EAAS,CACX,KAAM,GACN,KAAM,GACN,QAAS,EACb,EACA,QAAWC,KAA8BR,GAAW,QAAS,CACzD,IAAMS,EAAQN,GAAa,gBAAgBK,EAA2B,MAAOF,CAAS,EACtF,GAAKG,EAEL,CAAAF,EAAO,KAAO,+BACdA,EAAO,KAAOL,GAAuB,oBAAoBM,EAA2B,KAAMC,CAAK,EAC/FF,EAAO,QAAUN,GAAU,cAAcC,GAAuB,oBAAoBM,EAA2B,QAASC,CAAK,EAAG,KAAK,QAAQ,iBAAiB,EAC9J,MACJ,CACA,OAAOF,CACX,EACA,KAAK,QAAU,OAAO,OAAO,OAAO,OAAO,CAAC,EAAG,KAAK,OAAO,EAAGF,CAAO,CACzE,CACJ,EACAR,GAAQ,QAAUO,KClClB,IAAAM,GAAAC,EAAAC,IAAA,cACA,IAAIC,GAAmBD,IAAQA,GAAK,iBAAoB,SAAUE,EAAK,CACnE,OAAQA,GAAOA,EAAI,WAAcA,EAAM,CAAE,QAAWA,CAAI,CAC5D,EACA,OAAO,eAAeF,GAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAC5D,IAAMG,GAAYF,GAAgB,IAAoB,EAChDG,GAAgBH,GAAgB,IAAwB,EACxDI,GAAiBJ,GAAgB,IAAyB,EAC1DK,GAAcL,GAAgB,IAAsB,EACpDM,GAAkBN,GAAgB,IAA0B,EAC5DO,GAAkCP,GAAgB,IAA0C,EAC5FQ,GAAgB,CAClBJ,GAAe,QACfD,GAAc,QACdG,GAAgB,QAChBC,GAAgC,QAChCL,GAAU,QACVG,GAAY,OAChB,EACMI,GAAN,KAAmB,CACf,YAAYC,EAAS,CACjB,KAAK,QAAU,CACX,kBAAmB,CACvB,EACA,KAAK,MAASC,GAAc,CACxB,QAAWC,KAAUJ,GAAe,CAEhC,IAAMK,EADS,IAAID,EAAO,KAAK,OAAO,EAChB,MAAMD,CAAS,EACrC,GAAIE,EAAO,OAAS,GAChB,OAAOA,CACf,CACA,OAAO,IACX,EACA,KAAK,QAAU,OAAO,OAAO,OAAO,OAAO,CAAC,EAAG,KAAK,OAAO,EAAGH,CAAO,CACzE,CACJ,EACAX,GAAQ,QAAUU,sYCpClB,IAAAK,GAAAC,EAAAC,IAAA,cACA,IAAIC,GAAmBD,IAAQA,GAAK,iBAAoB,SAAUE,EAAK,CACnE,OAAQA,GAAOA,EAAI,WAAcA,EAAM,CAAE,QAAWA,CAAI,CAC5D,EACA,OAAO,eAAeF,GAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAC5D,IAAMG,GAAiBF,GAAgB,IAAqD,EACtFG,GAAyB,KACzBC,GAAe,KACfC,GAAN,KAAmB,CACf,aAAc,CACV,KAAK,MAASC,GAAc,CACxB,IAAMC,EAAS,CACX,KAAM,GACN,MAAO,GACP,MAAO,EACX,EACA,OAAW,CAACC,EAAOC,CAAM,IAAK,OAAO,QAAQP,GAAe,OAAO,EAAG,CAClE,IAAMQ,EAAQN,GAAa,gBAAgBK,EAAO,MAAOH,CAAS,EAClE,GAAKI,EAIL,IAFAH,EAAO,KAAO,SACdA,EAAO,MAAQC,EACX,UAAWC,GAAUA,EAAO,MAC5BF,EAAO,MAAQJ,GAAuB,oBAAoBM,EAAO,MAAOC,CAAK,EAAE,KAAK,UAE/E,WAAYD,GAAUA,EAAO,OAClC,QAAWE,KAASF,EAAO,OAAQ,CAC/B,IAAMG,EAAaR,GAAa,gBAAgBO,EAAM,MAAOL,CAAS,EACtE,GAAKM,EAEL,CAAAL,EAAO,MAAQJ,GAAuB,oBAAoBQ,EAAM,MAAOC,CAAU,EAAE,KAAK,EACxF,MACJ,CAEJ,MACJ,CACA,OAAOL,CACX,CACJ,CACJ,EACAR,GAAQ,QAAUM,gx6eCxClB,IAAAQ,GAAAC,EAAAC,IAAA,cACA,OAAO,eAAeA,GAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAC5DA,GAAQ,WAAcC,IAClBA,EAAQA,EAAM,QAAQ,KAAM,GAAG,EAC/BA,EAAQA,EAAM,QAAQ,OAAO,OAAQ,GAAG,EAAG,EAAE,EACzCA,IAAU,QACH,GACJA,KCPX,IAAAC,GAAAC,EAAAC,IAAA,cACA,IAAIC,GAAmBD,IAAQA,GAAK,iBAAoB,SAAUE,EAAK,CACnE,OAAQA,GAAOA,EAAI,WAAcA,EAAM,CAAE,QAAWA,CAAI,CAC5D,EACA,OAAO,eAAeF,GAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAC5D,IAAMG,GAAiBF,GAAgB,IAAqD,EACtFG,GAAyB,KACzBC,GAAe,KACfC,GAAU,KACVC,GAAN,KAAmB,CACf,aAAc,CACV,KAAK,MAASC,GAAc,CACxB,IAAMC,EAAS,CACX,KAAM,GACN,MAAO,GACP,MAAO,EACX,EACIC,EAAa,GACjB,OAAW,CAACC,EAAOC,CAAM,IAAK,OAAO,QAAQT,GAAe,OAAO,EAAG,CAClE,IAAMU,EAAQR,GAAa,gBAAgBO,EAAO,MAAOJ,CAAS,EAClE,GAAKK,EAIL,IAFAH,EAAa,WAAYE,GAAUA,EAAO,QAAU,GACpDH,EAAO,MAAQE,EACX,UAAWC,GAAUA,EAAO,MAC5BH,EAAO,MAAQH,GAAQ,WAAWF,GAAuB,oBAAoBQ,EAAO,MAAOC,CAAK,CAAC,EAAE,KAAK,UAEnG,WAAYD,GAAUA,EAAO,OAClC,QAAWE,KAASF,EAAO,OAAQ,CAC/B,IAAMG,EAAaV,GAAa,gBAAgBS,EAAM,MAAON,CAAS,EACtE,GAAKO,EAEL,CAAAN,EAAO,MAAQH,GAAQ,WAAWF,GAAuB,oBAAoBU,EAAM,MAAOC,CAAU,CAAC,EAAE,KAAK,EACxG,WAAYD,GAASA,EAAM,SAC3BJ,EAAaI,EAAM,QAEnB,UAAWA,IACXL,EAAO,MAAQK,EAAM,OAAS,IAElC,MACJ,CAEJ,MACJ,CAEA,OAAIJ,IAAe,KACfD,EAAO,KAAO,aAETC,IAAe,cACpBD,EAAO,KAAO,MAGdA,EAAO,KAAOC,EAGdD,EAAO,QAAU,YACjBA,EAAO,MAAQ,IAEZA,CACX,CACJ,CACJ,EACAT,GAAQ,QAAUO,u0QC9DlB,IAAAS,GAAAC,EAAAC,IAAA,cACA,IAAIC,GAAmBD,IAAQA,GAAK,iBAAoB,SAAUE,EAAK,CACnE,OAAQA,GAAOA,EAAI,WAAcA,EAAM,CAAE,QAAWA,CAAI,CAC5D,EACA,OAAO,eAAeF,GAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAC5D,IAAMG,GAAqBF,GAAgB,IAAyD,EAC9FG,GAAyB,KACzBC,GAAe,KACfC,GAAU,KACVC,GAAN,KAAuB,CACnB,aAAc,CACV,KAAK,MAASC,GAAc,CACxB,IAAMC,EAAS,CACX,KAAM,GACN,MAAO,GACP,MAAO,EACX,EACA,GAAI,CAAC,KAAK,QAAQD,CAAS,EACvB,OAAOC,EACXA,EAAO,KAAO,aACd,OAAW,CAACC,EAAOC,CAAU,IAAK,OAAO,QAAQR,GAAmB,OAAO,EAAG,CAC1E,IAAMS,EAAQP,GAAa,gBAAgBM,EAAW,MAAOH,CAAS,EACtE,GAAKI,EAGL,IADAH,EAAO,MAAQC,EACX,UAAWC,GAAcA,EAAW,MACpCF,EAAO,MAAQH,GAAQ,WAAWF,GAAuB,oBAAoBO,EAAW,MAAOC,CAAK,CAAC,EAAE,KAAK,UAEvG,WAAYD,GAAcA,EAAW,OAC1C,QAAWE,KAASF,EAAW,OAAQ,CACnC,IAAMG,EAAaT,GAAa,gBAAgBQ,EAAM,MAAOL,CAAS,EACtE,GAAKM,EAEL,CAAAL,EAAO,MAAQH,GAAQ,WAAWF,GAAuB,oBAAoBS,EAAM,MAAOC,CAAU,CAAC,EAAE,KAAK,EAC5G,MACJ,CAEJ,MACJ,CACA,OAAOL,CACX,EACA,KAAK,QAAWD,GACLH,GAAa,gBAAgB,qCAAwCG,CAAS,CAE7F,CACJ,EACAR,GAAQ,QAAUO,mYC9ClB,IAAAQ,GAAAC,EAAAC,IAAA,cACA,IAAIC,GAAmBD,IAAQA,GAAK,iBAAoB,SAAUE,EAAK,CACnE,OAAQA,GAAOA,EAAI,WAAcA,EAAM,CAAE,QAAWA,CAAI,CAC5D,EACA,OAAO,eAAeF,GAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAC5D,IAAMG,GAAsBF,GAAgB,IAA0D,EAChGG,GAAyB,KACzBC,GAAe,KACfC,GAAN,KAAgB,CACZ,aAAc,CACV,KAAK,MAASC,GAAc,CACxB,IAAMC,EAAS,CACX,KAAM,GACN,MAAO,GACP,MAAO,EACX,EACA,OAAW,CAACC,EAAOC,CAAG,IAAK,OAAO,QAAQP,GAAoB,OAAO,EAEjE,GADcE,GAAa,gBAAgBK,EAAI,MAAOH,CAAS,EAG/D,CAAAC,EAAO,KAAO,MACdA,EAAO,MAAQC,EACf,QAAWE,KAASD,EAAI,OAAQ,CAC5B,IAAME,EAAQP,GAAa,gBAAgBM,EAAM,MAAOJ,CAAS,EAC5DK,IAELJ,EAAO,MAAQJ,GAAuB,oBAAoBO,EAAM,MAAOC,CAAK,EAAE,KAAK,EACvF,CACA,MAEJ,OAAOJ,CACX,CACJ,CACJ,EACAR,GAAQ,QAAUM,yoBClClB,IAAAO,GAAAC,EAAAC,IAAA,cACA,IAAIC,GAAmBD,IAAQA,GAAK,iBAAoB,SAAUE,EAAK,CACnE,OAAQA,GAAOA,EAAI,WAAcA,EAAM,CAAE,QAAWA,CAAI,CAC5D,EACA,OAAO,eAAeF,GAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAC5D,IAAMG,GAAkBF,GAAgB,IAAsD,EACxFG,GAAyB,KACzBC,GAAe,KACfC,GAAN,KAAoB,CAChB,aAAc,CACV,KAAK,MAASC,GAAc,CACxB,IAAMC,EAAS,CACX,KAAM,GACN,MAAO,GACP,MAAO,EACX,EACA,OAAW,CAACC,EAAOC,CAAW,IAAK,OAAO,QAAQP,GAAgB,OAAO,EAAG,CACxE,IAAMQ,EAAQN,GAAa,gBAAgBK,EAAY,MAAOH,CAAS,EACvE,GAAKI,EAIL,IAFAH,EAAO,KAAOE,EAAY,OAC1BF,EAAO,MAAQC,EACX,UAAWC,GAAeA,EAAY,MACtCF,EAAO,MAAQJ,GAAuB,oBAAoBM,EAAY,MAAOC,CAAK,EAAE,KAAK,UAEpF,WAAYD,GAAeA,EAAY,OAC5C,QAAWE,KAASF,EAAY,OAAQ,CACpC,IAAMG,EAAaR,GAAa,gBAAgBO,EAAM,MAAOL,CAAS,EACtE,GAAKM,EAEL,CAAAL,EAAO,MAAQJ,GAAuB,oBAAoBQ,EAAM,MAAOC,CAAU,EAAE,KAAK,EACxF,MACJ,CAEJ,MACJ,CACA,OAAOL,CACX,CACJ,CACJ,EACAR,GAAQ,QAAUM,83ECxClB,IAAAQ,GAAAC,EAAAC,IAAA,cACA,IAAIC,GAAmBD,IAAQA,GAAK,iBAAoB,SAAUE,EAAK,CACnE,OAAQA,GAAOA,EAAI,WAAcA,EAAM,CAAE,QAAWA,CAAI,CAC5D,EACA,OAAO,eAAeF,GAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAC5D,IAAMG,GAAmBF,GAAgB,IAAuD,EAC1FG,GAAyB,KACzBC,GAAe,KACfC,GAAU,KACVC,GAAN,KAAsB,CAClB,aAAc,CACV,KAAK,MAASC,GAAc,CACxB,IAAMC,EAAS,CACX,KAAM,GACN,MAAO,GACP,MAAO,EACX,EACA,GAAI,CAACJ,GAAa,gBAAgB,QAASG,CAAS,EAChD,OAAOC,EAEX,OAAW,CAACC,EAAOC,CAAQ,IAAK,OAAO,QAAQR,GAAiB,OAAO,EAAG,CACtE,IAAMS,EAAQP,GAAa,gBAAgBM,EAAS,MAAOH,CAAS,EACpE,GAAKI,EAIL,IAFAH,EAAO,KAAO,UACdA,EAAO,MAAQC,EACX,UAAWC,GAAYA,EAAS,MAChCF,EAAO,MAAQH,GAAQ,WAAWF,GAAuB,oBAAoBO,EAAS,MAAOC,CAAK,CAAC,EAAE,KAAK,UAErG,WAAYD,GAAYA,EAAS,OACtC,QAAWE,KAASF,EAAS,OAAQ,CACjC,IAAMC,EAAQP,GAAa,gBAAgBQ,EAAM,MAAOL,CAAS,EAC5DI,IAELH,EAAO,MAAQL,GAAuB,oBAAoBS,EAAM,MAAOD,CAAK,EAAE,KAAK,EACvF,CAEJ,MACJ,CACA,OAAOH,CACX,CACJ,CACJ,EACAT,GAAQ,QAAUO,k4CC3ClB,IAAAO,GAAAC,EAAAC,IAAA,cACA,IAAIC,GAAmBD,IAAQA,GAAK,iBAAoB,SAAUE,EAAK,CACnE,OAAQA,GAAOA,EAAI,WAAcA,EAAM,CAAE,QAAWA,CAAI,CAC5D,EACA,OAAO,eAAeF,GAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAC5D,IAAMG,GAA+BF,GAAgB,IAAmE,EAClHG,GAAyB,KACzBC,GAAe,KACfC,GAAN,KAAiC,CAC7B,aAAc,CACV,KAAK,MAASC,GAAc,CACxB,IAAMC,EAAS,CACX,KAAM,GACN,MAAO,GACP,MAAO,EACX,EACA,OAAW,CAACC,EAAOC,CAAmB,IAAK,OAAO,QAAQP,GAA6B,OAAO,EAAG,CAC7F,IAAMQ,EAAQN,GAAa,gBAAgBK,EAAoB,MAAOH,CAAS,EAC/E,GAAKI,EAIL,IAFAH,EAAO,KAAOE,EAAoB,OAClCF,EAAO,MAAQC,EACX,UAAWC,GAAuBA,EAAoB,MACtDF,EAAO,MAAQJ,GAAuB,oBAAoBM,EAAoB,MAAOC,CAAK,EAAE,KAAK,UAE5F,WAAYD,GAAuBA,EAAoB,OAC5D,QAAWE,KAASF,EAAoB,OAAQ,CAC5C,IAAMG,EAAaR,GAAa,gBAAgBO,EAAM,MAAOL,CAAS,EACtE,GAAKM,EAEL,CAAAL,EAAO,MAAQJ,GAAuB,oBAAoBQ,EAAM,MAAOC,CAAU,EAAE,KAAK,EACxF,MACJ,CAEJ,MACJ,CACA,OAAOL,CACX,CACJ,CACJ,EACAR,GAAQ,QAAUM,KCxClB,IAAAQ,GAAAC,EAAAC,IAAA,cACA,IAAIC,GAAmBD,IAAQA,GAAK,iBAAoB,SAAUE,EAAK,CACnE,OAAQA,GAAOA,EAAI,WAAcA,EAAM,CAAE,QAAWA,CAAI,CAC5D,EACA,OAAO,eAAeF,GAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAC5D,IAAMG,GAAYF,GAAgB,IAAoB,EAChDG,GAAYH,GAAgB,IAAoB,EAChDI,GAAgBJ,GAAgB,IAAwB,EACxDK,GAASL,GAAgB,IAAiB,EAC1CM,GAAaN,GAAgB,IAAqB,EAClDO,GAAcP,GAAgB,IAAsB,EACpDQ,GAA2BR,GAAgB,IAAmC,EAC9ES,GAAgB,CAClBH,GAAW,QACXD,GAAO,QACPH,GAAU,QACVE,GAAc,QACdI,GAAyB,QACzBL,GAAU,QACVI,GAAY,OAChB,EACMG,GAAN,KAAmB,CACf,aAAc,CACV,KAAK,MAASC,GAAc,CACxB,QAAWC,KAAUH,GAAe,CAEhC,IAAMI,EADS,IAAID,EAAO,EACJ,MAAMD,CAAS,EACrC,GAAIE,EAAO,OAAS,GAChB,OAAOA,CAEf,CACA,OAAO,IACX,CACJ,CACJ,EACAd,GAAQ,QAAUW,+qqBCnClB,IAAAI,GAAAC,EAAAC,IAAA,cACA,IAAIC,GAAmBD,IAAQA,GAAK,iBAAoB,SAAUE,EAAK,CACnE,OAAQA,GAAOA,EAAI,WAAcA,EAAM,CAAE,QAAWA,CAAI,CAC5D,EACA,OAAO,eAAeF,GAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAC5D,IAAMG,GAAaF,GAAgB,IAA0C,EACvEG,GAAY,KACZC,GAAyB,KACzBC,GAAe,KACfC,GAA0BN,GAAgB,IAA2C,EACrFO,GAAiB,CAAC,UAAW,MAAO,YAAa,MAAO,OAAQ,UAAW,OAAQ,WAAW,EAC9FC,GAAeF,GAAwB,QAAQ,gBAC/CG,GAAaH,GAAwB,QAAQ,WAC7CI,GAAN,KAA4B,CACxB,YAAYC,EAAS,CACjB,KAAK,QAAU,CACX,kBAAmB,CACvB,EACA,KAAK,MAASC,GAAc,CACxB,IAAMC,EAAS,CACX,KAAM,GACN,QAAS,GACT,SAAU,KAAK,cAAcD,CAAS,CAC1C,EACA,QAAWE,KAAmBZ,GAAW,QAAS,CAC9C,IAAMa,EAAQV,GAAa,gBAAgBS,EAAgB,MAAOF,CAAS,EAC3E,GAAKG,EAEL,OAAAF,EAAO,KAAOT,GAAuB,oBAAoBU,EAAgB,KAAMC,CAAK,EACpFF,EAAO,QAAUV,GAAU,cAAcC,GAAuB,oBAAoBU,EAAgB,QAASC,CAAK,EAAG,KAAK,QAAQ,iBAAiB,EAC/IF,EAAO,OAAS,YAChBA,EAAO,KAAO,WAEdA,EAAO,OAAS,WAChBA,EAAO,KAAO,UAEdA,EAAO,OAAS,UAChBA,EAAO,KAAO,SAEXA,CACX,CACA,OAAO,IACX,EACA,KAAK,cAAiBD,GACdP,GAAa,gBAAgB,oCAAqCO,CAAS,EACpE,MAEPP,GAAa,gBAAgB,OAAQO,CAAS,EACvC,OAEPP,GAAa,gBAAgB,MAAOO,CAAS,EACtC,SAEPP,GAAa,gBAAgB,gCAAiCO,CAAS,EAChE,MAEPP,GAAa,gBAAgB,uBAAwBO,CAAS,EACvD,MAEJ,GAEX,KAAK,QAAU,OAAO,OAAO,OAAO,OAAO,CAAC,EAAG,KAAK,OAAO,EAAGD,CAAO,CACzE,CACJ,EACAZ,GAAQ,QAAUW,GAClBA,GAAsB,kBAAoB,IAAMH,GAChDG,GAAsB,YAAeM,GAAW,CAC5C,IAAMC,EAAcP,GAAsB,eAAeM,CAAM,EAC/D,OAAW,CAACE,EAAUC,CAAU,IAAK,OAAO,QAAQV,EAAU,EAC1D,GAAIU,EAAW,SAASF,CAAW,EAC/B,OAAOC,EAGf,MAAO,EACX,EACAR,GAAsB,eAAkBM,GAAW,CAC/C,OAAW,CAACI,EAAWC,CAAI,IAAK,OAAO,QAAQb,EAAY,EACvD,GAAIa,IAASL,EACT,OAAOI,EAEf,MAAO,EACX,8kBCjFA,IAAAE,GAAAC,EAAAC,IAAA,cACA,IAAIC,GAAmBD,IAAQA,GAAK,iBAAoB,SAAUE,EAAK,CACnE,OAAQA,GAAOA,EAAI,WAAcA,EAAM,CAAE,QAAWA,CAAI,CAC5D,EACA,OAAO,eAAeF,GAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAC5D,IAAMG,GAAyBF,GAAgB,IAAsD,EAC/FG,GAAe,KACfC,GAAN,KAA2B,CACvB,aAAc,CACV,KAAK,MAASC,GAAc,CACxB,OAAW,CAACC,EAAOC,CAAc,IAAK,OAAO,QAAQL,GAAuB,OAAO,EAC/E,QAAWM,KAASD,EAEhB,GADcJ,GAAa,gBAAgBK,EAAOH,CAAS,EAG3D,OAAOC,EAGf,MAAO,EACX,CACJ,CACJ,EACAP,GAAQ,QAAUK,u+gDCtBlB,IAAAK,GAAAC,EAAA,CAAAC,GAAAC,KAAA,cACA,IAAIC,GAAmBF,IAAQA,GAAK,iBAAoB,SAAUG,EAAK,CACnE,OAAQA,GAAOA,EAAI,WAAcA,EAAM,CAAE,QAAWA,CAAI,CAC5D,EACMC,GAAcF,GAAgB,IAA2C,EACzEG,GAAe,KACfC,GAAN,KAAgB,CACZ,aAAc,CACV,KAAK,MAASC,GAAc,CACxB,IAAIC,EAAIC,EAAIC,EAAIC,EAChB,QAAWC,KAAOR,GAAY,QAE1B,GADcC,GAAa,gBAAgBO,EAAI,MAAOL,CAAS,EAG/D,MAAO,CACH,KAAMK,EAAI,KACV,SAAUA,EAAI,UAAY,GAC1B,IAAKA,EAAI,KAAO,GAChB,SAAU,CACN,OAAQH,GAAMD,EAAKI,KAAS,MAAQJ,IAAO,OAAS,OAASA,EAAG,YAAc,MAAQC,IAAO,OAAS,OAASA,EAAG,OAAS,GAC3H,MAAOE,GAAMD,EAAKE,KAAS,MAAQF,IAAO,OAAS,OAASA,EAAG,YAAc,MAAQC,IAAO,OAAS,OAASA,EAAG,MAAQ,EAC7H,CACJ,EAEJ,OAAO,IACX,CACJ,CACJ,EACAV,GAAO,QAAUK,KC5BjB,IAAAO,GAAAC,EAAAC,IAAA,cACA,OAAO,eAAeA,GAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAC5DA,GAAQ,eAAiB,CAACC,EAAIC,EAAIC,IAAa,CAiB3C,IAAI,EACAC,EACAC,EAAU,EAQRC,EAAK,CACP,IAAO,GACP,MAAS,GACT,EAAK,GACL,KAAQ,GACR,EAAK,GACL,GAAM,GACN,GAAM,GACN,IAAK,GACL,EAAK,EACL,GAAM,CACV,EAUMC,EAAeC,IACjBA,GAAK,GAAKA,GAAG,QAAQ,UAAW,GAAG,EACnCA,EAAIA,EAAE,QAAQ,aAAc,MAAM,EAAE,QAAQ,UAAW,GAAG,EACjDA,EAAE,OAAgBA,EAAE,MAAM,GAAG,EAAlB,CAAC,EAAE,GAMrBC,EAAcD,GACRA,EAAS,MAAMA,CAAC,EAAIF,EAAGE,IAAM,GAAK,SAASA,EAAG,EAAE,EAA5C,EAKhB,IAHAP,EAAKM,EAAYN,CAAE,EACnBC,EAAKK,EAAYL,CAAE,EACnBE,EAAI,KAAK,IAAIH,EAAG,OAAQC,EAAG,MAAM,EAC5B,EAAI,EAAG,EAAIE,EAAG,IACf,GAAIH,EAAG,KAAOC,EAAG,IAKjB,GAFAD,EAAG,GAAKQ,EAAWR,EAAG,EAAE,EACxBC,EAAG,GAAKO,EAAWP,EAAG,EAAE,EACpBD,EAAG,GAAKC,EAAG,GAAI,CACfG,EAAU,GACV,KACJ,SACSJ,EAAG,GAAKC,EAAG,GAAI,CACpBG,EAAU,EACV,KACJ,EAEJ,GAAI,CAACF,EACD,OAAOE,EAKX,OAAQF,EAAU,CACd,IAAK,IACL,IAAK,KACD,OAAQE,EAAU,EACtB,IAAK,KACL,IAAK,KACD,OAAQA,GAAW,EACvB,IAAK,KACL,IAAK,KACD,OAAQA,GAAW,EACvB,IAAK,MACL,IAAK,IACL,IAAK,KACD,OAAQA,IAAY,EACxB,IAAK,KACL,IAAK,MACL,IAAK,KACD,OAAQA,IAAY,EACxB,IAAK,GACL,IAAK,IACL,IAAK,KACD,OAAQA,EAAU,EACtB,QACI,OAAO,IACf,CACJ,IC/GA,IAAAK,GAAAC,EAAA,CAAAC,GAAAC,KAAA,cACA,IAAIC,GAAmBF,IAAQA,GAAK,iBAAoB,SAAUG,EAAK,CACnE,OAAQA,GAAOA,EAAI,WAAcA,EAAM,CAAE,QAAWA,CAAI,CAC5D,EACMC,GAAWF,GAAgB,IAA2B,EACtDG,GAAWH,GAAgB,IAA2B,EACtDI,GAAqBJ,GAAgB,IAAqC,EAC1EK,GAAoBL,GAAgB,IAAoC,EACxEM,GAAYN,GAAgB,IAAmC,EAC/DO,GAAY,KACZC,GAAe,KACfC,GAAoB,KACpBC,GAAN,KAAqB,CACjB,YAAYC,EAAS,CAEjB,KAAK,QAAU,CACX,iBAAkB,GAClB,kBAAmB,CACvB,EACA,KAAK,MAASC,GAAc,CACxB,IAAIC,EAAIC,EAAIC,EAAIC,EAAIC,EAAIC,EAAIC,EAAIC,EAAIC,EAAIC,EAAIC,EAAIC,EAAIC,EAAIC,EACxD,IAAMC,EAAS,CACX,OAAQ,KAAK,aAAa,MAAMf,CAAS,EACzC,GAAI,KAAK,sBAAsB,MAAMA,CAAS,EAC9C,OAAQ,KAAK,aAAa,MAAMA,CAAS,EACzC,IAAK,KAAK,QAAQ,iBAAmB,KAAO,KAAK,UAAU,MAAMA,CAAS,CAC9E,EACMgB,GAAUf,EAAKc,EAAO,MAAQ,MAAQd,IAAO,OAAS,OAASA,EAAG,KAClEgB,GAAaf,EAAKa,EAAO,MAAQ,MAAQb,IAAO,OAAS,OAASA,EAAG,QACrEgB,EAAW1B,GAAmB,QAAQ,YAAYwB,GAAU,EAAE,EACpE,GAAI,EAAG,GAAAb,EAAKY,EAAO,UAAY,MAAQZ,IAAO,SAAkBA,EAAG,OAAQ,CACvE,IAAMgB,GAAQ,KAAK,qBAAqB,MAAMnB,CAAS,EACnDmB,KACKJ,EAAO,SACRA,EAAO,OAAS,KAAK,mBAAmB,GAE5CA,EAAO,OAAO,MAAQI,GAE9B,CAIA,MAAI,EAAG,GAAAf,EAAKW,EAAO,UAAY,MAAQX,IAAO,SAAkBA,EAAG,QAAU,CAAC,WAAY,UAAW,MAAO,KAAK,EAAE,SAASY,GAAU,EAAE,IAC/HD,EAAO,SACRA,EAAO,OAAS,KAAK,mBAAmB,GAE5CA,EAAO,OAAO,MAAQ,SAStB,EAAG,GAAAV,EAAKU,EAAO,UAAY,MAAQV,IAAO,SAAkBA,EAAG,OAASa,IAAa,WAAatB,GAAa,gBAAgB,mBAAoBI,CAAS,IACxJJ,GAAa,gBAAgB,mCAAoCI,CAAS,GACrEe,EAAO,SACRA,EAAO,OAAS,KAAK,mBAAmB,GAE5CA,EAAO,OAAO,KAAO,cAEhBnB,GAAa,gBAAgB,4BAA6BI,CAAS,IACnEe,EAAO,SACRA,EAAO,OAAS,KAAK,mBAAmB,GAE5CA,EAAO,OAAO,KAAO,YAMzB,EAAG,GAAAT,EAAKS,EAAO,UAAY,MAAQT,IAAO,SAAkBA,EAAG,OAAS,KAAK,yBAAyBN,CAAS,GAAKJ,GAAa,gBAAgB,eAAgBI,CAAS,KACrKe,EAAO,SACRA,EAAO,OAAS,KAAK,mBAAmB,GAE5CA,EAAO,OAAO,KAAO,UAKrB,EAAG,GAAAR,EAAKQ,EAAO,UAAY,MAAQR,IAAO,SAAkBA,EAAG,OAAS,KAAK,yBAAyBP,CAAS,IAC1Ge,EAAO,SACRA,EAAO,OAAS,KAAK,mBAAmB,GAE5CA,EAAO,OAAO,KAAO,cAUrB,EAAG,GAAAP,EAAKO,EAAO,UAAY,MAAQP,IAAO,SAAkBA,EAAG,OAASQ,IAAW,WAAaC,IAAc,KAC1GpB,GAAkB,eAAeoB,EAAW,KAAK,IAAM,IAClDF,EAAO,SACRA,EAAO,OAAS,KAAK,mBAAmB,GAE5CA,EAAO,OAAO,KAAO,cAEhBlB,GAAkB,eAAeoB,EAAW,KAAK,GAAK,GAAKpB,GAAkB,eAAeoB,EAAW,KAAK,IAAM,KAClHF,EAAO,SACRA,EAAO,OAAS,KAAK,mBAAmB,GAE5CA,EAAO,OAAO,KAAO,aAMvBN,EAAKM,EAAO,UAAY,MAAQN,IAAO,OAAS,OAASA,EAAG,QAAU,iBAAmBS,IAAa,YACxGH,EAAO,OAAO,KAAO,cAWrB,EAAG,GAAAL,EAAKK,EAAO,UAAY,MAAQL,IAAO,SAAkBA,EAAG,OAC5D,KAAK,gBAAgBV,CAAS,IAC7BgB,IAAW,cACPA,IAAW,WACRnB,GAAkB,eAAeoB,EAAW,KAAK,GAAK,KAC5DF,EAAO,SACRA,EAAO,OAAS,KAAK,mBAAmB,GAE5CA,EAAO,OAAO,KAAO,UAKrBnB,GAAa,gBAAgB,iBAAkBI,CAAS,IACnDe,EAAO,SACRA,EAAO,OAAS,KAAK,mBAAmB,GAE5CA,EAAO,OAAO,KAAO,cAKrBnB,GAAa,gBAAgB,yBAA0BI,CAAS,IAC3De,EAAO,SACRA,EAAO,OAAS,KAAK,mBAAmB,GAE5CA,EAAO,OAAO,KAAO,cAKrB,EAAG,GAAAJ,EAAKI,EAAO,UAAY,MAAQJ,IAAO,SAAkBA,EAAG,OAAS,CAAC,OAAQ,mBAAmB,EAAE,WAAWC,EAAKG,EAAO,UAAY,MAAQH,IAAO,OAAS,OAASA,EAAG,OAAS,EAAE,IACnLG,EAAO,SACRA,EAAO,OAAS,KAAK,mBAAmB,GAE5CA,EAAO,OAAO,KAAO,gBAKUF,EAAKE,EAAO,UAAY,MAAQF,IAAO,OAAS,OAASA,EAAG,QAA5E,WACHjB,GAAa,gBAAgB,UAAWI,CAAS,IAA1D,MACA,KAAK,mBAAmBA,CAAS,IAE/Be,EAAO,SACRA,EAAO,OAAS,KAAK,mBAAmB,GAE5CA,EAAO,OAAO,KAAO,WAGrB,EAAG,GAAAD,EAAKC,EAAO,UAAY,MAAQD,IAAO,SAAkBA,EAAG,OAAS,KAAK,UAAUC,EAAQG,CAAQ,IAClGH,EAAO,SACRA,EAAO,OAAS,KAAK,mBAAmB,GAE5CA,EAAO,OAAO,KAAO,WAElBA,CACX,EACA,KAAK,yBAA4Bf,GACtBJ,GAAa,gBAAgB,8BAAgCI,CAAS,EAEjF,KAAK,yBAA4BA,GACtBJ,GAAa,gBAAgB,8BAAgCI,CAAS,EAEjF,KAAK,mBAAsBA,GAChBJ,GAAa,gBAAgB,8BAA+BI,CAAS,EAEhF,KAAK,UAAY,CAACe,EAAQG,IAClB,CAACH,EAAO,IAIR,KAAK,kBAAkBA,EAAO,MAAM,EAC7B,GAEJvB,GAAmB,QAAQ,kBAAkB,EAAE,SAAS0B,CAAQ,EAE3E,KAAK,kBAAqBE,GAAW,CACjC,IAAInB,EAAIC,EACR,OAAKkB,IAEInB,EAAKmB,KAAY,MAAQnB,IAAO,OAAS,OAASA,EAAG,QAAU,WAAaP,GAAU,QAAQ,qBAAqBQ,EAAKkB,KAAY,MAAQlB,IAAO,OAAS,OAASA,EAAG,IAAI,EAD1K,EAEf,EACA,KAAK,gBAAmBF,GACbJ,GAAa,gBAAgB,QAASI,CAAS,EAE1D,KAAK,mBAAqB,KAAO,CAC7B,KAAM,GACN,MAAO,GACP,MAAO,EACX,GACA,KAAK,QAAU,OAAO,OAAO,OAAO,OAAO,CAAC,EAAG,KAAK,OAAO,EAAGD,CAAO,EACrE,KAAK,aAAe,IAAIT,GAAS,QAAQ,KAAK,OAAO,EACrD,KAAK,aAAe,IAAIC,GAAS,QACjC,KAAK,sBAAwB,IAAIC,GAAmB,QAAQ,KAAK,OAAO,EACxE,KAAK,qBAAuB,IAAIC,GAAkB,QAClD,KAAK,UAAY,IAAIE,EACzB,CACJ,EACAR,GAAO,QAAUW,KC/NjB,IAAAuB,GAAAC,EAAA,CAAAC,GAAAC,KAAA,EAAC,SAASC,EAAMC,EAAS,CACrB,aAII,OAAO,QAAW,YAAc,OAAO,IACvC,OAAO,aAAc,CAAC,EAAGA,CAAO,EACzB,OAAOH,IAAY,SAC1BC,GAAO,QAAUE,EAAQ,EAEzBD,EAAK,WAAaC,EAAQ,CAElC,GAAEH,GAAM,UAAW,CACf,aACA,SAASI,EAAUC,EAAG,CAClB,MAAO,CAAC,MAAM,WAAWA,CAAC,CAAC,GAAK,SAASA,CAAC,CAC9C,CAEA,SAASC,EAAYC,EAAK,CACtB,OAAOA,EAAI,OAAO,CAAC,EAAE,YAAY,EAAIA,EAAI,UAAU,CAAC,CACxD,CAEA,SAASC,EAAQC,EAAG,CAChB,OAAO,UAAW,CACd,OAAO,KAAKA,EAChB,CACJ,CAEA,IAAIC,EAAe,CAAC,gBAAiB,SAAU,WAAY,YAAY,EACnEC,EAAe,CAAC,eAAgB,YAAY,EAC5CC,EAAc,CAAC,WAAY,eAAgB,QAAQ,EACnDC,EAAa,CAAC,MAAM,EACpBC,EAAc,CAAC,YAAY,EAE3BC,EAAQL,EAAa,OAAOC,EAAcC,EAAaC,EAAYC,CAAW,EAElF,SAASE,EAAWC,EAAK,CACrB,GAAKA,EACL,QAASC,EAAI,EAAGA,EAAIH,EAAM,OAAQG,IAC1BD,EAAIF,EAAMG,MAAQ,QAClB,KAAK,MAAQZ,EAAYS,EAAMG,EAAE,GAAGD,EAAIF,EAAMG,GAAG,CAG7D,CAEAF,EAAW,UAAY,CACnB,QAAS,UAAW,CAChB,OAAO,KAAK,IAChB,EACA,QAAS,SAAS,EAAG,CACjB,GAAI,OAAO,UAAU,SAAS,KAAK,CAAC,IAAM,iBACtC,MAAM,IAAI,UAAU,uBAAuB,EAE/C,KAAK,KAAO,CAChB,EAEA,cAAe,UAAW,CACtB,OAAO,KAAK,UAChB,EACA,cAAe,SAAS,EAAG,CACvB,GAAI,aAAaA,EACb,KAAK,WAAa,UACX,aAAa,OACpB,KAAK,WAAa,IAAIA,EAAW,CAAC,MAElC,OAAM,IAAI,UAAU,6CAA6C,CAEzE,EAEA,SAAU,UAAW,CACjB,IAAIG,EAAW,KAAK,YAAY,GAAK,GACjCC,EAAa,KAAK,cAAc,GAAK,GACrCC,EAAe,KAAK,gBAAgB,GAAK,GACzCC,EAAe,KAAK,gBAAgB,GAAK,GAC7C,OAAI,KAAK,UAAU,EACXH,EACO,WAAaA,EAAW,IAAMC,EAAa,IAAMC,EAAe,IAEpE,UAAYD,EAAa,IAAMC,EAEtCC,EACOA,EAAe,KAAOH,EAAW,IAAMC,EAAa,IAAMC,EAAe,IAE7EF,EAAW,IAAMC,EAAa,IAAMC,CAC/C,CACJ,EAEAL,EAAW,WAAa,SAAgCT,EAAK,CACzD,IAAIgB,EAAiBhB,EAAI,QAAQ,GAAG,EAChCiB,EAAejB,EAAI,YAAY,GAAG,EAElCe,EAAef,EAAI,UAAU,EAAGgB,CAAc,EAC9CE,EAAOlB,EAAI,UAAUgB,EAAiB,EAAGC,CAAY,EAAE,MAAM,GAAG,EAChEE,EAAiBnB,EAAI,UAAUiB,EAAe,CAAC,EAEnD,GAAIE,EAAe,QAAQ,GAAG,IAAM,EAChC,IAAIC,EAAQ,gCAAgC,KAAKD,EAAgB,EAAE,EAC/DP,GAAWQ,EAAM,GACjBP,GAAaO,EAAM,GACnBN,GAAeM,EAAM,GAG7B,OAAO,IAAIX,EAAW,CAClB,aAAcM,EACd,KAAMG,GAAQ,OACd,SAAUN,GACV,WAAYC,IAAc,OAC1B,aAAcC,IAAgB,MAClC,CAAC,CACL,EAEA,QAASH,EAAI,EAAGA,EAAIR,EAAa,OAAQQ,IACrCF,EAAW,UAAU,MAAQV,EAAYI,EAAaQ,EAAE,GAAKV,EAAQE,EAAaQ,EAAE,EACpFF,EAAW,UAAU,MAAQV,EAAYI,EAAaQ,EAAE,GAAM,SAAST,EAAG,CACtE,OAAO,SAASmB,EAAG,CACf,KAAKnB,GAAK,QAAQmB,CAAC,CACvB,CACJ,EAAGlB,EAAaQ,EAAE,EAGtB,QAASW,EAAI,EAAGA,EAAIlB,EAAa,OAAQkB,IACrCb,EAAW,UAAU,MAAQV,EAAYK,EAAakB,EAAE,GAAKrB,EAAQG,EAAakB,EAAE,EACpFb,EAAW,UAAU,MAAQV,EAAYK,EAAakB,EAAE,GAAM,SAASpB,EAAG,CACtE,OAAO,SAASmB,EAAG,CACf,GAAI,CAACxB,EAAUwB,CAAC,EACZ,MAAM,IAAI,UAAUnB,EAAI,mBAAmB,EAE/C,KAAKA,GAAK,OAAOmB,CAAC,CACtB,CACJ,EAAGjB,EAAakB,EAAE,EAGtB,QAASC,EAAI,EAAGA,EAAIlB,EAAY,OAAQkB,IACpCd,EAAW,UAAU,MAAQV,EAAYM,EAAYkB,EAAE,GAAKtB,EAAQI,EAAYkB,EAAE,EAClFd,EAAW,UAAU,MAAQV,EAAYM,EAAYkB,EAAE,GAAM,SAASrB,EAAG,CACrE,OAAO,SAASmB,EAAG,CACf,KAAKnB,GAAK,OAAOmB,CAAC,CACtB,CACJ,EAAGhB,EAAYkB,EAAE,EAGrB,OAAOd,CACX,CAAC,IC9ID,IAAAe,GAAAC,EAAA,CAAAC,GAAAC,KAAA,EAAC,SAASC,EAAMC,EAAS,CACrB,aAII,OAAO,QAAW,YAAc,OAAO,IACvC,OAAO,qBAAsB,CAAC,YAAY,EAAGA,CAAO,EAC7C,OAAOH,IAAY,SAC1BC,GAAO,QAAUE,EAAQ,IAAqB,EAE9CD,EAAK,iBAAmBC,EAAQD,EAAK,UAAU,CAEvD,GAAEF,GAAM,SAA0BI,EAAY,CAC1C,aAEA,IAAIC,EAA8B,eAC9BC,EAAyB,iCACzBC,EAA4B,8BAEhC,MAAO,CAOH,MAAO,SAAiCC,EAAO,CAC3C,GAAI,OAAOA,EAAM,WAAe,KAAe,OAAOA,EAAM,mBAAuB,IAC/E,OAAO,KAAK,WAAWA,CAAK,EACzB,GAAIA,EAAM,OAASA,EAAM,MAAM,MAAMF,CAAsB,EAC9D,OAAO,KAAK,YAAYE,CAAK,EAC1B,GAAIA,EAAM,MACb,OAAO,KAAK,gBAAgBA,CAAK,EAEjC,MAAM,IAAI,MAAM,iCAAiC,CAEzD,EAGA,gBAAiB,SAA2CC,EAAS,CAEjE,GAAIA,EAAQ,QAAQ,GAAG,IAAM,GACzB,MAAO,CAACA,CAAO,EAGnB,IAAIC,EAAS,+BACTC,EAAQD,EAAO,KAAKD,EAAQ,QAAQ,QAAS,EAAE,CAAC,EACpD,MAAO,CAACE,EAAM,GAAIA,EAAM,IAAM,OAAWA,EAAM,IAAM,MAAS,CAClE,EAEA,YAAa,SAAuCH,EAAO,CACvD,IAAII,EAAWJ,EAAM,MAAM,MAAM;AAAA,CAAI,EAAE,OAAO,SAASK,EAAM,CACzD,MAAO,CAAC,CAACA,EAAK,MAAMP,CAAsB,CAC9C,EAAG,IAAI,EAEP,OAAOM,EAAS,IAAI,SAASC,EAAM,CAC3BA,EAAK,QAAQ,QAAQ,EAAI,KAEzBA,EAAOA,EAAK,QAAQ,aAAc,MAAM,EAAE,QAAQ,6BAA8B,EAAE,GAEtF,IAAIC,EAAgBD,EAAK,QAAQ,OAAQ,EAAE,EAAE,QAAQ,eAAgB,GAAG,EAAE,QAAQ,UAAW,EAAE,EAI3FE,EAAWD,EAAc,MAAM,YAAY,EAG/CA,EAAgBC,EAAWD,EAAc,QAAQC,EAAS,GAAI,EAAE,EAAID,EAIpE,IAAIE,EAAgB,KAAK,gBAAgBD,EAAWA,EAAS,GAAKD,CAAa,EAC3EG,EAAeF,GAAYD,GAAiB,OAC5CI,EAAW,CAAC,OAAQ,aAAa,EAAE,QAAQF,EAAc,EAAE,EAAI,GAAK,OAAYA,EAAc,GAElG,OAAO,IAAIZ,EAAW,CAClB,aAAca,EACd,SAAUC,EACV,WAAYF,EAAc,GAC1B,aAAcA,EAAc,GAC5B,OAAQH,CACZ,CAAC,CACL,EAAG,IAAI,CACX,EAEA,gBAAiB,SAA2CL,EAAO,CAC/D,IAAII,EAAWJ,EAAM,MAAM,MAAM;AAAA,CAAI,EAAE,OAAO,SAASK,EAAM,CACzD,MAAO,CAACA,EAAK,MAAMN,CAAyB,CAChD,EAAG,IAAI,EAEP,OAAOK,EAAS,IAAI,SAASC,EAAM,CAM/B,GAJIA,EAAK,QAAQ,SAAS,EAAI,KAC1BA,EAAOA,EAAK,QAAQ,mDAAoD,KAAK,GAG7EA,EAAK,QAAQ,GAAG,IAAM,IAAMA,EAAK,QAAQ,GAAG,IAAM,GAElD,OAAO,IAAIT,EAAW,CAClB,aAAcS,CAClB,CAAC,EAED,IAAIM,EAAoB,6BACpBC,EAAUP,EAAK,MAAMM,CAAiB,EACtCF,EAAeG,GAAWA,EAAQ,GAAKA,EAAQ,GAAK,OACpDJ,EAAgB,KAAK,gBAAgBH,EAAK,QAAQM,EAAmB,EAAE,CAAC,EAE5E,OAAO,IAAIf,EAAW,CAClB,aAAca,EACd,SAAUD,EAAc,GACxB,WAAYA,EAAc,GAC1B,aAAcA,EAAc,GAC5B,OAAQH,CACZ,CAAC,CAET,EAAG,IAAI,CACX,EAEA,WAAY,SAAsCQ,EAAG,CACjD,MAAI,CAACA,EAAE,YAAeA,EAAE,QAAQ,QAAQ;AAAA,CAAI,EAAI,IAC5CA,EAAE,QAAQ,MAAM;AAAA,CAAI,EAAE,OAASA,EAAE,WAAW,MAAM;AAAA,CAAI,EAAE,OACjD,KAAK,YAAYA,CAAC,EACjBA,EAAE,MAGH,KAAK,aAAaA,CAAC,EAFnB,KAAK,aAAaA,CAAC,CAIlC,EAEA,YAAa,SAAuCA,EAAG,CAKnD,QAJIC,EAAS,oCACTC,EAAQF,EAAE,QAAQ,MAAM;AAAA,CAAI,EAC5BG,EAAS,CAAC,EAELC,EAAI,EAAGC,EAAMH,EAAM,OAAQE,EAAIC,EAAKD,GAAK,EAAG,CACjD,IAAIE,EAAQL,EAAO,KAAKC,EAAME,EAAE,EAC5BE,GACAH,EAAO,KAAK,IAAIpB,EAAW,CACvB,SAAUuB,EAAM,GAChB,WAAYA,EAAM,GAClB,OAAQJ,EAAME,EAClB,CAAC,CAAC,CAEV,CAEA,OAAOD,CACX,EAEA,aAAc,SAAwCH,EAAG,CAKrD,QAJIC,EAAS,6DACTC,EAAQF,EAAE,WAAW,MAAM;AAAA,CAAI,EAC/BG,EAAS,CAAC,EAELC,EAAI,EAAGC,EAAMH,EAAM,OAAQE,EAAIC,EAAKD,GAAK,EAAG,CACjD,IAAIE,EAAQL,EAAO,KAAKC,EAAME,EAAE,EAC5BE,GACAH,EAAO,KACH,IAAIpB,EAAW,CACX,aAAcuB,EAAM,IAAM,OAC1B,SAAUA,EAAM,GAChB,WAAYA,EAAM,GAClB,OAAQJ,EAAME,EAClB,CAAC,CACL,CAER,CAEA,OAAOD,CACX,EAGA,aAAc,SAAwChB,EAAO,CACzD,IAAII,EAAWJ,EAAM,MAAM,MAAM;AAAA,CAAI,EAAE,OAAO,SAASK,EAAM,CACzD,MAAO,CAAC,CAACA,EAAK,MAAMR,CAA2B,GAAK,CAACQ,EAAK,MAAM,mBAAmB,CACvF,EAAG,IAAI,EAEP,OAAOD,EAAS,IAAI,SAASC,EAAM,CAC/B,IAAIe,EAASf,EAAK,MAAM,GAAG,EACvBG,EAAgB,KAAK,gBAAgBY,EAAO,IAAI,CAAC,EACjDC,EAAgBD,EAAO,MAAM,GAAK,GAClCX,EAAeY,EACd,QAAQ,iCAAkC,IAAI,EAC9C,QAAQ,aAAc,EAAE,GAAK,OAC9BC,EACAD,EAAa,MAAM,aAAa,IAChCC,EAAUD,EAAa,QAAQ,qBAAsB,IAAI,GAE7D,IAAIE,EAAQD,IAAY,QAAaA,IAAY,4BAC7C,OAAYA,EAAQ,MAAM,GAAG,EAEjC,OAAO,IAAI1B,EAAW,CAClB,aAAca,EACd,KAAMc,EACN,SAAUf,EAAc,GACxB,WAAYA,EAAc,GAC1B,aAAcA,EAAc,GAC5B,OAAQH,CACZ,CAAC,CACL,EAAG,IAAI,CACX,CACJ,CACJ,CAAC,ICzMD,IAAAmB,GAAAC,EAAA,CAAAC,GAAAC,KAAA,KAAIC,GAAS,OAAO,KAAS,IAAc,KAAOF,GAC9CG,GAAY,UAAY,CAC5B,SAASC,GAAI,CACb,KAAK,MAAQ,GACb,KAAK,aAAeF,GAAO,YAC3B,CACA,OAAAE,EAAE,UAAYF,GACP,IAAIE,CACX,EAAG,GACF,SAASC,EAAM,CAEhB,IAAIC,EAAc,SAAUN,EAAS,CAEnC,IAAIO,EAAU,CACZ,aAAc,oBAAqBF,EACnC,SAAU,WAAYA,GAAQ,aAAc,OAC5C,KACE,eAAgBA,GAChB,SAAUA,GACT,UAAW,CACV,GAAI,CACF,WAAI,KACG,EACT,MAAE,CACA,MAAO,EACT,CACF,EAAG,EACL,SAAU,aAAcA,EACxB,YAAa,gBAAiBA,CAChC,EAEA,SAASG,EAAWC,EAAK,CACvB,OAAOA,GAAO,SAAS,UAAU,cAAcA,CAAG,CACpD,CAEA,GAAIF,EAAQ,YACV,IAAIG,EAAc,CAChB,qBACA,sBACA,6BACA,sBACA,uBACA,sBACA,uBACA,wBACA,uBACF,EAEIC,EACF,YAAY,QACZ,SAASF,EAAK,CACZ,OAAOA,GAAOC,EAAY,QAAQ,OAAO,UAAU,SAAS,KAAKD,CAAG,CAAC,EAAI,EAC3E,EAGJ,SAASG,EAAcC,EAAM,CAI3B,GAHI,OAAOA,GAAS,WAClBA,EAAO,OAAOA,CAAI,GAEhB,4BAA4B,KAAKA,CAAI,EACvC,MAAM,IAAI,UAAU,wCAAwC,EAE9D,OAAOA,EAAK,YAAY,CAC1B,CAEA,SAASC,EAAeC,EAAO,CAC7B,OAAI,OAAOA,GAAU,WACnBA,EAAQ,OAAOA,CAAK,GAEfA,CACT,CAGA,SAASC,EAAYC,EAAO,CAC1B,IAAIC,EAAW,CACb,KAAM,UAAW,CACf,IAAIH,EAAQE,EAAM,MAAM,EACxB,MAAO,CAAC,KAAMF,IAAU,OAAW,MAAOA,CAAK,CACjD,CACF,EAEA,OAAIR,EAAQ,WACVW,EAAS,OAAO,UAAY,UAAW,CACrC,OAAOA,CACT,GAGKA,CACT,CAEA,SAASC,EAAQC,EAAS,CACxB,KAAK,IAAM,CAAC,EAERA,aAAmBD,EACrBC,EAAQ,QAAQ,SAASL,EAAOF,EAAM,CACpC,KAAK,OAAOA,EAAME,CAAK,CACzB,EAAG,IAAI,EACE,MAAM,QAAQK,CAAO,EAC9BA,EAAQ,QAAQ,SAASC,EAAQ,CAC/B,KAAK,OAAOA,EAAO,GAAIA,EAAO,EAAE,CAClC,EAAG,IAAI,EACED,GACT,OAAO,oBAAoBA,CAAO,EAAE,QAAQ,SAASP,EAAM,CACzD,KAAK,OAAOA,EAAMO,EAAQP,EAAK,CACjC,EAAG,IAAI,CAEX,CAEAM,EAAQ,UAAU,OAAS,SAASN,EAAME,EAAO,CAC/CF,EAAOD,EAAcC,CAAI,EACzBE,EAAQD,EAAeC,CAAK,EAC5B,IAAIO,EAAW,KAAK,IAAIT,GACxB,KAAK,IAAIA,GAAQS,EAAWA,EAAW,KAAOP,EAAQA,CACxD,EAEAI,EAAQ,UAAU,OAAY,SAASN,EAAM,CAC3C,OAAO,KAAK,IAAID,EAAcC,CAAI,EACpC,EAEAM,EAAQ,UAAU,IAAM,SAASN,EAAM,CACrC,OAAAA,EAAOD,EAAcC,CAAI,EAClB,KAAK,IAAIA,CAAI,EAAI,KAAK,IAAIA,GAAQ,IAC3C,EAEAM,EAAQ,UAAU,IAAM,SAASN,EAAM,CACrC,OAAO,KAAK,IAAI,eAAeD,EAAcC,CAAI,CAAC,CACpD,EAEAM,EAAQ,UAAU,IAAM,SAASN,EAAME,EAAO,CAC5C,KAAK,IAAIH,EAAcC,CAAI,GAAKC,EAAeC,CAAK,CACtD,EAEAI,EAAQ,UAAU,QAAU,SAASI,EAAUC,EAAS,CACtD,QAASX,KAAQ,KAAK,IAChB,KAAK,IAAI,eAAeA,CAAI,GAC9BU,EAAS,KAAKC,EAAS,KAAK,IAAIX,GAAOA,EAAM,IAAI,CAGvD,EAEAM,EAAQ,UAAU,KAAO,UAAW,CAClC,IAAIF,EAAQ,CAAC,EACb,YAAK,QAAQ,SAASF,EAAOF,EAAM,CACjCI,EAAM,KAAKJ,CAAI,CACjB,CAAC,EACMG,EAAYC,CAAK,CAC1B,EAEAE,EAAQ,UAAU,OAAS,UAAW,CACpC,IAAIF,EAAQ,CAAC,EACb,YAAK,QAAQ,SAASF,EAAO,CAC3BE,EAAM,KAAKF,CAAK,CAClB,CAAC,EACMC,EAAYC,CAAK,CAC1B,EAEAE,EAAQ,UAAU,QAAU,UAAW,CACrC,IAAIF,EAAQ,CAAC,EACb,YAAK,QAAQ,SAASF,EAAOF,EAAM,CACjCI,EAAM,KAAK,CAACJ,EAAME,CAAK,CAAC,CAC1B,CAAC,EACMC,EAAYC,CAAK,CAC1B,EAEIV,EAAQ,WACVY,EAAQ,UAAU,OAAO,UAAYA,EAAQ,UAAU,SAGzD,SAASM,EAASC,EAAM,CACtB,GAAIA,EAAK,SACP,OAAO,QAAQ,OAAO,IAAI,UAAU,cAAc,CAAC,EAErDA,EAAK,SAAW,EAClB,CAEA,SAASC,EAAgBC,EAAQ,CAC/B,OAAO,IAAI,QAAQ,SAASC,EAASC,EAAQ,CAC3CF,EAAO,OAAS,UAAW,CACzBC,EAAQD,EAAO,MAAM,CACvB,EACAA,EAAO,QAAU,UAAW,CAC1BE,EAAOF,EAAO,KAAK,CACrB,CACF,CAAC,CACH,CAEA,SAASG,EAAsBC,EAAM,CACnC,IAAIJ,EAAS,IAAI,WACbK,EAAUN,EAAgBC,CAAM,EACpC,OAAAA,EAAO,kBAAkBI,CAAI,EACtBC,CACT,CAEA,SAASC,EAAeF,EAAM,CAC5B,IAAIJ,EAAS,IAAI,WACbK,EAAUN,EAAgBC,CAAM,EACpC,OAAAA,EAAO,WAAWI,CAAI,EACfC,CACT,CAEA,SAASE,EAAsBC,EAAK,CAIlC,QAHIC,EAAO,IAAI,WAAWD,CAAG,EACzBE,EAAQ,IAAI,MAAMD,EAAK,MAAM,EAExBE,GAAI,EAAGA,GAAIF,EAAK,OAAQE,KAC/BD,EAAMC,IAAK,OAAO,aAAaF,EAAKE,GAAE,EAExC,OAAOD,EAAM,KAAK,EAAE,CACtB,CAEA,SAASE,EAAYJ,EAAK,CACxB,GAAIA,EAAI,MACN,OAAOA,EAAI,MAAM,CAAC,EAElB,IAAIC,EAAO,IAAI,WAAWD,EAAI,UAAU,EACxC,OAAAC,EAAK,IAAI,IAAI,WAAWD,CAAG,CAAC,EACrBC,EAAK,MAEhB,CAEA,SAASI,GAAO,CACd,YAAK,SAAW,GAEhB,KAAK,UAAY,SAASf,EAAM,CAC9B,KAAK,UAAYA,EACZA,EAEM,OAAOA,GAAS,SACzB,KAAK,UAAYA,EACRnB,EAAQ,MAAQ,KAAK,UAAU,cAAcmB,CAAI,EAC1D,KAAK,UAAYA,EACRnB,EAAQ,UAAY,SAAS,UAAU,cAAcmB,CAAI,EAClE,KAAK,cAAgBA,EACZnB,EAAQ,cAAgB,gBAAgB,UAAU,cAAcmB,CAAI,EAC7E,KAAK,UAAYA,EAAK,SAAS,EACtBnB,EAAQ,aAAeA,EAAQ,MAAQC,EAAWkB,CAAI,GAC/D,KAAK,iBAAmBc,EAAYd,EAAK,MAAM,EAE/C,KAAK,UAAY,IAAI,KAAK,CAAC,KAAK,gBAAgB,CAAC,GACxCnB,EAAQ,cAAgB,YAAY,UAAU,cAAcmB,CAAI,GAAKf,EAAkBe,CAAI,GACpG,KAAK,iBAAmBc,EAAYd,CAAI,EAExC,KAAK,UAAYA,EAAO,OAAO,UAAU,SAAS,KAAKA,CAAI,EAhB3D,KAAK,UAAY,GAmBd,KAAK,QAAQ,IAAI,cAAc,IAC9B,OAAOA,GAAS,SAClB,KAAK,QAAQ,IAAI,eAAgB,0BAA0B,EAClD,KAAK,WAAa,KAAK,UAAU,KAC1C,KAAK,QAAQ,IAAI,eAAgB,KAAK,UAAU,IAAI,EAC3CnB,EAAQ,cAAgB,gBAAgB,UAAU,cAAcmB,CAAI,GAC7E,KAAK,QAAQ,IAAI,eAAgB,iDAAiD,EAGxF,EAEInB,EAAQ,OACV,KAAK,KAAO,UAAW,CACrB,IAAImC,EAAWjB,EAAS,IAAI,EAC5B,GAAIiB,EACF,OAAOA,EAGT,GAAI,KAAK,UACP,OAAO,QAAQ,QAAQ,KAAK,SAAS,EAChC,GAAI,KAAK,iBACd,OAAO,QAAQ,QAAQ,IAAI,KAAK,CAAC,KAAK,gBAAgB,CAAC,CAAC,EACnD,GAAI,KAAK,cACd,MAAM,IAAI,MAAM,sCAAsC,EAEtD,OAAO,QAAQ,QAAQ,IAAI,KAAK,CAAC,KAAK,SAAS,CAAC,CAAC,CAErD,EAEA,KAAK,YAAc,UAAW,CAC5B,OAAI,KAAK,iBACAjB,EAAS,IAAI,GAAK,QAAQ,QAAQ,KAAK,gBAAgB,EAEvD,KAAK,KAAK,EAAE,KAAKM,CAAqB,CAEjD,GAGF,KAAK,KAAO,UAAW,CACrB,IAAIW,EAAWjB,EAAS,IAAI,EAC5B,GAAIiB,EACF,OAAOA,EAGT,GAAI,KAAK,UACP,OAAOR,EAAe,KAAK,SAAS,EAC/B,GAAI,KAAK,iBACd,OAAO,QAAQ,QAAQC,EAAsB,KAAK,gBAAgB,CAAC,EAC9D,GAAI,KAAK,cACd,MAAM,IAAI,MAAM,sCAAsC,EAEtD,OAAO,QAAQ,QAAQ,KAAK,SAAS,CAEzC,EAEI5B,EAAQ,WACV,KAAK,SAAW,UAAW,CACzB,OAAO,KAAK,KAAK,EAAE,KAAKoC,EAAM,CAChC,GAGF,KAAK,KAAO,UAAW,CACrB,OAAO,KAAK,KAAK,EAAE,KAAK,KAAK,KAAK,CACpC,EAEO,IACT,CAGA,IAAIC,EAAU,CAAC,SAAU,MAAO,OAAQ,UAAW,OAAQ,KAAK,EAEhE,SAASC,EAAgBC,EAAQ,CAC/B,IAAIC,EAAUD,EAAO,YAAY,EACjC,OAAOF,EAAQ,QAAQG,CAAO,EAAI,GAAKA,EAAUD,CACnD,CAEA,SAASE,EAAQC,EAAOC,EAAS,CAC/BA,EAAUA,GAAW,CAAC,EACtB,IAAIxB,EAAOwB,EAAQ,KAEnB,GAAID,aAAiBD,EAAS,CAC5B,GAAIC,EAAM,SACR,MAAM,IAAI,UAAU,cAAc,EAEpC,KAAK,IAAMA,EAAM,IACjB,KAAK,YAAcA,EAAM,YACpBC,EAAQ,UACX,KAAK,QAAU,IAAI/B,EAAQ8B,EAAM,OAAO,GAE1C,KAAK,OAASA,EAAM,OACpB,KAAK,KAAOA,EAAM,KAClB,KAAK,OAASA,EAAM,OAChB,CAACvB,GAAQuB,EAAM,WAAa,OAC9BvB,EAAOuB,EAAM,UACbA,EAAM,SAAW,GAErB,MACE,KAAK,IAAM,OAAOA,CAAK,EAYzB,GATA,KAAK,YAAcC,EAAQ,aAAe,KAAK,aAAe,eAC1DA,EAAQ,SAAW,CAAC,KAAK,WAC3B,KAAK,QAAU,IAAI/B,EAAQ+B,EAAQ,OAAO,GAE5C,KAAK,OAASL,EAAgBK,EAAQ,QAAU,KAAK,QAAU,KAAK,EACpE,KAAK,KAAOA,EAAQ,MAAQ,KAAK,MAAQ,KACzC,KAAK,OAASA,EAAQ,QAAU,KAAK,OACrC,KAAK,SAAW,MAEX,KAAK,SAAW,OAAS,KAAK,SAAW,SAAWxB,EACvD,MAAM,IAAI,UAAU,2CAA2C,EAEjE,KAAK,UAAUA,CAAI,CACrB,CAEAsB,EAAQ,UAAU,MAAQ,UAAW,CACnC,OAAO,IAAIA,EAAQ,KAAM,CAAC,KAAM,KAAK,SAAS,CAAC,CACjD,EAEA,SAASL,GAAOjB,EAAM,CACpB,IAAIyB,EAAO,IAAI,SACf,OAAAzB,EACG,KAAK,EACL,MAAM,GAAG,EACT,QAAQ,SAAS0B,EAAO,CACvB,GAAIA,EAAO,CACT,IAAIC,GAAQD,EAAM,MAAM,GAAG,EACvBvC,EAAOwC,GAAM,MAAM,EAAE,QAAQ,MAAO,GAAG,EACvCtC,EAAQsC,GAAM,KAAK,GAAG,EAAE,QAAQ,MAAO,GAAG,EAC9CF,EAAK,OAAO,mBAAmBtC,CAAI,EAAG,mBAAmBE,CAAK,CAAC,CACjE,CACF,CAAC,EACIoC,CACT,CAEA,SAASG,GAAaC,EAAY,CAChC,IAAInC,EAAU,IAAID,EAGdqC,EAAsBD,EAAW,QAAQ,eAAgB,GAAG,EAChE,OAAAC,EAAoB,MAAM,OAAO,EAAE,QAAQ,SAASC,GAAM,CACxD,IAAIC,EAAQD,GAAK,MAAM,GAAG,EACtBE,EAAMD,EAAM,MAAM,EAAE,KAAK,EAC7B,GAAIC,EAAK,CACP,IAAI5C,EAAQ2C,EAAM,KAAK,GAAG,EAAE,KAAK,EACjCtC,EAAQ,OAAOuC,EAAK5C,CAAK,CAC3B,CACF,CAAC,EACMK,CACT,CAEAqB,EAAK,KAAKO,EAAQ,SAAS,EAE3B,SAASY,GAASC,EAAUX,EAAS,CAC9BA,IACHA,EAAU,CAAC,GAGb,KAAK,KAAO,UACZ,KAAK,OAASA,EAAQ,SAAW,OAAY,IAAMA,EAAQ,OAC3D,KAAK,GAAK,KAAK,QAAU,KAAO,KAAK,OAAS,IAC9C,KAAK,WAAa,eAAgBA,EAAUA,EAAQ,WAAa,KACjE,KAAK,QAAU,IAAI/B,EAAQ+B,EAAQ,OAAO,EAC1C,KAAK,IAAMA,EAAQ,KAAO,GAC1B,KAAK,UAAUW,CAAQ,CACzB,CAEApB,EAAK,KAAKmB,GAAS,SAAS,EAE5BA,GAAS,UAAU,MAAQ,UAAW,CACpC,OAAO,IAAIA,GAAS,KAAK,UAAW,CAClC,OAAQ,KAAK,OACb,WAAY,KAAK,WACjB,QAAS,IAAIzC,EAAQ,KAAK,OAAO,EACjC,IAAK,KAAK,GACZ,CAAC,CACH,EAEAyC,GAAS,MAAQ,UAAW,CAC1B,IAAIE,EAAW,IAAIF,GAAS,KAAM,CAAC,OAAQ,EAAG,WAAY,EAAE,CAAC,EAC7D,OAAAE,EAAS,KAAO,QACTA,CACT,EAEA,IAAIC,GAAmB,CAAC,IAAK,IAAK,IAAK,IAAK,GAAG,EAE/CH,GAAS,SAAW,SAASI,EAAKC,EAAQ,CACxC,GAAIF,GAAiB,QAAQE,CAAM,IAAM,GACvC,MAAM,IAAI,WAAW,qBAAqB,EAG5C,OAAO,IAAIL,GAAS,KAAM,CAAC,OAAQK,EAAQ,QAAS,CAAC,SAAUD,CAAG,CAAC,CAAC,CACtE,EAEAhE,EAAQ,aAAeK,EAAK,aAC5B,GAAI,CACF,IAAIL,EAAQ,YACd,MAAE,CACAA,EAAQ,aAAe,SAASkE,EAASrD,EAAM,CAC7C,KAAK,QAAUqD,EACf,KAAK,KAAOrD,EACZ,IAAIsD,GAAQ,MAAMD,CAAO,EACzB,KAAK,MAAQC,GAAM,KACrB,EACAnE,EAAQ,aAAa,UAAY,OAAO,OAAO,MAAM,SAAS,EAC9DA,EAAQ,aAAa,UAAU,YAAcA,EAAQ,YACvD,CAEA,SAASoE,EAAMnB,EAAOoB,EAAM,CAC1B,OAAO,IAAI,QAAQ,SAASxC,EAASC,GAAQ,CAC3C,IAAIwC,EAAU,IAAItB,EAAQC,EAAOoB,CAAI,EAErC,GAAIC,EAAQ,QAAUA,EAAQ,OAAO,QACnC,OAAOxC,GAAO,IAAI9B,EAAQ,aAAa,UAAW,YAAY,CAAC,EAGjE,IAAIuE,EAAM,IAAI,eAEd,SAASC,GAAW,CAClBD,EAAI,MAAM,CACZ,CAEAA,EAAI,OAAS,UAAW,CACtB,IAAIrB,GAAU,CACZ,OAAQqB,EAAI,OACZ,WAAYA,EAAI,WAChB,QAASjB,GAAaiB,EAAI,sBAAsB,GAAK,EAAE,CACzD,EACArB,GAAQ,IAAM,gBAAiBqB,EAAMA,EAAI,YAAcrB,GAAQ,QAAQ,IAAI,eAAe,EAC1F,IAAIxB,EAAO,aAAc6C,EAAMA,EAAI,SAAWA,EAAI,aAClD1C,EAAQ,IAAI+B,GAASlC,EAAMwB,EAAO,CAAC,CACrC,EAEAqB,EAAI,QAAU,UAAW,CACvBzC,GAAO,IAAI,UAAU,wBAAwB,CAAC,CAChD,EAEAyC,EAAI,UAAY,UAAW,CACzBzC,GAAO,IAAI,UAAU,wBAAwB,CAAC,CAChD,EAEAyC,EAAI,QAAU,UAAW,CACvBzC,GAAO,IAAI9B,EAAQ,aAAa,UAAW,YAAY,CAAC,CAC1D,EAEAuE,EAAI,KAAKD,EAAQ,OAAQA,EAAQ,IAAK,EAAI,EAEtCA,EAAQ,cAAgB,UAC1BC,EAAI,gBAAkB,GACbD,EAAQ,cAAgB,SACjCC,EAAI,gBAAkB,IAGpB,iBAAkBA,GAAOhE,EAAQ,OACnCgE,EAAI,aAAe,QAGrBD,EAAQ,QAAQ,QAAQ,SAASvD,GAAOF,EAAM,CAC5C0D,EAAI,iBAAiB1D,EAAME,EAAK,CAClC,CAAC,EAEGuD,EAAQ,SACVA,EAAQ,OAAO,iBAAiB,QAASE,CAAQ,EAEjDD,EAAI,mBAAqB,UAAW,CAE9BA,EAAI,aAAe,GACrBD,EAAQ,OAAO,oBAAoB,QAASE,CAAQ,CAExD,GAGFD,EAAI,KAAK,OAAOD,EAAQ,UAAc,IAAc,KAAOA,EAAQ,SAAS,CAC9E,CAAC,CACH,CAEA,OAAAF,EAAM,SAAW,GAEZ/D,EAAK,QACRA,EAAK,MAAQ+D,EACb/D,EAAK,QAAUc,EACfd,EAAK,QAAU2C,EACf3C,EAAK,SAAWuD,IAGlB5D,EAAQ,QAAUmB,EAClBnB,EAAQ,QAAUgD,EAClBhD,EAAQ,SAAW4D,GACnB5D,EAAQ,MAAQoE,EAEhB,OAAO,eAAepE,EAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAErDA,CAET,EAAG,CAAC,CAAC,CACL,GAAGG,EAAQ,EACXA,GAAS,MAAM,SAAW,GAE1B,OAAOA,GAAS,MAAM,SAGtB,IAAIsE,GAAMtE,GACVH,GAAUyE,GAAI,MACdzE,GAAQ,QAAUyE,GAAI,MACtBzE,GAAQ,MAAQyE,GAAI,MACpBzE,GAAQ,QAAUyE,GAAI,QACtBzE,GAAQ,QAAUyE,GAAI,QACtBzE,GAAQ,SAAWyE,GAAI,SACvBxE,GAAO,QAAUD,KCziBjB,IAAA0E,GAAAC,EAAA,CAAAC,GAAAC,KAAA,CACA,SAASC,IAAW,CAAC,CAGrBA,GAAS,UAAU,MAAQ,UAAW,CAClC,KAAK,MAAQ,KACb,KAAK,KAAO,CAChB,EAGAA,GAAS,UAAU,KAAO,SAASC,EAAM,CAGrC,QAFIC,EAAM,KAAK,MAETA,IAAQ,MAAM,CAChB,IAAIC,EAAI,KAAK,YAAYF,EAAMC,EAAI,IAAI,EACvC,GAAGC,IAAM,EACL,OAAOD,EAAI,KAGXA,EAAMA,EAAI,UAAUC,EAAI,CAAC,CAEjC,CAEA,OAAO,IACX,EAGAH,GAAS,UAAU,SAAW,SAASC,EAAM,CAIzC,QAHIC,EAAM,KAAK,MACXE,EAAO,KAAK,SAAS,EAEnBF,IAAQ,MAAM,CAChB,IAAIC,EAAI,KAAK,YAAYF,EAAMC,EAAI,IAAI,EACvC,GAAGC,IAAM,EACL,OAAAC,EAAK,QAAUF,EACRE,EAGPA,EAAK,WAAW,KAAKF,CAAG,EACxBA,EAAMA,EAAI,UAAUC,EAAI,CAAC,CAEjC,CAEA,OAAO,IACX,EAGAH,GAAS,UAAU,WAAa,SAASK,EAAM,CAK3C,QAJIC,EAAM,KAAK,MACXF,EAAO,KAAK,SAAS,EACrBG,EAAM,KAAK,YAETD,IAAQ,MAAM,CAChB,IAAIH,EAAII,EAAIF,EAAMC,EAAI,IAAI,EAC1B,GAAGH,IAAM,EACL,OAAAC,EAAK,QAAUE,EACRF,EAEXA,EAAK,WAAW,KAAKE,CAAG,EACxBA,EAAMA,EAAI,UAAUH,EAAI,CAAC,CAC7B,CAEA,QAAQK,EAAEJ,EAAK,WAAW,OAAS,EAAGI,GAAK,EAAG,EAAEA,EAE5C,GADAF,EAAMF,EAAK,WAAWI,GACnBD,EAAIF,EAAMC,EAAI,IAAI,EAAI,EACrB,OAAAF,EAAK,QAAUE,EACfF,EAAK,WAAW,OAASI,EAClBJ,EAIf,OAAAA,EAAK,WAAW,OAAS,EAClBA,CACX,EAGAJ,GAAS,UAAU,WAAa,SAASK,EAAM,CAI3C,QAHID,EAAO,KAAK,WAAWC,CAAI,EAC3BE,EAAM,KAAK,YAETH,EAAK,KAAK,IAAM,MAAQG,EAAIH,EAAK,KAAK,EAAGC,CAAI,IAAM,GACrDD,EAAK,KAAK,EAGd,OAAOA,CACX,EAGAJ,GAAS,UAAU,IAAM,UAAW,CAChC,IAAIE,EAAM,KAAK,MACf,GAAGA,IAAQ,KACP,OAAO,KAGX,KAAMA,EAAI,OAAS,MACfA,EAAMA,EAAI,KAGd,OAAOA,EAAI,IACf,EAGAF,GAAS,UAAU,IAAM,UAAW,CAChC,IAAIE,EAAM,KAAK,MACf,GAAGA,IAAQ,KACP,OAAO,KAGX,KAAMA,EAAI,QAAU,MAChBA,EAAMA,EAAI,MAGd,OAAOA,EAAI,IACf,EAIAF,GAAS,UAAU,SAAW,UAAW,CACrC,OAAO,IAAIS,GAAS,IAAI,CAC5B,EAGAT,GAAS,UAAU,KAAO,SAASU,EAAI,CAEnC,QADIC,EAAG,KAAK,SAAS,EAAGV,GACjBA,EAAOU,EAAG,KAAK,KAAO,MACzB,GAAGD,EAAGT,CAAI,IAAM,GACZ,MAGZ,EAGAD,GAAS,UAAU,MAAQ,SAASU,EAAI,CAEpC,QADIC,EAAG,KAAK,SAAS,EAAGV,GACjBA,EAAOU,EAAG,KAAK,KAAO,MACzB,GAAGD,EAAGT,CAAI,IAAM,GACZ,MAGZ,EAGA,SAASQ,GAASG,EAAM,CACpB,KAAK,MAAQA,EACb,KAAK,WAAa,CAAC,EACnB,KAAK,QAAU,IACnB,CAEAH,GAAS,UAAU,KAAO,UAAW,CACjC,OAAO,KAAK,UAAY,KAAO,KAAK,QAAQ,KAAO,IACvD,EAIAA,GAAS,UAAU,KAAO,UAAW,CACjC,GAAG,KAAK,UAAY,KAAM,CACtB,IAAII,EAAO,KAAK,MAAM,MACnBA,IAAS,MACR,KAAK,SAASA,CAAI,CAE1B,SAEO,KAAK,QAAQ,QAAU,KAAM,CAG5B,IAAIC,EACJ,EAEI,IADAA,EAAO,KAAK,QACT,KAAK,WAAW,OACf,KAAK,QAAU,KAAK,WAAW,IAAI,MAElC,CACD,KAAK,QAAU,KACf,KACJ,OACI,KAAK,QAAQ,QAAUA,EACnC,MAGI,KAAK,WAAW,KAAK,KAAK,OAAO,EACjC,KAAK,SAAS,KAAK,QAAQ,KAAK,EAGxC,OAAO,KAAK,UAAY,KAAO,KAAK,QAAQ,KAAO,IACvD,EAIAL,GAAS,UAAU,KAAO,UAAW,CACjC,GAAG,KAAK,UAAY,KAAM,CACtB,IAAII,EAAO,KAAK,MAAM,MACnBA,IAAS,MACR,KAAK,SAASA,CAAI,CAE1B,SAEO,KAAK,QAAQ,OAAS,KAAM,CAC3B,IAAIC,EACJ,EAEI,IADAA,EAAO,KAAK,QACT,KAAK,WAAW,OACf,KAAK,QAAU,KAAK,WAAW,IAAI,MAElC,CACD,KAAK,QAAU,KACf,KACJ,OACI,KAAK,QAAQ,OAASA,EAClC,MAEI,KAAK,WAAW,KAAK,KAAK,OAAO,EACjC,KAAK,SAAS,KAAK,QAAQ,IAAI,EAGvC,OAAO,KAAK,UAAY,KAAO,KAAK,QAAQ,KAAO,IACvD,EAEAL,GAAS,UAAU,SAAW,SAASM,EAAO,CAC1C,KAAMA,EAAM,OAAS,MACjB,KAAK,WAAW,KAAKA,CAAK,EAC1BA,EAAQA,EAAM,KAElB,KAAK,QAAUA,CACnB,EAEAN,GAAS,UAAU,SAAW,SAASM,EAAO,CAC1C,KAAMA,EAAM,QAAU,MAClB,KAAK,WAAW,KAAKA,CAAK,EAC1BA,EAAQA,EAAM,MAElB,KAAK,QAAUA,CACnB,EAEAhB,GAAO,QAAUC,KCzOjB,IAAAgB,GAAAC,EAAA,CAAAC,GAAAC,KAAA,CACA,IAAIC,GAAW,KAEf,SAASC,GAAKC,EAAM,CAChB,KAAK,KAAOA,EACZ,KAAK,KAAO,KACZ,KAAK,MAAQ,KACb,KAAK,IAAM,EACf,CAEAD,GAAK,UAAU,UAAY,SAASE,EAAK,CACrC,OAAOA,EAAM,KAAK,MAAQ,KAAK,IACnC,EAEAF,GAAK,UAAU,UAAY,SAASE,EAAKC,EAAK,CACvCD,EACC,KAAK,MAAQC,EAGb,KAAK,KAAOA,CAEpB,EAEA,SAASC,GAAOC,EAAY,CACxB,KAAK,MAAQ,KACb,KAAK,YAAcA,EACnB,KAAK,KAAO,CAChB,CAEAD,GAAO,UAAY,IAAIL,GAGvBK,GAAO,UAAU,OAAS,SAASH,EAAM,CACrC,IAAIK,EAAM,GAEV,GAAG,KAAK,QAAU,KAEd,KAAK,MAAQ,IAAIN,GAAKC,CAAI,EAC1BK,EAAM,GACN,KAAK,WAEJ,CACD,IAAIC,EAAO,IAAIP,GAAK,MAAS,EAEzBE,EAAM,EACNM,EAAO,EAGPC,EAAK,KACLC,EAAMH,EACNI,EAAI,KACJC,EAAO,KAAK,MAIhB,IAHAF,EAAI,MAAQ,KAAK,QAGL,CAgBR,GAfGE,IAAS,MAERA,EAAO,IAAIZ,GAAKC,CAAI,EACpBU,EAAE,UAAUT,EAAKU,CAAI,EACrBN,EAAM,GACN,KAAK,QAEDO,GAAOD,EAAK,IAAI,GAAKC,GAAOD,EAAK,KAAK,IAE1CA,EAAK,IAAM,GACXA,EAAK,KAAK,IAAM,GAChBA,EAAK,MAAM,IAAM,IAIlBC,GAAOD,CAAI,GAAKC,GAAOF,CAAC,EAAG,CAC1B,IAAIG,EAAOJ,EAAI,QAAUD,EAEtBG,IAASD,EAAE,UAAUH,CAAI,EACxBE,EAAI,UAAUI,EAAMC,GAAcN,EAAI,CAACD,CAAI,CAAC,EAG5CE,EAAI,UAAUI,EAAME,GAAcP,EAAI,CAACD,CAAI,CAAC,CAEpD,CAEA,IAAIS,EAAM,KAAK,YAAYL,EAAK,KAAMX,CAAI,EAG1C,GAAGgB,IAAQ,EACP,MAGJT,EAAON,EACPA,EAAMe,EAAM,EAGTR,IAAO,OACNC,EAAMD,GAEVA,EAAKE,EACLA,EAAIC,EACJA,EAAOA,EAAK,UAAUV,CAAG,CAC7B,CAGA,KAAK,MAAQK,EAAK,KACtB,CAGA,YAAK,MAAM,IAAM,GAEVD,CACX,EAGAF,GAAO,UAAU,OAAS,SAASH,EAAM,CACrC,GAAG,KAAK,QAAU,KACd,MAAO,GAGX,IAAIM,EAAO,IAAIP,GAAK,MAAS,EACzBY,EAAOL,EACXK,EAAK,MAAQ,KAAK,MAMlB,QALID,EAAI,KACJF,EAAK,KACLS,EAAQ,KACRhB,EAAM,EAEJU,EAAK,UAAUV,CAAG,IAAM,MAAM,CAChC,IAAIM,EAAON,EAGXO,EAAKE,EACLA,EAAIC,EACJA,EAAOA,EAAK,UAAUV,CAAG,EAEzB,IAAIe,EAAM,KAAK,YAAYhB,EAAMW,EAAK,IAAI,EAU1C,GARAV,EAAMe,EAAM,EAGTA,IAAQ,IACPC,EAAQN,GAIT,CAACC,GAAOD,CAAI,GAAK,CAACC,GAAOD,EAAK,UAAUV,CAAG,CAAC,GAC3C,GAAGW,GAAOD,EAAK,UAAU,CAACV,CAAG,CAAC,EAAG,CAC7B,IAAIiB,EAAKJ,GAAcH,EAAMV,CAAG,EAChCS,EAAE,UAAUH,EAAMW,CAAE,EACpBR,EAAIQ,CACR,SACQ,CAACN,GAAOD,EAAK,UAAU,CAACV,CAAG,CAAC,EAAG,CACnC,IAAIkB,EAAUT,EAAE,UAAU,CAACH,CAAI,EAC/B,GAAGY,IAAY,KACX,GAAG,CAACP,GAAOO,EAAQ,UAAU,CAACZ,CAAI,CAAC,GAAK,CAACK,GAAOO,EAAQ,UAAUZ,CAAI,CAAC,EAEnEG,EAAE,IAAM,GACRS,EAAQ,IAAM,GACdR,EAAK,IAAM,OAEV,CACD,IAAIE,EAAOL,EAAG,QAAUE,EAErBE,GAAOO,EAAQ,UAAUZ,CAAI,CAAC,EAC7BC,EAAG,UAAUK,EAAME,GAAcL,EAAGH,CAAI,CAAC,EAErCK,GAAOO,EAAQ,UAAU,CAACZ,CAAI,CAAC,GACnCC,EAAG,UAAUK,EAAMC,GAAcJ,EAAGH,CAAI,CAAC,EAI7C,IAAIa,EAAMZ,EAAG,UAAUK,CAAI,EAC3BO,EAAI,IAAM,GACVT,EAAK,IAAM,GACXS,EAAI,KAAK,IAAM,GACfA,EAAI,MAAM,IAAM,EACpB,CAER,EAER,CAGA,OAAGH,IAAU,OACTA,EAAM,KAAON,EAAK,KAClBD,EAAE,UAAUA,EAAE,QAAUC,EAAMA,EAAK,UAAUA,EAAK,OAAS,IAAI,CAAC,EAChE,KAAK,QAIT,KAAK,MAAQL,EAAK,MACf,KAAK,QAAU,OACd,KAAK,MAAM,IAAM,IAGdW,IAAU,IACrB,EAEA,SAASL,GAAOD,EAAM,CAClB,OAAOA,IAAS,MAAQA,EAAK,GACjC,CAEA,SAASG,GAAcO,EAAMpB,EAAK,CAC9B,IAAIqB,EAAOD,EAAK,UAAU,CAACpB,CAAG,EAE9B,OAAAoB,EAAK,UAAU,CAACpB,EAAKqB,EAAK,UAAUrB,CAAG,CAAC,EACxCqB,EAAK,UAAUrB,EAAKoB,CAAI,EAExBA,EAAK,IAAM,GACXC,EAAK,IAAM,GAEJA,CACX,CAEA,SAASP,GAAcM,EAAMpB,EAAK,CAC9B,OAAAoB,EAAK,UAAU,CAACpB,EAAKa,GAAcO,EAAK,UAAU,CAACpB,CAAG,EAAG,CAACA,CAAG,CAAC,EACvDa,GAAcO,EAAMpB,CAAG,CAClC,CAEAJ,GAAO,QAAUM,KCzNjB,IAAAoB,GAAAC,EAAA,CAAAC,GAAAC,KAAA,CACA,IAAIC,GAAW,KAEf,SAASC,GAAKC,EAAM,CAChB,KAAK,KAAOA,EACZ,KAAK,KAAO,KACZ,KAAK,MAAQ,IACjB,CAEAD,GAAK,UAAU,UAAY,SAASE,EAAK,CACrC,OAAOA,EAAM,KAAK,MAAQ,KAAK,IACnC,EAEAF,GAAK,UAAU,UAAY,SAASE,EAAKC,EAAK,CACvCD,EACC,KAAK,MAAQC,EAGb,KAAK,KAAOA,CAEpB,EAEA,SAASC,GAAQC,EAAY,CACzB,KAAK,MAAQ,KACb,KAAK,YAAcA,EACnB,KAAK,KAAO,CAChB,CAEAD,GAAQ,UAAY,IAAIL,GAGxBK,GAAQ,UAAU,OAAS,SAASH,EAAM,CACtC,GAAG,KAAK,QAAU,KAEd,YAAK,MAAQ,IAAID,GAAKC,CAAI,EAC1B,KAAK,OACE,GAUX,QAPIC,EAAM,EAGNI,EAAI,KACJC,EAAO,KAAK,QAGJ,CACR,GAAGA,IAAS,KAER,OAAAA,EAAO,IAAIP,GAAKC,CAAI,EACpBK,EAAE,UAAUJ,EAAKK,CAAI,EACrB,IAAM,GACN,KAAK,OACE,GAIX,GAAG,KAAK,YAAYA,EAAK,KAAMN,CAAI,IAAM,EACrC,MAAO,GAGXC,EAAM,KAAK,YAAYK,EAAK,KAAMN,CAAI,EAAI,EAG1CK,EAAIC,EACJA,EAAOA,EAAK,UAAUL,CAAG,CAC7B,CACJ,EAGAE,GAAQ,UAAU,OAAS,SAASH,EAAM,CACtC,GAAG,KAAK,QAAU,KACd,MAAO,GAGX,IAAIO,EAAO,IAAIR,GAAK,MAAS,EACzBO,EAAOC,EACXD,EAAK,MAAQ,KAAK,MAKlB,QAJID,EAAI,KACJG,EAAQ,KACRP,EAAM,EAEJK,EAAK,UAAUL,CAAG,IAAM,MAAM,CAChCI,EAAIC,EACJA,EAAOA,EAAK,UAAUL,CAAG,EACzB,IAAIQ,EAAM,KAAK,YAAYT,EAAMM,EAAK,IAAI,EAC1CL,EAAMQ,EAAM,EAETA,IAAQ,IACPD,EAAQF,EAEhB,CAEA,OAAGE,IAAU,MACTA,EAAM,KAAOF,EAAK,KAClBD,EAAE,UAAUA,EAAE,QAAUC,EAAMA,EAAK,UAAUA,EAAK,OAAS,IAAI,CAAC,EAEhE,KAAK,MAAQC,EAAK,MAClB,KAAK,OACE,IAGA,EAEf,EAEAV,GAAO,QAAUM,KC1GjB,IAAAO,GAAAC,EAAA,CAAAC,GAAAC,KAAA,CAAAA,GAAO,QAAU,CACb,OAAQ,KACR,QAAS,IACb,ICHA,IAAAC,GAAAC,EAAA,CAAAC,GAAAC,KAAA,CAKA,IAAIC,GAAS,KAAoB,OAEjC,SAASC,GAAQC,EAAOC,EAAGC,EAAI,CAgB3B,KAAK,SAAYF,IAAU,GAC3B,KAAK,MAAQA,GAAS,IACtB,KAAK,EAAKC,IAAM,OAAa,GAAKA,EAClC,KAAK,GAAMC,IAAO,OAAa,IAAMA,EACrC,KAAK,UAAY,IAAIJ,GAAOK,EAAsB,EAClD,KAAK,OAAS,EACd,KAAK,MAAM,CACf,CAEAJ,GAAQ,UAAU,MAAQ,UAAW,CAGjC,KAAK,UAAU,MAAM,EACrB,KAAK,EAAI,EACT,KAAK,QAAU,EACf,KAAK,cAAgB,CACzB,EAEAA,GAAQ,UAAU,KAAO,UAAW,CAChC,OAAO,KAAK,UAAU,IAC1B,EAEAA,GAAQ,UAAU,QAAU,SAASK,EAAY,CAG7C,IAAIC,EAAS,CAAC,EACd,OAAID,GACA,KAAK,UAAU,EAAI,EACnB,KAAK,UAAU,KAAK,SAASE,EAAG,CAAED,EAAO,KAAKC,CAAC,CAAG,CAAC,GAEnD,KAAK,UAAU,KAAK,SAASA,EAAG,CAAED,EAAO,KAAK,CAAC,KAAKC,EAAE,KAAM,EAAEA,EAAE,CAAC,CAAC,CAAG,CAAC,EAEnED,CACX,EAEAN,GAAQ,UAAU,QAAU,UAAW,CACnC,IAAIQ,EAAU,KAAK,SAAY,SAAW,iBACtCC,EAAI,CAACD,EAAS,KAAK,EAAI,kBAAoB,KAAK,KAAK,EAAI,aACpD,SAAS,KAAK,WAAW,CAAC,EAC1B,SAAS,KAAK,WAAW,GAAI,EAC7B,SAAS,KAAK,WAAW,EAAG,EAC5B,SAAS,KAAK,WAAW,GAAI,EAC7B,SAAS,KAAK,WAAW,CAAG,CAAC,EACtC,OAAOC,EAAE,KAAK;AAAA,CAAI,CACtB,EAEA,SAASL,GAAuBM,EAAGC,EAAG,CAGlC,OAAQD,EAAE,KAAOC,EAAE,KAAQ,EAAKD,EAAE,KAAOC,EAAE,KAAQ,GAAK,CAC5D,CAEA,SAASC,GAA4BF,EAAGC,EAAG,CAGvC,OAAQD,EAAE,UAAYC,EAAE,SAC5B,CAEAX,GAAQ,UAAU,KAAO,SAASa,EAAGC,EAAG,CAIpCA,EAAIA,GAAK,EACTD,EAAI,MAAM,QAAQA,CAAC,EAAIA,EAAI,CAACA,CAAC,EAC7B,QAASE,EAAI,EAAIA,EAAIF,EAAE,OAASE,IAC5B,KAAK,QAAQF,EAAEE,GAAID,CAAC,CAE5B,EAEAd,GAAQ,UAAU,cAAgB,SAASO,EAAG,CAG1CA,EAAI,MAAM,QAAQA,CAAC,EAAIA,EAAI,CAACA,CAAC,EAC7B,QAASQ,EAAI,EAAIA,EAAIR,EAAE,OAASQ,IAC5B,KAAK,QAAQR,EAAEQ,GAAG,KAAMR,EAAEQ,GAAG,CAAC,CAEtC,EAEAf,GAAQ,UAAU,UAAY,SAASgB,EAAO,CAS1C,GAAI,OAAK,IAAM,KAAK,eAChB,CAACA,GAAS,KAAK,IAAM,KAAK,GAAM,KAAK,EAAI,KAAK,eAGlD,KAAIC,EAAO,EACX,KAAK,UAAU,KAAK,SAASV,EAAG,CAC5BA,EAAE,UAAYU,EAAOV,EAAE,EAAI,EAC3BU,EAAOV,EAAE,KAAOU,EAAOV,EAAE,CAC7B,CAAC,EACD,KAAK,EAAI,KAAK,cAAgBU,EAClC,EAEAjB,GAAQ,UAAU,aAAe,SAASa,EAAG,CAKzC,GAAI,KAAK,KAAK,IAAM,EAChB,OAAO,KAEX,IAAIK,EAAO,KAAK,UAAU,WAAW,CAAC,KAAKL,CAAC,CAAC,EACzCN,EAAKW,EAAK,KAAK,IAAM,KAAQA,EAAK,KAAK,EAAIA,EAAK,KAAK,EACzD,GAAIX,EAAE,OAASM,GAAK,KAAK,SACrB,OAAON,EAEX,IAAIY,EAAOD,EAAK,KAAK,EACrB,OAAIC,GAAQ,KAAK,IAAIA,EAAK,KAAON,CAAC,EAAI,KAAK,IAAIN,EAAE,KAAOM,CAAC,EAC9CM,EAEAZ,CAEf,EAEAP,GAAQ,UAAU,cAAgB,SAASa,EAAGC,EAAGG,EAAM,CAInD,IAAIV,EAAI,CAAC,KAAKM,EAAG,EAAEC,EAAG,KAAKG,CAAI,EAC/B,YAAK,UAAU,OAAOV,CAAC,EACvB,KAAK,GAAKO,EACHP,CACX,EAEAP,GAAQ,UAAU,WAAa,SAASoB,EAASP,EAAGC,EAAG,CAK/CD,IAAMO,EAAQ,OACdA,EAAQ,MAAQN,GAAKD,EAAIO,EAAQ,OAASA,EAAQ,EAAIN,IAE1DM,EAAQ,MAAQN,EAChBM,EAAQ,WAAaN,EAAI,EACzBM,EAAQ,GAAKN,EACb,KAAK,GAAKA,CACd,EAEAd,GAAQ,UAAU,QAAU,SAASa,EAAGC,EAAG,CAGvC,IAAIO,EAAM,KAAK,UAAU,IAAI,EACzBC,EAAM,KAAK,UAAU,IAAI,EACzBF,EAAU,KAAK,aAAaP,CAAC,EACjC,GAAIO,GAAWA,EAAQ,OAASP,EAI5B,KAAK,WAAWO,EAASP,EAAGC,CAAC,UACtBM,IAAYC,EACnB,KAAK,cAAcR,EAAGC,EAAG,CAAC,UACnBM,IAAYE,EACnB,KAAK,cAAcT,EAAGC,EAAG,KAAK,CAAC,UACxB,KAAK,SACZ,KAAK,cAAcD,EAAGC,EAAGM,EAAQ,IAAI,MAClC,CAKH,IAAIG,EAAIH,EAAQ,UAAY,KAAK,EAC7BI,EAAQ,KAAK,MAAM,EAAI,KAAK,EAAI,KAAK,MAAQD,GAAK,EAAIA,EAAE,EACxDC,EAAQJ,EAAQ,GAAKN,EACrB,KAAK,WAAWM,EAASP,EAAGC,CAAC,EAE7B,KAAK,cAAcD,EAAGC,EAAGM,EAAQ,IAAI,CAE7C,CACA,KAAK,UAAU,EAAK,EAChB,CAAC,KAAK,UAAY,KAAK,GAAK,KAAK,KAAK,EAAI,KAAK,EAAI,KAAK,OAExD,KAAK,SAAS,CAEtB,EAEApB,GAAQ,UAAU,WAAa,SAASa,EAAG,CAKvC,IAAIK,EAAO,KAAK,UAAU,WAAW,CAAC,KAAKL,CAAC,CAAC,EACzCY,EAAQP,EAAK,KAAK,EAClBQ,EAASD,EAAM,OAASZ,EAAKY,EAAQP,EAAK,KAAK,EACnD,MAAO,CAACO,EAAOC,CAAK,CACxB,EAEA1B,GAAQ,UAAU,OAAS,SAAS2B,EAAY,CAY5C,IAAIC,EAAK,MAAM,QAAQD,CAAU,EAAIA,EAAa,CAACA,CAAU,EACzDE,EAAKD,EAAG,IAAI,KAAK,QAAS,IAAI,EAClC,OAAO,MAAM,QAAQD,CAAU,EAAIE,EAAKA,EAAG,EAC/C,EAEA7B,GAAQ,UAAU,QAAU,SAASa,EAAG,CACpC,GAAI,KAAK,KAAK,IAAM,EAEb,KAAIA,EAAI,KAAK,UAAU,IAAI,EAAE,KAChC,MAAO,GACJ,GAAIA,EAAI,KAAK,UAAU,IAAI,EAAE,KAChC,MAAO,GAIX,KAAK,UAAU,EAAI,EACnB,IAAIiB,EAAQ,KAAK,WAAWjB,CAAC,EACzBY,EAAQK,EAAM,GAAIJ,EAAQI,EAAM,GACpC,GAAI,KAAK,SACL,OAAOL,EAAM,KAAO,KAAK,EAEzB,IAAIR,EAAOQ,EAAM,UACjB,OAAIA,IAAUC,IACVT,IAASJ,EAAIY,EAAM,OAASC,EAAM,UAAYD,EAAM,YAAcC,EAAM,KAAOD,EAAM,OAElFR,EAAO,KAAK,EAE3B,EAEAjB,GAAQ,UAAU,gBAAkB,SAASiB,EAAM,CAO/C,KAAK,UAAU,YAAcL,GAC7B,IAAIM,EAAO,KAAK,UAAU,WAAW,CAAC,UAAUD,CAAI,CAAC,EACrD,KAAK,UAAU,YAAcb,GAC7B,IAAIqB,EAAQP,EAAK,KAAK,EAClBQ,EAASD,GAASA,EAAM,YAAcR,EAAQQ,EAAQP,EAAK,KAAK,EACpE,MAAO,CAACO,EAAOC,CAAK,CACxB,EAEA1B,GAAQ,UAAU,WAAa,SAAS+B,EAAY,CAehD,IAAIF,EAAK,MAAM,QAAQE,CAAU,EAAIA,EAAa,CAACA,CAAU,EACzDC,EAAKH,EAAG,IAAI,KAAK,YAAa,IAAI,EACtC,OAAO,MAAM,QAAQE,CAAU,EAAIC,EAAKA,EAAG,EAC/C,EAEAhC,GAAQ,UAAU,YAAc,SAASuB,EAAG,CACxC,GAAI,KAAK,KAAK,IAAM,EAGpB,MAAK,UAAU,EAAI,EACnB,IAAIU,EAAI,KAAK,EAAIV,EACbO,EAAQ,KAAK,gBAAgBG,CAAC,EAC9BR,EAAQK,EAAM,GAAIJ,EAAQI,EAAM,GAEpC,OAAIJ,IAAUD,GAASA,IAAU,MAAQC,IAAU,MACvCD,GAASC,GAAO,KAChB,KAAK,SAENO,GAAKR,EAAM,KACXA,EAAM,KAENC,EAAM,KAJND,EAAM,MAAQQ,EAAIR,EAAM,YAAcC,EAAM,KAAOD,EAAM,OAASC,EAAM,UAAYD,EAAM,WAMzG,EAEA,SAASS,GAAWC,EAAS,CAIzB,IAAIC,EAAM,KAAK,MAAM,KAAK,OAAO,EAAID,EAAQ,MAAM,EACnD,OAAOA,EAAQ,OAAOC,EAAK,CAAC,EAAE,EAClC,CAEApC,GAAQ,UAAU,SAAW,UAAW,CAMpC,GAAI,MAAK,YAGT,KAAIqC,EAAS,KAAK,QAAQ,EAG1B,IAFA,KAAK,MAAM,EACX,KAAK,YAAc,GACZA,EAAO,OAAS,GACnB,KAAK,cAAcH,GAAWG,CAAM,CAAC,EAEzC,KAAK,UAAU,EAAI,EACnB,KAAK,YAAc,GACvB,EAEA,SAASC,GAAOC,EAAQ,CAMpB,KAAK,OAASA,GAAU,CAAC,EACzB,KAAK,KAAO,KAAK,OAAO,MAAQ,OAChCvC,GAAQ,KAAK,KAAM,KAAK,OAAS,OAASuC,EAAO,MAAQ,EAAK,EAC9D,KAAK,aAAe,KAAK,OAAO,OAAS,GACzC,KAAK,cAAgB,KAAK,OAAO,QAAU,IAC3C,KAAK,SAAW,CACpB,CACAD,GAAO,UAAY,OAAO,OAAOtC,GAAQ,SAAS,EAClDsC,GAAO,UAAU,YAAcA,GAE/BA,GAAO,UAAU,KAAO,SAASX,EAAY,CACzC3B,GAAQ,UAAU,KAAK,KAAK,KAAM2B,CAAU,EAC5C,KAAK,iBAAiB,CAC1B,EAEAW,GAAO,UAAU,cAAgB,SAASzB,EAAGC,EAAGG,EAAM,CAClD,KAAK,UAAY,EACjBjB,GAAQ,UAAU,cAAc,KAAK,KAAMa,EAAGC,EAAGG,CAAI,CACzD,EAEAqB,GAAO,UAAU,WAAa,SAASlB,EAASP,EAAGC,EAAG,CAC9CM,EAAQ,IAAM,IACd,KAAK,UAAY,GAErBpB,GAAQ,UAAU,WAAW,KAAK,KAAMoB,EAASP,EAAGC,CAAC,CACzD,EAEAwB,GAAO,UAAU,iBAAmB,UAAW,CAK3C,OAAI,KAAK,OAAS,QAAU,KAAK,KAAK,EAAI,KAAK,cACpC,GAEP,KAAK,SAAW,KAAK,KAAK,EAAI,KAAK,cACnC,KAAK,KAAO,OACZ,KAAK,SAAW,GAChB,KAAK,MAAQ,KAAK,OAAO,OAAS,IAClC,KAAK,SAAS,EACP,IAEJ,EACX,EAEAxC,GAAO,QAAU,CACb,QAAWE,GACX,OAAUsC,EACd,oPChYO,SAASE,EAAOC,EAAM,CAC5B,IAAIC,EAAGC,EAAGC,EAAKC,EAEf,IAAKF,EAAI,EAAGC,EAAM,UAAU,OAAQD,EAAIC,EAAKD,IAAK,CACjDE,EAAM,UAAUF,GAChB,IAAKD,KAAKG,EACTJ,EAAKC,GAAKG,EAAIH,EAEjB,CACC,OAAOD,CACR,CAIO,IAAIK,EAAS,OAAO,QAAW,UAAY,CACjD,SAASC,GAAI,CAAA,CACb,OAAO,SAAUC,EAAO,CACvB,OAAAD,EAAE,UAAYC,EACP,IAAID,CACb,CACA,EAAC,EAKM,SAASE,EAAKC,EAAIC,EAAK,CAC7B,IAAIC,EAAQ,MAAM,UAAU,MAE5B,GAAIF,EAAG,KACN,OAAOA,EAAG,KAAK,MAAMA,EAAIE,EAAM,KAAK,UAAW,CAAC,CAAC,EAGlD,IAAIC,EAAOD,EAAM,KAAK,UAAW,CAAC,EAElC,OAAO,UAAY,CAClB,OAAOF,EAAG,MAAMC,EAAKE,EAAK,OAASA,EAAK,OAAOD,EAAM,KAAK,SAAS,CAAC,EAAI,SAAS,CACnF,CACA,CAIO,IAAIE,EAAS,EAIb,SAASC,EAAMJ,EAAK,CAC1B,MAAM,gBAAiBA,IACtBA,EAAI,YAAiB,EAAEG,GAEjBH,EAAI,WACZ,CASO,SAASK,EAASN,EAAIO,EAAMC,EAAS,CAC3C,IAAIC,EAAMN,EAAMO,EAAWC,EAE3B,OAAAA,EAAQ,UAAY,CAEnBF,EAAO,GACHN,IACHO,EAAU,MAAMF,EAASL,CAAI,EAC7BA,EAAO,GAEV,EAECO,EAAY,UAAY,CACnBD,EAEHN,EAAO,WAIPH,EAAG,MAAMQ,EAAS,SAAS,EAC3B,WAAWG,EAAOJ,CAAI,EACtBE,EAAO,GAEV,EAEQC,CACR,CAMO,SAASE,EAAQC,EAAGC,EAAOC,EAAY,CAC7C,IAAIC,EAAMF,EAAM,GACZG,EAAMH,EAAM,GACZI,EAAIF,EAAMC,EACd,OAAOJ,IAAMG,GAAOD,EAAaF,IAAMA,EAAII,GAAOC,EAAIA,GAAKA,EAAID,CAChE,CAIO,SAASE,GAAU,CAAE,MAAO,EAAM,CAMlC,SAASC,EAAUC,EAAKC,EAAW,CACzC,GAAIA,IAAc,GAAS,OAAOD,EAClC,IAAIE,EAAM,KAAK,IAAI,GAAID,IAAc,OAAY,EAAIA,CAAS,EAC9D,OAAO,KAAK,MAAMD,EAAME,CAAG,EAAIA,CAChC,CAIO,SAASC,EAAKC,EAAK,CACzB,OAAOA,EAAI,KAAOA,EAAI,KAAI,EAAKA,EAAI,QAAQ,aAAc,EAAE,CAC5D,CAIO,SAASC,EAAWD,EAAK,CAC/B,OAAOD,EAAKC,CAAG,EAAE,MAAM,KAAK,CAC7B,CAIO,SAASE,EAAW1B,EAAK2B,EAAS,CACnC,OAAO,UAAU,eAAe,KAAK3B,EAAK,SAAS,IACvDA,EAAI,QAAUA,EAAI,QAAUL,EAAOK,EAAI,OAAO,EAAI,CAAA,GAEnD,QAAST,KAAKoC,EACb3B,EAAI,QAAQT,GAAKoC,EAAQpC,GAE1B,OAAOS,EAAI,OACZ,CAOO,SAAS4B,EAAe5B,EAAK6B,EAAaC,EAAW,CAC3D,IAAIC,EAAS,CAAA,EACb,QAASxC,KAAKS,EACb+B,EAAO,KAAK,mBAAmBD,EAAYvC,EAAE,YAAW,EAAKA,CAAC,EAAI,IAAM,mBAAmBS,EAAIT,EAAE,CAAC,EAEnG,OAAS,CAACsC,GAAeA,EAAY,QAAQ,GAAG,IAAM,GAAM,IAAM,KAAOE,EAAO,KAAK,GAAG,CACzF,CAEA,IAAIC,EAAa,sBAOV,SAASC,EAAST,EAAKU,EAAM,CACnC,OAAOV,EAAI,QAAQQ,EAAY,SAAUR,EAAKW,EAAK,CAClD,IAAIC,EAAQF,EAAKC,GAEjB,GAAIC,IAAU,OACb,MAAM,IAAI,MAAM,kCAAoCZ,CAAG,EAEjD,OAAI,OAAOY,GAAU,aAC3BA,EAAQA,EAAMF,CAAI,GAEZE,CACT,CAAE,CACF,CAIO,IAAIC,EAAU,MAAM,SAAW,SAAUrC,EAAK,CACpD,OAAQ,OAAO,UAAU,SAAS,KAAKA,CAAG,IAAM,gBACjD,EAIO,SAASsC,EAAQC,EAAOC,EAAI,CAClC,QAASjD,EAAI,EAAGA,EAAIgD,EAAM,OAAQhD,IACjC,GAAIgD,EAAMhD,KAAOiD,EAAM,OAAOjD,EAE/B,MAAO,EACR,CAMO,IAAIkD,EAAgB,6DAI3B,SAASC,EAAYC,EAAM,CAC1B,OAAO,OAAO,SAAWA,IAAS,OAAO,MAAQA,IAAS,OAAO,KAAOA,EACzE,CAEA,IAAIC,GAAW,EAGf,SAASC,GAAa9C,EAAI,CACzB,IAAIO,EAAO,CAAC,IAAI,KACZwC,EAAa,KAAK,IAAI,EAAG,IAAMxC,EAAOsC,GAAS,EAEnD,OAAAA,GAAWtC,EAAOwC,EACX,OAAO,WAAW/C,EAAI+C,CAAU,CACxC,CAEO,IAAIC,GAAY,OAAO,uBAAyBL,EAAY,uBAAuB,GAAKG,GACpFG,GAAW,OAAO,sBAAwBN,EAAY,sBAAsB,GACrFA,EAAY,6BAA6B,GAAK,SAAUO,EAAI,CAAE,OAAO,aAAaA,CAAE,CAAE,EAQjF,SAASC,EAAiBnD,EAAIQ,EAAS4C,EAAW,CACxD,GAAIA,GAAaJ,KAAcF,GAC9B9C,EAAG,KAAKQ,CAAO,MAEf,QAAOwC,GAAU,KAAK,OAAQjD,EAAKC,EAAIQ,CAAO,CAAC,CAEjD,CAIO,SAAS6C,EAAgBH,EAAI,CAC/BA,GACHD,GAAS,KAAK,OAAQC,CAAE,CAE1B,0RCtOO,SAASI,GAAQ,CAAA,CAExBA,EAAM,OAAS,SAAUC,EAAO,CAK/B,IAAIC,EAAW,UAAY,CAE1BC,EAAgB,IAAI,EAGhB,KAAK,YACR,KAAK,WAAW,MAAM,KAAM,SAAS,EAItC,KAAK,cAAa,CACpB,EAEKC,EAAcF,EAAS,UAAY,KAAK,UAExC1D,EAAQ6D,EAAYD,CAAW,EACnC5D,EAAM,YAAc0D,EAEpBA,EAAS,UAAY1D,EAGrB,QAASN,KAAK,KACT,OAAO,UAAU,eAAe,KAAK,KAAMA,CAAC,GAAKA,IAAM,aAAeA,IAAM,cAC/EgE,EAAShE,GAAK,KAAKA,IAKrB,OAAI+D,EAAM,SACTK,EAAYJ,EAAUD,EAAM,OAAO,EAIhCA,EAAM,WACTM,GAA2BN,EAAM,QAAQ,EACzCK,EAAY,MAAM,KAAM,CAAC9D,CAAK,EAAE,OAAOyD,EAAM,QAAQ,CAAC,GAIvDK,EAAY9D,EAAOyD,CAAK,EACxB,OAAOzD,EAAM,QACb,OAAOA,EAAM,SAGTA,EAAM,UACTA,EAAM,QAAU4D,EAAY,QAAUC,EAAYD,EAAY,OAAO,EAAI,CAAA,EACzEE,EAAY9D,EAAM,QAASyD,EAAM,OAAO,GAGzCzD,EAAM,WAAa,CAAA,EAGnBA,EAAM,cAAgB,UAAY,CAEjC,GAAI,MAAK,iBAET,CAAI4D,EAAY,eACfA,EAAY,cAAc,KAAK,IAAI,EAGpC,KAAK,iBAAmB,GAExB,QAASlE,EAAI,EAAGE,EAAMI,EAAM,WAAW,OAAQN,EAAIE,EAAKF,IACvDM,EAAM,WAAWN,GAAG,KAAK,IAAI,EAEhC,EAEQgE,CACR,EAKAF,EAAM,QAAU,SAAUC,EAAO,CAChC,IAAIO,EAAgB,KAAK,UAAU,QACnCF,OAAAA,EAAY,KAAK,UAAWL,CAAK,EAC7BA,EAAM,UACT,KAAK,UAAU,QAAUO,EACzB,KAAK,aAAaP,EAAM,OAAO,GAEzB,IACR,EAIAD,EAAM,aAAe,SAAU1B,EAAS,CACvCgC,OAAAA,EAAY,KAAK,UAAU,QAAShC,CAAO,EACpC,IACR,EAIA0B,EAAM,YAAc,SAAUtD,EAAI,CACjC,IAAIG,EAAO,MAAM,UAAU,MAAM,KAAK,UAAW,CAAC,EAE9C4D,EAAO,OAAO/D,GAAO,WAAaA,EAAK,UAAY,CACtD,KAAKA,GAAI,MAAM,KAAMG,CAAI,CAC3B,EAEC,YAAK,UAAU,WAAa,KAAK,UAAU,YAAc,CAAA,EACzD,KAAK,UAAU,WAAW,KAAK4D,CAAI,EAC5B,IACR,EAEA,SAASF,GAA2BG,EAAU,CAE7C,GAAI,SAAO,EAAM,KAAe,CAAC,GAAK,CAAC,EAAE,OAEzC,CAAAA,EAAWC,EAAaD,CAAQ,EAAIA,EAAW,CAACA,CAAQ,EAExD,QAASxE,EAAI,EAAGA,EAAIwE,EAAS,OAAQxE,IAChCwE,EAASxE,KAAO,EAAE,MAAM,QAC3B,QAAQ,KAAK,iIAE8B,IAAI,MAAK,EAAG,KAAK,EAG/D,CC1GO,IAAI0E,EAAS,CAQnB,GAAI,SAAUC,EAAOnE,EAAIQ,EAAS,CAGjC,GAAI,OAAO2D,GAAU,SACpB,QAASC,KAAQD,EAGhB,KAAK,IAAIC,EAAMD,EAAMC,GAAOpE,CAAE,MAGzB,CAENmE,EAAQE,EAAgBF,CAAK,EAE7B,QAAS3E,EAAI,EAAGE,EAAMyE,EAAM,OAAQ3E,EAAIE,EAAKF,IAC5C,KAAK,IAAI2E,EAAM3E,GAAIQ,EAAIQ,CAAO,CAElC,CAEE,OAAO,IACT,EAaC,IAAK,SAAU2D,EAAOnE,EAAIQ,EAAS,CAElC,GAAI,CAAC,UAAU,OAEd,OAAO,KAAK,gBAEF,OAAO2D,GAAU,SAC3B,QAASC,KAAQD,EAChB,KAAK,KAAKC,EAAMD,EAAMC,GAAOpE,CAAE,MAG1B,CACNmE,EAAQE,EAAgBF,CAAK,EAG7B,QADIG,EAAY,UAAU,SAAW,EAC5B9E,EAAI,EAAGE,EAAMyE,EAAM,OAAQ3E,EAAIE,EAAKF,IACxC8E,EACH,KAAK,KAAKH,EAAM3E,EAAE,EAElB,KAAK,KAAK2E,EAAM3E,GAAIQ,EAAIQ,CAAO,CAGpC,CAEE,OAAO,IACT,EAGC,IAAK,SAAU4D,EAAMpE,EAAIQ,EAAS+D,EAAO,CACxC,GAAI,OAAOvE,GAAO,WAAY,CAC7B,QAAQ,KAAK,wBAA0B,OAAOA,CAAE,EAChD,MACH,CAGE,GAAI,KAAK,SAASoE,EAAMpE,EAAIQ,CAAO,IAAM,GAIzC,CAAIA,IAAY,OAEfA,EAAU,QAGX,IAAIgE,EAAc,CAAC,GAAIxE,EAAI,IAAKQ,CAAO,EACnC+D,IACHC,EAAY,KAAO,IAGpB,KAAK,QAAU,KAAK,SAAW,CAAA,EAC/B,KAAK,QAAQJ,GAAQ,KAAK,QAAQA,IAAS,CAAA,EAC3C,KAAK,QAAQA,GAAM,KAAKI,CAAW,EACrC,EAEC,KAAM,SAAUJ,EAAMpE,EAAIQ,EAAS,CAClC,IAAIiE,EACAjF,EACAE,EAEJ,GAAK,KAAK,UAIV+E,EAAY,KAAK,QAAQL,GACrB,EAACK,GAIL,IAAI,UAAU,SAAW,EAAG,CAC3B,GAAI,KAAK,aAGR,IAAKjF,EAAI,EAAGE,EAAM+E,EAAU,OAAQjF,EAAIE,EAAKF,IAC5CiF,EAAUjF,GAAG,GAAKkF,EAIpB,OAAO,KAAK,QAAQN,GACpB,MACH,CAEE,GAAI,OAAOpE,GAAO,WAAY,CAC7B,QAAQ,KAAK,wBAA0B,OAAOA,CAAE,EAChD,MACH,CAGE,IAAI2E,EAAQ,KAAK,SAASP,EAAMpE,EAAIQ,CAAO,EAC3C,GAAImE,IAAU,GAAO,CACpB,IAAIC,EAAWH,EAAUE,GACrB,KAAK,eAERC,EAAS,GAAKF,EAGd,KAAK,QAAQN,GAAQK,EAAYA,EAAU,MAAK,GAEjDA,EAAU,OAAOE,EAAO,CAAC,CAC5B,EACA,EAMC,KAAM,SAAUP,EAAMjC,EAAM0C,EAAW,CACtC,GAAI,CAAC,KAAK,QAAQT,EAAMS,CAAS,EAAK,OAAO,KAE7C,IAAIC,EAAQlB,EAAY,CAAA,EAAIzB,EAAM,CACjC,KAAMiC,EACN,OAAQ,KACR,aAAcjC,GAAQA,EAAK,cAAgB,IAC9C,CAAG,EAED,GAAI,KAAK,QAAS,CACjB,IAAIsC,EAAY,KAAK,QAAQL,GAC7B,GAAIK,EAAW,CACd,KAAK,aAAgB,KAAK,aAAe,GAAM,EAC/C,QAASjF,EAAI,EAAGE,EAAM+E,EAAU,OAAQjF,EAAIE,EAAKF,IAAK,CACrD,IAAIuF,EAAIN,EAAUjF,GAEdQ,EAAK+E,EAAE,GACPA,EAAE,MACL,KAAK,IAAIX,EAAMpE,EAAI+E,EAAE,GAAG,EAEzB/E,EAAG,KAAK+E,EAAE,KAAO,KAAMD,CAAK,CACjC,CAEI,KAAK,cACT,CACA,CAEE,OAAID,GAEH,KAAK,gBAAgBC,CAAK,EAGpB,IACT,EAMC,QAAS,SAAUV,EAAMpE,EAAIQ,EAASqE,EAAW,CAC5C,OAAOT,GAAS,UACnB,QAAQ,KAAK,iCAAiC,EAI/C,IAAIY,EAAMhF,EACN,OAAOA,GAAO,aACjB6E,EAAY,CAAC,CAAC7E,EACdgF,EAAM,OACNxE,EAAU,QAGX,IAAIiE,EAAY,KAAK,SAAW,KAAK,QAAQL,GAC7C,GAAIK,GAAaA,EAAU,QACtB,KAAK,SAASL,EAAMY,EAAKxE,CAAO,IAAM,GACzC,MAAO,GAIT,GAAIqE,GAEH,QAAS3B,KAAM,KAAK,cACnB,GAAI,KAAK,cAAcA,GAAI,QAAQkB,EAAMpE,EAAIQ,EAASqE,CAAS,EAAK,MAAO,GAG7E,MAAO,EACT,EAGC,SAAU,SAAUT,EAAMpE,EAAIQ,EAAS,CACtC,GAAI,CAAC,KAAK,QACT,MAAO,GAGR,IAAIiE,EAAY,KAAK,QAAQL,IAAS,CAAA,EACtC,GAAI,CAACpE,EACJ,MAAO,CAAC,CAACyE,EAAU,OAGhBjE,IAAY,OAEfA,EAAU,QAGX,QAAShB,EAAI,EAAGE,EAAM+E,EAAU,OAAQjF,EAAIE,EAAKF,IAChD,GAAIiF,EAAUjF,GAAG,KAAOQ,GAAMyE,EAAUjF,GAAG,MAAQgB,EAClD,OAAOhB,EAGT,MAAO,EAET,EAIC,KAAM,SAAU2E,EAAOnE,EAAIQ,EAAS,CAGnC,GAAI,OAAO2D,GAAU,SACpB,QAASC,KAAQD,EAGhB,KAAK,IAAIC,EAAMD,EAAMC,GAAOpE,EAAI,EAAI,MAG/B,CAENmE,EAAQE,EAAgBF,CAAK,EAE7B,QAAS3E,EAAI,EAAGE,EAAMyE,EAAM,OAAQ3E,EAAIE,EAAKF,IAC5C,KAAK,IAAI2E,EAAM3E,GAAIQ,EAAIQ,EAAS,EAAI,CAExC,CAEE,OAAO,IACT,EAIC,eAAgB,SAAUP,EAAK,CAC9B,YAAK,cAAgB,KAAK,eAAiB,CAAA,EAC3C,KAAK,cAAcgF,EAAWhF,CAAG,GAAKA,EAC/B,IACT,EAIC,kBAAmB,SAAUA,EAAK,CACjC,OAAI,KAAK,eACR,OAAO,KAAK,cAAcgF,EAAWhF,CAAG,GAElC,IACT,EAEC,gBAAiB,SAAUiF,EAAG,CAC7B,QAAShC,KAAM,KAAK,cACnB,KAAK,cAAcA,GAAI,KAAKgC,EAAE,KAAMtB,EAAY,CAC/C,MAAOsB,EAAE,OACT,eAAgBA,EAAE,MACtB,EAAMA,CAAC,EAAG,EAAI,CAEd,CACA,EAMAhB,EAAO,iBAAmBA,EAAO,GAOjCA,EAAO,oBAAsBA,EAAO,uBAAyBA,EAAO,IAIpEA,EAAO,wBAA0BA,EAAO,KAIxCA,EAAO,UAAYA,EAAO,KAI1BA,EAAO,kBAAoBA,EAAO,QAExB,IAACiB,EAAU7B,EAAM,OAAOY,CAAM,EC7TjC,SAASkB,EAAMvE,EAAGwE,EAAGC,EAAO,CAElC,KAAK,EAAKA,EAAQ,KAAK,MAAMzE,CAAC,EAAIA,EAElC,KAAK,EAAKyE,EAAQ,KAAK,MAAMD,CAAC,EAAIA,CACnC,CAEA,IAAIE,GAAQ,KAAK,OAAS,SAAUC,EAAG,CACtC,OAAOA,EAAI,EAAI,KAAK,MAAMA,CAAC,EAAI,KAAK,KAAKA,CAAC,CAC3C,EAEAJ,EAAM,UAAY,CAIjB,MAAO,UAAY,CAClB,OAAO,IAAIA,EAAM,KAAK,EAAG,KAAK,CAAC,CACjC,EAIC,IAAK,SAAUK,EAAO,CAErB,OAAO,KAAK,MAAK,EAAG,KAAKC,EAAQD,CAAK,CAAC,CACzC,EAEC,KAAM,SAAUA,EAAO,CAEtB,YAAK,GAAKA,EAAM,EAChB,KAAK,GAAKA,EAAM,EACT,IACT,EAIC,SAAU,SAAUA,EAAO,CAC1B,OAAO,KAAK,MAAK,EAAG,UAAUC,EAAQD,CAAK,CAAC,CAC9C,EAEC,UAAW,SAAUA,EAAO,CAC3B,YAAK,GAAKA,EAAM,EAChB,KAAK,GAAKA,EAAM,EACT,IACT,EAIC,SAAU,SAAUpE,EAAK,CACxB,OAAO,KAAK,MAAK,EAAG,UAAUA,CAAG,CACnC,EAEC,UAAW,SAAUA,EAAK,CACzB,YAAK,GAAKA,EACV,KAAK,GAAKA,EACH,IACT,EAIC,WAAY,SAAUA,EAAK,CAC1B,OAAO,KAAK,MAAK,EAAG,YAAYA,CAAG,CACrC,EAEC,YAAa,SAAUA,EAAK,CAC3B,YAAK,GAAKA,EACV,KAAK,GAAKA,EACH,IACT,EAOC,QAAS,SAAUoE,EAAO,CACzB,OAAO,IAAIL,EAAM,KAAK,EAAIK,EAAM,EAAG,KAAK,EAAIA,EAAM,CAAC,CACrD,EAKC,UAAW,SAAUA,EAAO,CAC3B,OAAO,IAAIL,EAAM,KAAK,EAAIK,EAAM,EAAG,KAAK,EAAIA,EAAM,CAAC,CACrD,EAIC,MAAO,UAAY,CAClB,OAAO,KAAK,MAAK,EAAG,OAAM,CAC5B,EAEC,OAAQ,UAAY,CACnB,YAAK,EAAI,KAAK,MAAM,KAAK,CAAC,EAC1B,KAAK,EAAI,KAAK,MAAM,KAAK,CAAC,EACnB,IACT,EAIC,MAAO,UAAY,CAClB,OAAO,KAAK,MAAK,EAAG,OAAM,CAC5B,EAEC,OAAQ,UAAY,CACnB,YAAK,EAAI,KAAK,MAAM,KAAK,CAAC,EAC1B,KAAK,EAAI,KAAK,MAAM,KAAK,CAAC,EACnB,IACT,EAIC,KAAM,UAAY,CACjB,OAAO,KAAK,MAAK,EAAG,MAAK,CAC3B,EAEC,MAAO,UAAY,CAClB,YAAK,EAAI,KAAK,KAAK,KAAK,CAAC,EACzB,KAAK,EAAI,KAAK,KAAK,KAAK,CAAC,EAClB,IACT,EAIC,MAAO,UAAY,CAClB,OAAO,KAAK,MAAK,EAAG,OAAM,CAC5B,EAEC,OAAQ,UAAY,CACnB,YAAK,EAAIF,GAAM,KAAK,CAAC,EACrB,KAAK,EAAIA,GAAM,KAAK,CAAC,EACd,IACT,EAIC,WAAY,SAAUE,EAAO,CAC5BA,EAAQC,EAAQD,CAAK,EAErB,IAAI5E,EAAI4E,EAAM,EAAI,KAAK,EACnBJ,EAAII,EAAM,EAAI,KAAK,EAEvB,OAAO,KAAK,KAAK5E,EAAIA,EAAIwE,EAAIA,CAAC,CAChC,EAIC,OAAQ,SAAUI,EAAO,CACxB,OAAAA,EAAQC,EAAQD,CAAK,EAEdA,EAAM,IAAM,KAAK,GACjBA,EAAM,IAAM,KAAK,CAC1B,EAIC,SAAU,SAAUA,EAAO,CAC1B,OAAAA,EAAQC,EAAQD,CAAK,EAEd,KAAK,IAAIA,EAAM,CAAC,GAAK,KAAK,IAAI,KAAK,CAAC,GACpC,KAAK,IAAIA,EAAM,CAAC,GAAK,KAAK,IAAI,KAAK,CAAC,CAC7C,EAIC,SAAU,UAAY,CACrB,MAAO,SACCrE,EAAU,KAAK,CAAC,EAAI,KACpBA,EAAU,KAAK,CAAC,EAAI,GAC9B,CACA,EAYO,SAASsE,EAAQ7E,EAAGwE,EAAGC,EAAO,CACpC,OAAIzE,aAAauE,EACTvE,EAEJyB,EAAQzB,CAAC,EACL,IAAIuE,EAAMvE,EAAE,GAAIA,EAAE,EAAE,EAELA,GAAM,KACrBA,EAEJ,OAAOA,GAAM,UAAY,MAAOA,GAAK,MAAOA,EACxC,IAAIuE,EAAMvE,EAAE,EAAGA,EAAE,CAAC,EAEnB,IAAIuE,EAAMvE,EAAGwE,EAAGC,CAAK,CAC7B,CClMO,SAASK,GAAOC,EAAGC,EAAG,CAC5B,GAAKD,EAIL,QAFIE,EAASD,EAAI,CAACD,EAAGC,CAAC,EAAID,EAEjBpG,EAAI,EAAGE,EAAMoG,EAAO,OAAQtG,EAAIE,EAAKF,IAC7C,KAAK,OAAOsG,EAAOtG,EAAE,CAEvB,CAEAmG,GAAO,UAAY,CAOlB,OAAQ,SAAU1F,EAAK,CACtB,IAAI8F,EAAMC,EACV,GAAI,CAAC/F,EAAO,OAAO,KAEnB,GAAIA,aAAemF,GAAS,OAAOnF,EAAI,IAAO,UAAY,MAAOA,EAChE8F,EAAOC,EAAON,EAAQzF,CAAG,UAEzBA,EAAMgG,GAAShG,CAAG,EAClB8F,EAAO9F,EAAI,IACX+F,EAAO/F,EAAI,IAEP,CAAC8F,GAAQ,CAACC,EAAQ,OAAO,KAO9B,MAAI,CAAC,KAAK,KAAO,CAAC,KAAK,KACtB,KAAK,IAAMD,EAAK,MAAK,EACrB,KAAK,IAAMC,EAAK,MAAK,IAErB,KAAK,IAAI,EAAI,KAAK,IAAID,EAAK,EAAG,KAAK,IAAI,CAAC,EACxC,KAAK,IAAI,EAAI,KAAK,IAAIC,EAAK,EAAG,KAAK,IAAI,CAAC,EACxC,KAAK,IAAI,EAAI,KAAK,IAAID,EAAK,EAAG,KAAK,IAAI,CAAC,EACxC,KAAK,IAAI,EAAI,KAAK,IAAIC,EAAK,EAAG,KAAK,IAAI,CAAC,GAElC,IACT,EAIC,UAAW,SAAUV,EAAO,CAC3B,OAAOI,GACE,KAAK,IAAI,EAAI,KAAK,IAAI,GAAK,GAC3B,KAAK,IAAI,EAAI,KAAK,IAAI,GAAK,EAAGJ,CAAK,CAC9C,EAIC,cAAe,UAAY,CAC1B,OAAOI,EAAQ,KAAK,IAAI,EAAG,KAAK,IAAI,CAAC,CACvC,EAIC,YAAa,UAAY,CACxB,OAAOA,EAAQ,KAAK,IAAI,EAAG,KAAK,IAAI,CAAC,CACvC,EAIC,WAAY,UAAY,CACvB,OAAO,KAAK,GACd,EAIC,eAAgB,UAAY,CAC3B,OAAO,KAAK,GACd,EAIC,QAAS,UAAY,CACpB,OAAO,KAAK,IAAI,SAAS,KAAK,GAAG,CACnC,EAOC,SAAU,SAAUzF,EAAK,CACxB,IAAIgB,EAAKD,EAET,OAAI,OAAOf,EAAI,IAAO,UAAYA,aAAemF,EAChDnF,EAAMyF,EAAQzF,CAAG,EAEjBA,EAAMgG,GAAShG,CAAG,EAGfA,aAAe0F,IAClB1E,EAAMhB,EAAI,IACVe,EAAMf,EAAI,KAEVgB,EAAMD,EAAMf,EAGLgB,EAAI,GAAK,KAAK,IAAI,GAClBD,EAAI,GAAK,KAAK,IAAI,GAClBC,EAAI,GAAK,KAAK,IAAI,GAClBD,EAAI,GAAK,KAAK,IAAI,CAC5B,EAKC,WAAY,SAAUkF,EAAQ,CAC7BA,EAASD,GAASC,CAAM,EAExB,IAAIjF,EAAM,KAAK,IACXD,EAAM,KAAK,IACX+E,EAAOG,EAAO,IACdF,EAAOE,EAAO,IACdC,EAAeH,EAAK,GAAK/E,EAAI,GAAO8E,EAAK,GAAK/E,EAAI,EAClDoF,EAAeJ,EAAK,GAAK/E,EAAI,GAAO8E,EAAK,GAAK/E,EAAI,EAEtD,OAAOmF,GAAeC,CACxB,EAKC,SAAU,SAAUF,EAAQ,CAC3BA,EAASD,GAASC,CAAM,EAExB,IAAIjF,EAAM,KAAK,IACXD,EAAM,KAAK,IACX+E,EAAOG,EAAO,IACdF,EAAOE,EAAO,IACdG,EAAaL,EAAK,EAAI/E,EAAI,GAAO8E,EAAK,EAAI/E,EAAI,EAC9CsF,EAAaN,EAAK,EAAI/E,EAAI,GAAO8E,EAAK,EAAI/E,EAAI,EAElD,OAAOqF,GAAaC,CACtB,EAIC,QAAS,UAAY,CACpB,MAAO,CAAC,EAAE,KAAK,KAAO,KAAK,IAC7B,EAOC,IAAK,SAAUC,EAAa,CAC3B,IAAItF,EAAM,KAAK,IACfD,EAAM,KAAK,IACXwF,EAAe,KAAK,IAAIvF,EAAI,EAAID,EAAI,CAAC,EAAIuF,EACzCE,EAAc,KAAK,IAAIxF,EAAI,EAAID,EAAI,CAAC,EAAIuF,EAGxC,OAAON,GACNP,EAAQzE,EAAI,EAAIuF,EAAcvF,EAAI,EAAIwF,CAAW,EACjDf,EAAQ1E,EAAI,EAAIwF,EAAcxF,EAAI,EAAIyF,CAAW,CAAC,CACrD,EAKC,OAAQ,SAAUP,EAAQ,CACzB,OAAKA,GAELA,EAASD,GAASC,CAAM,EAEjB,KAAK,IAAI,OAAOA,EAAO,WAAU,CAAE,GACzC,KAAK,IAAI,OAAOA,EAAO,eAAc,CAAE,GALlB,EAMxB,CACA,EAQO,SAASD,GAASL,EAAGC,EAAG,CAC9B,MAAI,CAACD,GAAKA,aAAaD,GACfC,EAED,IAAID,GAAOC,EAAGC,CAAC,CACvB,CC1LO,SAASa,GAAaC,EAASC,EAAS,CAC9C,GAAKD,EAIL,QAFIE,EAAUD,EAAU,CAACD,EAASC,CAAO,EAAID,EAEpCnH,EAAI,EAAGE,EAAMmH,EAAQ,OAAQrH,EAAIE,EAAKF,IAC9C,KAAK,OAAOqH,EAAQrH,EAAE,CAExB,CAEAkH,GAAa,UAAY,CAQxB,OAAQ,SAAUzG,EAAK,CACtB,IAAI6G,EAAK,KAAK,WACVC,EAAK,KAAK,WACVC,EAAKC,EAET,GAAIhH,aAAeiH,GAClBF,EAAM/G,EACNgH,EAAMhH,UAEIA,aAAeyG,IAIzB,GAHAM,EAAM/G,EAAI,WACVgH,EAAMhH,EAAI,WAEN,CAAC+G,GAAO,CAACC,EAAO,OAAO,SAG3B,QAAOhH,EAAM,KAAK,OAAOkH,EAASlH,CAAG,GAAKmH,GAAenH,CAAG,CAAC,EAAI,KAGlE,MAAI,CAAC6G,GAAM,CAACC,GACX,KAAK,WAAa,IAAIG,GAAOF,EAAI,IAAKA,EAAI,GAAG,EAC7C,KAAK,WAAa,IAAIE,GAAOD,EAAI,IAAKA,EAAI,GAAG,IAE7CH,EAAG,IAAM,KAAK,IAAIE,EAAI,IAAKF,EAAG,GAAG,EACjCA,EAAG,IAAM,KAAK,IAAIE,EAAI,IAAKF,EAAG,GAAG,EACjCC,EAAG,IAAM,KAAK,IAAIE,EAAI,IAAKF,EAAG,GAAG,EACjCA,EAAG,IAAM,KAAK,IAAIE,EAAI,IAAKF,EAAG,GAAG,GAG3B,IACT,EAMC,IAAK,SAAUR,EAAa,CAC3B,IAAIO,EAAK,KAAK,WACVC,EAAK,KAAK,WACVP,EAAe,KAAK,IAAIM,EAAG,IAAMC,EAAG,GAAG,EAAIR,EAC3CE,EAAc,KAAK,IAAIK,EAAG,IAAMC,EAAG,GAAG,EAAIR,EAE9C,OAAO,IAAIG,GACH,IAAIQ,GAAOJ,EAAG,IAAMN,EAAcM,EAAG,IAAML,CAAW,EACtD,IAAIS,GAAOH,EAAG,IAAMP,EAAcO,EAAG,IAAMN,CAAW,CAAC,CACjE,EAIC,UAAW,UAAY,CACtB,OAAO,IAAIS,IACF,KAAK,WAAW,IAAM,KAAK,WAAW,KAAO,GAC7C,KAAK,WAAW,IAAM,KAAK,WAAW,KAAO,CAAC,CACzD,EAIC,aAAc,UAAY,CACzB,OAAO,KAAK,UACd,EAIC,aAAc,UAAY,CACzB,OAAO,KAAK,UACd,EAIC,aAAc,UAAY,CACzB,OAAO,IAAIA,GAAO,KAAK,SAAQ,EAAI,KAAK,QAAO,CAAE,CACnD,EAIC,aAAc,UAAY,CACzB,OAAO,IAAIA,GAAO,KAAK,SAAQ,EAAI,KAAK,QAAO,CAAE,CACnD,EAIC,QAAS,UAAY,CACpB,OAAO,KAAK,WAAW,GACzB,EAIC,SAAU,UAAY,CACrB,OAAO,KAAK,WAAW,GACzB,EAIC,QAAS,UAAY,CACpB,OAAO,KAAK,WAAW,GACzB,EAIC,SAAU,UAAY,CACrB,OAAO,KAAK,WAAW,GACzB,EAQC,SAAU,SAAUjH,EAAK,CACpB,OAAOA,EAAI,IAAO,UAAYA,aAAeiH,IAAU,QAASjH,EACnEA,EAAMkH,EAASlH,CAAG,EAElBA,EAAMmH,GAAenH,CAAG,EAGzB,IAAI6G,EAAK,KAAK,WACVC,EAAK,KAAK,WACVC,EAAKC,EAET,OAAIhH,aAAeyG,IAClBM,EAAM/G,EAAI,aAAY,EACtBgH,EAAMhH,EAAI,aAAY,GAEtB+G,EAAMC,EAAMhH,EAGL+G,EAAI,KAAOF,EAAG,KAASG,EAAI,KAAOF,EAAG,KACrCC,EAAI,KAAOF,EAAG,KAASG,EAAI,KAAOF,EAAG,GAC/C,EAIC,WAAY,SAAUb,EAAQ,CAC7BA,EAASkB,GAAelB,CAAM,EAE9B,IAAIY,EAAK,KAAK,WACVC,EAAK,KAAK,WACVC,EAAMd,EAAO,aAAY,EACzBe,EAAMf,EAAO,aAAY,EAEzBmB,EAAiBJ,EAAI,KAAOH,EAAG,KAASE,EAAI,KAAOD,EAAG,IACtDO,EAAiBL,EAAI,KAAOH,EAAG,KAASE,EAAI,KAAOD,EAAG,IAE1D,OAAOM,GAAiBC,CAC1B,EAIC,SAAU,SAAUpB,EAAQ,CAC3BA,EAASkB,GAAelB,CAAM,EAE9B,IAAIY,EAAK,KAAK,WACVC,EAAK,KAAK,WACVC,EAAMd,EAAO,aAAY,EACzBe,EAAMf,EAAO,aAAY,EAEzBqB,EAAeN,EAAI,IAAMH,EAAG,KAASE,EAAI,IAAMD,EAAG,IAClDS,EAAeP,EAAI,IAAMH,EAAG,KAASE,EAAI,IAAMD,EAAG,IAEtD,OAAOQ,GAAeC,CACxB,EAIC,aAAc,UAAY,CACzB,MAAO,CAAC,KAAK,QAAO,EAAI,KAAK,SAAQ,EAAI,KAAK,QAAO,EAAI,KAAK,SAAQ,CAAE,EAAE,KAAK,GAAG,CACpF,EAIC,OAAQ,SAAUtB,EAAQuB,EAAW,CACpC,OAAKvB,GAELA,EAASkB,GAAelB,CAAM,EAEvB,KAAK,WAAW,OAAOA,EAAO,aAAY,EAAIuB,CAAS,GACvD,KAAK,WAAW,OAAOvB,EAAO,aAAY,EAAIuB,CAAS,GALxC,EAMxB,EAIC,QAAS,UAAY,CACpB,MAAO,CAAC,EAAE,KAAK,YAAc,KAAK,WACpC,CACA,EAUO,SAASL,GAAexB,EAAGC,EAAG,CACpC,OAAID,aAAac,GACTd,EAED,IAAIc,GAAad,EAAGC,CAAC,CAC7B,CC7NO,SAASqB,GAAOQ,EAAKC,EAAKC,EAAK,CACrC,GAAI,MAAMF,CAAG,GAAK,MAAMC,CAAG,EAC1B,MAAM,IAAI,MAAM,2BAA6BD,EAAM,KAAOC,EAAM,GAAG,EAKpE,KAAK,IAAM,CAACD,EAIZ,KAAK,IAAM,CAACC,EAIRC,IAAQ,SACX,KAAK,IAAM,CAACA,EAEd,CAEAV,GAAO,UAAY,CAGlB,OAAQ,SAAUjH,EAAKwH,EAAW,CACjC,GAAI,CAACxH,EAAO,MAAO,GAEnBA,EAAMkH,EAASlH,CAAG,EAElB,IAAI4H,EAAS,KAAK,IACV,KAAK,IAAI,KAAK,IAAM5H,EAAI,GAAG,EAC3B,KAAK,IAAI,KAAK,IAAMA,EAAI,GAAG,CAAC,EAEpC,OAAO4H,IAAWJ,IAAc,OAAY,KAASA,EACvD,EAIC,SAAU,SAAUnG,EAAW,CAC9B,MAAO,UACCwG,EAAe,KAAK,IAAKxG,CAAS,EAAI,KACtCwG,EAAe,KAAK,IAAKxG,CAAS,EAAI,GAChD,EAIC,WAAY,SAAUyG,EAAO,CAC5B,OAAOC,GAAM,SAAS,KAAMb,EAASY,CAAK,CAAC,CAC7C,EAIC,KAAM,UAAY,CACjB,OAAOC,GAAM,WAAW,IAAI,CAC9B,EAIC,SAAU,SAAUC,EAAc,CACjC,IAAIC,EAAc,IAAMD,EAAe,SACnCE,EAAcD,EAAc,KAAK,IAAK,KAAK,GAAK,IAAO,KAAK,GAAG,EAEnE,OAAOd,GACC,CAAC,KAAK,IAAMc,EAAa,KAAK,IAAMC,CAAW,EAC/C,CAAC,KAAK,IAAMD,EAAa,KAAK,IAAMC,CAAW,CAAC,CAC1D,EAEC,MAAO,UAAY,CAClB,OAAO,IAAIjB,GAAO,KAAK,IAAK,KAAK,IAAK,KAAK,GAAG,CAChD,CACA,EAeO,SAASC,EAASvB,EAAGC,EAAGuC,EAAG,CACjC,OAAIxC,aAAasB,GACTtB,EAEJ3B,EAAa2B,CAAC,GAAK,OAAOA,EAAE,IAAO,SAClCA,EAAE,SAAW,EACT,IAAIsB,GAAOtB,EAAE,GAAIA,EAAE,GAAIA,EAAE,EAAE,EAE/BA,EAAE,SAAW,EACT,IAAIsB,GAAOtB,EAAE,GAAIA,EAAE,EAAE,EAEtB,KAEeA,GAAM,KACrBA,EAEJ,OAAOA,GAAM,UAAY,QAASA,EAC9B,IAAIsB,GAAOtB,EAAE,IAAK,QAASA,EAAIA,EAAE,IAAMA,EAAE,IAAKA,EAAE,GAAG,EAEvDC,IAAM,OACF,KAED,IAAIqB,GAAOtB,EAAGC,EAAGuC,CAAC,CAC1B,CCjHU,IAACC,GAAM,CAGhB,cAAe,SAAUC,EAAQC,EAAM,CACtC,IAAIC,EAAiB,KAAK,WAAW,QAAQF,CAAM,EAC/CG,EAAQ,KAAK,MAAMF,CAAI,EAE3B,OAAO,KAAK,eAAe,WAAWC,EAAgBC,CAAK,CAC7D,EAKC,cAAe,SAAUhD,EAAO8C,EAAM,CACrC,IAAIE,EAAQ,KAAK,MAAMF,CAAI,EACvBG,EAAqB,KAAK,eAAe,YAAYjD,EAAOgD,CAAK,EAErE,OAAO,KAAK,WAAW,UAAUC,CAAkB,CACrD,EAKC,QAAS,SAAUJ,EAAQ,CAC1B,OAAO,KAAK,WAAW,QAAQA,CAAM,CACvC,EAKC,UAAW,SAAU7C,EAAO,CAC3B,OAAO,KAAK,WAAW,UAAUA,CAAK,CACxC,EAMC,MAAO,SAAU8C,EAAM,CACtB,MAAO,KAAM,KAAK,IAAI,EAAGA,CAAI,CAC/B,EAKC,KAAM,SAAUE,EAAO,CACtB,OAAO,KAAK,IAAIA,EAAQ,GAAG,EAAI,KAAK,GACtC,EAIC,mBAAoB,SAAUF,EAAM,CACnC,GAAI,KAAK,SAAY,OAAO,KAE5B,IAAI1C,EAAI,KAAK,WAAW,OACpB,EAAI,KAAK,MAAM0C,CAAI,EACnBtH,EAAM,KAAK,eAAe,UAAU4E,EAAE,IAAK,CAAC,EAC5C7E,EAAM,KAAK,eAAe,UAAU6E,EAAE,IAAK,CAAC,EAEhD,OAAO,IAAIF,GAAO1E,EAAKD,CAAG,CAC5B,EAqBC,SAAU,GAKV,WAAY,SAAUsH,EAAQ,CAC7B,IAAIX,EAAM,KAAK,QAAUgB,EAAaL,EAAO,IAAK,KAAK,QAAS,EAAI,EAAIA,EAAO,IAC3EZ,EAAM,KAAK,QAAUiB,EAAaL,EAAO,IAAK,KAAK,QAAS,EAAI,EAAIA,EAAO,IAC3EV,EAAMU,EAAO,IAEjB,OAAO,IAAIpB,GAAOQ,EAAKC,EAAKC,CAAG,CACjC,EAMC,iBAAkB,SAAU1B,EAAQ,CACnC,IAAI0C,EAAS1C,EAAO,UAAS,EACzB2C,EAAY,KAAK,WAAWD,CAAM,EAClCE,EAAWF,EAAO,IAAMC,EAAU,IAClCE,EAAWH,EAAO,IAAMC,EAAU,IAEtC,GAAIC,IAAa,GAAKC,IAAa,EAClC,OAAO7C,EAGR,IAAIY,EAAKZ,EAAO,aAAY,EACxBa,EAAKb,EAAO,aAAY,EACxB8C,EAAQ,IAAI9B,GAAOJ,EAAG,IAAMgC,EAAUhC,EAAG,IAAMiC,CAAQ,EACvDE,EAAQ,IAAI/B,GAAOH,EAAG,IAAM+B,EAAU/B,EAAG,IAAMgC,CAAQ,EAE3D,OAAO,IAAIrC,GAAasC,EAAOC,CAAK,CACtC,CACA,EC7HWjB,GAAQpE,EAAY,CAAA,EAAIyE,GAAK,CACvC,QAAS,CAAC,KAAM,GAAG,EAKnB,EAAG,OAGH,SAAU,SAAUa,EAASC,EAAS,CACrC,IAAIC,EAAM,KAAK,GAAK,IAChBC,EAAOH,EAAQ,IAAME,EACrBE,EAAOH,EAAQ,IAAMC,EACrBG,EAAU,KAAK,KAAKJ,EAAQ,IAAMD,EAAQ,KAAOE,EAAM,CAAC,EACxDI,EAAU,KAAK,KAAKL,EAAQ,IAAMD,EAAQ,KAAOE,EAAM,CAAC,EACxDxD,EAAI2D,EAAUA,EAAU,KAAK,IAAIF,CAAI,EAAI,KAAK,IAAIC,CAAI,EAAIE,EAAUA,EACpEpB,EAAI,EAAI,KAAK,MAAM,KAAK,KAAKxC,CAAC,EAAG,KAAK,KAAK,EAAIA,CAAC,CAAC,EACrD,OAAO,KAAK,EAAIwC,CAClB,CACA,CAAC,ECnBGqB,GAAc,QAEPC,GAAoB,CAE9B,EAAGD,GACH,aAAc,cAEd,QAAS,SAAUnB,EAAQ,CAC1B,IAAIpH,EAAI,KAAK,GAAK,IACdF,EAAM,KAAK,aACX0G,EAAM,KAAK,IAAI,KAAK,IAAI1G,EAAKsH,EAAO,GAAG,EAAG,CAACtH,CAAG,EAC9C2I,EAAM,KAAK,IAAIjC,EAAMxG,CAAC,EAE1B,OAAO,IAAIkE,EACV,KAAK,EAAIkD,EAAO,IAAMpH,EACtB,KAAK,EAAI,KAAK,KAAK,EAAIyI,IAAQ,EAAIA,EAAI,EAAI,CAAC,CAC/C,EAEC,UAAW,SAAUlE,EAAO,CAC3B,IAAIvE,EAAI,IAAM,KAAK,GAEnB,OAAO,IAAIgG,IACT,EAAI,KAAK,KAAK,KAAK,IAAIzB,EAAM,EAAI,KAAK,CAAC,CAAC,EAAK,KAAK,GAAK,GAAMvE,EAC9DuE,EAAM,EAAIvE,EAAI,KAAK,CAAC,CACvB,EAEC,OAAS,UAAY,CACpB,IAAIA,EAAIuI,GAAc,KAAK,GAC3B,OAAO,IAAI9D,GAAO,CAAC,CAACzE,EAAG,CAACA,CAAC,EAAG,CAACA,EAAGA,CAAC,CAAC,CACpC,EAAE,CACF,ECnBO,SAAS0I,GAAehE,EAAGC,EAAGuC,EAAGlH,EAAG,CAC1C,GAAI+C,EAAa2B,CAAC,EAAG,CAEpB,KAAK,GAAKA,EAAE,GACZ,KAAK,GAAKA,EAAE,GACZ,KAAK,GAAKA,EAAE,GACZ,KAAK,GAAKA,EAAE,GACZ,MACF,CACC,KAAK,GAAKA,EACV,KAAK,GAAKC,EACV,KAAK,GAAKuC,EACV,KAAK,GAAKlH,CACX,CAEA0I,GAAe,UAAY,CAI1B,UAAW,SAAUnE,EAAOgD,EAAO,CAClC,OAAO,KAAK,WAAWhD,EAAM,MAAK,EAAIgD,CAAK,CAC7C,EAGC,WAAY,SAAUhD,EAAOgD,EAAO,CACnC,OAAAA,EAAQA,GAAS,EACjBhD,EAAM,EAAIgD,GAAS,KAAK,GAAKhD,EAAM,EAAI,KAAK,IAC5CA,EAAM,EAAIgD,GAAS,KAAK,GAAKhD,EAAM,EAAI,KAAK,IACrCA,CACT,EAKC,YAAa,SAAUA,EAAOgD,EAAO,CACpC,OAAAA,EAAQA,GAAS,EACV,IAAIrD,GACFK,EAAM,EAAIgD,EAAQ,KAAK,IAAM,KAAK,IAClChD,EAAM,EAAIgD,EAAQ,KAAK,IAAM,KAAK,EAAE,CAC/C,CACA,EAYO,SAASoB,GAAiBjE,EAAGC,EAAGuC,EAAGlH,EAAG,CAC5C,OAAO,IAAI0I,GAAehE,EAAGC,EAAGuC,EAAGlH,CAAC,CACrC,CChEO,IAAI4I,GAAWlG,EAAY,CAAA,EAAIoE,GAAO,CAC5C,KAAM,YACN,WAAY0B,GAEZ,eAAiB,UAAY,CAC5B,IAAIjB,EAAQ,IAAO,KAAK,GAAKiB,GAAkB,GAC/C,OAAOG,GAAiBpB,EAAO,GAAK,CAACA,EAAO,EAAG,CACjD,EAAE,CACF,CAAC,EAEUsB,GAAanG,EAAY,CAAA,EAAIkG,GAAU,CACjD,KAAM,aACP,CAAC,ECjBM,SAASE,GAAUpH,EAAM,CAC/B,OAAO,SAAS,gBAAgB,6BAA8BA,CAAI,CACnE,CAKO,SAASqH,GAAaC,EAAOC,EAAQ,CAC3C,IAAI1I,EAAM,GACVjC,EAAGC,EAAGC,EAAK0K,EAAMtE,EAAQuE,EAEzB,IAAK7K,EAAI,EAAGE,EAAMwK,EAAM,OAAQ1K,EAAIE,EAAKF,IAAK,CAG7C,IAFAsG,EAASoE,EAAM1K,GAEVC,EAAI,EAAG2K,EAAOtE,EAAO,OAAQrG,EAAI2K,EAAM3K,IAC3C4K,EAAIvE,EAAOrG,GACXgC,IAAQhC,EAAI,IAAM,KAAO4K,EAAE,EAAI,IAAMA,EAAE,EAIxC5I,GAAO0I,EAAUG,EAAQ,IAAM,IAAM,IAAO,EAC9C,CAGC,OAAO7I,GAAO,MACf,CChBA,IAAI8I,GAAQ,SAAS,gBAAgB,MAGjCC,GAAK,kBAAmB,OAGxBC,GAAQD,IAAM,CAAC,SAAS,iBAGxBE,GAAO,gBAAiB,WAAa,EAAE,iBAAkB,UAIzDC,GAASC,GAAkB,QAAQ,EAInCC,GAAUD,GAAkB,SAAS,EAGrCE,GAAYF,GAAkB,WAAW,GAAKA,GAAkB,WAAW,EAG3EG,GAAY,SAAS,qBAAqB,KAAK,UAAU,SAAS,EAAE,GAAI,EAAE,EAE1EC,GAAeH,IAAWD,GAAkB,QAAQ,GAAKG,GAAY,KAAO,EAAE,cAAe,QAG7FE,GAAQ,CAAC,CAAC,OAAO,MAGjBC,GAAS,CAACR,IAAQE,GAAkB,QAAQ,EAG5CO,GAAQP,GAAkB,OAAO,GAAK,CAACD,IAAU,CAACM,IAAS,CAACT,GAG5DY,GAAS,CAACF,IAAUN,GAAkB,QAAQ,EAE9CS,GAAUT,GAAkB,SAAS,EAIrCU,GAAU,gBAAiBf,GAG3BgB,GAAM,UAAU,SAAS,QAAQ,KAAK,IAAM,EAG5CC,GAAOhB,IAAO,eAAgBD,GAG9BkB,GAAY,oBAAqB,QAAY,QAAS,IAAI,OAAO,iBAAsB,CAACX,GAGxFY,GAAU,mBAAoBnB,GAI9BoB,GAAQ,CAAC,OAAO,eAAiBH,IAAQC,IAAYC,KAAY,CAACJ,IAAW,CAACD,GAG9EO,GAAS,OAAO,YAAgB,KAAehB,GAAkB,QAAQ,EAGzEiB,GAAeD,IAAUjB,GAIzBmB,GAAiBF,IAAUH,GAI3BM,GAAY,CAAC,OAAO,cAAgB,OAAO,eAI3CC,GAAU,CAAC,EAAE,OAAO,cAAgBD,IAOpCE,GAAc,iBAAkB,QAAU,CAAC,CAAC,OAAO,WAKnDC,GAAQ,CAAC,OAAO,aAAeD,IAAeD,IAG9CG,GAAcP,IAAUX,GAIxBmB,GAAcR,IAAUT,GAIxBkB,IAAU,OAAO,kBAAqB,OAAO,OAAO,WAAa,OAAO,OAAO,aAAgB,EAI/FC,GAAiB,UAAY,CAChC,IAAIC,EAAwB,GAC5B,GAAI,CACH,IAAIC,EAAO,OAAO,eAAe,CAAA,EAAI,UAAW,CAC/C,IAAK,UAAY,CAChBD,EAAwB,EAC5B,CACA,CAAG,EACD,OAAO,iBAAiB,0BAA2B7H,EAAc8H,CAAI,EACrE,OAAO,oBAAoB,0BAA2B9H,EAAc8H,CAAI,CAC1E,MAAG,CAEH,CACC,OAAOD,CACR,EAAC,EAIGE,GAAU,UAAY,CACzB,MAAO,CAAC,CAAC,SAAS,cAAc,QAAQ,EAAE,UAC3C,EAAC,EAIGC,GAAM,CAAC,EAAE,SAAS,iBAAmB1C,GAAU,KAAK,EAAE,eAEtD2C,GAAY,CAAC,CAACD,IAAQ,UAAY,CACrC,IAAIE,EAAM,SAAS,cAAc,KAAK,EACtC,OAAAA,EAAI,UAAY,UACRA,EAAI,YAAcA,EAAI,WAAW,gBAAkB,4BAC5D,EAAC,EAIGC,GAAM,CAACH,IAAQ,UAAY,CAC9B,GAAI,CACH,IAAIE,EAAM,SAAS,cAAc,KAAK,EACtCA,EAAI,UAAY,qBAEhB,IAAIE,EAAQF,EAAI,WAChB,OAAAE,EAAM,MAAM,SAAW,oBAEhBA,GAAU,OAAOA,EAAM,KAAQ,QAExC,MAAG,CACD,MAAO,EACT,CACA,EAAC,EAIGC,GAAM,UAAU,SAAS,QAAQ,KAAK,IAAM,EAG5CC,GAAQ,UAAU,SAAS,QAAQ,OAAO,IAAM,EAEpD,SAASpC,GAAkBnJ,EAAK,CAC/B,OAAO,UAAU,UAAU,YAAW,EAAG,QAAQA,CAAG,GAAK,CAC1D,CAGA,IAAA6I,EAAe,CACd,GAAIE,GACJ,MAAOC,GACP,KAAMC,GACN,OAAQC,GACR,QAASE,GACT,UAAWC,GACX,aAAcE,GACd,MAAOC,GACP,OAAQC,GACR,MAAOC,GACP,OAAQC,GACR,QAASC,GACT,QAASC,GACT,IAAKC,GACL,KAAMC,GACN,SAAUC,GACV,QAASC,GACT,MAAOC,GACP,OAAQC,GACR,aAAcC,GACd,eAAgBC,GAChB,UAAWC,GACX,QAASC,GACT,MAAOE,GACP,YAAaD,GACb,YAAaE,GACb,YAAaC,GACb,OAAQC,GACR,cAAeC,GACf,OAAQG,GACR,IAAKC,GACL,IAAKG,GACL,UAAWF,GACX,IAAKI,GACL,MAAOC,EACR,ECnNIC,GAAiB3C,EAAQ,UAAY,gBAAoB,cACzD4C,GAAiB5C,EAAQ,UAAY,gBAAoB,cACzD6C,GAAiB7C,EAAQ,UAAY,cAAoB,YACzD8C,GAAiB9C,EAAQ,UAAY,kBAAoB,gBACzD+C,GAAS,CACZ,WAAcJ,GACd,UAAcC,GACd,SAAcC,GACd,YAAcC,EACf,EACIE,GAAS,CACZ,WAAcC,GACd,UAAcC,GACd,SAAcA,GACd,YAAcA,EACf,EACIC,GAAY,CAAA,EACZC,GAAsB,GAKnB,SAASC,GAAmB1N,EAAKmE,EAAMwJ,EAAS,CAItD,OAHIxJ,IAAS,cACZyJ,GAAsB,EAElBP,GAAOlJ,IAIZwJ,EAAUN,GAAOlJ,GAAM,KAAK,KAAMwJ,CAAO,EACzC3N,EAAI,iBAAiBoN,GAAOjJ,GAAOwJ,EAAS,EAAK,EAC1CA,IALN,QAAQ,KAAK,yBAA0BxJ,CAAI,EACpCjD,EAKT,CAEO,SAAS2M,GAAsB7N,EAAKmE,EAAMwJ,EAAS,CACzD,GAAI,CAACP,GAAOjJ,GAAO,CAClB,QAAQ,KAAK,yBAA0BA,CAAI,EAC3C,MACF,CACCnE,EAAI,oBAAoBoN,GAAOjJ,GAAOwJ,EAAS,EAAK,CACrD,CAEA,SAASG,GAAmB7I,EAAG,CAC9BuI,GAAUvI,EAAE,WAAaA,CAC1B,CAEA,SAAS8I,GAAmB9I,EAAG,CAC1BuI,GAAUvI,EAAE,aACfuI,GAAUvI,EAAE,WAAaA,EAE3B,CAEA,SAAS+I,GAAiB/I,EAAG,CAC5B,OAAOuI,GAAUvI,EAAE,UACpB,CAEA,SAAS2I,IAAyB,CAE5BH,KAEJ,SAAS,iBAAiBT,GAAcc,GAAoB,EAAI,EAChE,SAAS,iBAAiBb,GAAcc,GAAoB,EAAI,EAChE,SAAS,iBAAiBb,GAAYc,GAAkB,EAAI,EAC5D,SAAS,iBAAiBb,GAAgBa,GAAkB,EAAI,EAEhEP,GAAsB,GAExB,CAEA,SAASF,GAAeI,EAAS1I,EAAG,CACnC,GAAIA,EAAE,eAAiBA,EAAE,sBAAwB,SAEjD,CAAAA,EAAE,QAAU,CAAA,EACZ,QAAS1F,KAAKiO,GACbvI,EAAE,QAAQ,KAAKuI,GAAUjO,EAAE,EAE5B0F,EAAE,eAAiB,CAACA,CAAC,EAErB0I,EAAQ1I,CAAC,EACV,CAEA,SAASqI,GAAgBK,EAAS1I,EAAG,CAEhCA,EAAE,sBAAwBA,EAAE,cAAgBA,EAAE,sBACjDgJ,GAAwBhJ,CAAC,EAE1BsI,GAAeI,EAAS1I,CAAC,CAC1B,CCvFA,SAASiJ,GAAarJ,EAAO,CAG5B,IAAIsJ,EAAW,CAAA,EACXC,EAAM7O,EACV,IAAKA,KAAKsF,EACTuJ,EAAOvJ,EAAMtF,GACb4O,EAAS5O,GAAK6O,GAAQA,EAAK,KAAOA,EAAK,KAAKvJ,CAAK,EAAIuJ,EAEtD,OAAAvJ,EAAQsJ,EACRA,EAAS,KAAO,WAChBA,EAAS,OAAS,EAClBA,EAAS,UAAY,GACrBA,EAAS,WAAa,GACfA,CACR,CAEA,IAAIE,GAAQ,IACL,SAASC,GAAqBtO,EAAK2N,EAAS,CAElD3N,EAAI,iBAAiB,WAAY2N,CAAO,EAKxC,IAAIY,EAAO,EACPC,EACJ,SAASC,EAAYxJ,EAAG,CACvB,GAAIA,EAAE,SAAW,EAAG,CACnBuJ,EAASvJ,EAAE,OACX,MACH,CAEE,GAAI,EAAAA,EAAE,cAAgB,SACpBA,EAAE,oBAAsB,CAACA,EAAE,mBAAmB,kBAUhD,KAAIyJ,EAAOC,GAA4B1J,CAAC,EACxC,GAAI,EAAAyJ,EAAK,KAAK,SAAUlM,EAAI,CAC3B,OAAOA,aAAc,kBAAoBA,EAAG,WAAW,GAC1D,CAAG,GACA,CAACkM,EAAK,KAAK,SAAUlM,EAAI,CACxB,OACCA,aAAc,kBACdA,aAAc,iBAEnB,CAAI,GAKF,KAAIoM,EAAM,KAAK,IAAG,EACdA,EAAML,GAAQF,IACjBG,IACIA,IAAW,GACdb,EAAQO,GAAajJ,CAAC,CAAC,GAGxBuJ,EAAS,EAEVD,EAAOK,GACT,CAEC,OAAA5O,EAAI,iBAAiB,QAASyO,CAAW,EAElC,CACN,SAAUd,EACV,YAAac,CACf,CACA,CAEO,SAASI,GAAwB7O,EAAK8O,EAAU,CACtD9O,EAAI,oBAAoB,WAAY8O,EAAS,QAAQ,EACrD9O,EAAI,oBAAoB,QAAS8O,EAAS,WAAW,CACtD,CCvEO,IAAIC,GAAYC,GACtB,CAAC,YAAa,kBAAmB,aAAc,eAAgB,aAAa,CAAC,EAOnEC,GAAaD,GACvB,CAAC,mBAAoB,aAAc,cAAe,gBAAiB,cAAc,CAAC,EAIxEE,GACVD,KAAe,oBAAsBA,KAAe,cAAgBA,GAAa,MAAQ,gBAMnF,SAASE,GAAIlM,EAAI,CACvB,OAAO,OAAOA,GAAO,SAAW,SAAS,eAAeA,CAAE,EAAIA,CAC/D,CAKO,SAASmM,GAAS5M,EAAI8H,EAAO,CACnC,IAAIlI,EAAQI,EAAG,MAAM8H,IAAW9H,EAAG,cAAgBA,EAAG,aAAa8H,GAEnE,IAAK,CAAClI,GAASA,IAAU,SAAW,SAAS,YAAa,CACzD,IAAIiN,EAAM,SAAS,YAAY,iBAAiB7M,EAAI,IAAI,EACxDJ,EAAQiN,EAAMA,EAAI/E,GAAS,IAC7B,CACC,OAAOlI,IAAU,OAAS,KAAOA,CAClC,CAIO,SAASzC,EAAO2P,EAASC,EAAWC,EAAW,CACrD,IAAIhN,EAAK,SAAS,cAAc8M,CAAO,EACvC,OAAA9M,EAAG,UAAY+M,GAAa,GAExBC,GACHA,EAAU,YAAYhN,CAAE,EAElBA,CACR,CAIO,SAASiN,GAAOjN,EAAI,CAC1B,IAAIkN,EAASlN,EAAG,WACZkN,GACHA,EAAO,YAAYlN,CAAE,CAEvB,CAIO,SAASmN,GAAMnN,EAAI,CACzB,KAAOA,EAAG,YACTA,EAAG,YAAYA,EAAG,UAAU,CAE9B,CAIO,SAASoN,GAAQpN,EAAI,CAC3B,IAAIkN,EAASlN,EAAG,WACZkN,GAAUA,EAAO,YAAclN,GAClCkN,EAAO,YAAYlN,CAAE,CAEvB,CAIO,SAASqN,GAAOrN,EAAI,CAC1B,IAAIkN,EAASlN,EAAG,WACZkN,GAAUA,EAAO,aAAelN,GACnCkN,EAAO,aAAalN,EAAIkN,EAAO,UAAU,CAE3C,CAIO,SAASI,GAAStN,EAAIG,EAAM,CAClC,GAAIH,EAAG,YAAc,OACpB,OAAOA,EAAG,UAAU,SAASG,CAAI,EAElC,IAAI4M,EAAYQ,GAASvN,CAAE,EAC3B,OAAO+M,EAAU,OAAS,GAAK,IAAI,OAAO,UAAY5M,EAAO,SAAS,EAAE,KAAK4M,CAAS,CACvF,CAIO,SAASS,EAASxN,EAAIG,EAAM,CAClC,GAAIH,EAAG,YAAc,OAEpB,QADIyN,EAAU7L,EAAgBzB,CAAI,EACzBpD,EAAI,EAAGE,EAAMwQ,EAAQ,OAAQ1Q,EAAIE,EAAKF,IAC9CiD,EAAG,UAAU,IAAIyN,EAAQ1Q,EAAE,UAElB,CAACuQ,GAAStN,EAAIG,CAAI,EAAG,CAC/B,IAAI4M,EAAYQ,GAASvN,CAAE,EAC3B0N,GAAS1N,GAAK+M,EAAYA,EAAY,IAAM,IAAM5M,CAAI,CACxD,CACA,CAIO,SAASwN,GAAY3N,EAAIG,EAAM,CACjCH,EAAG,YAAc,OACpBA,EAAG,UAAU,OAAOG,CAAI,EAExBuN,GAAS1N,EAAI4N,GAAW,IAAML,GAASvN,CAAE,EAAI,KAAK,QAAQ,IAAMG,EAAO,IAAK,GAAG,CAAC,CAAC,CAEnF,CAIO,SAASuN,GAAS1N,EAAIG,EAAM,CAC9BH,EAAG,UAAU,UAAY,OAC5BA,EAAG,UAAYG,EAGfH,EAAG,UAAU,QAAUG,CAEzB,CAIO,SAASoN,GAASvN,EAAI,CAG5B,OAAIA,EAAG,uBACNA,EAAKA,EAAG,sBAEFA,EAAG,UAAU,UAAY,OAAYA,EAAG,UAAYA,EAAG,UAAU,OACzE,CAKO,SAAS6N,GAAW7N,EAAIJ,EAAO,CACjC,YAAaI,EAAG,MACnBA,EAAG,MAAM,QAAUJ,EACT,WAAYI,EAAG,OACzB8N,GAAc9N,EAAIJ,CAAK,CAEzB,CAEA,SAASkO,GAAc9N,EAAIJ,EAAO,CACjC,IAAImO,EAAS,GACTC,EAAa,mCAGjB,GAAI,CACHD,EAAS/N,EAAG,QAAQ,KAAKgO,CAAU,CACrC,MAAG,CAGD,GAAIpO,IAAU,EAAK,MACrB,CAECA,EAAQ,KAAK,MAAMA,EAAQ,GAAG,EAE1BmO,GACHA,EAAO,QAAWnO,IAAU,IAC5BmO,EAAO,QAAUnO,GAEjBI,EAAG,MAAM,QAAU,WAAagO,EAAa,YAAcpO,EAAQ,GAErE,CAMO,SAAS4M,GAAS1L,EAAO,CAG/B,QAFIgH,EAAQ,SAAS,gBAAgB,MAE5B/K,EAAI,EAAGA,EAAI+D,EAAM,OAAQ/D,IACjC,GAAI+D,EAAM/D,KAAM+K,EACf,OAAOhH,EAAM/D,GAGf,MAAO,EACR,CAMO,SAASkR,GAAajO,EAAIkO,EAAQlI,EAAO,CAC/C,IAAImI,EAAMD,GAAU,IAAIvL,EAAM,EAAG,CAAC,EAElC3C,EAAG,MAAMuM,KACP1E,EAAQ,KACR,aAAesG,EAAI,EAAI,MAAQA,EAAI,EAAI,MACvC,eAAiBA,EAAI,EAAI,MAAQA,EAAI,EAAI,UACzCnI,EAAQ,UAAYA,EAAQ,IAAM,GACrC,CAMO,SAASoI,GAAYpO,EAAIgD,EAAO,CAGtChD,EAAG,aAAegD,EAGd6E,EAAQ,MACXoG,GAAajO,EAAIgD,CAAK,GAEtBhD,EAAG,MAAM,KAAOgD,EAAM,EAAI,KAC1BhD,EAAG,MAAM,IAAMgD,EAAM,EAAI,KAE3B,CAIO,SAASqL,GAAYrO,EAAI,CAI/B,OAAOA,EAAG,cAAgB,IAAI2C,EAAM,EAAG,CAAC,CACzC,CAUO,IAAI2L,GACAC,GACPC,GACJ,GAAI,kBAAmB,SACtBF,GAAuB,UAAY,CAClCG,EAAY,OAAQ,cAAehD,EAAuB,CAC5D,EACC8C,GAAsB,UAAY,CACjCG,GAAa,OAAQ,cAAejD,EAAuB,CAC7D,MACO,CACN,IAAIkD,GAAqBnC,GACxB,CAAC,aAAc,mBAAoB,cAAe,gBAAiB,cAAc,CAAC,EAEnF8B,GAAuB,UAAY,CAClC,GAAIK,GAAoB,CACvB,IAAI7G,EAAQ,SAAS,gBAAgB,MACrC0G,GAAc1G,EAAM6G,IACpB7G,EAAM6G,IAAsB,MAC/B,CACA,EACCJ,GAAsB,UAAY,CAC7BI,KACH,SAAS,gBAAgB,MAAMA,IAAsBH,GACrDA,GAAc,OAEjB,CACA,CAKO,SAASI,IAAmB,CAClCH,EAAY,OAAQ,YAAahD,EAAuB,CACzD,CAIO,SAASoD,IAAkB,CACjCH,GAAa,OAAQ,YAAajD,EAAuB,CAC1D,CAEA,IAAIqD,GAAiBC,GAMd,SAASC,GAAeC,EAAS,CACvC,KAAOA,EAAQ,WAAa,IAC3BA,EAAUA,EAAQ,WAEdA,EAAQ,QACbC,GAAc,EACdJ,GAAkBG,EAClBF,GAAgBE,EAAQ,MAAM,aAC9BA,EAAQ,MAAM,aAAe,OAC7BR,EAAY,OAAQ,UAAWS,EAAc,EAC9C,CAIO,SAASA,IAAiB,CAC3BJ,KACLA,GAAgB,MAAM,aAAeC,GACrCD,GAAkB,OAClBC,GAAgB,OAChBL,GAAa,OAAQ,UAAWQ,EAAc,EAC/C,CAIO,SAASC,GAAmBF,EAAS,CAC3C,GACCA,EAAUA,EAAQ,kBACT,CAACA,EAAQ,aAAe,CAACA,EAAQ,eAAiBA,IAAY,SAAS,MACjF,OAAOA,CACR,CAMO,SAASG,GAASH,EAAS,CACjC,IAAII,EAAOJ,EAAQ,sBAAqB,EAExC,MAAO,CACN,EAAGI,EAAK,MAAQJ,EAAQ,aAAe,EACvC,EAAGI,EAAK,OAASJ,EAAQ,cAAgB,EACzC,mBAAoBI,CACtB,CACA,wcCrUO,SAASC,EAAG9R,EAAKkE,EAAOnE,EAAIQ,EAAS,CAE3C,GAAI2D,GAAS,OAAOA,GAAU,SAC7B,QAASC,KAAQD,EAChB6N,GAAO/R,EAAKmE,EAAMD,EAAMC,GAAOpE,CAAE,MAE5B,CACNmE,EAAQE,EAAgBF,CAAK,EAE7B,QAAS3E,EAAI,EAAGE,EAAMyE,EAAM,OAAQ3E,EAAIE,EAAKF,IAC5CwS,GAAO/R,EAAKkE,EAAM3E,GAAIQ,EAAIQ,CAAO,CAEpC,CAEC,OAAO,IACR,CAEA,IAAIyR,GAAY,kBAkBT,SAASC,GAAIjS,EAAKkE,EAAOnE,EAAIQ,EAAS,CAE5C,GAAI,UAAU,SAAW,EACxB2R,GAAYlS,CAAG,EACf,OAAOA,EAAIgS,YAED9N,GAAS,OAAOA,GAAU,SACpC,QAASC,KAAQD,EAChBiO,GAAUnS,EAAKmE,EAAMD,EAAMC,GAAOpE,CAAE,UAIrCmE,EAAQE,EAAgBF,CAAK,EAEzB,UAAU,SAAW,EACxBgO,GAAYlS,EAAK,SAAUmE,EAAM,CAChC,OAAOiO,EAAalO,EAAOC,CAAI,IAAM,EACzC,CAAI,MAED,SAAS5E,EAAI,EAAGE,EAAMyE,EAAM,OAAQ3E,EAAIE,EAAKF,IAC5C4S,GAAUnS,EAAKkE,EAAM3E,GAAIQ,EAAIQ,CAAO,EAKvC,OAAO,IACR,CAEA,SAAS2R,GAAYlS,EAAKqS,EAAU,CACnC,QAASpP,KAAMjD,EAAIgS,IAAY,CAC9B,IAAI7N,EAAOlB,EAAG,MAAM,IAAI,EAAE,IACtB,CAACoP,GAAYA,EAASlO,CAAI,IAC7BgO,GAAUnS,EAAKmE,EAAM,KAAM,KAAMlB,CAAE,CAEtC,CACA,CAEA,IAAIqP,GAAa,CAChB,WAAY,YACZ,WAAY,WACZ,MAAO,EAAE,YAAa,SAAW,YAClC,EAEA,SAASP,GAAO/R,EAAKmE,EAAMpE,EAAIQ,EAAS,CACvC,IAAI0C,EAAKkB,EAAOa,EAAWjF,CAAE,GAAKQ,EAAU,IAAMyE,EAAWzE,CAAO,EAAI,IAExE,GAAIP,EAAIgS,KAAchS,EAAIgS,IAAW/O,GAAO,OAAO,KAEnD,IAAI0K,EAAU,SAAU1I,EAAG,CAC1B,OAAOlF,EAAG,KAAKQ,GAAWP,EAAKiF,GAAK,OAAO,KAAK,CAClD,EAEKsN,EAAkB5E,EAElB,CAACtD,EAAQ,aAAeA,EAAQ,SAAWlG,EAAK,QAAQ,OAAO,IAAM,EAExEwJ,EAAUD,GAAmB1N,EAAKmE,EAAMwJ,CAAO,EAErCtD,EAAQ,OAAUlG,IAAS,WACrCwJ,EAAUW,GAAqBtO,EAAK2N,CAAO,EAEjC,qBAAsB3N,EAE5BmE,IAAS,cAAgBA,IAAS,aAAeA,IAAS,SAAYA,IAAS,aAClFnE,EAAI,iBAAiBsS,GAAWnO,IAASA,EAAMwJ,EAAStD,EAAQ,cAAgB,CAAC,QAAS,EAAK,EAAI,EAAK,EAE9FlG,IAAS,cAAgBA,IAAS,cAC5CwJ,EAAU,SAAU1I,EAAG,CACtBA,EAAIA,GAAK,OAAO,MACZuN,GAAiBxS,EAAKiF,CAAC,GAC1BsN,EAAgBtN,CAAC,CAEtB,EACGjF,EAAI,iBAAiBsS,GAAWnO,GAAOwJ,EAAS,EAAK,GAGrD3N,EAAI,iBAAiBmE,EAAMoO,EAAiB,EAAK,EAIlDvS,EAAI,YAAY,KAAOmE,EAAMwJ,CAAO,EAGrC3N,EAAIgS,IAAahS,EAAIgS,KAAc,CAAA,EACnChS,EAAIgS,IAAW/O,GAAM0K,CACtB,CAEA,SAASwE,GAAUnS,EAAKmE,EAAMpE,EAAIQ,EAAS0C,EAAI,CAC9CA,EAAKA,GAAMkB,EAAOa,EAAWjF,CAAE,GAAKQ,EAAU,IAAMyE,EAAWzE,CAAO,EAAI,IAC1E,IAAIoN,EAAU3N,EAAIgS,KAAchS,EAAIgS,IAAW/O,GAE/C,GAAI,CAAC0K,EAAW,OAAO,KAEnB,CAACtD,EAAQ,aAAeA,EAAQ,SAAWlG,EAAK,QAAQ,OAAO,IAAM,EACxE0J,GAAsB7N,EAAKmE,EAAMwJ,CAAO,EAE9BtD,EAAQ,OAAUlG,IAAS,WACrC0K,GAAwB7O,EAAK2N,CAAO,EAE1B,wBAAyB3N,EAEnCA,EAAI,oBAAoBsS,GAAWnO,IAASA,EAAMwJ,EAAS,EAAK,EAGhE3N,EAAI,YAAY,KAAOmE,EAAMwJ,CAAO,EAGrC3N,EAAIgS,IAAW/O,GAAM,IACtB,CASO,SAASwP,GAAgBxN,EAAG,CAElC,OAAIA,EAAE,gBACLA,EAAE,gBAAe,EACPA,EAAE,cACZA,EAAE,cAAc,SAAW,GAE3BA,EAAE,aAAe,GAGX,IACR,CAIO,SAASyN,GAAyBlQ,EAAI,CAC5C,OAAAuP,GAAOvP,EAAI,QAASiQ,EAAe,EAC5B,IACR,CAKO,SAASE,GAAwBnQ,EAAI,CAC3C,OAAAsP,EAAGtP,EAAI,4CAA6CiQ,EAAe,EACnEjQ,EAAG,uBAA4B,GACxB,IACR,CAOO,SAASoQ,GAAe3N,EAAG,CACjC,OAAIA,EAAE,eACLA,EAAE,eAAc,EAEhBA,EAAE,YAAc,GAEV,IACR,CAIO,SAAS4N,GAAK5N,EAAG,CACvB,OAAA2N,GAAe3N,CAAC,EAChBwN,GAAgBxN,CAAC,EACV,IACR,CAMO,SAAS6N,GAAmBC,EAAI,CACtC,GAAIA,EAAG,aACN,OAAOA,EAAG,aAAY,EAMvB,QAHIrE,EAAO,CAAA,EACPlM,EAAKuQ,EAAG,OAELvQ,GACNkM,EAAK,KAAKlM,CAAE,EACZA,EAAKA,EAAG,WAET,OAAOkM,CACR,CAMO,SAASsE,GAAiB/N,EAAGuK,EAAW,CAC9C,GAAI,CAACA,EACJ,OAAO,IAAIrK,EAAMF,EAAE,QAASA,EAAE,OAAO,EAGtC,IAAIuD,EAAQoJ,GAASpC,CAAS,EAC1BkB,EAASlI,EAAM,mBAEnB,OAAO,IAAIrD,GAGTF,EAAE,QAAUyL,EAAO,MAAQlI,EAAM,EAAIgH,EAAU,YAC/CvK,EAAE,QAAUyL,EAAO,KAAOlI,EAAM,EAAIgH,EAAU,SACjD,CACA,CAOA,IAAIyD,GACF5I,EAAQ,OAASA,EAAQ,OAAU,OAAO,iBAC3CA,EAAQ,IAAM,OAAO,iBAAmB,EACxC,OAAO,iBAAmB,EAAI,EAAI,OAAO,iBAAmB,EAMtD,SAAS6I,GAAcjO,EAAG,CAChC,OAAQoF,EAAQ,KAAQpF,EAAE,YAAc,EAChCA,EAAE,QAAUA,EAAE,YAAc,EAAK,CAACA,EAAE,OAASgO,GAC7ChO,EAAE,QAAUA,EAAE,YAAc,EAAK,CAACA,EAAE,OAAS,GAC7CA,EAAE,QAAUA,EAAE,YAAc,EAAK,CAACA,EAAE,OAAS,GAC7CA,EAAE,QAAUA,EAAE,OAAU,EACzBA,EAAE,YAAcA,EAAE,aAAeA,EAAE,YAAc,EAChDA,EAAE,QAAU,KAAK,IAAIA,EAAE,MAAM,EAAI,MAAS,CAACA,EAAE,OAAS,GACvDA,EAAE,OAASA,EAAE,OAAS,OAAS,GAC/B,CACR,CAGO,SAASuN,GAAiBhQ,EAAIyC,EAAG,CAEvC,IAAIkO,EAAUlO,EAAE,cAEhB,GAAI,CAACkO,EAAW,MAAO,GAEvB,GAAI,CACH,KAAOA,GAAYA,IAAY3Q,GAC9B2Q,EAAUA,EAAQ,UAErB,MAAG,CACD,MAAO,EACT,CACC,OAAQA,IAAY3Q,CACrB,wPC/QW4Q,GAAelO,EAAQ,OAAO,CAOxC,IAAK,SAAU1C,EAAI6Q,EAAQC,EAAUC,EAAe,CACnD,KAAK,KAAI,EAET,KAAK,IAAM/Q,EACX,KAAK,YAAc,GACnB,KAAK,UAAY8Q,GAAY,IAC7B,KAAK,cAAgB,EAAI,KAAK,IAAIC,GAAiB,GAAK,EAAG,EAE3D,KAAK,UAAYC,GAAoBhR,CAAE,EACvC,KAAK,QAAU6Q,EAAO,SAAS,KAAK,SAAS,EAC7C,KAAK,WAAa,CAAC,IAAI,KAIvB,KAAK,KAAK,OAAO,EAEjB,KAAK,SAAQ,CACf,EAIC,KAAM,UAAY,CACZ,KAAK,cAEV,KAAK,MAAM,EAAI,EACf,KAAK,UAAS,EAChB,EAEC,SAAU,UAAY,CAErB,KAAK,QAAUI,EAAsB,KAAK,SAAU,IAAI,EACxD,KAAK,MAAK,CACZ,EAEC,MAAO,SAAUpO,EAAO,CACvB,IAAIqO,EAAW,CAAC,IAAI,KAAU,KAAK,WAC/BJ,EAAW,KAAK,UAAY,IAE5BI,EAAUJ,EACb,KAAK,UAAU,KAAK,SAASI,EAAUJ,CAAQ,EAAGjO,CAAK,GAEvD,KAAK,UAAU,CAAC,EAChB,KAAK,UAAS,EAEjB,EAEC,UAAW,SAAUsO,EAAUtO,EAAO,CACrC,IAAIsL,EAAM,KAAK,UAAU,IAAI,KAAK,QAAQ,WAAWgD,CAAQ,CAAC,EAC1DtO,GACHsL,EAAI,OAAM,EAEXiD,GAAoB,KAAK,IAAKjD,CAAG,EAIjC,KAAK,KAAK,MAAM,CAClB,EAEC,UAAW,UAAY,CACtBkD,EAAqB,KAAK,OAAO,EAEjC,KAAK,YAAc,GAGnB,KAAK,KAAK,KAAK,CACjB,EAEC,SAAU,SAAUC,EAAG,CACtB,MAAO,GAAI,KAAK,IAAI,EAAIA,EAAG,KAAK,aAAa,CAC/C,CACA,CAAC,ECjFUC,EAAM7O,EAAQ,OAAO,CAE/B,QAAS,CAKR,IAAK2E,GAIL,OAAQ,OAIR,KAAM,OAMN,QAAS,OAMT,QAAS,OAIT,OAAQ,CAAA,EAOR,UAAW,OAKX,SAAU,OAOV,cAAe,GAIf,uBAAwB,EAKxB,cAAe,GAMf,oBAAqB,GAMrB,iBAAkB,QASlB,SAAU,EAOV,UAAW,EAIX,YAAa,EACf,EAEC,WAAY,SAAU5G,EAAItB,EAAS,CAClCA,EAAU6B,EAAgB,KAAM7B,CAAO,EAIvC,KAAK,UAAY,CAAA,EACjB,KAAK,QAAU,CAAA,EACf,KAAK,iBAAmB,CAAA,EACxB,KAAK,aAAe,GAEpB,KAAK,eAAesB,CAAE,EACtB,KAAK,YAAW,EAGhB,KAAK,UAAY+Q,EAAU,KAAK,UAAW,IAAI,EAE/C,KAAK,YAAW,EAEZrS,EAAQ,WACX,KAAK,aAAaA,EAAQ,SAAS,EAGhCA,EAAQ,OAAS,SACpB,KAAK,MAAQ,KAAK,WAAWA,EAAQ,IAAI,GAGtCA,EAAQ,QAAUA,EAAQ,OAAS,QACtC,KAAK,QAAQuF,EAASvF,EAAQ,MAAM,EAAGA,EAAQ,KAAM,CAAC,MAAO,EAAI,CAAC,EAGnE,KAAK,cAAa,EAGlB,KAAK,cAAgBsS,IAAsB5J,EAAQ,OAAS,CAACA,EAAQ,aACnE,KAAK,QAAQ,cAIX,KAAK,gBACR,KAAK,iBAAgB,EACrB4G,EAAY,KAAK,OAAQiD,GAAwB,KAAK,oBAAqB,IAAI,GAGhF,KAAK,WAAW,KAAK,QAAQ,MAAM,CACrC,EAQC,QAAS,SAAUvL,EAAQL,EAAM3G,EAAS,CAQzC,GANA2G,EAAOA,IAAS,OAAY,KAAK,MAAQ,KAAK,WAAWA,CAAI,EAC7DK,EAAS,KAAK,aAAazB,EAASyB,CAAM,EAAGL,EAAM,KAAK,QAAQ,SAAS,EACzE3G,EAAUA,GAAW,CAAA,EAErB,KAAK,MAAK,EAEN,KAAK,SAAW,CAACA,EAAQ,OAASA,IAAY,GAAM,CAEnDA,EAAQ,UAAY,SACvBA,EAAQ,KAAOgC,EAAY,CAAC,QAAShC,EAAQ,OAAO,EAAGA,EAAQ,IAAI,EACnEA,EAAQ,IAAMgC,EAAY,CAAC,QAAShC,EAAQ,QAAS,SAAUA,EAAQ,QAAQ,EAAGA,EAAQ,GAAG,GAI9F,IAAIwS,EAAS,KAAK,QAAU7L,EAC3B,KAAK,kBAAoB,KAAK,iBAAiBK,EAAQL,EAAM3G,EAAQ,IAAI,EACzE,KAAK,gBAAgBgH,EAAQhH,EAAQ,GAAG,EAEzC,GAAIwS,EAEH,oBAAa,KAAK,UAAU,EACrB,IAEX,CAGE,YAAK,WAAWxL,EAAQL,EAAM3G,EAAQ,KAAOA,EAAQ,IAAI,WAAW,EAE7D,IACT,EAIC,QAAS,SAAU2G,EAAM3G,EAAS,CACjC,OAAK,KAAK,QAIH,KAAK,QAAQ,KAAK,UAAS,EAAI2G,EAAM,CAAC,KAAM3G,CAAO,CAAC,GAH1D,KAAK,MAAQ2G,EACN,KAGV,EAIC,OAAQ,SAAU8L,EAAOzS,EAAS,CACjC,OAAAyS,EAAQA,IAAU/J,EAAQ,MAAQ,KAAK,QAAQ,UAAY,GACpD,KAAK,QAAQ,KAAK,MAAQ+J,EAAOzS,CAAO,CACjD,EAIC,QAAS,SAAUyS,EAAOzS,EAAS,CAClC,OAAAyS,EAAQA,IAAU/J,EAAQ,MAAQ,KAAK,QAAQ,UAAY,GACpD,KAAK,QAAQ,KAAK,MAAQ+J,EAAOzS,CAAO,CACjD,EAQC,cAAe,SAAU0G,EAAQC,EAAM3G,EAAS,CAC/C,IAAI6G,EAAQ,KAAK,aAAaF,CAAI,EAC9B+L,EAAW,KAAK,QAAO,EAAG,SAAS,CAAC,EACpCC,EAAiBjM,aAAkBlD,EAAQkD,EAAS,KAAK,uBAAuBA,CAAM,EAEtFkM,EAAeD,EAAe,SAASD,CAAQ,EAAE,WAAW,EAAI,EAAI7L,CAAK,EACzEI,EAAY,KAAK,uBAAuByL,EAAS,IAAIE,CAAY,CAAC,EAEtE,OAAO,KAAK,QAAQ3L,EAAWN,EAAM,CAAC,KAAM3G,CAAO,CAAC,CACtD,EAEC,qBAAsB,SAAUsE,EAAQtE,EAAS,CAEhDA,EAAUA,GAAW,CAAA,EACrBsE,EAASA,EAAO,UAAYA,EAAO,UAAS,EAAKkB,GAAelB,CAAM,EAEtE,IAAIuO,EAAY/O,EAAQ9D,EAAQ,gBAAkBA,EAAQ,SAAW,CAAC,EAAG,CAAC,CAAC,EACvE8S,EAAYhP,EAAQ9D,EAAQ,oBAAsBA,EAAQ,SAAW,CAAC,EAAG,CAAC,CAAC,EAE3E2G,EAAO,KAAK,cAAcrC,EAAQ,GAAOuO,EAAU,IAAIC,CAAS,CAAC,EAIrE,GAFAnM,EAAQ,OAAO3G,EAAQ,SAAY,SAAY,KAAK,IAAIA,EAAQ,QAAS2G,CAAI,EAAIA,EAE7EA,IAAS,IACZ,MAAO,CACN,OAAQrC,EAAO,UAAS,EACxB,KAAMqC,CACV,EAGE,IAAIoM,EAAgBD,EAAU,SAASD,CAAS,EAAE,SAAS,CAAC,EAExDG,EAAU,KAAK,QAAQ1O,EAAO,aAAY,EAAIqC,CAAI,EAClDsM,EAAU,KAAK,QAAQ3O,EAAO,aAAY,EAAIqC,CAAI,EAClDK,EAAS,KAAK,UAAUgM,EAAQ,IAAIC,CAAO,EAAE,SAAS,CAAC,EAAE,IAAIF,CAAa,EAAGpM,CAAI,EAErF,MAAO,CACN,OAAQK,EACR,KAAML,CACT,CACA,EAKC,UAAW,SAAUrC,EAAQtE,EAAS,CAIrC,GAFAsE,EAASkB,GAAelB,CAAM,EAE1B,CAACA,EAAO,QAAO,EAClB,MAAM,IAAI,MAAM,uBAAuB,EAGxC,IAAI4O,EAAS,KAAK,qBAAqB5O,EAAQtE,CAAO,EACtD,OAAO,KAAK,QAAQkT,EAAO,OAAQA,EAAO,KAAMlT,CAAO,CACzD,EAKC,SAAU,SAAUA,EAAS,CAC5B,OAAO,KAAK,UAAU,CAAC,CAAC,IAAK,IAAI,EAAG,CAAC,GAAI,GAAG,CAAC,EAAGA,CAAO,CACzD,EAIC,MAAO,SAAUgH,EAAQhH,EAAS,CACjC,OAAO,KAAK,QAAQgH,EAAQ,KAAK,MAAO,CAAC,IAAKhH,CAAO,CAAC,CACxD,EAIC,MAAO,SAAU+O,EAAQ/O,EAAS,CAIjC,GAHA+O,EAASjL,EAAQiL,CAAM,EAAE,MAAK,EAC9B/O,EAAUA,GAAW,CAAA,EAEjB,CAAC+O,EAAO,GAAK,CAACA,EAAO,EACxB,OAAO,KAAK,KAAK,SAAS,EAI3B,GAAI/O,EAAQ,UAAY,IAAQ,CAAC,KAAK,QAAO,EAAG,SAAS+O,CAAM,EAC9D,YAAK,WAAW,KAAK,UAAU,KAAK,QAAQ,KAAK,UAAS,CAAE,EAAE,IAAIA,CAAM,CAAC,EAAG,KAAK,QAAO,CAAE,EACnF,KAkBR,GAfK,KAAK,WACT,KAAK,SAAW,IAAI0C,GAEpB,KAAK,SAAS,GAAG,CAChB,KAAQ,KAAK,qBACb,IAAO,KAAK,mBAChB,EAAM,IAAI,GAIHzR,EAAQ,aACZ,KAAK,KAAK,WAAW,EAIlBA,EAAQ,UAAY,GAAO,CAC9BmT,EAAiB,KAAK,SAAU,kBAAkB,EAElD,IAAIzB,EAAS,KAAK,eAAc,EAAG,SAAS3C,CAAM,EAAE,MAAK,EACzD,KAAK,SAAS,IAAI,KAAK,SAAU2C,EAAQ1R,EAAQ,UAAY,IAAMA,EAAQ,aAAa,CAC3F,MACG,KAAK,UAAU+O,CAAM,EACrB,KAAK,KAAK,MAAM,EAAE,KAAK,SAAS,EAGjC,OAAO,IACT,EAKC,MAAO,SAAUqE,EAAcC,EAAYrT,EAAS,CAGnD,GADAA,EAAUA,GAAW,CAAA,EACjBA,EAAQ,UAAY,IAAS,CAAC0I,EAAQ,MACzC,OAAO,KAAK,QAAQ0K,EAAcC,EAAYrT,CAAO,EAGtD,KAAK,MAAK,EAEV,IAAIsT,EAAO,KAAK,QAAQ,KAAK,UAAS,CAAE,EACpCC,EAAK,KAAK,QAAQH,CAAY,EAC9BI,EAAO,KAAK,QAAO,EACnBC,EAAY,KAAK,MAErBL,EAAe7N,EAAS6N,CAAY,EACpCC,EAAaA,IAAe,OAAYI,EAAYJ,EAEpD,IAAIK,EAAK,KAAK,IAAIF,EAAK,EAAGA,EAAK,CAAC,EAC5BG,EAAKD,EAAK,KAAK,aAAaD,EAAWJ,CAAU,EACjDO,EAAML,EAAG,WAAWD,CAAI,GAAM,EAC9BO,EAAM,KACNC,EAAOD,EAAMA,EAEjB,SAASE,EAAEnW,GAAG,CACb,IAAIoW,GAAKpW,GAAI,GAAK,EACdqW,GAAKrW,GAAI+V,EAAKD,EACdQ,GAAKP,EAAKA,EAAKD,EAAKA,EAAKM,GAAKF,EAAOA,EAAOF,EAAKA,EACjDO,GAAK,EAAIF,GAAKH,EAAOF,EACrB3P,GAAIiQ,GAAKC,GACTC,GAAK,KAAK,KAAKnQ,GAAIA,GAAI,CAAC,EAAIA,GAIxBoQ,GAAMD,GAAK,KAAc,IAAM,KAAK,IAAIA,EAAE,EAElD,OAAOC,EACV,CAEE,SAASC,GAAKC,GAAG,CAAE,OAAQ,KAAK,IAAIA,EAAC,EAAI,KAAK,IAAI,CAACA,EAAC,GAAK,CAAE,CAC3D,SAASC,GAAKD,GAAG,CAAE,OAAQ,KAAK,IAAIA,EAAC,EAAI,KAAK,IAAI,CAACA,EAAC,GAAK,CAAE,CAC3D,SAASE,GAAKF,GAAG,CAAE,OAAOD,GAAKC,EAAC,EAAIC,GAAKD,EAAC,CAAE,CAE5C,IAAIG,GAAKX,EAAE,CAAC,EAEZ,SAASY,GAAEC,GAAG,CAAE,OAAOlB,GAAMc,GAAKE,EAAE,EAAIF,GAAKE,GAAKb,EAAMe,EAAC,EAAG,CAC5D,SAASC,GAAED,GAAG,CAAE,OAAOlB,GAAMc,GAAKE,EAAE,EAAID,GAAKC,GAAKb,EAAMe,EAAC,EAAIN,GAAKI,EAAE,GAAKZ,CAAK,CAE9E,SAASgB,GAAQ3C,GAAG,CAAE,MAAO,GAAI,KAAK,IAAI,EAAIA,GAAG,GAAG,CAAE,CAEtD,IAAI4C,GAAQ,KAAK,IAAG,EAChBC,IAAKjB,EAAE,CAAC,EAAIW,IAAMb,EAClBlC,GAAW3R,EAAQ,SAAW,IAAOA,EAAQ,SAAW,IAAOgV,GAAI,GAEvE,SAASC,IAAQ,CAChB,IAAI9C,IAAK,KAAK,IAAG,EAAK4C,IAASpD,GAC3BiD,GAAIE,GAAQ3C,EAAC,EAAI6C,GAEjB7C,IAAK,GACR,KAAK,YAAcL,EAAsBmD,GAAO,IAAI,EAEpD,KAAK,MACJ,KAAK,UAAU3B,EAAK,IAAIC,EAAG,SAASD,CAAI,EAAE,WAAWuB,GAAED,EAAC,EAAIhB,CAAE,CAAC,EAAGH,CAAS,EAC3E,KAAK,aAAaC,EAAKiB,GAAEC,EAAC,EAAGnB,CAAS,EACtC,CAAC,MAAO,EAAI,CAAC,GAGd,KACE,MAAML,EAAcC,CAAU,EAC9B,SAAS,EAAI,CAEnB,CAEE,YAAK,WAAW,GAAMrT,EAAQ,WAAW,EAEzCiV,GAAM,KAAK,IAAI,EACR,IACT,EAKC,YAAa,SAAU3Q,EAAQtE,EAAS,CACvC,IAAIkT,EAAS,KAAK,qBAAqB5O,EAAQtE,CAAO,EACtD,OAAO,KAAK,MAAMkT,EAAO,OAAQA,EAAO,KAAMlT,CAAO,CACvD,EAIC,aAAc,SAAUsE,EAAQ,CAO/B,OANAA,EAASkB,GAAelB,CAAM,EAE1B,KAAK,QAAQ,UAAW,KAAK,mBAAmB,GACnD,KAAK,IAAI,UAAW,KAAK,mBAAmB,EAGxCA,EAAO,QAAO,GAKnB,KAAK,QAAQ,UAAYA,EAErB,KAAK,SACR,KAAK,oBAAmB,EAGlB,KAAK,GAAG,UAAW,KAAK,mBAAmB,IAVjD,KAAK,QAAQ,UAAY,KAClB,KAUV,EAIC,WAAY,SAAUqC,EAAM,CAC3B,IAAIuO,EAAU,KAAK,QAAQ,QAG3B,OAFA,KAAK,QAAQ,QAAUvO,EAEnB,KAAK,SAAWuO,IAAYvO,IAC/B,KAAK,KAAK,kBAAkB,EAExB,KAAK,QAAO,EAAK,KAAK,QAAQ,SAC1B,KAAK,QAAQA,CAAI,EAInB,IACT,EAIC,WAAY,SAAUA,EAAM,CAC3B,IAAIuO,EAAU,KAAK,QAAQ,QAG3B,OAFA,KAAK,QAAQ,QAAUvO,EAEnB,KAAK,SAAWuO,IAAYvO,IAC/B,KAAK,KAAK,kBAAkB,EAExB,KAAK,QAAO,EAAK,KAAK,QAAQ,SAC1B,KAAK,QAAQA,CAAI,EAInB,IACT,EAIC,gBAAiB,SAAUrC,EAAQtE,EAAS,CAC3C,KAAK,iBAAmB,GACxB,IAAIgH,EAAS,KAAK,UAAS,EACvBC,EAAY,KAAK,aAAaD,EAAQ,KAAK,MAAOxB,GAAelB,CAAM,CAAC,EAE5E,OAAK0C,EAAO,OAAOC,CAAS,GAC3B,KAAK,MAAMA,EAAWjH,CAAO,EAG9B,KAAK,iBAAmB,GACjB,IACT,EAOC,UAAW,SAAU0G,EAAQ1G,EAAS,CACrCA,EAAUA,GAAW,CAAA,EAErB,IAAI6S,EAAY/O,EAAQ9D,EAAQ,gBAAkBA,EAAQ,SAAW,CAAC,EAAG,CAAC,CAAC,EACvE8S,EAAYhP,EAAQ9D,EAAQ,oBAAsBA,EAAQ,SAAW,CAAC,EAAG,CAAC,CAAC,EAC3EmV,EAAc,KAAK,QAAQ,KAAK,UAAS,CAAE,EAC3CC,EAAa,KAAK,QAAQ1O,CAAM,EAChC2O,EAAc,KAAK,eAAc,EACjCC,EAAejR,GAAS,CAACgR,EAAY,IAAI,IAAIxC,CAAS,EAAGwC,EAAY,IAAI,SAASvC,CAAS,CAAC,CAAC,EAC7FyC,EAAaD,EAAa,QAAO,EAErC,GAAI,CAACA,EAAa,SAASF,CAAU,EAAG,CACvC,KAAK,iBAAmB,GACxB,IAAIxC,EAAewC,EAAW,SAASE,EAAa,UAAS,CAAE,EAC3DvG,EAASuG,EAAa,OAAOF,CAAU,EAAE,QAAO,EAAG,SAASG,CAAU,EAC1EJ,EAAY,GAAKvC,EAAa,EAAI,EAAI,CAAC7D,EAAO,EAAIA,EAAO,EACzDoG,EAAY,GAAKvC,EAAa,EAAI,EAAI,CAAC7D,EAAO,EAAIA,EAAO,EACzD,KAAK,MAAM,KAAK,UAAUoG,CAAW,EAAGnV,CAAO,EAC/C,KAAK,iBAAmB,EAC3B,CACE,OAAO,IACT,EAeC,eAAgB,SAAUA,EAAS,CAClC,GAAI,CAAC,KAAK,QAAW,OAAO,KAE5BA,EAAUgC,EAAY,CACrB,QAAS,GACT,IAAK,EACR,EAAKhC,IAAY,GAAO,CAAC,QAAS,EAAI,EAAIA,CAAO,EAE/C,IAAIwV,EAAU,KAAK,QAAO,EAC1B,KAAK,aAAe,GACpB,KAAK,YAAc,KAEnB,IAAIC,EAAU,KAAK,QAAO,EACtBC,EAAYF,EAAQ,SAAS,CAAC,EAAE,MAAK,EACrCvO,EAAYwO,EAAQ,SAAS,CAAC,EAAE,MAAK,EACrC1G,EAAS2G,EAAU,SAASzO,CAAS,EAEzC,MAAI,CAAC8H,EAAO,GAAK,CAACA,EAAO,EAAY,MAEjC/O,EAAQ,SAAWA,EAAQ,IAC9B,KAAK,MAAM+O,CAAM,GAGb/O,EAAQ,KACX,KAAK,UAAU+O,CAAM,EAGtB,KAAK,KAAK,MAAM,EAEZ/O,EAAQ,iBACX,aAAa,KAAK,UAAU,EAC5B,KAAK,WAAa,WAAWqS,EAAU,KAAK,KAAM,KAAM,SAAS,EAAG,GAAG,GAEvE,KAAK,KAAK,SAAS,GAOd,KAAK,KAAK,SAAU,CAC1B,QAASmD,EACT,QAASC,CACZ,CAAG,EACH,EAKC,KAAM,UAAY,CACjB,YAAK,QAAQ,KAAK,WAAW,KAAK,KAAK,CAAC,EACnC,KAAK,QAAQ,UACjB,KAAK,KAAK,WAAW,EAEf,KAAK,MAAK,CACnB,EAWC,OAAQ,SAAUzV,EAAS,CAW1B,GATAA,EAAU,KAAK,eAAiBgC,EAAY,CAC3C,QAAS,IACT,MAAO,EAKV,EAAKhC,CAAO,EAEN,EAAE,gBAAiB,WACtB,YAAK,wBAAwB,CAC5B,KAAM,EACN,QAAS,4BACb,CAAI,EACM,KAGR,IAAI2V,EAAatD,EAAU,KAAK,2BAA4B,IAAI,EAC5DuD,EAAUvD,EAAU,KAAK,wBAAyB,IAAI,EAE1D,OAAIrS,EAAQ,MACX,KAAK,iBACG,UAAU,YAAY,cAAc2V,EAAYC,EAAS5V,CAAO,EAExE,UAAU,YAAY,mBAAmB2V,EAAYC,EAAS5V,CAAO,EAE/D,IACT,EAMC,WAAY,UAAY,CACvB,OAAI,UAAU,aAAe,UAAU,YAAY,YAClD,UAAU,YAAY,WAAW,KAAK,gBAAgB,EAEnD,KAAK,iBACR,KAAK,eAAe,QAAU,IAExB,IACT,EAEC,wBAAyB,SAAU6V,EAAO,CACzC,GAAK,KAAK,WAAW,YAErB,KAAIrP,EAAIqP,EAAM,KACVC,EAAUD,EAAM,UACPrP,IAAM,EAAI,oBACVA,IAAM,EAAI,uBAAyB,WAE5C,KAAK,eAAe,SAAW,CAAC,KAAK,SACxC,KAAK,SAAQ,EAMd,KAAK,KAAK,gBAAiB,CAC1B,KAAMA,EACN,QAAS,sBAAwBsP,EAAU,GAC9C,CAAG,EACH,EAEC,2BAA4B,SAAU9G,EAAK,CAC1C,GAAK,KAAK,WAAW,YAErB,KAAIlJ,EAAMkJ,EAAI,OAAO,SACjBjJ,EAAMiJ,EAAI,OAAO,UACjBtI,EAAS,IAAIpB,GAAOQ,EAAKC,CAAG,EAC5BzB,EAASoC,EAAO,SAASsI,EAAI,OAAO,SAAW,CAAC,EAChDhP,EAAU,KAAK,eAEnB,GAAIA,EAAQ,QAAS,CACpB,IAAI2G,EAAO,KAAK,cAAcrC,CAAM,EACpC,KAAK,QAAQoC,EAAQ1G,EAAQ,QAAU,KAAK,IAAI2G,EAAM3G,EAAQ,OAAO,EAAI2G,CAAI,CAChF,CAEE,IAAIpG,EAAO,CACV,OAAQmG,EACR,OAAQpC,EACR,UAAW0K,EAAI,SAClB,EAEE,QAASpR,KAAKoR,EAAI,OACb,OAAOA,EAAI,OAAOpR,IAAO,WAC5B2C,EAAK3C,GAAKoR,EAAI,OAAOpR,IAOvB,KAAK,KAAK,gBAAiB2C,CAAI,EACjC,EAMC,WAAY,SAAUS,EAAM+U,EAAc,CACzC,GAAI,CAACA,EAAgB,OAAO,KAE5B,IAAI/J,EAAU,KAAKhL,GAAQ,IAAI+U,EAAa,IAAI,EAEhD,YAAK,UAAU,KAAK/J,CAAO,EAEvB,KAAK,QAAQhL,IAChBgL,EAAQ,OAAM,EAGR,IACT,EAIC,OAAQ,UAAY,CAKnB,GAHA,KAAK,YAAY,EAAI,EACjB,KAAK,QAAQ,WAAa,KAAK,IAAI,UAAW,KAAK,mBAAmB,EAEtE,KAAK,eAAiB,KAAK,WAAW,YACzC,MAAM,IAAI,MAAM,mDAAmD,EAGpE,GAAI,CAEH,OAAO,KAAK,WAAW,YACvB,OAAO,KAAK,YACf,MAAI,CAED,KAAK,WAAW,YAAc,OAE9B,KAAK,aAAe,MACvB,CAEM,KAAK,mBAAqB,QAC7B,KAAK,WAAU,EAGhB,KAAK,MAAK,EAEVgK,GAAe,KAAK,QAAQ,EAExB,KAAK,kBACR,KAAK,iBAAgB,EAElB,KAAK,iBACR9D,EAAqB,KAAK,cAAc,EACxC,KAAK,eAAiB,MAGvB,KAAK,eAAc,EAEf,KAAK,SAIR,KAAK,KAAK,QAAQ,EAGnB,IAAItU,EACJ,IAAKA,KAAK,KAAK,QACd,KAAK,QAAQA,GAAG,OAAM,EAEvB,IAAKA,KAAK,KAAK,OACdoY,GAAe,KAAK,OAAOpY,EAAE,EAG9B,YAAK,QAAU,CAAA,EACf,KAAK,OAAS,CAAA,EACd,OAAO,KAAK,SACZ,OAAO,KAAK,UAEL,IACT,EAOC,WAAY,SAAUoD,EAAM6M,EAAW,CACtC,IAAID,EAAY,gBAAkB5M,EAAO,YAAcA,EAAK,QAAQ,OAAQ,EAAE,EAAI,QAAU,IACxFiV,EAAOC,EAAe,MAAOtI,EAAWC,GAAa,KAAK,QAAQ,EAEtE,OAAI7M,IACH,KAAK,OAAOA,GAAQiV,GAEdA,CACT,EAMC,UAAW,UAAY,CAGtB,OAFA,KAAK,eAAc,EAEf,KAAK,aAAe,CAAC,KAAK,OAAM,EAC5B,KAAK,YAAY,MAAK,EAEvB,KAAK,mBAAmB,KAAK,qBAAoB,CAAE,CAC5D,EAIC,QAAS,UAAY,CACpB,OAAO,KAAK,KACd,EAIC,UAAW,UAAY,CACtB,IAAI3R,EAAS,KAAK,eAAc,EAC5BY,EAAK,KAAK,UAAUZ,EAAO,cAAa,CAAE,EAC1Ca,EAAK,KAAK,UAAUb,EAAO,YAAW,CAAE,EAE5C,OAAO,IAAIQ,GAAaI,EAAIC,CAAE,CAChC,EAIC,WAAY,UAAY,CACvB,OAAO,KAAK,QAAQ,UAAY,OAAY,KAAK,gBAAkB,EAAI,KAAK,QAAQ,OACtF,EAIC,WAAY,UAAY,CACvB,OAAO,KAAK,QAAQ,UAAY,OAC9B,KAAK,iBAAmB,OAAY,IAAW,KAAK,eACrD,KAAK,QAAQ,OAChB,EAOC,cAAe,SAAUb,EAAQ6R,EAAQC,EAAS,CACjD9R,EAASkB,GAAelB,CAAM,EAC9B8R,EAAUtS,EAAQsS,GAAW,CAAC,EAAG,CAAC,CAAC,EAEnC,IAAIzP,EAAO,KAAK,QAAO,GAAM,EACzBtH,EAAM,KAAK,WAAU,EACrBD,EAAM,KAAK,WAAU,EACrBiX,EAAK/R,EAAO,aAAY,EACxBgS,EAAKhS,EAAO,aAAY,EACxBkP,EAAO,KAAK,QAAO,EAAG,SAAS4C,CAAO,EACtCG,EAAalS,GAAS,KAAK,QAAQiS,EAAI3P,CAAI,EAAG,KAAK,QAAQ0P,EAAI1P,CAAI,CAAC,EAAE,QAAO,EAC7E6P,EAAO9N,EAAQ,MAAQ,KAAK,QAAQ,SAAW,EAC/C+N,EAASjD,EAAK,EAAI+C,EAAW,EAC7BG,EAASlD,EAAK,EAAI+C,EAAW,EAC7B1P,GAAQsP,EAAS,KAAK,IAAIM,EAAQC,CAAM,EAAI,KAAK,IAAID,EAAQC,CAAM,EAEvE,OAAA/P,EAAO,KAAK,aAAaE,GAAOF,CAAI,EAEhC6P,IACH7P,EAAO,KAAK,MAAMA,GAAQ6P,EAAO,IAAI,GAAKA,EAAO,KACjD7P,EAAOwP,EAAS,KAAK,KAAKxP,EAAO6P,CAAI,EAAIA,EAAO,KAAK,MAAM7P,EAAO6P,CAAI,EAAIA,GAGpE,KAAK,IAAInX,EAAK,KAAK,IAAID,EAAKuH,CAAI,CAAC,CAC1C,EAIC,QAAS,UAAY,CACpB,OAAI,CAAC,KAAK,OAAS,KAAK,gBACvB,KAAK,MAAQ,IAAInD,EAChB,KAAK,WAAW,aAAe,EAC/B,KAAK,WAAW,cAAgB,CAAC,EAElC,KAAK,aAAe,IAEd,KAAK,MAAM,MAAK,CACzB,EAKC,eAAgB,SAAUwD,EAAQL,EAAM,CACvC,IAAIgQ,EAAe,KAAK,iBAAiB3P,EAAQL,CAAI,EACrD,OAAO,IAAI5C,GAAO4S,EAAcA,EAAa,IAAI,KAAK,QAAO,CAAE,CAAC,CAClE,EAQC,eAAgB,UAAY,CAC3B,YAAK,eAAc,EACZ,KAAK,YACd,EAKC,oBAAqB,SAAUhQ,EAAM,CACpC,OAAO,KAAK,QAAQ,IAAI,mBAAmBA,IAAS,OAAY,KAAK,QAAO,EAAKA,CAAI,CACvF,EAMC,QAAS,SAAUsP,EAAM,CACxB,OAAO,OAAOA,GAAS,SAAW,KAAK,OAAOA,GAAQA,CACxD,EAKC,SAAU,UAAY,CACrB,OAAO,KAAK,MACd,EAIC,aAAc,UAAY,CACzB,OAAO,KAAK,UACd,EAQC,aAAc,SAAUW,EAAQC,EAAU,CAEzC,IAAIC,EAAM,KAAK,QAAQ,IACvB,OAAAD,EAAWA,IAAa,OAAY,KAAK,MAAQA,EAC1CC,EAAI,MAAMF,CAAM,EAAIE,EAAI,MAAMD,CAAQ,CAC/C,EAMC,aAAc,SAAUhQ,EAAOgQ,EAAU,CACxC,IAAIC,EAAM,KAAK,QAAQ,IACvBD,EAAWA,IAAa,OAAY,KAAK,MAAQA,EACjD,IAAIlQ,EAAOmQ,EAAI,KAAKjQ,EAAQiQ,EAAI,MAAMD,CAAQ,CAAC,EAC/C,OAAO,MAAMlQ,CAAI,EAAI,IAAWA,CAClC,EAOC,QAAS,SAAUD,EAAQC,EAAM,CAChC,OAAAA,EAAOA,IAAS,OAAY,KAAK,MAAQA,EAClC,KAAK,QAAQ,IAAI,cAAcpB,EAASmB,CAAM,EAAGC,CAAI,CAC9D,EAIC,UAAW,SAAU9C,EAAO8C,EAAM,CACjC,OAAAA,EAAOA,IAAS,OAAY,KAAK,MAAQA,EAClC,KAAK,QAAQ,IAAI,cAAc7C,EAAQD,CAAK,EAAG8C,CAAI,CAC5D,EAKC,mBAAoB,SAAU9C,EAAO,CACpC,IAAI+C,EAAiB9C,EAAQD,CAAK,EAAE,IAAI,KAAK,eAAc,CAAE,EAC7D,OAAO,KAAK,UAAU+C,CAAc,CACtC,EAKC,mBAAoB,SAAUF,EAAQ,CACrC,IAAIE,EAAiB,KAAK,QAAQrB,EAASmB,CAAM,CAAC,EAAE,OAAM,EAC1D,OAAOE,EAAe,UAAU,KAAK,eAAc,CAAE,CACvD,EAQC,WAAY,SAAUF,EAAQ,CAC7B,OAAO,KAAK,QAAQ,IAAI,WAAWnB,EAASmB,CAAM,CAAC,CACrD,EAQC,iBAAkB,SAAUA,EAAQ,CACnC,OAAO,KAAK,QAAQ,IAAI,iBAAiBlB,GAAekB,CAAM,CAAC,CACjE,EAKC,SAAU,SAAUY,EAASC,EAAS,CACrC,OAAO,KAAK,QAAQ,IAAI,SAAShC,EAAS+B,CAAO,EAAG/B,EAASgC,CAAO,CAAC,CACvE,EAKC,2BAA4B,SAAU1D,EAAO,CAC5C,OAAOC,EAAQD,CAAK,EAAE,SAAS,KAAK,eAAc,CAAE,CACtD,EAKC,2BAA4B,SAAUA,EAAO,CAC5C,OAAOC,EAAQD,CAAK,EAAE,IAAI,KAAK,eAAc,CAAE,CACjD,EAKC,uBAAwB,SAAUA,EAAO,CACxC,IAAIkT,EAAa,KAAK,2BAA2BjT,EAAQD,CAAK,CAAC,EAC/D,OAAO,KAAK,mBAAmBkT,CAAU,CAC3C,EAKC,uBAAwB,SAAUrQ,EAAQ,CACzC,OAAO,KAAK,2BAA2B,KAAK,mBAAmBnB,EAASmB,CAAM,CAAC,CAAC,CAClF,EAKC,2BAA4B,SAAUpD,EAAG,CACxC,OAAO0T,GAA0B1T,EAAG,KAAK,UAAU,CACrD,EAKC,uBAAwB,SAAUA,EAAG,CACpC,OAAO,KAAK,2BAA2B,KAAK,2BAA2BA,CAAC,CAAC,CAC3E,EAKC,mBAAoB,SAAUA,EAAG,CAChC,OAAO,KAAK,mBAAmB,KAAK,uBAAuBA,CAAC,CAAC,CAC/D,EAKC,eAAgB,SAAUhC,EAAI,CAC7B,IAAIuM,EAAY,KAAK,WAAaoJ,GAAY3V,CAAE,EAEhD,GAAKuM,GAEE,GAAIA,EAAU,YACpB,MAAM,IAAI,MAAM,uCAAuC,MAFvD,OAAM,IAAI,MAAM,0BAA0B,EAK3CyB,EAAYzB,EAAW,SAAU,KAAK,UAAW,IAAI,EACrD,KAAK,aAAexK,EAAWwK,CAAS,CAC1C,EAEC,YAAa,UAAY,CACxB,IAAIA,EAAY,KAAK,WAErB,KAAK,cAAgB,KAAK,QAAQ,eAAiBnF,EAAQ,MAE3DyK,EAAiBtF,EAAW,qBAC1BnF,EAAQ,MAAQ,iBAAmB,KACnCA,EAAQ,OAAS,kBAAoB,KACrCA,EAAQ,MAAQ,iBAAmB,KACnCA,EAAQ,OAAS,kBAAoB,KACrC,KAAK,cAAgB,qBAAuB,GAAG,EAEjD,IAAIwO,EAAWC,GAAiBtJ,EAAW,UAAU,EAEjDqJ,IAAa,YAAcA,IAAa,YAAcA,IAAa,SAAWA,IAAa,WAC9FrJ,EAAU,MAAM,SAAW,YAG5B,KAAK,WAAU,EAEX,KAAK,iBACR,KAAK,gBAAe,CAEvB,EAEC,WAAY,UAAY,CACvB,IAAIuJ,EAAQ,KAAK,OAAS,CAAA,EAC1B,KAAK,eAAiB,CAAA,EActB,KAAK,SAAW,KAAK,WAAW,UAAW,KAAK,UAAU,EAC1DnF,GAAoB,KAAK,SAAU,IAAIzO,EAAM,EAAG,CAAC,CAAC,EAIlD,KAAK,WAAW,UAAU,EAG1B,KAAK,WAAW,aAAa,EAG7B,KAAK,WAAW,YAAY,EAG5B,KAAK,WAAW,YAAY,EAG5B,KAAK,WAAW,aAAa,EAG7B,KAAK,WAAW,WAAW,EAEtB,KAAK,QAAQ,sBACjB2P,EAAiBiE,EAAM,WAAY,mBAAmB,EACtDjE,EAAiBiE,EAAM,WAAY,mBAAmB,EAEzD,EAMC,WAAY,SAAUpQ,EAAQL,EAAM0Q,EAAa,CAChDpF,GAAoB,KAAK,SAAU,IAAIzO,EAAM,EAAG,CAAC,CAAC,EAElD,IAAI8T,EAAU,CAAC,KAAK,QACpB,KAAK,QAAU,GACf3Q,EAAO,KAAK,WAAWA,CAAI,EAE3B,KAAK,KAAK,cAAc,EAExB,IAAI4Q,EAAc,KAAK,QAAU5Q,EACjC,KACE,WAAW4Q,EAAaF,CAAW,EACnC,MAAMrQ,EAAQL,CAAI,EAClB,SAAS4Q,CAAW,EAKtB,KAAK,KAAK,WAAW,EAKjBD,GACH,KAAK,KAAK,MAAM,CAEnB,EAEC,WAAY,SAAUC,EAAaF,EAAa,CAK/C,OAAIE,GACH,KAAK,KAAK,WAAW,EAEjBF,GACJ,KAAK,KAAK,WAAW,EAEf,IACT,EAEC,MAAO,SAAUrQ,EAAQL,EAAMpG,EAAMiX,EAAc,CAC9C7Q,IAAS,SACZA,EAAO,KAAK,OAEb,IAAI4Q,EAAc,KAAK,QAAU5Q,EAEjC,YAAK,MAAQA,EACb,KAAK,YAAcK,EACnB,KAAK,aAAe,KAAK,mBAAmBA,CAAM,EAE7CwQ,EAYMjX,GAAQA,EAAK,OACvB,KAAK,KAAK,OAAQA,CAAI,IATlBgX,GAAgBhX,GAAQA,EAAK,QAChC,KAAK,KAAK,OAAQA,CAAI,EAMvB,KAAK,KAAK,OAAQA,CAAI,GAIhB,IACT,EAEC,SAAU,SAAUgX,EAAa,CAGhC,OAAIA,GACH,KAAK,KAAK,SAAS,EAMb,KAAK,KAAK,SAAS,CAC5B,EAEC,MAAO,UAAY,CAClBrF,OAAAA,EAAqB,KAAK,WAAW,EACjC,KAAK,UACR,KAAK,SAAS,KAAI,EAEZ,IACT,EAEC,UAAW,SAAUnD,EAAQ,CAC5BkD,GAAoB,KAAK,SAAU,KAAK,eAAc,EAAG,SAASlD,CAAM,CAAC,CAC3E,EAEC,aAAc,UAAY,CACzB,OAAO,KAAK,WAAU,EAAK,KAAK,WAAU,CAC5C,EAEC,oBAAqB,UAAY,CAC3B,KAAK,kBACT,KAAK,gBAAgB,KAAK,QAAQ,SAAS,CAE9C,EAEC,eAAgB,UAAY,CAC3B,GAAI,CAAC,KAAK,QACT,MAAM,IAAI,MAAM,gCAAgC,CAEnD,EAKC,YAAa,SAAUjB,EAAQ,CAC9B,KAAK,SAAW,CAAA,EAChB,KAAK,SAASzK,EAAW,KAAK,UAAU,GAAK,KAE7C,IAAIoU,EAAQ3J,EAASyB,GAAeD,EA6BpCmI,EAAM,KAAK,WAAY,mGAC6C,KAAK,gBAAiB,IAAI,EAE1F,KAAK,QAAQ,aAChBA,EAAM,OAAQ,SAAU,KAAK,UAAW,IAAI,EAGzC/O,EAAQ,OAAS,KAAK,QAAQ,mBAChCoF,EAAS,KAAK,IAAM,KAAK,IAAI,KAAK,KAAM,UAAW,KAAK,UAAU,CAEtE,EAEC,UAAW,UAAY,CACtBoE,EAAqB,KAAK,cAAc,EACxC,KAAK,eAAiBJ,EACd,UAAY,CAAE,KAAK,eAAe,CAAC,gBAAiB,EAAI,CAAC,CAAE,EAAI,IAAI,CAC7E,EAEC,UAAW,UAAY,CACtB,KAAK,WAAW,UAAa,EAC7B,KAAK,WAAW,WAAa,CAC/B,EAEC,WAAY,UAAY,CACvB,IAAI9C,EAAM,KAAK,eAAc,EACzB,KAAK,IAAI,KAAK,IAAIA,EAAI,CAAC,EAAG,KAAK,IAAIA,EAAI,CAAC,CAAC,GAAK,KAAK,QAAQ,kBAG9D,KAAK,WAAW,KAAK,UAAS,EAAI,KAAK,QAAO,CAAE,CAEnD,EAEC,kBAAmB,SAAU1L,EAAGd,EAAM,CAOrC,QANIkV,EAAU,CAAA,EACVxE,EACAyE,EAAUnV,IAAS,YAAcA,IAAS,YAC1CzE,EAAMuF,EAAE,QAAUA,EAAE,WACpBsU,EAAW,GAER7Z,GAAK,CAEX,GADAmV,EAAS,KAAK,SAAS7P,EAAWtF,CAAG,GACjCmV,IAAW1Q,IAAS,SAAWA,IAAS,aAAe,KAAK,gBAAgB0Q,CAAM,EAAG,CAExF0E,EAAW,GACX,KACJ,CAMG,GALI1E,GAAUA,EAAO,QAAQ1Q,EAAM,EAAI,IAClCmV,GAAW,CAACE,GAA0B9Z,EAAKuF,CAAC,IAChDoU,EAAQ,KAAKxE,CAAM,EACfyE,KAED5Z,IAAQ,KAAK,WAAc,MAC/BA,EAAMA,EAAI,UACb,CACE,MAAI,CAAC2Z,EAAQ,QAAU,CAACE,GAAY,CAACD,GAAW,KAAK,QAAQnV,EAAM,EAAI,IACtEkV,EAAU,CAAC,IAAI,GAETA,CACT,EAEC,iBAAkB,SAAU7W,EAAI,CAC/B,KAAOA,GAAMA,IAAO,KAAK,YAAY,CACpC,GAAIA,EAAG,uBAA6B,MAAO,GAC3CA,EAAKA,EAAG,UACX,CACA,EAEC,gBAAiB,SAAUyC,EAAG,CAC7B,IAAIzC,EAAMyC,EAAE,QAAUA,EAAE,WACxB,GAAI,GAAC,KAAK,SAAWzC,EAAG,yBAA8ByC,EAAE,OAAS,SAAW,KAAK,iBAAiBzC,CAAE,GAIpG,KAAI2B,EAAOc,EAAE,KAETd,IAAS,aAEZsV,GAAuBjX,CAAE,EAG1B,KAAK,cAAcyC,EAAGd,CAAI,EAC5B,EAEC,aAAc,CAAC,QAAS,WAAY,YAAa,WAAY,aAAa,EAE1E,cAAe,SAAUc,EAAGd,EAAMuV,EAAe,CAEhD,GAAIzU,EAAE,OAAS,QAAS,CAMvB,IAAI0U,EAAQhW,EAAY,CAAA,EAAIsB,CAAC,EAC7B0U,EAAM,KAAO,WACb,KAAK,cAAcA,EAAOA,EAAM,KAAMD,CAAa,CACtD,CAGE,IAAIL,EAAU,KAAK,kBAAkBpU,EAAGd,CAAI,EAE5C,GAAIuV,EAAe,CAElB,QADIE,EAAW,CAAA,EACNra,EAAI,EAAGA,EAAIma,EAAc,OAAQna,IACrCma,EAAcna,GAAG,QAAQ4E,EAAM,EAAI,GACtCyV,EAAS,KAAKF,EAAcna,EAAE,EAGhC8Z,EAAUO,EAAS,OAAOP,CAAO,CACpC,CAEE,GAAKA,EAAQ,OAEb,CAAIlV,IAAS,eACZ8J,GAAwBhJ,CAAC,EAG1B,IAAI4P,EAASwE,EAAQ,GACjBnX,EAAO,CACV,cAAe+C,CAClB,EAEE,GAAIA,EAAE,OAAS,YAAcA,EAAE,OAAS,WAAaA,EAAE,OAAS,QAAS,CACxE,IAAI4U,EAAWhF,EAAO,YAAc,CAACA,EAAO,SAAWA,EAAO,SAAW,IACzE3S,EAAK,eAAiB2X,EACrB,KAAK,uBAAuBhF,EAAO,UAAS,CAAE,EAAI,KAAK,2BAA2B5P,CAAC,EACpF/C,EAAK,WAAa,KAAK,2BAA2BA,EAAK,cAAc,EACrEA,EAAK,OAAS2X,EAAWhF,EAAO,UAAS,EAAK,KAAK,mBAAmB3S,EAAK,UAAU,CACxF,CAEE,IAAK3C,EAAI,EAAGA,EAAI8Z,EAAQ,OAAQ9Z,IAE/B,GADA8Z,EAAQ9Z,GAAG,KAAK4E,EAAMjC,EAAM,EAAI,EAC5BA,EAAK,cAAc,UACrBmX,EAAQ9Z,GAAG,QAAQ,sBAAwB,IAAS6S,EAAa,KAAK,aAAcjO,CAAI,IAAM,GAAO,OAE1G,EAEC,gBAAiB,SAAUnE,EAAK,CAC/B,OAAAA,EAAMA,EAAI,UAAYA,EAAI,SAAS,QAAO,EAAKA,EAAM,KAC7CA,EAAI,UAAYA,EAAI,SAAS,MAAK,GAAQ,KAAK,SAAW,KAAK,QAAQ,MAAK,CACtF,EAEC,eAAgB,UAAY,CAC3B,QAAST,EAAI,EAAGE,EAAM,KAAK,UAAU,OAAQF,EAAIE,EAAKF,IACrD,KAAK,UAAUA,GAAG,QAAO,CAE5B,EAQC,UAAW,SAAUua,EAAUvZ,EAAS,CACvC,OAAI,KAAK,QACRuZ,EAAS,KAAKvZ,GAAW,KAAM,CAAC,OAAQ,IAAI,CAAC,EAE7C,KAAK,GAAG,OAAQuZ,EAAUvZ,CAAO,EAE3B,IACT,EAKC,eAAgB,UAAY,CAC3B,OAAOiT,GAAoB,KAAK,QAAQ,GAAK,IAAIrO,EAAM,EAAG,CAAC,CAC7D,EAEC,OAAQ,UAAY,CACnB,IAAIwL,EAAM,KAAK,eAAc,EAC7B,OAAOA,GAAO,CAACA,EAAI,OAAO,CAAC,EAAG,CAAC,CAAC,CAClC,EAEC,iBAAkB,SAAUhI,EAAQL,EAAM,CACzC,IAAIyR,EAAcpR,GAAUL,IAAS,OACpC,KAAK,mBAAmBK,EAAQL,CAAI,EACpC,KAAK,eAAc,EACpB,OAAOyR,EAAY,SAAS,KAAK,eAAc,CAAE,CACnD,EAEC,mBAAoB,SAAUpR,EAAQL,EAAM,CAC3C,IAAI+L,EAAW,KAAK,QAAO,EAAG,UAAU,CAAC,EACzC,OAAO,KAAK,QAAQ1L,EAAQL,CAAI,EAAE,UAAU+L,CAAQ,EAAE,KAAK,KAAK,eAAc,CAAE,EAAE,OAAM,CAC1F,EAEC,uBAAwB,SAAUhM,EAAQC,EAAMK,EAAQ,CACvD,IAAIqR,EAAU,KAAK,mBAAmBrR,EAAQL,CAAI,EAClD,OAAO,KAAK,QAAQD,EAAQC,CAAI,EAAE,UAAU0R,CAAO,CACrD,EAEC,8BAA+B,SAAUC,EAAc3R,EAAMK,EAAQ,CACpE,IAAIqR,EAAU,KAAK,mBAAmBrR,EAAQL,CAAI,EAClD,OAAOtC,GAAS,CACf,KAAK,QAAQiU,EAAa,aAAY,EAAI3R,CAAI,EAAE,UAAU0R,CAAO,EACjE,KAAK,QAAQC,EAAa,aAAY,EAAI3R,CAAI,EAAE,UAAU0R,CAAO,EACjE,KAAK,QAAQC,EAAa,aAAY,EAAI3R,CAAI,EAAE,UAAU0R,CAAO,EACjE,KAAK,QAAQC,EAAa,aAAY,EAAI3R,CAAI,EAAE,UAAU0R,CAAO,CACpE,CAAG,CACH,EAGC,qBAAsB,UAAY,CACjC,OAAO,KAAK,2BAA2B,KAAK,QAAO,EAAG,UAAU,CAAC,CAAC,CACpE,EAGC,iBAAkB,SAAU3R,EAAQ,CACnC,OAAO,KAAK,mBAAmBA,CAAM,EAAE,SAAS,KAAK,qBAAoB,CAAE,CAC7E,EAGC,aAAc,SAAUM,EAAQL,EAAMrC,EAAQ,CAE7C,GAAI,CAACA,EAAU,OAAO0C,EAEtB,IAAIuR,EAAc,KAAK,QAAQvR,EAAQL,CAAI,EACvC+L,EAAW,KAAK,QAAO,EAAG,SAAS,CAAC,EACpC8F,EAAa,IAAIzU,GAAOwU,EAAY,SAAS7F,CAAQ,EAAG6F,EAAY,IAAI7F,CAAQ,CAAC,EACjF3D,EAAS,KAAK,iBAAiByJ,EAAYlU,EAAQqC,CAAI,EAK3D,OAAI,KAAK,IAAIoI,EAAO,CAAC,GAAK,GAAK,KAAK,IAAIA,EAAO,CAAC,GAAK,EAC7C/H,EAGD,KAAK,UAAUuR,EAAY,IAAIxJ,CAAM,EAAGpI,CAAI,CACrD,EAGC,aAAc,SAAUoI,EAAQzK,EAAQ,CACvC,GAAI,CAACA,EAAU,OAAOyK,EAEtB,IAAIyJ,EAAa,KAAK,eAAc,EAChCC,EAAY,IAAI1U,GAAOyU,EAAW,IAAI,IAAIzJ,CAAM,EAAGyJ,EAAW,IAAI,IAAIzJ,CAAM,CAAC,EAEjF,OAAOA,EAAO,IAAI,KAAK,iBAAiB0J,EAAWnU,CAAM,CAAC,CAC5D,EAGC,iBAAkB,SAAUoU,EAAUC,EAAWhS,EAAM,CACtD,IAAIiS,EAAqBvU,GACjB,KAAK,QAAQsU,EAAU,aAAY,EAAIhS,CAAI,EAC3C,KAAK,QAAQgS,EAAU,aAAY,EAAIhS,CAAI,CACrD,EACMkS,EAAYD,EAAmB,IAAI,SAASF,EAAS,GAAG,EACxDI,EAAYF,EAAmB,IAAI,SAASF,EAAS,GAAG,EAExDK,EAAK,KAAK,SAASF,EAAU,EAAG,CAACC,EAAU,CAAC,EAC5CE,EAAK,KAAK,SAASH,EAAU,EAAG,CAACC,EAAU,CAAC,EAEhD,OAAO,IAAItV,EAAMuV,EAAIC,CAAE,CACzB,EAEC,SAAU,SAAUC,EAAMC,EAAO,CAChC,OAAOD,EAAOC,EAAQ,EACrB,KAAK,MAAMD,EAAOC,CAAK,EAAI,EAC3B,KAAK,IAAI,EAAG,KAAK,KAAKD,CAAI,CAAC,EAAI,KAAK,IAAI,EAAG,KAAK,MAAMC,CAAK,CAAC,CAC/D,EAEC,WAAY,SAAUvS,EAAM,CAC3B,IAAItH,EAAM,KAAK,WAAU,EACrBD,EAAM,KAAK,WAAU,EACrBoX,EAAO9N,EAAQ,MAAQ,KAAK,QAAQ,SAAW,EACnD,OAAI8N,IACH7P,EAAO,KAAK,MAAMA,EAAO6P,CAAI,EAAIA,GAE3B,KAAK,IAAInX,EAAK,KAAK,IAAID,EAAKuH,CAAI,CAAC,CAC1C,EAEC,qBAAsB,UAAY,CACjC,KAAK,KAAK,MAAM,CAClB,EAEC,oBAAqB,UAAY,CAChCwS,GAAoB,KAAK,SAAU,kBAAkB,EACrD,KAAK,KAAK,SAAS,CACrB,EAEC,gBAAiB,SAAUnS,EAAQhH,EAAS,CAE3C,IAAI+O,EAAS,KAAK,iBAAiB/H,CAAM,EAAE,OAAM,EAGjD,OAAKhH,GAAWA,EAAQ,WAAa,IAAQ,CAAC,KAAK,QAAO,EAAG,SAAS+O,CAAM,EAAY,IAExF,KAAK,MAAMA,EAAQ/O,CAAO,EAEnB,GACT,EAEC,iBAAkB,UAAY,CAE7B,IAAIoZ,EAAQ,KAAK,OAASlD,EAAe,MAAO,qCAAqC,EACrF,KAAK,OAAO,QAAQ,YAAYkD,CAAK,EAErC,KAAK,GAAG,WAAY,SAAU9V,EAAG,CAChC,IAAImJ,EAAO4M,GACPC,EAAY,KAAK,OAAO,MAAM7M,GAElC8M,GAAqB,KAAK,OAAQ,KAAK,QAAQjW,EAAE,OAAQA,EAAE,IAAI,EAAG,KAAK,aAAaA,EAAE,KAAM,CAAC,CAAC,EAG1FgW,IAAc,KAAK,OAAO,MAAM7M,IAAS,KAAK,gBACjD,KAAK,qBAAoB,CAE7B,EAAK,IAAI,EAEP,KAAK,GAAG,eAAgB,KAAK,aAAc,IAAI,EAE/C,KAAK,IAAI,SAAU,KAAK,kBAAmB,IAAI,CACjD,EAEC,kBAAmB,UAAY,CAC9BuJ,GAAe,KAAK,MAAM,EAC1B,KAAK,IAAI,eAAgB,KAAK,aAAc,IAAI,EAChD,OAAO,KAAK,MACd,EAEC,aAAc,UAAY,CACzB,IAAIxP,EAAI,KAAK,UAAS,EAClBgT,EAAI,KAAK,QAAO,EACpBD,GAAqB,KAAK,OAAQ,KAAK,QAAQ/S,EAAGgT,CAAC,EAAG,KAAK,aAAaA,EAAG,CAAC,CAAC,CAC/E,EAEC,oBAAqB,SAAUlW,EAAG,CAC7B,KAAK,gBAAkBA,EAAE,aAAa,QAAQ,WAAW,GAAK,GACjE,KAAK,qBAAoB,CAE5B,EAEC,kBAAmB,UAAY,CAC9B,MAAO,CAAC,KAAK,WAAW,uBAAuB,uBAAuB,EAAE,MAC1E,EAEC,iBAAkB,SAAU0D,EAAQL,EAAM3G,EAAS,CAElD,GAAI,KAAK,eAAkB,MAAO,GAKlC,GAHAA,EAAUA,GAAW,CAAA,EAGjB,CAAC,KAAK,eAAiBA,EAAQ,UAAY,IAAS,KAAK,kBAAiB,GACtE,KAAK,IAAI2G,EAAO,KAAK,KAAK,EAAI,KAAK,QAAQ,uBAA0B,MAAO,GAGpF,IAAIE,EAAQ,KAAK,aAAaF,CAAI,EAC9BoI,EAAS,KAAK,iBAAiB/H,CAAM,EAAE,UAAU,EAAI,EAAIH,CAAK,EAGlE,OAAI7G,EAAQ,UAAY,IAAQ,CAAC,KAAK,QAAO,EAAG,SAAS+O,CAAM,EAAY,IAE3E+C,EAAsB,UAAY,CACjC,KACK,WAAW,GAAM9R,EAAQ,aAAe,EAAK,EAC7C,aAAagH,EAAQL,EAAM,EAAI,CACvC,EAAK,IAAI,EAEA,GACT,EAEC,aAAc,SAAUK,EAAQL,EAAM8S,EAAWC,EAAU,CACrD,KAAK,WAEND,IACH,KAAK,eAAiB,GAGtB,KAAK,iBAAmBzS,EACxB,KAAK,eAAiBL,EAEtBwM,EAAiB,KAAK,SAAU,mBAAmB,GAMpD,KAAK,KAAK,WAAY,CACrB,OAAQnM,EACR,KAAML,EACN,SAAU+S,CACb,CAAG,EAEI,KAAK,qBACT,KAAK,mBAAqB,KAAK,QAAU,KAAK,gBAG/C,KAAK,MAAM,KAAK,iBAAkB,KAAK,eAAgB,OAAW,EAAI,EAGtE,WAAWrH,EAAU,KAAK,qBAAsB,IAAI,EAAG,GAAG,EAC5D,EAEC,qBAAsB,UAAY,CAC5B,KAAK,iBAEN,KAAK,UACR8G,GAAoB,KAAK,SAAU,mBAAmB,EAGvD,KAAK,eAAiB,GAEtB,KAAK,MAAM,KAAK,iBAAkB,KAAK,eAAgB,OAAW,EAAI,EAElE,KAAK,oBACR,KAAK,KAAK,MAAM,EAEjB,OAAO,KAAK,mBAEZ,KAAK,KAAK,MAAM,EAEhB,KAAK,SAAS,EAAI,EACpB,CACA,CAAC,EAYM,SAASQ,GAAUrY,EAAItB,EAAS,CACtC,OAAO,IAAIoS,EAAI9Q,EAAItB,CAAO,CAC3B,CCvsDU,IAAC4Z,GAAUlY,EAAM,OAAO,CAGjC,QAAS,CAIR,SAAU,UACZ,EAEC,WAAY,SAAU1B,EAAS,CAC9B6B,EAAgB,KAAM7B,CAAO,CAC/B,EAQC,YAAa,UAAY,CACxB,OAAO,KAAK,QAAQ,QACtB,EAIC,YAAa,SAAUkX,EAAU,CAChC,IAAI2C,EAAM,KAAK,KAEf,OAAIA,GACHA,EAAI,cAAc,IAAI,EAGvB,KAAK,QAAQ,SAAW3C,EAEpB2C,GACHA,EAAI,WAAW,IAAI,EAGb,IACT,EAIC,aAAc,UAAY,CACzB,OAAO,KAAK,UACd,EAIC,MAAO,SAAUA,EAAK,CACrB,KAAK,OAAM,EACX,KAAK,KAAOA,EAEZ,IAAIhM,EAAY,KAAK,WAAa,KAAK,MAAMgM,CAAG,EAC5C7K,EAAM,KAAK,YAAW,EACtB8K,EAASD,EAAI,gBAAgB7K,GAEjCmE,OAAAA,EAAiBtF,EAAW,iBAAiB,EAEzCmB,EAAI,QAAQ,QAAQ,IAAM,GAC7B8K,EAAO,aAAajM,EAAWiM,EAAO,UAAU,EAEhDA,EAAO,YAAYjM,CAAS,EAG7B,KAAK,KAAK,GAAG,SAAU,KAAK,OAAQ,IAAI,EAEjC,IACT,EAIC,OAAQ,UAAY,CACnB,OAAK,KAAK,MAIVmI,GAAe,KAAK,UAAU,EAE1B,KAAK,UACR,KAAK,SAAS,KAAK,IAAI,EAGxB,KAAK,KAAK,IAAI,SAAU,KAAK,OAAQ,IAAI,EACzC,KAAK,KAAO,KAEL,MAZC,IAaV,EAEC,cAAe,SAAU1S,EAAG,CAEvB,KAAK,MAAQA,GAAKA,EAAE,QAAU,GAAKA,EAAE,QAAU,GAClD,KAAK,KAAK,aAAY,EAAG,MAAK,CAEjC,CACA,CAAC,EAEUyW,GAAU,SAAU/Z,EAAS,CACvC,OAAO,IAAI4Z,GAAQ5Z,CAAO,CAC3B,EAiBAoS,EAAI,QAAQ,CAGX,WAAY,SAAU2H,EAAS,CAC9B,OAAAA,EAAQ,MAAM,IAAI,EACX,IACT,EAIC,cAAe,SAAUA,EAAS,CACjC,OAAAA,EAAQ,OAAM,EACP,IACT,EAEC,gBAAiB,UAAY,CAC5B,IAAIC,EAAU,KAAK,gBAAkB,CAAA,EACjC7W,EAAI,WACJ0K,EAAY,KAAK,kBACTqI,EAAe,MAAO/S,EAAI,oBAAqB,KAAK,UAAU,EAE1E,SAAS8W,EAAaC,EAAOC,EAAO,CACnC,IAAIvM,EAAYzK,EAAI+W,EAAQ,IAAM/W,EAAIgX,EAEtCH,EAAQE,EAAQC,GAASjE,EAAe,MAAOtI,EAAWC,CAAS,CACtE,CAEEoM,EAAa,MAAO,MAAM,EAC1BA,EAAa,MAAO,OAAO,EAC3BA,EAAa,SAAU,MAAM,EAC7BA,EAAa,SAAU,OAAO,CAChC,EAEC,iBAAkB,UAAY,CAC7B,QAASrc,KAAK,KAAK,gBAClBoY,GAAe,KAAK,gBAAgBpY,EAAE,EAEvCoY,GAAe,KAAK,iBAAiB,EACrC,OAAO,KAAK,gBACZ,OAAO,KAAK,iBACd,CACA,CAAC,EChIM,IAAIoE,GAASR,GAAQ,OAAO,CAGlC,QAAS,CAGR,UAAW,GACX,SAAU,WAIV,WAAY,GAIZ,eAAgB,GAKhB,WAAY,GAQZ,aAAc,SAAUS,EAAQC,EAAQC,EAAOC,EAAO,CACrD,OAAOD,EAAQC,EAAQ,GAAMA,EAAQD,EAAQ,EAAI,CACpD,CACA,EAEC,WAAY,SAAUE,EAAYC,EAAU1a,EAAS,CACpD6B,EAAgB,KAAM7B,CAAO,EAE7B,KAAK,oBAAsB,CAAA,EAC3B,KAAK,QAAU,CAAA,EACf,KAAK,YAAc,EACnB,KAAK,eAAiB,GACtB,KAAK,cAAgB,GAErB,QAASpC,KAAK6c,EACb,KAAK,UAAUA,EAAW7c,GAAIA,CAAC,EAGhC,IAAKA,KAAK8c,EACT,KAAK,UAAUA,EAAS9c,GAAIA,EAAG,EAAI,CAEtC,EAEC,MAAO,SAAUic,EAAK,CACrB,KAAK,YAAW,EAChB,KAAK,QAAO,EAEZ,KAAK,KAAOA,EACZA,EAAI,GAAG,UAAW,KAAK,qBAAsB,IAAI,EAEjD,QAASjc,EAAI,EAAGA,EAAI,KAAK,QAAQ,OAAQA,IACxC,KAAK,QAAQA,GAAG,MAAM,GAAG,aAAc,KAAK,eAAgB,IAAI,EAGjE,OAAO,KAAK,UACd,EAEC,MAAO,SAAUic,EAAK,CACrB,OAAAD,GAAQ,UAAU,MAAM,KAAK,KAAMC,CAAG,EAE/B,KAAK,sBAAqB,CACnC,EAEC,SAAU,UAAY,CACrB,KAAK,KAAK,IAAI,UAAW,KAAK,qBAAsB,IAAI,EAExD,QAASjc,EAAI,EAAGA,EAAI,KAAK,QAAQ,OAAQA,IACxC,KAAK,QAAQA,GAAG,MAAM,IAAI,aAAc,KAAK,eAAgB,IAAI,CAEpE,EAIC,aAAc,SAAU+c,EAAO3Z,EAAM,CACpC,YAAK,UAAU2Z,EAAO3Z,CAAI,EAClB,KAAK,KAAQ,KAAK,QAAO,EAAK,IACxC,EAIC,WAAY,SAAU2Z,EAAO3Z,EAAM,CAClC,YAAK,UAAU2Z,EAAO3Z,EAAM,EAAI,EACxB,KAAK,KAAQ,KAAK,QAAO,EAAK,IACxC,EAIC,YAAa,SAAU2Z,EAAO,CAC7BA,EAAM,IAAI,aAAc,KAAK,eAAgB,IAAI,EAEjD,IAAItc,EAAM,KAAK,UAAUgF,EAAWsX,CAAK,CAAC,EAC1C,OAAItc,GACH,KAAK,QAAQ,OAAO,KAAK,QAAQ,QAAQA,CAAG,EAAG,CAAC,EAEzC,KAAK,KAAQ,KAAK,QAAO,EAAK,IACxC,EAIC,OAAQ,UAAY,CACnB8U,EAAiB,KAAK,WAAY,iCAAiC,EACnE,KAAK,SAAS,MAAM,OAAS,KAC7B,IAAIyH,EAAmB,KAAK,KAAK,QAAO,EAAG,GAAK,KAAK,WAAW,UAAY,IAC5E,OAAIA,EAAmB,KAAK,SAAS,cACpCzH,EAAiB,KAAK,SAAU,kCAAkC,EAClE,KAAK,SAAS,MAAM,OAASyH,EAAmB,MAEhDzB,GAAoB,KAAK,SAAU,kCAAkC,EAEtE,KAAK,qBAAoB,EAClB,IACT,EAIC,SAAU,UAAY,CACrBA,OAAAA,GAAoB,KAAK,WAAY,iCAAiC,EAC/D,IACT,EAEC,YAAa,UAAY,CACxB,IAAIvL,EAAY,yBACZC,EAAY,KAAK,WAAaqI,EAAe,MAAOtI,CAAS,EAC7DiN,EAAY,KAAK,QAAQ,UAG7BhN,EAAU,aAAa,gBAAiB,EAAI,EAE5CiN,GAAiCjN,CAAS,EAC1CkN,GAAkClN,CAAS,EAE3C,IAAImN,EAAU,KAAK,SAAW9E,EAAe,UAAWtI,EAAY,OAAO,EAEvEiN,IACH,KAAK,KAAK,GAAG,QAAS,KAAK,SAAU,IAAI,EAEzCvL,EAAYzB,EAAW,CACtB,WAAY,KAAK,cACjB,WAAY,KAAK,QACrB,EAAM,IAAI,GAGR,IAAIoN,EAAO,KAAK,YAAc/E,EAAe,IAAKtI,EAAY,UAAWC,CAAS,EAClFoN,EAAK,KAAO,IACZA,EAAK,MAAQ,SACbA,EAAK,aAAa,OAAQ,QAAQ,EAElC3L,EAAY2L,EAAM,CACjB,QAAS,SAAU3X,EAAG,CACjBA,EAAE,UAAY,IACjB,KAAK,cAAa,CAEvB,EAEG,MAAO,SAAUA,EAAG,CACnBgJ,GAAwBhJ,CAAC,EACzB,KAAK,cAAa,CACtB,CACA,EAAK,IAAI,EAEFuX,GACJ,KAAK,OAAM,EAGZ,KAAK,gBAAkB3E,EAAe,MAAOtI,EAAY,QAASoN,CAAO,EACzE,KAAK,WAAa9E,EAAe,MAAOtI,EAAY,aAAcoN,CAAO,EACzE,KAAK,cAAgB9E,EAAe,MAAOtI,EAAY,YAAaoN,CAAO,EAE3EnN,EAAU,YAAYmN,CAAO,CAC/B,EAEC,UAAW,SAAU1Z,EAAI,CACxB,QAAS1D,EAAI,EAAGA,EAAI,KAAK,QAAQ,OAAQA,IAExC,GAAI,KAAK,QAAQA,IAAMyF,EAAW,KAAK,QAAQzF,GAAG,KAAK,IAAM0D,EAC5D,OAAO,KAAK,QAAQ1D,EAGxB,EAEC,UAAW,SAAU+c,EAAO3Z,EAAMka,EAAS,CACtC,KAAK,MACRP,EAAM,GAAG,aAAc,KAAK,eAAgB,IAAI,EAGjD,KAAK,QAAQ,KAAK,CACjB,MAAOA,EACP,KAAM3Z,EACN,QAASka,CACZ,CAAG,EAEG,KAAK,QAAQ,YAChB,KAAK,QAAQ,KAAK7I,EAAU,SAAUrO,EAAGC,EAAG,CAC3C,OAAO,KAAK,QAAQ,aAAaD,EAAE,MAAOC,EAAE,MAAOD,EAAE,KAAMC,EAAE,IAAI,CACrE,EAAM,IAAI,CAAC,EAGL,KAAK,QAAQ,YAAc0W,EAAM,YACpC,KAAK,cACLA,EAAM,UAAU,KAAK,WAAW,GAGjC,KAAK,sBAAqB,CAC5B,EAEC,QAAS,UAAY,CACpB,GAAI,CAAC,KAAK,WAAc,OAAO,KAE/BQ,GAAc,KAAK,eAAe,EAClCA,GAAc,KAAK,aAAa,EAEhC,KAAK,oBAAsB,CAAA,EAC3B,IAAIC,EAAmBC,EAAiBzd,EAAGS,EAAKid,EAAkB,EAElE,IAAK1d,EAAI,EAAGA,EAAI,KAAK,QAAQ,OAAQA,IACpCS,EAAM,KAAK,QAAQT,GACnB,KAAK,SAASS,CAAG,EACjBgd,EAAkBA,GAAmBhd,EAAI,QACzC+c,EAAoBA,GAAqB,CAAC/c,EAAI,QAC9Cid,GAAoBjd,EAAI,QAAc,EAAJ,EAInC,OAAI,KAAK,QAAQ,iBAChB+c,EAAoBA,GAAqBE,EAAkB,EAC3D,KAAK,gBAAgB,MAAM,QAAUF,EAAoB,GAAK,QAG/D,KAAK,WAAW,MAAM,QAAUC,GAAmBD,EAAoB,GAAK,OAErE,IACT,EAEC,eAAgB,SAAU9X,EAAG,CACvB,KAAK,gBACT,KAAK,QAAO,EAGb,IAAIjF,EAAM,KAAK,UAAUgF,EAAWC,EAAE,MAAM,CAAC,EAWzCd,EAAOnE,EAAI,QACbiF,EAAE,OAAS,MAAQ,aAAe,gBAClCA,EAAE,OAAS,MAAQ,kBAAoB,KAErCd,GACH,KAAK,KAAK,KAAKA,EAAMnE,CAAG,CAE3B,EAGC,oBAAqB,SAAU2C,EAAMua,EAAS,CAE7C,IAAIC,EAAY,qEACdxa,EAAO,KAAOua,EAAU,qBAAuB,IAAM,KAEnDE,EAAgB,SAAS,cAAc,KAAK,EAChD,OAAAA,EAAc,UAAYD,EAEnBC,EAAc,UACvB,EAEC,SAAU,SAAUpd,EAAK,CACxB,IAAIqd,EAAQ,SAAS,cAAc,OAAO,EACtCH,EAAU,KAAK,KAAK,SAASld,EAAI,KAAK,EACtCsd,EAEAtd,EAAI,SACPsd,EAAQ,SAAS,cAAc,OAAO,EACtCA,EAAM,KAAO,WACbA,EAAM,UAAY,kCAClBA,EAAM,eAAiBJ,GAEvBI,EAAQ,KAAK,oBAAoB,uBAAyBtY,EAAW,IAAI,EAAGkY,CAAO,EAGpF,KAAK,oBAAoB,KAAKI,CAAK,EACnCA,EAAM,QAAUtY,EAAWhF,EAAI,KAAK,EAEpCiR,EAAYqM,EAAO,QAAS,KAAK,cAAe,IAAI,EAEpD,IAAI3a,EAAO,SAAS,cAAc,MAAM,EACxCA,EAAK,UAAY,IAAM3C,EAAI,KAI3B,IAAIud,EAAS,SAAS,cAAc,MAAM,EAE1CF,EAAM,YAAYE,CAAM,EACxBA,EAAO,YAAYD,CAAK,EACxBC,EAAO,YAAY5a,CAAI,EAEvB,IAAI6M,EAAYxP,EAAI,QAAU,KAAK,cAAgB,KAAK,gBACxD,OAAAwP,EAAU,YAAY6N,CAAK,EAE3B,KAAK,qBAAoB,EAClBA,CACT,EAEC,cAAe,UAAY,CAE1B,GAAI,MAAK,cAIT,KAAIG,EAAS,KAAK,oBACdF,EAAOhB,EACPmB,EAAc,CAAA,EACdC,EAAgB,CAAA,EAEpB,KAAK,eAAiB,GAEtB,QAASne,EAAIie,EAAO,OAAS,EAAGje,GAAK,EAAGA,IACvC+d,EAAQE,EAAOje,GACf+c,EAAQ,KAAK,UAAUgB,EAAM,OAAO,EAAE,MAElCA,EAAM,QACTG,EAAY,KAAKnB,CAAK,EACXgB,EAAM,SACjBI,EAAc,KAAKpB,CAAK,EAK1B,IAAK/c,EAAI,EAAGA,EAAIme,EAAc,OAAQne,IACjC,KAAK,KAAK,SAASme,EAAcne,EAAE,GACtC,KAAK,KAAK,YAAYme,EAAcne,EAAE,EAGxC,IAAKA,EAAI,EAAGA,EAAIke,EAAY,OAAQle,IAC9B,KAAK,KAAK,SAASke,EAAYle,EAAE,GACrC,KAAK,KAAK,SAASke,EAAYle,EAAE,EAInC,KAAK,eAAiB,GAEtB,KAAK,cAAa,EACpB,EAEC,qBAAsB,UAAY,CAMjC,QALIie,EAAS,KAAK,oBACdF,EACAhB,EACAhU,EAAO,KAAK,KAAK,QAAO,EAEnB/I,EAAIie,EAAO,OAAS,EAAGje,GAAK,EAAGA,IACvC+d,EAAQE,EAAOje,GACf+c,EAAQ,KAAK,UAAUgB,EAAM,OAAO,EAAE,MACtCA,EAAM,SAAYhB,EAAM,QAAQ,UAAY,QAAahU,EAAOgU,EAAM,QAAQ,SAC5DA,EAAM,QAAQ,UAAY,QAAahU,EAAOgU,EAAM,QAAQ,OAGjF,EAEC,sBAAuB,UAAY,CAClC,OAAI,KAAK,MAAQ,CAAC,KAAK,QAAQ,WAC9B,KAAK,OAAM,EAEL,IACT,EAEC,cAAe,UAAY,CAC1B,IAAIK,EAAU,KAAK,SACnB,KAAK,cAAgB,GACrB1L,EAAY0L,EAAS,QAAS1O,EAAuB,EACrD,KAAK,OAAM,EACX,IAAI0P,EAAO,KACX,WAAW,UAAY,CACtBzM,GAAayL,EAAS,QAAS1O,EAAuB,EACtD0P,EAAK,cAAgB,EACxB,CAAG,CACH,CAEA,CAAC,EAKUC,GAAS,SAAUxB,EAAYC,EAAU1a,EAAS,CAC5D,OAAO,IAAIoa,GAAOK,EAAYC,EAAU1a,CAAO,CAChD,EC5aWkc,GAAOtC,GAAQ,OAAO,CAGhC,QAAS,CACR,SAAU,UAIV,WAAY,oCAIZ,YAAa,UAIb,YAAa,2CAIb,aAAc,UAChB,EAEC,MAAO,SAAUC,EAAK,CACrB,IAAIsC,EAAW,uBACXtO,EAAYqI,EAAe,MAAOiG,EAAW,cAAc,EAC3Dnc,EAAU,KAAK,QAEnB,YAAK,cAAiB,KAAK,cAAcA,EAAQ,WAAYA,EAAQ,YAC7Dmc,EAAW,MAAQtO,EAAW,KAAK,OAAO,EAClD,KAAK,eAAiB,KAAK,cAAc7N,EAAQ,YAAaA,EAAQ,aAC9Dmc,EAAW,OAAQtO,EAAW,KAAK,QAAQ,EAEnD,KAAK,gBAAe,EACpBgM,EAAI,GAAG,2BAA4B,KAAK,gBAAiB,IAAI,EAEtDhM,CACT,EAEC,SAAU,SAAUgM,EAAK,CACxBA,EAAI,IAAI,2BAA4B,KAAK,gBAAiB,IAAI,CAChE,EAEC,QAAS,UAAY,CACpB,YAAK,UAAY,GACjB,KAAK,gBAAe,EACb,IACT,EAEC,OAAQ,UAAY,CACnB,YAAK,UAAY,GACjB,KAAK,gBAAe,EACb,IACT,EAEC,QAAS,SAAUvW,EAAG,CACjB,CAAC,KAAK,WAAa,KAAK,KAAK,MAAQ,KAAK,KAAK,WAAU,GAC5D,KAAK,KAAK,OAAO,KAAK,KAAK,QAAQ,WAAaA,EAAE,SAAW,EAAI,EAAE,CAEtE,EAEC,SAAU,SAAUA,EAAG,CAClB,CAAC,KAAK,WAAa,KAAK,KAAK,MAAQ,KAAK,KAAK,WAAU,GAC5D,KAAK,KAAK,QAAQ,KAAK,KAAK,QAAQ,WAAaA,EAAE,SAAW,EAAI,EAAE,CAEvE,EAEC,cAAe,SAAU8Y,EAAMC,EAAOzO,EAAWC,EAAWzP,EAAI,CAC/D,IAAI6c,EAAO/E,EAAe,IAAKtI,EAAWC,CAAS,EACnD,OAAAoN,EAAK,UAAYmB,EACjBnB,EAAK,KAAO,IACZA,EAAK,MAAQoB,EAKbpB,EAAK,aAAa,OAAQ,QAAQ,EAClCA,EAAK,aAAa,aAAcoB,CAAK,EAErCvB,GAAiCG,CAAI,EACrC3L,EAAY2L,EAAM,QAASqB,EAAa,EACxChN,EAAY2L,EAAM,QAAS7c,EAAI,IAAI,EACnCkR,EAAY2L,EAAM,QAAS,KAAK,cAAe,IAAI,EAE5CA,CACT,EAEC,gBAAiB,UAAY,CAC5B,IAAIpB,EAAM,KAAK,KACXjM,EAAY,mBAEhBuL,GAAoB,KAAK,cAAevL,CAAS,EACjDuL,GAAoB,KAAK,eAAgBvL,CAAS,EAClD,KAAK,cAAc,aAAa,gBAAiB,OAAO,EACxD,KAAK,eAAe,aAAa,gBAAiB,OAAO,GAErD,KAAK,WAAaiM,EAAI,QAAUA,EAAI,WAAU,KACjD1G,EAAiB,KAAK,eAAgBvF,CAAS,EAC/C,KAAK,eAAe,aAAa,gBAAiB,MAAM,IAErD,KAAK,WAAaiM,EAAI,QAAUA,EAAI,WAAU,KACjD1G,EAAiB,KAAK,cAAevF,CAAS,EAC9C,KAAK,cAAc,aAAa,gBAAiB,MAAM,EAE1D,CACA,CAAC,EAMDwE,EAAI,aAAa,CAChB,YAAa,EACd,CAAC,EAEDA,EAAI,YAAY,UAAY,CACvB,KAAK,QAAQ,cAKhB,KAAK,YAAc,IAAI8J,GACvB,KAAK,WAAW,KAAK,WAAW,EAElC,CAAC,EAKM,IAAIvV,GAAO,SAAU3G,EAAS,CACpC,OAAO,IAAIkc,GAAKlc,CAAO,CACxB,EC/HWuc,GAAQ3C,GAAQ,OAAO,CAGjC,QAAS,CACR,SAAU,aAIV,SAAU,IAIV,OAAQ,GAIR,SAAU,EAIZ,EAEC,MAAO,SAAUC,EAAK,CACrB,IAAIjM,EAAY,wBACZC,EAAYqI,EAAe,MAAOtI,CAAS,EAC3C5N,EAAU,KAAK,QAEnB,YAAK,WAAWA,EAAS4N,EAAY,QAASC,CAAS,EAEvDgM,EAAI,GAAG7Z,EAAQ,eAAiB,UAAY,OAAQ,KAAK,QAAS,IAAI,EACtE6Z,EAAI,UAAU,KAAK,QAAS,IAAI,EAEzBhM,CACT,EAEC,SAAU,SAAUgM,EAAK,CACxBA,EAAI,IAAI,KAAK,QAAQ,eAAiB,UAAY,OAAQ,KAAK,QAAS,IAAI,CAC9E,EAEC,WAAY,SAAU7Z,EAAS4N,EAAWC,EAAW,CAChD7N,EAAQ,SACX,KAAK,QAAUkW,EAAe,MAAOtI,EAAWC,CAAS,GAEtD7N,EAAQ,WACX,KAAK,QAAUkW,EAAe,MAAOtI,EAAWC,CAAS,EAE5D,EAEC,QAAS,UAAY,CACpB,IAAIgM,EAAM,KAAK,KACXpW,EAAIoW,EAAI,QAAO,EAAG,EAAI,EAEtB2C,EAAY3C,EAAI,SACnBA,EAAI,uBAAuB,CAAC,EAAGpW,CAAC,CAAC,EACjCoW,EAAI,uBAAuB,CAAC,KAAK,QAAQ,SAAUpW,CAAC,CAAC,CAAC,EAEvD,KAAK,cAAc+Y,CAAS,CAC9B,EAEC,cAAe,SAAUA,EAAW,CAC/B,KAAK,QAAQ,QAAUA,GAC1B,KAAK,cAAcA,CAAS,EAEzB,KAAK,QAAQ,UAAYA,GAC5B,KAAK,gBAAgBA,CAAS,CAEjC,EAEC,cAAe,SAAUA,EAAW,CACnC,IAAIC,EAAS,KAAK,aAAaD,CAAS,EACpCd,EAAQe,EAAS,IAAOA,EAAS,KAAQA,EAAS,IAAQ,MAE9D,KAAK,aAAa,KAAK,QAASf,EAAOe,EAASD,CAAS,CAC3D,EAEC,gBAAiB,SAAUA,EAAW,CACrC,IAAIE,EAAUF,EAAY,UACtBG,EAAUC,EAAOC,EAEjBH,EAAU,MACbC,EAAWD,EAAU,KACrBE,EAAQ,KAAK,aAAaD,CAAQ,EAClC,KAAK,aAAa,KAAK,QAASC,EAAQ,MAAOA,EAAQD,CAAQ,IAG/DE,EAAO,KAAK,aAAaH,CAAO,EAChC,KAAK,aAAa,KAAK,QAASG,EAAO,MAAOA,EAAOH,CAAO,EAE/D,EAEC,aAAc,SAAU7V,EAAOiW,EAAMC,EAAO,CAC3ClW,EAAM,MAAM,MAAQ,KAAK,MAAM,KAAK,QAAQ,SAAWkW,CAAK,EAAI,KAChElW,EAAM,UAAYiW,CACpB,EAEC,aAAc,SAAUrd,EAAK,CAC5B,IAAIud,EAAQ,KAAK,IAAI,IAAK,KAAK,MAAMvd,CAAG,EAAI,IAAI,OAAS,CAAC,EACtDH,EAAIG,EAAMud,EAEd,OAAA1d,EAAIA,GAAK,GAAK,GACVA,GAAK,EAAI,EACTA,GAAK,EAAI,EACTA,GAAK,EAAI,EAAI,EAEV0d,EAAQ1d,CACjB,CACA,CAAC,EAKUuH,GAAQ,SAAU7G,EAAS,CACrC,OAAO,IAAIuc,GAAMvc,CAAO,CACzB,EC3HIid,GAAgB,mQAWTC,GAActD,GAAQ,OAAO,CAGvC,QAAS,CACR,SAAU,cAIV,OAAQ,sFAAwFlR,EAAQ,UAAYuU,GAAgB,IAAM,IAAM,aAClJ,EAEC,WAAY,SAAUjd,EAAS,CAC9B6B,EAAgB,KAAM7B,CAAO,EAE7B,KAAK,cAAgB,CAAA,CACvB,EAEC,MAAO,SAAU6Z,EAAK,CACrBA,EAAI,mBAAqB,KACzB,KAAK,WAAa3D,EAAe,MAAO,6BAA6B,EACrE4E,GAAiC,KAAK,UAAU,EAGhD,QAASld,KAAKic,EAAI,QACbA,EAAI,QAAQjc,GAAG,gBAClB,KAAK,eAAeic,EAAI,QAAQjc,GAAG,eAAc,CAAE,EAIrD,YAAK,QAAO,EAEZic,EAAI,GAAG,WAAY,KAAK,gBAAiB,IAAI,EAEtC,KAAK,UACd,EAEC,SAAU,SAAUA,EAAK,CACxBA,EAAI,IAAI,WAAY,KAAK,gBAAiB,IAAI,CAChD,EAEC,gBAAiB,SAAUzI,EAAI,CAC1BA,EAAG,MAAM,iBACZ,KAAK,eAAeA,EAAG,MAAM,eAAc,CAAE,EAC7CA,EAAG,MAAM,KAAK,SAAU,UAAY,CACnC,KAAK,kBAAkBA,EAAG,MAAM,eAAc,CAAE,CACpD,EAAM,IAAI,EAEV,EAIC,UAAW,SAAU+L,EAAQ,CAC5B,YAAK,QAAQ,OAASA,EACtB,KAAK,QAAO,EACL,IACT,EAIC,eAAgB,SAAUL,EAAM,CAC/B,OAAKA,GAEA,KAAK,cAAcA,KACvB,KAAK,cAAcA,GAAQ,GAE5B,KAAK,cAAcA,KAEnB,KAAK,QAAO,EAEL,MATa,IAUtB,EAIC,kBAAmB,SAAUA,EAAM,CAClC,OAAKA,GAED,KAAK,cAAcA,KACtB,KAAK,cAAcA,KACnB,KAAK,QAAO,GAGN,MAPa,IAQtB,EAEC,QAAS,UAAY,CACpB,GAAK,KAAK,KAEV,KAAIM,EAAU,CAAA,EAEd,QAASxf,KAAK,KAAK,cACd,KAAK,cAAcA,IACtBwf,EAAQ,KAAKxf,CAAC,EAIhB,IAAIyf,EAAmB,CAAA,EAEnB,KAAK,QAAQ,QAChBA,EAAiB,KAAK,KAAK,QAAQ,MAAM,EAEtCD,EAAQ,QACXC,EAAiB,KAAKD,EAAQ,KAAK,IAAI,CAAC,EAGzC,KAAK,WAAW,UAAYC,EAAiB,KAAK,qCAAqC,EACzF,CACA,CAAC,EAMDjL,EAAI,aAAa,CAChB,mBAAoB,EACrB,CAAC,EAEDA,EAAI,YAAY,UAAY,CACvB,KAAK,QAAQ,oBAChB,IAAI8K,GAAW,EAAG,MAAM,IAAI,CAE9B,CAAC,EAKM,IAAII,GAAc,SAAUtd,EAAS,CAC3C,OAAO,IAAIkd,GAAYld,CAAO,CAC/B,EC7IA4Z,GAAQ,OAASQ,GACjBR,GAAQ,KAAOsC,GACftC,GAAQ,MAAQ2C,GAChB3C,GAAQ,YAAcsD,GAEtBnD,GAAQ,OAASkC,GACjBlC,GAAQ,KAAOpT,GACfoT,GAAQ,MAAQlT,GAChBkT,GAAQ,YAAcuD,GCHZ,IAACC,GAAU7b,EAAM,OAAO,CACjC,WAAY,SAAUmY,EAAK,CAC1B,KAAK,KAAOA,CACd,EAIC,OAAQ,UAAY,CACnB,OAAI,KAAK,SAAmB,MAE5B,KAAK,SAAW,GAChB,KAAK,SAAQ,EACN,KACT,EAIC,QAAS,UAAY,CACpB,OAAK,KAAK,UAEV,KAAK,SAAW,GAChB,KAAK,YAAW,EACT,MAJsB,IAK/B,EAIC,QAAS,UAAY,CACpB,MAAO,CAAC,CAAC,KAAK,QAChB,CAQA,CAAC,EAKD0D,GAAQ,MAAQ,SAAU1D,EAAK7Y,EAAM,CACpC,OAAA6Y,EAAI,WAAW7Y,EAAM,IAAI,EAClB,IACR,EChDU,IAACwc,GAAQ,CAAC,OAAQlb,CAAM,ECe9Bmb,GAAQ/U,EAAQ,MAAQ,uBAAyB,YAE1CgV,GAAYna,EAAQ,OAAO,CAErC,QAAS,CAMR,eAAgB,CAClB,EAIC,WAAY,SAAUuM,EAAS6N,EAAiB9N,EAAgB7P,EAAS,CACxE6B,EAAgB,KAAM7B,CAAO,EAE7B,KAAK,SAAW8P,EAChB,KAAK,iBAAmB6N,GAAmB7N,EAC3C,KAAK,gBAAkBD,CACzB,EAIC,OAAQ,UAAY,CACf,KAAK,WAETP,EAAY,KAAK,iBAAkBmO,GAAO,KAAK,QAAS,IAAI,EAE5D,KAAK,SAAW,GAClB,EAIC,QAAS,UAAY,CACf,KAAK,WAINC,GAAU,YAAc,MAC3B,KAAK,WAAW,EAAI,EAGrBnO,GAAa,KAAK,iBAAkBkO,GAAO,KAAK,QAAS,IAAI,EAE7D,KAAK,SAAW,GAChB,KAAK,OAAS,GAChB,EAEC,QAAS,SAAUna,EAAG,CAGrB,GAAK,KAAK,WAEV,KAAK,OAAS,GAEVsa,CAAAA,GAAiB,KAAK,SAAU,mBAAmB,GAEvD,IAAIta,EAAE,SAAWA,EAAE,QAAQ,SAAW,EAAG,CAEpCoa,GAAU,YAAc,MAC3B,KAAK,WAAU,EAEhB,MACH,CAEE,GAAI,EAAAA,GAAU,WAAapa,EAAE,UAAcA,EAAE,QAAU,GAAOA,EAAE,SAAW,GAAM,CAACA,EAAE,WACpFoa,GAAU,UAAY,KAElB,KAAK,iBACR5F,GAAuB,KAAK,QAAQ,EAGrC+F,GAAwB,EACxBC,GAA4B,EAExB,MAAK,SAIT,MAAK,KAAK,MAAM,EAEhB,IAAIC,EAAQza,EAAE,QAAUA,EAAE,QAAQ,GAAKA,EACnC0a,EAAcC,GAA2B,KAAK,QAAQ,EAE1D,KAAK,YAAc,IAAIza,EAAMua,EAAM,QAASA,EAAM,OAAO,EACzD,KAAK,UAAYlM,GAAoB,KAAK,QAAQ,EAGlD,KAAK,aAAeqM,GAAiBF,CAAW,EAEhD,IAAIG,EAAa7a,EAAE,OAAS,YAC5BgM,EAAY,SAAU6O,EAAa,YAAc,YAAa,KAAK,QAAS,IAAI,EAChF7O,EAAY,SAAU6O,EAAa,UAAY,uBAAwB,KAAK,MAAO,IAAI,GACzF,EAEC,QAAS,SAAU7a,EAAG,CAGrB,GAAK,KAAK,SAEV,IAAIA,EAAE,SAAWA,EAAE,QAAQ,OAAS,EAAG,CACtC,KAAK,OAAS,GACd,MACH,CAEE,IAAIya,EAASza,EAAE,SAAWA,EAAE,QAAQ,SAAW,EAAIA,EAAE,QAAQ,GAAKA,EAC9DyL,EAAS,IAAIvL,EAAMua,EAAM,QAASA,EAAM,OAAO,EAAE,UAAU,KAAK,WAAW,EAE3E,CAAChP,EAAO,GAAK,CAACA,EAAO,GACrB,KAAK,IAAIA,EAAO,CAAC,EAAI,KAAK,IAAIA,EAAO,CAAC,EAAI,KAAK,QAAQ,iBAK3DA,EAAO,GAAK,KAAK,aAAa,EAC9BA,EAAO,GAAK,KAAK,aAAa,EAE9BzC,GAAwBhJ,CAAC,EAEpB,KAAK,SAGT,KAAK,KAAK,WAAW,EAErB,KAAK,OAAS,GAEd6P,EAAiB,SAAS,KAAM,kBAAkB,EAElD,KAAK,YAAc7P,EAAE,QAAUA,EAAE,WAG7B,OAAO,oBAAsB,KAAK,uBAAuB,OAAO,qBACnE,KAAK,YAAc,KAAK,YAAY,yBAErC6P,EAAiB,KAAK,YAAa,qBAAqB,GAGzD,KAAK,QAAU,KAAK,UAAU,IAAIpE,CAAM,EACxC,KAAK,QAAU,GAEf,KAAK,WAAazL,EAClB,KAAK,gBAAe,GACtB,EAEC,gBAAiB,UAAY,CAC5B,IAAIA,EAAI,CAAC,cAAe,KAAK,UAAU,EAKvC,KAAK,KAAK,UAAWA,CAAC,EACtB2O,GAAoB,KAAK,SAAU,KAAK,OAAO,EAI/C,KAAK,KAAK,OAAQ3O,CAAC,CACrB,EAEC,MAAO,UAAY,CAGb,KAAK,UACV,KAAK,WAAU,CACjB,EAEC,WAAY,SAAU8a,EAAW,CAChCjF,GAAoB,SAAS,KAAM,kBAAkB,EAEjD,KAAK,cACRA,GAAoB,KAAK,YAAa,qBAAqB,EAC3D,KAAK,YAAc,MAGpB5J,GAAa,SAAU,sBAAuB,KAAK,QAAS,IAAI,EAChEA,GAAa,SAAU,+BAAgC,KAAK,MAAO,IAAI,EAEvE8O,GAAuB,EACvBC,GAA2B,EAE3B,IAAIC,EAAc,KAAK,QAAU,KAAK,QAEtC,KAAK,QAAU,GACfb,GAAU,UAAY,GAElBa,GAGH,KAAK,KAAK,UAAW,CACpB,UAAWH,EACX,SAAU,KAAK,QAAQ,WAAW,KAAK,SAAS,CACpD,CAAI,CAEJ,CAEA,CAAC,EC5MM,SAASI,GAAYta,EAAQI,EAAQZ,EAAO,CAClD,IAAI+a,EACAC,EAAQ,CAAC,EAAG,EAAG,EAAG,CAAC,EACnB9gB,EAAGC,EAAG8gB,EACN3a,EAAGC,EACHnG,EAAKgL,EAAML,EAEf,IAAK7K,EAAI,EAAGE,EAAMoG,EAAO,OAAQtG,EAAIE,EAAKF,IACzCsG,EAAOtG,GAAG,MAAQghB,GAAqB1a,EAAOtG,GAAI0G,CAAM,EAIzD,IAAKqa,EAAI,EAAGA,EAAI,EAAGA,IAAK,CAIvB,IAHA7V,EAAO4V,EAAMC,GACbF,EAAgB,CAAA,EAEX7gB,EAAI,EAAGE,EAAMoG,EAAO,OAAQrG,EAAIC,EAAM,EAAGF,EAAIE,EAAKD,EAAID,IAC1DoG,EAAIE,EAAOtG,GACXqG,EAAIC,EAAOrG,GAGLmG,EAAE,MAAQ8E,EAUH7E,EAAE,MAAQ6E,IACtBL,EAAIoW,GAA8B5a,EAAGD,EAAG8E,EAAMxE,EAAQZ,CAAK,EAC3D+E,EAAE,MAAQmW,GAAqBnW,EAAGnE,CAAM,EACxCma,EAAc,KAAKhW,CAAC,IAXhBxE,EAAE,MAAQ6E,IACbL,EAAIoW,GAA8B5a,EAAGD,EAAG8E,EAAMxE,EAAQZ,CAAK,EAC3D+E,EAAE,MAAQmW,GAAqBnW,EAAGnE,CAAM,EACxCma,EAAc,KAAKhW,CAAC,GAErBgW,EAAc,KAAKza,CAAC,GAStBE,EAASua,CACX,CAEC,OAAOva,CACR,CAKO,SAAS4a,GAAc7Z,EAAS6R,EAAK,CAC3C,IAAIlZ,EAAGC,EAAGkhB,EAAIC,EAAIC,EAAGC,EAAMjgB,EAAGwE,EAAGuD,EAEjC,GAAI,CAAC/B,GAAWA,EAAQ,SAAW,EAClC,MAAM,IAAI,MAAM,oBAAoB,EAGhCka,GAAgBla,CAAO,IAC3B,QAAQ,KAAK,wDAAwD,EACrEA,EAAUA,EAAQ,IAGnB,IAAIma,EAAiB7Z,EAAS,CAAC,EAAG,CAAC,CAAC,EAEhCjB,EAASkB,GAAeP,CAAO,EAC/Boa,GAAa/a,EAAO,aAAY,EAAG,WAAWA,EAAO,aAAY,CAAE,EAAIA,EAAO,aAAY,EAAG,WAAWA,EAAO,aAAY,CAAE,EAE7H+a,GAAa,OAEhBD,EAAiBE,GAASra,CAAO,GAGlC,IAAInH,GAAMmH,EAAQ,OACdf,GAAS,CAAA,EACb,IAAKtG,EAAI,EAAGA,EAAIE,GAAKF,IAAK,CACzB,IAAI8I,GAASnB,EAASN,EAAQrH,EAAE,EAChCsG,GAAO,KAAK4S,EAAI,QAAQvR,EAAS,CAACmB,GAAO,IAAM0Y,EAAe,IAAK1Y,GAAO,IAAM0Y,EAAe,GAAG,CAAC,CAAC,CAAC,CACvG,CAKC,IAHAF,EAAOjgB,EAAIwE,EAAI,EAGV7F,EAAI,EAAGC,EAAIC,GAAM,EAAGF,EAAIE,GAAKD,EAAID,IACrCmhB,EAAK7a,GAAOtG,GACZohB,EAAK9a,GAAOrG,GAEZohB,EAAIF,EAAG,EAAIC,EAAG,EAAIA,EAAG,EAAID,EAAG,EAC5B9f,IAAM8f,EAAG,EAAIC,EAAG,GAAKC,EACrBxb,IAAMsb,EAAG,EAAIC,EAAG,GAAKC,EACrBC,GAAQD,EAAI,EAGTC,IAAS,EAEZlY,EAAS9C,GAAO,GAEhB8C,EAAS,CAAC/H,EAAIigB,EAAMzb,EAAIyb,CAAI,EAG7B,IAAIK,GAAezI,EAAI,UAAUhT,EAAQkD,CAAM,CAAC,EAChD,OAAOzB,EAAS,CAACga,GAAa,IAAMH,EAAe,IAAKG,GAAa,IAAMH,EAAe,GAAG,CAAC,CAC/F,CAKO,SAASE,GAASE,EAAQ,CAIhC,QAHIC,EAAS,EACTC,EAAS,EACT5hB,EAAM,EACDF,EAAI,EAAGA,EAAI4hB,EAAO,OAAQ5hB,IAAK,CACvC,IAAI8I,EAASnB,EAASia,EAAO5hB,EAAE,EAC/B6hB,GAAU/Y,EAAO,IACjBgZ,GAAUhZ,EAAO,IACjB5I,GACF,CACC,OAAOyH,EAAS,CAACka,EAAS3hB,EAAK4hB,EAAS5hB,CAAG,CAAC,CAC7C,qECxGO,SAAS6hB,GAASzb,EAAQ0b,EAAW,CAC3C,GAAI,CAACA,GAAa,CAAC1b,EAAO,OACzB,OAAOA,EAAO,MAAK,EAGpB,IAAI2b,EAAcD,EAAYA,EAG1B,OAAA1b,EAAS4b,GAAc5b,EAAQ2b,CAAW,EAG1C3b,EAAS6b,GAAY7b,EAAQ2b,CAAW,EAErC3b,CACR,CAIO,SAAS8b,GAAuBvX,EAAGsW,EAAIC,EAAI,CACjD,OAAO,KAAK,KAAKiB,GAAyBxX,EAAGsW,EAAIC,EAAI,EAAI,CAAC,CAC3D,CAIO,SAASkB,GAAsBzX,EAAGsW,EAAIC,EAAI,CAChD,OAAOiB,GAAyBxX,EAAGsW,EAAIC,CAAE,CAC1C,CAGA,SAASe,GAAY7b,EAAQ2b,EAAa,CAEzC,IAAI/hB,EAAMoG,EAAO,OACbic,EAAmB,OAAO,YAAe,OAAY,GAAK,WAAa,MACvEC,EAAU,IAAID,EAAiBriB,CAAG,EAElCsiB,EAAQ,GAAKA,EAAQtiB,EAAM,GAAK,EAEpCuiB,GAAgBnc,EAAQkc,EAASP,EAAa,EAAG/hB,EAAM,CAAC,EAExD,IAAIF,EACA0iB,EAAY,CAAA,EAEhB,IAAK1iB,EAAI,EAAGA,EAAIE,EAAKF,IAChBwiB,EAAQxiB,IACX0iB,EAAU,KAAKpc,EAAOtG,EAAE,EAI1B,OAAO0iB,CACR,CAEA,SAASD,GAAgBnc,EAAQkc,EAASP,EAAa9B,EAAOnR,EAAM,CAEnE,IAAI2T,EAAY,EAChBxd,EAAOnF,EAAG4iB,EAEV,IAAK5iB,EAAImgB,EAAQ,EAAGngB,GAAKgP,EAAO,EAAGhP,IAClC4iB,EAASP,GAAyB/b,EAAOtG,GAAIsG,EAAO6Z,GAAQ7Z,EAAO0I,GAAO,EAAI,EAE1E4T,EAASD,IACZxd,EAAQnF,EACR2iB,EAAYC,GAIVD,EAAYV,IACfO,EAAQrd,GAAS,EAEjBsd,GAAgBnc,EAAQkc,EAASP,EAAa9B,EAAOhb,CAAK,EAC1Dsd,GAAgBnc,EAAQkc,EAASP,EAAa9c,EAAO6J,CAAI,EAE3D,CAGA,SAASkT,GAAc5b,EAAQ2b,EAAa,CAG3C,QAFIY,EAAgB,CAACvc,EAAO,EAAE,EAErBtG,EAAI,EAAG8iB,EAAO,EAAG5iB,EAAMoG,EAAO,OAAQtG,EAAIE,EAAKF,IACnD+iB,GAAQzc,EAAOtG,GAAIsG,EAAOwc,EAAK,EAAIb,IACtCY,EAAc,KAAKvc,EAAOtG,EAAE,EAC5B8iB,EAAO9iB,GAGT,OAAI8iB,EAAO5iB,EAAM,GAChB2iB,EAAc,KAAKvc,EAAOpG,EAAM,EAAE,EAE5B2iB,CACR,CAEA,IAAIG,GAOG,SAASC,GAAY7c,EAAGC,EAAGK,EAAQwc,EAAapd,EAAO,CAC7D,IAAIqd,EAAQD,EAAcF,GAAYI,GAAYhd,EAAGM,CAAM,EACvD2c,EAAQD,GAAY/c,EAAGK,CAAM,EAE7B4c,EAASzY,EAAG0Y,EAKhB,IAFIP,GAAYK,IAEH,CAEZ,GAAI,EAAEF,EAAQE,GACb,MAAO,CAACjd,EAAGC,CAAC,EAIb,GAAI8c,EAAQE,EACX,MAAO,GAIRC,EAAUH,GAASE,EACnBxY,EAAI2Y,GAAqBpd,EAAGC,EAAGid,EAAS5c,EAAQZ,CAAK,EACrDyd,EAAUH,GAAYvY,EAAGnE,CAAM,EAE3B4c,IAAYH,GACf/c,EAAIyE,EACJsY,EAAQI,IAERld,EAAIwE,EACJwY,EAAQE,EAEX,CACA,CAEO,SAASC,GAAqBpd,EAAGC,EAAGod,EAAM/c,EAAQZ,EAAO,CAC/D,IAAIqV,EAAK9U,EAAE,EAAID,EAAE,EACbgV,EAAK/U,EAAE,EAAID,EAAE,EACb3E,EAAMiF,EAAO,IACblF,EAAMkF,EAAO,IACbrF,EAAGwE,EAEP,OAAI4d,EAAO,GACVpiB,EAAI+E,EAAE,EAAI+U,GAAM3Z,EAAI,EAAI4E,EAAE,GAAKgV,EAC/BvV,EAAIrE,EAAI,GAEEiiB,EAAO,GACjBpiB,EAAI+E,EAAE,EAAI+U,GAAM1Z,EAAI,EAAI2E,EAAE,GAAKgV,EAC/BvV,EAAIpE,EAAI,GAEEgiB,EAAO,GACjBpiB,EAAIG,EAAI,EACRqE,EAAIO,EAAE,EAAIgV,GAAM5Z,EAAI,EAAI4E,EAAE,GAAK+U,GAErBsI,EAAO,IACjBpiB,EAAII,EAAI,EACRoE,EAAIO,EAAE,EAAIgV,GAAM3Z,EAAI,EAAI2E,EAAE,GAAK+U,GAGzB,IAAIvV,EAAMvE,EAAGwE,EAAGC,CAAK,CAC7B,CAEO,SAASsd,GAAYvY,EAAGnE,EAAQ,CACtC,IAAI+c,EAAO,EAEX,OAAI5Y,EAAE,EAAInE,EAAO,IAAI,EACpB+c,GAAQ,EACE5Y,EAAE,EAAInE,EAAO,IAAI,IAC3B+c,GAAQ,GAGL5Y,EAAE,EAAInE,EAAO,IAAI,EACpB+c,GAAQ,EACE5Y,EAAE,EAAInE,EAAO,IAAI,IAC3B+c,GAAQ,GAGFA,CACR,CAGA,SAASV,GAAQ5B,EAAIC,EAAI,CACxB,IAAIjG,EAAKiG,EAAG,EAAID,EAAG,EACf/F,EAAKgG,EAAG,EAAID,EAAG,EACnB,OAAOhG,EAAKA,EAAKC,EAAKA,CACvB,CAGO,SAASiH,GAAyBxX,EAAGsW,EAAIC,EAAIwB,EAAQ,CAC3D,IAAIvhB,EAAI8f,EAAG,EACPtb,EAAIsb,EAAG,EACPhG,EAAKiG,EAAG,EAAI/f,EACZ+Z,EAAKgG,EAAG,EAAIvb,EACZ6d,EAAMvI,EAAKA,EAAKC,EAAKA,EACrB7G,EAEJ,OAAImP,EAAM,IACTnP,IAAM1J,EAAE,EAAIxJ,GAAK8Z,GAAMtQ,EAAE,EAAIhF,GAAKuV,GAAMsI,EAEpCnP,EAAI,GACPlT,EAAI+f,EAAG,EACPvb,EAAIub,EAAG,GACG7M,EAAI,IACdlT,GAAK8Z,EAAK5G,EACV1O,GAAKuV,EAAK7G,IAIZ4G,EAAKtQ,EAAE,EAAIxJ,EACX+Z,EAAKvQ,EAAE,EAAIhF,EAEJ+c,EAASzH,EAAKA,EAAKC,EAAKA,EAAK,IAAIxV,EAAMvE,EAAGwE,CAAC,CACnD,CAKO,SAAS8d,GAAOtc,EAAS,CAC/B,MAAO,CAAC5C,EAAa4C,EAAQ,EAAE,GAAM,OAAOA,EAAQ,GAAG,IAAO,UAAY,OAAOA,EAAQ,GAAG,GAAO,GACpG,CAEO,SAASuc,GAAMvc,EAAS,CAC9B,eAAQ,KAAK,gEAAgE,EACtEsc,GAAOtc,CAAO,CACtB,CAKO,SAASwc,GAAexc,EAAS6R,EAAK,CAC5C,IAAIlZ,EAAG8jB,EAAUC,EAASC,EAAM7C,EAAIC,EAAIjC,EAAO/V,EAE/C,GAAI,CAAC/B,GAAWA,EAAQ,SAAW,EAClC,MAAM,IAAI,MAAM,oBAAoB,EAGhCsc,GAAOtc,CAAO,IAClB,QAAQ,KAAK,wDAAwD,EACrEA,EAAUA,EAAQ,IAGnB,IAAIma,EAAiB7Z,EAAS,CAAC,EAAG,CAAC,CAAC,EAEhCjB,EAASkB,GAAeP,CAAO,EAC/Boa,EAAa/a,EAAO,aAAY,EAAG,WAAWA,EAAO,aAAY,CAAE,EAAIA,EAAO,aAAY,EAAG,WAAWA,EAAO,aAAY,CAAE,EAE7H+a,EAAa,OAEhBD,EAAiBE,GAASra,CAAO,GAGlC,IAAInH,GAAMmH,EAAQ,OACdf,GAAS,CAAA,EACb,IAAKtG,EAAI,EAAGA,EAAIE,GAAKF,IAAK,CACzB,IAAI8I,GAASnB,EAASN,EAAQrH,EAAE,EAChCsG,GAAO,KAAK4S,EAAI,QAAQvR,EAAS,CAACmB,GAAO,IAAM0Y,EAAe,IAAK1Y,GAAO,IAAM0Y,EAAe,GAAG,CAAC,CAAC,CAAC,CACvG,CAEC,IAAKxhB,EAAI,EAAG8jB,EAAW,EAAG9jB,EAAIE,GAAM,EAAGF,IACtC8jB,GAAYxd,GAAOtG,GAAG,WAAWsG,GAAOtG,EAAI,EAAE,EAAI,EAInD,GAAI8jB,IAAa,EAChB1a,EAAS9C,GAAO,OAEhB,KAAKtG,EAAI,EAAGgkB,EAAO,EAAGhkB,EAAIE,GAAM,EAAGF,IAMlC,GALAmhB,EAAK7a,GAAOtG,GACZohB,EAAK9a,GAAOtG,EAAI,GAChB+jB,EAAU5C,EAAG,WAAWC,CAAE,EAC1B4C,GAAQD,EAEJC,EAAOF,EAAU,CACpB3E,GAAS6E,EAAOF,GAAYC,EAC5B3a,EAAS,CACRgY,EAAG,EAAIjC,GAASiC,EAAG,EAAID,EAAG,GAC1BC,EAAG,EAAIjC,GAASiC,EAAG,EAAID,EAAG,EAC/B,EACI,KACJ,CAIC,IAAIQ,GAAezI,EAAI,UAAUhT,EAAQkD,CAAM,CAAC,EAChD,OAAOzB,EAAS,CAACga,GAAa,IAAMH,EAAe,IAAKG,GAAa,IAAMH,EAAe,GAAG,CAAC,CAC/F,+MChSWyC,GAAS,CACnB,QAAS,SAAUnb,EAAQ,CAC1B,OAAO,IAAIlD,EAAMkD,EAAO,IAAKA,EAAO,GAAG,CACzC,EAEC,UAAW,SAAU7C,EAAO,CAC3B,OAAO,IAAIyB,GAAOzB,EAAM,EAAGA,EAAM,CAAC,CACpC,EAEC,OAAQ,IAAIE,GAAO,CAAC,KAAM,GAAG,EAAG,CAAC,IAAK,EAAE,CAAC,CAC1C,EChBW+d,GAAW,CACrB,EAAG,QACH,QAAS,oBAET,OAAQ,IAAI/d,GAAO,CAAC,kBAAiB,iBAAe,EAAG,CAAC,iBAAgB,gBAAc,CAAC,EAEvF,QAAS,SAAU2C,EAAQ,CAC1B,IAAIpH,EAAI,KAAK,GAAK,IACdyU,EAAI,KAAK,EACTtQ,EAAIiD,EAAO,IAAMpH,EACjByiB,EAAM,KAAK,QAAUhO,EACrBzQ,EAAI,KAAK,KAAK,EAAIye,EAAMA,CAAG,EAC3BC,EAAM1e,EAAI,KAAK,IAAIG,CAAC,EAEpBwe,EAAK,KAAK,IAAI,KAAK,GAAK,EAAIxe,EAAI,CAAC,EAAI,KAAK,KAAK,EAAIue,IAAQ,EAAIA,GAAM1e,EAAI,CAAC,EAC9E,OAAAG,EAAI,CAACsQ,EAAI,KAAK,IAAI,KAAK,IAAIkO,EAAI,KAAK,CAAC,EAE9B,IAAIze,EAAMkD,EAAO,IAAMpH,EAAIyU,EAAGtQ,CAAC,CACxC,EAEC,UAAW,SAAUI,EAAO,CAQ3B,QAPIvE,EAAI,IAAM,KAAK,GACfyU,EAAI,KAAK,EACTgO,EAAM,KAAK,QAAUhO,EACrBzQ,EAAI,KAAK,KAAK,EAAIye,EAAMA,CAAG,EAC3BE,EAAK,KAAK,IAAI,CAACpe,EAAM,EAAIkQ,CAAC,EAC1BmO,EAAM,KAAK,GAAK,EAAI,EAAI,KAAK,KAAKD,CAAE,EAE/BrkB,EAAI,EAAGukB,EAAO,GAAKH,EAAKpkB,EAAI,IAAM,KAAK,IAAIukB,CAAI,EAAI,KAAMvkB,IACjEokB,EAAM1e,EAAI,KAAK,IAAI4e,CAAG,EACtBF,EAAM,KAAK,KAAK,EAAIA,IAAQ,EAAIA,GAAM1e,EAAI,CAAC,EAC3C6e,EAAO,KAAK,GAAK,EAAI,EAAI,KAAK,KAAKF,EAAKD,CAAG,EAAIE,EAC/CA,GAAOC,EAGR,OAAO,IAAI7c,GAAO4c,EAAM5iB,EAAGuE,EAAM,EAAIvE,EAAIyU,CAAC,CAC5C,CACA,iEErCWqO,GAAWpgB,EAAY,CAAA,EAAIoE,GAAO,CAC5C,KAAM,YACN,WAAY0b,GAEZ,eAAiB,UAAY,CAC5B,IAAIjb,EAAQ,IAAO,KAAK,GAAKib,GAAS,GACtC,OAAO7Z,GAAiBpB,EAAO,GAAK,CAACA,EAAO,EAAG,CACjD,EAAE,CACF,CAAC,ECDUwb,GAAWrgB,EAAY,CAAA,EAAIoE,GAAO,CAC5C,KAAM,YACN,WAAYyb,GACZ,eAAgB5Z,GAAiB,EAAI,IAAK,EAAG,GAAK,IAAK,EAAG,CAC3D,CAAC,ECPUqa,GAAStgB,EAAY,CAAA,EAAIyE,GAAK,CACxC,WAAYob,GACZ,eAAgB5Z,GAAiB,EAAG,EAAG,GAAI,CAAC,EAE5C,MAAO,SAAUtB,EAAM,CACtB,OAAO,KAAK,IAAI,EAAGA,CAAI,CACzB,EAEC,KAAM,SAAUE,EAAO,CACtB,OAAO,KAAK,IAAIA,CAAK,EAAI,KAAK,GAChC,EAEC,SAAU,SAAUS,EAASC,EAAS,CACrC,IAAIwR,EAAKxR,EAAQ,IAAMD,EAAQ,IAC3B0R,EAAKzR,EAAQ,IAAMD,EAAQ,IAE/B,OAAO,KAAK,KAAKyR,EAAKA,EAAKC,EAAKA,CAAE,CACpC,EAEC,SAAU,EACX,CAAC,EC5BDvS,GAAI,MAAQL,GACZK,GAAI,SAAW2b,GACf3b,GAAI,SAAWyB,GACfzB,GAAI,WAAa0B,GACjB1B,GAAI,SAAW4b,GACf5b,GAAI,OAAS6b,GCiBH,IAACC,GAAQhf,EAAQ,OAAO,CAGjC,QAAS,CAGR,KAAM,cAIN,YAAa,KAEb,oBAAqB,EACvB,EAQC,MAAO,SAAUsW,EAAK,CACrB,OAAAA,EAAI,SAAS,IAAI,EACV,IACT,EAIC,OAAQ,UAAY,CACnB,OAAO,KAAK,WAAW,KAAK,MAAQ,KAAK,SAAS,CACpD,EAQC,WAAY,SAAUxb,EAAK,CAC1B,OAAIA,GACHA,EAAI,YAAY,IAAI,EAEd,IACT,EAIC,QAAS,SAAU2C,EAAM,CACxB,OAAO,KAAK,KAAK,QAAQA,EAAQ,KAAK,QAAQA,IAASA,EAAQ,KAAK,QAAQ,IAAI,CAClF,EAEC,qBAAsB,SAAUwhB,EAAU,CACzC,YAAK,KAAK,SAASnf,EAAWmf,CAAQ,GAAK,KACpC,IACT,EAEC,wBAAyB,SAAUA,EAAU,CAC5C,cAAO,KAAK,KAAK,SAASnf,EAAWmf,CAAQ,GACtC,IACT,EAIC,eAAgB,UAAY,CAC3B,OAAO,KAAK,QAAQ,WACtB,EAEC,UAAW,SAAUlf,EAAG,CACvB,IAAIuW,EAAMvW,EAAE,OAGZ,GAAKuW,EAAI,SAAS,IAAI,EAKtB,IAHA,KAAK,KAAOA,EACZ,KAAK,cAAgBA,EAAI,cAErB,KAAK,UAAW,CACnB,IAAI4I,EAAS,KAAK,UAAS,EAC3B5I,EAAI,GAAG4I,EAAQ,IAAI,EACnB,KAAK,KAAK,SAAU,UAAY,CAC/B5I,EAAI,IAAI4I,EAAQ,IAAI,CACxB,EAAM,IAAI,CACV,CAEE,KAAK,MAAM5I,CAAG,EAEd,KAAK,KAAK,KAAK,EACfA,EAAI,KAAK,WAAY,CAAC,MAAO,IAAI,CAAC,EACpC,CACA,CAAC,EAmCDzH,EAAI,QAAQ,CAGX,SAAU,SAAUuI,EAAO,CAC1B,GAAI,CAACA,EAAM,UACV,MAAM,IAAI,MAAM,qCAAqC,EAGtD,IAAIrZ,EAAK+B,EAAWsX,CAAK,EACzB,OAAI,KAAK,QAAQrZ,GAAc,MAC/B,KAAK,QAAQA,GAAMqZ,EAEnBA,EAAM,UAAY,KAEdA,EAAM,WACTA,EAAM,UAAU,IAAI,EAGrB,KAAK,UAAUA,EAAM,UAAWA,CAAK,EAE9B,KACT,EAIC,YAAa,SAAUA,EAAO,CAC7B,IAAIrZ,EAAK+B,EAAWsX,CAAK,EAEzB,OAAK,KAAK,QAAQrZ,IAEd,KAAK,SACRqZ,EAAM,SAAS,IAAI,EAGpB,OAAO,KAAK,QAAQrZ,GAEhB,KAAK,UACR,KAAK,KAAK,cAAe,CAAC,MAAOqZ,CAAK,CAAC,EACvCA,EAAM,KAAK,QAAQ,GAGpBA,EAAM,KAAOA,EAAM,UAAY,KAExB,MAfyB,IAgBlC,EAIC,SAAU,SAAUA,EAAO,CAC1B,OAAOtX,EAAWsX,CAAK,IAAK,KAAK,OACnC,EAUC,UAAW,SAAU+H,EAAQ9jB,EAAS,CACrC,QAAShB,KAAK,KAAK,QAClB8kB,EAAO,KAAK9jB,EAAS,KAAK,QAAQhB,EAAE,EAErC,OAAO,IACT,EAEC,WAAY,SAAUqe,EAAQ,CAC7BA,EAASA,EAAU5Z,EAAa4Z,CAAM,EAAIA,EAAS,CAACA,CAAM,EAAK,CAAA,EAE/D,QAASre,EAAI,EAAGE,EAAMme,EAAO,OAAQre,EAAIE,EAAKF,IAC7C,KAAK,SAASqe,EAAOre,EAAE,CAE1B,EAEC,cAAe,SAAU+c,EAAO,EAC3B,CAAC,MAAMA,EAAM,QAAQ,OAAO,GAAK,CAAC,MAAMA,EAAM,QAAQ,OAAO,KAChE,KAAK,iBAAiBtX,EAAWsX,CAAK,GAAKA,EAC3C,KAAK,kBAAiB,EAEzB,EAEC,iBAAkB,SAAUA,EAAO,CAClC,IAAIrZ,EAAK+B,EAAWsX,CAAK,EAErB,KAAK,iBAAiBrZ,KACzB,OAAO,KAAK,iBAAiBA,GAC7B,KAAK,kBAAiB,EAEzB,EAEC,kBAAmB,UAAY,CAC9B,IAAIqhB,EAAU,IACVC,EAAU,KACVC,EAAc,KAAK,aAAY,EAEnC,QAASjlB,KAAK,KAAK,iBAAkB,CACpC,IAAIoC,EAAU,KAAK,iBAAiBpC,GAAG,QAEvC+kB,EAAU3iB,EAAQ,UAAY,OAAY2iB,EAAU,KAAK,IAAIA,EAAS3iB,EAAQ,OAAO,EACrF4iB,EAAU5iB,EAAQ,UAAY,OAAY4iB,EAAU,KAAK,IAAIA,EAAS5iB,EAAQ,OAAO,CACxF,CAEE,KAAK,eAAiB4iB,IAAY,KAAY,OAAYA,EAC1D,KAAK,eAAiBD,IAAY,IAAW,OAAYA,EAMrDE,IAAgB,KAAK,aAAY,GACpC,KAAK,KAAK,kBAAkB,EAGzB,KAAK,QAAQ,UAAY,QAAa,KAAK,gBAAkB,KAAK,QAAO,EAAK,KAAK,gBACtF,KAAK,QAAQ,KAAK,cAAc,EAE7B,KAAK,QAAQ,UAAY,QAAa,KAAK,gBAAkB,KAAK,QAAO,EAAK,KAAK,gBACtF,KAAK,QAAQ,KAAK,cAAc,CAEnC,CACA,CAAC,EC5PS,IAACC,GAAaP,GAAM,OAAO,CAEpC,WAAY,SAAUtG,EAAQjc,EAAS,CACtC6B,EAAgB,KAAM7B,CAAO,EAE7B,KAAK,QAAU,CAAA,EAEf,IAAIpC,EAAGE,EAEP,GAAIme,EACH,IAAKre,EAAI,EAAGE,EAAMme,EAAO,OAAQre,EAAIE,EAAKF,IACzC,KAAK,SAASqe,EAAOre,EAAE,CAG3B,EAIC,SAAU,SAAU+c,EAAO,CAC1B,IAAIrZ,EAAK,KAAK,WAAWqZ,CAAK,EAE9B,YAAK,QAAQrZ,GAAMqZ,EAEf,KAAK,MACR,KAAK,KAAK,SAASA,CAAK,EAGlB,IACT,EAOC,YAAa,SAAUA,EAAO,CAC7B,IAAIrZ,EAAKqZ,KAAS,KAAK,QAAUA,EAAQ,KAAK,WAAWA,CAAK,EAE9D,OAAI,KAAK,MAAQ,KAAK,QAAQrZ,IAC7B,KAAK,KAAK,YAAY,KAAK,QAAQA,EAAG,EAGvC,OAAO,KAAK,QAAQA,GAEb,IACT,EAOC,SAAU,SAAUqZ,EAAO,CAC1B,IAAIoI,EAAU,OAAOpI,GAAU,SAAWA,EAAQ,KAAK,WAAWA,CAAK,EACvE,OAAOoI,KAAW,KAAK,OACzB,EAIC,YAAa,UAAY,CACxB,OAAO,KAAK,UAAU,KAAK,YAAa,IAAI,CAC9C,EAMC,OAAQ,SAAUC,EAAY,CAC7B,IAAIzkB,EAAO,MAAM,UAAU,MAAM,KAAK,UAAW,CAAC,EAC9CX,EAAG+c,EAEP,IAAK/c,KAAK,KAAK,QACd+c,EAAQ,KAAK,QAAQ/c,GAEjB+c,EAAMqI,IACTrI,EAAMqI,GAAY,MAAMrI,EAAOpc,CAAI,EAIrC,OAAO,IACT,EAEC,MAAO,SAAUsb,EAAK,CACrB,KAAK,UAAUA,EAAI,SAAUA,CAAG,CAClC,EAEC,SAAU,SAAUA,EAAK,CACxB,KAAK,UAAUA,EAAI,YAAaA,CAAG,CACrC,EASC,UAAW,SAAU6I,EAAQ9jB,EAAS,CACrC,QAAShB,KAAK,KAAK,QAClB8kB,EAAO,KAAK9jB,EAAS,KAAK,QAAQhB,EAAE,EAErC,OAAO,IACT,EAIC,SAAU,SAAU0D,EAAI,CACvB,OAAO,KAAK,QAAQA,EACtB,EAIC,UAAW,UAAY,CACtB,IAAI2a,EAAS,CAAA,EACb,YAAK,UAAUA,EAAO,KAAMA,CAAM,EAC3BA,CACT,EAIC,UAAW,SAAUgH,EAAQ,CAC5B,OAAO,KAAK,OAAO,YAAaA,CAAM,CACxC,EAIC,WAAY,SAAUtI,EAAO,CAC5B,OAAOtX,EAAWsX,CAAK,CACzB,CACA,CAAC,EAKUuI,GAAa,SAAUjH,EAAQjc,EAAS,CAClD,OAAO,IAAI8iB,GAAW7G,EAAQjc,CAAO,CACtC,ECrIWmjB,GAAeL,GAAW,OAAO,CAE3C,SAAU,SAAUnI,EAAO,CAC1B,OAAI,KAAK,SAASA,CAAK,EACf,MAGRA,EAAM,eAAe,IAAI,EAEzBmI,GAAW,UAAU,SAAS,KAAK,KAAMnI,CAAK,EAIvC,KAAK,KAAK,WAAY,CAAC,MAAOA,CAAK,CAAC,EAC7C,EAEC,YAAa,SAAUA,EAAO,CAC7B,OAAK,KAAK,SAASA,CAAK,GAGpBA,KAAS,KAAK,UACjBA,EAAQ,KAAK,QAAQA,IAGtBA,EAAM,kBAAkB,IAAI,EAE5BmI,GAAW,UAAU,YAAY,KAAK,KAAMnI,CAAK,EAI1C,KAAK,KAAK,cAAe,CAAC,MAAOA,CAAK,CAAC,GAZtC,IAaV,EAIC,SAAU,SAAUhS,EAAO,CAC1B,OAAO,KAAK,OAAO,WAAYA,CAAK,CACtC,EAIC,aAAc,UAAY,CACzB,OAAO,KAAK,OAAO,cAAc,CACnC,EAIC,YAAa,UAAY,CACxB,OAAO,KAAK,OAAO,aAAa,CAClC,EAIC,UAAW,UAAY,CACtB,IAAIrE,EAAS,IAAIQ,GAEjB,QAASxD,KAAM,KAAK,QAAS,CAC5B,IAAIqZ,EAAQ,KAAK,QAAQrZ,GACzBgD,EAAO,OAAOqW,EAAM,UAAYA,EAAM,UAAS,EAAKA,EAAM,UAAS,CAAE,CACxE,CACE,OAAOrW,CACT,CACA,CAAC,EAIU8e,GAAe,SAAUnH,EAAQjc,EAAS,CACpD,OAAO,IAAImjB,GAAalH,EAAQjc,CAAO,CACxC,EC5DWqjB,GAAO3hB,EAAM,OAAO,CA0C9B,QAAS,CACR,YAAa,CAAC,EAAG,CAAC,EAClB,cAAe,CAAC,EAAG,CAAC,EAMpB,YAAa,EACf,EAEC,WAAY,SAAU1B,EAAS,CAC9BD,EAAW,KAAMC,CAAO,CAC1B,EAKC,WAAY,SAAUsjB,EAAS,CAC9B,OAAO,KAAK,YAAY,OAAQA,CAAO,CACzC,EAIC,aAAc,SAAUA,EAAS,CAChC,OAAO,KAAK,YAAY,SAAUA,CAAO,CAC3C,EAEC,YAAa,SAAUtiB,EAAMsiB,EAAS,CACrC,IAAIvlB,EAAM,KAAK,YAAYiD,CAAI,EAE/B,GAAI,CAACjD,EAAK,CACT,GAAIiD,IAAS,OACZ,MAAM,IAAI,MAAM,iDAAiD,EAElE,OAAO,IACV,CAEE,IAAIuiB,EAAM,KAAK,WAAWxlB,EAAKulB,GAAWA,EAAQ,UAAY,MAAQA,EAAU,IAAI,EACpF,YAAK,eAAeC,EAAKviB,CAAI,GAEzB,KAAK,QAAQ,aAAe,KAAK,QAAQ,cAAgB,MAC5DuiB,EAAI,YAAc,KAAK,QAAQ,cAAgB,GAAO,GAAK,KAAK,QAAQ,aAGlEA,CACT,EAEC,eAAgB,SAAUA,EAAKviB,EAAM,CACpC,IAAIhB,EAAU,KAAK,QACfwjB,EAAaxjB,EAAQgB,EAAO,QAE5B,OAAOwiB,GAAe,WACzBA,EAAa,CAACA,EAAYA,CAAU,GAGrC,IAAIhQ,EAAO3P,EAAM2f,CAAU,EACvBC,EAAS5f,EAAM7C,IAAS,UAAYhB,EAAQ,cAAgBA,EAAQ,YAC5DwT,GAAQA,EAAK,SAAS,EAAG,EAAI,CAAC,EAE1C+P,EAAI,UAAY,kBAAoBviB,EAAO,KAAOhB,EAAQ,WAAa,IAEnEyjB,IACHF,EAAI,MAAM,WAAc,CAACE,EAAO,EAAK,KACrCF,EAAI,MAAM,UAAc,CAACE,EAAO,EAAK,MAGlCjQ,IACH+P,EAAI,MAAM,MAAS/P,EAAK,EAAI,KAC5B+P,EAAI,MAAM,OAAS/P,EAAK,EAAI,KAE/B,EAEC,WAAY,SAAUzV,EAAK8C,EAAI,CAC9B,OAAAA,EAAKA,GAAM,SAAS,cAAc,KAAK,EACvCA,EAAG,IAAM9C,EACF8C,CACT,EAEC,YAAa,SAAUG,EAAM,CAC5B,OAAO0H,EAAQ,QAAU,KAAK,QAAQ1H,EAAO,cAAgB,KAAK,QAAQA,EAAO,MACnF,CACA,CAAC,EAKM,SAAS0iB,GAAK1jB,EAAS,CAC7B,OAAO,IAAIqjB,GAAKrjB,CAAO,CACxB,CCjJO,IAAI2jB,GAAcN,GAAK,OAAO,CAEpC,QAAS,CACR,QAAe,kBACf,cAAe,qBACf,UAAe,oBACf,SAAa,CAAC,GAAI,EAAE,EACpB,WAAa,CAAC,GAAI,EAAE,EACpB,YAAa,CAAC,EAAG,GAAG,EACpB,cAAe,CAAC,GAAI,GAAG,EACvB,WAAa,CAAC,GAAI,EAAE,CACtB,EAEC,YAAa,SAAUriB,EAAM,CAC5B,OAAI,OAAO2iB,GAAY,WAAc,WACpCA,GAAY,UAAY,KAAK,gBAAe,IAOrC,KAAK,QAAQ,WAAaA,GAAY,WAAaN,GAAK,UAAU,YAAY,KAAK,KAAMriB,CAAI,CACvG,EAEC,UAAW,SAAU+L,EAAM,CAC1B,IAAI6W,EAAQ,SAAU/jB,EAAKgkB,EAAIC,EAAK,CACnC,IAAIC,EAAQF,EAAG,KAAKhkB,CAAG,EACvB,OAAOkkB,GAASA,EAAMD,EACzB,EACE,OAAA/W,EAAO6W,EAAM7W,EAAM,yBAA0B,CAAC,EACvCA,GAAQ6W,EAAM7W,EAAM,yBAA0B,CAAC,CACxD,EAEC,gBAAiB,UAAY,CAC5B,IAAIlM,EAAKqV,EAAe,MAAQ,4BAA6B,SAAS,IAAI,EACtEnJ,EAAOoK,GAAiBtW,EAAI,kBAAkB,GACvCsW,GAAiBtW,EAAI,iBAAiB,EAIjD,GAFA,SAAS,KAAK,YAAYA,CAAE,EAC5BkM,EAAO,KAAK,UAAUA,CAAI,EACtBA,EAAQ,OAAOA,EACnB,IAAIkO,EAAO,SAAS,cAAc,2BAA2B,EAC7D,OAAKA,EACEA,EAAK,KAAK,UAAU,EAAGA,EAAK,KAAK,OAAS,GAAuB,CAAC,EADrD,EAEtB,CACA,CAAC,ECxCU+I,GAAazG,GAAQ,OAAO,CACtC,WAAY,SAAU0G,EAAQ,CAC7B,KAAK,QAAUA,CACjB,EAEC,SAAU,UAAY,CACrB,IAAIP,EAAO,KAAK,QAAQ,MAEnB,KAAK,aACT,KAAK,WAAa,IAAIhG,GAAUgG,EAAMA,EAAM,EAAI,GAGjD,KAAK,WAAW,GAAG,CAClB,UAAW,KAAK,aAChB,QAAS,KAAK,WACd,KAAM,KAAK,QACX,QAAS,KAAK,UACjB,EAAK,IAAI,EAAE,OAAM,EAEfvQ,EAAiBuQ,EAAM,0BAA0B,CACnD,EAEC,YAAa,UAAY,CACxB,KAAK,WAAW,IAAI,CACnB,UAAW,KAAK,aAChB,QAAS,KAAK,WACd,KAAM,KAAK,QACX,QAAS,KAAK,UACjB,EAAK,IAAI,EAAE,QAAO,EAEZ,KAAK,QAAQ,OAChBvK,GAAoB,KAAK,QAAQ,MAAO,0BAA0B,CAErE,EAEC,MAAO,UAAY,CAClB,OAAO,KAAK,YAAc,KAAK,WAAW,MAC5C,EAEC,WAAY,SAAU7V,EAAG,CACxB,IAAI2gB,EAAS,KAAK,QACdpK,EAAMoK,EAAO,KACbC,EAAQ,KAAK,QAAQ,QAAQ,aAC7B9N,EAAU,KAAK,QAAQ,QAAQ,eAC/B+N,EAAUtS,GAAoBoS,EAAO,KAAK,EAC1C3f,EAASuV,EAAI,eAAc,EAC3BuK,EAASvK,EAAI,eAAc,EAE3BwK,EAAYhgB,GACfC,EAAO,IAAI,UAAU8f,CAAM,EAAE,IAAIhO,CAAO,EACxC9R,EAAO,IAAI,UAAU8f,CAAM,EAAE,SAAShO,CAAO,CAChD,EAEE,GAAI,CAACiO,EAAU,SAASF,CAAO,EAAG,CAEjC,IAAIG,EAAWxgB,GACb,KAAK,IAAIugB,EAAU,IAAI,EAAGF,EAAQ,CAAC,EAAIE,EAAU,IAAI,IAAM/f,EAAO,IAAI,EAAI+f,EAAU,IAAI,IACxF,KAAK,IAAIA,EAAU,IAAI,EAAGF,EAAQ,CAAC,EAAIE,EAAU,IAAI,IAAM/f,EAAO,IAAI,EAAI+f,EAAU,IAAI,IAExF,KAAK,IAAIA,EAAU,IAAI,EAAGF,EAAQ,CAAC,EAAIE,EAAU,IAAI,IAAM/f,EAAO,IAAI,EAAI+f,EAAU,IAAI,IACxF,KAAK,IAAIA,EAAU,IAAI,EAAGF,EAAQ,CAAC,EAAIE,EAAU,IAAI,IAAM/f,EAAO,IAAI,EAAI+f,EAAU,IAAI,EAC7F,EAAK,WAAWH,CAAK,EAElBrK,EAAI,MAAMyK,EAAU,CAAC,QAAS,EAAK,CAAC,EAEpC,KAAK,WAAW,QAAQ,KAAKA,CAAQ,EACrC,KAAK,WAAW,UAAU,KAAKA,CAAQ,EAEvCrS,GAAoBgS,EAAO,MAAO,KAAK,WAAW,OAAO,EACzD,KAAK,QAAQ3gB,CAAC,EAEd,KAAK,YAAc/B,EAAiB,KAAK,WAAW,KAAK,KAAM+B,CAAC,CAAC,CACpE,CACA,EAEC,aAAc,UAAY,CAQzB,KAAK,WAAa,KAAK,QAAQ,UAAS,EAGxC,KAAK,QAAQ,YAAc,KAAK,QAAQ,WAAU,EAElD,KAAK,QACH,KAAK,WAAW,EAChB,KAAK,WAAW,CACpB,EAEC,WAAY,SAAUA,EAAG,CACpB,KAAK,QAAQ,QAAQ,UACxB7B,EAAgB,KAAK,WAAW,EAChC,KAAK,YAAcF,EAAiB,KAAK,WAAW,KAAK,KAAM+B,CAAC,CAAC,EAEpE,EAEC,QAAS,SAAUA,EAAG,CACrB,IAAI2gB,EAAS,KAAK,QACdM,EAASN,EAAO,QAChBE,EAAUtS,GAAoBoS,EAAO,KAAK,EAC1Cvd,EAASud,EAAO,KAAK,mBAAmBE,CAAO,EAG/CI,GACHtS,GAAoBsS,EAAQJ,CAAO,EAGpCF,EAAO,QAAUvd,EACjBpD,EAAE,OAASoD,EACXpD,EAAE,UAAY,KAAK,WAInB2gB,EACK,KAAK,OAAQ3gB,CAAC,EACd,KAAK,OAAQA,CAAC,CACrB,EAEC,WAAY,SAAUA,EAAG,CAIvB7B,EAAgB,KAAK,WAAW,EAIjC,OAAO,KAAK,WACZ,KAAK,QACA,KAAK,SAAS,EACd,KAAK,UAAW6B,CAAC,CACxB,CACA,CAAC,EC1IUkhB,GAASjC,GAAM,OAAO,CAIhC,QAAS,CAKR,KAAM,IAAIoB,GAGV,YAAa,GAIb,SAAU,GAKV,MAAO,GAKP,IAAK,SAIL,aAAc,EAId,QAAS,EAIT,YAAa,GAIb,WAAY,IAIZ,KAAM,aAIN,WAAY,aAKZ,oBAAqB,GAMrB,eAAgB,GAKhB,UAAW,GAIX,QAAS,GAKT,eAAgB,CAAC,GAAI,EAAE,EAIvB,aAAc,EAChB,EAOC,WAAY,SAAUjd,EAAQ1G,EAAS,CACtC6B,EAAgB,KAAM7B,CAAO,EAC7B,KAAK,QAAUykB,EAAO/d,CAAM,CAC9B,EAEC,MAAO,SAAUmT,EAAK,CACrB,KAAK,cAAgB,KAAK,eAAiBA,EAAI,QAAQ,oBAEnD,KAAK,eACRA,EAAI,GAAG,WAAY,KAAK,aAAc,IAAI,EAG3C,KAAK,UAAS,EACd,KAAK,OAAM,CACb,EAEC,SAAU,SAAUA,EAAK,CACpB,KAAK,UAAY,KAAK,SAAS,QAAO,IACzC,KAAK,QAAQ,UAAY,GACzB,KAAK,SAAS,YAAW,GAE1B,OAAO,KAAK,SAER,KAAK,eACRA,EAAI,IAAI,WAAY,KAAK,aAAc,IAAI,EAG5C,KAAK,YAAW,EAChB,KAAK,cAAa,CACpB,EAEC,UAAW,UAAY,CACtB,MAAO,CACN,KAAM,KAAK,OACX,UAAW,KAAK,MACnB,CACA,EAIC,UAAW,UAAY,CACtB,OAAO,KAAK,OACd,EAIC,UAAW,SAAUnT,EAAQ,CAC5B,IAAIge,EAAY,KAAK,QACrB,YAAK,QAAUD,EAAO/d,CAAM,EAC5B,KAAK,OAAM,EAIJ,KAAK,KAAK,OAAQ,CAAC,UAAWge,EAAW,OAAQ,KAAK,OAAO,CAAC,CACvE,EAIC,gBAAiB,SAAU3V,EAAQ,CAClC,YAAK,QAAQ,aAAeA,EACrB,KAAK,OAAM,CACpB,EAIC,QAAS,UAAY,CACpB,OAAO,KAAK,QAAQ,IACtB,EAIC,QAAS,SAAU2U,EAAM,CAExB,YAAK,QAAQ,KAAOA,EAEhB,KAAK,OACR,KAAK,UAAS,EACd,KAAK,OAAM,GAGR,KAAK,QACR,KAAK,UAAU,KAAK,OAAQ,KAAK,OAAO,OAAO,EAGzC,IACT,EAEC,WAAY,UAAY,CACvB,OAAO,KAAK,KACd,EAEC,OAAQ,UAAY,CAEnB,GAAI,KAAK,OAAS,KAAK,KAAM,CAC5B,IAAI1U,EAAM,KAAK,KAAK,mBAAmB,KAAK,OAAO,EAAE,MAAK,EAC1D,KAAK,QAAQA,CAAG,CACnB,CAEE,OAAO,IACT,EAEC,UAAW,UAAY,CACtB,IAAIhP,EAAU,KAAK,QACf2kB,EAAa,iBAAmB,KAAK,cAAgB,WAAa,QAElEjB,EAAO1jB,EAAQ,KAAK,WAAW,KAAK,KAAK,EACzC4kB,EAAU,GAGVlB,IAAS,KAAK,QACb,KAAK,OACR,KAAK,YAAW,EAEjBkB,EAAU,GAEN5kB,EAAQ,QACX0jB,EAAK,MAAQ1jB,EAAQ,OAGlB0jB,EAAK,UAAY,QACpBA,EAAK,IAAM1jB,EAAQ,KAAO,KAI5BmT,EAAiBuQ,EAAMiB,CAAU,EAE7B3kB,EAAQ,WACX0jB,EAAK,SAAW,IAChBA,EAAK,aAAa,OAAQ,QAAQ,GAGnC,KAAK,MAAQA,EAET1jB,EAAQ,aACX,KAAK,GAAG,CACP,UAAW,KAAK,cAChB,SAAU,KAAK,YACnB,CAAI,EAGE,KAAK,QAAQ,gBAChBsP,EAAYoU,EAAM,QAAS,KAAK,YAAa,IAAI,EAGlD,IAAImB,EAAY7kB,EAAQ,KAAK,aAAa,KAAK,OAAO,EAClD8kB,EAAY,GAEZD,IAAc,KAAK,UACtB,KAAK,cAAa,EAClBC,EAAY,IAGTD,IACH1R,EAAiB0R,EAAWF,CAAU,EACtCE,EAAU,IAAM,IAEjB,KAAK,QAAUA,EAGX7kB,EAAQ,QAAU,GACrB,KAAK,eAAc,EAIhB4kB,GACH,KAAK,QAAO,EAAG,YAAY,KAAK,KAAK,EAEtC,KAAK,iBAAgB,EACjBC,GAAaC,GAChB,KAAK,QAAQ9kB,EAAQ,UAAU,EAAE,YAAY,KAAK,OAAO,CAE5D,EAEC,YAAa,UAAY,CACpB,KAAK,QAAQ,aAChB,KAAK,IAAI,CACR,UAAW,KAAK,cAChB,SAAU,KAAK,YACnB,CAAI,EAGE,KAAK,QAAQ,gBAChBuP,GAAa,KAAK,MAAO,QAAS,KAAK,YAAa,IAAI,EAGzDyG,GAAe,KAAK,KAAK,EACzB,KAAK,wBAAwB,KAAK,KAAK,EAEvC,KAAK,MAAQ,IACf,EAEC,cAAe,UAAY,CACtB,KAAK,SACRA,GAAe,KAAK,OAAO,EAE5B,KAAK,QAAU,IACjB,EAEC,QAAS,SAAUhH,EAAK,CAEnB,KAAK,OACRiD,GAAoB,KAAK,MAAOjD,CAAG,EAGhC,KAAK,SACRiD,GAAoB,KAAK,QAASjD,CAAG,EAGtC,KAAK,QAAUA,EAAI,EAAI,KAAK,QAAQ,aAEpC,KAAK,aAAY,CACnB,EAEC,cAAe,SAAUD,EAAQ,CAC5B,KAAK,QACR,KAAK,MAAM,MAAM,OAAS,KAAK,QAAUA,EAE5C,EAEC,aAAc,SAAUgW,EAAK,CAC5B,IAAI/V,EAAM,KAAK,KAAK,uBAAuB,KAAK,QAAS+V,EAAI,KAAMA,EAAI,MAAM,EAAE,MAAK,EAEpF,KAAK,QAAQ/V,CAAG,CAClB,EAEC,iBAAkB,UAAY,CAE7B,GAAK,KAAK,QAAQ,cAElBmE,EAAiB,KAAK,MAAO,qBAAqB,EAElD,KAAK,qBAAqB,KAAK,KAAK,EAEhC6Q,IAAY,CACf,IAAIgB,EAAY,KAAK,QAAQ,UACzB,KAAK,WACRA,EAAY,KAAK,SAAS,QAAO,EACjC,KAAK,SAAS,QAAO,GAGtB,KAAK,SAAW,IAAIhB,GAAW,IAAI,EAE/BgB,GACH,KAAK,SAAS,OAAM,CAExB,CACA,EAIC,WAAY,SAAUC,EAAS,CAC9B,YAAK,QAAQ,QAAUA,EACnB,KAAK,MACR,KAAK,eAAc,EAGb,IACT,EAEC,eAAgB,UAAY,CAC3B,IAAIA,EAAU,KAAK,QAAQ,QAEvB,KAAK,OACRC,GAAmB,KAAK,MAAOD,CAAO,EAGnC,KAAK,SACRC,GAAmB,KAAK,QAASD,CAAO,CAE3C,EAEC,cAAe,UAAY,CAC1B,KAAK,cAAc,KAAK,QAAQ,UAAU,CAC5C,EAEC,aAAc,UAAY,CACzB,KAAK,cAAc,CAAC,CACtB,EAEC,YAAa,UAAY,CACxB,IAAIpL,EAAM,KAAK,KACf,GAAKA,EAEL,KAAIsL,EAAW,KAAK,QAAQ,KAAK,QAC7B3R,EAAO2R,EAAS,SAAWthB,EAAMshB,EAAS,QAAQ,EAAIthB,EAAM,EAAG,CAAC,EAChE4f,EAAS0B,EAAS,WAAathB,EAAMshB,EAAS,UAAU,EAAIthB,EAAM,EAAG,CAAC,EAE1EgW,EAAI,UAAU,KAAK,QAAS,CAC3B,eAAgB4J,EAChB,mBAAoBjQ,EAAK,SAASiQ,CAAM,CAC3C,CAAG,EACH,EAEC,gBAAiB,UAAY,CAC5B,OAAO,KAAK,QAAQ,KAAK,QAAQ,WACnC,EAEC,kBAAmB,UAAY,CAC9B,OAAO,KAAK,QAAQ,KAAK,QAAQ,aACnC,CACA,CAAC,EAOM,SAASQ,GAAOvd,EAAQ1G,EAAS,CACvC,OAAO,IAAIwkB,GAAO9d,EAAQ1G,CAAO,CAClC,CCtZU,IAAColB,GAAO7C,GAAM,OAAO,CAI9B,QAAS,CAGR,OAAQ,GAIR,MAAO,UAIP,OAAQ,EAIR,QAAS,EAIT,QAAS,QAIT,SAAU,QAIV,UAAW,KAIX,WAAY,KAIZ,KAAM,GAIN,UAAW,KAIX,YAAa,GAIb,SAAU,UAKV,YAAa,GAKb,oBAAqB,EACvB,EAEC,UAAW,SAAU1I,EAAK,CAGzB,KAAK,UAAYA,EAAI,YAAY,IAAI,CACvC,EAEC,MAAO,UAAY,CAClB,KAAK,UAAU,UAAU,IAAI,EAC7B,KAAK,OAAM,EACX,KAAK,UAAU,SAAS,IAAI,CAC9B,EAEC,SAAU,UAAY,CACrB,KAAK,UAAU,YAAY,IAAI,CACjC,EAIC,OAAQ,UAAY,CACnB,OAAI,KAAK,MACR,KAAK,UAAU,YAAY,IAAI,EAEzB,IACT,EAIC,SAAU,SAAUlR,EAAO,CAC1B9G,OAAAA,EAAgB,KAAM8G,CAAK,EACvB,KAAK,YACR,KAAK,UAAU,aAAa,IAAI,EAC5B,KAAK,QAAQ,QAAUA,GAAS,OAAO,UAAU,eAAe,KAAKA,EAAO,QAAQ,GACvF,KAAK,cAAa,GAGb,IACT,EAIC,aAAc,UAAY,CACzB,OAAI,KAAK,WACR,KAAK,UAAU,cAAc,IAAI,EAE3B,IACT,EAIC,YAAa,UAAY,CACxB,OAAI,KAAK,WACR,KAAK,UAAU,aAAa,IAAI,EAE1B,IACT,EAEC,WAAY,UAAY,CACvB,OAAO,KAAK,KACd,EAEC,OAAQ,UAAY,CAEnB,KAAK,SAAQ,EACb,KAAK,QAAO,CACd,EAEC,gBAAiB,UAAY,CAE5B,OAAQ,KAAK,QAAQ,OAAS,KAAK,QAAQ,OAAS,EAAI,IACrD,KAAK,UAAU,QAAQ,WAAa,EACzC,CACA,CAAC,ECrIU0c,GAAeD,GAAK,OAAO,CAIrC,QAAS,CACR,KAAM,GAIN,OAAQ,EACV,EAEC,WAAY,SAAU1e,EAAQ1G,EAAS,CACtC6B,EAAgB,KAAM7B,CAAO,EAC7B,KAAK,QAAUuF,EAASmB,CAAM,EAC9B,KAAK,QAAU,KAAK,QAAQ,MAC9B,EAIC,UAAW,SAAUA,EAAQ,CAC5B,IAAIge,EAAY,KAAK,QACrB,YAAK,QAAUnf,EAASmB,CAAM,EAC9B,KAAK,OAAM,EAIJ,KAAK,KAAK,OAAQ,CAAC,UAAWge,EAAW,OAAQ,KAAK,OAAO,CAAC,CACvE,EAIC,UAAW,UAAY,CACtB,OAAO,KAAK,OACd,EAIC,UAAW,SAAUY,EAAQ,CAC5B,YAAK,QAAQ,OAAS,KAAK,QAAUA,EAC9B,KAAK,OAAM,CACpB,EAIC,UAAW,UAAY,CACtB,OAAO,KAAK,OACd,EAEC,SAAW,SAAUtlB,EAAS,CAC7B,IAAIslB,EAAStlB,GAAWA,EAAQ,QAAU,KAAK,QAC/C,OAAAolB,GAAK,UAAU,SAAS,KAAK,KAAMplB,CAAO,EAC1C,KAAK,UAAUslB,CAAM,EACd,IACT,EAEC,SAAU,UAAY,CACrB,KAAK,OAAS,KAAK,KAAK,mBAAmB,KAAK,OAAO,EACvD,KAAK,cAAa,CACpB,EAEC,cAAe,UAAY,CAC1B,IAAI,EAAI,KAAK,QACTC,EAAK,KAAK,UAAY,EACtB5Q,EAAI,KAAK,gBAAe,EACxBlM,EAAI,CAAC,EAAIkM,EAAG4Q,EAAK5Q,CAAC,EACtB,KAAK,UAAY,IAAI5Q,GAAO,KAAK,OAAO,SAAS0E,CAAC,EAAG,KAAK,OAAO,IAAIA,CAAC,CAAC,CACzE,EAEC,QAAS,UAAY,CAChB,KAAK,MACR,KAAK,YAAW,CAEnB,EAEC,YAAa,UAAY,CACxB,KAAK,UAAU,cAAc,IAAI,CACnC,EAEC,OAAQ,UAAY,CACnB,OAAO,KAAK,SAAW,CAAC,KAAK,UAAU,QAAQ,WAAW,KAAK,SAAS,CAC1E,EAGC,eAAgB,SAAUA,EAAG,CAC5B,OAAOA,EAAE,WAAW,KAAK,MAAM,GAAK,KAAK,QAAU,KAAK,gBAAe,CACzE,CACA,CAAC,EAKM,SAAS+c,GAAa9e,EAAQ1G,EAAS,CAC7C,OAAO,IAAIqlB,GAAa3e,EAAQ1G,CAAO,CACxC,CCpFU,IAACylB,GAASJ,GAAa,OAAO,CAEvC,WAAY,SAAU3e,EAAQ1G,EAAS0lB,EAAe,CAQrD,GAPI,OAAO1lB,GAAY,WAEtBA,EAAUgC,EAAY,CAAA,EAAI0jB,EAAe,CAAC,OAAQ1lB,CAAO,CAAC,GAE3D6B,EAAgB,KAAM7B,CAAO,EAC7B,KAAK,QAAUuF,EAASmB,CAAM,EAE1B,MAAM,KAAK,QAAQ,MAAM,EAAK,MAAM,IAAI,MAAM,6BAA6B,EAK/E,KAAK,SAAW,KAAK,QAAQ,MAC/B,EAIC,UAAW,SAAU4e,EAAQ,CAC5B,YAAK,SAAWA,EACT,KAAK,OAAM,CACpB,EAIC,UAAW,UAAY,CACtB,OAAO,KAAK,QACd,EAIC,UAAW,UAAY,CACtB,IAAIK,EAAO,CAAC,KAAK,QAAS,KAAK,UAAY,KAAK,OAAO,EAEvD,OAAO,IAAI7gB,GACV,KAAK,KAAK,mBAAmB,KAAK,OAAO,SAAS6gB,CAAI,CAAC,EACvD,KAAK,KAAK,mBAAmB,KAAK,OAAO,IAAIA,CAAI,CAAC,CAAC,CACtD,EAEC,SAAUP,GAAK,UAAU,SAEzB,SAAU,UAAY,CAErB,IAAIrf,EAAM,KAAK,QAAQ,IACnBD,EAAM,KAAK,QAAQ,IACnB+T,EAAM,KAAK,KACX/C,EAAM+C,EAAI,QAAQ,IAEtB,GAAI/C,EAAI,WAAa1Q,GAAM,SAAU,CACpC,IAAI9G,EAAI,KAAK,GAAK,IACdsmB,EAAQ,KAAK,SAAWxf,GAAM,EAAK9G,EACnCumB,EAAMhM,EAAI,QAAQ,CAAC/T,EAAM8f,EAAM7f,CAAG,CAAC,EACnC+f,EAASjM,EAAI,QAAQ,CAAC/T,EAAM8f,EAAM7f,CAAG,CAAC,EACtC0C,EAAIod,EAAI,IAAIC,CAAM,EAAE,SAAS,CAAC,EAC9Bpe,EAAOmS,EAAI,UAAUpR,CAAC,EAAE,IACxBsd,EAAO,KAAK,MAAM,KAAK,IAAIH,EAAOtmB,CAAC,EAAI,KAAK,IAAIwG,EAAMxG,CAAC,EAAI,KAAK,IAAIoI,EAAOpI,CAAC,IACnE,KAAK,IAAIwG,EAAMxG,CAAC,EAAI,KAAK,IAAIoI,EAAOpI,CAAC,EAAE,EAAIA,GAEpD,MAAMymB,CAAI,GAAKA,IAAS,KAC3BA,EAAOH,EAAO,KAAK,IAAI,KAAK,GAAK,IAAM9f,CAAG,GAG3C,KAAK,OAAS2C,EAAE,SAASoR,EAAI,eAAc,CAAE,EAC7C,KAAK,QAAU,MAAMkM,CAAI,EAAI,EAAItd,EAAE,EAAIoR,EAAI,QAAQ,CAACnS,EAAM3B,EAAMggB,CAAI,CAAC,EAAE,EACvE,KAAK,SAAWtd,EAAE,EAAIod,EAAI,CAE7B,KAAS,CACN,IAAIte,EAAUuP,EAAI,UAAUA,EAAI,QAAQ,KAAK,OAAO,EAAE,SAAS,CAAC,KAAK,SAAU,CAAC,CAAC,CAAC,EAElF,KAAK,OAAS+C,EAAI,mBAAmB,KAAK,OAAO,EACjD,KAAK,QAAU,KAAK,OAAO,EAAIA,EAAI,mBAAmBtS,CAAO,EAAE,CAClE,CAEE,KAAK,cAAa,CACpB,CACA,CAAC,EASM,SAASye,GAAOtf,EAAQ1G,EAAS0lB,EAAe,CACtD,OAAO,IAAID,GAAO/e,EAAQ1G,EAAS0lB,CAAa,CACjD,CCjEU,IAACO,GAAWb,GAAK,OAAO,CAIjC,QAAS,CAIR,aAAc,EAId,OAAQ,EACV,EAEC,WAAY,SAAUngB,EAASjF,EAAS,CACvC6B,EAAgB,KAAM7B,CAAO,EAC7B,KAAK,YAAYiF,CAAO,CAC1B,EAIC,WAAY,UAAY,CACvB,OAAO,KAAK,QACd,EAIC,WAAY,SAAUA,EAAS,CAC9B,YAAK,YAAYA,CAAO,EACjB,KAAK,OAAM,CACpB,EAIC,QAAS,UAAY,CACpB,MAAO,CAAC,KAAK,SAAS,MACxB,EAIC,kBAAmB,SAAUwD,EAAG,CAM/B,QALIyd,EAAc,IACdC,EAAW,KACXC,EAAUC,GACVtH,EAAIC,EAECnhB,EAAI,EAAGyoB,EAAO,KAAK,OAAO,OAAQzoB,EAAIyoB,EAAMzoB,IAGpD,QAFIqG,EAAS,KAAK,OAAOrG,GAEhBD,EAAI,EAAGE,EAAMoG,EAAO,OAAQtG,EAAIE,EAAKF,IAAK,CAClDmhB,EAAK7a,EAAOtG,EAAI,GAChBohB,EAAK9a,EAAOtG,GAEZ,IAAI4iB,EAAS4F,EAAQ3d,EAAGsW,EAAIC,EAAI,EAAI,EAEhCwB,EAAS0F,IACZA,EAAc1F,EACd2F,EAAWC,EAAQ3d,EAAGsW,EAAIC,CAAE,EAEjC,CAEE,OAAImH,IACHA,EAAS,SAAW,KAAK,KAAKD,CAAW,GAEnCC,CACT,EAIC,UAAW,UAAY,CAEtB,GAAI,CAAC,KAAK,KACT,MAAM,IAAI,MAAM,gDAAgD,EAEjE,OAAOI,GAAwB,KAAK,cAAa,EAAI,KAAK,KAAK,QAAQ,GAAG,CAC5E,EAIC,UAAW,UAAY,CACtB,OAAO,KAAK,OACd,EAMC,UAAW,SAAU7f,EAAQzB,EAAS,CACrC,OAAAA,EAAUA,GAAW,KAAK,cAAa,EACvCyB,EAASnB,EAASmB,CAAM,EACxBzB,EAAQ,KAAKyB,CAAM,EACnB,KAAK,QAAQ,OAAOA,CAAM,EACnB,KAAK,OAAM,CACpB,EAEC,YAAa,SAAUzB,EAAS,CAC/B,KAAK,QAAU,IAAIH,GACnB,KAAK,SAAW,KAAK,gBAAgBG,CAAO,CAC9C,EAEC,cAAe,UAAY,CAC1B,OAAOka,GAAgB,KAAK,QAAQ,EAAI,KAAK,SAAW,KAAK,SAAS,EACxE,EAGC,gBAAiB,SAAUla,EAAS,CAInC,QAHIuhB,EAAS,CAAA,EACTC,EAAOtH,GAAgBla,CAAO,EAEzBrH,EAAI,EAAGE,EAAMmH,EAAQ,OAAQrH,EAAIE,EAAKF,IAC1C6oB,GACHD,EAAO5oB,GAAK2H,EAASN,EAAQrH,EAAE,EAC/B,KAAK,QAAQ,OAAO4oB,EAAO5oB,EAAE,GAE7B4oB,EAAO5oB,GAAK,KAAK,gBAAgBqH,EAAQrH,EAAE,EAI7C,OAAO4oB,CACT,EAEC,SAAU,UAAY,CACrB,IAAI9N,EAAW,IAAI3U,GACnB,KAAK,OAAS,CAAA,EACd,KAAK,gBAAgB,KAAK,SAAU,KAAK,OAAQ2U,CAAQ,EAErD,KAAK,QAAQ,QAAO,GAAMA,EAAS,QAAO,IAC7C,KAAK,aAAeA,EACpB,KAAK,cAAa,EAErB,EAEC,cAAe,UAAY,CAC1B,IAAI/D,EAAI,KAAK,gBAAe,EACxBlM,EAAI,IAAIjF,EAAMmR,EAAGA,CAAC,EAEjB,KAAK,eAIV,KAAK,UAAY,IAAI5Q,GAAO,CAC3B,KAAK,aAAa,IAAI,SAAS0E,CAAC,EAChC,KAAK,aAAa,IAAI,IAAIA,CAAC,CAC9B,CAAG,EACH,EAGC,gBAAiB,SAAUxD,EAASuhB,EAAQE,EAAiB,CAC5D,IAAID,EAAOxhB,EAAQ,aAAcK,GAC7BxH,EAAMmH,EAAQ,OACdrH,EAAG+oB,EAEP,GAAIF,EAAM,CAET,IADAE,EAAO,CAAA,EACF/oB,EAAI,EAAGA,EAAIE,EAAKF,IACpB+oB,EAAK/oB,GAAK,KAAK,KAAK,mBAAmBqH,EAAQrH,EAAE,EACjD8oB,EAAgB,OAAOC,EAAK/oB,EAAE,EAE/B4oB,EAAO,KAAKG,CAAI,CACnB,KACG,KAAK/oB,EAAI,EAAGA,EAAIE,EAAKF,IACpB,KAAK,gBAAgBqH,EAAQrH,GAAI4oB,EAAQE,CAAe,CAG5D,EAGC,YAAa,UAAY,CACxB,IAAIpiB,EAAS,KAAK,UAAU,QAG5B,GADA,KAAK,OAAS,CAAA,EACV,GAAC,KAAK,WAAa,CAAC,KAAK,UAAU,WAAWA,CAAM,GAIxD,IAAI,KAAK,QAAQ,OAAQ,CACxB,KAAK,OAAS,KAAK,OACnB,MACH,CAEE,IAAIsiB,EAAQ,KAAK,OACbhpB,EAAGC,EAAG8gB,EAAG7gB,EAAK0K,EAAMqe,EAAS3iB,EAEjC,IAAKtG,EAAI,EAAG+gB,EAAI,EAAG7gB,EAAM,KAAK,OAAO,OAAQF,EAAIE,EAAKF,IAGrD,IAFAsG,EAAS,KAAK,OAAOtG,GAEhBC,EAAI,EAAG2K,EAAOtE,EAAO,OAAQrG,EAAI2K,EAAO,EAAG3K,IAC/CgpB,EAAUC,GAAqB5iB,EAAOrG,GAAIqG,EAAOrG,EAAI,GAAIyG,EAAQzG,EAAG,EAAI,EAEnEgpB,IAELD,EAAMjI,GAAKiI,EAAMjI,IAAM,CAAA,EACvBiI,EAAMjI,GAAG,KAAKkI,EAAQ,EAAE,GAGnBA,EAAQ,KAAO3iB,EAAOrG,EAAI,IAAQA,IAAM2K,EAAO,KACnDoe,EAAMjI,GAAG,KAAKkI,EAAQ,EAAE,EACxBlI,MAIL,EAGC,gBAAiB,UAAY,CAI5B,QAHIiI,EAAQ,KAAK,OACbhH,EAAY,KAAK,QAAQ,aAEpBhiB,EAAI,EAAGE,EAAM8oB,EAAM,OAAQhpB,EAAIE,EAAKF,IAC5CgpB,EAAMhpB,GAAKmpB,GAAkBH,EAAMhpB,GAAIgiB,CAAS,CAEnD,EAEC,QAAS,UAAY,CACf,KAAK,OAEV,KAAK,YAAW,EAChB,KAAK,gBAAe,EACpB,KAAK,YAAW,EAClB,EAEC,YAAa,UAAY,CACxB,KAAK,UAAU,YAAY,IAAI,CACjC,EAGC,eAAgB,SAAUnX,EAAGF,EAAQ,CACpC,IAAI3K,EAAGC,EAAG8gB,EAAG7gB,EAAK0K,EAAMwe,EACpBrS,EAAI,KAAK,gBAAe,EAE5B,GAAI,CAAC,KAAK,WAAa,CAAC,KAAK,UAAU,SAASlM,CAAC,EAAK,MAAO,GAG7D,IAAK7K,EAAI,EAAGE,EAAM,KAAK,OAAO,OAAQF,EAAIE,EAAKF,IAG9C,IAFAopB,EAAO,KAAK,OAAOppB,GAEdC,EAAI,EAAG2K,EAAOwe,EAAK,OAAQrI,EAAInW,EAAO,EAAG3K,EAAI2K,EAAMmW,EAAI9gB,IAC3D,GAAI,GAAC0K,GAAW1K,IAAM,IAElBopB,GAAgCxe,EAAGue,EAAKrI,GAAIqI,EAAKnpB,EAAE,GAAK8W,EAC3D,MAAO,GAIV,MAAO,EACT,CACA,CAAC,EAOM,SAASuS,GAASjiB,EAASjF,EAAS,CAC1C,OAAO,IAAIimB,GAAShhB,EAASjF,CAAO,CACrC,CAGAimB,GAAS,MAAQkB,GC7PP,IAACC,GAAUnB,GAAS,OAAO,CAEpC,QAAS,CACR,KAAM,EACR,EAEC,QAAS,UAAY,CACpB,MAAO,CAAC,KAAK,SAAS,QAAU,CAAC,KAAK,SAAS,GAAG,MACpD,EAIC,UAAW,UAAY,CAEtB,GAAI,CAAC,KAAK,KACT,MAAM,IAAI,MAAM,gDAAgD,EAEjE,OAAOoB,GAAuB,KAAK,cAAa,EAAI,KAAK,KAAK,QAAQ,GAAG,CAC3E,EAEC,gBAAiB,SAAUpiB,EAAS,CACnC,IAAIuhB,EAASP,GAAS,UAAU,gBAAgB,KAAK,KAAMhhB,CAAO,EAC9DnH,EAAM0oB,EAAO,OAGjB,OAAI1oB,GAAO,GAAK0oB,EAAO,aAAclhB,IAAUkhB,EAAO,GAAG,OAAOA,EAAO1oB,EAAM,EAAE,GAC9E0oB,EAAO,IAAG,EAEJA,CACT,EAEC,YAAa,SAAUvhB,EAAS,CAC/BghB,GAAS,UAAU,YAAY,KAAK,KAAMhhB,CAAO,EAC7Cka,GAAgB,KAAK,QAAQ,IAChC,KAAK,SAAW,CAAC,KAAK,QAAQ,EAEjC,EAEC,cAAe,UAAY,CAC1B,OAAOA,GAAgB,KAAK,SAAS,EAAE,EAAI,KAAK,SAAS,GAAK,KAAK,SAAS,GAAG,EACjF,EAEC,YAAa,UAAY,CAGxB,IAAI7a,EAAS,KAAK,UAAU,QACxBqQ,EAAI,KAAK,QAAQ,OACjBlM,EAAI,IAAIjF,EAAMmR,EAAGA,CAAC,EAMtB,GAHArQ,EAAS,IAAIP,GAAOO,EAAO,IAAI,SAASmE,CAAC,EAAGnE,EAAO,IAAI,IAAImE,CAAC,CAAC,EAE7D,KAAK,OAAS,CAAA,EACV,GAAC,KAAK,WAAa,CAAC,KAAK,UAAU,WAAWnE,CAAM,GAIxD,IAAI,KAAK,QAAQ,OAAQ,CACxB,KAAK,OAAS,KAAK,OACnB,MACH,CAEE,QAAS1G,EAAI,EAAGE,EAAM,KAAK,OAAO,OAAQwpB,EAAS1pB,EAAIE,EAAKF,IAC3D0pB,EAAUC,GAAqB,KAAK,OAAO3pB,GAAI0G,EAAQ,EAAI,EACvDgjB,EAAQ,QACX,KAAK,OAAO,KAAKA,CAAO,EAG5B,EAEC,YAAa,UAAY,CACxB,KAAK,UAAU,YAAY,KAAM,EAAI,CACvC,EAGC,eAAgB,SAAU7e,EAAG,CAC5B,IAAI0N,EAAS,GACT6Q,EAAMjI,EAAIC,EAAIphB,EAAGC,EAAG8gB,EAAG7gB,EAAK0K,EAEhC,GAAI,CAAC,KAAK,WAAa,CAAC,KAAK,UAAU,SAASC,CAAC,EAAK,MAAO,GAG7D,IAAK7K,EAAI,EAAGE,EAAM,KAAK,OAAO,OAAQF,EAAIE,EAAKF,IAG9C,IAFAopB,EAAO,KAAK,OAAOppB,GAEdC,EAAI,EAAG2K,EAAOwe,EAAK,OAAQrI,EAAInW,EAAO,EAAG3K,EAAI2K,EAAMmW,EAAI9gB,IAC3DkhB,EAAKiI,EAAKnpB,GACVmhB,EAAKgI,EAAKrI,GAEJI,EAAG,EAAItW,EAAE,GAAQuW,EAAG,EAAIvW,EAAE,GAAQA,EAAE,GAAKuW,EAAG,EAAID,EAAG,IAAMtW,EAAE,EAAIsW,EAAG,IAAMC,EAAG,EAAID,EAAG,GAAKA,EAAG,IAC/F5I,EAAS,CAACA,GAMb,OAAOA,GAAU8P,GAAS,UAAU,eAAe,KAAK,KAAMxd,EAAG,EAAI,CACvE,CAEA,CAAC,EAIM,SAAS+e,GAAQviB,EAASjF,EAAS,CACzC,OAAO,IAAIonB,GAAQniB,EAASjF,CAAO,CACpC,CC5HU,IAACynB,GAAUtE,GAAa,OAAO,CAoDxC,WAAY,SAAUuE,EAAS1nB,EAAS,CACvC6B,EAAgB,KAAM7B,CAAO,EAE7B,KAAK,QAAU,CAAA,EAEX0nB,GACH,KAAK,QAAQA,CAAO,CAEvB,EAIC,QAAS,SAAUA,EAAS,CAC3B,IAAIC,EAAWtlB,EAAaqlB,CAAO,EAAIA,EAAUA,EAAQ,SACrD9pB,EAAGE,EAAK8pB,EAEZ,GAAID,EAAU,CACb,IAAK/pB,EAAI,EAAGE,EAAM6pB,EAAS,OAAQ/pB,EAAIE,EAAKF,IAE3CgqB,EAAUD,EAAS/pB,IACfgqB,EAAQ,YAAcA,EAAQ,UAAYA,EAAQ,UAAYA,EAAQ,cACzE,KAAK,QAAQA,CAAO,EAGtB,OAAO,IACV,CAEE,IAAI5nB,EAAU,KAAK,QAEnB,GAAIA,EAAQ,QAAU,CAACA,EAAQ,OAAO0nB,CAAO,EAAK,OAAO,KAEzD,IAAI/M,EAAQkN,GAAgBH,EAAS1nB,CAAO,EAC5C,OAAK2a,GAGLA,EAAM,QAAUmN,GAAUJ,CAAO,EAEjC/M,EAAM,eAAiBA,EAAM,QAC7B,KAAK,WAAWA,CAAK,EAEjB3a,EAAQ,eACXA,EAAQ,cAAc0nB,EAAS/M,CAAK,EAG9B,KAAK,SAASA,CAAK,GAXlB,IAYV,EAKC,WAAY,SAAUA,EAAO,CAC5B,OAAIA,IAAU,OACN,KAAK,UAAU,KAAK,WAAY,IAAI,GAG5CA,EAAM,QAAU3Y,EAAY,CAAA,EAAI2Y,EAAM,cAAc,EACpD,KAAK,eAAeA,EAAO,KAAK,QAAQ,KAAK,EACtC,KACT,EAIC,SAAU,SAAUhS,EAAO,CAC1B,OAAO,KAAK,UAAU,SAAUgS,EAAO,CACtC,KAAK,eAAeA,EAAOhS,CAAK,CACnC,EAAK,IAAI,CACT,EAEC,eAAgB,SAAUgS,EAAOhS,EAAO,CACnCgS,EAAM,WACL,OAAOhS,GAAU,aACpBA,EAAQA,EAAMgS,EAAM,OAAO,GAE5BA,EAAM,SAAShS,CAAK,EAEvB,CACA,CAAC,EASM,SAASkf,GAAgBH,EAAS1nB,EAAS,CAEjD,IAAI+nB,EAAWL,EAAQ,OAAS,UAAYA,EAAQ,SAAWA,EAC3DlI,EAASuI,EAAWA,EAAS,YAAc,KAC3C9L,EAAS,CAAA,EACT+L,EAAehoB,GAAWA,EAAQ,aAClCioB,EAAkBjoB,GAAWA,EAAQ,gBAAkBkoB,GACvDxhB,EAAQzB,EAASrH,EAAGE,EAExB,GAAI,CAAC0hB,GAAU,CAACuI,EACf,OAAO,KAGR,OAAQA,EAAS,KAAI,CACrB,IAAK,QACJ,OAAArhB,EAASuhB,EAAgBzI,CAAM,EACxB2I,GAAcH,EAAcN,EAAShhB,EAAQ1G,CAAO,EAE5D,IAAK,aACJ,IAAKpC,EAAI,EAAGE,EAAM0hB,EAAO,OAAQ5hB,EAAIE,EAAKF,IACzC8I,EAASuhB,EAAgBzI,EAAO5hB,EAAE,EAClCqe,EAAO,KAAKkM,GAAcH,EAAcN,EAAShhB,EAAQ1G,CAAO,CAAC,EAElE,OAAO,IAAImjB,GAAalH,CAAM,EAE/B,IAAK,aACL,IAAK,kBACJ,OAAAhX,EAAUmjB,GAAgB5I,EAAQuI,EAAS,OAAS,aAAe,EAAI,EAAGE,CAAe,EAClF,IAAIhC,GAAShhB,EAASjF,CAAO,EAErC,IAAK,UACL,IAAK,eACJ,OAAAiF,EAAUmjB,GAAgB5I,EAAQuI,EAAS,OAAS,UAAY,EAAI,EAAGE,CAAe,EAC/E,IAAIb,GAAQniB,EAASjF,CAAO,EAEpC,IAAK,qBACJ,IAAKpC,EAAI,EAAGE,EAAMiqB,EAAS,WAAW,OAAQnqB,EAAIE,EAAKF,IAAK,CAC3D,IAAIyqB,EAAWR,GAAgB,CAC9B,SAAUE,EAAS,WAAWnqB,GAC9B,KAAM,UACN,WAAY8pB,EAAQ,UACxB,EAAM1nB,CAAO,EAENqoB,GACHpM,EAAO,KAAKoM,CAAQ,CAExB,CACE,OAAO,IAAIlF,GAAalH,CAAM,EAE/B,IAAK,oBACJ,IAAKre,EAAI,EAAGE,EAAMiqB,EAAS,SAAS,OAAQnqB,EAAIE,EAAKF,IAAK,CACzD,IAAI0qB,EAAeT,GAAgBE,EAAS,SAASnqB,GAAIoC,CAAO,EAE5DsoB,GACHrM,EAAO,KAAKqM,CAAY,CAE5B,CACE,OAAO,IAAInF,GAAalH,CAAM,EAE/B,QACC,MAAM,IAAI,MAAM,yBAAyB,CAC3C,CACA,CAEA,SAASkM,GAAcI,EAAgBb,EAAShhB,EAAQ1G,EAAS,CAChE,OAAOuoB,EACNA,EAAeb,EAAShhB,CAAM,EAC9B,IAAI8d,GAAO9d,EAAQ1G,GAAWA,EAAQ,uBAAyBA,CAAO,CACxE,CAKO,SAASkoB,GAAe1I,EAAQ,CACtC,OAAO,IAAIla,GAAOka,EAAO,GAAIA,EAAO,GAAIA,EAAO,EAAE,CAClD,CAMO,SAAS4I,GAAgB5I,EAAQgJ,EAAYP,EAAiB,CAGpE,QAFIhjB,EAAU,CAAA,EAELrH,EAAI,EAAGE,EAAM0hB,EAAO,OAAQ9Y,EAAQ9I,EAAIE,EAAKF,IACrD8I,EAAS8hB,EACRJ,GAAgB5I,EAAO5hB,GAAI4qB,EAAa,EAAGP,CAAe,GACzDA,GAAmBC,IAAgB1I,EAAO5hB,EAAE,EAE9CqH,EAAQ,KAAKyB,CAAM,EAGpB,OAAOzB,CACR,CAKO,SAASwjB,GAAe/hB,EAAQhH,EAAW,CACjD,OAAAgH,EAASnB,EAASmB,CAAM,EACjBA,EAAO,MAAQ,OACrB,CAACR,EAAeQ,EAAO,IAAKhH,CAAS,EAAGwG,EAAeQ,EAAO,IAAKhH,CAAS,EAAGwG,EAAeQ,EAAO,IAAKhH,CAAS,CAAC,EACpH,CAACwG,EAAeQ,EAAO,IAAKhH,CAAS,EAAGwG,EAAeQ,EAAO,IAAKhH,CAAS,CAAC,CAC/E,CAMO,SAASgpB,GAAgBzjB,EAASujB,EAAYjgB,EAAQ7I,EAAW,CAGvE,QAFI8f,EAAS,CAAA,EAEJ5hB,EAAI,EAAGE,EAAMmH,EAAQ,OAAQrH,EAAIE,EAAKF,IAE9C4hB,EAAO,KAAKgJ,EACXE,GAAgBzjB,EAAQrH,GAAIuhB,GAAgBla,EAAQrH,EAAE,EAAI,EAAI4qB,EAAa,EAAGjgB,EAAQ7I,CAAS,EAC/F+oB,GAAexjB,EAAQrH,GAAI8B,CAAS,CAAC,EAGvC,MAAI,CAAC8oB,GAAcjgB,GAAUiX,EAAO,OAAS,GAC5CA,EAAO,KAAKA,EAAO,GAAG,MAAK,CAAE,EAGvBA,CACR,CAEO,SAASmJ,GAAWhO,EAAOiO,EAAa,CAC9C,OAAOjO,EAAM,QACZ3Y,EAAY,CAAA,EAAI2Y,EAAM,QAAS,CAAC,SAAUiO,CAAW,CAAC,EACtDd,GAAUc,CAAW,CACvB,CAIO,SAASd,GAAUJ,EAAS,CAClC,OAAIA,EAAQ,OAAS,WAAaA,EAAQ,OAAS,oBAC3CA,EAGD,CACN,KAAM,UACN,WAAY,CAAA,EACZ,SAAUA,CACZ,CACA,CAEA,IAAImB,GAAiB,CACpB,UAAW,SAAUnpB,EAAW,CAC/B,OAAOipB,GAAW,KAAM,CACvB,KAAM,QACN,YAAaF,GAAe,KAAK,UAAS,EAAI/oB,CAAS,CAC1D,CAAG,CACH,CACA,EAOA8kB,GAAO,QAAQqE,EAAc,EAM7BpD,GAAO,QAAQoD,EAAc,EAC7BxD,GAAa,QAAQwD,EAAc,EAOnC5C,GAAS,QAAQ,CAChB,UAAW,SAAUvmB,EAAW,CAC/B,IAAIopB,EAAQ,CAAC3J,GAAgB,KAAK,QAAQ,EAEtCK,EAASkJ,GAAgB,KAAK,SAAUI,EAAQ,EAAI,EAAG,GAAOppB,CAAS,EAE3E,OAAOipB,GAAW,KAAM,CACvB,MAAOG,EAAQ,QAAU,IAAM,aAC/B,YAAatJ,CAChB,CAAG,CACH,CACA,CAAC,EAMD4H,GAAQ,QAAQ,CACf,UAAW,SAAU1nB,EAAW,CAC/B,IAAIqpB,EAAQ,CAAC5J,GAAgB,KAAK,QAAQ,EACtC2J,EAAQC,GAAS,CAAC5J,GAAgB,KAAK,SAAS,EAAE,EAElDK,EAASkJ,GAAgB,KAAK,SAAUI,EAAQ,EAAIC,EAAQ,EAAI,EAAG,GAAMrpB,CAAS,EAEtF,OAAKqpB,IACJvJ,EAAS,CAACA,CAAM,GAGVmJ,GAAW,KAAM,CACvB,MAAOG,EAAQ,QAAU,IAAM,UAC/B,YAAatJ,CAChB,CAAG,CACH,CACA,CAAC,EAIDsD,GAAW,QAAQ,CAClB,aAAc,SAAUpjB,EAAW,CAClC,IAAI8f,EAAS,CAAA,EAEb,YAAK,UAAU,SAAU7E,EAAO,CAC/B6E,EAAO,KAAK7E,EAAM,UAAUjb,CAAS,EAAE,SAAS,WAAW,CAC9D,CAAG,EAEMipB,GAAW,KAAM,CACvB,KAAM,aACN,YAAanJ,CAChB,CAAG,CACH,EAKC,UAAW,SAAU9f,EAAW,CAE/B,IAAI8C,EAAO,KAAK,SAAW,KAAK,QAAQ,UAAY,KAAK,QAAQ,SAAS,KAE1E,GAAIA,IAAS,aACZ,OAAO,KAAK,aAAa9C,CAAS,EAGnC,IAAIspB,EAAuBxmB,IAAS,qBAChCymB,EAAQ,CAAA,EAmBZ,OAjBA,KAAK,UAAU,SAAUtO,EAAO,CAC/B,GAAIA,EAAM,UAAW,CACpB,IAAIuO,EAAOvO,EAAM,UAAUjb,CAAS,EACpC,GAAIspB,EACHC,EAAM,KAAKC,EAAK,QAAQ,MAClB,CACN,IAAItB,EAAUE,GAAUoB,CAAI,EAExBtB,EAAQ,OAAS,oBACpBqB,EAAM,KAAK,MAAMA,EAAOrB,EAAQ,QAAQ,EAExCqB,EAAM,KAAKrB,CAAO,CAExB,CACA,CACA,CAAG,EAEGoB,EACIL,GAAW,KAAM,CACvB,WAAYM,EACZ,KAAM,oBACV,CAAI,EAGK,CACN,KAAM,oBACN,SAAUA,CACb,CACA,CACA,CAAC,EAOM,SAASE,GAAQzB,EAAS1nB,EAAS,CACzC,OAAO,IAAIynB,GAAQC,EAAS1nB,CAAO,CACpC,CAGU,IAACopB,GAAUD,GC7aVE,GAAe9G,GAAM,OAAO,CAItC,QAAS,CAGR,QAAS,EAIT,IAAK,GAIL,YAAa,GAMb,YAAa,GAIb,gBAAiB,GAIjB,OAAQ,EAIR,UAAW,EACb,EAEC,WAAY,SAAU+G,EAAKhlB,EAAQtE,EAAS,CAC3C,KAAK,KAAOspB,EACZ,KAAK,QAAU9jB,GAAelB,CAAM,EAEpCzC,EAAgB,KAAM7B,CAAO,CAC/B,EAEC,MAAO,UAAY,CACb,KAAK,SACT,KAAK,WAAU,EAEX,KAAK,QAAQ,QAAU,GAC1B,KAAK,eAAc,GAIjB,KAAK,QAAQ,cAChBmT,EAAiB,KAAK,OAAQ,qBAAqB,EACnD,KAAK,qBAAqB,KAAK,MAAM,GAGtC,KAAK,QAAO,EAAG,YAAY,KAAK,MAAM,EACtC,KAAK,OAAM,CACb,EAEC,SAAU,UAAY,CACrB6C,GAAe,KAAK,MAAM,EACtB,KAAK,QAAQ,aAChB,KAAK,wBAAwB,KAAK,MAAM,CAE3C,EAIC,WAAY,SAAUiP,EAAS,CAC9B,YAAK,QAAQ,QAAUA,EAEnB,KAAK,QACR,KAAK,eAAc,EAEb,IACT,EAEC,SAAU,SAAUsE,EAAW,CAC9B,OAAIA,EAAU,SACb,KAAK,WAAWA,EAAU,OAAO,EAE3B,IACT,EAIC,aAAc,UAAY,CACzB,OAAI,KAAK,MACRC,GAAgB,KAAK,MAAM,EAErB,IACT,EAIC,YAAa,UAAY,CACxB,OAAI,KAAK,MACRC,GAAe,KAAK,MAAM,EAEpB,IACT,EAIC,OAAQ,SAAUH,EAAK,CACtB,YAAK,KAAOA,EAER,KAAK,SACR,KAAK,OAAO,IAAMA,GAEZ,IACT,EAIC,UAAW,SAAUhlB,EAAQ,CAC5B,YAAK,QAAUkB,GAAelB,CAAM,EAEhC,KAAK,MACR,KAAK,OAAM,EAEL,IACT,EAEC,UAAW,UAAY,CACtB,IAAIme,EAAS,CACZ,KAAM,KAAK,OACX,UAAW,KAAK,MACnB,EAEE,OAAI,KAAK,gBACRA,EAAO,SAAW,KAAK,cAGjBA,CACT,EAIC,UAAW,SAAUhiB,EAAO,CAC3B,YAAK,QAAQ,OAASA,EACtB,KAAK,cAAa,EACX,IACT,EAIC,UAAW,UAAY,CACtB,OAAO,KAAK,OACd,EAKC,WAAY,UAAY,CACvB,OAAO,KAAK,MACd,EAEC,WAAY,UAAY,CACvB,IAAIipB,EAAqB,KAAK,KAAK,UAAY,MAC3CnG,EAAM,KAAK,OAASmG,EAAqB,KAAK,KAAOxT,EAAe,KAAK,EAsB7E,GApBA/C,EAAiBoQ,EAAK,qBAAqB,EACvC,KAAK,eAAiBpQ,EAAiBoQ,EAAK,uBAAuB,EACnE,KAAK,QAAQ,WAAapQ,EAAiBoQ,EAAK,KAAK,QAAQ,SAAS,EAE1EA,EAAI,cAAgBzgB,EACpBygB,EAAI,YAAczgB,EAIlBygB,EAAI,OAASlR,EAAU,KAAK,KAAM,KAAM,MAAM,EAC9CkR,EAAI,QAAUlR,EAAU,KAAK,gBAAiB,KAAM,OAAO,GAEvD,KAAK,QAAQ,aAAe,KAAK,QAAQ,cAAgB,MAC5DkR,EAAI,YAAc,KAAK,QAAQ,cAAgB,GAAO,GAAK,KAAK,QAAQ,aAGrE,KAAK,QAAQ,QAChB,KAAK,cAAa,EAGfmG,EAAoB,CACvB,KAAK,KAAOnG,EAAI,IAChB,MACH,CAEEA,EAAI,IAAM,KAAK,KACfA,EAAI,IAAM,KAAK,QAAQ,GACzB,EAEC,aAAc,SAAUjgB,EAAG,CAC1B,IAAIuD,EAAQ,KAAK,KAAK,aAAavD,EAAE,IAAI,EACrCyL,EAAS,KAAK,KAAK,8BAA8B,KAAK,QAASzL,EAAE,KAAMA,EAAE,MAAM,EAAE,IAErFiW,GAAqB,KAAK,OAAQxK,EAAQlI,CAAK,CACjD,EAEC,OAAQ,UAAY,CACnB,IAAI8iB,EAAQ,KAAK,OACbrlB,EAAS,IAAIP,GACT,KAAK,KAAK,mBAAmB,KAAK,QAAQ,aAAY,CAAE,EACxD,KAAK,KAAK,mBAAmB,KAAK,QAAQ,aAAY,CAAE,CAAC,EAC7DyP,EAAOlP,EAAO,QAAO,EAEzB2N,GAAoB0X,EAAOrlB,EAAO,GAAG,EAErCqlB,EAAM,MAAM,MAASnW,EAAK,EAAI,KAC9BmW,EAAM,MAAM,OAASnW,EAAK,EAAI,IAChC,EAEC,eAAgB,UAAY,CAC3B0R,GAAmB,KAAK,OAAQ,KAAK,QAAQ,OAAO,CACtD,EAEC,cAAe,UAAY,CACtB,KAAK,QAAU,KAAK,QAAQ,SAAW,QAAa,KAAK,QAAQ,SAAW,OAC/E,KAAK,OAAO,MAAM,OAAS,KAAK,QAAQ,OAE3C,EAEC,gBAAiB,UAAY,CAG5B,KAAK,KAAK,OAAO,EAEjB,IAAI0E,EAAW,KAAK,QAAQ,gBACxBA,GAAY,KAAK,OAASA,IAC7B,KAAK,KAAOA,EACZ,KAAK,OAAO,IAAMA,EAErB,EAIC,UAAW,UAAY,CACtB,OAAO,KAAK,QAAQ,UAAS,CAC/B,CACA,CAAC,EAKUC,GAAe,SAAUP,EAAKhlB,EAAQtE,EAAS,CACzD,OAAO,IAAIqpB,GAAaC,EAAKhlB,EAAQtE,CAAO,CAC7C,ECtPW8pB,GAAeT,GAAa,OAAO,CAI7C,QAAS,CAIR,SAAU,GAIV,KAAM,GAKN,gBAAiB,GAIjB,MAAO,GAIP,YAAa,EACf,EAEC,WAAY,UAAY,CACvB,IAAIK,EAAqB,KAAK,KAAK,UAAY,QAC3CK,EAAM,KAAK,OAASL,EAAqB,KAAK,KAAOxT,EAAe,OAAO,EAa/E,GAXA/C,EAAiB4W,EAAK,qBAAqB,EACvC,KAAK,eAAiB5W,EAAiB4W,EAAK,uBAAuB,EACnE,KAAK,QAAQ,WAAa5W,EAAiB4W,EAAK,KAAK,QAAQ,SAAS,EAE1EA,EAAI,cAAgBjnB,EACpBinB,EAAI,YAAcjnB,EAIlBinB,EAAI,aAAe1X,EAAU,KAAK,KAAM,KAAM,MAAM,EAEhDqX,EAAoB,CAGvB,QAFIM,EAAiBD,EAAI,qBAAqB,QAAQ,EAClDE,EAAU,CAAA,EACLpsB,EAAI,EAAGA,EAAImsB,EAAe,OAAQnsB,IAC1CosB,EAAQ,KAAKD,EAAensB,GAAG,GAAG,EAGnC,KAAK,KAAQmsB,EAAe,OAAS,EAAKC,EAAU,CAACF,EAAI,GAAG,EAC5D,MACH,CAEO1nB,EAAa,KAAK,IAAI,IAAK,KAAK,KAAO,CAAC,KAAK,IAAI,GAElD,CAAC,KAAK,QAAQ,iBAAmB,OAAO,UAAU,eAAe,KAAK0nB,EAAI,MAAO,WAAW,IAC/FA,EAAI,MAAM,UAAe,QAE1BA,EAAI,SAAW,CAAC,CAAC,KAAK,QAAQ,SAC9BA,EAAI,KAAO,CAAC,CAAC,KAAK,QAAQ,KAC1BA,EAAI,MAAQ,CAAC,CAAC,KAAK,QAAQ,MAC3BA,EAAI,YAAc,CAAC,CAAC,KAAK,QAAQ,YACjC,QAASnsB,EAAI,EAAGA,EAAI,KAAK,KAAK,OAAQA,IAAK,CAC1C,IAAIssB,EAAShU,EAAe,QAAQ,EACpCgU,EAAO,IAAM,KAAK,KAAKtsB,GACvBmsB,EAAI,YAAYG,CAAM,CACzB,CACA,CAKA,CAAC,EAOM,SAASC,GAAaC,EAAO9lB,EAAQtE,EAAS,CACpD,OAAO,IAAI8pB,GAAaM,EAAO9lB,EAAQtE,CAAO,CAC/C,CChFU,IAACqqB,GAAahB,GAAa,OAAO,CAC3C,WAAY,UAAY,CACvB,IAAIxoB,EAAK,KAAK,OAAS,KAAK,KAE5BsS,EAAiBtS,EAAI,qBAAqB,EACtC,KAAK,eAAiBsS,EAAiBtS,EAAI,uBAAuB,EAClE,KAAK,QAAQ,WAAasS,EAAiBtS,EAAI,KAAK,QAAQ,SAAS,EAEzEA,EAAG,cAAgBiC,EACnBjC,EAAG,YAAciC,CACnB,CAKA,CAAC,EAOM,SAASwnB,GAAWzpB,EAAIyD,EAAQtE,EAAS,CAC/C,OAAO,IAAIqqB,GAAWxpB,EAAIyD,EAAQtE,CAAO,CAC1C,CCjCU,IAACuqB,GAAahI,GAAM,OAAO,CAIpC,QAAS,CAGR,YAAa,GAIb,OAAQ,CAAC,EAAG,CAAC,EAIb,UAAW,GAIX,KAAM,OAKN,QAAS,EACX,EAEC,WAAY,SAAUviB,EAASkqB,EAAQ,CAClClqB,IAAYA,aAAmBsF,IAAUjD,EAAarC,CAAO,IAChE,KAAK,QAAUuF,EAASvF,CAAO,EAC/B6B,EAAgB,KAAMqoB,CAAM,IAE5BroB,EAAgB,KAAM7B,CAAO,EAC7B,KAAK,QAAUkqB,GAEZ,KAAK,QAAQ,UAChB,KAAK,SAAW,KAAK,QAAQ,QAEhC,EAKC,OAAQ,SAAUrQ,EAAK,CACtB,OAAAA,EAAM,UAAU,OAASA,EAAM,KAAK,QAAQ,KACvCA,EAAI,SAAS,IAAI,GACrBA,EAAI,SAAS,IAAI,EAEX,IACT,EAMC,MAAO,UAAY,CAClB,OAAI,KAAK,MACR,KAAK,KAAK,YAAY,IAAI,EAEpB,IACT,EAMC,OAAQ,SAAUc,EAAO,CACxB,OAAI,KAAK,KACR,KAAK,MAAK,GAEN,UAAU,OACb,KAAK,QAAUA,EAEfA,EAAQ,KAAK,QAEd,KAAK,aAAY,EAGjB,KAAK,OAAOA,EAAM,IAAI,GAEhB,IACT,EAEC,MAAO,SAAUd,EAAK,CACrB,KAAK,cAAgBA,EAAI,cAEpB,KAAK,YACT,KAAK,YAAW,EAGbA,EAAI,eACPqL,GAAmB,KAAK,WAAY,CAAC,EAGtC,aAAa,KAAK,cAAc,EAChC,KAAK,QAAO,EAAG,YAAY,KAAK,UAAU,EAC1C,KAAK,OAAM,EAEPrL,EAAI,eACPqL,GAAmB,KAAK,WAAY,CAAC,EAGtC,KAAK,aAAY,EAEb,KAAK,QAAQ,cAChB/R,EAAiB,KAAK,WAAY,qBAAqB,EACvD,KAAK,qBAAqB,KAAK,UAAU,EAE5C,EAEC,SAAU,SAAU0G,EAAK,CACpBA,EAAI,eACPqL,GAAmB,KAAK,WAAY,CAAC,EACrC,KAAK,eAAiB,WAAW7S,EAAU2D,GAAgB,OAAW,KAAK,UAAU,EAAG,GAAG,GAE3FA,GAAe,KAAK,UAAU,EAG3B,KAAK,QAAQ,cAChBmD,GAAoB,KAAK,WAAY,qBAAqB,EAC1D,KAAK,wBAAwB,KAAK,UAAU,EAE/C,EAKC,UAAW,UAAY,CACtB,OAAO,KAAK,OACd,EAIC,UAAW,SAAUzS,EAAQ,CAC5B,YAAK,QAAUnB,EAASmB,CAAM,EAC1B,KAAK,OACR,KAAK,gBAAe,EACpB,KAAK,WAAU,GAET,IACT,EAIC,WAAY,UAAY,CACvB,OAAO,KAAK,QACd,EAKC,WAAY,SAAU8jB,EAAS,CAC9B,YAAK,SAAWA,EAChB,KAAK,OAAM,EACJ,IACT,EAIC,WAAY,UAAY,CACvB,OAAO,KAAK,UACd,EAIC,OAAQ,UAAY,CACd,KAAK,OAEV,KAAK,WAAW,MAAM,WAAa,SAEnC,KAAK,eAAc,EACnB,KAAK,cAAa,EAClB,KAAK,gBAAe,EAEpB,KAAK,WAAW,MAAM,WAAa,GAEnC,KAAK,WAAU,EACjB,EAEC,UAAW,UAAY,CACtB,IAAI/H,EAAS,CACZ,KAAM,KAAK,gBACX,UAAW,KAAK,eACnB,EAEE,OAAI,KAAK,gBACRA,EAAO,SAAW,KAAK,cAEjBA,CACT,EAIC,OAAQ,UAAY,CACnB,MAAO,CAAC,CAAC,KAAK,MAAQ,KAAK,KAAK,SAAS,IAAI,CAC/C,EAIC,aAAc,UAAY,CACzB,OAAI,KAAK,MACR+G,GAAgB,KAAK,UAAU,EAEzB,IACT,EAIC,YAAa,UAAY,CACxB,OAAI,KAAK,MACRC,GAAe,KAAK,UAAU,EAExB,IACT,EAGC,aAAc,SAAU/iB,EAAQ,CAC/B,IAAIwjB,EAAS,KAAK,QAClB,GAAI,CAACA,EAAO,KAAQ,MAAO,GAE3B,GAAIA,aAAkB/G,GAAc,CACnC+G,EAAS,KACT,IAAIjO,EAAS,KAAK,QAAQ,QAC1B,QAAS3a,KAAM2a,EACd,GAAIA,EAAO3a,GAAI,KAAM,CACpB4oB,EAASjO,EAAO3a,GAChB,KACL,CAEG,GAAI,CAAC4oB,EAAU,MAAO,GAGtB,KAAK,QAAUA,CAClB,CAEE,GAAI,CAACxjB,EACJ,GAAIwjB,EAAO,UACVxjB,EAASwjB,EAAO,UAAS,UACfA,EAAO,UACjBxjB,EAASwjB,EAAO,UAAS,UACfA,EAAO,UACjBxjB,EAASwjB,EAAO,UAAS,EAAG,UAAS,MAErC,OAAM,IAAI,MAAM,oCAAoC,EAGtD,YAAK,UAAUxjB,CAAM,EAEjB,KAAK,MAER,KAAK,OAAM,EAGL,EACT,EAEC,eAAgB,UAAY,CAC3B,GAAK,KAAK,SAEV,KAAI+jB,EAAO,KAAK,aACZD,EAAW,OAAO,KAAK,UAAa,WAAc,KAAK,SAAS,KAAK,SAAW,IAAI,EAAI,KAAK,SAEjG,GAAI,OAAOA,GAAY,SACtBC,EAAK,UAAYD,MACX,CACN,KAAOC,EAAK,cAAa,GACxBA,EAAK,YAAYA,EAAK,UAAU,EAEjCA,EAAK,YAAYD,CAAO,CAC3B,CAME,KAAK,KAAK,eAAe,EAC3B,EAEC,gBAAiB,UAAY,CAC5B,GAAK,KAAK,KAEV,KAAIxb,EAAM,KAAK,KAAK,mBAAmB,KAAK,OAAO,EAC/CD,EAASjL,EAAQ,KAAK,QAAQ,MAAM,EACpC2f,EAAS,KAAK,WAAU,EAExB,KAAK,cACRxR,GAAoB,KAAK,WAAYjD,EAAI,IAAIyU,CAAM,CAAC,EAEpD1U,EAASA,EAAO,IAAIC,CAAG,EAAE,IAAIyU,CAAM,EAGpC,IAAIqC,EAAS,KAAK,iBAAmB,CAAC/W,EAAO,EACzCkK,EAAO,KAAK,eAAiB,CAAC,KAAK,MAAM,KAAK,gBAAkB,CAAC,EAAIlK,EAAO,EAGhF,KAAK,WAAW,MAAM,OAAS+W,EAAS,KACxC,KAAK,WAAW,MAAM,KAAO7M,EAAO,KACtC,EAEC,WAAY,UAAY,CACvB,MAAO,CAAC,EAAG,CAAC,CACd,CAEA,CAAC,EAED7G,EAAI,QAAQ,CACX,aAAc,SAAUsY,EAAcF,EAAS9jB,EAAQ1G,EAAS,CAC/D,IAAIkb,EAAUsP,EACd,OAAMtP,aAAmBwP,IACxBxP,EAAU,IAAIwP,EAAa1qB,CAAO,EAAE,WAAWwqB,CAAO,GAEnD9jB,GACHwU,EAAQ,UAAUxU,CAAM,EAElBwU,CACT,CACA,CAAC,EAGDqH,GAAM,QAAQ,CACb,aAAc,SAAUmI,EAAcC,EAAKH,EAASxqB,EAAS,CAC5D,IAAIkb,EAAUsP,EACd,OAAItP,aAAmBwP,GACtB7oB,EAAgBqZ,EAASlb,CAAO,EAChCkb,EAAQ,QAAU,OAElBA,EAAWyP,GAAO,CAAC3qB,EAAW2qB,EAAM,IAAID,EAAa1qB,EAAS,IAAI,EAClEkb,EAAQ,WAAWsP,CAAO,GAEpBtP,CACT,CACA,CAAC,EChTS,IAAC0P,GAAQL,GAAW,OAAO,CAIpC,QAAS,CAGR,KAAM,YAIN,OAAQ,CAAC,EAAG,CAAC,EAIb,SAAU,IAIV,SAAU,GAOV,UAAW,KAKX,QAAS,GAKT,sBAAuB,KAKvB,0BAA2B,KAI3B,eAAgB,CAAC,EAAG,CAAC,EAKrB,WAAY,GAIZ,YAAa,GAKb,UAAW,GAKX,iBAAkB,GAQlB,UAAW,EACb,EAMC,OAAQ,SAAU1Q,EAAK,CACtB,OAAAA,EAAM,UAAU,OAASA,EAAM,KAAK,QAAQ,KAExC,CAACA,EAAI,SAAS,IAAI,GAAKA,EAAI,QAAUA,EAAI,OAAO,QAAQ,WAC3DA,EAAI,YAAYA,EAAI,MAAM,EAE3BA,EAAI,OAAS,KAEN0Q,GAAW,UAAU,OAAO,KAAK,KAAM1Q,CAAG,CACnD,EAEC,MAAO,SAAUA,EAAK,CACrB0Q,GAAW,UAAU,MAAM,KAAK,KAAM1Q,CAAG,EAMzCA,EAAI,KAAK,YAAa,CAAC,MAAO,IAAI,CAAC,EAE/B,KAAK,UAKR,KAAK,QAAQ,KAAK,YAAa,CAAC,MAAO,IAAI,EAAG,EAAI,EAG5C,KAAK,mBAAmBuL,IAC7B,KAAK,QAAQ,GAAG,WAAYyF,EAAwB,EAGxD,EAEC,SAAU,SAAUhR,EAAK,CACxB0Q,GAAW,UAAU,SAAS,KAAK,KAAM1Q,CAAG,EAM5CA,EAAI,KAAK,aAAc,CAAC,MAAO,IAAI,CAAC,EAEhC,KAAK,UAKR,KAAK,QAAQ,KAAK,aAAc,CAAC,MAAO,IAAI,EAAG,EAAI,EAC7C,KAAK,mBAAmBuL,IAC7B,KAAK,QAAQ,IAAI,WAAYyF,EAAwB,EAGzD,EAEC,UAAW,UAAY,CACtB,IAAIpI,EAAS8H,GAAW,UAAU,UAAU,KAAK,IAAI,EAErD,OAAI,KAAK,QAAQ,eAAiB,OAAY,KAAK,QAAQ,aAAe,KAAK,KAAK,QAAQ,qBAC3F9H,EAAO,SAAW,KAAK,OAGpB,KAAK,QAAQ,aAChBA,EAAO,QAAU,KAAK,YAGhBA,CACT,EAEC,YAAa,UAAY,CACxB,IAAItF,EAAS,gBACTtP,EAAY,KAAK,WAAaqI,EAAe,MAChDiH,EAAS,KAAO,KAAK,QAAQ,WAAa,IAC1C,wBAAwB,EAErB2N,EAAU,KAAK,SAAW5U,EAAe,MAAOiH,EAAS,mBAAoBtP,CAAS,EAU1F,GATA,KAAK,aAAeqI,EAAe,MAAOiH,EAAS,WAAY2N,CAAO,EAEtEhQ,GAAiCjN,CAAS,EAC1CkN,GAAkC,KAAK,YAAY,EACnDzL,EAAYzB,EAAW,cAAegd,EAAwB,EAE9D,KAAK,cAAgB3U,EAAe,MAAOiH,EAAS,iBAAkBtP,CAAS,EAC/E,KAAK,KAAOqI,EAAe,MAAOiH,EAAS,OAAQ,KAAK,aAAa,EAEjE,KAAK,QAAQ,YAAa,CAC7B,IAAI4N,EAAc,KAAK,aAAe7U,EAAe,IAAKiH,EAAS,gBAAiBtP,CAAS,EAC7Fkd,EAAY,aAAa,OAAQ,QAAQ,EACzCA,EAAY,aAAa,aAAc,aAAa,EACpDA,EAAY,KAAO,SACnBA,EAAY,UAAY,yCAExBzb,EAAYyb,EAAa,QAAS,SAAU3Z,EAAI,CAC/C9E,GAAwB8E,CAAE,EAC1B,KAAK,MAAK,CACd,EAAM,IAAI,CACV,CACA,EAEC,cAAe,UAAY,CAC1B,IAAIvD,EAAY,KAAK,aACjBlF,EAAQkF,EAAU,MAEtBlF,EAAM,MAAQ,GACdA,EAAM,WAAa,SAEnB,IAAIqiB,EAAQnd,EAAU,YACtBmd,EAAQ,KAAK,IAAIA,EAAO,KAAK,QAAQ,QAAQ,EAC7CA,EAAQ,KAAK,IAAIA,EAAO,KAAK,QAAQ,QAAQ,EAE7CriB,EAAM,MAASqiB,EAAQ,EAAK,KAC5BriB,EAAM,WAAa,GAEnBA,EAAM,OAAS,GAEf,IAAIsiB,EAASpd,EAAU,aACnBqd,EAAY,KAAK,QAAQ,UACzBC,EAAgB,yBAEhBD,GAAaD,EAASC,GACzBviB,EAAM,OAASuiB,EAAY,KAC3B/X,EAAiBtF,EAAWsd,CAAa,GAEzChS,GAAoBtL,EAAWsd,CAAa,EAG7C,KAAK,gBAAkB,KAAK,WAAW,WACzC,EAEC,aAAc,SAAU7nB,EAAG,CAC1B,IAAI0L,EAAM,KAAK,KAAK,uBAAuB,KAAK,QAAS1L,EAAE,KAAMA,EAAE,MAAM,EACrEmgB,EAAS,KAAK,WAAU,EAC5BxR,GAAoB,KAAK,WAAYjD,EAAI,IAAIyU,CAAM,CAAC,CACtD,EAEC,WAAY,UAAY,CACvB,GAAK,KAAK,QAAQ,QAKlB,IAJI,KAAK,KAAK,UAAY,KAAK,KAAK,SAAS,KAAI,EAI7C,KAAK,aAAc,CACtB,KAAK,aAAe,GACpB,MACH,CAEE,IAAI5J,EAAM,KAAK,KACXuR,EAAe,SAASjU,GAAiB,KAAK,WAAY,cAAc,EAAG,EAAE,GAAK,EAClFkU,EAAkB,KAAK,WAAW,aAAeD,EACjDE,EAAiB,KAAK,gBACtBC,EAAW,IAAI/nB,EAAM,KAAK,eAAgB,CAAC6nB,EAAkB,KAAK,gBAAgB,EAEtFE,EAAS,KAAK1Z,GAAoB,KAAK,UAAU,CAAC,EAElD,IAAI2Z,EAAe3R,EAAI,2BAA2B0R,CAAQ,EACtDnV,EAAUtS,EAAQ,KAAK,QAAQ,cAAc,EAC7C+O,EAAY/O,EAAQ,KAAK,QAAQ,uBAAyBsS,CAAO,EACjEtD,EAAYhP,EAAQ,KAAK,QAAQ,2BAA6BsS,CAAO,EACrE5C,EAAOqG,EAAI,QAAO,EAClBd,EAAK,EACLC,EAAK,EAELwS,EAAa,EAAIF,EAAiBxY,EAAU,EAAIU,EAAK,IACxDuF,EAAKyS,EAAa,EAAIF,EAAiB9X,EAAK,EAAIV,EAAU,GAEvD0Y,EAAa,EAAIzS,EAAKlG,EAAU,EAAI,IACvCkG,EAAKyS,EAAa,EAAI3Y,EAAU,GAE7B2Y,EAAa,EAAIH,EAAkBvY,EAAU,EAAIU,EAAK,IACzDwF,EAAKwS,EAAa,EAAIH,EAAkB7X,EAAK,EAAIV,EAAU,GAExD0Y,EAAa,EAAIxS,EAAKnG,EAAU,EAAI,IACvCmG,EAAKwS,EAAa,EAAI3Y,EAAU,IAO7BkG,GAAMC,KAEL,KAAK,QAAQ,aAChB,KAAK,aAAe,IAGrBa,EACK,KAAK,cAAc,EACnB,MAAM,CAACd,EAAIC,CAAE,CAAC,GAEtB,EAEC,WAAY,UAAY,CAEvB,OAAOlV,EAAQ,KAAK,SAAW,KAAK,QAAQ,gBAAkB,KAAK,QAAQ,gBAAe,EAAK,CAAC,EAAG,CAAC,CAAC,CACvG,CAEA,CAAC,EAQU2nB,GAAQ,SAAUzrB,EAASkqB,EAAQ,CAC7C,OAAO,IAAIU,GAAM5qB,EAASkqB,CAAM,CACjC,EAQA9X,EAAI,aAAa,CAChB,kBAAmB,EACpB,CAAC,EAKDA,EAAI,QAAQ,CAMX,UAAW,SAAUqZ,EAAO/kB,EAAQ1G,EAAS,CAC5C,YAAK,aAAa4qB,GAAOa,EAAO/kB,EAAQ1G,CAAO,EAC5C,OAAO,IAAI,EAEP,IACT,EAIC,WAAY,SAAUyrB,EAAO,CAC5B,OAAAA,EAAQ,UAAU,OAASA,EAAQ,KAAK,OACpCA,GACHA,EAAM,MAAK,EAEL,IACT,CACA,CAAC,EAkBDlJ,GAAM,QAAQ,CAMb,UAAW,SAAUiI,EAASxqB,EAAS,CACtC,YAAK,OAAS,KAAK,aAAa4qB,GAAO,KAAK,OAAQJ,EAASxqB,CAAO,EAC/D,KAAK,sBACT,KAAK,GAAG,CACP,MAAO,KAAK,WACZ,SAAU,KAAK,YACf,OAAQ,KAAK,WACb,KAAM,KAAK,UACf,CAAI,EACD,KAAK,oBAAsB,IAGrB,IACT,EAIC,YAAa,UAAY,CACxB,OAAI,KAAK,SACR,KAAK,IAAI,CACR,MAAO,KAAK,WACZ,SAAU,KAAK,YACf,OAAQ,KAAK,WACb,KAAM,KAAK,UACf,CAAI,EACD,KAAK,oBAAsB,GAC3B,KAAK,OAAS,MAER,IACT,EAIC,UAAW,SAAU0G,EAAQ,CAC5B,OAAI,KAAK,SACF,gBAAgByc,KACrB,KAAK,OAAO,QAAU,MAEnB,KAAK,OAAO,aAAazc,GAAU,KAAK,OAAO,GAElD,KAAK,OAAO,OAAO,KAAK,IAAI,GAGvB,IACT,EAIC,WAAY,UAAY,CACvB,OAAI,KAAK,QACR,KAAK,OAAO,MAAK,EAEX,IACT,EAIC,YAAa,UAAY,CACxB,OAAI,KAAK,QACR,KAAK,OAAO,OAAO,IAAI,EAEjB,IACT,EAIC,YAAa,UAAY,CACxB,OAAQ,KAAK,OAAS,KAAK,OAAO,OAAM,EAAK,EAC/C,EAIC,gBAAiB,SAAU8jB,EAAS,CACnC,OAAI,KAAK,QACR,KAAK,OAAO,WAAWA,CAAO,EAExB,IACT,EAIC,SAAU,UAAY,CACrB,OAAO,KAAK,MACd,EAEC,WAAY,SAAUlnB,EAAG,CACxB,GAAI,GAAC,KAAK,QAAU,CAAC,KAAK,MAI1BgZ,CAAAA,GAAchZ,CAAC,EAEf,IAAI4P,EAAS5P,EAAE,OAASA,EAAE,OAC1B,GAAI,KAAK,OAAO,UAAY4P,GAAU,EAAEA,aAAkBkS,IAAO,CAG5D,KAAK,KAAK,SAAS,KAAK,MAAM,EACjC,KAAK,WAAU,EAEf,KAAK,UAAU9hB,EAAE,MAAM,EAExB,MACH,CACE,KAAK,OAAO,QAAU4P,EACtB,KAAK,UAAU5P,EAAE,MAAM,EACzB,EAEC,WAAY,SAAUA,EAAG,CACxB,KAAK,OAAO,UAAUA,EAAE,MAAM,CAChC,EAEC,YAAa,SAAUA,EAAG,CACrBA,EAAE,cAAc,UAAY,IAC/B,KAAK,WAAWA,CAAC,CAEpB,CACA,CAAC,ECxcS,IAACooB,GAAUnB,GAAW,OAAO,CAItC,QAAS,CAGR,KAAM,cAIN,OAAQ,CAAC,EAAG,CAAC,EAOb,UAAW,OAIX,UAAW,GAIX,OAAQ,GAIR,QAAS,EACX,EAEC,MAAO,SAAU1Q,EAAK,CACrB0Q,GAAW,UAAU,MAAM,KAAK,KAAM1Q,CAAG,EACzC,KAAK,WAAW,KAAK,QAAQ,OAAO,EAMpCA,EAAI,KAAK,cAAe,CAAC,QAAS,IAAI,CAAC,EAEnC,KAAK,UACR,KAAK,eAAe,KAAK,OAAO,EAMhC,KAAK,QAAQ,KAAK,cAAe,CAAC,QAAS,IAAI,EAAG,EAAI,EAEzD,EAEC,SAAU,SAAUA,EAAK,CACxB0Q,GAAW,UAAU,SAAS,KAAK,KAAM1Q,CAAG,EAM5CA,EAAI,KAAK,eAAgB,CAAC,QAAS,IAAI,CAAC,EAEpC,KAAK,UACR,KAAK,kBAAkB,KAAK,OAAO,EAMnC,KAAK,QAAQ,KAAK,eAAgB,CAAC,QAAS,IAAI,EAAG,EAAI,EAE1D,EAEC,UAAW,UAAY,CACtB,IAAI4I,EAAS8H,GAAW,UAAU,UAAU,KAAK,IAAI,EAErD,OAAK,KAAK,QAAQ,YACjB9H,EAAO,SAAW,KAAK,OAGjBA,CACT,EAEC,YAAa,UAAY,CACxB,IAAItF,EAAS,kBACTvP,EAAYuP,EAAS,KAAO,KAAK,QAAQ,WAAa,IAAM,kBAAoB,KAAK,cAAgB,WAAa,QAEtH,KAAK,aAAe,KAAK,WAAajH,EAAe,MAAOtI,CAAS,EAErE,KAAK,WAAW,aAAa,OAAQ,SAAS,EAC9C,KAAK,WAAW,aAAa,KAAM,mBAAqBvK,EAAW,IAAI,CAAC,CAC1E,EAEC,cAAe,UAAY,CAAA,EAE3B,WAAY,UAAY,CAAA,EAExB,aAAc,SAAU2L,EAAK,CAC5B,IAAI2c,EAAMC,EACN/R,EAAM,KAAK,KACXhM,EAAY,KAAK,WACjB0K,EAAcsB,EAAI,uBAAuBA,EAAI,UAAS,CAAE,EACxDgS,EAAehS,EAAI,2BAA2B7K,CAAG,EACjD8c,EAAY,KAAK,QAAQ,UACzBC,EAAele,EAAU,YACzBme,EAAgBne,EAAU,aAC1BkB,EAASjL,EAAQ,KAAK,QAAQ,MAAM,EACpC2f,EAAS,KAAK,WAAU,EAExBqI,IAAc,OACjBH,EAAOI,EAAe,EACtBH,EAAOI,GACGF,IAAc,UACxBH,EAAOI,EAAe,EACtBH,EAAO,GACGE,IAAc,UACxBH,EAAOI,EAAe,EACtBH,EAAOI,EAAgB,GACbF,IAAc,SACxBH,EAAO,EACPC,EAAOI,EAAgB,GACbF,IAAc,QACxBH,EAAOI,EACPH,EAAOI,EAAgB,GACbH,EAAa,EAAItT,EAAY,GACvCuT,EAAY,QACZH,EAAO,EACPC,EAAOI,EAAgB,IAEvBF,EAAY,OACZH,EAAOI,GAAgBhd,EAAO,EAAI0U,EAAO,GAAK,EAC9CmI,EAAOI,EAAgB,GAGxBhd,EAAMA,EAAI,SAASlL,EAAQ6nB,EAAMC,EAAM,EAAI,CAAC,EAAE,IAAI7c,CAAM,EAAE,IAAI0U,CAAM,EAEpEtK,GAAoBtL,EAAW,uBAAuB,EACtDsL,GAAoBtL,EAAW,sBAAsB,EACrDsL,GAAoBtL,EAAW,qBAAqB,EACpDsL,GAAoBtL,EAAW,wBAAwB,EACvDsF,EAAiBtF,EAAW,mBAAqBie,CAAS,EAC1D7Z,GAAoBpE,EAAWmB,CAAG,CACpC,EAEC,gBAAiB,UAAY,CAC5B,IAAIA,EAAM,KAAK,KAAK,mBAAmB,KAAK,OAAO,EACnD,KAAK,aAAaA,CAAG,CACvB,EAEC,WAAY,SAAUiW,EAAS,CAC9B,KAAK,QAAQ,QAAUA,EAEnB,KAAK,YACRC,GAAmB,KAAK,WAAYD,CAAO,CAE9C,EAEC,aAAc,SAAU3hB,EAAG,CAC1B,IAAI0L,EAAM,KAAK,KAAK,uBAAuB,KAAK,QAAS1L,EAAE,KAAMA,EAAE,MAAM,EACzE,KAAK,aAAa0L,CAAG,CACvB,EAEC,WAAY,UAAY,CAEvB,OAAOlL,EAAQ,KAAK,SAAW,KAAK,QAAQ,mBAAqB,CAAC,KAAK,QAAQ,OAAS,KAAK,QAAQ,kBAAiB,EAAK,CAAC,EAAG,CAAC,CAAC,CACnI,CAEA,CAAC,EAQUmoB,GAAU,SAAUjsB,EAASkqB,EAAQ,CAC/C,OAAO,IAAIwB,GAAQ1rB,EAASkqB,CAAM,CACnC,EAIA9X,EAAI,QAAQ,CAOX,YAAa,SAAU6Z,EAASvlB,EAAQ1G,EAAS,CAChD,YAAK,aAAa0rB,GAASO,EAASvlB,EAAQ1G,CAAO,EAChD,OAAO,IAAI,EAEP,IACT,EAIC,aAAc,SAAUisB,EAAS,CAChC,OAAAA,EAAQ,MAAK,EACN,IACT,CAEA,CAAC,EAgBD1J,GAAM,QAAQ,CAMb,YAAa,SAAUiI,EAASxqB,EAAS,CAExC,OAAI,KAAK,UAAY,KAAK,cAAa,GACtC,KAAK,cAAa,EAGnB,KAAK,SAAW,KAAK,aAAa0rB,GAAS,KAAK,SAAUlB,EAASxqB,CAAO,EAC1E,KAAK,yBAAwB,EAEzB,KAAK,SAAS,QAAQ,WAAa,KAAK,MAAQ,KAAK,KAAK,SAAS,IAAI,GAC1E,KAAK,YAAW,EAGV,IACT,EAIC,cAAe,UAAY,CAC1B,OAAI,KAAK,WACR,KAAK,yBAAyB,EAAI,EAClC,KAAK,aAAY,EACjB,KAAK,SAAW,MAEV,IACT,EAEC,yBAA0B,SAAU8N,EAAQ,CAC3C,GAAI,GAACA,GAAU,KAAK,uBACpB,KAAI2J,EAAQ3J,EAAS,MAAQ,KACzB2U,EAAS,CACZ,OAAQ,KAAK,aACb,KAAM,KAAK,YACd,EACO,KAAK,SAAS,QAAQ,UAU1BA,EAAO,IAAM,KAAK,cATlBA,EAAO,UAAY,KAAK,aACxBA,EAAO,SAAW,KAAK,aACvBA,EAAO,MAAQ,KAAK,aAChB,KAAK,KACR,KAAK,mBAAkB,EAEvBA,EAAO,IAAM,KAAK,oBAKhB,KAAK,SAAS,QAAQ,SACzBA,EAAO,UAAY,KAAK,cAEzB,KAAKhL,GAAOgL,CAAM,EAClB,KAAK,sBAAwB,CAAC3U,EAChC,EAIC,YAAa,SAAUpH,EAAQ,CAC9B,OAAI,KAAK,WACF,gBAAgByc,KACrB,KAAK,SAAS,QAAU,MAErB,KAAK,SAAS,aAAazc,CAAM,IAEpC,KAAK,SAAS,OAAO,KAAK,IAAI,EAE1B,KAAK,WACR,KAAK,2BAA2B,IAAI,EAC1B,KAAK,WACf,KAAK,UAAU,KAAK,2BAA4B,IAAI,IAIhD,IACT,EAIC,aAAc,UAAY,CACzB,GAAI,KAAK,SACR,OAAO,KAAK,SAAS,MAAK,CAE7B,EAIC,cAAe,UAAY,CAC1B,OAAI,KAAK,UACR,KAAK,SAAS,OAAO,IAAI,EAEnB,IACT,EAIC,cAAe,UAAY,CAC1B,OAAO,KAAK,SAAS,OAAM,CAC7B,EAIC,kBAAmB,SAAU8jB,EAAS,CACrC,OAAI,KAAK,UACR,KAAK,SAAS,WAAWA,CAAO,EAE1B,IACT,EAIC,WAAY,UAAY,CACvB,OAAO,KAAK,QACd,EAEC,mBAAoB,UAAY,CAC3B,KAAK,WACR,KAAK,0BAA0B,IAAI,EACzB,KAAK,WACf,KAAK,UAAU,KAAK,0BAA2B,IAAI,CAEtD,EAEC,0BAA2B,SAAU7P,EAAO,CAC3C,IAAI9Z,EAAK,OAAO8Z,EAAM,YAAe,YAAcA,EAAM,WAAU,EAC/D9Z,IACHyO,EAAYzO,EAAI,QAAS,UAAY,CACpC,KAAK,SAAS,QAAU8Z,EACxB,KAAK,YAAW,CACpB,EAAM,IAAI,EACPrL,EAAYzO,EAAI,OAAQ,KAAK,aAAc,IAAI,EAElD,EAEC,2BAA4B,SAAU8Z,EAAO,CAC5C,IAAI9Z,EAAK,OAAO8Z,EAAM,YAAe,YAAcA,EAAM,WAAU,EAC/D9Z,GACHA,EAAG,aAAa,mBAAoB,KAAK,SAAS,WAAW,EAAE,CAElE,EAGC,aAAc,SAAUyC,EAAG,CAC1B,GAAI,GAAC,KAAK,UAAY,CAAC,KAAK,MAK5B,IAAI,KAAK,KAAK,UAAY,KAAK,KAAK,SAAS,OAAM,GAAM,CAAC,KAAK,cAAe,CAC7E,KAAK,cAAgB,GACrB,IAAI0Y,EAAO,KACX,KAAK,KAAK,KAAK,UAAW,UAAY,CACrCA,EAAK,cAAgB,GACrBA,EAAK,aAAa1Y,CAAC,CACvB,CAAI,EACD,MACH,CAEE,KAAK,SAAS,QAAUA,EAAE,OAASA,EAAE,OAErC,KAAK,YAAY,KAAK,SAAS,QAAQ,OAASA,EAAE,OAAS,MAAS,EACtE,EAEC,aAAc,SAAUA,EAAG,CAC1B,IAAIoD,EAASpD,EAAE,OAAQqP,EAAgBoE,EACnC,KAAK,SAAS,QAAQ,QAAUzT,EAAE,gBACrCqP,EAAiB,KAAK,KAAK,2BAA2BrP,EAAE,aAAa,EACrEyT,EAAa,KAAK,KAAK,2BAA2BpE,CAAc,EAChEjM,EAAS,KAAK,KAAK,mBAAmBqQ,CAAU,GAEjD,KAAK,SAAS,UAAUrQ,CAAM,CAChC,CACA,CAAC,ECpaS,IAACwlB,GAAU7I,GAAK,OAAO,CAChC,QAAS,CAGR,SAAU,CAAC,GAAI,EAAE,EAQjB,KAAM,GAIN,MAAO,KAEP,UAAW,kBACb,EAEC,WAAY,SAAUC,EAAS,CAC9B,IAAItY,EAAOsY,GAAWA,EAAQ,UAAY,MAASA,EAAU,SAAS,cAAc,KAAK,EACrFtjB,EAAU,KAAK,QASnB,GAPIA,EAAQ,gBAAgB,SAC3BgO,GAAMhD,CAAG,EACTA,EAAI,YAAYhL,EAAQ,IAAI,GAE5BgL,EAAI,UAAYhL,EAAQ,OAAS,GAAQA,EAAQ,KAAO,GAGrDA,EAAQ,MAAO,CAClB,IAAImsB,EAAQtoB,EAAM7D,EAAQ,KAAK,EAC/BgL,EAAI,MAAM,mBAAsB,CAACmhB,EAAM,EAAK,MAAS,CAACA,EAAM,EAAK,IACpE,CACE,YAAK,eAAenhB,EAAK,MAAM,EAExBA,CACT,EAEC,aAAc,UAAY,CACzB,OAAO,IACT,CACA,CAAC,EAIM,SAASohB,GAAQpsB,EAAS,CAChC,OAAO,IAAIksB,GAAQlsB,CAAO,CAC3B,CCtEAqjB,GAAK,QAAUM,GCuEL,IAAC0I,GAAY9J,GAAM,OAAO,CAInC,QAAS,CAGR,SAAU,IAIV,QAAS,EAOT,eAAgB7Z,EAAQ,OAIxB,kBAAmB,GAInB,eAAgB,IAIhB,OAAQ,EAIR,OAAQ,KAIR,QAAS,EAIT,QAAS,OAMT,cAAe,OAMf,cAAe,OAQf,OAAQ,GAIR,KAAM,WAIN,UAAW,GAIX,WAAY,CACd,EAEC,WAAY,SAAU1I,EAAS,CAC9B6B,EAAgB,KAAM7B,CAAO,CAC/B,EAEC,MAAO,UAAY,CAClB,KAAK,eAAc,EAEnB,KAAK,QAAU,CAAA,EACf,KAAK,OAAS,CAAA,EAEd,KAAK,WAAU,CACjB,EAEC,UAAW,SAAU6Z,EAAK,CACzBA,EAAI,cAAc,IAAI,CACxB,EAEC,SAAU,SAAUA,EAAK,CACxB,KAAK,gBAAe,EACpB7D,GAAe,KAAK,UAAU,EAC9B6D,EAAI,iBAAiB,IAAI,EACzB,KAAK,WAAa,KAClB,KAAK,UAAY,MACnB,EAIC,aAAc,UAAY,CACzB,OAAI,KAAK,OACR2P,GAAgB,KAAK,UAAU,EAC/B,KAAK,eAAe,KAAK,GAAG,GAEtB,IACT,EAIC,YAAa,UAAY,CACxB,OAAI,KAAK,OACRC,GAAe,KAAK,UAAU,EAC9B,KAAK,eAAe,KAAK,GAAG,GAEtB,IACT,EAIC,aAAc,UAAY,CACzB,OAAO,KAAK,UACd,EAIC,WAAY,SAAUxE,EAAS,CAC9B,YAAK,QAAQ,QAAUA,EACvB,KAAK,eAAc,EACZ,IACT,EAIC,UAAW,SAAUhC,EAAQ,CAC5B,YAAK,QAAQ,OAASA,EACtB,KAAK,cAAa,EAEX,IACT,EAIC,UAAW,UAAY,CACtB,OAAO,KAAK,QACd,EAIC,OAAQ,UAAY,CACnB,GAAI,KAAK,KAAM,CACd,KAAK,gBAAe,EACpB,IAAIqJ,EAAW,KAAK,WAAW,KAAK,KAAK,QAAO,CAAE,EAC9CA,IAAa,KAAK,YACrB,KAAK,UAAYA,EACjB,KAAK,cAAa,GAEnB,KAAK,QAAO,CACf,CACE,OAAO,IACT,EAEC,UAAW,UAAY,CACtB,IAAI7J,EAAS,CACZ,aAAc,KAAK,eACnB,UAAW,KAAK,WAChB,KAAM,KAAK,WACX,QAAS,KAAK,UACjB,EAEE,OAAK,KAAK,QAAQ,iBAEZ,KAAK,UACT,KAAK,QAAU8J,EAAc,KAAK,WAAY,KAAK,QAAQ,eAAgB,IAAI,GAGhF9J,EAAO,KAAO,KAAK,SAGhB,KAAK,gBACRA,EAAO,SAAW,KAAK,cAGjBA,CACT,EAQC,WAAY,UAAY,CACvB,OAAO,SAAS,cAAc,KAAK,CACrC,EAKC,YAAa,UAAY,CACxB,IAAI7N,EAAI,KAAK,QAAQ,SACrB,OAAOA,aAAapR,EAAQoR,EAAI,IAAIpR,EAAMoR,EAAGA,CAAC,CAChD,EAEC,cAAe,UAAY,CACtB,KAAK,YAAc,KAAK,QAAQ,SAAW,QAAa,KAAK,QAAQ,SAAW,OACnF,KAAK,WAAW,MAAM,OAAS,KAAK,QAAQ,OAE/C,EAEC,eAAgB,SAAU4X,EAAS,CAMlC,QAHIvQ,EAAS,KAAK,QAAO,EAAG,SACxBwQ,EAAa,CAACD,EAAQ,KAAW,GAAQ,EAEpC5uB,EAAI,EAAGE,EAAMme,EAAO,OAAQgH,EAAQrlB,EAAIE,EAAKF,IAErDqlB,EAAShH,EAAOre,GAAG,MAAM,OAErBqe,EAAOre,KAAO,KAAK,YAAcqlB,IACpCwJ,EAAaD,EAAQC,EAAY,CAACxJ,CAAM,GAItC,SAASwJ,CAAU,IACtB,KAAK,QAAQ,OAASA,EAAaD,EAAQ,GAAI,CAAC,EAChD,KAAK,cAAa,EAErB,EAEC,eAAgB,UAAY,CAC3B,GAAK,KAAK,MAGN,CAAA9jB,EAAQ,MAEZwc,CAAAA,GAAmB,KAAK,WAAY,KAAK,QAAQ,OAAO,EAExD,IAAIjY,EAAM,CAAC,IAAI,KACXyf,EAAY,GACZC,EAAY,GAEhB,QAASnsB,KAAO,KAAK,OAAQ,CAC5B,IAAIosB,EAAO,KAAK,OAAOpsB,GACvB,GAAI,GAACosB,EAAK,SAAW,CAACA,EAAK,QAE3B,KAAIC,EAAO,KAAK,IAAI,GAAI5f,EAAM2f,EAAK,QAAU,GAAG,EAEhD1H,GAAmB0H,EAAK,GAAIC,CAAI,EAC5BA,EAAO,EACVH,EAAY,IAERE,EAAK,OACRD,EAAY,GAEZ,KAAK,cAAcC,CAAI,EAExBA,EAAK,OAAS,IAElB,CAEMD,GAAa,CAAC,KAAK,UAAY,KAAK,YAAW,EAE/CD,IACHxa,EAAqB,KAAK,UAAU,EACpC,KAAK,WAAaJ,EAAsB,KAAK,eAAgB,IAAI,GAEpE,EAEC,cAAehP,EAEf,eAAgB,UAAY,CACvB,KAAK,aAET,KAAK,WAAaoT,EAAe,MAAO,kBAAoB,KAAK,QAAQ,WAAa,GAAG,EACzF,KAAK,cAAa,EAEd,KAAK,QAAQ,QAAU,GAC1B,KAAK,eAAc,EAGpB,KAAK,QAAO,EAAG,YAAY,KAAK,UAAU,EAC5C,EAEC,cAAe,UAAY,CAE1B,IAAIvP,EAAO,KAAK,UACZic,EAAU,KAAK,QAAQ,QAE3B,GAAIjc,IAAS,OAEb,SAAS6S,KAAK,KAAK,QAClBA,EAAI,OAAOA,CAAC,EACR,KAAK,QAAQA,GAAG,GAAG,SAAS,QAAUA,IAAM7S,GAC/C,KAAK,QAAQ6S,GAAG,GAAG,MAAM,OAASoJ,EAAU,KAAK,IAAIjc,EAAO6S,CAAC,EAC7D,KAAK,eAAeA,CAAC,IAErBxD,GAAe,KAAK,QAAQwD,GAAG,EAAE,EACjC,KAAK,mBAAmBA,CAAC,EACzB,KAAK,eAAeA,CAAC,EACrB,OAAO,KAAK,QAAQA,IAItB,IAAIsT,EAAQ,KAAK,QAAQnmB,GACrBkT,EAAM,KAAK,KAEf,OAAKiT,IACJA,EAAQ,KAAK,QAAQnmB,GAAQ,CAAA,EAE7BmmB,EAAM,GAAK5W,EAAe,MAAO,+CAAgD,KAAK,UAAU,EAChG4W,EAAM,GAAG,MAAM,OAASlK,EAExBkK,EAAM,OAASjT,EAAI,QAAQA,EAAI,UAAUA,EAAI,eAAc,CAAE,EAAGlT,CAAI,EAAE,MAAK,EAC3EmmB,EAAM,KAAOnmB,EAEb,KAAK,kBAAkBmmB,EAAOjT,EAAI,UAAS,EAAIA,EAAI,QAAO,CAAE,EAG5D/W,EAAagqB,EAAM,GAAG,WAAW,EAEjC,KAAK,eAAeA,CAAK,GAG1B,KAAK,OAASA,EAEPA,EACT,EAEC,eAAgBhqB,EAEhB,eAAgBA,EAEhB,eAAgBA,EAEhB,YAAa,UAAY,CACxB,GAAK,KAAK,KAIV,KAAItC,EAAKosB,EAELjmB,EAAO,KAAK,KAAK,QAAO,EAC5B,GAAIA,EAAO,KAAK,QAAQ,SACvBA,EAAO,KAAK,QAAQ,QAAS,CAC7B,KAAK,gBAAe,EACpB,MACH,CAEE,IAAKnG,KAAO,KAAK,OAChBosB,EAAO,KAAK,OAAOpsB,GACnBosB,EAAK,OAASA,EAAK,QAGpB,IAAKpsB,KAAO,KAAK,OAEhB,GADAosB,EAAO,KAAK,OAAOpsB,GACfosB,EAAK,SAAW,CAACA,EAAK,OAAQ,CACjC,IAAIpN,EAASoN,EAAK,OACb,KAAK,cAAcpN,EAAO,EAAGA,EAAO,EAAGA,EAAO,EAAGA,EAAO,EAAI,CAAC,GACjE,KAAK,gBAAgBA,EAAO,EAAGA,EAAO,EAAGA,EAAO,EAAGA,EAAO,EAAI,CAAC,CAEpE,CAGE,IAAKhf,KAAO,KAAK,OACX,KAAK,OAAOA,GAAK,QACrB,KAAK,YAAYA,CAAG,EAGxB,EAEC,mBAAoB,SAAUmG,EAAM,CACnC,QAASnG,KAAO,KAAK,OAChB,KAAK,OAAOA,GAAK,OAAO,IAAMmG,GAGlC,KAAK,YAAYnG,CAAG,CAEvB,EAEC,gBAAiB,UAAY,CAC5B,QAASA,KAAO,KAAK,OACpB,KAAK,YAAYA,CAAG,CAEvB,EAEC,eAAgB,UAAY,CAC3B,QAASgZ,KAAK,KAAK,QAClBxD,GAAe,KAAK,QAAQwD,GAAG,EAAE,EACjC,KAAK,eAAe,OAAOA,CAAC,CAAC,EAC7B,OAAO,KAAK,QAAQA,GAErB,KAAK,gBAAe,EAEpB,KAAK,UAAY,MACnB,EAEC,cAAe,SAAUva,EAAGwE,EAAG+V,EAAGmJ,EAAS,CAC1C,IAAIoK,EAAK,KAAK,MAAM9tB,EAAI,CAAC,EACrB+tB,EAAK,KAAK,MAAMvpB,EAAI,CAAC,EACrBwpB,EAAKzT,EAAI,EACT0T,EAAU,IAAI1pB,EAAM,CAACupB,EAAI,CAACC,CAAE,EAChCE,EAAQ,EAAI,CAACD,EAEb,IAAIzsB,EAAM,KAAK,iBAAiB0sB,CAAO,EACnCN,EAAO,KAAK,OAAOpsB,GAEvB,OAAIosB,GAAQA,EAAK,QAChBA,EAAK,OAAS,GACP,KAEGA,GAAQA,EAAK,SACvBA,EAAK,OAAS,IAGXK,EAAKtK,EACD,KAAK,cAAcoK,EAAIC,EAAIC,EAAItK,CAAO,EAGvC,GACT,EAEC,gBAAiB,SAAU1jB,EAAGwE,EAAG+V,EAAGoJ,EAAS,CAE5C,QAAShlB,EAAI,EAAIqB,EAAGrB,EAAI,EAAIqB,EAAI,EAAGrB,IAClC,QAASC,EAAI,EAAI4F,EAAG5F,EAAI,EAAI4F,EAAI,EAAG5F,IAAK,CAEvC,IAAI2hB,EAAS,IAAIhc,EAAM5F,EAAGC,CAAC,EAC3B2hB,EAAO,EAAIhG,EAAI,EAEf,IAAIhZ,EAAM,KAAK,iBAAiBgf,CAAM,EAClCoN,EAAO,KAAK,OAAOpsB,GAEvB,GAAIosB,GAAQA,EAAK,OAAQ,CACxBA,EAAK,OAAS,GACd,QAEL,MAAeA,GAAQA,EAAK,SACvBA,EAAK,OAAS,IAGXpT,EAAI,EAAIoJ,GACX,KAAK,gBAAgBhlB,EAAGC,EAAG2b,EAAI,EAAGoJ,CAAO,CAE9C,CAEA,EAEC,WAAY,SAAUtf,EAAG,CACxB,IAAI6pB,EAAY7pB,IAAMA,EAAE,OAASA,EAAE,OACnC,KAAK,SAAS,KAAK,KAAK,UAAS,EAAI,KAAK,KAAK,QAAO,EAAI6pB,EAAWA,CAAS,CAChF,EAEC,aAAc,SAAU7pB,EAAG,CAC1B,KAAK,SAASA,EAAE,OAAQA,EAAE,KAAM,GAAMA,EAAE,QAAQ,CAClD,EAEC,WAAY,SAAUqD,EAAM,CAC3B,IAAI3G,EAAU,KAAK,QAEnB,OAAkBA,EAAQ,gBAAtB,QAAuC2G,EAAO3G,EAAQ,cAClDA,EAAQ,cAGEA,EAAQ,gBAAtB,QAAuCA,EAAQ,cAAgB2G,EAC3D3G,EAAQ,cAGT2G,CACT,EAEC,SAAU,SAAUK,EAAQL,EAAMymB,EAAS1T,EAAU,CACpD,IAAI4S,EAAW,KAAK,MAAM3lB,CAAI,EACzB,KAAK,QAAQ,UAAY,QAAa2lB,EAAW,KAAK,QAAQ,SAC9D,KAAK,QAAQ,UAAY,QAAaA,EAAW,KAAK,QAAQ,QAClEA,EAAW,OAEXA,EAAW,KAAK,WAAWA,CAAQ,EAGpC,IAAIe,EAAkB,KAAK,QAAQ,mBAAsBf,IAAa,KAAK,WAEvE,CAAC5S,GAAY2T,KAEhB,KAAK,UAAYf,EAEb,KAAK,eACR,KAAK,cAAa,EAGnB,KAAK,cAAa,EAClB,KAAK,WAAU,EAEXA,IAAa,QAChB,KAAK,QAAQtlB,CAAM,EAGfomB,GACJ,KAAK,YAAW,EAKjB,KAAK,SAAW,CAAC,CAACA,GAGnB,KAAK,mBAAmBpmB,EAAQL,CAAI,CACtC,EAEC,mBAAoB,SAAUK,EAAQL,EAAM,CAC3C,QAAS/I,KAAK,KAAK,QAClB,KAAK,kBAAkB,KAAK,QAAQA,GAAIoJ,EAAQL,CAAI,CAEvD,EAEC,kBAAmB,SAAUmmB,EAAO9lB,EAAQL,EAAM,CACjD,IAAIE,EAAQ,KAAK,KAAK,aAAaF,EAAMmmB,EAAM,IAAI,EAC/CQ,EAAYR,EAAM,OAAO,WAAWjmB,CAAK,EACpC,SAAS,KAAK,KAAK,mBAAmBG,EAAQL,CAAI,CAAC,EAAE,MAAK,EAE/D+B,EAAQ,MACX6Q,GAAqBuT,EAAM,GAAIQ,EAAWzmB,CAAK,EAE/CoL,GAAoB6a,EAAM,GAAIQ,CAAS,CAE1C,EAEC,WAAY,UAAY,CACvB,IAAIzT,EAAM,KAAK,KACX/C,EAAM+C,EAAI,QAAQ,IAClB0T,EAAW,KAAK,UAAY,KAAK,YAAW,EAC5CjB,EAAW,KAAK,UAEhBhoB,EAAS,KAAK,KAAK,oBAAoB,KAAK,SAAS,EACrDA,IACH,KAAK,iBAAmB,KAAK,qBAAqBA,CAAM,GAGzD,KAAK,OAASwS,EAAI,SAAW,CAAC,KAAK,QAAQ,QAAU,CACpD,KAAK,MAAM+C,EAAI,QAAQ,CAAC,EAAG/C,EAAI,QAAQ,EAAE,EAAGwV,CAAQ,EAAE,EAAIiB,EAAS,CAAC,EACpE,KAAK,KAAK1T,EAAI,QAAQ,CAAC,EAAG/C,EAAI,QAAQ,EAAE,EAAGwV,CAAQ,EAAE,EAAIiB,EAAS,CAAC,CACtE,EACE,KAAK,OAASzW,EAAI,SAAW,CAAC,KAAK,QAAQ,QAAU,CACpD,KAAK,MAAM+C,EAAI,QAAQ,CAAC/C,EAAI,QAAQ,GAAI,CAAC,EAAGwV,CAAQ,EAAE,EAAIiB,EAAS,CAAC,EACpE,KAAK,KAAK1T,EAAI,QAAQ,CAAC/C,EAAI,QAAQ,GAAI,CAAC,EAAGwV,CAAQ,EAAE,EAAIiB,EAAS,CAAC,CACtE,CACA,EAEC,WAAY,UAAY,CACnB,CAAC,KAAK,MAAQ,KAAK,KAAK,gBAE5B,KAAK,QAAO,CACd,EAEC,qBAAsB,SAAUvmB,EAAQ,CACvC,IAAI6S,EAAM,KAAK,KACX2T,EAAU3T,EAAI,eAAiB,KAAK,IAAIA,EAAI,eAAgBA,EAAI,QAAO,CAAE,EAAIA,EAAI,QAAO,EACxFhT,EAAQgT,EAAI,aAAa2T,EAAS,KAAK,SAAS,EAChDrY,EAAc0E,EAAI,QAAQ7S,EAAQ,KAAK,SAAS,EAAE,MAAK,EACvDymB,EAAW5T,EAAI,QAAO,EAAG,SAAShT,EAAQ,CAAC,EAE/C,OAAO,IAAI9C,GAAOoR,EAAY,SAASsY,CAAQ,EAAGtY,EAAY,IAAIsY,CAAQ,CAAC,CAC7E,EAGC,QAAS,SAAUzmB,EAAQ,CAC1B,IAAI6S,EAAM,KAAK,KACf,GAAKA,EACL,KAAIlT,EAAO,KAAK,WAAWkT,EAAI,QAAO,CAAE,EAGxC,GADI7S,IAAW,SAAaA,EAAS6S,EAAI,UAAS,GAC9C,KAAK,YAAc,OAEvB,KAAIxE,EAAc,KAAK,qBAAqBrO,CAAM,EAC9C0mB,EAAY,KAAK,qBAAqBrY,CAAW,EACjDsY,EAAaD,EAAU,UAAS,EAChCE,EAAQ,CAAA,EACR3nB,EAAS,KAAK,QAAQ,WACtB4nB,EAAe,IAAI9pB,GAAO2pB,EAAU,cAAa,EAAG,SAAS,CAACznB,EAAQ,CAACA,CAAM,CAAC,EACpDynB,EAAU,YAAW,EAAG,IAAI,CAACznB,EAAQ,CAACA,CAAM,CAAC,CAAC,EAG5E,GAAI,EAAE,SAASynB,EAAU,IAAI,CAAC,GACxB,SAASA,EAAU,IAAI,CAAC,GACxB,SAASA,EAAU,IAAI,CAAC,GACxB,SAASA,EAAU,IAAI,CAAC,GAAM,MAAM,IAAI,MAAM,+CAA+C,EAEnG,QAASltB,KAAO,KAAK,OAAQ,CAC5B,IAAIgG,EAAI,KAAK,OAAOhG,GAAK,QACrBgG,EAAE,IAAM,KAAK,WAAa,CAACqnB,EAAa,SAAS,IAAIrqB,EAAMgD,EAAE,EAAGA,EAAE,CAAC,CAAC,KACvE,KAAK,OAAOhG,GAAK,QAAU,GAE/B,CAIE,GAAI,KAAK,IAAImG,EAAO,KAAK,SAAS,EAAI,EAAG,CAAE,KAAK,SAASK,EAAQL,CAAI,EAAG,MAAO,CAG/E,QAAS9I,EAAI6vB,EAAU,IAAI,EAAG7vB,GAAK6vB,EAAU,IAAI,EAAG7vB,IACnD,QAASD,EAAI8vB,EAAU,IAAI,EAAG9vB,GAAK8vB,EAAU,IAAI,EAAG9vB,IAAK,CACxD,IAAI4hB,GAAS,IAAIhc,EAAM5F,EAAGC,CAAC,EAG3B,GAFA2hB,GAAO,EAAI,KAAK,UAEZ,EAAC,KAAK,aAAaA,EAAM,EAE7B,KAAIoN,GAAO,KAAK,OAAO,KAAK,iBAAiBpN,EAAM,GAC/CoN,GACHA,GAAK,QAAU,GAEfgB,EAAM,KAAKpO,EAAM,EAEtB,CAQE,GAJAoO,EAAM,KAAK,SAAU5pB,GAAGC,GAAG,CAC1B,OAAOD,GAAE,WAAW2pB,CAAU,EAAI1pB,GAAE,WAAW0pB,CAAU,CAC5D,CAAG,EAEGC,EAAM,SAAW,EAAG,CAElB,KAAK,WACT,KAAK,SAAW,GAGhB,KAAK,KAAK,SAAS,GAIpB,IAAIE,GAAW,SAAS,uBAAsB,EAE9C,IAAKlwB,EAAI,EAAGA,EAAIgwB,EAAM,OAAQhwB,IAC7B,KAAK,SAASgwB,EAAMhwB,GAAIkwB,EAAQ,EAGjC,KAAK,OAAO,GAAG,YAAYA,EAAQ,CACtC,GACA,EAEC,aAAc,SAAUtO,EAAQ,CAC/B,IAAI1I,EAAM,KAAK,KAAK,QAAQ,IAE5B,GAAI,CAACA,EAAI,SAAU,CAElB,IAAIxS,EAAS,KAAK,iBAClB,GAAK,CAACwS,EAAI,UAAY0I,EAAO,EAAIlb,EAAO,IAAI,GAAKkb,EAAO,EAAIlb,EAAO,IAAI,IAClE,CAACwS,EAAI,UAAY0I,EAAO,EAAIlb,EAAO,IAAI,GAAKkb,EAAO,EAAIlb,EAAO,IAAI,GAAO,MAAO,EACxF,CAEE,GAAI,CAAC,KAAK,QAAQ,OAAU,MAAO,GAGnC,IAAIypB,EAAa,KAAK,oBAAoBvO,CAAM,EAChD,OAAOlH,GAAa,KAAK,QAAQ,MAAM,EAAE,SAASyV,CAAU,CAC9D,EAEC,aAAc,SAAUvtB,EAAK,CAC5B,OAAO,KAAK,oBAAoB,KAAK,iBAAiBA,CAAG,CAAC,CAC5D,EAEC,kBAAmB,SAAUgf,EAAQ,CACpC,IAAI3F,EAAM,KAAK,KACX0T,EAAW,KAAK,YAAW,EAC3BS,EAAUxO,EAAO,QAAQ+N,CAAQ,EACjCU,EAAUD,EAAQ,IAAIT,CAAQ,EAC9BlX,EAAKwD,EAAI,UAAUmU,EAASxO,EAAO,CAAC,EACpClJ,EAAKuD,EAAI,UAAUoU,EAASzO,EAAO,CAAC,EACxC,MAAO,CAACnJ,EAAIC,CAAE,CAChB,EAGC,oBAAqB,SAAUkJ,EAAQ,CACtC,IAAI0O,EAAK,KAAK,kBAAkB1O,CAAM,EAClClb,EAAS,IAAIQ,GAAaopB,EAAG,GAAIA,EAAG,EAAE,EAE1C,OAAK,KAAK,QAAQ,SACjB5pB,EAAS,KAAK,KAAK,iBAAiBA,CAAM,GAEpCA,CACT,EAEC,iBAAkB,SAAUkb,EAAQ,CACnC,OAAOA,EAAO,EAAI,IAAMA,EAAO,EAAI,IAAMA,EAAO,CAClD,EAGC,iBAAkB,SAAUhf,EAAK,CAChC,IAAIme,EAAIne,EAAI,MAAM,GAAG,EACjBgf,EAAS,IAAIhc,EAAM,CAACmb,EAAE,GAAI,CAACA,EAAE,EAAE,EACnC,OAAAa,EAAO,EAAI,CAACb,EAAE,GACPa,CACT,EAEC,YAAa,SAAUhf,EAAK,CAC3B,IAAIosB,EAAO,KAAK,OAAOpsB,GAClBosB,IAEL5W,GAAe4W,EAAK,EAAE,EAEtB,OAAO,KAAK,OAAOpsB,GAInB,KAAK,KAAK,aAAc,CACvB,KAAMosB,EAAK,GACX,OAAQ,KAAK,iBAAiBpsB,CAAG,CACpC,CAAG,EACH,EAEC,UAAW,SAAUosB,EAAM,CAC1BzZ,EAAiByZ,EAAM,cAAc,EAErC,IAAIW,EAAW,KAAK,YAAW,EAC/BX,EAAK,MAAM,MAAQW,EAAS,EAAI,KAChCX,EAAK,MAAM,OAASW,EAAS,EAAI,KAEjCX,EAAK,cAAgB9pB,EACrB8pB,EAAK,YAAc9pB,EAGf4F,EAAQ,OAAS,KAAK,QAAQ,QAAU,GAC3Cwc,GAAmB0H,EAAM,KAAK,QAAQ,OAAO,CAEhD,EAEC,SAAU,SAAUpN,EAAQ3R,EAAW,CACtC,IAAIsgB,EAAU,KAAK,YAAY3O,CAAM,EACjChf,EAAM,KAAK,iBAAiBgf,CAAM,EAElCoN,EAAO,KAAK,WAAW,KAAK,YAAYpN,CAAM,EAAGnN,EAAU,KAAK,WAAY,KAAMmN,CAAM,CAAC,EAE7F,KAAK,UAAUoN,CAAI,EAIf,KAAK,WAAW,OAAS,GAE5B9a,EAAsBO,EAAU,KAAK,WAAY,KAAMmN,EAAQ,KAAMoN,CAAI,CAAC,EAG3E3a,GAAoB2a,EAAMuB,CAAO,EAGjC,KAAK,OAAO3tB,GAAO,CAClB,GAAIosB,EACJ,OAAQpN,EACR,QAAS,EACZ,EAEE3R,EAAU,YAAY+e,CAAI,EAG1B,KAAK,KAAK,gBAAiB,CAC1B,KAAMA,EACN,OAAQpN,CACX,CAAG,CACH,EAEC,WAAY,SAAUA,EAAQ4O,EAAKxB,EAAM,CACpCwB,GAGH,KAAK,KAAK,YAAa,CACtB,MAAOA,EACP,KAAMxB,EACN,OAAQpN,CACZ,CAAI,EAGF,IAAIhf,EAAM,KAAK,iBAAiBgf,CAAM,EAEtCoN,EAAO,KAAK,OAAOpsB,GACdosB,IAELA,EAAK,OAAS,CAAC,IAAI,KACf,KAAK,KAAK,eACb1H,GAAmB0H,EAAK,GAAI,CAAC,EAC7B1a,EAAqB,KAAK,UAAU,EACpC,KAAK,WAAaJ,EAAsB,KAAK,eAAgB,IAAI,IAEjE8a,EAAK,OAAS,GACd,KAAK,YAAW,GAGZwB,IACJjb,EAAiByZ,EAAK,GAAI,qBAAqB,EAI/C,KAAK,KAAK,WAAY,CACrB,KAAMA,EAAK,GACX,OAAQpN,CACZ,CAAI,GAGE,KAAK,eAAc,IACtB,KAAK,SAAW,GAGhB,KAAK,KAAK,MAAM,EAEZ9W,EAAQ,OAAS,CAAC,KAAK,KAAK,cAC/BoJ,EAAsB,KAAK,YAAa,IAAI,EAI5C,WAAWO,EAAU,KAAK,YAAa,IAAI,EAAG,GAAG,GAGrD,EAEC,YAAa,SAAUmN,EAAQ,CAC9B,OAAOA,EAAO,QAAQ,KAAK,YAAW,CAAE,EAAE,SAAS,KAAK,OAAO,MAAM,CACvE,EAEC,YAAa,SAAUA,EAAQ,CAC9B,IAAI6O,EAAY,IAAI7qB,EACnB,KAAK,OAASuD,EAAayY,EAAO,EAAG,KAAK,MAAM,EAAIA,EAAO,EAC3D,KAAK,OAASzY,EAAayY,EAAO,EAAG,KAAK,MAAM,EAAIA,EAAO,CAAC,EAC7D,OAAA6O,EAAU,EAAI7O,EAAO,EACd6O,CACT,EAEC,qBAAsB,SAAU/pB,EAAQ,CACvC,IAAIipB,EAAW,KAAK,YAAW,EAC/B,OAAO,IAAIxpB,GACVO,EAAO,IAAI,UAAUipB,CAAQ,EAAE,MAAK,EACpCjpB,EAAO,IAAI,UAAUipB,CAAQ,EAAE,KAAI,EAAG,SAAS,CAAC,EAAG,CAAC,CAAC,CAAC,CACzD,EAEC,eAAgB,UAAY,CAC3B,QAAS/sB,KAAO,KAAK,OACpB,GAAI,CAAC,KAAK,OAAOA,GAAK,OAAU,MAAO,GAExC,MAAO,EACT,CACA,CAAC,EAIM,SAAS8tB,GAAUtuB,EAAS,CAClC,OAAO,IAAIqsB,GAAUrsB,CAAO,CAC7B,CCp3BU,IAACuuB,GAAYlC,GAAU,OAAO,CAIvC,QAAS,CAGR,QAAS,EAIT,QAAS,GAIT,WAAY,MAIZ,aAAc,GAId,WAAY,EAIZ,IAAK,GAIL,YAAa,GAIb,aAAc,GAMd,YAAa,GAQb,eAAgB,EAClB,EAEC,WAAY,SAAU/C,EAAKtpB,EAAS,CAEnC,KAAK,KAAOspB,EAEZtpB,EAAU6B,EAAgB,KAAM7B,CAAO,EAGnCA,EAAQ,cAAgB0I,EAAQ,QAAU1I,EAAQ,QAAU,GAE/DA,EAAQ,SAAW,KAAK,MAAMA,EAAQ,SAAW,CAAC,EAE7CA,EAAQ,aAIZA,EAAQ,aACRA,EAAQ,QAAU,KAAK,IAAIA,EAAQ,QAASA,EAAQ,QAAU,CAAC,IAJ/DA,EAAQ,aACRA,EAAQ,QAAU,KAAK,IAAIA,EAAQ,QAASA,EAAQ,QAAU,CAAC,GAMhEA,EAAQ,QAAU,KAAK,IAAI,EAAGA,EAAQ,OAAO,GAClCA,EAAQ,YAKnBA,EAAQ,QAAU,KAAK,IAAIA,EAAQ,QAASA,EAAQ,OAAO,EAH3DA,EAAQ,QAAU,KAAK,IAAIA,EAAQ,QAASA,EAAQ,OAAO,EAMxD,OAAOA,EAAQ,YAAe,WACjCA,EAAQ,WAAaA,EAAQ,WAAW,MAAM,EAAE,GAGjD,KAAK,GAAG,aAAc,KAAK,aAAa,CAC1C,EAMC,OAAQ,SAAUspB,EAAKkF,EAAU,CAChC,OAAI,KAAK,OAASlF,GAAOkF,IAAa,SACrCA,EAAW,IAGZ,KAAK,KAAOlF,EAEPkF,GACJ,KAAK,OAAM,EAEL,IACT,EAMC,WAAY,SAAUhP,EAAQiP,EAAM,CACnC,IAAI7B,EAAO,SAAS,cAAc,KAAK,EAEvCtd,OAAAA,EAAYsd,EAAM,OAAQva,EAAU,KAAK,YAAa,KAAMoc,EAAM7B,CAAI,CAAC,EACvEtd,EAAYsd,EAAM,QAASva,EAAU,KAAK,aAAc,KAAMoc,EAAM7B,CAAI,CAAC,GAErE,KAAK,QAAQ,aAAe,KAAK,QAAQ,cAAgB,MAC5DA,EAAK,YAAc,KAAK,QAAQ,cAAgB,GAAO,GAAK,KAAK,QAAQ,aAKtE,OAAO,KAAK,QAAQ,gBAAmB,WAC1CA,EAAK,eAAiB,KAAK,QAAQ,gBAOpCA,EAAK,IAAM,GAEXA,EAAK,IAAM,KAAK,WAAWpN,CAAM,EAE1BoN,CACT,EAQC,WAAY,SAAUpN,EAAQ,CAC7B,IAAIjf,EAAO,CACV,EAAGmI,EAAQ,OAAS,MAAQ,GAC5B,EAAG,KAAK,cAAc8W,CAAM,EAC5B,EAAGA,EAAO,EACV,EAAGA,EAAO,EACV,EAAG,KAAK,eAAc,CACzB,EACE,GAAI,KAAK,MAAQ,CAAC,KAAK,KAAK,QAAQ,IAAI,SAAU,CACjD,IAAIkP,EAAY,KAAK,iBAAiB,IAAI,EAAIlP,EAAO,EACjD,KAAK,QAAQ,MAChBjf,EAAK,EAAOmuB,GAEbnuB,EAAK,MAAQmuB,CAChB,CAEE,OAAOC,EAAc,KAAK,KAAM3sB,EAAYzB,EAAM,KAAK,OAAO,CAAC,CACjE,EAEC,YAAa,SAAUkuB,EAAM7B,EAAM,CAE9BlkB,EAAQ,MACX,WAAW2J,EAAUoc,EAAM,KAAM,KAAM7B,CAAI,EAAG,CAAC,EAE/C6B,EAAK,KAAM7B,CAAI,CAElB,EAEC,aAAc,SAAU6B,EAAM7B,EAAMtpB,EAAG,CACtC,IAAIsmB,EAAW,KAAK,QAAQ,aACxBA,GAAYgD,EAAK,aAAa,KAAK,IAAMhD,IAC5CgD,EAAK,IAAMhD,GAEZ6E,EAAKnrB,EAAGspB,CAAI,CACd,EAEC,cAAe,SAAUtpB,EAAG,CAC3BA,EAAE,KAAK,OAAS,IAClB,EAEC,eAAgB,UAAY,CAC3B,IAAIqD,EAAO,KAAK,UAChBic,EAAU,KAAK,QAAQ,QACvBgM,EAAc,KAAK,QAAQ,YAC3BC,EAAa,KAAK,QAAQ,WAE1B,OAAID,IACHjoB,EAAOic,EAAUjc,GAGXA,EAAOkoB,CAChB,EAEC,cAAe,SAAUC,EAAW,CACnC,IAAI/rB,EAAQ,KAAK,IAAI+rB,EAAU,EAAIA,EAAU,CAAC,EAAI,KAAK,QAAQ,WAAW,OAC1E,OAAO,KAAK,QAAQ,WAAW/rB,EACjC,EAGC,cAAe,UAAY,CAC1B,IAAInF,EAAGgvB,EACP,IAAKhvB,KAAK,KAAK,OACd,GAAI,KAAK,OAAOA,GAAG,OAAO,IAAM,KAAK,YACpCgvB,EAAO,KAAK,OAAOhvB,GAAG,GAEtBgvB,EAAK,OAAS9pB,EACd8pB,EAAK,QAAU9pB,EAEX,CAAC8pB,EAAK,UAAU,CACnBA,EAAK,IAAMmC,EACX,IAAIvP,EAAS,KAAK,OAAO5hB,GAAG,OAC5BoY,GAAe4W,CAAI,EACnB,OAAO,KAAK,OAAOhvB,GAGnB,KAAK,KAAK,YAAa,CACtB,KAAMgvB,EACN,OAAQpN,CACd,CAAM,CACN,CAGA,EAEC,YAAa,SAAUhf,EAAK,CAC3B,IAAIosB,EAAO,KAAK,OAAOpsB,GACvB,GAAKosB,EAGL,OAAAA,EAAK,GAAG,aAAa,MAAOmC,CAAkB,EAEvC1C,GAAU,UAAU,YAAY,KAAK,KAAM7rB,CAAG,CACvD,EAEC,WAAY,SAAUgf,EAAQ4O,EAAKxB,EAAM,CACxC,GAAI,GAAC,KAAK,MAASA,GAAQA,EAAK,aAAa,KAAK,IAAMmC,GAIxD,OAAO1C,GAAU,UAAU,WAAW,KAAK,KAAM7M,EAAQ4O,EAAKxB,CAAI,CACpE,CACA,CAAC,EAMM,SAASoC,GAAU1F,EAAKtpB,EAAS,CACvC,OAAO,IAAIuuB,GAAUjF,EAAKtpB,CAAO,CAClC,CCxQO,IAAIivB,GAAeV,GAAU,OAAO,CAO1C,iBAAkB,CACjB,QAAS,MACT,QAAS,SAIT,OAAQ,GAIR,OAAQ,GAIR,OAAQ,aAIR,YAAa,GAIb,QAAS,OACX,EAEC,QAAS,CAIR,IAAK,KAIL,UAAW,EACb,EAEC,WAAY,SAAUjF,EAAKtpB,EAAS,CAEnC,KAAK,KAAOspB,EAEZ,IAAI4F,EAAYxxB,EAAO,CAAA,EAAI,KAAK,gBAAgB,EAGhD,QAASE,KAAKoC,EACPpC,KAAK,KAAK,UACfsxB,EAAUtxB,GAAKoC,EAAQpC,IAIzBoC,EAAUD,EAAW,KAAMC,CAAO,EAElC,IAAImvB,EAAanvB,EAAQ,cAAgB0I,EAAQ,OAAS,EAAI,EAC1D6kB,EAAW,KAAK,YAAW,EAC/B2B,EAAU,MAAQ3B,EAAS,EAAI4B,EAC/BD,EAAU,OAAS3B,EAAS,EAAI4B,EAEhC,KAAK,UAAYD,CACnB,EAEC,MAAO,SAAUrV,EAAK,CAErB,KAAK,KAAO,KAAK,QAAQ,KAAOA,EAAI,QAAQ,IAC5C,KAAK,YAAc,WAAW,KAAK,UAAU,OAAO,EAEpD,IAAIuV,EAAgB,KAAK,aAAe,IAAM,MAAQ,MACtD,KAAK,UAAUA,GAAiB,KAAK,KAAK,KAE1Cb,GAAU,UAAU,MAAM,KAAK,KAAM1U,CAAG,CAC1C,EAEC,WAAY,SAAU2F,EAAQ,CAE7B,IAAIuO,EAAa,KAAK,kBAAkBvO,CAAM,EAC1C1I,EAAM,KAAK,KACXxS,EAASD,GAASyS,EAAI,QAAQiX,EAAW,EAAE,EAAGjX,EAAI,QAAQiX,EAAW,EAAE,CAAC,EACxE1uB,EAAMiF,EAAO,IACblF,EAAMkF,EAAO,IACb+qB,GAAQ,KAAK,aAAe,KAAO,KAAK,OAAShN,GACjD,CAAChjB,EAAI,EAAGA,EAAI,EAAGD,EAAI,EAAGA,EAAI,CAAC,EAC3B,CAACC,EAAI,EAAGA,EAAI,EAAGD,EAAI,EAAGA,EAAI,CAAC,GAAG,KAAK,GAAG,EACtCkqB,EAAMiF,GAAU,UAAU,WAAW,KAAK,KAAM/O,CAAM,EAC1D,OAAO8J,EACNrpB,EAAe,KAAK,UAAWqpB,EAAK,KAAK,QAAQ,SAAS,GACzD,KAAK,QAAQ,UAAY,SAAW,UAAY+F,CACpD,EAIC,UAAW,SAAUjvB,EAAQouB,EAAU,CAEtC,OAAA9wB,EAAO,KAAK,UAAW0C,CAAM,EAExBouB,GACJ,KAAK,OAAM,EAGL,IACT,CACA,CAAC,EAKM,SAASc,GAAahG,EAAKtpB,EAAS,CAC1C,OAAO,IAAIivB,GAAa3F,EAAKtpB,CAAO,CACrC,CCrIAuuB,GAAU,IAAMU,GAChBD,GAAU,IAAMM,GCwBN,IAACC,GAAWhN,GAAM,OAAO,CAIlC,QAAS,CAIR,QAAS,EACX,EAEC,WAAY,SAAUviB,EAAS,CAC9B6B,EAAgB,KAAM7B,CAAO,EAC7BqD,EAAW,IAAI,EACf,KAAK,QAAU,KAAK,SAAW,CAAA,CACjC,EAEC,MAAO,UAAY,CACb,KAAK,aACT,KAAK,eAAc,EAGnB8P,EAAiB,KAAK,WAAY,uBAAuB,GAG1D,KAAK,QAAO,EAAG,YAAY,KAAK,UAAU,EAC1C,KAAK,QAAO,EACZ,KAAK,GAAG,SAAU,KAAK,aAAc,IAAI,CAC3C,EAEC,SAAU,UAAY,CACrB,KAAK,IAAI,SAAU,KAAK,aAAc,IAAI,EAC1C,KAAK,kBAAiB,CACxB,EAEC,UAAW,UAAY,CACtB,IAAIsP,EAAS,CACZ,UAAW,KAAK,OAChB,KAAM,KAAK,QACX,QAAS,KAAK,QACd,QAAS,KAAK,UACjB,EACE,OAAI,KAAK,gBACRA,EAAO,SAAW,KAAK,aAEjBA,CACT,EAEC,YAAa,SAAUrR,EAAI,CAC1B,KAAK,iBAAiBA,EAAG,OAAQA,EAAG,IAAI,CAC1C,EAEC,QAAS,UAAY,CACpB,KAAK,iBAAiB,KAAK,KAAK,UAAS,EAAI,KAAK,KAAK,QAAO,CAAE,CAClE,EAEC,iBAAkB,SAAUpK,EAAQL,EAAM,CACzC,IAAIE,EAAQ,KAAK,KAAK,aAAaF,EAAM,KAAK,KAAK,EAC/C+L,EAAW,KAAK,KAAK,QAAO,EAAG,WAAW,GAAM,KAAK,QAAQ,OAAO,EACpE8c,EAAqB,KAAK,KAAK,QAAQ,KAAK,QAAS7oB,CAAI,EAEzD8oB,EAAgB/c,EAAS,WAAW,CAAC7L,CAAK,EAAE,IAAI2oB,CAAkB,EACjE,SAAS,KAAK,KAAK,mBAAmBxoB,EAAQL,CAAI,CAAC,EAEpD+B,EAAQ,MACX6Q,GAAqB,KAAK,WAAYkW,EAAe5oB,CAAK,EAE1DoL,GAAoB,KAAK,WAAYwd,CAAa,CAErD,EAEC,OAAQ,UAAY,CACnB,KAAK,QAAO,EACZ,KAAK,iBAAiB,KAAK,QAAS,KAAK,KAAK,EAE9C,QAASnuB,KAAM,KAAK,QACnB,KAAK,QAAQA,GAAI,OAAM,CAE1B,EAEC,WAAY,UAAY,CACvB,QAASA,KAAM,KAAK,QACnB,KAAK,QAAQA,GAAI,SAAQ,CAE5B,EAEC,aAAc,UAAY,CACzB,QAASA,KAAM,KAAK,QACnB,KAAK,QAAQA,GAAI,QAAO,CAE3B,EAEC,QAAS,UAAY,CAGpB,IAAImH,EAAI,KAAK,QAAQ,QACjB+K,EAAO,KAAK,KAAK,QAAO,EACxBnU,EAAM,KAAK,KAAK,2BAA2BmU,EAAK,WAAW,CAAC/K,CAAC,CAAC,EAAE,MAAK,EAEzE,KAAK,QAAU,IAAI1E,GAAO1E,EAAKA,EAAI,IAAImU,EAAK,WAAW,EAAI/K,EAAI,CAAC,CAAC,EAAE,MAAK,CAAE,EAE1E,KAAK,QAAU,KAAK,KAAK,UAAS,EAClC,KAAK,MAAQ,KAAK,KAAK,QAAO,CAChC,CACA,CAAC,EC7FUinB,GAASH,GAAS,OAAO,CAInC,QAAS,CAGR,UAAW,CACb,EAEC,UAAW,UAAY,CACtB,IAAI9M,EAAS8M,GAAS,UAAU,UAAU,KAAK,IAAI,EACnD,OAAA9M,EAAO,aAAe,KAAK,gBACpBA,CACT,EAEC,gBAAiB,UAAY,CAE5B,KAAK,qBAAuB,EAC9B,EAEC,MAAO,UAAY,CAClB8M,GAAS,UAAU,MAAM,KAAK,IAAI,EAIlC,KAAK,MAAK,CACZ,EAEC,eAAgB,UAAY,CAC3B,IAAI1hB,EAAY,KAAK,WAAa,SAAS,cAAc,QAAQ,EAEjEyB,EAAYzB,EAAW,YAAa,KAAK,aAAc,IAAI,EAC3DyB,EAAYzB,EAAW,+CAAgD,KAAK,SAAU,IAAI,EAC1FyB,EAAYzB,EAAW,WAAY,KAAK,gBAAiB,IAAI,EAC7DA,EAAU,wBAA6B,GAEvC,KAAK,KAAOA,EAAU,WAAW,IAAI,CACvC,EAEC,kBAAmB,UAAY,CAC9BqE,EAAqB,KAAK,cAAc,EACxC,OAAO,KAAK,KACZ8D,GAAe,KAAK,UAAU,EAC9BzG,GAAa,KAAK,UAAU,EAC5B,OAAO,KAAK,UACd,EAEC,aAAc,UAAY,CACzB,GAAI,MAAK,qBAET,KAAIoL,EACJ,KAAK,cAAgB,KACrB,QAASrZ,KAAM,KAAK,QACnBqZ,EAAQ,KAAK,QAAQrZ,GACrBqZ,EAAM,QAAO,EAEd,KAAK,QAAO,EACd,EAEC,QAAS,UAAY,CACpB,GAAI,OAAK,KAAK,gBAAkB,KAAK,SAErC,CAAA4U,GAAS,UAAU,QAAQ,KAAK,IAAI,EAEpC,IAAItrB,EAAI,KAAK,QACT4J,EAAY,KAAK,WACjB2F,EAAOvP,EAAE,QAAO,EAChB0rB,EAAIjnB,EAAQ,OAAS,EAAI,EAE7BuJ,GAAoBpE,EAAW5J,EAAE,GAAG,EAGpC4J,EAAU,MAAQ8hB,EAAInc,EAAK,EAC3B3F,EAAU,OAAS8hB,EAAInc,EAAK,EAC5B3F,EAAU,MAAM,MAAQ2F,EAAK,EAAI,KACjC3F,EAAU,MAAM,OAAS2F,EAAK,EAAI,KAE9B9K,EAAQ,QACX,KAAK,KAAK,MAAM,EAAG,CAAC,EAIrB,KAAK,KAAK,UAAU,CAACzE,EAAE,IAAI,EAAG,CAACA,EAAE,IAAI,CAAC,EAGtC,KAAK,KAAK,QAAQ,EACpB,EAEC,OAAQ,UAAY,CACnBsrB,GAAS,UAAU,OAAO,KAAK,IAAI,EAE/B,KAAK,uBACR,KAAK,qBAAuB,GAC5B,KAAK,aAAY,EAEpB,EAEC,UAAW,SAAU5U,EAAO,CAC3B,KAAK,iBAAiBA,CAAK,EAC3B,KAAK,QAAQtX,EAAWsX,CAAK,GAAKA,EAElC,IAAIiV,EAAQjV,EAAM,OAAS,CAC1B,MAAOA,EACP,KAAM,KAAK,UACX,KAAM,IACT,EACM,KAAK,YAAa,KAAK,UAAU,KAAOiV,GAC5C,KAAK,UAAYA,EACjB,KAAK,WAAa,KAAK,YAAc,KAAK,SAC5C,EAEC,SAAU,SAAUjV,EAAO,CAC1B,KAAK,eAAeA,CAAK,CAC3B,EAEC,YAAa,SAAUA,EAAO,CAC7B,IAAIiV,EAAQjV,EAAM,OACdkV,EAAOD,EAAM,KACblP,EAAOkP,EAAM,KAEbC,EACHA,EAAK,KAAOnP,EAEZ,KAAK,UAAYA,EAEdA,EACHA,EAAK,KAAOmP,EAEZ,KAAK,WAAaA,EAGnB,OAAOlV,EAAM,OAEb,OAAO,KAAK,QAAQtX,EAAWsX,CAAK,GAEpC,KAAK,eAAeA,CAAK,CAC3B,EAEC,YAAa,SAAUA,EAAO,CAG7B,KAAK,oBAAoBA,CAAK,EAC9BA,EAAM,SAAQ,EACdA,EAAM,QAAO,EAGb,KAAK,eAAeA,CAAK,CAC3B,EAEC,aAAc,SAAUA,EAAO,CAC9B,KAAK,iBAAiBA,CAAK,EAC3B,KAAK,eAAeA,CAAK,CAC3B,EAEC,iBAAkB,SAAUA,EAAO,CAClC,GAAI,OAAOA,EAAM,QAAQ,WAAc,SAAU,CAChD,IAAIiM,EAAQjM,EAAM,QAAQ,UAAU,MAAM,OAAO,EAC7CmV,EAAY,CAAA,EACZC,EACAnyB,EACJ,IAAKA,EAAI,EAAGA,EAAIgpB,EAAM,OAAQhpB,IAAK,CAGlC,GAFAmyB,EAAY,OAAOnJ,EAAMhpB,EAAE,EAEvB,MAAMmyB,CAAS,EAAK,OACxBD,EAAU,KAAKC,CAAS,CAC5B,CACGpV,EAAM,QAAQ,WAAamV,CAC9B,MACGnV,EAAM,QAAQ,WAAaA,EAAM,QAAQ,SAE5C,EAEC,eAAgB,SAAUA,EAAO,CAC3B,KAAK,OAEV,KAAK,oBAAoBA,CAAK,EAC9B,KAAK,eAAiB,KAAK,gBAAkB7I,EAAsB,KAAK,QAAS,IAAI,EACvF,EAEC,oBAAqB,SAAU6I,EAAO,CACrC,GAAIA,EAAM,UAAW,CACpB,IAAIvE,GAAWuE,EAAM,QAAQ,QAAU,GAAK,EAC5C,KAAK,cAAgB,KAAK,eAAiB,IAAI5W,GAC/C,KAAK,cAAc,OAAO4W,EAAM,UAAU,IAAI,SAAS,CAACvE,EAASA,CAAO,CAAC,CAAC,EAC1E,KAAK,cAAc,OAAOuE,EAAM,UAAU,IAAI,IAAI,CAACvE,EAASA,CAAO,CAAC,CAAC,CACxE,CACA,EAEC,QAAS,UAAY,CACpB,KAAK,eAAiB,KAElB,KAAK,gBACR,KAAK,cAAc,IAAI,OAAM,EAC7B,KAAK,cAAc,IAAI,MAAK,GAG7B,KAAK,OAAM,EACX,KAAK,MAAK,EAEV,KAAK,cAAgB,IACvB,EAEC,OAAQ,UAAY,CACnB,IAAI9R,EAAS,KAAK,cAClB,GAAIA,EAAQ,CACX,IAAIkP,EAAOlP,EAAO,QAAO,EACzB,KAAK,KAAK,UAAUA,EAAO,IAAI,EAAGA,EAAO,IAAI,EAAGkP,EAAK,EAAGA,EAAK,CAAC,CACjE,MACG,KAAK,KAAK,KAAI,EACd,KAAK,KAAK,aAAa,EAAG,EAAG,EAAG,EAAG,EAAG,CAAC,EACvC,KAAK,KAAK,UAAU,EAAG,EAAG,KAAK,WAAW,MAAO,KAAK,WAAW,MAAM,EACvE,KAAK,KAAK,QAAO,CAEpB,EAEC,MAAO,UAAY,CAClB,IAAImH,EAAOrW,EAAS,KAAK,cAEzB,GADA,KAAK,KAAK,KAAI,EACVA,EAAQ,CACX,IAAIkP,EAAOlP,EAAO,QAAO,EACzB,KAAK,KAAK,UAAS,EACnB,KAAK,KAAK,KAAKA,EAAO,IAAI,EAAGA,EAAO,IAAI,EAAGkP,EAAK,EAAGA,EAAK,CAAC,EACzD,KAAK,KAAK,KAAI,CACjB,CAEE,KAAK,SAAW,GAEhB,QAASoc,EAAQ,KAAK,WAAYA,EAAOA,EAAQA,EAAM,KACtDjV,EAAQiV,EAAM,OACV,CAACtrB,GAAWqW,EAAM,WAAaA,EAAM,UAAU,WAAWrW,CAAM,IACnEqW,EAAM,YAAW,EAInB,KAAK,SAAW,GAEhB,KAAK,KAAK,QAAO,CACnB,EAEC,YAAa,SAAUA,EAAOpS,EAAQ,CACrC,GAAK,KAAK,SAEV,KAAI3K,EAAGC,EAAG2K,EAAMC,EACZme,EAAQjM,EAAM,OACd7c,EAAM8oB,EAAM,OACZoJ,EAAM,KAAK,KAEf,GAAKlyB,EAIL,KAFAkyB,EAAI,UAAS,EAERpyB,EAAI,EAAGA,EAAIE,EAAKF,IAAK,CACzB,IAAKC,EAAI,EAAG2K,EAAOoe,EAAMhpB,GAAG,OAAQC,EAAI2K,EAAM3K,IAC7C4K,EAAIme,EAAMhpB,GAAGC,GACbmyB,EAAInyB,EAAI,SAAW,UAAU4K,EAAE,EAAGA,EAAE,CAAC,EAElCF,GACHynB,EAAI,UAAS,CAEjB,CAEE,KAAK,YAAYA,EAAKrV,CAAK,GAG7B,EAEC,cAAe,SAAUA,EAAO,CAE/B,GAAI,GAAC,KAAK,UAAYA,EAAM,OAAM,GAElC,KAAIlS,EAAIkS,EAAM,OACVqV,EAAM,KAAK,KACXjc,EAAI,KAAK,IAAI,KAAK,MAAM4G,EAAM,OAAO,EAAG,CAAC,EACzC/F,GAAK,KAAK,IAAI,KAAK,MAAM+F,EAAM,QAAQ,EAAG,CAAC,GAAK5G,GAAKA,EAErDa,IAAM,IACTob,EAAI,KAAI,EACRA,EAAI,MAAM,EAAGpb,CAAC,GAGfob,EAAI,UAAS,EACbA,EAAI,IAAIvnB,EAAE,EAAGA,EAAE,EAAImM,EAAGb,EAAG,EAAG,KAAK,GAAK,EAAG,EAAK,EAE1Ca,IAAM,GACTob,EAAI,QAAO,EAGZ,KAAK,YAAYA,EAAKrV,CAAK,EAC7B,EAEC,YAAa,SAAUqV,EAAKrV,EAAO,CAClC,IAAI3a,EAAU2a,EAAM,QAEhB3a,EAAQ,OACXgwB,EAAI,YAAchwB,EAAQ,YAC1BgwB,EAAI,UAAYhwB,EAAQ,WAAaA,EAAQ,MAC7CgwB,EAAI,KAAKhwB,EAAQ,UAAY,SAAS,GAGnCA,EAAQ,QAAUA,EAAQ,SAAW,IACpCgwB,EAAI,aACPA,EAAI,YAAYrV,EAAM,SAAWA,EAAM,QAAQ,YAAc,CAAA,CAAE,EAEhEqV,EAAI,YAAchwB,EAAQ,QAC1BgwB,EAAI,UAAYhwB,EAAQ,OACxBgwB,EAAI,YAAchwB,EAAQ,MAC1BgwB,EAAI,QAAUhwB,EAAQ,QACtBgwB,EAAI,SAAWhwB,EAAQ,SACvBgwB,EAAI,OAAM,EAEb,EAKC,SAAU,SAAU1sB,EAAG,CAGtB,QAFIO,EAAQ,KAAK,KAAK,uBAAuBP,CAAC,EAAGqX,EAAOsV,EAE/CL,EAAQ,KAAK,WAAYA,EAAOA,EAAQA,EAAM,KACtDjV,EAAQiV,EAAM,MACVjV,EAAM,QAAQ,aAAeA,EAAM,eAAe9W,CAAK,IACtD,EAAEP,EAAE,OAAS,SAAWA,EAAE,OAAS,aAAe,CAAC,KAAK,KAAK,gBAAgBqX,CAAK,KACrFsV,EAAetV,GAIlB,KAAK,WAAWsV,EAAe,CAACA,CAAY,EAAI,GAAO3sB,CAAC,CAC1D,EAEC,aAAc,SAAUA,EAAG,CAC1B,GAAI,GAAC,KAAK,MAAQ,KAAK,KAAK,SAAS,OAAM,GAAM,KAAK,KAAK,gBAE3D,KAAIO,EAAQ,KAAK,KAAK,uBAAuBP,CAAC,EAC9C,KAAK,kBAAkBA,EAAGO,CAAK,EACjC,EAGC,gBAAiB,SAAUP,EAAG,CAC7B,IAAIqX,EAAQ,KAAK,cACbA,IAEHxB,GAAoB,KAAK,WAAY,qBAAqB,EAC1D,KAAK,WAAW,CAACwB,CAAK,EAAGrX,EAAG,UAAU,EACtC,KAAK,cAAgB,KACrB,KAAK,qBAAuB,GAE/B,EAEC,kBAAmB,SAAUA,EAAGO,EAAO,CACtC,GAAI,MAAK,qBAMT,SAFI8W,EAAOuV,EAEFN,EAAQ,KAAK,WAAYA,EAAOA,EAAQA,EAAM,KACtDjV,EAAQiV,EAAM,MACVjV,EAAM,QAAQ,aAAeA,EAAM,eAAe9W,CAAK,IAC1DqsB,EAAwBvV,GAItBuV,IAA0B,KAAK,gBAClC,KAAK,gBAAgB5sB,CAAC,EAElB4sB,IACH/c,EAAiB,KAAK,WAAY,qBAAqB,EACvD,KAAK,WAAW,CAAC+c,CAAqB,EAAG5sB,EAAG,WAAW,EACvD,KAAK,cAAgB4sB,IAIvB,KAAK,WAAW,KAAK,cAAgB,CAAC,KAAK,aAAa,EAAI,GAAO5sB,CAAC,EAEpE,KAAK,qBAAuB,GAC5B,WAAW+O,EAAU,UAAY,CAChC,KAAK,qBAAuB,EAC/B,EAAK,IAAI,EAAG,EAAE,EACd,EAEC,WAAY,SAAU4J,EAAQ3Y,EAAGd,EAAM,CACtC,KAAK,KAAK,cAAcc,EAAGd,GAAQc,EAAE,KAAM2Y,CAAM,CACnD,EAEC,cAAe,SAAUtB,EAAO,CAC/B,IAAIiV,EAAQjV,EAAM,OAElB,GAAKiV,EAEL,KAAIC,EAAOD,EAAM,KACblP,EAAOkP,EAAM,KAEjB,GAAIC,EACHA,EAAK,KAAOnP,MAGZ,QAEGA,EACHA,EAAK,KAAOmP,EACFA,IAGV,KAAK,WAAaA,GAGnBD,EAAM,KAAO,KAAK,UAClB,KAAK,UAAU,KAAOA,EAEtBA,EAAM,KAAO,KACb,KAAK,UAAYA,EAEjB,KAAK,eAAejV,CAAK,EAC3B,EAEC,aAAc,SAAUA,EAAO,CAC9B,IAAIiV,EAAQjV,EAAM,OAElB,GAAKiV,EAEL,KAAIC,EAAOD,EAAM,KACblP,EAAOkP,EAAM,KAEjB,GAAIlP,EACHA,EAAK,KAAOmP,MAGZ,QAEGA,EACHA,EAAK,KAAOnP,EACFA,IAGV,KAAK,UAAYA,GAGlBkP,EAAM,KAAO,KAEbA,EAAM,KAAO,KAAK,WAClB,KAAK,WAAW,KAAOA,EACvB,KAAK,WAAaA,EAElB,KAAK,eAAejV,CAAK,EAC3B,CACA,CAAC,EAIM,SAAS9P,GAAO7K,EAAS,CAC/B,OAAO0I,EAAQ,OAAS,IAAIgnB,GAAO1vB,CAAO,EAAI,IAC/C,CCleO,IAAImwB,GAAa,UAAY,CACnC,GAAI,CACH,gBAAS,WAAW,IAAI,OAAQ,+BAA+B,EACxD,SAAUnvB,EAAM,CACtB,OAAO,SAAS,cAAc,SAAWA,EAAO,gBAAgB,CACnE,CACA,MAAG,CAGH,CACC,OAAO,SAAUA,EAAM,CACtB,OAAO,SAAS,cAAc,IAAMA,EAAO,sDAAsD,CACnG,CACA,EAAC,EAYUovB,GAAW,CAErB,eAAgB,UAAY,CAC3B,KAAK,WAAala,EAAe,MAAO,uBAAuB,CACjE,EAEC,QAAS,UAAY,CAChB,KAAK,KAAK,iBACdqZ,GAAS,UAAU,QAAQ,KAAK,IAAI,EACpC,KAAK,KAAK,QAAQ,EACpB,EAEC,UAAW,SAAU5U,EAAO,CAC3B,IAAI9M,EAAY8M,EAAM,WAAawV,GAAU,OAAO,EAEpDhd,EAAiBtF,EAAW,sBAAwB,KAAK,QAAQ,WAAa,GAAG,EAEjFA,EAAU,UAAY,MAEtB8M,EAAM,MAAQwV,GAAU,MAAM,EAC9BtiB,EAAU,YAAY8M,EAAM,KAAK,EAEjC,KAAK,aAAaA,CAAK,EACvB,KAAK,QAAQtX,EAAWsX,CAAK,GAAKA,CACpC,EAEC,SAAU,SAAUA,EAAO,CAC1B,IAAI9M,EAAY8M,EAAM,WACtB,KAAK,WAAW,YAAY9M,CAAS,EAEjC8M,EAAM,QAAQ,aACjBA,EAAM,qBAAqB9M,CAAS,CAEvC,EAEC,YAAa,SAAU8M,EAAO,CAC7B,IAAI9M,EAAY8M,EAAM,WACtB3E,GAAenI,CAAS,EACxB8M,EAAM,wBAAwB9M,CAAS,EACvC,OAAO,KAAK,QAAQxK,EAAWsX,CAAK,EACtC,EAEC,aAAc,SAAUA,EAAO,CAC9B,IAAI0V,EAAS1V,EAAM,QACf2V,EAAO3V,EAAM,MACb3a,EAAU2a,EAAM,QAChB9M,EAAY8M,EAAM,WAEtB9M,EAAU,QAAU,CAAC,CAAC7N,EAAQ,OAC9B6N,EAAU,OAAS,CAAC,CAAC7N,EAAQ,KAEzBA,EAAQ,QACNqwB,IACJA,EAAS1V,EAAM,QAAUwV,GAAU,QAAQ,GAE5CtiB,EAAU,YAAYwiB,CAAM,EAC5BA,EAAO,OAASrwB,EAAQ,OAAS,KACjCqwB,EAAO,MAAQrwB,EAAQ,MACvBqwB,EAAO,QAAUrwB,EAAQ,QAErBA,EAAQ,UACXqwB,EAAO,UAAYhuB,EAAarC,EAAQ,SAAS,EAC7CA,EAAQ,UAAU,KAAK,GAAG,EAC1BA,EAAQ,UAAU,QAAQ,WAAY,GAAG,EAE7CqwB,EAAO,UAAY,GAEpBA,EAAO,OAASrwB,EAAQ,QAAQ,QAAQ,OAAQ,MAAM,EACtDqwB,EAAO,UAAYrwB,EAAQ,UAEjBqwB,IACVxiB,EAAU,YAAYwiB,CAAM,EAC5B1V,EAAM,QAAU,MAGb3a,EAAQ,MACNswB,IACJA,EAAO3V,EAAM,MAAQwV,GAAU,MAAM,GAEtCtiB,EAAU,YAAYyiB,CAAI,EAC1BA,EAAK,MAAQtwB,EAAQ,WAAaA,EAAQ,MAC1CswB,EAAK,QAAUtwB,EAAQ,aAEbswB,IACVziB,EAAU,YAAYyiB,CAAI,EAC1B3V,EAAM,MAAQ,KAEjB,EAEC,cAAe,SAAUA,EAAO,CAC/B,IAAIlS,EAAIkS,EAAM,OAAO,MAAK,EACtB5G,EAAI,KAAK,MAAM4G,EAAM,OAAO,EAC5B4K,EAAK,KAAK,MAAM5K,EAAM,UAAY5G,CAAC,EAEvC,KAAK,SAAS4G,EAAOA,EAAM,OAAM,EAAK,OACrC,MAAQlS,EAAE,EAAI,IAAMA,EAAE,EAAI,IAAMsL,EAAI,IAAMwR,EAAK,MAAS,MAAQ,GAAI,CACvE,EAEC,SAAU,SAAU5K,EAAO5N,EAAM,CAChC4N,EAAM,MAAM,EAAI5N,CAClB,EAEC,cAAe,SAAU4N,EAAO,CAC/B6O,GAAgB7O,EAAM,UAAU,CAClC,EAEC,aAAc,SAAUA,EAAO,CAC9B8O,GAAe9O,EAAM,UAAU,CACjC,CACA,ECtIW3c,GAAS0K,EAAQ,IAAMynB,GAAY/nB,GAsCnCmoB,GAAMhB,GAAS,OAAO,CAEhC,eAAgB,UAAY,CAC3B,KAAK,WAAavxB,GAAO,KAAK,EAG9B,KAAK,WAAW,aAAa,iBAAkB,MAAM,EAErD,KAAK,WAAaA,GAAO,GAAG,EAC5B,KAAK,WAAW,YAAY,KAAK,UAAU,CAC7C,EAEC,kBAAmB,UAAY,CAC9BgY,GAAe,KAAK,UAAU,EAC9BzG,GAAa,KAAK,UAAU,EAC5B,OAAO,KAAK,WACZ,OAAO,KAAK,WACZ,OAAO,KAAK,QACd,EAEC,QAAS,UAAY,CACpB,GAAI,OAAK,KAAK,gBAAkB,KAAK,SAErC,CAAAggB,GAAS,UAAU,QAAQ,KAAK,IAAI,EAEpC,IAAItrB,EAAI,KAAK,QACTuP,EAAOvP,EAAE,QAAO,EAChB4J,EAAY,KAAK,YAGjB,CAAC,KAAK,UAAY,CAAC,KAAK,SAAS,OAAO2F,CAAI,KAC/C,KAAK,SAAWA,EAChB3F,EAAU,aAAa,QAAS2F,EAAK,CAAC,EACtC3F,EAAU,aAAa,SAAU2F,EAAK,CAAC,GAIxCvB,GAAoBpE,EAAW5J,EAAE,GAAG,EACpC4J,EAAU,aAAa,UAAW,CAAC5J,EAAE,IAAI,EAAGA,EAAE,IAAI,EAAGuP,EAAK,EAAGA,EAAK,CAAC,EAAE,KAAK,GAAG,CAAC,EAE9E,KAAK,KAAK,QAAQ,EACpB,EAIC,UAAW,SAAUmH,EAAO,CAC3B,IAAI5N,EAAO4N,EAAM,MAAQ3c,GAAO,MAAM,EAKlC2c,EAAM,QAAQ,WACjBxH,EAAiBpG,EAAM4N,EAAM,QAAQ,SAAS,EAG3CA,EAAM,QAAQ,aACjBxH,EAAiBpG,EAAM,qBAAqB,EAG7C,KAAK,aAAa4N,CAAK,EACvB,KAAK,QAAQlc,EAAMkc,CAAK,GAAKA,CAC/B,EAEC,SAAU,SAAUA,EAAO,CACrB,KAAK,YAAc,KAAK,eAAc,EAC3C,KAAK,WAAW,YAAYA,EAAM,KAAK,EACvCA,EAAM,qBAAqBA,EAAM,KAAK,CACxC,EAEC,YAAa,SAAUA,EAAO,CAC7B3E,GAAe2E,EAAM,KAAK,EAC1BA,EAAM,wBAAwBA,EAAM,KAAK,EACzC,OAAO,KAAK,QAAQlc,EAAMkc,CAAK,EACjC,EAEC,YAAa,SAAUA,EAAO,CAC7BA,EAAM,SAAQ,EACdA,EAAM,QAAO,CACf,EAEC,aAAc,SAAUA,EAAO,CAC9B,IAAI5N,EAAO4N,EAAM,MACb3a,EAAU2a,EAAM,QAEf5N,IAED/M,EAAQ,QACX+M,EAAK,aAAa,SAAU/M,EAAQ,KAAK,EACzC+M,EAAK,aAAa,iBAAkB/M,EAAQ,OAAO,EACnD+M,EAAK,aAAa,eAAgB/M,EAAQ,MAAM,EAChD+M,EAAK,aAAa,iBAAkB/M,EAAQ,OAAO,EACnD+M,EAAK,aAAa,kBAAmB/M,EAAQ,QAAQ,EAEjDA,EAAQ,UACX+M,EAAK,aAAa,mBAAoB/M,EAAQ,SAAS,EAEvD+M,EAAK,gBAAgB,kBAAkB,EAGpC/M,EAAQ,WACX+M,EAAK,aAAa,oBAAqB/M,EAAQ,UAAU,EAEzD+M,EAAK,gBAAgB,mBAAmB,GAGzCA,EAAK,aAAa,SAAU,MAAM,EAG/B/M,EAAQ,MACX+M,EAAK,aAAa,OAAQ/M,EAAQ,WAAaA,EAAQ,KAAK,EAC5D+M,EAAK,aAAa,eAAgB/M,EAAQ,WAAW,EACrD+M,EAAK,aAAa,YAAa/M,EAAQ,UAAY,SAAS,GAE5D+M,EAAK,aAAa,OAAQ,MAAM,EAEnC,EAEC,YAAa,SAAU4N,EAAOpS,EAAQ,CACrC,KAAK,SAASoS,EAAOtS,GAAasS,EAAM,OAAQpS,CAAM,CAAC,CACzD,EAEC,cAAe,SAAUoS,EAAO,CAC/B,IAAIlS,EAAIkS,EAAM,OACV5G,EAAI,KAAK,IAAI,KAAK,MAAM4G,EAAM,OAAO,EAAG,CAAC,EACzC4K,EAAK,KAAK,IAAI,KAAK,MAAM5K,EAAM,QAAQ,EAAG,CAAC,GAAK5G,EAChDyc,EAAM,IAAMzc,EAAI,IAAMwR,EAAK,UAG3BjmB,EAAIqb,EAAM,OAAM,EAAK,OACxB,KAAOlS,EAAE,EAAIsL,GAAK,IAAMtL,EAAE,EAC1B+nB,EAAOzc,EAAI,EAAK,MAChByc,EAAO,CAACzc,EAAI,EAAK,MAElB,KAAK,SAAS4G,EAAOrb,CAAC,CACxB,EAEC,SAAU,SAAUqb,EAAO5N,EAAM,CAChC4N,EAAM,MAAM,aAAa,IAAK5N,CAAI,CACpC,EAGC,cAAe,SAAU4N,EAAO,CAC/B6O,GAAgB7O,EAAM,KAAK,CAC7B,EAEC,aAAc,SAAUA,EAAO,CAC9B8O,GAAe9O,EAAM,KAAK,CAC5B,CACA,CAAC,EAEGjS,EAAQ,KACX6nB,GAAI,QAAQH,EAAQ,EAMd,SAAStlB,GAAI9K,EAAS,CAC5B,OAAO0I,EAAQ,KAAOA,EAAQ,IAAM,IAAI6nB,GAAIvwB,CAAO,EAAI,IACxD,CC1MAoS,EAAI,QAAQ,CAKX,YAAa,SAAUuI,EAAO,CAI7B,IAAI8V,EAAW9V,EAAM,QAAQ,UAAY,KAAK,iBAAiBA,EAAM,QAAQ,IAAI,GAAK,KAAK,QAAQ,UAAY,KAAK,UAEpH,OAAK8V,IACJA,EAAW,KAAK,UAAY,KAAK,gBAAe,GAG5C,KAAK,SAASA,CAAQ,GAC1B,KAAK,SAASA,CAAQ,EAEhBA,CACT,EAEC,iBAAkB,SAAUzvB,EAAM,CACjC,GAAIA,IAAS,eAAiBA,IAAS,OACtC,MAAO,GAGR,IAAIyvB,EAAW,KAAK,eAAezvB,GACnC,OAAIyvB,IAAa,SAChBA,EAAW,KAAK,gBAAgB,CAAC,KAAMzvB,CAAI,CAAC,EAC5C,KAAK,eAAeA,GAAQyvB,GAEtBA,CACT,EAEC,gBAAiB,SAAUzwB,EAAS,CAInC,OAAQ,KAAK,QAAQ,cAAgB6K,GAAO7K,CAAO,GAAM8K,GAAI9K,CAAO,CACtE,CACA,CAAC,ECdS,IAAC0wB,GAAYtJ,GAAQ,OAAO,CACrC,WAAY,SAAU9O,EAActY,EAAS,CAC5ConB,GAAQ,UAAU,WAAW,KAAK,KAAM,KAAK,iBAAiB9O,CAAY,EAAGtY,CAAO,CACtF,EAIC,UAAW,SAAUsY,EAAc,CAClC,OAAO,KAAK,WAAW,KAAK,iBAAiBA,CAAY,CAAC,CAC5D,EAEC,iBAAkB,SAAUA,EAAc,CACzC,OAAAA,EAAe9S,GAAe8S,CAAY,EACnC,CACNA,EAAa,aAAY,EACzBA,EAAa,aAAY,EACzBA,EAAa,aAAY,EACzBA,EAAa,aAAY,CAC5B,CACA,CACA,CAAC,EAIM,SAASqY,GAAUrY,EAActY,EAAS,CAChD,OAAO,IAAI0wB,GAAUpY,EAActY,CAAO,CAC3C,CCrDAuwB,GAAI,OAASvyB,GACbuyB,GAAI,aAAeloB,GCAnBof,GAAQ,gBAAkBI,GAC1BJ,GAAQ,eAAiBS,GACzBT,GAAQ,gBAAkBW,GAC1BX,GAAQ,eAAiBgB,GACzBhB,GAAQ,gBAAkBiB,GAC1BjB,GAAQ,WAAakB,GACrBlB,GAAQ,UAAYK,GCKpB1V,EAAI,aAAa,CAIhB,QAAS,EACV,CAAC,EAEM,IAAIwe,GAAUrT,GAAQ,OAAO,CACnC,WAAY,SAAU1D,EAAK,CAC1B,KAAK,KAAOA,EACZ,KAAK,WAAaA,EAAI,WACtB,KAAK,MAAQA,EAAI,OAAO,YACxB,KAAK,mBAAqB,EAC1BA,EAAI,GAAG,SAAU,KAAK,SAAU,IAAI,CACtC,EAEC,SAAU,UAAY,CACrBvK,EAAY,KAAK,WAAY,YAAa,KAAK,aAAc,IAAI,CACnE,EAEC,YAAa,UAAY,CACxBC,GAAa,KAAK,WAAY,YAAa,KAAK,aAAc,IAAI,CACpE,EAEC,MAAO,UAAY,CAClB,OAAO,KAAK,MACd,EAEC,SAAU,UAAY,CACrByG,GAAe,KAAK,KAAK,EACzB,OAAO,KAAK,KACd,EAEC,YAAa,UAAY,CACxB,KAAK,mBAAqB,EAC1B,KAAK,OAAS,EAChB,EAEC,yBAA0B,UAAY,CACjC,KAAK,qBAAuB,IAC/B,aAAa,KAAK,kBAAkB,EACpC,KAAK,mBAAqB,EAE7B,EAEC,aAAc,SAAU1S,EAAG,CAC1B,GAAI,CAACA,EAAE,UAAcA,EAAE,QAAU,GAAOA,EAAE,SAAW,EAAO,MAAO,GAInE,KAAK,yBAAwB,EAC7B,KAAK,YAAW,EAEhBwa,GAA4B,EAC5BD,GAAwB,EAExB,KAAK,YAAc,KAAK,KAAK,2BAA2Bva,CAAC,EAEzDgM,EAAY,SAAU,CACrB,YAAagN,GACb,UAAW,KAAK,aAChB,QAAS,KAAK,WACd,QAAS,KAAK,UACjB,EAAK,IAAI,CACT,EAEC,aAAc,SAAUhZ,EAAG,CACrB,KAAK,SACT,KAAK,OAAS,GAEd,KAAK,KAAO4S,EAAe,MAAO,mBAAoB,KAAK,UAAU,EACrE/C,EAAiB,KAAK,WAAY,mBAAmB,EAErD,KAAK,KAAK,KAAK,cAAc,GAG9B,KAAK,OAAS,KAAK,KAAK,2BAA2B7P,CAAC,EAEpD,IAAIgB,EAAS,IAAIP,GAAO,KAAK,OAAQ,KAAK,WAAW,EACjDyP,EAAOlP,EAAO,QAAO,EAEzB2N,GAAoB,KAAK,KAAM3N,EAAO,GAAG,EAEzC,KAAK,KAAK,MAAM,MAASkP,EAAK,EAAI,KAClC,KAAK,KAAK,MAAM,OAASA,EAAK,EAAI,IACpC,EAEC,QAAS,UAAY,CAChB,KAAK,SACRwC,GAAe,KAAK,IAAI,EACxBmD,GAAoB,KAAK,WAAY,mBAAmB,GAGzDmF,GAA2B,EAC3BD,GAAuB,EAEvB9O,GAAa,SAAU,CACtB,YAAa+M,GACb,UAAW,KAAK,aAChB,QAAS,KAAK,WACd,QAAS,KAAK,UACjB,EAAK,IAAI,CACT,EAEC,WAAY,SAAUhZ,EAAG,CACxB,GAAK,EAAAA,EAAE,QAAU,GAAOA,EAAE,SAAW,KAErC,KAAK,QAAO,EAER,EAAC,KAAK,QAGV,MAAK,yBAAwB,EAC7B,KAAK,mBAAqB,WAAW+O,EAAU,KAAK,YAAa,IAAI,EAAG,CAAC,EAEzE,IAAI/N,EAAS,IAAIQ,GACT,KAAK,KAAK,uBAAuB,KAAK,WAAW,EACjD,KAAK,KAAK,uBAAuB,KAAK,MAAM,CAAC,EAErD,KAAK,KACH,UAAUR,CAAM,EAChB,KAAK,aAAc,CAAC,cAAeA,CAAM,CAAC,EAC9C,EAEC,WAAY,SAAUhB,EAAG,CACpBA,EAAE,UAAY,KACjB,KAAK,QAAO,EACZ,KAAK,yBAAwB,EAC7B,KAAK,YAAW,EAEnB,CACA,CAAC,EAKD8O,EAAI,YAAY,aAAc,UAAWwe,EAAO,EC7IhDxe,EAAI,aAAa,CAMhB,gBAAiB,EAClB,CAAC,EAEM,IAAIye,GAAkBtT,GAAQ,OAAO,CAC3C,SAAU,UAAY,CACrB,KAAK,KAAK,GAAG,WAAY,KAAK,eAAgB,IAAI,CACpD,EAEC,YAAa,UAAY,CACxB,KAAK,KAAK,IAAI,WAAY,KAAK,eAAgB,IAAI,CACrD,EAEC,eAAgB,SAAUja,EAAG,CAC5B,IAAIuW,EAAM,KAAK,KACX3E,EAAU2E,EAAI,QAAO,EACrBpH,EAAQoH,EAAI,QAAQ,UACpBlT,EAAOrD,EAAE,cAAc,SAAW4R,EAAUzC,EAAQyC,EAAUzC,EAE9DoH,EAAI,QAAQ,kBAAoB,SACnCA,EAAI,QAAQlT,CAAI,EAEhBkT,EAAI,cAAcvW,EAAE,eAAgBqD,CAAI,CAE3C,CACA,CAAC,EAcDyL,EAAI,YAAY,aAAc,kBAAmBye,EAAe,ECxChEze,EAAI,aAAa,CAGhB,SAAU,GAQV,QAAS,GAIT,oBAAqB,KAIrB,gBAAiB,IAGjB,cAAe,GAOf,cAAe,GAQf,mBAAoB,CACrB,CAAC,EAEM,IAAI0e,GAAOvT,GAAQ,OAAO,CAChC,SAAU,UAAY,CACrB,GAAI,CAAC,KAAK,WAAY,CACrB,IAAI1D,EAAM,KAAK,KAEf,KAAK,WAAa,IAAI6D,GAAU7D,EAAI,SAAUA,EAAI,UAAU,EAE5D,KAAK,WAAW,GAAG,CAClB,UAAW,KAAK,aAChB,KAAM,KAAK,QACX,QAAS,KAAK,UAClB,EAAM,IAAI,EAEP,KAAK,WAAW,GAAG,UAAW,KAAK,gBAAiB,IAAI,EACpDA,EAAI,QAAQ,gBACf,KAAK,WAAW,GAAG,UAAW,KAAK,eAAgB,IAAI,EACvDA,EAAI,GAAG,UAAW,KAAK,WAAY,IAAI,EAEvCA,EAAI,UAAU,KAAK,WAAY,IAAI,EAEvC,CACE1G,EAAiB,KAAK,KAAK,WAAY,iCAAiC,EACxE,KAAK,WAAW,OAAM,EACtB,KAAK,WAAa,CAAA,EAClB,KAAK,OAAS,CAAA,CAChB,EAEC,YAAa,UAAY,CACxBgG,GAAoB,KAAK,KAAK,WAAY,cAAc,EACxDA,GAAoB,KAAK,KAAK,WAAY,oBAAoB,EAC9D,KAAK,WAAW,QAAO,CACzB,EAEC,MAAO,UAAY,CAClB,OAAO,KAAK,YAAc,KAAK,WAAW,MAC5C,EAEC,OAAQ,UAAY,CACnB,OAAO,KAAK,YAAc,KAAK,WAAW,OAC5C,EAEC,aAAc,UAAY,CACzB,IAAIU,EAAM,KAAK,KAGf,GADAA,EAAI,MAAK,EACL,KAAK,KAAK,QAAQ,WAAa,KAAK,KAAK,QAAQ,mBAAoB,CACxE,IAAIvV,EAASgU,GAAa,KAAK,KAAK,QAAQ,SAAS,EAErD,KAAK,aAAejU,GACnB,KAAK,KAAK,uBAAuBC,EAAO,aAAY,CAAE,EAAE,WAAW,EAAE,EACrE,KAAK,KAAK,uBAAuBA,EAAO,aAAY,CAAE,EAAE,WAAW,EAAE,EACnE,IAAI,KAAK,KAAK,QAAO,CAAE,CAAC,EAE3B,KAAK,WAAa,KAAK,IAAI,EAAK,KAAK,IAAI,EAAK,KAAK,KAAK,QAAQ,kBAAkB,CAAC,CACtF,MACG,KAAK,aAAe,KAGrBuV,EACK,KAAK,WAAW,EAChB,KAAK,WAAW,EAEjBA,EAAI,QAAQ,UACf,KAAK,WAAa,CAAA,EAClB,KAAK,OAAS,CAAA,EAEjB,EAEC,QAAS,SAAUvW,EAAG,CACrB,GAAI,KAAK,KAAK,QAAQ,QAAS,CAC9B,IAAI3E,EAAO,KAAK,UAAY,CAAC,IAAI,KAC7BqQ,EAAM,KAAK,SAAW,KAAK,WAAW,SAAW,KAAK,WAAW,QAErE,KAAK,WAAW,KAAKA,CAAG,EACxB,KAAK,OAAO,KAAKrQ,CAAI,EAErB,KAAK,gBAAgBA,CAAI,CAC5B,CAEE,KAAK,KACA,KAAK,OAAQ2E,CAAC,EACd,KAAK,OAAQA,CAAC,CACrB,EAEC,gBAAiB,SAAU3E,EAAM,CAChC,KAAO,KAAK,WAAW,OAAS,GAAKA,EAAO,KAAK,OAAO,GAAK,IAC5D,KAAK,WAAW,MAAK,EACrB,KAAK,OAAO,MAAK,CAEpB,EAEC,WAAY,UAAY,CACvB,IAAIoyB,EAAW,KAAK,KAAK,QAAO,EAAG,SAAS,CAAC,EACzCC,EAAgB,KAAK,KAAK,mBAAmB,CAAC,EAAG,CAAC,CAAC,EAEvD,KAAK,oBAAsBA,EAAc,SAASD,CAAQ,EAAE,EAC5D,KAAK,YAAc,KAAK,KAAK,oBAAmB,EAAG,QAAO,EAAG,CAC/D,EAEC,cAAe,SAAUtwB,EAAOwwB,EAAW,CAC1C,OAAOxwB,GAASA,EAAQwwB,GAAa,KAAK,UAC5C,EAEC,gBAAiB,UAAY,CAC5B,GAAI,GAAC,KAAK,YAAc,CAAC,KAAK,cAE9B,KAAIliB,EAAS,KAAK,WAAW,QAAQ,SAAS,KAAK,WAAW,SAAS,EAEnEmiB,EAAQ,KAAK,aACbniB,EAAO,EAAImiB,EAAM,IAAI,IAAKniB,EAAO,EAAI,KAAK,cAAcA,EAAO,EAAGmiB,EAAM,IAAI,CAAC,GAC7EniB,EAAO,EAAImiB,EAAM,IAAI,IAAKniB,EAAO,EAAI,KAAK,cAAcA,EAAO,EAAGmiB,EAAM,IAAI,CAAC,GAC7EniB,EAAO,EAAImiB,EAAM,IAAI,IAAKniB,EAAO,EAAI,KAAK,cAAcA,EAAO,EAAGmiB,EAAM,IAAI,CAAC,GAC7EniB,EAAO,EAAImiB,EAAM,IAAI,IAAKniB,EAAO,EAAI,KAAK,cAAcA,EAAO,EAAGmiB,EAAM,IAAI,CAAC,GAEjF,KAAK,WAAW,QAAU,KAAK,WAAW,UAAU,IAAIniB,CAAM,EAChE,EAEC,eAAgB,UAAY,CAE3B,IAAIoiB,EAAa,KAAK,YAClBC,EAAY,KAAK,MAAMD,EAAa,CAAC,EACrCpY,EAAK,KAAK,oBACV9Z,EAAI,KAAK,WAAW,QAAQ,EAC5BoyB,GAASpyB,EAAImyB,EAAYrY,GAAMoY,EAAaC,EAAYrY,EACxDuY,GAASryB,EAAImyB,EAAYrY,GAAMoY,EAAaC,EAAYrY,EACxDwY,EAAO,KAAK,IAAIF,EAAQtY,CAAE,EAAI,KAAK,IAAIuY,EAAQvY,CAAE,EAAIsY,EAAQC,EAEjE,KAAK,WAAW,QAAU,KAAK,WAAW,QAAQ,MAAK,EACvD,KAAK,WAAW,QAAQ,EAAIC,CAC9B,EAEC,WAAY,SAAUjuB,EAAG,CACxB,IAAIuW,EAAM,KAAK,KACX7Z,EAAU6Z,EAAI,QAEduE,EAAY,CAACpe,EAAQ,SAAWsD,EAAE,WAAa,KAAK,OAAO,OAAS,EAIxE,GAFAuW,EAAI,KAAK,UAAWvW,CAAC,EAEjB8a,EACHvE,EAAI,KAAK,SAAS,MAEZ,CACN,KAAK,gBAAgB,CAAC,IAAI,IAAM,EAEhC,IAAIiS,EAAY,KAAK,SAAS,SAAS,KAAK,WAAW,EAAE,EACrDna,GAAY,KAAK,UAAY,KAAK,OAAO,IAAM,IAC/C6f,EAAOxxB,EAAQ,cAEfyxB,EAAc3F,EAAU,WAAW0F,EAAO7f,CAAQ,EAClDuS,EAAQuN,EAAY,WAAW,CAAC,EAAG,CAAC,CAAC,EAErCC,EAAe,KAAK,IAAI1xB,EAAQ,gBAAiBkkB,CAAK,EACtDyN,EAAqBF,EAAY,WAAWC,EAAexN,CAAK,EAEhE0N,EAAuBF,GAAgB1xB,EAAQ,oBAAsBwxB,GACrEziB,EAAS4iB,EAAmB,WAAW,CAACC,EAAuB,CAAC,EAAE,MAAK,EAEvE,CAAC7iB,EAAO,GAAK,CAACA,EAAO,EACxB8K,EAAI,KAAK,SAAS,GAGlB9K,EAAS8K,EAAI,aAAa9K,EAAQ8K,EAAI,QAAQ,SAAS,EAEvD/H,EAAsB,UAAY,CACjC+H,EAAI,MAAM9K,EAAQ,CACjB,SAAU6iB,EACV,cAAeJ,EACf,YAAa,GACb,QAAS,EACf,CAAM,CACN,CAAK,EAEL,CACA,CACA,CAAC,EAKDpf,EAAI,YAAY,aAAc,WAAY0e,EAAI,EC9N9C1e,EAAI,aAAa,CAIhB,SAAU,GAIV,iBAAkB,EACnB,CAAC,EAEM,IAAIyf,GAAWtU,GAAQ,OAAO,CAEpC,SAAU,CACT,KAAS,CAAC,EAAE,EACZ,MAAS,CAAC,EAAE,EACZ,KAAS,CAAC,EAAE,EACZ,GAAS,CAAC,EAAE,EACZ,OAAS,CAAC,IAAK,IAAK,GAAI,GAAG,EAC3B,QAAS,CAAC,IAAK,IAAK,GAAI,GAAG,CAC7B,EAEC,WAAY,SAAU1D,EAAK,CAC1B,KAAK,KAAOA,EAEZ,KAAK,aAAaA,EAAI,QAAQ,gBAAgB,EAC9C,KAAK,cAAcA,EAAI,QAAQ,SAAS,CAC1C,EAEC,SAAU,UAAY,CACrB,IAAIhM,EAAY,KAAK,KAAK,WAGtBA,EAAU,UAAY,IACzBA,EAAU,SAAW,KAGtBsC,EAAGtC,EAAW,CACb,MAAO,KAAK,SACZ,KAAM,KAAK,QACX,UAAW,KAAK,YACnB,EAAK,IAAI,EAEP,KAAK,KAAK,GAAG,CACZ,MAAO,KAAK,UACZ,KAAM,KAAK,YACd,EAAK,IAAI,CACT,EAEC,YAAa,UAAY,CACxB,KAAK,aAAY,EAEjByC,GAAI,KAAK,KAAK,WAAY,CACzB,MAAO,KAAK,SACZ,KAAM,KAAK,QACX,UAAW,KAAK,YACnB,EAAK,IAAI,EAEP,KAAK,KAAK,IAAI,CACb,MAAO,KAAK,UACZ,KAAM,KAAK,YACd,EAAK,IAAI,CACT,EAEC,aAAc,UAAY,CACzB,GAAI,MAAK,SAET,KAAIwhB,EAAO,SAAS,KAChBC,EAAQ,SAAS,gBACjBlM,EAAMiM,EAAK,WAAaC,EAAM,UAC9B9Y,EAAO6Y,EAAK,YAAcC,EAAM,WAEpC,KAAK,KAAK,WAAW,MAAK,EAE1B,OAAO,SAAS9Y,EAAM4M,CAAG,EAC3B,EAEC,SAAU,UAAY,CACrB,KAAK,SAAW,GAChB,KAAK,KAAK,KAAK,OAAO,CACxB,EAEC,QAAS,UAAY,CACpB,KAAK,SAAW,GAChB,KAAK,KAAK,KAAK,MAAM,CACvB,EAEC,aAAc,SAAUmM,EAAU,CACjC,IAAIC,EAAO,KAAK,SAAW,CAAA,EACvBC,EAAQ,KAAK,SACbt0B,EAAGE,EAEP,IAAKF,EAAI,EAAGE,EAAMo0B,EAAM,KAAK,OAAQt0B,EAAIE,EAAKF,IAC7Cq0B,EAAKC,EAAM,KAAKt0B,IAAM,CAAC,GAAKo0B,EAAU,CAAC,EAExC,IAAKp0B,EAAI,EAAGE,EAAMo0B,EAAM,MAAM,OAAQt0B,EAAIE,EAAKF,IAC9Cq0B,EAAKC,EAAM,MAAMt0B,IAAM,CAACo0B,EAAU,CAAC,EAEpC,IAAKp0B,EAAI,EAAGE,EAAMo0B,EAAM,KAAK,OAAQt0B,EAAIE,EAAKF,IAC7Cq0B,EAAKC,EAAM,KAAKt0B,IAAM,CAAC,EAAGo0B,CAAQ,EAEnC,IAAKp0B,EAAI,EAAGE,EAAMo0B,EAAM,GAAG,OAAQt0B,EAAIE,EAAKF,IAC3Cq0B,EAAKC,EAAM,GAAGt0B,IAAM,CAAC,EAAG,GAAKo0B,CAAQ,CAExC,EAEC,cAAe,SAAUG,EAAW,CACnC,IAAIF,EAAO,KAAK,UAAY,CAAA,EACxBC,EAAQ,KAAK,SACbt0B,EAAGE,EAEP,IAAKF,EAAI,EAAGE,EAAMo0B,EAAM,OAAO,OAAQt0B,EAAIE,EAAKF,IAC/Cq0B,EAAKC,EAAM,OAAOt0B,IAAMu0B,EAEzB,IAAKv0B,EAAI,EAAGE,EAAMo0B,EAAM,QAAQ,OAAQt0B,EAAIE,EAAKF,IAChDq0B,EAAKC,EAAM,QAAQt0B,IAAM,CAACu0B,CAE7B,EAEC,UAAW,UAAY,CACtBhiB,EAAG,SAAU,UAAW,KAAK,WAAY,IAAI,CAC/C,EAEC,aAAc,UAAY,CACzBG,GAAI,SAAU,UAAW,KAAK,WAAY,IAAI,CAChD,EAEC,WAAY,SAAUhN,EAAG,CACxB,GAAI,EAAAA,EAAE,QAAUA,EAAE,SAAWA,EAAE,SAE/B,KAAI9C,EAAM8C,EAAE,QACRuW,EAAM,KAAK,KACX9K,EAEJ,GAAIvO,KAAO,KAAK,UACf,GAAI,CAACqZ,EAAI,UAAY,CAACA,EAAI,SAAS,YAUlC,GATA9K,EAAS,KAAK,SAASvO,GACnB8C,EAAE,WACLyL,EAASjL,EAAQiL,CAAM,EAAE,WAAW,CAAC,GAGlC8K,EAAI,QAAQ,YACf9K,EAAS8K,EAAI,aAAa/V,EAAQiL,CAAM,EAAG8K,EAAI,QAAQ,SAAS,GAG7DA,EAAI,QAAQ,cAAe,CAC9B,IAAIuY,EAAYvY,EAAI,WAAWA,EAAI,UAAUA,EAAI,QAAQA,EAAI,UAAS,CAAE,EAAE,IAAI9K,CAAM,CAAC,CAAC,EACtF8K,EAAI,MAAMuY,CAAS,CACxB,MACKvY,EAAI,MAAM9K,CAAM,UAGRvO,KAAO,KAAK,UACtBqZ,EAAI,QAAQA,EAAI,QAAO,GAAMvW,EAAE,SAAW,EAAI,GAAK,KAAK,UAAU9C,EAAI,UAE5DA,IAAQ,IAAMqZ,EAAI,QAAUA,EAAI,OAAO,QAAQ,iBACzDA,EAAI,WAAU,MAGd,QAGD3I,GAAK5N,CAAC,EACR,CACA,CAAC,EAMD8O,EAAI,YAAY,aAAc,WAAYyf,EAAQ,EC3KlDzf,EAAI,aAAa,CAKhB,gBAAiB,GAKjB,kBAAmB,GAMnB,oBAAqB,EACtB,CAAC,EAEM,IAAIigB,GAAkB9U,GAAQ,OAAO,CAC3C,SAAU,UAAY,CACrBjO,EAAY,KAAK,KAAK,WAAY,QAAS,KAAK,eAAgB,IAAI,EAEpE,KAAK,OAAS,CAChB,EAEC,YAAa,UAAY,CACxBC,GAAa,KAAK,KAAK,WAAY,QAAS,KAAK,eAAgB,IAAI,CACvE,EAEC,eAAgB,SAAUjM,EAAG,CAC5B,IAAImP,EAAQ6f,GAAuBhvB,CAAC,EAEhCivB,EAAW,KAAK,KAAK,QAAQ,kBAEjC,KAAK,QAAU9f,EACf,KAAK,cAAgB,KAAK,KAAK,2BAA2BnP,CAAC,EAEtD,KAAK,aACT,KAAK,WAAa,CAAC,IAAI,MAGxB,IAAI2V,EAAO,KAAK,IAAIsZ,GAAY,CAAC,IAAI,KAAS,KAAK,YAAa,CAAC,EAEjE,aAAa,KAAK,MAAM,EACxB,KAAK,OAAS,WAAWlgB,EAAU,KAAK,aAAc,IAAI,EAAG4G,CAAI,EAEjEqD,GAAchZ,CAAC,CACjB,EAEC,aAAc,UAAY,CACzB,IAAIuW,EAAM,KAAK,KACXlT,EAAOkT,EAAI,QAAO,EAClBrD,EAAO,KAAK,KAAK,QAAQ,UAAY,EAEzCqD,EAAI,MAAK,EAGT,IAAI2Y,EAAK,KAAK,QAAU,KAAK,KAAK,QAAQ,oBAAsB,GAC5DC,EAAK,EAAI,KAAK,IAAI,GAAK,EAAI,KAAK,IAAI,CAAC,KAAK,IAAID,CAAE,CAAC,EAAE,EAAI,KAAK,IAC5DE,EAAKlc,EAAO,KAAK,KAAKic,EAAKjc,CAAI,EAAIA,EAAOic,EAC1ChgB,EAAQoH,EAAI,WAAWlT,GAAQ,KAAK,OAAS,EAAI+rB,EAAK,CAACA,EAAG,EAAI/rB,EAElE,KAAK,OAAS,EACd,KAAK,WAAa,KAEb8L,IAEDoH,EAAI,QAAQ,kBAAoB,SACnCA,EAAI,QAAQlT,EAAO8L,CAAK,EAExBoH,EAAI,cAAc,KAAK,cAAelT,EAAO8L,CAAK,EAErD,CACA,CAAC,EAKDL,EAAI,YAAY,aAAc,kBAAmBigB,EAAe,EC9EhE,IAAIM,GAAe,IAInBvgB,EAAI,aAAa,CAIhB,QAAS1J,EAAQ,aAAeA,EAAQ,QAAUA,EAAQ,OAK1D,aAAc,EACf,CAAC,EAEM,IAAIkqB,GAAUrV,GAAQ,OAAO,CACnC,SAAU,UAAY,CACrBjO,EAAY,KAAK,KAAK,WAAY,aAAc,KAAK,QAAS,IAAI,CACpE,EAEC,YAAa,UAAY,CACxBC,GAAa,KAAK,KAAK,WAAY,aAAc,KAAK,QAAS,IAAI,CACrE,EAEC,QAAS,SAAUjM,EAAG,CAErB,GADA,aAAa,KAAK,YAAY,EAC1BA,EAAE,QAAQ,SAAW,EAEzB,KAAIya,EAAQza,EAAE,QAAQ,GACtB,KAAK,UAAY,KAAK,QAAU,IAAIE,EAAMua,EAAM,QAASA,EAAM,OAAO,EAEtE,KAAK,aAAe,WAAW1L,EAAU,UAAY,CACpD,KAAK,QAAO,EACP,KAAK,YAAW,IAGrB/C,EAAY,SAAU,WAAYhD,EAAuB,EACzDgD,EAAY,SAAU,uBAAwB,KAAK,mBAAmB,EACtE,KAAK,eAAe,cAAeyO,CAAK,EAC3C,EAAK,IAAI,EAAG4U,EAAY,EAEtBrjB,EAAY,SAAU,mCAAoC,KAAK,QAAS,IAAI,EAC5EA,EAAY,SAAU,YAAa,KAAK,QAAS,IAAI,EACvD,EAEC,oBAAqB,SAASujB,GAAqB,CAClDtjB,GAAa,SAAU,WAAYjD,EAAuB,EAC1DiD,GAAa,SAAU,uBAAwBsjB,CAAkB,CACnE,EAEC,QAAS,UAAY,CACpB,aAAa,KAAK,YAAY,EAC9BtjB,GAAa,SAAU,mCAAoC,KAAK,QAAS,IAAI,EAC7EA,GAAa,SAAU,YAAa,KAAK,QAAS,IAAI,CACxD,EAEC,QAAS,SAAUjM,EAAG,CACrB,IAAIya,EAAQza,EAAE,QAAQ,GACtB,KAAK,QAAU,IAAIE,EAAMua,EAAM,QAASA,EAAM,OAAO,CACvD,EAEC,YAAa,UAAY,CACxB,OAAO,KAAK,QAAQ,WAAW,KAAK,SAAS,GAAK,KAAK,KAAK,QAAQ,YACtE,EAEC,eAAgB,SAAUvb,EAAMc,EAAG,CAClC,IAAIwvB,EAAiB,IAAI,WAAWtwB,EAAM,CACzC,QAAS,GACT,WAAY,GACZ,KAAM,OAEN,QAASc,EAAE,QACX,QAASA,EAAE,QACX,QAASA,EAAE,QACX,QAASA,EAAE,OAGd,CAAG,EAEDwvB,EAAe,WAAa,GAE5BxvB,EAAE,OAAO,cAAcwvB,CAAc,CACvC,CACA,CAAC,EAKD1gB,EAAI,YAAY,aAAc,UAAWwgB,EAAO,ECxFhDxgB,EAAI,aAAa,CAOhB,UAAW1J,EAAQ,MAKnB,mBAAoB,EACrB,CAAC,EAEM,IAAIqqB,GAAYxV,GAAQ,OAAO,CACrC,SAAU,UAAY,CACrBpK,EAAiB,KAAK,KAAK,WAAY,oBAAoB,EAC3D7D,EAAY,KAAK,KAAK,WAAY,aAAc,KAAK,cAAe,IAAI,CAC1E,EAEC,YAAa,UAAY,CACxB6J,GAAoB,KAAK,KAAK,WAAY,oBAAoB,EAC9D5J,GAAa,KAAK,KAAK,WAAY,aAAc,KAAK,cAAe,IAAI,CAC3E,EAEC,cAAe,SAAUjM,EAAG,CAC3B,IAAIuW,EAAM,KAAK,KACf,GAAI,GAACvW,EAAE,SAAWA,EAAE,QAAQ,SAAW,GAAKuW,EAAI,gBAAkB,KAAK,UAEvE,KAAIkF,EAAKlF,EAAI,2BAA2BvW,EAAE,QAAQ,EAAE,EAChD0b,EAAKnF,EAAI,2BAA2BvW,EAAE,QAAQ,EAAE,EAEpD,KAAK,aAAeuW,EAAI,QAAO,EAAG,UAAU,CAAC,EAC7C,KAAK,aAAeA,EAAI,uBAAuB,KAAK,YAAY,EAC5DA,EAAI,QAAQ,YAAc,WAC7B,KAAK,kBAAoBA,EAAI,uBAAuBkF,EAAG,IAAIC,CAAE,EAAE,UAAU,CAAC,CAAC,GAG5E,KAAK,WAAaD,EAAG,WAAWC,CAAE,EAClC,KAAK,WAAanF,EAAI,QAAO,EAE7B,KAAK,OAAS,GACd,KAAK,SAAW,GAEhBA,EAAI,MAAK,EAETvK,EAAY,SAAU,YAAa,KAAK,aAAc,IAAI,EAC1DA,EAAY,SAAU,uBAAwB,KAAK,YAAa,IAAI,EAEpEhD,GAAwBhJ,CAAC,EAC3B,EAEC,aAAc,SAAUA,EAAG,CAC1B,GAAI,GAACA,EAAE,SAAWA,EAAE,QAAQ,SAAW,GAAK,CAAC,KAAK,UAElD,KAAIuW,EAAM,KAAK,KACXkF,EAAKlF,EAAI,2BAA2BvW,EAAE,QAAQ,EAAE,EAChD0b,EAAKnF,EAAI,2BAA2BvW,EAAE,QAAQ,EAAE,EAChDuD,EAAQkY,EAAG,WAAWC,CAAE,EAAI,KAAK,WAUrC,GARA,KAAK,MAAQnF,EAAI,aAAahT,EAAO,KAAK,UAAU,EAEhD,CAACgT,EAAI,QAAQ,qBACf,KAAK,MAAQA,EAAI,WAAU,GAAMhT,EAAQ,GACzC,KAAK,MAAQgT,EAAI,WAAU,GAAMhT,EAAQ,KAC1C,KAAK,MAAQgT,EAAI,WAAW,KAAK,KAAK,GAGnCA,EAAI,QAAQ,YAAc,UAE7B,GADA,KAAK,QAAU,KAAK,aAChBhT,IAAU,EAAK,WACb,CAEN,IAAI4L,EAAQsM,EAAG,KAAKC,CAAE,EAAE,UAAU,CAAC,EAAE,UAAU,KAAK,YAAY,EAChE,GAAInY,IAAU,GAAK4L,EAAM,IAAM,GAAKA,EAAM,IAAM,EAAK,OACrD,KAAK,QAAUoH,EAAI,UAAUA,EAAI,QAAQ,KAAK,kBAAmB,KAAK,KAAK,EAAE,SAASpH,CAAK,EAAG,KAAK,KAAK,CAC3G,CAEO,KAAK,SACToH,EAAI,WAAW,GAAM,EAAK,EAC1B,KAAK,OAAS,IAGf3H,EAAqB,KAAK,YAAY,EAEtC,IAAI8gB,EAAS3gB,EAAUwH,EAAI,MAAOA,EAAK,KAAK,QAAS,KAAK,MAAO,CAAC,MAAO,GAAM,MAAO,EAAK,EAAG,MAAS,EACvG,KAAK,aAAe/H,EAAsBkhB,EAAQ,KAAM,EAAI,EAE5D1mB,GAAwBhJ,CAAC,EAC3B,EAEC,YAAa,UAAY,CACxB,GAAI,CAAC,KAAK,QAAU,CAAC,KAAK,SAAU,CACnC,KAAK,SAAW,GAChB,MACH,CAEE,KAAK,SAAW,GAChB4O,EAAqB,KAAK,YAAY,EAEtC3C,GAAa,SAAU,YAAa,KAAK,aAAc,IAAI,EAC3DA,GAAa,SAAU,uBAAwB,KAAK,YAAa,IAAI,EAGjE,KAAK,KAAK,QAAQ,cACrB,KAAK,KAAK,aAAa,KAAK,QAAS,KAAK,KAAK,WAAW,KAAK,KAAK,EAAG,GAAM,KAAK,KAAK,QAAQ,QAAQ,EAEvG,KAAK,KAAK,WAAW,KAAK,QAAS,KAAK,KAAK,WAAW,KAAK,KAAK,CAAC,CAEtE,CACA,CAAC,EAKD6C,EAAI,YAAY,aAAc,YAAa2gB,EAAS,EC/HpD3gB,EAAI,QAAUwe,GAEdxe,EAAI,gBAAkBye,GAEtBze,EAAI,KAAO0e,GAEX1e,EAAI,SAAWyf,GAEfzf,EAAI,gBAAkBigB,GAEtBjgB,EAAI,QAAUwgB,GAEdxgB,EAAI,UAAY2gB,4mCCdhB,IAAAE,GAA2B,SCG3B,SAASC,GAAmBC,EAAU,CACpC,IAAIC,EAAc,KAAK,YACvB,OAAO,KAAK,KACV,SAASC,EAAO,CAEd,OAAOD,EAAY,QAAQD,EAAS,CAAC,EAAE,KAAK,UAAW,CACrD,OAAOE,CACT,CAAC,CACH,EACA,SAASC,EAAQ,CAEf,OAAOF,EAAY,QAAQD,EAAS,CAAC,EAAE,KAAK,UAAW,CAErD,OAAOC,EAAY,OAAOE,CAAM,CAClC,CAAC,CACH,CACF,CACF,CAEA,IAAOC,GAAQL,GCtBf,SAASM,GAAWC,EAAK,CACvB,IAAIC,EAAI,KACR,OAAO,IAAIA,EAAE,SAASC,EAASC,EAAQ,CACrC,GAAI,EAAEH,GAAO,OAAOA,EAAI,OAAW,KACjC,OAAOG,EACL,IAAI,UACF,OAAOH,EACL,IACAA,EACA,gEACJ,CACF,EAEF,IAAII,EAAO,MAAM,UAAU,MAAM,KAAKJ,CAAG,EACzC,GAAII,EAAK,SAAW,EAAG,OAAOF,EAAQ,CAAC,CAAC,EACxC,IAAIG,EAAYD,EAAK,OAErB,SAASE,EAAIC,EAAGC,EAAK,CACnB,GAAIA,IAAQ,OAAOA,GAAQ,UAAY,OAAOA,GAAQ,YAAa,CACjE,IAAIC,EAAOD,EAAI,KACf,GAAI,OAAOC,GAAS,WAAY,CAC9BA,EAAK,KACHD,EACA,SAASA,EAAK,CACZF,EAAIC,EAAGC,CAAG,CACZ,EACA,SAASE,EAAG,CACVN,EAAKG,GAAK,CAAE,OAAQ,WAAY,OAAQG,CAAE,EACtC,EAAEL,IAAc,GAClBH,EAAQE,CAAI,CAEhB,CACF,EACA,MACF,CACF,CACAA,EAAKG,GAAK,CAAE,OAAQ,YAAa,MAAOC,CAAI,EACxC,EAAEH,IAAc,GAClBH,EAAQE,CAAI,CAEhB,CAEA,QAASG,EAAI,EAAGA,EAAIH,EAAK,OAAQG,IAC/BD,EAAIC,EAAGH,EAAKG,EAAE,CAElB,CAAC,CACH,CAEA,IAAOI,GAAQZ,GC3Cf,IAAIa,GAAiB,WAErB,SAASC,GAAQC,EAAG,CAClB,OAAO,QAAQA,GAAK,OAAOA,EAAE,OAAW,GAAW,CACrD,CAEA,SAASC,IAAO,CAAC,CAGjB,SAASC,GAAKC,EAAIC,EAAS,CACzB,OAAO,UAAW,CAChBD,EAAG,MAAMC,EAAS,SAAS,CAC7B,CACF,CAMA,SAASC,GAAQF,EAAI,CACnB,GAAI,EAAE,gBAAgBE,IACpB,MAAM,IAAI,UAAU,sCAAsC,EAC5D,GAAI,OAAOF,GAAO,WAAY,MAAM,IAAI,UAAU,gBAAgB,EAElE,KAAK,OAAS,EAEd,KAAK,SAAW,GAEhB,KAAK,OAAS,OAEd,KAAK,WAAa,CAAC,EAEnBG,GAAUH,EAAI,IAAI,CACpB,CAEA,SAASI,GAAOC,EAAMC,EAAU,CAC9B,KAAOD,EAAK,SAAW,GACrBA,EAAOA,EAAK,OAEd,GAAIA,EAAK,SAAW,EAAG,CACrBA,EAAK,WAAW,KAAKC,CAAQ,EAC7B,MACF,CACAD,EAAK,SAAW,GAChBH,GAAQ,aAAa,UAAW,CAC9B,IAAIK,EAAKF,EAAK,SAAW,EAAIC,EAAS,YAAcA,EAAS,WAC7D,GAAIC,IAAO,KAAM,EACdF,EAAK,SAAW,EAAIG,GAAUC,IAAQH,EAAS,QAASD,EAAK,MAAM,EACpE,MACF,CACA,IAAIK,EACJ,GAAI,CACFA,EAAMH,EAAGF,EAAK,MAAM,CACtB,OAASM,EAAP,CACAF,GAAOH,EAAS,QAASK,CAAC,EAC1B,MACF,CACAH,GAAQF,EAAS,QAASI,CAAG,CAC/B,CAAC,CACH,CAEA,SAASF,GAAQH,EAAMO,EAAU,CAC/B,GAAI,CAEF,GAAIA,IAAaP,EACf,MAAM,IAAI,UAAU,2CAA2C,EACjE,GACEO,IACC,OAAOA,GAAa,UAAY,OAAOA,GAAa,YACrD,CACA,IAAIC,EAAOD,EAAS,KACpB,GAAIA,aAAoBV,GAAS,CAC/BG,EAAK,OAAS,EACdA,EAAK,OAASO,EACdE,GAAOT,CAAI,EACX,MACF,SAAW,OAAOQ,GAAS,WAAY,CACrCV,GAAUJ,GAAKc,EAAMD,CAAQ,EAAGP,CAAI,EACpC,MACF,CACF,CACAA,EAAK,OAAS,EACdA,EAAK,OAASO,EACdE,GAAOT,CAAI,CACb,OAASM,EAAP,CACAF,GAAOJ,EAAMM,CAAC,CAChB,CACF,CAEA,SAASF,GAAOJ,EAAMO,EAAU,CAC9BP,EAAK,OAAS,EACdA,EAAK,OAASO,EACdE,GAAOT,CAAI,CACb,CAEA,SAASS,GAAOT,EAAM,CAChBA,EAAK,SAAW,GAAKA,EAAK,WAAW,SAAW,GAClDH,GAAQ,aAAa,UAAW,CACzBG,EAAK,UACRH,GAAQ,sBAAsBG,EAAK,MAAM,CAE7C,CAAC,EAGH,QAASU,EAAI,EAAGC,EAAMX,EAAK,WAAW,OAAQU,EAAIC,EAAKD,IACrDX,GAAOC,EAAMA,EAAK,WAAWU,EAAE,EAEjCV,EAAK,WAAa,IACpB,CAKA,SAASY,GAAQC,EAAaC,EAAYC,EAAS,CACjD,KAAK,YAAc,OAAOF,GAAgB,WAAaA,EAAc,KACrE,KAAK,WAAa,OAAOC,GAAe,WAAaA,EAAa,KAClE,KAAK,QAAUC,CACjB,CAQA,SAASjB,GAAUH,EAAIK,EAAM,CAC3B,IAAIgB,EAAO,GACX,GAAI,CACFrB,EACE,SAASsB,EAAO,CACVD,IACJA,EAAO,GACPb,GAAQH,EAAMiB,CAAK,EACrB,EACA,SAASC,EAAQ,CACXF,IACJA,EAAO,GACPZ,GAAOJ,EAAMkB,CAAM,EACrB,CACF,CACF,OAASC,EAAP,CACA,GAAIH,EAAM,OACVA,EAAO,GACPZ,GAAOJ,EAAMmB,CAAE,CACjB,CACF,CAEAtB,GAAQ,UAAU,MAAW,SAASiB,EAAY,CAChD,OAAO,KAAK,KAAK,KAAMA,CAAU,CACnC,EAEAjB,GAAQ,UAAU,KAAO,SAASgB,EAAaC,EAAY,CAEzD,IAAIM,EAAO,IAAI,KAAK,YAAY3B,EAAI,EAEpC,OAAAM,GAAO,KAAM,IAAIa,GAAQC,EAAaC,EAAYM,CAAI,CAAC,EAChDA,CACT,EAEAvB,GAAQ,UAAU,QAAawB,GAE/BxB,GAAQ,IAAM,SAASyB,EAAK,CAC1B,OAAO,IAAIzB,GAAQ,SAASM,EAASC,EAAQ,CAC3C,GAAI,CAACb,GAAQ+B,CAAG,EACd,OAAOlB,EAAO,IAAI,UAAU,8BAA8B,CAAC,EAG7D,IAAImB,EAAO,MAAM,UAAU,MAAM,KAAKD,CAAG,EACzC,GAAIC,EAAK,SAAW,EAAG,OAAOpB,EAAQ,CAAC,CAAC,EACxC,IAAIqB,EAAYD,EAAK,OAErB,SAASE,EAAIf,EAAGgB,EAAK,CACnB,GAAI,CACF,GAAIA,IAAQ,OAAOA,GAAQ,UAAY,OAAOA,GAAQ,YAAa,CACjE,IAAIlB,EAAOkB,EAAI,KACf,GAAI,OAAOlB,GAAS,WAAY,CAC9BA,EAAK,KACHkB,EACA,SAASA,EAAK,CACZD,EAAIf,EAAGgB,CAAG,CACZ,EACAtB,CACF,EACA,MACF,CACF,CACAmB,EAAKb,GAAKgB,EACN,EAAEF,IAAc,GAClBrB,EAAQoB,CAAI,CAEhB,OAASJ,EAAP,CACAf,EAAOe,CAAE,CACX,CACF,CAEA,QAAST,EAAI,EAAGA,EAAIa,EAAK,OAAQb,IAC/Be,EAAIf,EAAGa,EAAKb,EAAE,CAElB,CAAC,CACH,EAEAb,GAAQ,WAAa8B,GAErB9B,GAAQ,QAAU,SAASoB,EAAO,CAChC,OAAIA,GAAS,OAAOA,GAAU,UAAYA,EAAM,cAAgBpB,GACvDoB,EAGF,IAAIpB,GAAQ,SAASM,EAAS,CACnCA,EAAQc,CAAK,CACf,CAAC,CACH,EAEApB,GAAQ,OAAS,SAASoB,EAAO,CAC/B,OAAO,IAAIpB,GAAQ,SAASM,EAASC,EAAQ,CAC3CA,EAAOa,CAAK,CACd,CAAC,CACH,EAEApB,GAAQ,KAAO,SAASyB,EAAK,CAC3B,OAAO,IAAIzB,GAAQ,SAASM,EAASC,EAAQ,CAC3C,GAAI,CAACb,GAAQ+B,CAAG,EACd,OAAOlB,EAAO,IAAI,UAAU,+BAA+B,CAAC,EAG9D,QAAS,EAAI,EAAGO,EAAMW,EAAI,OAAQ,EAAIX,EAAK,IACzCd,GAAQ,QAAQyB,EAAI,EAAE,EAAE,KAAKnB,EAASC,CAAM,CAEhD,CAAC,CACH,EAGAP,GAAQ,aAEL,OAAO,cAAiB,YACvB,SAASF,EAAI,CAEX,aAAaA,CAAE,CACjB,GACF,SAASA,EAAI,CACXL,GAAeK,EAAI,CAAC,CACtB,EAEFE,GAAQ,sBAAwB,SAA+B+B,EAAK,CAC9D,OAAO,QAAY,KAAe,SACpC,QAAQ,KAAK,wCAAyCA,CAAG,CAE7D,EAEA,IAAOC,GAAQhC,GC5Pf,IAAMiC,GAAW,aACXC,GAAiB,IAIjB,SAAUC,GACdC,EACAC,EAA8C,KAA9CC,EAAAD,IAAA,OAA4C,CAAA,EAAEA,EAA5CE,EAAAD,EAAA,UAAAE,EAASD,IAAA,OAAG,KAAKA,EAAEE,EAAAH,EAAA,cAAAI,EAAaD,IAAA,OAAG,CAAA,EAAEA,EAEvC,GAAIL,EAAO,OACT,QAASO,EAAI,EAAGA,EAAIP,EAAO,OAAO,OAAQO,IAAK,CAC7C,IAAIC,EAAI,IAAIC,GAAU,CAAE,cAAaH,CAAA,CAAE,EACvCN,EAAO,OAAOO,GAAKC,EAAE,SAASR,EAAO,OAAOO,EAAE,EAMlD,QAFIG,EAAI,GACJC,EAAO,CAAC,UAAW,SAAU,cAAe,SAAS,EAChDC,EAAQ,EAAGA,EAAQ,EAAGA,IAAS,CAEtC,QADIC,EAAO,CAAE,MAAKD,EAAE,cAAaN,CAAA,EACjBQ,EAAA,EAAAC,EAAAJ,EAAAG,EAAAC,EAAA,OAAAD,IAAM,CAAjB,IAAIE,EAAGD,EAAAD,GACNG,EAAMjB,EAAOgB,GACbC,IACFjB,EAAOgB,GAAOE,GAASD,EAAKJ,CAAI,GAKpC,GADAH,EAAI,KAAK,UAAUV,CAAM,EACrBU,EAAE,OAASN,EACb,OAAOM,EAIX,IAAIS,EAAS,CACX,KAAMT,EAAE,MAAM,EAAG,KAAK,MAAMN,EAAY,CAAC,CAAC,EAAI,OAEhDO,EAAK,KAAK,QAAQ,EAClB,QAAgBS,EAAA,EAAAC,EAAAV,EAAAS,EAAAC,EAAA,OAAAD,IAAM,CAAjB,IAAIJ,EAAGK,EAAAD,GACNH,EAAMjB,EAAOgB,GACZC,IAILP,EAAI,KAAK,UAAUO,CAAG,EACtBE,EAAOH,GAAON,EAAE,QAGlB,IAAIY,EAAM,IAAI,MACZ,4DAA4D,EAE7D,MAAAA,EAAY,OAASH,EAChBG,CACR,CAEA,SAASC,GAAMC,EAAaZ,EAAa,CACvC,OAAOY,GAAOZ,GAAS,CACzB,CAOA,IAAAH,GAAA,UAAA,CAUE,SAAAA,EAAYI,EAAuB,CAT3B,KAAA,gBAAkB,KAClB,KAAA,gBAAkBf,GAClB,KAAA,eAAiBA,GACjB,KAAA,SAAW,EAEX,KAAA,KAAiB,CAAA,EACjB,KAAA,cAAuB,CAAA,EACvB,KAAA,KAAc,CAAA,EAGpB,IAAIc,EAAQC,EAAK,OAAS,EAC1B,KAAK,cAAgBA,EAAK,eAAiB,CAAA,EAE3C,KAAK,gBAAkBU,GAAM,KAAK,gBAAiBX,CAAK,EACxD,KAAK,gBAAkBW,GAAM,KAAK,gBAAiBX,CAAK,EACxD,KAAK,eAAiBW,GAAM,KAAK,eAAgBX,CAAK,EACtD,KAAK,SAAWW,GAAM,KAAK,SAAUX,CAAK,CAC5C,CAEO,OAAAH,EAAA,UAAA,SAAP,SAAgBgB,EAAYT,EAAUU,EAAS,CAC7C,GAD0BV,IAAA,SAAAA,EAAA,IAAUU,IAAA,SAAAA,EAAA,GAChCD,GAAU,KACZ,OAAOA,EAGT,OAAQ,OAAOA,EAAO,CACpB,IAAK,UACL,IAAK,SACL,IAAK,WACH,OAAOA,EACT,IAAK,SACH,OAAO,KAAK,eAAeA,CAAK,EAClC,IAAK,SACH,MACF,QACE,OAAO,KAAK,eAAe,OAAOA,CAAK,CAAC,EAG5C,GAAIA,aAAiB,OACnB,OAAO,KAAK,eAAeA,EAAM,SAAQ,CAAE,EAG7C,GACEA,aAAiB,SACjBA,aAAiB,QACjBA,aAAiB,MACjBA,aAAiB,OAEjB,OAAOA,EAGT,GAAIA,aAAiB,MACnB,OAAO,KAAK,eAAeA,EAAM,SAAQ,CAAE,EAG7C,GAAI,KAAK,KAAK,QAAQA,CAAK,GAAK,EAC9B,MAAO,aAAa,KAAK,QAAQA,CAAK,EAAC,IAGzC,IAAIE,EAAOC,GAAWH,CAAK,EAG3B,GADAC,IACIA,EAAQ,KAAK,SACf,MAAO,cAAcC,EAAI,IAM3B,OAHA,KAAK,KAAK,KAAKX,CAAG,EAClB,KAAK,KAAK,KAAKS,CAAK,EAEZE,EAAM,CACZ,IAAK,QACH,OAAO,KAAK,cAAcF,EAAOC,CAAK,EACxC,IAAK,SACH,OAAO,KAAK,eAAeD,EAAOC,CAAK,EACzC,QACE,IAAIG,EAAQ,KAAK,SACjB,KAAK,SAAW,EAEhB,IAAIZ,EAAM,KAAK,eAAeQ,EAAOC,CAAK,EAC1C,OAAAT,EAAI,OAASU,EAEb,KAAK,SAAWE,EAETZ,EAEb,EAEQR,EAAA,UAAA,QAAR,SAAgBgB,EAAK,CAGnB,QAFIK,EAAQ,KAAK,KAAK,QAAQL,CAAK,EAC/BM,EAAO,CAAC,KAAK,KAAKD,EAAM,EACnBvB,EAAIuB,EAAOvB,GAAK,EAAGA,IAAK,CAC/B,IAAIyB,EAAM,KAAK,KAAKzB,GAChByB,GAAOC,GAAQD,EAAKD,EAAK,EAAE,IAAMN,IACnCA,EAAQO,EACRD,EAAK,QAAQ,KAAK,KAAKxB,EAAE,GAG7B,MAAO,IAAMwB,EAAK,KAAK,GAAG,CAC5B,EAEQtB,EAAA,UAAA,eAAR,SAAuBC,EAAS,CAC9B,OAAIA,EAAE,OAAS,KAAK,gBACXA,EAAE,MAAM,EAAG,KAAK,eAAe,EAAI,MAErCA,CACT,EAEQD,EAAA,UAAA,cAAR,SAAsByB,EAAYR,EAAS,CAATA,IAAA,SAAAA,EAAA,GAGhC,QAFIS,EAAS,EACTC,EAAW,CAAA,EACN7B,EAAI,EAAGA,EAAI2B,EAAI,OAAQ3B,IAAK,CACnC,IAAI8B,EAAKH,EAAI3B,GAIb,GAHA6B,EAAI,KAAK,KAAK,SAASC,EAAI9B,EAAE,SAAQ,EAAImB,CAAK,CAAC,EAE/CS,IACIA,GAAU,KAAK,eACjB,MAGJ,OAAOC,CACT,EAEQ3B,EAAA,UAAA,eAAR,SAAuBQ,EAAUS,EAAS,CAATA,IAAA,SAAAA,EAAA,GAC/B,IAAIS,EAAS,EACTC,EAAM,CAAA,EACV,QAASpB,KAAOC,EACd,GAAK,OAAO,UAAU,eAAe,KAAKA,EAAKD,CAAG,EAGlD,IAAIsB,GAActB,EAAK,KAAK,aAAa,EAAG,CAC1CoB,EAAIpB,GAAOnB,GACX,SAGF,IAAI4B,EAAQQ,GAAQhB,EAAKD,CAAG,EAE5B,GAAI,EAAAS,IAAU,QAAa,OAAOA,GAAU,cAG5CW,EAAIpB,GAAO,KAAK,SAASS,EAAOT,EAAKU,CAAK,EAE1CS,IACIA,GAAU,KAAK,iBACjB,MAGJ,OAAOC,CACT,EACF3B,CAAA,EApJA,EAsJM,SAAUS,GAASO,EAAYZ,EAA4B,CAA5BA,IAAA,SAAAA,EAAA,CAAA,GACnC,IAAI,EAAI,IAAIJ,GAAUI,CAAI,EAC1B,OAAO,EAAE,SAASY,CAAK,CACzB,CAEA,SAASQ,GAAQhB,EAAUsB,EAAY,CAErC,GAAI,CACF,OAAOtB,EAAIsB,QACX,CACA,OAEJ,CAEA,SAASX,GAAWX,EAAQ,CAC1B,IAAIP,EAAI,OAAO,UAAU,SAAS,MAAMO,CAAG,EAC3C,OAAOP,EAAE,MAAM,EAAmB,EAAE,CACtC,CAEA,SAAS4B,GAActB,EAAaV,EAAoB,CACtD,QAAcQ,EAAA,EAAA0B,EAAAlC,EAAAQ,EAAA0B,EAAA,OAAA1B,IAAe,CAAxB,IAAI2B,EAACD,EAAA1B,GAIR,GAHI2B,IAAMzB,GAGNyB,aAAa,QACXzB,EAAI,MAAMyB,CAAC,EACb,MAAO,GAIb,MAAO,EACT,CC/OA,IAAAC,GAAA,UAAA,CAUE,SAAAA,EAAYC,EAAiBC,EAAcC,EAAgB,CAH3D,KAAA,KAAO,EACP,KAAA,OAAS,EAGP,KAAK,QAAUF,EAEf,KAAK,KAAOC,EACZ,KAAK,UAAYC,GAAa,IAAI,IACpC,CAEA,OAAAH,EAAA,UAAA,IAAA,SAAII,EAAc,CAChB,KAAK,QAAUA,GAAoB,IAAI,KAEvC,KAAK,MAAQ,KAAK,QAAQ,QAAO,EAAK,KAAK,UAAU,QAAO,EAC5D,KAAK,QAAQ,UAAU,KAAK,KAAM,KAAK,IAAI,EAC3C,KAAK,QAAU,IACjB,EAEAJ,EAAA,UAAA,OAAA,UAAA,CACE,GAAI,MAAK,QAAO,EAGhB,KAAIK,EAAM,IAAI,KACd,KAAK,MAAQA,EAAI,QAAO,EAAK,KAAK,UAAU,QAAO,EACnD,KAAK,UAAY,KACnB,EAEAL,EAAA,UAAA,QAAA,UAAA,CACO,KAAK,QAAO,IAGjB,KAAK,UAAY,IAAI,KACvB,EAEAA,EAAA,UAAA,QAAA,UAAA,CACE,OAAO,KAAK,WAAa,IAC3B,EACFA,CAAA,EA5CA,EA8CA,IAAAM,GAAA,UAAA,CAOE,SAAAA,GAAA,CAHA,KAAA,OAAS,CAAA,EACT,KAAA,QAAU,CAAA,EAGR,KAAK,UAAY,IAAI,IACvB,CAEA,OAAAA,EAAA,UAAA,IAAA,SAAIC,EAAc,CACX,KAAK,UACR,KAAK,QAAUA,GAAW,IAAI,KAElC,EAEAD,EAAA,UAAA,YAAA,UAAA,CACE,MAAO,EACT,EAEAA,EAAA,UAAA,UAAA,SAAUE,EAAcC,EAAgB,CACtC,IAAIC,EAAO,KAAK,OAAOF,GACnBE,EACFA,EAAK,UAELA,EAAO,IAAIC,GAAK,KAAMH,EAAMC,CAAS,EACrC,KAAK,OAAOD,GAAQE,EAExB,EAEAJ,EAAA,UAAA,QAAA,SAAQE,EAAcD,EAAc,CAClC,IAAIG,EAAO,KAAK,OAAOF,GACvB,GAAI,CAACE,EAAM,CACT,QAAQ,MAAM,mCAAoCF,CAAI,EACtD,OAGEE,EAAK,OAAS,EAChBA,EAAK,UAELA,EAAK,IAAIH,CAAO,EAChB,OAAO,KAAK,OAAOG,EAAK,MAE5B,EAEAJ,EAAA,UAAA,UAAA,SAAUE,EAAcI,EAAU,CAChC,KAAK,QAAQJ,IAAS,KAAK,QAAQA,IAAS,GAAKI,CACnD,EAEAN,EAAA,UAAA,UAAA,UAAA,CACE,OAAK,KAAK,UACR,KAAK,QAAU,IAAI,MAEd,KAAK,QAAQ,QAAO,EAAK,KAAK,UAAU,QAAO,CACxD,EACFA,CAAA,EAxDA,EA0DA,IAAAO,GAAA,UAAA,CAAA,SAAAA,GAAA,CAOA,CANE,OAAAA,EAAA,UAAA,YAAA,UAAA,CACE,MAAO,EACT,EACAA,EAAA,UAAA,UAAA,SAAUC,EAAeC,EAAiB,CAAS,EACnDF,EAAA,UAAA,QAAA,SAAQC,EAAeC,EAAiB,CAAS,EACjDF,EAAA,UAAA,UAAA,SAAUC,EAAeE,EAAW,CAAS,EAC/CH,CAAA,EAPA,4NCnGAI,GAAA,UAAA,CAAA,SAAAA,GAAA,CACE,KAAA,YAAc,IAAIC,GAIlB,KAAA,SAAiB,CAAA,EAEjB,KAAA,eAAiB,GACjB,KAAA,SAA6B,CAAA,CAyE/B,CAtEE,OAAAD,EAAA,UAAA,MAAA,UAAA,CACE,IAAME,EAAQ,IAAIF,EAClB,OAAAE,EAAM,SAAQC,GAAA,CAAA,EAAQ,KAAK,QAAQ,EACnCD,EAAM,SAAW,KAAK,SAAS,MAAK,EAC7BA,CACT,EAEAF,EAAA,UAAA,WAAA,SAAWI,EAAa,CACtB,KAAK,SAAQD,GAAAA,GAAA,CAAA,EAAQ,KAAK,QAAQ,EAAKC,CAAO,CAChD,EAEAJ,EAAA,UAAA,QAAA,UAAA,CACE,IAAMK,EAAGF,GAAA,CAAA,EAAQ,KAAK,QAAQ,EAC9B,OAAI,KAAK,SAAS,OAAS,IACzBE,EAAI,QAAU,KAAK,SAAS,MAAK,GAE5BA,CACT,EAEAL,EAAA,UAAA,YAAA,SAAYM,EAAqB,CAC/B,GAAI,KAAK,YAAYA,CAAK,EAAG,CACvB,KAAK,YAAY,IACnB,KAAK,YAAY,MAEjB,KAAK,YAAY,IAAM,EAEzB,OAGGA,EAAM,OACTA,EAAM,KAAO,IAAI,MAEnB,KAAK,SAAS,KAAKA,CAAK,EACxB,KAAK,YAAcA,EAEf,KAAK,SAAS,OAAS,KAAK,iBAC9B,KAAK,SAAW,KAAK,SAAS,MAAM,CAAC,KAAK,cAAc,EAE5D,EAEQN,EAAA,UAAA,YAAR,SAAoBM,EAAK,CACvB,GAAI,CAAC,KAAK,YACR,MAAO,GAET,QAASC,KAAOD,EACd,GAAI,GAACA,EAAM,eAAeC,CAAG,GAAKA,IAAQ,SAGtCD,EAAMC,KAAS,KAAK,YAAYA,GAClC,MAAO,GAGX,MAAO,EACT,EAEAP,EAAA,UAAA,YAAA,UAAA,CACE,OAAO,KAAK,cAAgB,KAAK,WACnC,EAEAA,EAAA,UAAA,eAAA,SAAeQ,EAAe,CAC5B,KAAK,aAAeA,CACtB,EAEAR,EAAA,UAAA,YAAA,UAAA,CACE,OAAO,KAAK,cAAgB,KAAK,WACnC,EAEAA,EAAA,UAAA,eAAA,SAAeQ,EAAe,CAC5B,KAAK,aAAeA,CACtB,EACFR,CAAA,EAjFA,ECVA,IAAAS,GAA6B,SAEvBC,GAAa,OAAO,SAAY,UAAY,QAAQ,KAa1D,SAASC,GAAMC,EAAW,CACxB,GAAI,CACF,OAAO,GAAAC,QAAiB,MAAMD,CAAG,QAC1BE,EAAP,CACIJ,IAAcE,EAAI,OACpB,QAAQ,KAAK,oBAAqBE,EAAS,SAAQ,EAAIF,EAAI,KAAK,EAIpE,OAAIA,EAAI,SACC,CAACA,CAAG,EAGN,CAAA,CACT,CAEM,SAAUG,GAAaH,EAAW,CACtC,IAAII,EAA4B,CAAA,EAEhC,GAAIJ,EAAI,QACNI,EAAU,KAAK,CACb,SAAUJ,EAAI,cAAgB,GAC9B,KAAMA,EAAI,UAAY,GACtB,KAAMA,EAAI,YAAc,EACxB,OAAQA,EAAI,cAAgB,EAC7B,MACI,CACL,IAAIK,EAASN,GAAMC,CAAG,EACtB,GAAIK,EAAO,SAAW,EACpB,GAAI,CACF,MAAM,IAAI,MAAM,MAAM,QACfC,EAAP,CACAD,EAASN,GAAMO,CAAO,EACtBD,EAAO,MAAK,EACZA,EAAO,MAAK,EAIhB,QAAkBE,EAAA,EAAAC,EAAAH,EAAAE,EAAAC,EAAA,OAAAD,IAAQ,CAArB,IAAIE,EAAKD,EAAAD,GACZH,EAAU,KAAK,CACb,SAAUK,EAAM,cAAgB,GAChC,KAAMA,EAAM,UAAY,GACxB,KAAMA,EAAM,YAAc,EAC1B,OAAQA,EAAM,cAAgB,EAC/B,GAIL,IAAIC,EAAeV,EAAI,KAAOA,EAAI,KAAO,GACrCW,EAAcX,EAAI,QAAU,OAAOA,EAAI,OAAO,EAAI,OAAOA,CAAG,EAEhE,MAAO,CACL,KAAIU,EACJ,QAASC,EACT,UAASP,EAEb,CCvEA,IAAIQ,GAAK,IAAI,OACX,CACE,IACA,gBACA,MACA,cACA,KACA,KAAK,EAAE,CAAC,EAGN,SAAUC,GAAqBC,EAAe,CAClD,IAAIC,EAAMD,EAAO,OAAO,GACxB,GAAIC,EAAI,OAAS,IAAMA,EAAI,OAAS,QAClC,OAAOD,EAGT,IAAIE,EAAID,EAAI,QAAQ,MAAMH,EAAE,EAC5B,OAAII,IAAM,OACRD,EAAI,KAAOC,EAAE,GACbD,EAAI,QAAUC,EAAE,IAGXF,CACT,CCtBM,SAAUG,IAAkB,CAChC,IAAIC,EACAC,EAEJ,OAAO,SAACC,EAAe,CACrB,IAAIC,EAAI,KAAK,UAAUD,EAAO,MAAM,EACpC,OAAIC,IAAMH,EACD,MAGLC,GACF,aAAaA,CAAO,EAGtBD,EAAiBG,EACjBF,EAAU,WAAW,UAAA,CACnBD,EAAiB,EACnB,EAAG,GAAI,EAEAE,EACT,CACF,CCtBA,IAAME,GAAmB,CACvB,eACA,gBACA,sBAGI,SAAUC,GAAkBC,EAAe,CAC/C,IAAIC,EAAMD,EAAO,OAAO,GACxB,GAAIC,EAAI,OAAS,IAAMH,GAAiB,QAAQG,EAAI,OAAO,IAAM,GAC/D,OAAO,KAGT,GAAIA,EAAI,WAAaA,EAAI,UAAU,OAAS,EAAG,CAC7C,IAAIC,EAAQD,EAAI,UAAU,GAC1B,GAAIC,EAAM,OAAS,cACjB,OAAO,KAIX,OAAOF,CACT,CCpBA,IAAIG,GAAK,IAAI,OACX,CACE,IACA,cACA,QACA,OACA,OACA,KACA,KAAK,EAAE,CAAC,EAEN,SAAUC,GAAsBC,EAAe,CACnD,IAAIC,EAAMD,EAAO,OAAO,GACxB,GAAIC,EAAI,OAAS,IAAMA,EAAI,OAAS,QAClC,OAAOD,EAGT,IAAIE,EAAID,EAAI,QAAQ,MAAMH,EAAE,EAC5B,OAAII,IAAM,OACRD,EAAI,KAAOC,EAAE,GACbD,EAAI,QAAUC,EAAE,IAGXF,CACT,CCzBA,IAAAG,GAAkB,SCaX,IAAIC,GAAS,CAClB,aAAc,IAAI,MAChB,qDAAqD,EAEvD,cAAe,IAAI,MAAM,8BAA8B,GDbzD,IAAIC,GAAiB,EAEf,SAAUC,GAAQC,EAAiB,CACvC,IAAIC,EAAQ,KAAK,IAAG,EAAK,IACzB,GAAIA,EAAQH,GACV,OAAOI,GAAQ,OAAOC,GAAO,aAAa,EAG5C,IAAIC,EAAM,CACR,OAAQJ,EAAI,OACZ,KAAMA,EAAI,MAEZ,SAAO,GAAAK,SAAML,EAAI,IAAKI,CAAG,EAAE,KAAK,SAACE,EAAc,CAC7C,GAAIA,EAAK,SAAW,IAClB,MAAMH,GAAO,aAGf,GAAIG,EAAK,SAAW,IAAK,CACvB,IAAIC,EAAID,EAAK,QAAQ,IAAI,mBAAmB,EAC5C,GAAI,CAACC,EACH,MAAMJ,GAAO,cAGf,IAAIK,EAAI,SAASD,EAAG,EAAE,EACtB,MAAIC,EAAI,IACNV,GAAiB,KAAK,IAAG,EAAK,IAAOU,GAGjCL,GAAO,cAGf,GAAIG,EAAK,SAAW,IAClB,MAAO,CAAE,KAAM,IAAI,EAErB,GAAIA,EAAK,SAAW,IAClB,MAAM,IAAI,MAAM,eAAe,EAGjC,OAAIA,EAAK,QAAU,KAAOA,EAAK,OAAS,IAC/BA,EAAK,KAAI,EAAG,KAAK,SAACG,EAAI,CAC3B,MAAO,CAAE,KAAIA,CAAA,CACf,CAAC,EAGCH,EAAK,QAAU,KAAOA,EAAK,OAAS,IAC/BA,EAAK,KAAI,EAAG,KAAK,SAACG,EAAI,CAC3B,IAAIC,EAAM,IAAI,MAAMD,EAAK,OAAO,EAChC,MAAMC,CACR,CAAC,EAGIJ,EAAK,KAAI,EAAG,KAAK,SAACK,EAAI,CAC3B,IAAID,EAAM,IAAI,MACZ,8CAA8CJ,EAAK,OAAM,UAAUK,EAAI,GAAG,EAE5E,MAAMD,CACR,CAAC,CACH,CAAC,CACH,CEnDM,SAAUE,GAAcC,EAAe,CAC3C,OAAO,SAACC,EAAiB,CACvB,OAAOC,GAAQD,EAAKD,CAAG,CACzB,CACF,CAEA,IAAIG,GAAiB,EAErB,SAASD,GAAQD,EAAmBD,EAAe,CACjD,IAAII,EAAQ,KAAK,IAAG,EAAK,IACzB,OAAIA,EAAQD,GACHE,GAAQ,OAAOC,GAAO,aAAa,EAGrC,IAAID,GAAQ,SAACE,EAASC,EAAM,CACjCR,EACE,CACE,IAAKC,EAAI,IACT,OAAQA,EAAI,OACZ,KAAMA,EAAI,KACV,QAAS,CACP,eAAgB,oBAElB,QAASA,EAAI,SAEf,SAACQ,EAAYC,EAAmCC,EAAS,CACvD,GAAIF,EAAO,CACTD,EAAOC,CAAK,EACZ,OAGF,GAAI,CAACC,EAAK,WAAY,CACpBD,EAAQ,IAAI,MACV,6CAA6CC,EAAK,UAAY,EAEhEF,EAAOC,CAAK,EACZ,OAGF,GAAIC,EAAK,aAAe,IAAK,CAC3BF,EAAOF,GAAO,YAAY,EAC1B,OAGF,GAAII,EAAK,aAAe,IAAK,CAC3BF,EAAOF,GAAO,aAAa,EAE3B,IAAI,EAAII,EAAK,QAAQ,qBACrB,GAAI,CAAC,EACH,OAGF,IAAIE,EAAC,OACL,GAAI,OAAO,GAAM,SACfA,EAAI,UACK,aAAa,MACtBA,EAAI,EAAE,OAEN,QAGF,IAAIC,EAAI,SAASD,EAAG,EAAE,EAClBC,EAAI,IACNV,GAAiB,KAAK,IAAG,EAAK,IAAOU,GAGvC,OAGF,GAAIH,EAAK,aAAe,IAAK,CAC3BH,EAAQ,CAAE,KAAM,IAAI,CAAE,EACtB,OAGF,GAAIG,EAAK,YAAc,KAAOA,EAAK,WAAa,IAAK,CACnD,IAAII,EAAI,OACR,GAAI,CACFA,EAAO,KAAK,MAAMH,CAAI,QACfI,EAAP,CACAP,EAAOO,CAAG,EACV,OAEFR,EAAQO,CAAI,EACZ,OAGF,GAAIJ,EAAK,YAAc,KAAOA,EAAK,WAAa,IAAK,CACnD,IAAII,EAAI,OACR,GAAI,CACFA,EAAO,KAAK,MAAMH,CAAI,QACfI,EAAP,CACAP,EAAOO,CAAG,EACV,OAEFN,EAAQ,IAAI,MAAMK,EAAK,OAAO,EAC9BN,EAAOC,CAAK,EACZ,OAGFE,EAAOA,EAAK,KAAI,EAChBF,EAAQ,IAAI,MACV,6CAA6CC,EAAK,WAAU,UAAUC,EAAI,GAAG,EAE/EH,EAAOC,CAAK,CACd,CAAC,CAEL,CAAC,CACH,CC/GM,SAAUO,GAAcC,EAAc,CAC1C,OAAIA,EAAK,QACAD,GAAkBC,EAAK,OAAO,EAEhCC,EACT,wWCZIC,GACOC,GAAa,GAExB,GAAI,CACFD,GAAU,KACVC,GAAa,QACb,CAAY,CAuBd,IAAAC,GAAA,UAAA,CAAA,SAAAA,GAAA,CACE,KAAA,MAAQ,EACR,KAAA,IAAM,EACN,KAAA,MAAQ,EACR,KAAA,IAAM,IAAIF,GAAQ,MAsBpB,CApBE,OAAAE,EAAA,UAAA,IAAA,SAAIC,EAAU,CACRA,IAAO,IACTA,EAAK,MAEP,KAAK,OAAS,EACd,KAAK,KAAOA,EACZ,KAAK,OAASA,EAAKA,EACf,KAAK,KACP,KAAK,IAAI,KAAKA,CAAE,CAEpB,EAEAD,EAAA,UAAA,OAAA,UAAA,CACE,MAAO,CACL,MAAO,KAAK,MACZ,IAAK,KAAK,IACV,MAAO,KAAK,MACZ,iBAAkBE,GAAiB,KAAK,GAAG,EAE/C,EACFF,CAAA,EA1BA,EA4BA,IAAAG,GAAA,SAAAC,EAAA,CAAuCC,GAAAF,EAAAC,CAAA,EAAvC,SAAAD,GAAA,CAAA,IAAAG,EAAAF,IAAA,MAAAA,EAAA,MAAA,KAAA,SAAA,GAAA,KACE,OAAAE,EAAA,OAAyC,CAAA,GA6B3C,CA3BE,OAAAH,EAAA,UAAA,UAAA,SAAUI,EAAiBC,EAAiC,CAC1D,KAAK,IAAID,CAAO,EAChB,QAAWE,KAAQD,EACbA,EAAO,eAAeC,CAAI,GAC5B,KAAK,SAASA,EAAMD,EAAOC,EAAK,CAGtC,EAEAN,EAAA,UAAA,SAAA,SAASO,EAAcC,EAAU,CAC/B,IAAIC,EAAO,KAAK,OAAOF,GAClBE,IACHA,EAAO,IAAIC,GACX,KAAK,OAAOH,GAAQE,GAEtBA,EAAK,IAAID,CAAE,CACb,EAEAR,EAAA,UAAA,OAAA,UAAA,CACE,MAAO,CACL,MAAO,KAAK,MACZ,IAAK,KAAK,IACV,MAAO,KAAK,MACZ,iBAAkBW,GAAiB,KAAK,GAAG,EAC3C,OAAQ,KAAK,OAEjB,EACFX,CAAA,EA9BuCU,EAAW,EAgClD,SAASE,GAAiBC,EAAY,CACpC,IAAIC,EAAkB,CAAA,EAClBC,EAAmB,CAAA,EACvB,OAAAF,EAAG,UAAU,KAAK,SAACG,EAAY,CAC7BF,EAAM,KAAKE,EAAE,IAAI,EACjBD,EAAO,KAAKC,EAAE,CAAC,CACjB,CAAC,EACM,CACL,KAAMF,EACN,MAAOC,EAEX,2NChGME,GAAiB,KAYvBC,GAAA,UAAA,CAUE,SAAAA,EAAYC,EAAU,CAAVA,IAAA,SAAAA,EAAA,IATZ,KAAA,OAAS,GACT,KAAA,MAAQ,GACR,KAAA,MAAQ,GACR,KAAA,KAAO,GACP,KAAA,KAAO,GACP,KAAA,KAAO,EACP,KAAA,UAAY,IAAI,KAId,KAAK,MAAQA,CACf,CAEA,OAAAD,EAAA,UAAA,UAAA,UAAA,CACE,OAAK,KAAK,UACR,KAAK,QAAU,IAAI,MAEd,KAAK,QAAQ,QAAO,EAAK,KAAK,UAAU,QAAO,CACxD,EACFA,CAAA,EApBA,EAsBA,IAAAE,GAAA,UAAA,CAQE,SAAAA,EAAYC,EAAa,CAHzB,KAAA,GAAqC,CAAA,EAInC,KAAK,KAAOA,EACZ,KAAK,KAAUA,EAAI,KAAI,oBAAoBA,EAAI,UAAS,sBAAsBA,EAAI,WAClF,KAAK,WAAaC,GAAcD,CAAG,CACrC,CAEA,OAAAD,EAAA,UAAA,MAAA,SAAMG,EAAU,CAAV,OAAAA,IAAA,SAAAA,EAAA,IACG,IAAIC,GAAUD,CAAK,CAC5B,EAEAH,EAAA,UAAA,OAAA,SAAOK,EAAY,CAAnB,IAAAC,EAAA,KACE,GAAKC,GAIL,KAAIC,EAAKH,EAAE,UAAS,EAEdI,EAAS,GAAK,IAChBC,EAAY,IAAI,KAClB,KAAK,MAAML,EAAE,UAAU,QAAO,EAAKI,CAAM,EAAIA,CAAM,EAGjDE,EAAiB,CACnB,OAAQN,EAAE,OACV,MAAOA,EAAE,MACT,MAAOA,EAAE,MACT,KAAMA,EAAE,KACR,KAAMA,EAAE,KACR,KAAMA,EAAE,KACR,KAAMK,GAEJE,EAAS,KAAK,UAAUD,CAAG,EAE3BE,EAAO,KAAK,GAAGD,GACdC,IACHA,EAAO,IAAIC,GACX,KAAK,GAAGF,GAAUC,GAGpBA,EAAK,IAAIL,CAAE,EAEP,MAAK,SAGT,KAAK,OAAS,WAAW,UAAA,CACvBF,EAAK,OAAM,CACb,EAAGS,EAAc,GACnB,EAEAf,EAAA,UAAA,OAAA,UAAA,CACE,IAAIgB,EAAU,CAAA,EACd,QAASJ,KAAU,KAAK,GACtB,GAAK,KAAK,GAAG,eAAeA,CAAM,EAIlC,KAAID,EAAiB,KAAK,MAAMC,CAAM,EAClCK,EAACC,GAAAA,GAAA,CAAA,EACAP,CAAG,EACH,KAAK,GAAGC,GAAQ,OAAM,CAAE,EAG7BI,EAAQ,KAAKC,CAAC,EAGhB,KAAK,GAAK,CAAA,EACV,KAAK,OAAS,KAEd,IAAIE,EAAU,KAAK,UAAU,CAC3B,YAAa,KAAK,KAAK,YACvB,QAAOH,EACR,EACGI,EAAM,CACR,OAAQ,OACR,IAAK,KAAK,KACV,KAAMD,GAER,KAAK,WAAWC,CAAG,EAChB,KAAK,SAACC,EAAK,CAEZ,CAAC,EACA,MAAM,SAACC,EAAG,CACL,QAAQ,OACV,QAAQ,MAAM,+BAAgCA,CAAG,CAErD,CAAC,CACL,EACFtB,CAAA,EA/FA,+jBCjCMuB,GAAiB,KAOvBC,GAAA,SAAAC,EAAA,CAAiCC,GAAAF,EAAAC,CAAA,EAG/B,SAAAD,EAAYG,EAAa,CAAzB,IAAAC,EACEH,EAAA,KAAA,IAAA,GAAO,KACP,OAAAG,EAAK,MAAQD,EACbC,EAAK,UAAY,IAAI,MACvB,CACF,OAAAJ,CAAA,EARiCK,EAAU,EAU3C,IAAAC,GAAA,UAAA,CAQE,SAAAA,EAAYC,EAAa,CAHzB,KAAA,GAA2C,CAAA,EAIzC,KAAK,KAAOA,EACZ,KAAK,KAAUA,EAAI,KAAI,oBAAoBA,EAAI,UAAS,qBAAqBA,EAAI,WACjF,KAAK,WAAaC,GAAcD,CAAG,CACrC,CAEA,OAAAD,EAAA,UAAA,OAAA,SAAOG,EAAc,CAArB,IAAAC,EAAA,KACE,GAAKC,GAIL,KAAIC,EAAKH,EAAE,UAAS,EAChBG,IAAO,IACTA,EAAK,MAGP,IAAMC,EAAS,GAAK,IAChBC,EAAY,IAAI,KAClB,KAAK,MAAML,EAAE,UAAU,QAAO,EAAKI,CAAM,EAAIA,CAAM,EAGjDE,EAAiB,CACnB,MAAON,EAAE,MACT,KAAMK,GAEJE,EAAS,KAAK,UAAUD,CAAG,EAE3BE,EAAO,KAAK,GAAGD,GACdC,IACHA,EAAO,IAAIC,GACX,KAAK,GAAGF,GAAUC,GAGpBA,EAAK,UAAUL,EAAIH,EAAE,OAAO,EAExB,MAAK,SAGT,KAAK,OAAS,WAAW,UAAA,CACvBC,EAAK,OAAM,CACb,EAAGS,EAAc,GACnB,EAEAb,EAAA,UAAA,OAAA,UAAA,CACE,IAAIc,EAAS,CAAA,EACb,QAASJ,KAAU,KAAK,GACtB,GAAK,KAAK,GAAG,eAAeA,CAAM,EAIlC,KAAID,EAAiB,KAAK,MAAMC,CAAM,EAClCK,EAACC,GAAAA,GAAA,CAAA,EACAP,CAAG,EACH,KAAK,GAAGC,GAAQ,OAAM,CAAE,EAG7BI,EAAO,KAAKC,CAAC,EAGf,KAAK,GAAK,CAAA,EACV,KAAK,OAAS,KAEd,IAAIE,EAAU,KAAK,UAAU,CAC3B,YAAa,KAAK,KAAK,YACvB,OAAMH,EACP,EACGI,EAAM,CACR,OAAQ,OACR,IAAK,KAAK,KACV,KAAMD,GAER,KAAK,WAAWC,CAAG,EAChB,KAAK,SAACC,EAAK,CAEZ,CAAC,EACA,MAAM,SAACC,EAAG,CACL,QAAQ,OACV,QAAQ,MAAM,mCAAoCA,CAAG,CAEzD,CAAC,CACL,EACFpB,CAAA,EAzFA,+jBCjBMqB,GAAiB,KAgBvBC,GAAA,SAAAC,EAAA,CAAiCC,GAAAF,EAAAC,CAAA,EAM/B,SAAAD,EAAYG,EAAaC,EAAYC,EAAgBC,EAAgB,CAAzDH,IAAA,SAAAA,EAAA,IAAaC,IAAA,SAAAA,EAAA,IAAYC,IAAA,SAAAA,EAAA,GAAgBC,IAAA,SAAAA,EAAA,IAArD,IAAAC,EACEN,EAAA,KAAA,IAAA,GAAO,KACP,OAAAM,EAAK,OAASJ,EACdI,EAAK,MAAQH,EACbG,EAAK,WAAaF,EAClBE,EAAK,YAAcD,EACnBC,EAAK,UAAY,IAAI,MACvB,CACF,OAAAP,CAAA,EAdiCQ,EAAU,EAgB3C,IAAAC,GAAA,UAAA,CAQE,SAAAA,EAAYC,EAAa,CAHzB,KAAA,GAAqC,CAAA,EAInC,KAAK,KAAOA,EACZ,KAAK,KAAUA,EAAI,KAAI,oBAAoBA,EAAI,UAAS,qBAAqBA,EAAI,WACjF,KAAK,WAAaC,GAAcD,CAAG,CACrC,CAEA,OAAAD,EAAA,UAAA,OAAA,SAAOG,EAAgB,CAAvB,IAAAC,EAAA,KACE,GAAKC,GAIL,KAAIC,EAAKH,EAAI,UAAS,EAEhBI,EAAS,GAAK,IAChBC,EAAY,IAAI,KAClB,KAAK,MAAML,EAAI,UAAU,QAAO,EAAKI,CAAM,EAAIA,CAAM,EAGnDE,EAAiB,CACnB,OAAQN,EAAI,OACZ,MAAOA,EAAI,MACX,WAAYA,EAAI,WAChB,KAAMK,GAEJE,EAAS,KAAK,UAAUD,CAAG,EAE3BE,EAAO,KAAK,GAAGD,GACdC,IACHA,EAAO,IAAIC,GACX,KAAK,GAAGF,GAAUC,GAGpBA,EAAK,IAAIL,CAAE,EAEP,MAAK,SAGT,KAAK,OAAS,WAAW,UAAA,CACvBF,EAAK,OAAM,CACb,EAAGS,EAAc,GACnB,EAEAb,EAAA,UAAA,OAAA,UAAA,CACE,IAAIc,EAAS,CAAA,EACb,QAASJ,KAAU,KAAK,GACtB,GAAK,KAAK,GAAG,eAAeA,CAAM,EAIlC,KAAID,EAAiB,KAAK,MAAMC,CAAM,EAClCK,EAACC,GAAAA,GAAA,CAAA,EACAP,CAAG,EACH,KAAK,GAAGC,GAAQ,OAAM,CAAE,EAG7BI,EAAO,KAAKC,CAAC,EAGf,KAAK,GAAK,CAAA,EACV,KAAK,OAAS,KAEd,IAAIE,EAAU,KAAK,UAAU,CAC3B,YAAa,KAAK,KAAK,YACvB,OAAMH,EACP,EACGX,EAAM,CACR,OAAQ,OACR,IAAK,KAAK,KACV,KAAMc,GAER,KAAK,WAAWd,CAAG,EAChB,KAAK,SAACe,EAAK,CAEZ,CAAC,EACA,MAAM,SAACC,EAAG,CACL,QAAQ,OACV,QAAQ,MAAM,8BAA+BA,CAAG,CAEpD,CAAC,CACL,EACFnB,CAAA,EAxFA,EA0FA,IAAAoB,GAAA,UAAA,CAQE,SAAAA,EAAYC,EAAa,CAHzB,KAAA,GAA2C,CAAA,EAIzC,KAAK,KAAOA,EACZ,KAAK,KAAUA,EAAI,KAAI,oBAAoBA,EAAI,UAAS,0BAA0BA,EAAI,WACtF,KAAK,WAAaC,GAAcD,CAAG,CACrC,CAEA,OAAAD,EAAA,UAAA,OAAA,SAAOG,EAAgB,CAAvB,IAAAC,EAAA,KACE,GAAKC,IAKH,EAAAF,EAAI,WAAa,KAChBA,EAAI,YAAc,KAAOA,EAAI,WAAa,KAC3CA,EAAI,aAAe,KACnB,OAAO,KAAKA,EAAI,OAAO,EAAE,SAAW,GAKtC,KAAIG,EAAKH,EAAI,UAAS,EAClBG,IAAO,IACTA,EAAK,MAGP,IAAMC,EAAS,GAAK,IAChBC,EAAY,IAAI,KAClB,KAAK,MAAML,EAAI,UAAU,QAAO,EAAKI,CAAM,EAAIA,CAAM,EAGnDE,EAAqB,CACvB,OAAQN,EAAI,OACZ,MAAOA,EAAI,MACX,aAAc,KAAK,cAAcA,CAAG,EACpC,KAAMK,GAEJE,EAAS,KAAK,UAAUD,CAAG,EAE3BE,EAAO,KAAK,GAAGD,GACdC,IACHA,EAAO,IAAIC,GACX,KAAK,GAAGF,GAAUC,GAGpBA,EAAK,UAAUL,EAAIH,EAAI,OAAO,EAE1B,MAAK,SAGT,KAAK,OAAS,WAAW,UAAA,CACvBC,EAAK,OAAM,CACb,EAAGS,EAAc,GACnB,EAEAb,EAAA,UAAA,OAAA,UAAA,CACE,IAAIc,EAAS,CAAA,EACb,QAASJ,KAAU,KAAK,GACtB,GAAK,KAAK,GAAG,eAAeA,CAAM,EAIlC,KAAID,EAAqB,KAAK,MAAMC,CAAM,EACtCK,EAACC,GAAAA,GAAA,CAAA,EACAP,CAAG,EACH,KAAK,GAAGC,GAAQ,OAAM,CAAE,EAG7BI,EAAO,KAAKC,CAAC,EAGf,KAAK,GAAK,CAAA,EACV,KAAK,OAAS,KAEd,IAAIE,EAAU,KAAK,UAAU,CAC3B,YAAa,KAAK,KAAK,YACvB,OAAMH,EACP,EACGX,EAAM,CACR,OAAQ,OACR,IAAK,KAAK,KACV,KAAMc,GAER,KAAK,WAAWd,CAAG,EAChB,KAAK,SAACe,EAAK,CAEZ,CAAC,EACA,MAAM,SAACC,EAAG,CACL,QAAQ,OACV,QAAQ,MAAM,mCAAoCA,CAAG,CAEzD,CAAC,CACL,EAEAnB,EAAA,UAAA,cAAA,SAAcG,EAAgB,CAC5B,OAAIA,EAAI,YAAc,IACb,MAELA,EAAI,YAAc,IACb,MAEJA,EAAI,YAGFA,EAAI,YAAY,MAAM,GAAG,EAAE,GAAG,MAAM,GAAG,EAAE,IAFvC,EAGX,EACFH,CAAA,EAjHA,EC/HO,IAAMoB,GAAgB,sBAChBC,GAAmB,QACnBC,GACX,iSCsBFC,GAAA,UAAA,CAgBE,SAAAA,EAAYC,EAAa,CAAzB,IAAAC,EAAA,KACE,GAPF,KAAA,SAAqB,CAAA,EACrB,KAAA,oBAA2C,CAAA,EAC3C,KAAA,OAAS,IAAIC,GAEb,KAAA,SAA2B,CAAA,EAGrB,CAACF,EAAI,WAAa,CAACA,EAAI,WACzB,MAAM,IAAI,MAAM,iDAAiD,EAGnE,KAAK,KAAOA,EACZ,KAAK,KAAK,KAAO,KAAK,KAAK,MAAQ,0BACnC,KAAK,KAAK,QAAU,KAAK,KAAK,SAAW,IACzC,KAAK,KAAK,cAAgB,KAAK,KAAK,eAClC,KAAK,KAAK,eAAiB,CAAC,WAAY,QAAQ,EAClD,KAAK,KAAU,KAAK,KAAK,KAAI,oBAAoB,KAAK,KAAK,UAAS,gBAAgB,KAAK,KAAK,WAE9F,KAAK,WAAa,KAAK,KAAK,WAAaG,GACzC,KAAK,WAAaC,GAAc,KAAK,IAAI,EAEzC,KAAK,UAAUC,EAAiB,EAChC,KAAK,UAAUC,GAAkB,CAAE,EACnC,KAAK,UAAUC,EAAqB,EACpC,KAAK,UAAUC,EAAoB,EAEnC,KAAK,UAAU,SAACC,EAAe,CAC7B,OAAAA,EAAO,QAAQ,SAAW,CACxB,KAAMC,GACN,QAASC,GACT,IAAKC,IAEHX,EAAK,KAAK,cACZQ,EAAO,QAAQ,YAAcR,EAAK,KAAK,aAElCQ,CACT,CAAC,EAED,KAAK,OAAS,IAAII,GAAO,IAAI,EAC7B,KAAK,OAAS,IAAIC,GAAO,IAAI,EAC7B,KAAK,QAAU,IAAIC,GAAa,KAAK,IAAI,CAC3C,CAEA,OAAAhB,EAAA,UAAA,MAAA,UAAA,CACE,QAAeiB,EAAA,EAAAC,EAAA,KAAK,SAALD,EAAAC,EAAA,OAAAD,IAAe,CAAzB,IAAIE,EAAED,EAAAD,GACTE,EAAE,EAEN,EAEAnB,EAAA,UAAA,MAAA,UAAA,CACE,OAAO,KAAK,MACd,EAEAA,EAAA,UAAA,eAAA,SAAeoB,EAAY,CACzB,KAAK,OAASA,CAChB,EAEApB,EAAA,UAAA,UAAA,SAAUqB,EAAc,CACtB,KAAK,SAAS,KAAKA,CAAM,CAC3B,EAEArB,EAAA,UAAA,qBAAA,SAAqBsB,EAAoC,CACvD,KAAK,oBAAoB,KAAKA,CAAiB,CACjD,EAEAtB,EAAA,UAAA,OAAA,SAAOuB,EAAQ,CACb,IAAIb,EAAkB,CACpB,OAAQ,CAAA,EACR,QAAOc,GAAAA,GAAA,CACL,SAAU,OAAO,EACd,KAAK,MAAK,EAAG,QAAO,CAAE,EACtBD,EAAI,OAAO,EAEhB,OAAQA,EAAI,QAAU,CAAA,EACtB,YAAaA,EAAI,aAAe,CAAA,EAChC,QAASA,EAAI,SAAW,CAAA,GAO1B,IAJI,OAAOA,GAAQ,UAAYA,EAAI,QAAU,UAC3CA,EAAM,CAAE,MAAOA,CAAG,GAGhB,CAACA,EAAI,MACP,OAAAb,EAAO,MAAQ,IAAI,MACjB,qBAAqB,KAAK,UAAUa,EAAI,KAAK,EAAC,mBAAmB,EAE5DE,GAAQ,QAAQf,CAAM,EAG/B,IAAIgB,EAAQ,KAAK,WAAWH,EAAI,KAAK,EACrCb,EAAO,OAAO,KAAKgB,CAAK,EAExB,QAAmBT,EAAA,EAAAC,EAAA,KAAK,SAALD,EAAAC,EAAA,OAAAD,IAAe,CAA7B,IAAII,EAAMH,EAAAD,GACTU,EAAIN,EAAOX,CAAM,EACrB,GAAIiB,IAAM,KACR,OAAAjB,EAAO,MAAQ,IAAI,MAAM,6BAA6B,EAC/Ce,GAAQ,QAAQf,CAAM,EAE/BA,EAASiB,EAGX,OAAKjB,EAAO,UACVA,EAAO,QAAU,CAAA,GAEnBA,EAAO,QAAQ,SAAW,aACnB,KAAK,YAAYA,CAAM,CAChC,EAEAV,EAAA,UAAA,YAAA,SAAYU,EAAe,CACzB,IAAIkB,EAAOC,GAAcnB,EAAQ,CAC/B,cAAe,KAAK,KAAK,cAC1B,EACD,GAAI,KAAK,KAAK,SAAU,CACtB,GAAI,OAAO,KAAK,KAAK,UAAa,WAChC,OAAO,KAAK,KAAK,SAASA,CAAM,EAEhC,QAAQ,KAAK,+CAA+C,EAIhE,IAAIoB,EAAM,CACR,OAAQ,OACR,IAAK,KAAK,KACV,KAAIF,GAEN,OAAO,KAAK,WAAWE,CAAG,EACvB,KAAK,SAACC,EAAI,CACT,OAAArB,EAAO,GAAKqB,EAAK,KAAK,GACtBrB,EAAO,IAAMqB,EAAK,KAAK,IAChBrB,CACT,CAAC,EACA,MAAM,SAACa,EAAG,CACT,OAAAb,EAAO,MAAQa,EACRb,CACT,CAAC,CACL,EAEAV,EAAA,UAAA,KAAA,SAAKmB,EAAIa,EAAoB,CAC3B,GADOA,IAAA,SAAAA,EAAA,CAAA,GACHb,EAAG,UACL,OAAOA,EAIT,IAAIc,EAAS,KACTC,EAAkB,UAAA,CACpB,IAAIC,EAAS,MAAM,UAAU,MAAM,KAAK,SAAS,EAC7CC,EAAcH,EAAO,eAAeE,CAAM,EAC9C,GAAI,CACF,OAAOhB,EAAG,MAAM,KAAMiB,CAAW,QAC1Bb,EAAP,CACA,MAAAU,EAAO,OAAO,CAAE,MAAOV,EAAK,OAAQ,CAAE,UAAWY,CAAM,CAAE,CAAE,EAC3D,KAAK,uBAAsB,EACrBZ,EAEV,EAEA,QAASc,KAAQlB,EACXA,EAAG,eAAekB,CAAI,IACxBH,EAAgBG,GAAQlB,EAAGkB,IAG/B,QAAiBpB,EAAA,EAAAqB,EAAAN,EAAAf,EAAAqB,EAAA,OAAArB,IAAO,CAAnB,IAAIoB,EAAIC,EAAArB,GACPE,EAAG,eAAekB,CAAI,IACxBH,EAAgBG,GAAQlB,EAAGkB,IAI/B,OAAAH,EAAgB,UAAY,GAC5BA,EAAgB,MAAQf,EAEjBe,CACT,EAEAlC,EAAA,UAAA,eAAA,SAAeuC,EAAW,CACxB,QAASC,EAAI,EAAGA,EAAID,EAAK,OAAQC,IAAK,CACpC,IAAIC,EAAMF,EAAKC,GACX,OAAOC,GAAQ,aACjBF,EAAKC,GAAK,KAAK,KAAKC,CAAG,GAG3B,OAAOF,CACT,EAEAvC,EAAA,UAAA,uBAAA,UAAA,CAA0B,EAE1BA,EAAA,UAAA,KAAA,SAAKmB,EAAE,SAAEuB,EAAA,CAAA,EAAAzB,EAAA,EAAAA,EAAA,UAAA,OAAAA,IAAAyB,EAAAzB,EAAA,GAAA,UAAAA,GACP,IAAI0B,EAAU,KAAK,KAAKxB,CAAE,EAC1B,OAAOwB,EAAQ,MAAM,KAAM,MAAM,UAAU,MAAM,KAAK,UAAW,CAAC,CAAC,CACrE,EACF3C,CAAA,EAvMA,EAyMA,IAAA4C,GAAA,UAAA,CAKE,SAAAA,EAAYC,EAAsB,CAChC,KAAK,UAAYA,EACjB,KAAK,QAAU,IAAIC,GAAYD,EAAS,IAAI,EAC5C,KAAK,YAAc,IAAIE,GAAiBF,EAAS,IAAI,CACvD,CAEA,OAAAD,EAAA,UAAA,MAAA,SACEI,EACAC,EACAC,EACAC,EAAgB,CAHhBH,IAAA,SAAAA,EAAA,IACAC,IAAA,SAAAA,EAAA,IACAC,IAAA,SAAAA,EAAA,GACAC,IAAA,SAAAA,EAAA,IAEA,IAAMC,EAAS,IAAIC,GAAYL,EAAQC,EAAOC,EAAYC,CAAW,EAE/DG,EAAQ,KAAK,UAAU,MAAK,EAAG,MAAK,EAC1C,OAAAA,EAAM,WAAW,CAAE,WAAYN,EAAQ,MAAKC,CAAA,CAAE,EAC9CK,EAAM,eAAeF,CAAM,EAC3B,KAAK,UAAU,eAAeE,CAAK,EAE5BF,CACT,EAEAR,EAAA,UAAA,OAAA,SAAOW,EAAgB,CACrBA,EAAI,IAAG,EACP,QAAgCC,EAAA,EAAAC,EAAA,KAAK,UAAU,oBAAfD,EAAAC,EAAA,OAAAD,IAAoC,CAA/D,IAAME,EAAiBD,EAAAD,GAC1B,GAAIE,EAAkBH,CAAG,IAAM,KAC7B,OAGJ,KAAK,QAAQ,OAAOA,CAAG,EACvB,KAAK,YAAY,OAAOA,CAAG,CAC7B,EACFX,CAAA,EArCA,EAuCAe,GAAA,UAAA,CAIE,SAAAA,EAAYd,EAAsB,CAChC,KAAK,UAAYA,EACjB,KAAK,QAAU,IAAIe,GAAYf,EAAS,IAAI,CAC9C,CAEA,OAAAc,EAAA,UAAA,MAAA,SAAME,EAAa,CACjB,IAAMT,EAAS,IAAIU,GAAYD,CAAK,EAE9BP,EAAQ,KAAK,UAAU,MAAK,EAAG,MAAK,EAC1C,OAAAA,EAAM,WAAW,CAAE,MAAKO,CAAA,CAAE,EAC1BP,EAAM,eAAeF,CAAM,EAC3B,KAAK,UAAU,eAAeE,CAAK,EAE5BF,CACT,EAEAO,EAAA,UAAA,OAAA,SAAOI,EAAc,CACnBA,EAAE,IAAG,EACL,KAAK,QAAQ,OAAOA,CAAC,CACvB,EACFJ,CAAA,EAxBA,ECvQM,SAAUK,GAAaC,EAAe,CAC1C,OAAI,OAAO,WAAa,OAAO,UAAU,YACvCA,EAAO,QAAQ,UAAY,OAAO,UAAU,WAE1C,OAAO,WACTA,EAAO,QAAQ,IAAM,OAAO,OAAO,QAAQ,EAE3CA,EAAO,QAAQ,cACb,OAAO,SAAS,SAAW,KAAO,OAAO,SAAS,MAE/CA,CACT,CCVA,IAAMC,GAAkB,CAAC,QAAS,MAAO,OAAQ,OAAQ,OAAO,EAE1D,SAAUC,GAAkBC,EAAkB,CAElD,mBAASC,EAAC,CACR,GAAI,EAAEA,KAAK,0BAIX,IAAMC,EAAQ,QAAQD,GAClBE,EAAS,UAAA,SAACC,EAAA,CAAA,EAAAC,EAAA,EAAAA,EAAA,UAAA,OAAAA,IAAAD,EAAAC,GAAA,UAAAA,GACZH,EAAM,MAAM,QAASE,CAAI,EACzBJ,EAAS,MAAK,EAAG,YAAY,CAC3B,KAAM,MACN,SAAUC,EACV,UAAWG,EACZ,CACH,EACAD,EAAM,MAAQD,EACd,QAAQD,GAAKE,GAfDE,EAAA,EAAAC,EAAAR,GAAAO,EAAAC,EAAA,OAAAD,IAAe,CAAxB,IAAIJ,EAACK,EAAAD,KAADJ,CAAC,EAiBZ,CCtBA,IAAMM,GAAY,CAAC,OAAQ,OAAQ,KAAK,EAElC,SAAUC,GAAcC,EAAkB,CAC9C,IAAMC,EAAUC,GAAiBF,CAAQ,EAErC,OAAO,mBACT,OAAO,iBAAiB,OAAQC,CAAO,EACvC,OAAO,iBACL,QACA,SAACE,EAAY,CACPC,GAAQD,EAAO,OAAO,GAG1BF,EAAQE,CAAK,CACf,EACA,EAAI,GAIJ,OAAO,UAAa,UAAY,SAAS,mBAC3C,SAAS,iBAAiB,mBAAoBF,CAAO,EACrD,SAAS,iBAAiB,QAASA,CAAO,EAC1C,SAAS,iBAAiB,WAAYA,CAAO,EAEjD,CAEA,SAASC,GAAiBF,EAAkB,CAC1C,OAAO,SAACG,EAAY,CAClB,IAAIE,EAASD,GAAQD,EAAO,QAAQ,EACpC,GAAKE,EAIL,KAAIC,EAAa,CAAE,KAAMH,EAAM,IAAI,EAEnC,GAAI,CACFG,EAAM,OAASC,GAASF,CAAM,QACvBG,EAAP,CACAF,EAAM,OAAS,IAAI,OAAOE,CAAG,EAAC,IAGhCR,EAAS,MAAK,EAAG,YAAYM,CAAK,EACpC,CACF,CAEA,SAASG,GAASC,EAAiB,CACjC,GAAI,CAACA,EACH,MAAO,GAGT,IAAIC,EAAc,CAAA,EAWlB,GATID,EAAK,SACPC,EAAE,KAAKD,EAAK,QAAQ,YAAW,CAAE,EAG/BA,EAAK,KACPC,EAAE,KAAK,GAAG,EACVA,EAAE,KAAKD,EAAK,EAAE,GAGZA,EAAK,WAAa,MAAM,KAC1BC,EAAE,KAAK,GAAG,EACVA,EAAE,KAAK,MAAM,KAAKD,EAAK,SAAS,EAAE,KAAK,GAAG,CAAC,UAClCA,EAAK,UAAW,CACzB,IAAIE,EAAMC,GAAgBH,EAAK,SAAS,EACpCE,IAAQ,KACVD,EAAE,KAAK,GAAG,EACVA,EAAE,KAAKC,CAAG,GAId,GAAIF,EAAK,aACP,QAAiBI,EAAA,EAAAC,EAAAjB,GAAAgB,EAAAC,EAAA,OAAAD,IAAW,CAAvB,IAAIE,EAAID,EAAAD,GACPG,EAAQP,EAAK,aAAaM,CAAI,EAC9BC,GACFN,EAAE,KAAK,IAAIK,EAAI,KAAKC,EAAK,IAAI,EAKnC,OAAON,EAAE,KAAK,EAAE,CAClB,CAEA,SAASE,GAAgBK,EAAS,CAChC,OAAIA,EAAK,MACAA,EAAK,MAAM,GAAG,EAAE,KAAK,GAAG,EAE7BA,EAAK,SAAWA,EAAK,QAAQ,MAExBA,EAAK,QAAQ,MAAM,GAAG,EAAE,KAAK,GAAG,GAEzC,QAAQ,MAAM,yCAA0C,OAAOA,CAAI,EAC5D,GACT,CAEA,SAASX,GAASG,EAAiB,CAMjC,QALMS,EAAS,GAEXC,EAAiB,CAAA,EAEjBC,EAASX,EACNW,GAAQ,CACb,IAAIC,EAAOb,GAASY,CAAM,EAC1B,GAAIC,IAAS,KACXF,EAAK,KAAKE,CAAI,EACVF,EAAK,OAASD,GAChB,MAGJE,EAASA,EAAO,WAGlB,OAAID,EAAK,SAAW,EACX,OAAOV,CAAI,EAGbU,EAAK,QAAO,EAAG,KAAK,KAAK,CAClC,CAEA,SAAShB,GAAQmB,EAAUC,EAAY,CACrC,GAAI,CACF,OAAOD,EAAIC,QACX,CAEA,OAAO,KAEX,CC/HM,SAAUC,GAAgBC,EAAkB,CAEhD,IAAIC,EAAW,OAAO,MACtB,OAAO,MAAQ,SACbC,EACAC,EAAqB,CAErB,IAAIC,EAAa,CACf,KAAM,MACN,KAAM,IAAI,MAGZ,OAAAA,EAAM,OAASD,GAAWA,EAAQ,OAASA,EAAQ,OAAS,MACxD,OAAOD,GAAQ,SACjBE,EAAM,IAAMF,GAEZE,EAAM,OAASF,EAAI,OACnBE,EAAM,IAAMF,EAAI,KAIlBF,EAAS,iBACT,WAAW,UAAA,CAAM,OAAAA,EAAS,gBAAT,CAAyB,EAEnCC,EACJ,MAAM,KAAM,SAAS,EACrB,KAAK,SAACI,EAAc,CACnB,OAAAD,EAAM,WAAaC,EAAK,OACxBD,EAAM,SAAW,IAAI,KAAI,EAAG,QAAO,EAAKA,EAAM,KAAK,QAAO,EAC1DJ,EAAS,MAAK,EAAG,YAAYI,CAAK,EAC3BC,CACT,CAAC,EACA,MAAM,SAACC,EAAG,CACT,MAAAF,EAAM,MAAQE,EACdF,EAAM,SAAW,IAAI,KAAI,EAAG,QAAO,EAAKA,EAAM,KAAK,QAAO,EAC1DJ,EAAS,MAAK,EAAG,YAAYI,CAAK,EAC5BE,CACR,CAAC,CACL,CACF,CCvCA,IAAIC,GAAe,GAGnB,SAASC,IAAkB,CACzB,OAAO,SAAS,UAAY,SAAS,SAAS,QAChD,CAEM,SAAUC,GAAmBC,EAAkB,CACnDH,GAAeC,GAAkB,EAEjC,IAAMG,EAAQ,OAAO,WACrB,OAAO,WAAa,SAAsBC,EAAqB,CAC7D,IAAMC,EAAML,GAAkB,EAI9B,GAHIK,GACFC,GAAeJ,EAAUG,CAAG,EAE1BF,EACF,OAAOA,EAAM,MAAM,KAAM,SAAS,CAEtC,EAEA,IAAMI,EAAe,QAAQ,UAC7B,QAAQ,UAAY,SAClBC,EACAC,EACAJ,EAAmB,CAEfA,GACFC,GAAeJ,EAAUG,EAAI,SAAQ,CAAE,EAEzCE,EAAa,MAAM,KAAM,SAAS,CACpC,CACF,CAEA,SAASD,GAAeJ,EAAoBG,EAAW,CACrD,IAAIK,EAAQL,EAAI,QAAQ,KAAK,EACzBK,GAAS,GACXL,EAAMA,EAAI,MAAMK,EAAQ,CAAC,EACzBA,EAAQL,EAAI,QAAQ,GAAG,EACvBA,EAAMK,GAAS,EAAIL,EAAI,MAAMK,CAAK,EAAI,KAC7BL,EAAI,OAAO,CAAC,IAAM,MAC3BA,EAAM,IAAMA,GAGdH,EAAS,MAAK,EAAG,YAAY,CAC3B,KAAM,WACN,KAAMH,GACN,GAAIM,EACL,EACDN,GAAeM,CACjB,CC9CM,SAAUM,GAAcC,EAAkB,CAC9C,SAASC,EAAUC,EAA6B,CAC9C,IAAMC,EAAQD,EAAI,QAClBC,EAAM,WAAaD,EAAI,OACvBC,EAAM,SAAW,IAAI,KAAI,EAAG,QAAO,EAAKA,EAAM,KAAK,QAAO,EAC1DH,EAAS,MAAK,EAAG,YAAYG,CAAK,CACpC,CAEA,IAAMC,EAAU,eAAe,UAAU,KACzC,eAAe,UAAU,KAAO,SAC9BC,EACAC,EACAC,EACAC,EACAC,EAAkB,CAEdT,EAAS,iBAAmB,IAC9B,KAAK,QAAU,CACb,KAAM,MACN,OAAMK,EACN,IAAGC,IAGPF,EAAQ,MAAM,KAAM,SAAS,CAC/B,EAEA,IAAMM,EAAU,eAAe,UAAU,KACzC,eAAe,UAAU,KAAO,SAAgBC,EAAW,CACzD,IAAIC,EAAQ,KAAK,mBACjB,YAAK,mBAAqB,SAAUC,EAAU,CAI5C,GAHI,KAAK,aAAe,GAAK,KAAK,SAChCZ,EAAU,IAAI,EAEZW,EACF,OAAOA,EAAM,MAAM,KAAM,SAAS,CAEtC,EAEI,KAAK,UACN,KAAkC,QAAQ,KAAO,IAAI,MAEjDF,EAAQ,MAAM,KAAM,SAAS,CACtC,CACF,8jBChCAI,GAAA,SAAAC,EAAA,CAA8BC,GAAAF,EAAAC,CAAA,EAO5B,SAAAD,EAAYG,EAAa,CAAzB,IAAAC,EACEH,EAAA,KAAA,KAAME,CAAG,GAAC,KAEV,OATQC,EAAA,QAAU,GACVA,EAAA,KAAgB,CAAA,EAE1BA,EAAA,mBAAqB,EACrBA,EAAA,eAAiB,EAKX,OAAO,OAAW,MAItBA,EAAK,UAAUC,EAAY,EAEvB,OAAO,mBACTD,EAAK,SAAWA,EAAK,SAAS,KAAKA,CAAI,EACvC,OAAO,iBAAiB,SAAUA,EAAK,QAAQ,EAC/CA,EAAK,UAAYA,EAAK,UAAU,KAAKA,CAAI,EACzC,OAAO,iBAAiB,UAAWA,EAAK,SAAS,EAEjDA,EAAK,qBAAuBA,EAAK,qBAAqB,KAAKA,CAAI,EAC/D,OAAO,iBAAiB,qBAAsBA,EAAK,oBAAoB,EAEvEA,EAAK,SAAS,KAAK,UAAA,CACjB,OAAO,oBAAoB,SAAUA,EAAK,QAAQ,EAClD,OAAO,oBAAoB,UAAWA,EAAK,SAAS,EACpD,OAAO,oBACL,qBACAA,EAAK,oBAAoB,CAE7B,CAAC,GAICA,EAAK,KAAK,oBACZD,EAAI,gBAAgB,QAAU,IAGhCC,EAAK,YAAYD,EAAI,eAAe,IACtC,CAEA,OAAAH,EAAA,UAAA,YAAA,SAAYG,EAAiC,CAK3C,GALUA,IAAA,SAAAA,EAAA,CAAA,GACNA,EAAI,UAAY,SAClBA,EAAI,QAAU,CAACG,GAAS,KAAK,KAAK,WAAW,GAG3CC,GAAQJ,EAAI,OAAO,EAAG,CAExB,IAAIK,EAAO,KACPC,EAAa,OAAO,QACxB,OAAO,QAAU,UAAkB,CAC7BA,GACFA,EAAW,MAAM,KAAM,SAAS,EAElCD,EAAK,QAAQ,MAAMA,EAAM,SAAS,CACpC,EAGFE,GAAc,IAAI,EACdH,GAAQJ,EAAI,KAAK,GAAK,OAAO,OAAU,YACzCQ,GAAgB,IAAI,EAElBJ,GAAQJ,EAAI,OAAO,GAAK,OAAO,SAAY,UAC7CS,GAAmB,IAAI,EAErBL,GAAQJ,EAAI,OAAO,GAAK,OAAO,SAAY,UAC7CU,GAAkB,IAAI,EAEpBN,GAAQJ,EAAI,GAAG,GAAK,OAAO,eAAmB,KAChDW,GAAc,IAAI,CAEtB,EAEOd,EAAA,UAAA,OAAP,SAAce,EAAQ,CAAtB,IAAAX,EAAA,KACE,OAAI,KAAK,QACA,IAAIY,GAAQ,SAACC,EAASC,EAAM,CAMjC,IALAd,EAAK,KAAK,KAAK,CACb,IAAGW,EACH,QAAOE,EACP,OAAMC,EACP,EACMd,EAAK,KAAK,OAAS,KAAK,CAC7B,IAAIe,EAAIf,EAAK,KAAK,MAAK,EACvB,GAAIe,IAAM,OACR,MAEFA,EAAE,QAAQ,CACR,MAAO,IAAI,MAAM,sCAAsC,EACxD,EAEL,CAAC,EAGIlB,EAAA,UAAM,OAAM,KAAA,KAACc,CAAG,CACzB,EAEUf,EAAA,UAAA,SAAV,UAAA,CACE,KAAK,QAAU,GAEf,mBAASmB,EAAC,CACRC,EAAK,OAAOD,EAAE,GAAG,EAAE,KAAK,SAACE,EAAM,CAC7BF,EAAE,QAAQE,CAAM,CAClB,CAAC,UAHWC,EAAA,EAAAC,EAAA,KAAK,KAALD,EAAAC,EAAA,OAAAD,IAAS,CAAlB,IAAIH,EAACI,EAAAD,KAADH,CAAC,EAKV,KAAK,KAAO,CAAA,CACd,EAEUnB,EAAA,UAAA,UAAV,UAAA,CACE,KAAK,QAAU,EACjB,EAEUA,EAAA,UAAA,qBAAV,SAA+BwB,EAAM,CAInC,IAAIC,EAASD,EAAE,QAAWA,EAAE,QAAUA,EAAE,OAAO,OAC/C,GAAKC,EAGL,KAAIC,EAAMD,EAAO,SAAW,OAAOA,CAAM,EACzC,GAAI,EAAAC,EAAI,SAAWA,EAAI,QAAQ,YAAY,IAAM,GAGjD,IAAI,OAAOD,GAAW,UAAYA,EAAO,QAAU,OAAW,CAC5D,KAAK,OAAO,CACV,MAAOA,EACP,QAAS,CACP,mBAAoB,IAEvB,EACD,OAEF,KAAK,OAAME,GAAAA,GAAA,CAAA,EACNF,CAAM,EAAA,CACT,QAAS,CACP,mBAAoB,GACrB,CAAA,CAAA,GAEL,EAEAzB,EAAA,UAAA,QAAA,SACE4B,EACAC,EACAC,EACAC,EACAhB,EAAW,CAEX,GAAI,OAAK,mBAAqB,GAI9B,IAAIA,EAAK,CACP,KAAK,OAAO,CACV,MAAOA,EACP,QAAS,CACP,YAAa,IAEhB,EACD,OAIE,CAACc,GAAY,CAACC,GAIlB,KAAK,OAAO,CACV,MAAO,CACL,QAAOF,EACP,SAAUC,EACV,WAAYC,EACZ,aAAcC,EACd,QAAS,IAEX,QAAS,CACP,YAAa,IAEhB,EACH,EAEA/B,EAAA,UAAA,uBAAA,UAAA,CAAA,IAAAI,EAAA,KACE,KAAK,qBACL,WAAW,UAAA,CAAM,OAAAA,EAAK,oBAAL,CAAyB,CAC5C,EACFJ,CAAA,EA1L8BgC,EAAY,EA4L1C,SAASC,GAASC,EAAQ,CACxB,OAAOA,GAAOA,EAAI,YAAcA,EAAI,WAAW,KAAK,CACtD,CAEA,SAASC,GAAQC,EAAsB,CACrC,OAAOA,IAAM,QAAaA,IAAM,EAClC,EC/MC,UAAY,CACT,GAAI,OAAO,UAAY,QACnB,OAAO,iBAAmB,QAC1B,OAAO,eAAe,0BACtB,OAEJ,IAAMC,EAAqB,YACrBC,EAAoB,CACtB,YAAa,UAAuB,CAChC,OAAO,QAAQ,UAAUD,EAAoB,CAAC,EAAG,KAAK,WAAW,CACrE,CACJ,EACA,OAAO,YAAcC,EAAkB,YACvC,YAAY,UAAYD,EAAmB,UAC3C,YAAY,UAAU,YAAc,YACpC,OAAO,eAAe,YAAaA,CAAkB,CACzD,GAAG,GA0BF,SAASE,EAAW,CACnB,GAAI,OAAOA,EAAU,eAAiB,WAAY,OAElDA,EAAU,cAAgB,SAASC,EAAW,CACxCA,GACFC,EAAkBD,EAAW,IAAI,EACjCA,EAAU,MAAM,IAEhBA,EAAY,SAAS,cAAc,OAAO,EAC1CA,EAAU,KAAO,SACjBA,EAAU,OAAS,GACnB,KAAK,YAAYA,CAAS,EAC1BA,EAAU,MAAM,EAChB,KAAK,YAAYA,CAAS,EAE9B,EAEA,SAASC,EAAkBD,EAAWE,EAAM,CAC1CF,aAAqB,aAAeG,EAAM,UAAW,0CAA0C,EAC/FH,EAAU,MAAQ,UAAYG,EAAM,UAAW,8CAA8C,EAC7FH,EAAU,MAAQE,GAAQC,EAAM,aAAc,0DAA2D,eAAe,CAC1H,CAEA,SAASA,EAAMC,EAAkBC,EAASC,EAAM,CAC9C,MAAM,IAAIF,EAAiB,2DAA6DC,EAAU,IAAKC,CAAI,CAC7G,CACF,GAAG,gBAAgB,SAAS,EAE5B,IAAMC,GAAmB,IAAI,QAC7B,SAASC,GAA6BC,EAAQ,CAC1C,IAAMC,EAAUD,aAAkB,QAAUA,EAASA,aAAkB,KAAOA,EAAO,cAAgB,KAC/FE,EAAYD,EAAUA,EAAQ,QAAQ,eAAe,EAAI,KAC/D,OAA8DC,GAAU,MAAS,SAAWA,EAAY,IAC5G,CACA,SAASC,GAAcC,EAAO,CAC1B,IAAMb,EAAYQ,GAA6BK,EAAM,MAAM,EACvDb,GAAaA,EAAU,MACvBO,GAAiB,IAAIP,EAAU,KAAMA,CAAS,CAEtD,EACC,UAAY,CACT,GAAI,cAAe,MAAM,UACrB,OACJ,IAAID,EACJ,GAAI,gBAAiB,QAAU,iBAAiB,KAAK,UAAU,MAAM,EACjEA,EAAY,OAAO,YAAY,cAE9B,IAAI,gBAAiB,OACtB,OAGAA,EAAY,OAAO,MAAM,UAE7B,iBAAiB,QAASa,GAAe,EAAI,EAC7C,OAAO,eAAeb,EAAW,YAAa,CAC1C,KAAM,CACF,GAAI,KAAK,MAAQ,UAAY,KAAK,kBAAkB,gBAChD,OAAOQ,GAAiB,IAAI,KAAK,MAAM,CAE/C,CACJ,CAAC,CACL,GAAG,EAEH,IAAIO,IACH,SAAUA,EAAmB,CAC1BA,EAAkB,MAAW,QAC7BA,EAAkB,KAAU,MAChC,GAAGA,KAAsBA,GAAoB,CAAC,EAAE,EAChD,IAAMC,GAAN,cAA2B,WAAY,CACnC,aAAc,CACV,MAAM,EACN,KAAK,OAAS,QAAQ,QAAQ,EAC9B,KAAK,SAAW,IAAIA,GAAa,oBAAoB,IAAI,CAC7D,CACA,WAAW,oBAAqB,CAC5B,MAAO,CAAC,WAAY,WAAY,UAAW,KAAK,CACpD,CACA,mBAAoB,CAChB,KAAK,SAAS,QAAQ,CAC1B,CACA,sBAAuB,CACnB,KAAK,SAAS,WAAW,CAC7B,CACA,QAAS,CACL,OAAO,KAAK,SAAS,kBAAkB,CAC3C,CACA,yBAAyBT,EAAM,CACvBA,GAAQ,UACR,KAAK,SAAS,oBAAoB,EAE7BA,GAAQ,WACb,KAAK,SAAS,gBAAgB,EAEzBA,GAAQ,MACb,KAAK,SAAS,iBAAiB,EAG/B,KAAK,SAAS,gBAAgB,CAEtC,CACA,IAAI,KAAM,CACN,OAAO,KAAK,aAAa,KAAK,CAClC,CACA,IAAI,IAAIU,EAAO,CACPA,EACA,KAAK,aAAa,MAAOA,CAAK,EAG9B,KAAK,gBAAgB,KAAK,CAElC,CACA,IAAI,SAAU,CACV,OAAOC,GAA4B,KAAK,aAAa,SAAS,GAAK,EAAE,CACzE,CACA,IAAI,QAAQD,EAAO,CACXA,EACA,KAAK,aAAa,UAAWA,CAAK,EAGlC,KAAK,gBAAgB,SAAS,CAEtC,CACA,IAAI,UAAW,CACX,OAAO,KAAK,aAAa,UAAU,CACvC,CACA,IAAI,SAASA,EAAO,CACZA,EACA,KAAK,aAAa,WAAY,EAAE,EAGhC,KAAK,gBAAgB,UAAU,CAEvC,CACA,IAAI,YAAa,CACb,OAAO,KAAK,aAAa,YAAY,CACzC,CACA,IAAI,WAAWA,EAAO,CACdA,EACA,KAAK,aAAa,aAAc,EAAE,EAGlC,KAAK,gBAAgB,YAAY,CAEzC,CACA,IAAI,UAAW,CACX,MAAO,CAAC,KAAK,SAAS,SAC1B,CACA,IAAI,UAAW,CACX,OAAO,KAAK,gBAAkB,UAAY,CAAC,KAAK,SACpD,CACA,IAAI,WAAY,CACZ,IAAIE,EAAIC,EACR,OAAQA,GAAMD,EAAK,KAAK,iBAAmB,MAAQA,IAAO,OAAS,OAASA,EAAG,mBAAqB,MAAQC,IAAO,OAAS,OAASA,EAAG,aAAa,oBAAoB,CAC7K,CACJ,EACA,SAASF,GAA4BG,EAAO,CACxC,OAAQA,EAAM,YAAY,EAAG,CACzB,IAAK,OACD,OAAON,GAAkB,KAC7B,QACI,OAAOA,GAAkB,KACjC,CACJ,CAEA,SAASO,GAAUC,EAAW,CAC1B,OAAO,IAAI,IAAIA,EAAU,SAAS,EAAG,SAAS,OAAO,CACzD,CACA,SAASC,GAAUC,EAAK,CACpB,IAAIC,EACJ,GAAID,EAAI,KACJ,OAAOA,EAAI,KAAK,MAAM,CAAC,EAEtB,GAAKC,EAAcD,EAAI,KAAK,MAAM,QAAQ,EAC3C,OAAOC,EAAY,EAE3B,CACA,SAASC,GAAUxB,EAAMF,EAAW,CAChC,IAAM2B,EAAgE3B,GAAU,aAAa,YAAY,GAAME,EAAK,aAAa,QAAQ,GAAKA,EAAK,OACnJ,OAAOmB,GAAUM,CAAM,CAC3B,CACA,SAASC,GAAaJ,EAAK,CACvB,OAAQK,GAAqBL,CAAG,EAAE,MAAM,UAAU,GAAK,CAAC,GAAG,IAAM,EACrE,CACA,SAASM,GAAON,EAAK,CACjB,MAAO,CAAC,CAACI,GAAaJ,CAAG,EAAE,MAAM,iCAAiC,CACtE,CACA,SAASO,GAAaC,EAASR,EAAK,CAChC,IAAMS,EAASC,GAAUV,CAAG,EAC5B,OAAOQ,EAAQ,OAASX,GAAUY,CAAM,EAAE,MAAQD,EAAQ,KAAK,WAAWC,CAAM,CACpF,CACA,SAASE,GAAoBC,EAAUC,EAAc,CACjD,OAAON,GAAaK,EAAUC,CAAY,GAAKP,GAAOM,CAAQ,CAClE,CACA,SAASE,GAAcd,EAAK,CACxB,IAAMe,EAAShB,GAAUC,CAAG,EAC5B,OAAOe,GAAU,KAAOf,EAAI,KAAK,MAAM,EAAG,EAAEe,EAAO,OAAS,EAAE,EAAIf,EAAI,IAC1E,CACA,SAASgB,GAAWhB,EAAK,CACrB,OAAOc,GAAcd,CAAG,CAC5B,CACA,SAASiB,GAAaC,EAAMC,EAAO,CAC/B,OAAOtB,GAAUqB,CAAI,EAAE,MAAQrB,GAAUsB,CAAK,EAAE,IACpD,CACA,SAASC,GAAkBpB,EAAK,CAC5B,OAAOA,EAAI,SAAS,MAAM,GAAG,EAAE,MAAM,CAAC,CAC1C,CACA,SAASK,GAAqBL,EAAK,CAC/B,OAAOoB,GAAkBpB,CAAG,EAAE,MAAM,EAAE,EAAE,EAC5C,CACA,SAASU,GAAUV,EAAK,CACpB,OAAOqB,GAAiBrB,EAAI,OAASA,EAAI,QAAQ,CACrD,CACA,SAASqB,GAAiB7B,EAAO,CAC7B,OAAOA,EAAM,SAAS,GAAG,EAAIA,EAAQA,EAAQ,GACjD,CAEA,IAAM8B,GAAN,KAAoB,CAChB,YAAYC,EAAU,CAClB,KAAK,SAAWA,CACpB,CACA,IAAI,WAAY,CACZ,OAAO,KAAK,SAAS,EACzB,CACA,IAAI,QAAS,CACT,MAAO,CAAC,KAAK,SACjB,CACA,IAAI,aAAc,CACd,OAAO,KAAK,YAAc,KAAO,KAAK,YAAc,GACxD,CACA,IAAI,aAAc,CACd,OAAO,KAAK,YAAc,KAAO,KAAK,YAAc,GACxD,CACA,IAAI,YAAa,CACb,OAAO,KAAK,SAAS,UACzB,CACA,IAAI,UAAW,CACX,OAAO1B,GAAU,KAAK,SAAS,GAAG,CACtC,CACA,IAAI,QAAS,CACT,OAAO,KAAK,aAAe,KAAK,YAAY,MAAM,wDAAwD,CAC9G,CACA,IAAI,YAAa,CACb,OAAO,KAAK,SAAS,MACzB,CACA,IAAI,aAAc,CACd,OAAO,KAAK,OAAO,cAAc,CACrC,CACA,IAAI,cAAe,CACf,OAAO,KAAK,SAAS,MAAM,EAAE,KAAK,CACtC,CACA,IAAI,cAAe,CACf,OAAI,KAAK,OACE,KAAK,SAAS,MAAM,EAAE,KAAK,EAG3B,QAAQ,QAAQ,MAAS,CAExC,CACA,OAAOf,EAAM,CACT,OAAO,KAAK,SAAS,QAAQ,IAAIA,CAAI,CACzC,CACJ,EAEA,SAAS0C,GAASrB,EAAQ,CACtB,OAAOA,GAAU,WAAaA,GAAU,WAAaA,GAAU,SACnE,CAEA,SAASsB,GAAsBvC,EAAS,CACpC,GAAIA,EAAQ,aAAa,iBAAiB,GAAK,QAC3C,OAAOA,EAEN,CACD,IAAMwC,EAAuB,SAAS,cAAc,QAAQ,EACtDC,EAAWC,GAAe,WAAW,EAC3C,OAAID,IACAD,EAAqB,MAAQC,GAEjCD,EAAqB,YAAcxC,EAAQ,YAC3CwC,EAAqB,MAAQ,GAC7BG,GAAsBH,EAAsBxC,CAAO,EAC5CwC,CACX,CACJ,CACA,SAASG,GAAsBC,EAAoBC,EAAe,CAC9D,OAAW,CAAE,KAAAjD,EAAM,MAAAU,CAAM,IAAKuC,EAAc,WACxCD,EAAmB,aAAahD,EAAMU,CAAK,CAEnD,CACA,SAASwC,GAAuBC,EAAM,CAClC,IAAMC,EAAW,SAAS,cAAc,UAAU,EAClD,OAAAA,EAAS,UAAYD,EACdC,EAAS,OACpB,CACA,SAASC,GAASC,EAAW,CAAE,OAAAnD,EAAQ,WAAAoD,EAAY,OAAAC,CAAO,EAAI,CAAC,EAAG,CAC9D,IAAMjD,EAAQ,IAAI,YAAY+C,EAAW,CACrC,WAAAC,EACA,QAAS,GACT,OAAAC,CACJ,CAAC,EACD,OAAIrD,GAAUA,EAAO,YACjBA,EAAO,cAAcI,CAAK,EAG1B,SAAS,gBAAgB,cAAcA,CAAK,EAEzCA,CACX,CACA,SAASkD,IAAqB,CAC1B,OAAO,IAAI,QAASC,GAAY,sBAAsB,IAAMA,EAAQ,CAAC,CAAC,CAC1E,CACA,SAASC,IAAoB,CACzB,OAAO,IAAI,QAASD,GAAY,WAAW,IAAMA,EAAQ,EAAG,CAAC,CAAC,CAClE,CACA,SAASE,IAAgB,CACrB,OAAO,QAAQ,QAAQ,CAC3B,CACA,SAASC,GAAkBV,EAAO,GAAI,CAClC,OAAO,IAAI,UAAU,EAAE,gBAAgBA,EAAM,WAAW,CAC5D,CACA,SAASW,GAASC,KAAYC,EAAQ,CAClC,IAAMC,EAAQC,GAAYH,EAASC,CAAM,EAAE,QAAQ,MAAO,EAAE,EAAE,MAAM;AAAA,CAAI,EAClEG,EAAQF,EAAM,GAAG,MAAM,MAAM,EAC7BG,EAASD,EAAQA,EAAM,GAAG,OAAS,EACzC,OAAOF,EAAM,IAAKI,GAASA,EAAK,MAAMD,CAAM,CAAC,EAAE,KAAK;AAAA,CAAI,CAC5D,CACA,SAASF,GAAYH,EAASC,EAAQ,CAClC,OAAOD,EAAQ,OAAO,CAACO,EAAQC,EAAQC,IAAM,CACzC,IAAM9D,EAAQsD,EAAOQ,IAAM,KAAY,GAAKR,EAAOQ,GACnD,OAAOF,EAASC,EAAS7D,CAC7B,EAAG,EAAE,CACT,CACA,SAAS+D,IAAO,CACZ,OAAO,MAAM,KAAK,CAAE,OAAQ,EAAG,CAAC,EAC3B,IAAI,CAACC,EAAGF,IACLA,GAAK,GAAKA,GAAK,IAAMA,GAAK,IAAMA,GAAK,GAC9B,IAEFA,GAAK,GACH,IAEFA,GAAK,IACF,KAAK,MAAM,KAAK,OAAO,EAAI,CAAC,EAAI,GAAG,SAAS,EAAE,EAG/C,KAAK,MAAM,KAAK,OAAO,EAAI,EAAE,EAAE,SAAS,EAAE,CAExD,EACI,KAAK,EAAE,CAChB,CACA,SAASG,GAAaC,KAAkBC,EAAU,CAC9C,QAAWnE,KAASmE,EAAS,IAAKzE,GAA8DA,GAAQ,aAAawE,CAAa,CAAC,EAC/H,GAAI,OAAOlE,GAAS,SAChB,OAAOA,EAEf,OAAO,IACX,CACA,SAASoE,GAAaF,KAAkBC,EAAU,CAC9C,OAAOA,EAAS,KAAMzE,GAAYA,GAAWA,EAAQ,aAAawE,CAAa,CAAC,CACpF,CACA,SAASG,MAAcF,EAAU,CAC7B,QAAWzE,KAAWyE,EACdzE,EAAQ,WAAa,eACrBA,EAAQ,aAAa,OAAQ,EAAE,EAEnCA,EAAQ,aAAa,YAAa,MAAM,CAEhD,CACA,SAAS4E,MAAkBH,EAAU,CACjC,QAAWzE,KAAWyE,EACdzE,EAAQ,WAAa,eACrBA,EAAQ,gBAAgB,MAAM,EAElCA,EAAQ,gBAAgB,WAAW,CAE3C,CACA,SAAS6E,GAAY7E,EAAS8E,EAAwB,IAAM,CACxD,OAAO,IAAI,QAASxB,GAAY,CAC5B,IAAMyB,EAAa,IAAM,CACrB/E,EAAQ,oBAAoB,QAAS+E,CAAU,EAC/C/E,EAAQ,oBAAoB,OAAQ+E,CAAU,EAC9CzB,EAAQ,CACZ,EACAtD,EAAQ,iBAAiB,OAAQ+E,EAAY,CAAE,KAAM,EAAK,CAAC,EAC3D/E,EAAQ,iBAAiB,QAAS+E,EAAY,CAAE,KAAM,EAAK,CAAC,EAC5D,WAAWzB,EAASwB,CAAqB,CAC7C,CAAC,CACL,CACA,SAASE,GAA0B/D,EAAQ,CACvC,OAAQA,EAAQ,CACZ,IAAK,UACD,OAAO,QAAQ,aACnB,IAAK,UACL,IAAK,UACD,OAAO,QAAQ,SACvB,CACJ,CACA,SAASgE,MAAkBR,EAAU,CACjC,IAAMxD,EAASsD,GAAa,oBAAqB,GAAGE,CAAQ,EAC5D,OAAOnC,GAASrB,CAAM,EAAIA,EAAS,IACvC,CACA,SAASiE,GAAetF,EAAM,CAC1B,OAAO,SAAS,cAAc,cAAcA,KAAQ,CACxD,CACA,SAAS8C,GAAe9C,EAAM,CAC1B,IAAMI,EAAUkF,GAAetF,CAAI,EACnC,OAAOI,GAAWA,EAAQ,OAC9B,CACA,SAASmF,GAAevF,EAAMwF,EAAS,CACnC,IAAIpF,EAAUkF,GAAetF,CAAI,EACjC,OAAKI,IACDA,EAAU,SAAS,cAAc,MAAM,EACvCA,EAAQ,aAAa,OAAQJ,CAAI,EACjC,SAAS,KAAK,YAAYI,CAAO,GAErCA,EAAQ,aAAa,UAAWoF,CAAO,EAChCpF,CACX,CAEA,IAAIqF,IACH,SAAUA,EAAa,CACpBA,EAAYA,EAAY,IAAS,GAAK,MACtCA,EAAYA,EAAY,KAAU,GAAK,OACvCA,EAAYA,EAAY,IAAS,GAAK,MACtCA,EAAYA,EAAY,MAAW,GAAK,QACxCA,EAAYA,EAAY,OAAY,GAAK,QAC7C,GAAGA,KAAgBA,GAAc,CAAC,EAAE,EACpC,SAASC,GAAsBC,EAAQ,CACnC,OAAQA,EAAO,YAAY,EAAG,CAC1B,IAAK,MACD,OAAOF,GAAY,IACvB,IAAK,OACD,OAAOA,GAAY,KACvB,IAAK,MACD,OAAOA,GAAY,IACvB,IAAK,QACD,OAAOA,GAAY,MACvB,IAAK,SACD,OAAOA,GAAY,MAC3B,CACJ,CACA,IAAMG,GAAN,KAAmB,CACf,YAAYC,EAAUF,EAAQ7D,EAAUgE,EAAO,IAAI,gBAAmB3F,EAAS,KAAM,CACjF,KAAK,gBAAkB,IAAI,gBAC3B,KAAK,sBAAyB4F,GAAW,CAAE,EAC3C,KAAK,SAAWF,EAChB,KAAK,OAASF,EACd,KAAK,QAAU,KAAK,eACpB,KAAK,KAAOG,EACZ,KAAK,IAAMhE,EACX,KAAK,OAAS3B,CAClB,CACA,IAAI,UAAW,CACX,OAAO,KAAK,GAChB,CACA,IAAI,QAAS,CACT,OAAO,KAAK,IAAI,YACpB,CACA,IAAI,SAAU,CACV,OAAO,KAAK,KAAO,MAAM,KAAK,KAAK,KAAK,QAAQ,CAAC,EAAI,CAAC,CAC1D,CACA,QAAS,CACL,KAAK,gBAAgB,MAAM,CAC/B,CACA,MAAM,SAAU,CACZ,IAAIS,EAAIC,EACR,GAAM,CAAE,aAAAmF,CAAa,EAAI,MACxBnF,GAAMD,EAAK,KAAK,UAAU,4BAA8B,MAAQC,IAAO,QAAkBA,EAAG,KAAKD,EAAI,KAAK,QAAS,IAAI,EACxH,MAAM,KAAK,4BAA4BoF,CAAY,EACnD,GAAI,CACA,KAAK,SAAS,eAAe,IAAI,EACjC,IAAMvD,EAAW,MAAM,MAAM,KAAK,IAAI,KAAMuD,CAAY,EACxD,OAAO,MAAM,KAAK,QAAQvD,CAAQ,CACtC,OACOwD,EAAP,CACI,GAAIA,EAAM,OAAS,aACf,MAAI,KAAK,0BAA0BA,CAAK,GACpC,KAAK,SAAS,eAAe,KAAMA,CAAK,EAEtCA,CAEd,QACA,CACI,KAAK,SAAS,gBAAgB,IAAI,CACtC,CACJ,CACA,MAAM,QAAQxD,EAAU,CACpB,IAAMyD,EAAgB,IAAI1D,GAAcC,CAAQ,EAMhD,OALcY,GAAS,8BAA+B,CAClD,WAAY,GACZ,OAAQ,CAAE,cAAA6C,CAAc,EACxB,OAAQ,KAAK,MACjB,CAAC,EACS,iBACN,KAAK,SAAS,iCAAiC,KAAMA,CAAa,EAE7DA,EAAc,UACnB,KAAK,SAAS,6BAA6B,KAAMA,CAAa,EAG9D,KAAK,SAAS,0BAA0B,KAAMA,CAAa,EAExDA,CACX,CACA,IAAI,cAAe,CACf,IAAItF,EACJ,MAAO,CACH,OAAQ6E,GAAY,KAAK,QAAQ,YAAY,EAC7C,YAAa,cACb,QAAS,KAAK,QACd,SAAU,SACV,KAAM,KAAK,aAAe,KAAO,KAAK,KACtC,OAAQ,KAAK,YACb,UAAW7E,EAAK,KAAK,SAAS,YAAc,MAAQA,IAAO,OAAS,OAASA,EAAG,IACpF,CACJ,CACA,IAAI,gBAAiB,CACjB,MAAO,CACH,OAAQ,kCACZ,CACJ,CACA,IAAI,cAAe,CACf,OAAO,KAAK,QAAU6E,GAAY,GACtC,CACA,IAAI,aAAc,CACd,OAAO,KAAK,gBAAgB,MAChC,CACA,mBAAmBU,EAAU,CACzB,KAAK,QAAQ,OAAY,CAACA,EAAU,KAAK,QAAQ,MAAS,EAAE,KAAK,IAAI,CACzE,CACA,MAAM,4BAA4BH,EAAc,CAC5C,IAAMI,EAAsB,IAAI,QAAS1C,GAAa,KAAK,sBAAwBA,CAAQ,EAC7EL,GAAS,6BAA8B,CACjD,WAAY,GACZ,OAAQ,CACJ,aAAA2C,EACA,IAAK,KAAK,IACV,OAAQ,KAAK,qBACjB,EACA,OAAQ,KAAK,MACjB,CAAC,EACS,kBACN,MAAMI,CACd,CACA,0BAA0BH,EAAO,CAM7B,MAAO,CALO5C,GAAS,4BAA6B,CAChD,OAAQ,KAAK,OACb,WAAY,GACZ,OAAQ,CAAE,QAAS,KAAM,MAAO4C,CAAM,CAC1C,CAAC,EACa,gBAClB,CACJ,EAEMI,GAAN,KAAyB,CACrB,YAAYR,EAAUzF,EAAS,CAC3B,KAAK,QAAU,GACf,KAAK,UAAakG,GAAY,CAC1B,IAAMC,EAAYD,EAAQ,MAAM,EAAE,EAAE,GACsBC,GAAU,gBAChE,KAAK,SAAS,0BAA0B,KAAK,OAAO,CAE5D,EACA,KAAK,SAAWV,EAChB,KAAK,QAAUzF,EACf,KAAK,qBAAuB,IAAI,qBAAqB,KAAK,SAAS,CACvE,CACA,OAAQ,CACC,KAAK,UACN,KAAK,QAAU,GACf,KAAK,qBAAqB,QAAQ,KAAK,OAAO,EAEtD,CACA,MAAO,CACC,KAAK,UACL,KAAK,QAAU,GACf,KAAK,qBAAqB,UAAU,KAAK,OAAO,EAExD,CACJ,EAEMoG,GAAN,KAAoB,CAChB,YAAYC,EAAU,CAClB,KAAK,SAAWC,GAAqBD,CAAQ,CACjD,CACA,OAAO,KAAK1G,EAAS,CACjB,OAAI,OAAOA,GAAW,SACX,IAAI,KAAKmD,GAAuBnD,CAAO,CAAC,EAGxCA,CAEf,CACJ,EACAyG,GAAc,YAAc,6BAC5B,SAASE,GAAqBD,EAAU,CACpC,QAAWrG,KAAWqG,EAAS,iBAAiB,cAAc,EAAG,CAC7D,IAAME,EAAgB,SAAS,WAAWvG,EAAS,EAAI,EACvD,QAAWwG,KAAsBD,EAAc,gBAAgB,QAAQ,iBAAiB,QAAQ,EAC5FC,EAAmB,YAAYjE,GAAsBiE,CAAkB,CAAC,EAE5ExG,EAAQ,YAAYuG,CAAa,CACrC,CACA,OAAOF,CACX,CAEA,IAAII,IACH,SAAUA,EAAqB,CAC5BA,EAAoBA,EAAoB,YAAiB,GAAK,cAC9DA,EAAoBA,EAAoB,WAAgB,GAAK,aAC7DA,EAAoBA,EAAoB,QAAa,GAAK,UAC1DA,EAAoBA,EAAoB,UAAe,GAAK,YAC5DA,EAAoBA,EAAoB,SAAc,GAAK,WAC3DA,EAAoBA,EAAoB,QAAa,GAAK,SAC9D,GAAGA,KAAwBA,GAAsB,CAAC,EAAE,EACpD,IAAIC,IACH,SAAUA,EAAa,CACpBA,EAAY,WAAgB,oCAC5BA,EAAY,UAAe,sBAC3BA,EAAY,MAAW,YAC3B,GAAGA,KAAgBA,GAAc,CAAC,EAAE,EACpC,SAASC,GAAsBC,EAAU,CACrC,OAAQA,EAAS,YAAY,EAAG,CAC5B,KAAKF,GAAY,UACb,OAAOA,GAAY,UACvB,KAAKA,GAAY,MACb,OAAOA,GAAY,MACvB,QACI,OAAOA,GAAY,UAC3B,CACJ,CACA,IAAMG,GAAN,KAAqB,CACjB,YAAYpB,EAAUqB,EAAaxH,EAAWyH,EAAe,GAAO,CAChE,KAAK,MAAQN,GAAoB,YACjC,KAAK,SAAWhB,EAChB,KAAK,YAAcqB,EACnB,KAAK,UAAYxH,EACjB,KAAK,SAAW0H,GAAcF,EAAaxH,CAAS,EACpD,KAAK,SAAWqB,GAAU,KAAK,MAAM,EACjC,KAAK,QAAU0E,GAAY,KAC3B4B,GAAqB,KAAK,SAAU,CAAC,GAAG,KAAK,KAAK,QAAQ,CAAC,CAAC,EAEhE,KAAK,aAAe,IAAIzB,GAAa,KAAM,KAAK,OAAQ,KAAK,SAAU,KAAK,KAAM,KAAK,WAAW,EAClG,KAAK,aAAeuB,CACxB,CACA,OAAO,cAAcpH,EAASuH,EAAUC,EAAY,CAChD,OAAO,QAAQ,QAAQ,QAAQxH,CAAO,CAAC,CAC3C,CACA,IAAI,QAAS,CACT,IAAIa,EACJ,IAAM+E,IAAW/E,EAAK,KAAK,aAAe,MAAQA,IAAO,OAAS,OAASA,EAAG,aAAa,YAAY,IAAM,KAAK,YAAY,aAAa,QAAQ,GAAK,GACxJ,OAAO8E,GAAsBC,EAAO,YAAY,CAAC,GAAKF,GAAY,GACtE,CACA,IAAI,QAAS,CACT,IAAI7E,EACJ,IAAM4G,EAAoB,OAAO,KAAK,YAAY,QAAW,SAAW,KAAK,YAAY,OAAS,KAClG,MAAK,GAAA5G,EAAK,KAAK,aAAe,MAAQA,IAAO,SAAkBA,EAAG,aAAa,YAAY,EAChF,KAAK,UAAU,aAAa,YAAY,GAAK,GAG7C,KAAK,YAAY,aAAa,QAAQ,GAAK4G,GAAqB,EAE/E,CACA,IAAI,MAAO,CACP,OAAI,KAAK,SAAWV,GAAY,YAAc,KAAK,QAAUrB,GAAY,IAC9D,IAAI,gBAAgB,KAAK,cAAc,EAGvC,KAAK,QAEpB,CACA,IAAI,SAAU,CACV,IAAI7E,EACJ,OAAOmG,KAAwBnG,EAAK,KAAK,aAAe,MAAQA,IAAO,OAAS,OAASA,EAAG,aAAa,aAAa,IAAM,KAAK,YAAY,OAAO,CACxJ,CACA,IAAI,cAAe,CACf,OAAO,KAAK,aAAa,YAC7B,CACA,IAAI,gBAAiB,CACjB,MAAO,CAAC,GAAG,KAAK,QAAQ,EAAE,OAAO,CAAC0F,EAAS,CAACtG,EAAMU,CAAK,IAC5C4F,EAAQ,OAAO,OAAO5F,GAAS,SAAW,CAAC,CAACV,EAAMU,CAAK,CAAC,EAAI,CAAC,CAAC,EACtE,CAAC,CAAC,CACT,CACA,MAAM,OAAQ,CACV,GAAM,CAAE,YAAA+G,EAAa,WAAAC,CAAW,EAAIb,GAC9Bc,EAAsBhD,GAAa,qBAAsB,KAAK,UAAW,KAAK,WAAW,EAC/F,GAAI,SAAOgD,GAAwB,UAE3B,CADW,MAAMV,GAAe,cAAcU,EAAqB,KAAK,YAAa,KAAK,SAAS,IAKvG,KAAK,OAASF,EACd,YAAK,MAAQC,EACN,KAAK,aAAa,QAAQ,CAEzC,CACA,MAAO,CACH,GAAM,CAAE,SAAAE,EAAU,QAAAC,CAAQ,EAAIhB,GAC9B,GAAI,KAAK,OAASe,GAAY,KAAK,OAASC,EACxC,YAAK,MAAQD,EACb,KAAK,aAAa,OAAO,EAClB,EAEf,CACA,yBAAyBE,EAASC,EAAS,CACvC,GAAI,CAACA,EAAQ,aAAc,CACvB,IAAMC,EAAQC,GAAenF,GAAe,YAAY,CAAC,GAAKA,GAAe,YAAY,EACrFkF,IACAF,EAAQ,gBAAkBE,EAElC,CACI,KAAK,kCAAkCD,CAAO,GAC9CA,EAAQ,mBAAmBvB,GAAc,WAAW,CAE5D,CACA,eAAe0B,EAAU,CACrB,IAAItH,EACJ,KAAK,MAAQiG,GAAoB,SAChCjG,EAAK,KAAK,aAAe,MAAQA,IAAO,QAAkBA,EAAG,aAAa,WAAY,EAAE,EACzFyC,GAAS,qBAAsB,CAC3B,OAAQ,KAAK,YACb,OAAQ,CAAE,eAAgB,IAAK,CACnC,CAAC,EACD,KAAK,SAAS,sBAAsB,IAAI,CAC5C,CACA,iCAAiC0E,EAAStF,EAAU,CAChD,KAAK,OAAS,CAAE,QAASA,EAAS,UAAW,cAAeA,CAAS,CACzE,CACA,6BAA6BsF,EAAStF,EAAU,CAC5C,GAAIA,EAAS,aAAeA,EAAS,YACjC,KAAK,SAAS,iCAAiC,KAAMA,CAAQ,UAExD,KAAK,oBAAoBsF,CAAO,GAAKI,GAAiC1F,CAAQ,EAAG,CACtF,IAAMwD,EAAQ,IAAI,MAAM,kDAAkD,EAC1E,KAAK,SAAS,sBAAsB,KAAMA,CAAK,CACnD,MAEI,KAAK,MAAQY,GAAoB,UACjC,KAAK,OAAS,CAAE,QAAS,GAAM,cAAepE,CAAS,EACvD,KAAK,SAAS,oCAAoC,KAAMA,CAAQ,CAExE,CACA,0BAA0BsF,EAAStF,EAAU,CACzC,KAAK,OAAS,CAAE,QAAS,GAAO,cAAeA,CAAS,EACxD,KAAK,SAAS,iCAAiC,KAAMA,CAAQ,CACjE,CACA,eAAesF,EAAS9B,EAAO,CAC3B,KAAK,OAAS,CAAE,QAAS,GAAO,MAAAA,CAAM,EACtC,KAAK,SAAS,sBAAsB,KAAMA,CAAK,CACnD,CACA,gBAAgBiC,EAAU,CACtB,IAAItH,EACJ,KAAK,MAAQiG,GAAoB,SAChCjG,EAAK,KAAK,aAAe,MAAQA,IAAO,QAAkBA,EAAG,gBAAgB,UAAU,EACxFyC,GAAS,mBAAoB,CACzB,OAAQ,KAAK,YACb,OAAQ,OAAO,OAAO,CAAE,eAAgB,IAAK,EAAG,KAAK,MAAM,CAC/D,CAAC,EACD,KAAK,SAAS,uBAAuB,IAAI,CAC7C,CACA,oBAAoB0E,EAAS,CACzB,MAAO,CAACA,EAAQ,cAAgB,KAAK,YACzC,CACA,kCAAkCA,EAAS,CACvC,MAAO,CAACA,EAAQ,cAAgBjD,GAAa,oBAAqB,KAAK,UAAW,KAAK,WAAW,CACtG,CACJ,EACA,SAASsC,GAAcF,EAAaxH,EAAW,CAC3C,IAAM0I,EAAW,IAAI,SAASlB,CAAW,EACnClH,EAA6DN,GAAU,aAAa,MAAM,EAC1FgB,EAA8DhB,GAAU,aAAa,OAAO,EAClG,OAAIM,GACAoI,EAAS,OAAOpI,EAAMU,GAAS,EAAE,EAE9B0H,CACX,CACA,SAASH,GAAeI,EAAY,CAChC,GAAIA,GAAc,KAAM,CAEpB,IAAMC,GADU,SAAS,OAAS,SAAS,OAAO,MAAM,IAAI,EAAI,CAAC,GAC1C,KAAMA,GAAWA,EAAO,WAAWD,CAAU,CAAC,EACrE,GAAIC,EAAQ,CACR,IAAM5H,EAAQ4H,EAAO,MAAM,GAAG,EAAE,MAAM,CAAC,EAAE,KAAK,GAAG,EACjD,OAAO5H,EAAQ,mBAAmBA,CAAK,EAAI,MAC/C,CACJ,CACJ,CACA,SAASyH,GAAiC1F,EAAU,CAChD,OAAOA,EAAS,YAAc,KAAO,CAACA,EAAS,UACnD,CACA,SAAS4E,GAAqBnG,EAAKoF,EAAS,CACxC,IAAMiC,EAAe,IAAI,gBACzB,OAAW,CAACvI,EAAMU,CAAK,IAAK4F,EACpB5F,aAAiB,MAErB6H,EAAa,OAAOvI,EAAMU,CAAK,EAEnC,OAAAQ,EAAI,OAASqH,EAAa,SAAS,EAC5BrH,CACX,CAEA,IAAMsH,GAAN,KAAe,CACX,YAAYpI,EAAS,CACjB,KAAK,QAAUA,CACnB,CACA,IAAI,eAAgB,CAChB,OAAO,KAAK,QAAQ,cAAc,aACtC,CACA,IAAI,UAAW,CACX,MAAO,CAAC,GAAG,KAAK,QAAQ,QAAQ,CACpC,CACA,UAAU6B,EAAQ,CACd,OAAO,KAAK,oBAAoBA,CAAM,GAAK,IAC/C,CACA,oBAAoBA,EAAQ,CACxB,OAAOA,EAAS,KAAK,QAAQ,cAAc,QAAQA,gBAAqBA,KAAU,EAAI,IAC1F,CACA,IAAI,aAAc,CACd,OAAO,KAAK,QAAQ,WACxB,CACA,IAAI,2BAA4B,CAC5B,IAAMwG,EAAwB,wEAC9B,QAAWrI,KAAW,KAAK,QAAQ,iBAAiB,aAAa,EAC7D,GAAIA,EAAQ,QAAQqI,CAAqB,GAAK,KAC1C,OAAOrI,EAIf,OAAO,IACX,CACA,IAAI,mBAAoB,CACpB,OAAOsI,GAA0B,KAAK,OAAO,CACjD,CACA,wBAAwBC,EAAI,CACxB,OAAOC,GAAwB,KAAK,QAASD,CAAE,CACnD,CACA,kCAAkCE,EAAU,CACxC,IAAMC,EAAsB,CAAC,EAC7B,QAAWC,KAA2B,KAAK,kBAAmB,CAC1D,GAAM,CAAE,GAAAJ,CAAG,EAAII,EACTC,EAAsBH,EAAS,wBAAwBF,CAAE,EAC3DK,IACAF,EAAoBH,GAAM,CAACI,EAAyBC,CAAmB,EAE/E,CACA,OAAOF,CACX,CACJ,EACA,SAASF,GAAwBK,EAAMN,EAAI,CACvC,OAAOM,EAAK,cAAc,IAAIN,yBAA0B,CAC5D,CACA,SAASD,GAA0BO,EAAM,CACrC,OAAOA,EAAK,iBAAiB,4BAA4B,CAC7D,CAEA,IAAMC,GAAN,KAAyB,CACrB,YAAYrD,EAAUsD,EAAa,CAC/B,KAAK,QAAU,GACf,KAAK,eAAiB,IAAM,CACxB,KAAK,YAAY,oBAAoB,SAAU,KAAK,cAAe,EAAK,EACxE,KAAK,YAAY,iBAAiB,SAAU,KAAK,cAAe,EAAK,CACzE,EACA,KAAK,cAAkB5I,GAAU,CAC7B,GAAI,CAACA,EAAM,iBAAkB,CACzB,IAAMX,EAAOW,EAAM,kBAAkB,gBAAkBA,EAAM,OAAS,OAChEb,EAAYa,EAAM,WAAa,OACjCX,GACAwJ,GAA+BxJ,EAAMF,CAAS,GAC9C2J,GAA8BzJ,EAAMF,CAAS,GAC7C,KAAK,SAAS,eAAeE,EAAMF,CAAS,IAC5Ca,EAAM,eAAe,EACrBA,EAAM,yBAAyB,EAC/B,KAAK,SAAS,cAAcX,EAAMF,CAAS,EAEnD,CACJ,EACA,KAAK,SAAWmG,EAChB,KAAK,YAAcsD,CACvB,CACA,OAAQ,CACC,KAAK,UACN,KAAK,YAAY,iBAAiB,SAAU,KAAK,eAAgB,EAAI,EACrE,KAAK,QAAU,GAEvB,CACA,MAAO,CACC,KAAK,UACL,KAAK,YAAY,oBAAoB,SAAU,KAAK,eAAgB,EAAI,EACxE,KAAK,QAAU,GAEvB,CACJ,EACA,SAASC,GAA+BxJ,EAAMF,EAAW,CAErD,OADsEA,GAAU,aAAa,YAAY,GAAME,EAAK,aAAa,QAAQ,IACxH,QACrB,CACA,SAASyJ,GAA8BzJ,EAAMF,EAAW,CACpD,IAAMS,EAAgET,GAAU,aAAa,YAAY,GAAME,EAAK,OACpH,QAAWQ,KAAW,SAAS,kBAAkBD,CAAM,EACnD,GAAIC,aAAmB,kBACnB,MAAO,GAEf,MAAO,EACX,CAEA,IAAMkJ,GAAN,KAAW,CACP,YAAYzD,EAAUzF,EAAS,CAC3B,KAAK,qBAAwB2F,GAAW,CAAE,EAC1C,KAAK,2BAA8BA,GAAW,CAAE,EAChD,KAAK,SAAWF,EAChB,KAAK,QAAUzF,CACnB,CACA,eAAe6B,EAAQ,CACnB,IAAM7B,EAAU,KAAK,SAAS,oBAAoB6B,CAAM,EACpD7B,GACA,KAAK,gBAAgBA,CAAO,EAC5B,KAAK,aAAaA,CAAO,GAGzB,KAAK,iBAAiB,CAAE,EAAG,EAAG,EAAG,CAAE,CAAC,CAE5C,CACA,2BAA2B0B,EAAU,CACjC,KAAK,eAAeb,GAAUa,CAAQ,CAAC,CAC3C,CACA,gBAAgB1B,EAAS,CACrBA,EAAQ,eAAe,CAC3B,CACA,aAAaA,EAAS,CACdA,aAAmB,cACfA,EAAQ,aAAa,UAAU,EAC/BA,EAAQ,MAAM,GAGdA,EAAQ,aAAa,WAAY,IAAI,EACrCA,EAAQ,MAAM,EACdA,EAAQ,gBAAgB,UAAU,GAG9C,CACA,iBAAiB,CAAE,EAAAmJ,EAAG,EAAAC,CAAE,EAAG,CACvB,KAAK,WAAW,SAASD,EAAGC,CAAC,CACjC,CACA,aAAc,CACV,KAAK,iBAAiB,CAAE,EAAG,EAAG,EAAG,CAAE,CAAC,CACxC,CACA,IAAI,YAAa,CACb,OAAO,MACX,CACA,MAAM,OAAOC,EAAU,CACnB,GAAM,CAAE,UAAAC,EAAW,aAAAC,EAAc,YAAad,CAAS,EAAIY,EAC3D,GAAIE,EACA,GAAI,CACA,KAAK,cAAgB,IAAI,QAASjG,GAAa,KAAK,qBAAuBA,CAAQ,EACnF,KAAK,SAAW+F,EAChB,MAAM,KAAK,wBAAwBA,CAAQ,EAC3C,IAAMG,EAAqB,IAAI,QAASlG,GAAa,KAAK,2BAA6BA,CAAQ,EACzFmG,EAAU,CAAE,OAAQ,KAAK,2BAA4B,OAAQ,KAAK,SAAS,aAAc,EACvE,KAAK,SAAS,sBAAsBhB,EAAUgB,CAAO,GAEzE,MAAMD,EACV,MAAM,KAAK,eAAeH,CAAQ,EAClC,KAAK,SAAS,qBAAqBZ,EAAUa,CAAS,EACtD,KAAK,SAAS,0BAA0B,KAAK,OAAO,EACpD,KAAK,wBAAwBD,CAAQ,CACzC,QACA,CACI,OAAO,KAAK,SACZ,KAAK,qBAAqB,MAAS,EACnC,OAAO,KAAK,aAChB,MAGA,KAAK,WAAWA,EAAS,YAAY,CAE7C,CACA,WAAWK,EAAQ,CACf,KAAK,SAAS,gBAAgBA,CAAM,CACxC,CACA,MAAM,wBAAwBL,EAAU,CACpC,KAAK,cAAcA,EAAS,SAAS,EACrC,MAAMA,EAAS,gBAAgB,CACnC,CACA,cAAcC,EAAW,CACjBA,EACA,KAAK,QAAQ,aAAa,qBAAsB,EAAE,EAGlD,KAAK,QAAQ,gBAAgB,oBAAoB,CAEzD,CACA,MAAM,eAAeD,EAAU,CAC3B,MAAMA,EAAS,OAAO,CAC1B,CACA,wBAAwBA,EAAU,CAC9BA,EAAS,gBAAgB,CAC7B,CACJ,EAEMM,GAAN,cAAwBT,EAAK,CACzB,YAAa,CACT,KAAK,QAAQ,UAAY,EAC7B,CACA,IAAI,UAAW,CACX,OAAO,IAAId,GAAS,KAAK,OAAO,CACpC,CACJ,EAEMwB,GAAN,KAAsB,CAClB,YAAYnE,EAAUzF,EAAS,CAC3B,KAAK,aAAgBG,GAAU,CACvB,KAAK,sBAAsBA,EAAM,MAAM,EACvC,KAAK,WAAaA,EAGlB,OAAO,KAAK,UAEpB,EACA,KAAK,YAAgBA,GAAU,CACvB,KAAK,YAAc,KAAK,sBAAsBA,EAAM,MAAM,GAAKA,EAAM,kBAAkB,SACnF,KAAK,SAAS,yBAAyBA,EAAM,OAAQA,EAAM,OAAO,IAAKA,EAAM,OAAO,aAAa,IACjG,KAAK,WAAW,eAAe,EAC/BA,EAAM,eAAe,EACrB,KAAK,SAAS,qBAAqBA,EAAM,OAAQA,EAAM,OAAO,IAAKA,EAAM,OAAO,aAAa,GAGrG,OAAO,KAAK,UAChB,EACA,KAAK,UAAc0J,GAAW,CAC1B,OAAO,KAAK,UAChB,EACA,KAAK,SAAWpE,EAChB,KAAK,QAAUzF,CACnB,CACA,OAAQ,CACJ,KAAK,QAAQ,iBAAiB,QAAS,KAAK,YAAY,EACxD,SAAS,iBAAiB,cAAe,KAAK,WAAW,EACzD,SAAS,iBAAiB,qBAAsB,KAAK,SAAS,CAClE,CACA,MAAO,CACH,KAAK,QAAQ,oBAAoB,QAAS,KAAK,YAAY,EAC3D,SAAS,oBAAoB,cAAe,KAAK,WAAW,EAC5D,SAAS,oBAAoB,qBAAsB,KAAK,SAAS,CACrE,CACA,sBAAsBD,EAAQ,CAC1B,IAAMC,EAAUD,aAAkB,QAAUA,EAASA,aAAkB,KAAOA,EAAO,cAAgB,KACrG,OAAOC,GAAWA,EAAQ,QAAQ,mBAAmB,GAAK,KAAK,OACnE,CACJ,EAEM8J,GAAN,KAAwB,CACpB,YAAYrE,EAAUsD,EAAa,CAC/B,KAAK,QAAU,GACf,KAAK,cAAgB,IAAM,CACvB,KAAK,YAAY,oBAAoB,QAAS,KAAK,aAAc,EAAK,EACtE,KAAK,YAAY,iBAAiB,QAAS,KAAK,aAAc,EAAK,CACvE,EACA,KAAK,aAAgB5I,GAAU,CAC3B,GAAIA,aAAiB,YAAc,KAAK,wBAAwBA,CAAK,EAAG,CACpE,IAAMJ,EAAUI,EAAM,cAAgBA,EAAM,aAAa,EAAE,IAAOA,EAAM,OAClE4J,EAAO,KAAK,wBAAwBhK,CAAM,EAChD,GAAIgK,GAAQC,GAAoBD,CAAI,EAAG,CACnC,IAAMrI,EAAW,KAAK,mBAAmBqI,CAAI,EACzC,KAAK,SAAS,yBAAyBA,EAAMrI,EAAUvB,CAAK,IAC5DA,EAAM,eAAe,EACrB,KAAK,SAAS,uBAAuB4J,EAAMrI,CAAQ,EAE3D,CACJ,CACJ,EACA,KAAK,SAAW+D,EAChB,KAAK,YAAcsD,CACvB,CACA,OAAQ,CACC,KAAK,UACN,KAAK,YAAY,iBAAiB,QAAS,KAAK,cAAe,EAAI,EACnE,KAAK,QAAU,GAEvB,CACA,MAAO,CACC,KAAK,UACL,KAAK,YAAY,oBAAoB,QAAS,KAAK,cAAe,EAAI,EACtE,KAAK,QAAU,GAEvB,CACA,wBAAwB5I,EAAO,CAC3B,MAAO,EAAGA,EAAM,QAAUA,EAAM,OAAO,mBACnCA,EAAM,kBACNA,EAAM,MAAQ,GACdA,EAAM,QACNA,EAAM,SACNA,EAAM,SACNA,EAAM,SACd,CACA,wBAAwBJ,EAAQ,CAC5B,GAAIA,aAAkB,QAClB,OAAOA,EAAO,QAAQ,0CAA0C,CAExE,CACA,mBAAmBgK,EAAM,CACrB,OAAOpJ,GAAUoJ,EAAK,aAAa,MAAM,GAAK,EAAE,CACpD,CACJ,EACA,SAASC,GAAoBnI,EAAQ,CACjC,QAAW7B,KAAW,SAAS,kBAAkB6B,EAAO,MAAM,EAC1D,GAAI7B,aAAmB,kBACnB,MAAO,GAEf,MAAO,EACX,CAEA,IAAMiK,GAAN,KAA4B,CACxB,YAAYxE,EAAUzF,EAAS,CAC3B,KAAK,SAAWyF,EAChB,KAAK,gBAAkB,IAAIqE,GAAkB,KAAM9J,CAAO,CAC9D,CACA,OAAQ,CACJ,KAAK,gBAAgB,MAAM,CAC/B,CACA,MAAO,CACH,KAAK,gBAAgB,KAAK,CAC9B,CACA,yBAAyB+J,EAAMrI,EAAUwI,EAAe,CACpD,OAAQ,KAAK,SAAS,6BAA6BH,EAAMrI,EAAUwI,CAAa,GAC5EH,EAAK,aAAa,mBAAmB,CAC7C,CACA,uBAAuBA,EAAMrI,EAAU,CACnC,IAAMT,EAASS,EAAS,KAClBlC,EAAO,SAAS,cAAc,MAAM,EAC1CA,EAAK,aAAa,aAAc,MAAM,EACtCA,EAAK,aAAa,SAAUyB,CAAM,EAClCzB,EAAK,aAAa,SAAU,EAAE,EAC9B,IAAM+F,EAASwE,EAAK,aAAa,mBAAmB,EAChDxE,GACA/F,EAAK,aAAa,SAAU+F,CAAM,EACtC,IAAM4E,EAAaJ,EAAK,aAAa,kBAAkB,EACnDI,GACA3K,EAAK,aAAa,mBAAoB2K,CAAU,EACpD,IAAMC,EAAcL,EAAK,aAAa,mBAAmB,EACrDK,GACA5K,EAAK,aAAa,oBAAqB4K,CAAW,EACtD,IAAMC,EAAeN,EAAK,aAAa,oBAAoB,EACvDM,GACA7K,EAAK,aAAa,qBAAsB6K,CAAY,EACpCN,EAAK,aAAa,mBAAmB,GAErDvK,EAAK,aAAa,oBAAqB,EAAE,EAC7C,KAAK,SAAS,4BAA4BuK,EAAMrI,EAAUlC,CAAI,EAC9D,SAAS,KAAK,YAAYA,CAAI,EAC9BA,EAAK,iBAAiB,mBAAoB,IAAMA,EAAK,OAAO,EAAG,CAAE,KAAM,EAAK,CAAC,EAC7E,sBAAsB,IAAMA,EAAK,cAAc,CAAC,CACpD,CACJ,EAEM8K,GAAN,KAAY,CACR,YAAY7E,EAAUiD,EAAqB,CACvC,KAAK,SAAWjD,EAChB,KAAK,oBAAsBiD,CAC/B,CACA,OAAO,4BAA4BjD,EAAUiD,EAAqB6B,EAAU,CACxE,IAAMC,EAAQ,IAAI,KAAK/E,EAAUiD,CAAmB,EACpD8B,EAAM,MAAM,EACZD,EAAS,EACTC,EAAM,MAAM,CAChB,CACA,OAAQ,CACJ,QAAWjC,KAAM,KAAK,oBAAqB,CACvC,GAAM,CAACI,EAAyBC,CAAmB,EAAI,KAAK,oBAAoBL,GAChF,KAAK,SAAS,cAAcI,EAAyBC,CAAmB,EACxE,KAAK,0CAA0CA,CAAmB,CACtE,CACJ,CACA,OAAQ,CACJ,QAAWL,KAAM,KAAK,oBAAqB,CACvC,GAAM,CAACI,CAAuB,EAAI,KAAK,oBAAoBJ,GAC3D,KAAK,wCAAwCI,CAAuB,EACpE,KAAK,uCAAuCA,CAAuB,EACnE,KAAK,SAAS,aAAaA,CAAuB,CACtD,CACJ,CACA,0CAA0C8B,EAAkB,CACxD,IAAMC,EAAcC,GAAqCF,CAAgB,EACzEA,EAAiB,YAAYC,CAAW,CAC5C,CACA,wCAAwCD,EAAkB,CACtD,IAAMG,EAAQH,EAAiB,UAAU,EAAI,EAC7CA,EAAiB,YAAYG,CAAK,CACtC,CACA,uCAAuCH,EAAkB,CACrD,IAAMC,EAAc,KAAK,mBAAmBD,EAAiB,EAAE,EACLC,GAAY,YAAYD,CAAgB,CACtG,CACA,mBAAmBlC,EAAI,CACnB,OAAO,KAAK,aAAa,KAAMvI,GAAYA,EAAQ,SAAWuI,CAAE,CACpE,CACA,IAAI,cAAe,CACf,MAAO,CAAC,GAAG,SAAS,iBAAiB,iDAAiD,CAAC,CAC3F,CACJ,EACA,SAASoC,GAAqCF,EAAkB,CAC5D,IAAMzK,EAAU,SAAS,cAAc,MAAM,EAC7C,OAAAA,EAAQ,aAAa,OAAQ,6BAA6B,EAC1DA,EAAQ,aAAa,UAAWyK,EAAiB,EAAE,EAC5CzK,CACX,CAEA,IAAM6K,GAAN,KAAe,CACX,YAAYC,EAAiBC,EAAaC,EAAe1B,EAAW2B,EAAa,GAAM,CACnF,KAAK,cAAgB,KACrB,KAAK,gBAAkBH,EACvB,KAAK,YAAcC,EACnB,KAAK,UAAYzB,EACjB,KAAK,WAAa2B,EAClB,KAAK,cAAgBD,EACrB,KAAK,QAAU,IAAI,QAAQ,CAAC1H,EAAS4H,IAAY,KAAK,mBAAqB,CAAE,QAAA5H,EAAS,OAAA4H,CAAO,CAAE,CACnG,CACA,IAAI,cAAe,CACf,MAAO,EACX,CACA,IAAI,cAAe,CAEnB,CACA,iBAAkB,CAElB,CACA,iBAAkB,CACV,KAAK,qBACL,KAAK,mBAAmB,QAAQ,EAChC,OAAO,KAAK,mBAEpB,CACA,4BAA4BX,EAAU,CAClCD,GAAM,4BAA4B,KAAM,KAAK,oBAAqBC,CAAQ,CAC9E,CACA,gCAAiC,CAC7B,IAAMvK,EAAU,KAAK,kBAAkB,0BACnCmL,GAAmBnL,CAAO,GAC1BA,EAAQ,MAAM,CAEtB,CACA,cAAc2I,EAAyB,CAC/B,KAAK,eAELA,EAAwB,SAAS,KAAK,gBAAgB,aAAa,IACnE,KAAK,cAAgB,KAAK,gBAAgB,cAElD,CACA,aAAaA,EAAyB,CAC9BA,EAAwB,SAAS,KAAK,aAAa,GAAK,KAAK,yBAAyB,cACtF,KAAK,cAAc,MAAM,EACzB,KAAK,cAAgB,KAE7B,CACA,IAAI,mBAAoB,CACpB,OAAO,KAAK,YAAY,YAAc,KAAK,YAAc,KAAK,eAClE,CACA,IAAI,gBAAiB,CACjB,OAAO,KAAK,gBAAgB,OAChC,CACA,IAAI,YAAa,CACb,OAAO,KAAK,YAAY,OAC5B,CACA,IAAI,qBAAsB,CACtB,OAAO,KAAK,gBAAgB,kCAAkC,KAAK,WAAW,CAClF,CACJ,EACA,SAASwC,GAAmBnL,EAAS,CACjC,OAAOA,GAAW,OAAOA,EAAQ,OAAS,UAC9C,CAEA,IAAMoL,GAAN,cAA4BP,EAAS,CACjC,YAAYpF,EAAUqF,EAAiBC,EAAaC,EAAe1B,EAAW2B,EAAa,GAAM,CAC7F,MAAMH,EAAiBC,EAAaC,EAAe1B,EAAW2B,CAAU,EACxE,KAAK,SAAWxF,CACpB,CACA,OAAO,cAAc4F,EAAgBC,EAAY,CAC7C,IAAI9K,EACJ,IAAM+K,EAAmB,SAAS,YAAY,EAC9CA,EAAiB,mBAAmBF,CAAc,EAClDE,EAAiB,eAAe,EAChC,IAAMC,EAAeF,EACfG,GAAejL,EAAKgL,EAAa,iBAAmB,MAAQhL,IAAO,OAAS,OAASA,EAAG,YAAY,EACtGiL,IACAA,EAAY,mBAAmBD,CAAY,EAC3CH,EAAe,YAAYI,EAAY,gBAAgB,CAAC,EAEhE,CACA,IAAI,cAAe,CACf,MAAO,EACX,CACA,MAAM,QAAS,CACX,MAAMpI,GAAmB,EACzB,KAAK,4BAA4B,IAAM,CACnC,KAAK,iBAAiB,CAC1B,CAAC,EACD,KAAK,oBAAoB,EACzB,MAAMA,GAAmB,EACzB,KAAK,+BAA+B,EACpC,MAAMA,GAAmB,EACzB,KAAK,uBAAuB,CAChC,CACA,kBAAmB,CACf,KAAK,SAAS,gBAAgB,KAAK,eAAgB,KAAK,UAAU,EAClE,KAAK,cAAc,KAAK,eAAgB,KAAK,UAAU,CAC3D,CACA,qBAAsB,CAClB,GAAI,KAAK,eAAe,YAAc,KAAK,WAAW,WAAY,CAC9D,IAAMrD,EAAU,KAAK,eAAe,kBAC9B0L,EAAQC,GAA0B,KAAK,eAAe,aAAa,uBAAuB,EAAG,KAAK,EAClGC,EAAWC,GAAmB,KAAK,eAAe,aAAa,0BAA0B,EAAG,MAAM,EACxG,GAAI7L,EACA,OAAAA,EAAQ,eAAe,CAAE,MAAA0L,EAAO,SAAAE,CAAS,CAAC,EACnC,EAEf,CACA,MAAO,EACX,CACA,wBAAyB,CACrB,QAAWpF,KAAsB,KAAK,kBAAmB,CACrD,IAAMsF,EAAyBvJ,GAAsBiE,CAAkB,EACvEA,EAAmB,YAAYsF,CAAsB,CACzD,CACJ,CACA,IAAI,mBAAoB,CACpB,OAAO,KAAK,eAAe,iBAAiB,QAAQ,CACxD,CACJ,EACA,SAASH,GAA0BrL,EAAOyL,EAAc,CACpD,OAAIzL,GAAS,OAASA,GAAS,SAAWA,GAAS,UAAYA,GAAS,UAC7DA,EAGAyL,CAEf,CACA,SAASF,GAAmBvL,EAAOyL,EAAc,CAC7C,OAAIzL,GAAS,QAAUA,GAAS,SACrBA,EAGAyL,CAEf,CAEA,IAAMC,GAAN,KAAkB,CACd,aAAc,CACV,KAAK,OAAS,GACd,KAAK,MAAQ,EACb,KAAK,QAAU,GACf,KAAK,QAAU,IAAM,CACjB,KAAK,SAAS,KAAK,MAAQ,KAAK,OAAO,EAAI,GAAG,CAClD,EACA,KAAK,kBAAoB,KAAK,wBAAwB,EACtD,KAAK,gBAAkB,KAAK,sBAAsB,EAClD,KAAK,yBAAyB,EAC9B,KAAK,SAAS,CAAC,CACnB,CACA,WAAW,YAAa,CACpB,OAAOtI;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,kBAUGsI,GAAY;AAAA,oBACVA,GAAY,kBAAoB,OAAOA,GAAY,kBAAoB;AAAA;AAAA;AAAA,KAIvF,CACA,MAAO,CACE,KAAK,UACN,KAAK,QAAU,GACf,KAAK,uBAAuB,EAC5B,KAAK,eAAe,EAE5B,CACA,MAAO,CACC,KAAK,SAAW,CAAC,KAAK,SACtB,KAAK,OAAS,GACd,KAAK,oBAAoB,IAAM,CAC3B,KAAK,yBAAyB,EAC9B,KAAK,cAAc,EACnB,KAAK,QAAU,GACf,KAAK,OAAS,EAClB,CAAC,EAET,CACA,SAAS1L,EAAO,CACZ,KAAK,MAAQA,EACb,KAAK,QAAQ,CACjB,CACA,0BAA2B,CACvB,SAAS,KAAK,aAAa,KAAK,kBAAmB,SAAS,KAAK,UAAU,CAC/E,CACA,wBAAyB,CACrB,KAAK,gBAAgB,MAAM,MAAQ,IACnC,KAAK,gBAAgB,MAAM,QAAU,IACrC,SAAS,gBAAgB,aAAa,KAAK,gBAAiB,SAAS,IAAI,EACzE,KAAK,QAAQ,CACjB,CACA,oBAAoBiK,EAAU,CAC1B,KAAK,gBAAgB,MAAM,QAAU,IACrC,WAAWA,EAAUyB,GAAY,kBAAoB,GAAG,CAC5D,CACA,0BAA2B,CACnB,KAAK,gBAAgB,YACrB,SAAS,gBAAgB,YAAY,KAAK,eAAe,CAEjE,CACA,gBAAiB,CACR,KAAK,kBACN,KAAK,gBAAkB,OAAO,YAAY,KAAK,QAASA,GAAY,iBAAiB,EAE7F,CACA,eAAgB,CACZ,OAAO,cAAc,KAAK,eAAe,EACzC,OAAO,KAAK,eAChB,CACA,SAAU,CACN,sBAAsB,IAAM,CACxB,KAAK,gBAAgB,MAAM,MAAQ,GAAG,GAAK,KAAK,MAAQ,KAC5D,CAAC,CACL,CACA,yBAA0B,CACtB,IAAMhM,EAAU,SAAS,cAAc,OAAO,EAC9C,OAAAA,EAAQ,KAAO,WACfA,EAAQ,YAAcgM,GAAY,WAC9B,KAAK,WACLhM,EAAQ,MAAQ,KAAK,UAElBA,CACX,CACA,uBAAwB,CACpB,IAAMA,EAAU,SAAS,cAAc,KAAK,EAC5C,OAAAA,EAAQ,UAAY,qBACbA,CACX,CACA,IAAI,UAAW,CACX,OAAO0C,GAAe,WAAW,CACrC,CACJ,EACAsJ,GAAY,kBAAoB,IAEhC,IAAMC,GAAN,cAA2B7D,EAAS,CAChC,aAAc,CACV,MAAM,GAAG,SAAS,EAClB,KAAK,mBAAqB,KAAK,SAC1B,OAAQpI,GAAY,CAACkM,GAAkBlM,CAAO,CAAC,EAC/C,IAAKA,GAAYmM,GAAoBnM,CAAO,CAAC,EAC7C,OAAO,CAACkE,EAAQlE,IAAY,CAC7B,GAAM,CAAE,UAAAoM,CAAU,EAAIpM,EAChBqM,EAAUD,KAAalI,EACvBA,EAAOkI,GACP,CACE,KAAME,GAAYtM,CAAO,EACzB,QAASuM,GAAiBvM,CAAO,EACjC,SAAU,CAAC,CACf,EACJ,OAAO,OAAO,OAAO,OAAO,OAAO,CAAC,EAAGkE,CAAM,EAAG,CAAE,CAACkI,GAAY,OAAO,OAAO,OAAO,OAAO,CAAC,EAAGC,CAAO,EAAG,CAAE,SAAU,CAAC,GAAGA,EAAQ,SAAUrM,CAAO,CAAE,CAAC,CAAE,CAAC,CAC5J,EAAG,CAAC,CAAC,CACT,CACA,IAAI,yBAA0B,CAC1B,OAAO,OAAO,KAAK,KAAK,kBAAkB,EACrC,OAAQoM,GAAc,KAAK,mBAAmBA,GAAW,OAAO,EAChE,KAAK,EAAE,CAChB,CACA,+BAA+B3D,EAAU,CACrC,OAAO,KAAK,qCAAqC,SAAUA,CAAQ,CACvE,CACA,mCAAmCA,EAAU,CACzC,OAAO,KAAK,qCAAqC,aAAcA,CAAQ,CAC3E,CACA,qCAAqC+D,EAAa/D,EAAU,CACxD,OAAO,OAAO,KAAK,KAAK,kBAAkB,EACrC,OAAQ2D,GAAc,EAAEA,KAAa3D,EAAS,mBAAmB,EACjE,IAAK2D,GAAc,KAAK,mBAAmBA,EAAU,EACrD,OAAO,CAAC,CAAE,KAAAK,CAAK,IAAMA,GAAQD,CAAW,EACxC,IAAI,CAAC,CAAE,SAAU,CAACxM,CAAO,CAAE,IAAMA,CAAO,CACjD,CACA,IAAI,qBAAsB,CACtB,OAAO,OAAO,KAAK,KAAK,kBAAkB,EAAE,OAAO,CAACkE,EAAQkI,IAAc,CACtE,GAAM,CAAE,KAAAK,EAAM,QAAAC,EAAS,SAAAjI,CAAS,EAAI,KAAK,mBAAmB2H,GAC5D,OAAIK,GAAQ,MAAQ,CAACC,EACV,CAAC,GAAGxI,EAAQ,GAAGO,CAAQ,EAEzBA,EAAS,OAAS,EAChB,CAAC,GAAGP,EAAQ,GAAGO,EAAS,MAAM,CAAC,CAAC,EAGhCP,CAEf,EAAG,CAAC,CAAC,CACT,CACA,aAAatE,EAAM,CACf,IAAMI,EAAU,KAAK,sBAAsBJ,CAAI,EAC/C,OAAOI,EAAUA,EAAQ,aAAa,SAAS,EAAI,IACvD,CACA,sBAAsBJ,EAAM,CACxB,OAAO,OAAO,KAAK,KAAK,kBAAkB,EAAE,OAAO,CAACsE,EAAQkI,IAAc,CACtE,GAAM,CAAE,SAAU,CAACpM,CAAO,CAAG,EAAI,KAAK,mBAAmBoM,GACzD,OAAOO,GAA6B3M,EAASJ,CAAI,EAAII,EAAUkE,CACnE,EAAG,MAAS,CAChB,CACJ,EACA,SAASoI,GAAYtM,EAAS,CAC1B,GAAI4M,GAAgB5M,CAAO,EACvB,MAAO,SAEN,GAAI6M,GAAoB7M,CAAO,EAChC,MAAO,YAEf,CACA,SAASuM,GAAiBvM,EAAS,CAC/B,OAAOA,EAAQ,aAAa,kBAAkB,GAAK,QACvD,CACA,SAAS4M,GAAgB5M,EAAS,CAE9B,OADgBA,EAAQ,WACN,QACtB,CACA,SAASkM,GAAkBlM,EAAS,CAEhC,OADgBA,EAAQ,WACN,UACtB,CACA,SAAS6M,GAAoB7M,EAAS,CAClC,IAAM8M,EAAU9M,EAAQ,UACxB,OAAO8M,GAAW,SAAYA,GAAW,QAAU9M,EAAQ,aAAa,KAAK,GAAK,YACtF,CACA,SAAS2M,GAA6B3M,EAASJ,EAAM,CAEjD,OADgBI,EAAQ,WACN,QAAUA,EAAQ,aAAa,MAAM,GAAKJ,CAChE,CACA,SAASuM,GAAoBnM,EAAS,CAClC,OAAIA,EAAQ,aAAa,OAAO,GAC5BA,EAAQ,aAAa,QAAS,EAAE,EAE7BA,CACX,CAEA,IAAM+M,GAAN,cAA2B3E,EAAS,CAChC,YAAYpI,EAASgN,EAAc,CAC/B,MAAMhN,CAAO,EACb,KAAK,aAAegN,CACxB,CACA,OAAO,eAAejK,EAAO,GAAI,CAC7B,OAAO,KAAK,aAAaU,GAAkBV,CAAI,CAAC,CACpD,CACA,OAAO,YAAY/C,EAAS,CACxB,OAAO,KAAK,aAAaA,EAAQ,aAAa,CAClD,CACA,OAAO,aAAa,CAAE,KAAAiN,EAAM,KAAAvH,CAAK,EAAG,CAChC,OAAO,IAAI,KAAKA,EAAM,IAAIuG,GAAagB,CAAI,CAAC,CAChD,CACA,OAAQ,CACJ,IAAMC,EAAgB,KAAK,QAAQ,UAAU,EAAI,EAC3CC,EAAiB,KAAK,QAAQ,iBAAiB,QAAQ,EACvDC,EAAuBF,EAAc,iBAAiB,QAAQ,EACpE,OAAW,CAACG,EAAOC,CAAM,IAAKH,EAAe,QAAQ,EAAG,CACpD,IAAMvC,EAAQwC,EAAqBC,GACnC,QAAWE,KAAU3C,EAAM,gBACvB2C,EAAO,SAAW,GACtB,QAAWA,KAAUD,EAAO,gBACxB1C,EAAM,QAAQ2C,EAAO,OAAO,SAAW,EAC/C,CACA,QAAWC,KAAuBN,EAAc,iBAAiB,wBAAwB,EACrFM,EAAoB,MAAQ,GAEhC,OAAO,IAAIT,GAAaG,EAAe,KAAK,YAAY,CAC5D,CACA,IAAI,aAAc,CACd,OAAO,KAAK,aAAa,OAC7B,CACA,IAAI,cAAe,CACf,IAAI1M,EACJ,IAAMiN,GAAQjN,EAAK,KAAK,WAAW,MAAM,KAAO,MAAQA,IAAO,OAASA,EAAK,IAC7E,OAAOG,GAAU8M,CAAI,CACzB,CACA,IAAI,mBAAoB,CACpB,OAAO,KAAK,WAAW,eAAe,CAC1C,CACA,IAAI,eAAgB,CAChB,OAAO,KAAK,mBAAqB,YACrC,CACA,IAAI,aAAc,CACd,OAAO,KAAK,mBAAqB,UACrC,CACA,IAAI,aAAc,CACd,OAAO,KAAK,WAAW,eAAe,GAAK,QAC/C,CACA,WAAW7N,EAAM,CACb,OAAO,KAAK,aAAa,aAAa,SAASA,GAAM,CACzD,CACJ,EAEI8N,IACH,SAAUA,EAAc,CACrBA,EAAa,WAAgB,aAC7BA,EAAa,aAAkB,eAC/BA,EAAa,WAAgB,aAC7BA,EAAa,SAAc,UAC/B,GAAGA,KAAiBA,GAAe,CAAC,EAAE,EACtC,IAAIC,IACH,SAAUA,EAAY,CACnBA,EAAW,YAAiB,cAC5BA,EAAW,QAAa,UACxBA,EAAW,SAAc,WACzBA,EAAW,OAAY,SACvBA,EAAW,UAAe,WAC9B,GAAGA,KAAeA,GAAa,CAAC,EAAE,EAClC,IAAMC,GAAiB,CACnB,OAAQ,UACR,eAAgB,GAChB,oBAAqB,IAAM,CAAE,EAC7B,WAAY,GACZ,cAAe,GACf,oBAAqB,GACrB,sBAAuB,EAC3B,EACIC,IACH,SAAUA,EAAkB,CACzBA,EAAiBA,EAAiB,eAAoB,GAAK,iBAC3DA,EAAiBA,EAAiB,eAAoB,IAAM,iBAC5DA,EAAiBA,EAAiB,oBAAyB,IAAM,qBACrE,GAAGA,KAAqBA,GAAmB,CAAC,EAAE,EAC9C,IAAMC,GAAN,KAAY,CACR,YAAYrI,EAAU/D,EAAUqM,EAAuBtE,EAAU,CAAC,EAAG,CACjE,KAAK,WAAapF,GAAK,EACvB,KAAK,cAAgB,CAAC,EACtB,KAAK,iBAAmB,GACxB,KAAK,eAAiB,GACtB,KAAK,SAAW,GAChB,KAAK,oBAAsB,GAC3B,KAAK,sBAAwB,GAC7B,KAAK,eAAiB,GACtB,KAAK,MAAQsJ,GAAW,YACxB,KAAK,SAAWlI,EAChB,KAAK,SAAW/D,EAChB,KAAK,sBAAwBqM,GAAyB1J,GAAK,EAC3D,GAAM,CAAE,OAAApD,EAAQ,eAAA+M,EAAgB,SAAAC,EAAU,SAAAxF,EAAU,aAAAyF,EAAc,SAAA7L,EAAU,oBAAA8L,EAAqB,WAAAlD,EAAY,cAAAmD,EAAe,oBAAAC,EAAqB,sBAAAC,CAAuB,EAAI,OAAO,OAAO,OAAO,OAAO,CAAC,EAAGV,EAAc,EAAGnE,CAAO,EACpO,KAAK,OAASxI,EACd,KAAK,eAAiB+M,EACtB,KAAK,SAAWC,EAChB,KAAK,SAAWxF,EAChB,KAAK,aAAeyF,EACpB,KAAK,SAAW7L,EAChB,KAAK,WAAa,KAAK,SAAS,6BAA6B,KAAK,SAAU,KAAK,MAAM,EACvF,KAAK,oBAAsB8L,EAC3B,KAAK,WAAalD,EAClB,KAAK,cAAgBmD,EACrB,KAAK,SAAW,CAACnD,EACjB,KAAK,oBAAsBoD,EAC3B,KAAK,sBAAwBC,CACjC,CACA,IAAI,SAAU,CACV,OAAO,KAAK,SAAS,OACzB,CACA,IAAI,MAAO,CACP,OAAO,KAAK,SAAS,IACzB,CACA,IAAI,SAAU,CACV,OAAO,KAAK,SAAS,OACzB,CACA,IAAI,iBAAkB,CAClB,OAAO,KAAK,QAAQ,gCAAgC,KAAK,qBAAqB,CAClF,CACA,IAAI,QAAS,CACT,OAAO,KAAK,UAChB,CACA,OAAQ,CACA,KAAK,OAASX,GAAW,cACzB,KAAK,mBAAmBD,GAAa,UAAU,EAC/C,KAAK,MAAQC,GAAW,QACxB,KAAK,QAAQ,aAAa,IAAI,EAC9B,KAAK,SAAS,aAAa,IAAI,EAEvC,CACA,QAAS,CACD,KAAK,OAASA,GAAW,UACrB,KAAK,SACL,KAAK,QAAQ,OAAO,EAExB,KAAK,aAAa,EAClB,KAAK,MAAQA,GAAW,SAEhC,CACA,UAAW,CACH,KAAK,OAASA,GAAW,UACzB,KAAK,mBAAmBD,GAAa,QAAQ,EAC7C,KAAK,MAAQC,GAAW,UACxB,KAAK,eAAe,EACf,KAAK,mBACN,KAAK,QAAQ,eAAe,IAAI,EAChC,KAAK,SAAS,eAAe,IAAI,GAG7C,CACA,MAAO,CACC,KAAK,OAASA,GAAW,UACzB,KAAK,MAAQA,GAAW,OACxB,KAAK,QAAQ,YAAY,IAAI,EAErC,CACA,eAAgB,CACZ,IAAInN,EACJ,GAAI,CAAC,KAAK,gBAAkB,KAAK,cAAe,CAC5C,IAAM+N,EAAmB,KAAK,SAAS,SAAW/N,EAAK,KAAK,YAAc,MAAQA,IAAO,OAAS,OAASA,EAAG,MAAQ,UAAY,KAAK,OACjI+E,EAASP,GAA0BuJ,CAAgB,EACzD,KAAK,QAAQ,OAAOhJ,EAAQ,KAAK,SAAU,KAAK,qBAAqB,EACrE,KAAK,eAAiB,EAC1B,CACJ,CACA,cAAe,CACP,KAAK,qBAAqB,EAC1B,KAAK,gBAAgB,EAEhB,KAAK,mBAAmB,GAAK,CAAC,KAAK,UACxC,KAAK,QAAU,IAAIC,GAAa,KAAMH,GAAY,IAAK,KAAK,QAAQ,EACpE,KAAK,QAAQ,QAAQ,EAE7B,CACA,iBAAkB,CACV,KAAK,WACL,KAAK,aAAa,EAClB,KAAK,eAAe,EACpB,KAAK,cAAc,EAE3B,CACA,cAAe,CACX,KAAK,mBAAmBqI,GAAa,YAAY,EACjD,KAAK,QAAQ,oBAAoB,IAAI,CACzC,CACA,eAAerL,EAAW,KAAK,SAAU,CAErC,GADA,KAAK,SAAWA,EACZA,EAAU,CACV,GAAM,CAAE,WAAAmM,CAAW,EAAInM,EACnBoM,GAAaD,CAAU,EACvB,KAAK,QAAQ,sBAAsB,IAAI,EAGvC,KAAK,QAAQ,iCAAiC,KAAMA,CAAU,CAEtE,CACJ,CACA,eAAgB,CACZ,KAAK,mBAAmBd,GAAa,UAAU,EAC/C,KAAK,QAAQ,qBAAqB,IAAI,CAC1C,CACA,cAAe,CACX,GAAI,KAAK,SAAU,CACf,GAAM,CAAE,WAAAc,EAAY,aAAAE,CAAa,EAAI,KAAK,SAC1C,KAAK,OAAO,SAAY,CAChB,KAAK,qBACL,KAAK,cAAc,EACnB,KAAK,KAAK,eACV,MAAM,KAAK,KAAK,cAChBD,GAAaD,CAAU,GAAKE,GAAgB,MAC5C,MAAM,KAAK,KAAK,WAAW3B,GAAa,eAAe2B,CAAY,EAAG,GAAO,KAAK,WAAY,IAAI,EAClG,KAAK,cAAc,EACnB,KAAK,QAAQ,cAAc,IAAI,EAC/B,KAAK,SAAS,IAGd,MAAM,KAAK,KAAK,YAAY3B,GAAa,eAAe2B,CAAY,EAAG,IAAI,EAC3E,KAAK,QAAQ,cAAc,IAAI,EAC/B,KAAK,KAAK,EAElB,CAAC,CACL,CACJ,CACA,mBAAoB,CAChB,IAAMjG,EAAW,KAAK,KAAK,6BAA6B,KAAK,QAAQ,GAAK,KAAK,qBAAqB,EACpG,GAAIA,IAAa,CAAC5H,GAAU,KAAK,QAAQ,GAAK4H,EAAS,UAAU5H,GAAU,KAAK,QAAQ,CAAC,KACjF,KAAK,QAAU,WAAa4H,EAAS,eACrC,OAAOA,CAGnB,CACA,sBAAuB,CACnB,GAAI,KAAK,aACL,OAAOsE,GAAa,eAAe,KAAK,YAAY,CAE5D,CACA,mBAAoB,CAChB,OAAO,KAAK,kBAAkB,GAAK,IACvC,CACA,oBAAqB,CACjB,IAAMtE,EAAW,KAAK,kBAAkB,EACxC,GAAIA,EAAU,CACV,IAAMa,EAAY,KAAK,mBAAmB,EAC1C,KAAK,OAAO,SAAY,CACpB,KAAK,cAAc,EACf,KAAK,WACL,KAAK,QAAQ,cAAc,IAAI,GAG3B,KAAK,KAAK,eACV,MAAM,KAAK,KAAK,cACpB,MAAM,KAAK,KAAK,WAAWb,EAAUa,EAAW,KAAK,WAAY,IAAI,EACrE,KAAK,cAAc,EACnB,KAAK,QAAQ,cAAc,IAAI,EAC1BA,GACD,KAAK,SAAS,EAG1B,CAAC,CACL,CACJ,CACA,gBAAiB,CACb,IAAI9I,EACA,KAAK,sBAAwB,CAAC,KAAK,mBAAsB,GAAAA,EAAK,KAAK,YAAc,MAAQA,IAAO,SAAkBA,EAAG,cACrH,KAAK,QAAQ,wBAAwB,KAAK,qBAAsB,CAC5D,OAAQ,UACR,SAAU,KAAK,QACnB,CAAC,EACD,KAAK,iBAAmB,GAEhC,CACA,oBAAqB,CACb,KAAK,YACL,KAAK,OAAO,SAAY,CACpB,KAAK,cAAc,EACnB,KAAK,cAAc,EACnB,KAAK,cAAc,EACnB,KAAK,QAAQ,cAAc,IAAI,CACnC,CAAC,CAET,CACA,yBAAyBkH,EAASC,EAAS,CACnC,KAAK,uBACLA,EAAQ,mBAAmBvB,GAAc,WAAW,CAE5D,CACA,gBAAiB,CACb,KAAK,aAAa,CACtB,CACA,iCAAiC0B,EAAU6G,EAAW,CAAE,CACxD,MAAM,6BAA6BhH,EAAStF,EAAU,CAClD,IAAMqM,EAAe,MAAMrM,EAAS,aAC9B,CAAE,WAAAuM,EAAY,WAAAJ,CAAW,EAAInM,EAC/BqM,GAAgB,KAChB,KAAK,eAAe,CAChB,WAAYb,GAAiB,oBAC7B,WAAAe,CACJ,CAAC,GAGD,KAAK,qBAAuBvM,EAAS,WAAaA,EAAS,SAAW,OACtE,KAAK,eAAe,CAAE,WAAYmM,EAAY,aAAAE,EAAc,WAAAE,CAAW,CAAC,EAEhF,CACA,MAAM,0BAA0BjH,EAAStF,EAAU,CAC/C,IAAMqM,EAAe,MAAMrM,EAAS,aAC9B,CAAE,WAAAuM,EAAY,WAAAJ,CAAW,EAAInM,EAC/BqM,GAAgB,KAChB,KAAK,eAAe,CAChB,WAAYb,GAAiB,oBAC7B,WAAAe,CACJ,CAAC,EAGD,KAAK,eAAe,CAAE,WAAYJ,EAAY,aAAAE,EAAc,WAAAE,CAAW,CAAC,CAEhF,CACA,eAAe9G,EAAU+G,EAAQ,CAC7B,KAAK,eAAe,CAChB,WAAYhB,GAAiB,eAC7B,WAAY,EAChB,CAAC,CACL,CACA,iBAAkB,CACd,KAAK,cAAc,CACvB,CACA,eAAgB,CACR,CAAC,KAAK,UAAY,CAAC,KAAK,KAAK,gBACzB,KAAK,QAAU,UACf,KAAK,yBAAyB,GAAK,KAAK,eAAe,GAAK,KAAK,KAAK,YAAY,EAGlF,KAAK,eAAe,GAAK,KAAK,KAAK,YAAY,EAE/C,KAAK,YACL,KAAK,SAAS,gCAAgC,KAAK,KAAK,qBAAsB,KAAK,QAAQ,EAE/F,KAAK,SAAW,GAExB,CACA,0BAA2B,CACvB,GAAM,CAAE,eAAAiB,CAAe,EAAI,KAAK,gBAChC,GAAIA,EACA,YAAK,KAAK,iBAAiBA,CAAc,EAClC,EAEf,CACA,gBAAiB,CACb,IAAMjN,EAAShB,GAAU,KAAK,QAAQ,EACtC,GAAIgB,GAAU,KACV,YAAK,KAAK,eAAeA,CAAM,EACxB,EAEf,CACA,mBAAmBkN,EAAQ,CACvB,KAAK,cAAcA,GAAU,IAAI,KAAK,EAAE,QAAQ,CACpD,CACA,kBAAmB,CACf,OAAO,OAAO,OAAO,CAAC,EAAG,KAAK,aAAa,CAC/C,CACA,0BAA0B9N,EAAQ,CAC9B,OAAQA,EAAQ,CACZ,IAAK,UACD,OAAO,QAAQ,aACnB,IAAK,UACL,IAAK,UACD,OAAO,QAAQ,SACvB,CACJ,CACA,sBAAuB,CACnB,OAAO,OAAO,KAAK,UAAY,QACnC,CACA,oBAAqB,CACjB,OAAI,KAAK,WACE,GAEF,KAAK,QAAU,UACb,CAAC,KAAK,kBAAkB,EAGxB,KAAK,UAEpB,CACA,eAAgB,CACP,KAAK,iBACN,KAAK,KAAK,cAAc,KAAK,QAAQ,EAAE,KAAMwH,GAAaA,GAAY,KAAK,oBAAoBA,CAAQ,CAAC,EACxG,KAAK,eAAiB,GAE9B,CACA,MAAM,OAAO8B,EAAU,CACnB,KAAK,aAAa,EAClB,MAAM,IAAI,QAASjH,GAAY,CAC3B,KAAK,MAAQ,sBAAsB,IAAMA,EAAQ,CAAC,CACtD,CAAC,EACD,MAAMiH,EAAS,EACf,OAAO,KAAK,KAChB,CACA,cAAe,CACP,KAAK,QACL,qBAAqB,KAAK,KAAK,EAC/B,OAAO,KAAK,MAEpB,CACJ,EACA,SAASkE,GAAaD,EAAY,CAC9B,OAAOA,GAAc,KAAOA,EAAa,GAC7C,CAEA,IAAMQ,GAAN,KAAqB,CACjB,YAAYC,EAAS,CACjB,KAAK,YAAc,IAAIjD,GACvB,KAAK,gBAAkB,IAAM,CACzB,KAAK,YAAY,KAAK,CAC1B,EACA,KAAK,QAAUiD,CACnB,CACA,wBAAwBvN,EAAU+H,EAAS,CACvC,KAAK,UAAU,WAAW/H,EAA6D+H,GAAQ,uBAA0BpF,GAAK,EAAGoF,CAAO,CAC5I,CACA,aAAayF,EAAO,CAChB,KAAK,SAAWA,EAAM,SACtBA,EAAM,mBAAmB,EACzBA,EAAM,aAAa,EACnBA,EAAM,mBAAmB,CAC7B,CACA,oBAAoBA,EAAO,CACvB,KAAK,YAAY,SAAS,CAAC,EACvBA,EAAM,kBAAkB,GAAKA,EAAM,QAAU,UAC7C,KAAK,+BAA+B,EAGpC,KAAK,gBAAgB,CAE7B,CACA,sBAAsBA,EAAO,CACzBA,EAAM,aAAa,CACvB,CACA,iCAAiCA,EAAOV,EAAY,CAChD,OAAQA,EAAY,CAChB,KAAKX,GAAiB,eACtB,KAAKA,GAAiB,eACtB,KAAKA,GAAiB,oBAClB,OAAO,KAAK,OAAO,CACf,OAAQ,iBACR,QAAS,CACL,WAAAW,CACJ,CACJ,CAAC,EACL,QACI,OAAOU,EAAM,aAAa,CAClC,CACJ,CACA,qBAAqBC,EAAQ,CACzB,KAAK,YAAY,SAAS,CAAC,EAC3B,KAAK,qBAAqB,CAC9B,CACA,eAAeA,EAAQ,CAAE,CACzB,gBAAgBzF,EAAQ,CACpB,KAAK,OAAOA,CAAM,CACtB,CACA,YAAYyF,EAAQ,CAAE,CACtB,cAAcA,EAAQ,CAAE,CACxB,sBAAsBC,EAAiB,CACnC,KAAK,YAAY,SAAS,CAAC,EAC3B,KAAK,8BAA8B,CACvC,CACA,uBAAuBA,EAAiB,CACpC,KAAK,YAAY,SAAS,CAAC,EAC3B,KAAK,oBAAoB,CAC7B,CACA,gCAAiC,CAC7B,KAAK,wBAA0B,OAAO,WAAW,KAAK,gBAAiB,KAAK,QAAQ,gBAAgB,CACxG,CACA,sBAAuB,CACnB,KAAK,YAAY,KAAK,EAClB,KAAK,yBAA2B,OAChC,OAAO,aAAa,KAAK,uBAAuB,EAChD,OAAO,KAAK,wBAEpB,CACA,+BAAgC,CACxB,KAAK,wBAA0B,OAC/B,KAAK,uBAAyB,OAAO,WAAW,KAAK,gBAAiB,KAAK,QAAQ,gBAAgB,EAE3G,CACA,qBAAsB,CAClB,KAAK,YAAY,KAAK,EAClB,KAAK,wBAA0B,OAC/B,OAAO,aAAa,KAAK,sBAAsB,EAC/C,OAAO,KAAK,uBAEpB,CACA,OAAO1F,EAAQ,CACX,IAAIlJ,EACJyC,GAAS,eAAgB,CAAE,OAAQyG,CAAO,CAAC,EAC3C,OAAO,SAAS,OAASlJ,EAAK,KAAK,YAAc,MAAQA,IAAO,OAAS,OAASA,EAAG,SAAS,IAAM,OAAO,SAAS,IACxH,CACA,IAAI,WAAY,CACZ,OAAO,KAAK,QAAQ,SACxB,CACJ,EAEM6O,GAAN,KAAoB,CAChB,aAAc,CACV,KAAK,QAAU,GACf,KAAK,oBAAwBxF,GAAW,CACpC,IAAMyF,EAAgB,CAAC,GAAG,SAAS,iBAAiB,4BAA4B,CAAC,EACjF,QAAWtP,KAAWsP,EAClBtP,EAAQ,OAAO,CAEvB,CACJ,CACA,OAAQ,CACC,KAAK,UACN,KAAK,QAAU,GACf,iBAAiB,qBAAsB,KAAK,oBAAqB,EAAK,EAE9E,CACA,MAAO,CACC,KAAK,UACL,KAAK,QAAU,GACf,oBAAoB,qBAAsB,KAAK,oBAAqB,EAAK,EAEjF,CACJ,EAEMuP,GAAN,KAAsB,CAClB,YAAYN,EAASjP,EAAS,CAC1B,KAAK,QAAUiP,EACf,KAAK,QAAUjP,EACf,KAAK,gBAAkB,IAAI4J,GAAgB,KAAM5J,CAAO,EACxD,KAAK,mBAAqB,IAAI8I,GAAmB,KAAM9I,CAAO,CAClE,CACA,OAAQ,CACJ,KAAK,gBAAgB,MAAM,EAC3B,KAAK,mBAAmB,MAAM,CAClC,CACA,MAAO,CACH,KAAK,gBAAgB,KAAK,EAC1B,KAAK,mBAAmB,KAAK,CACjC,CACA,yBAAyBA,EAASwP,EAAW3F,EAAQ,CACjD,OAAO,KAAK,eAAe7J,CAAO,CACtC,CACA,qBAAqBA,EAASc,EAAKX,EAAO,CACtC,IAAMsP,EAAQ,KAAK,iBAAiBzP,CAAO,EACvCyP,GACAA,EAAM,SAAS,qBAAqBzP,EAASc,EAAKX,CAAK,CAE/D,CACA,eAAeH,EAASV,EAAW,CAC/B,OAAQU,EAAQ,QAAQ,aAAa,GAAK,MACtC,KAAK,aAAaA,EAASV,CAAS,GACpC,KAAK,eAAeU,EAASV,CAAS,CAC9C,CACA,cAAcU,EAASV,EAAW,CAC9B,IAAMmQ,EAAQ,KAAK,iBAAiBzP,EAASV,CAAS,EAClDmQ,GACAA,EAAM,SAAS,cAAczP,EAASV,CAAS,CAEvD,CACA,aAAaE,EAAMF,EAAW,CAC1B,IAAIkB,EACJ,IAAMS,EAASD,GAAUxB,EAAMF,CAAS,EAClCoQ,EAAO,KAAK,QAAQ,cAAc,cAAc,yBAAyB,EACzE/N,EAAehB,IAAWH,EAAiDkP,GAAK,WAAa,MAAQlP,IAAO,OAASA,EAAK,GAAG,EACnI,OAAO,KAAK,eAAehB,EAAMF,CAAS,GAAKmC,GAAoBR,EAAQU,CAAY,CAC3F,CACA,eAAe3B,EAASV,EAAW,CAI/B,GAHsBU,aAAmB,gBACnC,KAAK,QAAQ,wBAAwBA,EAASV,CAAS,EACvD,KAAK,QAAQ,qBAAqBU,CAAO,EAC5B,CACf,IAAMyP,EAAQ,KAAK,iBAAiBzP,EAASV,CAAS,EACtD,OAAOmQ,EAAQA,GAASzP,EAAQ,QAAQ,aAAa,EAAI,EAC7D,KAEI,OAAO,EAEf,CACA,iBAAiBA,EAASV,EAAW,CACjC,IAAMiJ,EAA4DjJ,GAAU,aAAa,kBAAkB,GAAMU,EAAQ,aAAa,kBAAkB,EACxJ,GAAIuI,GAAMA,GAAM,OAAQ,CACpB,IAAMkH,EAAQ,KAAK,QAAQ,cAAc,IAAIlH,mBAAoB,EACjE,GAAIkH,aAAiBpP,GACjB,OAAOoP,CAEf,CACJ,CACJ,EAEME,GAAN,KAAc,CACV,YAAYlK,EAAU,CAClB,KAAK,sBAAwBpB,GAAK,EAClC,KAAK,gBAAkB,CAAC,EACxB,KAAK,QAAU,GACf,KAAK,WAAa,GAClB,KAAK,WAAclE,GAAU,CACzB,GAAI,KAAK,qBAAqB,EAAG,CAC7B,GAAM,CAAE,MAAAyP,CAAM,EAAIzP,EAAM,OAAS,CAAC,EAClC,GAAIyP,EAAO,CACP,KAAK,SAAW,IAAI,IAAI,OAAO,SAAS,IAAI,EAC5C,GAAM,CAAE,sBAAA7B,CAAsB,EAAI6B,EAClC,KAAK,sBAAwB7B,EAC7B,KAAK,SAAS,iDAAiD,KAAK,SAAUA,CAAqB,CACvG,CACJ,CACJ,EACA,KAAK,WAAa,MAAOlE,GAAW,CAChC,MAAMrG,GAAc,EACpB,KAAK,WAAa,EACtB,EACA,KAAK,SAAWiC,CACpB,CACA,OAAQ,CACC,KAAK,UACN,iBAAiB,WAAY,KAAK,WAAY,EAAK,EACnD,iBAAiB,OAAQ,KAAK,WAAY,EAAK,EAC/C,KAAK,QAAU,GACf,KAAK,QAAQ,IAAI,IAAI,OAAO,SAAS,IAAI,CAAC,EAElD,CACA,MAAO,CACC,KAAK,UACL,oBAAoB,WAAY,KAAK,WAAY,EAAK,EACtD,oBAAoB,OAAQ,KAAK,WAAY,EAAK,EAClD,KAAK,QAAU,GAEvB,CACA,KAAK/D,EAAUqM,EAAuB,CAClC,KAAK,OAAO,QAAQ,UAAWrM,EAAUqM,CAAqB,CAClE,CACA,QAAQrM,EAAUqM,EAAuB,CACrC,KAAK,OAAO,QAAQ,aAAcrM,EAAUqM,CAAqB,CACrE,CACA,OAAOxI,EAAQ7D,EAAUqM,EAAwB1J,GAAK,EAAG,CACrD,IAAMwL,EAAQ,CAAE,MAAO,CAAE,sBAAA9B,CAAsB,CAAE,EACjDxI,EAAO,KAAK,QAASsK,EAAO,GAAInO,EAAS,IAAI,EAC7C,KAAK,SAAWA,EAChB,KAAK,sBAAwBqM,CACjC,CACA,gCAAgCA,EAAuB,CACnD,OAAO,KAAK,gBAAgBA,IAA0B,CAAC,CAC3D,CACA,sBAAsB+B,EAAgB,CAClC,GAAM,CAAE,sBAAA/B,CAAsB,EAAI,KAC5BgC,EAAkB,KAAK,gBAAgBhC,GAC7C,KAAK,gBAAgBA,GAAyB,OAAO,OAAO,OAAO,OAAO,CAAC,EAAGgC,CAAe,EAAGD,CAAc,CAClH,CACA,kCAAmC,CAC/B,IAAItP,EACC,KAAK,4BACN,KAAK,2BAA6BA,EAAK,QAAQ,qBAAuB,MAAQA,IAAO,OAASA,EAAK,OACnG,QAAQ,kBAAoB,SAEpC,CACA,sCAAuC,CAC/B,KAAK,4BACL,QAAQ,kBAAoB,KAAK,0BACjC,OAAO,KAAK,0BAEpB,CACA,sBAAuB,CACnB,OAAO,KAAK,aAAa,CAC7B,CACA,cAAe,CACX,OAAO,KAAK,YAAc,SAAS,YAAc,UACrD,CACJ,EAEMwP,GAAN,KAAgB,CACZ,YAAYvK,EAAU,CAClB,KAAK,SAAWA,CACpB,CACA,aAAa/D,EAAU+H,EAAU,CAAC,EAAG,CAC7B,KAAK,SAAS,iCAAiC/H,EAAU+H,EAAQ,MAAM,IACnEhI,GAAoBC,EAAU,KAAK,KAAK,SAAS,YAAY,EAC7D,KAAK,SAAS,wBAAwBA,EAAU+H,CAAO,EAGvD,OAAO,SAAS,KAAO/H,EAAS,SAAS,EAGrD,CACA,WAAWd,EAAWmN,EAAuBtE,EAAU,CAAC,EAAG,CACvD,KAAK,KAAK,EACV,KAAK,aAAe,IAAIqE,GAAM,KAAMnN,GAAUC,CAAS,EAAGmN,EAAuB,OAAO,OAAO,CAAE,SAAU,KAAK,QAAS,EAAGtE,CAAO,CAAC,EACpI,KAAK,aAAa,MAAM,CAC5B,CACA,WAAWjK,EAAMF,EAAW,CACxB,KAAK,KAAK,EACV,KAAK,eAAiB,IAAIuH,GAAe,KAAMrH,EAAMF,EAAW,EAAI,EACpE,KAAK,eAAe,MAAM,CAC9B,CACA,MAAO,CACC,KAAK,iBACL,KAAK,eAAe,KAAK,EACzB,OAAO,KAAK,gBAEZ,KAAK,eACL,KAAK,aAAa,OAAO,EACzB,OAAO,KAAK,aAEpB,CACA,IAAI,SAAU,CACV,OAAO,KAAK,SAAS,OACzB,CACA,IAAI,MAAO,CACP,OAAO,KAAK,SAAS,IACzB,CACA,IAAI,SAAU,CACV,OAAO,KAAK,SAAS,OACzB,CACA,sBAAsB2Q,EAAgB,CAC9B,OAAO,KAAK,QAAQ,uBAA0B,YAC9C,KAAK,QAAQ,sBAAsBA,CAAc,CAEzD,CACA,MAAM,oCAAoCA,EAAgBnK,EAAe,CACrE,GAAImK,GAAkB,KAAK,eAAgB,CACvC,IAAMvB,EAAe,MAAM5I,EAAc,aACzC,GAAI4I,EAAc,CACd,IAAML,EAAsB4B,EAAe,QAAU5K,GAAY,IAC5DgJ,GACD,KAAK,KAAK,mBAAmB,EAEjC,GAAM,CAAE,WAAAG,EAAY,WAAAI,CAAW,EAAI9I,EAE7BoK,EAAe,CACjB,OAFW,KAAK,2BAA2BD,CAAc,EAGzD,oBAAA5B,EACA,SAAU,CAAE,WAAAG,EAAY,aAAAE,EAAc,WAAAE,CAAW,CACrD,EACA,KAAK,aAAa9I,EAAc,SAAUoK,CAAY,CAC1D,CACJ,CACJ,CACA,MAAM,iCAAiCD,EAAgBnK,EAAe,CAClE,IAAM4I,EAAe,MAAM5I,EAAc,aACzC,GAAI4I,EAAc,CACd,IAAMjG,EAAWsE,GAAa,eAAe2B,CAAY,EACrD5I,EAAc,YACd,MAAM,KAAK,KAAK,YAAY2C,EAAU,KAAK,YAAY,EAGvD,MAAM,KAAK,KAAK,WAAWA,EAAU,GAAO,GAAM,KAAK,YAAY,EAEvE,KAAK,KAAK,YAAY,EACtB,KAAK,KAAK,mBAAmB,CACjC,CACJ,CACA,sBAAsBwH,EAAgBpK,EAAO,CACzC,QAAQ,MAAMA,CAAK,CACvB,CACA,uBAAuBoK,EAAgB,CAC/B,OAAO,KAAK,QAAQ,wBAA2B,YAC/C,KAAK,QAAQ,uBAAuBA,CAAc,CAE1D,CACA,aAAaf,EAAO,CAChB,KAAK,SAAS,aAAaA,CAAK,CACpC,CACA,eAAeA,EAAO,CAClB,KAAK,SAAS,eAAeA,CAAK,CACtC,CACA,6BAA6BxN,EAAUT,EAAQ,CAC3C,IAAMY,EAAShB,GAAUa,CAAQ,EAC3ByO,EAAgBtP,GAAU,KAAK,KAAK,oBAAoB,EACxDuP,EAAqBnP,IAAW,WAAa,OAAOY,EAAW,IACrE,OAAQZ,IAAW,WACfW,GAAcF,CAAQ,IAAME,GAAc,KAAK,KAAK,oBAAoB,IACvEwO,GAAuBvO,GAAU,MAAQA,IAAWsO,EAC7D,CACA,gCAAgCE,EAAQC,EAAQ,CAC5C,KAAK,SAAS,gCAAgCD,EAAQC,CAAM,CAChE,CACA,IAAI,UAAW,CACX,OAAO,KAAK,QAAQ,QACxB,CACA,IAAI,uBAAwB,CACxB,OAAO,KAAK,QAAQ,qBACxB,CACA,2BAA2BL,EAAgB,CACvC,GAAM,CAAE,YAAAnJ,EAAa,UAAAxH,CAAU,EAAI2Q,EAC7BhP,EAASsD,GAAa,oBAAqBjF,EAAWwH,CAAW,EACvE,OAAOxE,GAASrB,CAAM,EAAIA,EAAS,SACvC,CACJ,EAEIsP,IACH,SAAUA,EAAW,CAClBA,EAAUA,EAAU,QAAa,GAAK,UACtCA,EAAUA,EAAU,QAAa,GAAK,UACtCA,EAAUA,EAAU,YAAiB,GAAK,cAC1CA,EAAUA,EAAU,SAAc,GAAK,UAC3C,GAAGA,KAAcA,GAAY,CAAC,EAAE,EAChC,IAAMC,GAAN,KAAmB,CACf,YAAY/K,EAAU,CAClB,KAAK,MAAQ8K,GAAU,QACvB,KAAK,QAAU,GACf,KAAK,oBAAsB,IAAM,CAC7B,GAAM,CAAE,WAAAE,CAAW,EAAI,KACnBA,GAAc,cACd,KAAK,kBAAkB,EAElBA,GAAc,YACnB,KAAK,eAAe,CAE5B,EACA,KAAK,eAAiB,IAAM,CACxB,KAAK,SAAS,eAAe,CACjC,EACA,KAAK,SAAWhL,CACpB,CACA,OAAQ,CACC,KAAK,UACF,KAAK,OAAS8K,GAAU,UACxB,KAAK,MAAQA,GAAU,SAE3B,SAAS,iBAAiB,mBAAoB,KAAK,oBAAqB,EAAK,EAC7E,iBAAiB,WAAY,KAAK,eAAgB,EAAK,EACvD,KAAK,QAAU,GAEvB,CACA,MAAO,CACC,KAAK,UACL,SAAS,oBAAoB,mBAAoB,KAAK,oBAAqB,EAAK,EAChF,oBAAoB,WAAY,KAAK,eAAgB,EAAK,EAC1D,KAAK,QAAU,GAEvB,CACA,mBAAoB,CACZ,KAAK,OAASA,GAAU,UACxB,KAAK,MAAQA,GAAU,YACvB,KAAK,SAAS,sBAAsB,EAE5C,CACA,gBAAiB,CACb,KAAK,kBAAkB,EACnB,KAAK,OAASA,GAAU,cACxB,KAAK,MAAQA,GAAU,SACvB,KAAK,SAAS,WAAW,EAEjC,CACA,IAAI,YAAa,CACb,OAAO,SAAS,UACpB,CACJ,EAEMG,GAAN,KAAqB,CACjB,YAAYjL,EAAU,CAClB,KAAK,QAAU,GACf,KAAK,SAAW,IAAM,CAClB,KAAK,eAAe,CAAE,EAAG,OAAO,YAAa,EAAG,OAAO,WAAY,CAAC,CACxE,EACA,KAAK,SAAWA,CACpB,CACA,OAAQ,CACC,KAAK,UACN,iBAAiB,SAAU,KAAK,SAAU,EAAK,EAC/C,KAAK,SAAS,EACd,KAAK,QAAU,GAEvB,CACA,MAAO,CACC,KAAK,UACL,oBAAoB,SAAU,KAAK,SAAU,EAAK,EAClD,KAAK,QAAU,GAEvB,CACA,eAAekL,EAAU,CACrB,KAAK,SAAS,sBAAsBA,CAAQ,CAChD,CACJ,EAEMC,GAAN,KAA4B,CACxB,OAAO,CAAE,SAAAvK,CAAS,EAAG,CACjBiE,GAAM,4BAA4B,KAAMuG,GAAkCxK,CAAQ,EAAG,IAAM,SAAS,gBAAgB,YAAYA,CAAQ,CAAC,CAC7I,CACA,cAAcsC,EAAyBC,EAAqB,CACxDA,EAAoB,YAAYD,EAAwB,UAAU,EAAI,CAAC,CAC3E,CACA,cAAe,CAAE,CACrB,EACA,SAASkI,GAAkCxK,EAAU,CACjD,IAAMyK,EAA8BxI,GAA0B,SAAS,eAAe,EAChFI,EAAsB,CAAC,EAC7B,QAAWqI,KAA8BD,EAA6B,CAClE,GAAM,CAAE,GAAAvI,CAAG,EAAIwI,EACf,QAAWxK,KAAiBF,EAAS,iBAAiB,cAAc,EAAG,CACnE,IAAM2K,EAAkBxI,GAAwBjC,EAAc,gBAAgB,QAASgC,CAAE,EACrFyI,IACAtI,EAAoBH,GAAM,CAACwI,EAA4BC,CAAe,EAE9E,CACJ,CACA,OAAOtI,CACX,CAEA,IAAMuI,GAAN,KAAqB,CACjB,YAAYxL,EAAU,CAClB,KAAK,QAAU,IAAI,IACnB,KAAK,QAAU,GACf,KAAK,qBAAyBtF,GAAU,CACpC,IAAMkC,EAAW6O,GAAuB/Q,CAAK,EACzCkC,GAAY8O,GAAsB9O,CAAQ,IAC1ClC,EAAM,eAAe,EACrB,KAAK,uBAAuBkC,CAAQ,EAE5C,EACA,KAAK,oBAAuBlC,GAAU,CAC9B,KAAK,SAAW,OAAOA,EAAM,MAAQ,UACrC,KAAK,mBAAmBA,EAAM,IAAI,CAE1C,EACA,KAAK,SAAWsF,CACpB,CACA,OAAQ,CACC,KAAK,UACN,KAAK,QAAU,GACf,iBAAiB,8BAA+B,KAAK,qBAAsB,EAAK,EAExF,CACA,MAAO,CACC,KAAK,UACL,KAAK,QAAU,GACf,oBAAoB,8BAA+B,KAAK,qBAAsB,EAAK,EAE3F,CACA,oBAAoB6H,EAAQ,CACnB,KAAK,wBAAwBA,CAAM,IACpC,KAAK,QAAQ,IAAIA,CAAM,EACvBA,EAAO,iBAAiB,UAAW,KAAK,oBAAqB,EAAK,EAE1E,CACA,uBAAuBA,EAAQ,CACvB,KAAK,wBAAwBA,CAAM,IACnC,KAAK,QAAQ,OAAOA,CAAM,EAC1BA,EAAO,oBAAoB,UAAW,KAAK,oBAAqB,EAAK,EAE7E,CACA,wBAAwBA,EAAQ,CAC5B,OAAO,KAAK,QAAQ,IAAIA,CAAM,CAClC,CACA,MAAM,uBAAuBjL,EAAU,CACnC,IAAMU,EAAO,MAAMV,EAAS,aACxBU,GACA,KAAK,mBAAmBA,CAAI,CAEpC,CACA,mBAAmBA,EAAM,CACrB,KAAK,SAAS,0BAA0BqD,GAAc,KAAKrD,CAAI,CAAC,CACpE,CACJ,EACA,SAASmO,GAAuB/Q,EAAO,CACnC,IAAIK,EACJ,IAAMsF,GAAiBtF,EAAKL,EAAM,UAAY,MAAQK,IAAO,OAAS,OAASA,EAAG,cAClF,GAAIsF,aAAyB1D,GACzB,OAAO0D,CAEf,CACA,SAASqL,GAAsB9O,EAAU,CACrC,IAAI7B,EAEJ,QADqBA,EAAK6B,EAAS,eAAiB,MAAQ7B,IAAO,OAASA,EAAK,IAC9D,WAAW4F,GAAc,WAAW,CAC3D,CAEA,IAAMgL,GAAN,cAA4BvG,EAAS,CACjC,OAAO,cAAcQ,EAAgBC,EAAY,CAC7C,GAAM,CAAE,gBAAA+F,EAAiB,KAAA3L,CAAK,EAAI,SAClC2L,EAAgB,aAAa/F,EAAY5F,CAAI,CACjD,CACA,MAAM,QAAS,CACX,KAAK,mBAAmB,EACxB,KAAK,uBAAuB,CAChC,CACA,oBAAqB,CACjB,GAAM,CAAE,gBAAA2L,EAAiB,KAAApE,CAAK,EAAI,SAClCoE,EAAgB,aAAa,KAAK,QAASpE,CAAI,EAC/C,KAAK,cAAc,KAAK,eAAgB,KAAK,UAAU,CAC3D,CACA,wBAAyB,CACrB,QAAWqE,KAAsB,KAAK,eAAgB,CAClD,IAAMC,EAAaD,EAAmB,WACtC,GAAIC,EAAY,CACZ,IAAMvR,EAAUuC,GAAsB+O,CAAkB,EACxDC,EAAW,aAAavR,EAASsR,CAAkB,CACvD,CACJ,CACJ,CACA,IAAI,SAAU,CACV,OAAO,KAAK,YAAY,aAAa,OACzC,CACA,IAAI,gBAAiB,CACjB,OAAO,SAAS,gBAAgB,iBAAiB,QAAQ,CAC7D,CACJ,EAEME,GAAN,cAA2B3G,EAAS,CAChC,OAAO,cAAcQ,EAAgBC,EAAY,CACzC,SAAS,MAAQA,aAAsB,gBACvC,SAAS,KAAK,YAAYA,CAAU,EAGpC,SAAS,gBAAgB,YAAYA,CAAU,CAEvD,CACA,IAAI,cAAe,CACf,OAAO,KAAK,YAAY,aAAe,KAAK,2BAChD,CACA,IAAI,cAAe,CACf,GAAI,CAAC,KAAK,YAAY,YAClB,MAAO,CACH,OAAQ,+BACZ,EAEJ,GAAI,CAAC,KAAK,4BACN,MAAO,CACH,OAAQ,0BACZ,CAER,CACA,MAAM,iBAAkB,CACpB,MAAM,KAAK,UAAU,CACzB,CACA,MAAM,QAAS,CACP,KAAK,YACL,KAAK,YAAY,CAEzB,CACA,iBAAkB,CACd,MAAM,gBAAgB,EACjB,KAAK,WACN,KAAK,+BAA+B,CAE5C,CACA,IAAI,qBAAsB,CACtB,OAAO,KAAK,gBAAgB,YAChC,CACA,IAAI,iBAAkB,CAClB,OAAO,KAAK,YAAY,YAC5B,CACA,IAAI,YAAa,CACb,OAAO,KAAK,YAAY,OAC5B,CACA,MAAM,WAAY,CACd,IAAMmG,EAAwB,KAAK,8BAA8B,EACjE,KAAK,0BAA0B,EAC/B,KAAK,qCAAqC,EAC1C,KAAK,+BAA+B,EACpC,MAAMA,CACV,CACA,aAAc,CACV,KAAK,4BAA4B,IAAM,CACnC,KAAK,gBAAgB,EACrB,KAAK,cAAc,CACvB,CAAC,CACL,CACA,IAAI,6BAA8B,CAC9B,OAAO,KAAK,oBAAoB,yBAA2B,KAAK,gBAAgB,uBACpF,CACA,MAAM,+BAAgC,CAClC,IAAMC,EAAkB,CAAC,EACzB,QAAW1R,KAAW,KAAK,0BACvB0R,EAAgB,KAAK7M,GAAY7E,CAAO,CAAC,EACzC,SAAS,KAAK,YAAYA,CAAO,EAErC,MAAM,QAAQ,IAAI0R,CAAe,CACrC,CACA,2BAA4B,CACxB,QAAW1R,KAAW,KAAK,sBACvB,SAAS,KAAK,YAAYuC,GAAsBvC,CAAO,CAAC,CAEhE,CACA,sCAAuC,CACnC,QAAWA,KAAW,KAAK,+BACvB,SAAS,KAAK,YAAYA,CAAO,CAEzC,CACA,gCAAiC,CAC7B,QAAWA,KAAW,KAAK,2BACvB,SAAS,KAAK,YAAYA,CAAO,CAEzC,CACA,iBAAkB,CACd,SAAS,UAAU,KAAK,UAAU,EAClC,KAAK,8BAA8B,CACvC,CACA,+BAAgC,CAC5B,QAAWwG,KAAsB,KAAK,sBAAuB,CACzD,IAAMsF,EAAyBvJ,GAAsBiE,CAAkB,EACvEA,EAAmB,YAAYsF,CAAsB,CACzD,CACJ,CACA,eAAgB,CACZ,KAAK,cAAc,KAAK,eAAgB,KAAK,UAAU,CAC3D,CACA,IAAI,2BAA4B,CAC5B,OAAO,KAAK,gBAAgB,mCAAmC,KAAK,mBAAmB,CAC3F,CACA,IAAI,uBAAwB,CACxB,OAAO,KAAK,gBAAgB,+BAA+B,KAAK,mBAAmB,CACvF,CACA,IAAI,gCAAiC,CACjC,OAAO,KAAK,oBAAoB,mBACpC,CACA,IAAI,4BAA6B,CAC7B,OAAO,KAAK,gBAAgB,mBAChC,CACA,IAAI,uBAAwB,CACxB,OAAO,KAAK,WAAW,iBAAiB,QAAQ,CACpD,CACJ,EAEM6F,GAAN,KAAoB,CAChB,YAAYC,EAAM,CACd,KAAK,KAAO,CAAC,EACb,KAAK,UAAY,CAAC,EAClB,KAAK,KAAOA,CAChB,CACA,IAAIlQ,EAAU,CACV,OAAOI,GAAWJ,CAAQ,IAAK,KAAK,SACxC,CACA,IAAIA,EAAU,CACV,GAAI,KAAK,IAAIA,CAAQ,EAAG,CACpB,IAAM+G,EAAW,KAAK,KAAK/G,CAAQ,EACnC,YAAK,MAAMA,CAAQ,EACZ+G,CACX,CACJ,CACA,IAAI/G,EAAU+G,EAAU,CACpB,YAAK,MAAM/G,EAAU+G,CAAQ,EAC7B,KAAK,MAAM/G,CAAQ,EACZ+G,CACX,CACA,OAAQ,CACJ,KAAK,UAAY,CAAC,CACtB,CACA,KAAK/G,EAAU,CACX,OAAO,KAAK,UAAUI,GAAWJ,CAAQ,EAC7C,CACA,MAAMA,EAAU+G,EAAU,CACtB,KAAK,UAAU3G,GAAWJ,CAAQ,GAAK+G,CAC3C,CACA,MAAM/G,EAAU,CACZ,IAAMmQ,EAAM/P,GAAWJ,CAAQ,EACzB2L,EAAQ,KAAK,KAAK,QAAQwE,CAAG,EAC/BxE,EAAQ,IACR,KAAK,KAAK,OAAOA,EAAO,CAAC,EAC7B,KAAK,KAAK,QAAQwE,CAAG,EACrB,KAAK,KAAK,CACd,CACA,MAAO,CACH,QAAWA,KAAO,KAAK,KAAK,OAAO,KAAK,IAAI,EACxC,OAAO,KAAK,UAAUA,EAE9B,CACJ,EAEMC,GAAN,cAAuB5I,EAAK,CACxB,aAAc,CACV,MAAM,GAAG,SAAS,EAClB,KAAK,cAAgB,IAAIyI,GAAc,EAAE,EACzC,KAAK,qBAAuB,IAAI,IAAI,SAAS,IAAI,EACjD,KAAK,cAAgB,EACzB,CACA,WAAWlJ,EAAUa,EAAY,GAAO2B,EAAa,GAAMiE,EAAO,CAC9D,IAAM7F,EAAW,IAAImI,GAAa,KAAK,SAAU/I,EAAU+I,GAAa,cAAelI,EAAW2B,CAAU,EAC5G,OAAK5B,EAAS,aAIoC6F,GAAM,cAAc,EAHlE,KAAK,cAAgB,GAKlB,KAAK,OAAO7F,CAAQ,CAC/B,CACA,YAAYZ,EAAUyG,EAAO,CACqBA,GAAM,cAAc,EAClE,IAAM7F,EAAW,IAAI+H,GAAc,KAAK,SAAU3I,EAAU2I,GAAc,cAAe,EAAK,EAC9F,OAAO,KAAK,OAAO/H,CAAQ,CAC/B,CACA,oBAAqB,CACjB,KAAK,cAAc,MAAM,CAC7B,CACA,MAAM,cAAcZ,EAAW,KAAK,SAAU,CAC1C,GAAIA,EAAS,YAAa,CACtB,KAAK,SAAS,sBAAsB,EACpC,GAAM,CAAE,qBAAsB/G,CAAS,EAAI,KAC3C,MAAM6B,GAAkB,EACxB,IAAMwO,EAAiBtJ,EAAS,MAAM,EACtC,YAAK,cAAc,IAAI/G,EAAUqQ,CAAc,EACxCA,CACX,CACJ,CACA,6BAA6BrQ,EAAU,CACnC,OAAO,KAAK,cAAc,IAAIA,CAAQ,CAC1C,CACA,IAAI,UAAW,CACX,OAAOqL,GAAa,YAAY,KAAK,OAAO,CAChD,CACJ,EAEMiF,GAAN,KAAgB,CACZ,YAAYvM,EAAU,CAClB,KAAK,SAAW,wBAChB,KAAK,SAAWA,CACpB,CACA,IAAI,eAAgB,CAChB,OAAO,KAAK,SAAS,UAAU,KAAK,aACxC,CACA,OAAQ,CACJ,GAAI,SAAS,aAAe,UACxB,OAAO,SAAS,iBAAiB,mBAAoB,IAAM,CACvD,KAAK,0BAA0B,SAAS,IAAI,CAChD,CAAC,EAGD,KAAK,0BAA0B,SAAS,IAAI,CAEpD,CACA,0BAA0BzF,EAAS,CAC/B,QAAW+J,KAAQ/J,EAAQ,iBAAiB,KAAK,QAAQ,EACrD,KAAK,WAAW+J,CAAI,CAE5B,CACA,MAAM,WAAWA,EAAM,CACnB,IAAMrI,EAAW,IAAI,IAAIqI,EAAK,IAAI,EAClC,GAAI,MAAK,cAAc,IAAIrI,CAAQ,EAGnC,GAAI,CAEA,IAAMuQ,EAAe,MADJ,MAAM,MAAMvQ,EAAS,SAAS,EAAG,CAAE,QAAS,CAAE,eAAgB,OAAQ,OAAQ,WAAY,CAAE,CAAC,GAC1E,KAAK,EACnC+G,EAAWsE,GAAa,eAAekF,CAAY,EACzD,KAAK,cAAc,IAAIvQ,EAAU+G,CAAQ,CAC7C,MACA,CACA,CACJ,CACJ,EAEMyJ,GAAN,KAAc,CACV,aAAc,CACV,KAAK,UAAY,IAAIlC,GAAU,IAAI,EACnC,KAAK,QAAU,IAAIL,GAAQ,IAAI,EAC/B,KAAK,UAAY,IAAIqC,GAAU,IAAI,EACnC,KAAK,KAAO,IAAIF,GAAS,KAAM,SAAS,eAAe,EACvD,KAAK,QAAU,IAAI9C,GAAe,IAAI,EACtC,KAAK,aAAe,IAAIwB,GAAa,IAAI,EACzC,KAAK,cAAgB,IAAInB,GACzB,KAAK,kBAAoB,IAAIvF,GAAkB,KAAM,MAAM,EAC3D,KAAK,mBAAqB,IAAIhB,GAAmB,KAAM,QAAQ,EAC/D,KAAK,eAAiB,IAAI4H,GAAe,IAAI,EAC7C,KAAK,eAAiB,IAAIO,GAAe,IAAI,EAC7C,KAAK,sBAAwB,IAAIhH,GAAsB,KAAM,SAAS,eAAe,EACrF,KAAK,gBAAkB,IAAIsF,GAAgB,KAAM,SAAS,eAAe,EACzE,KAAK,sBAAwB,IAAIqB,GACjC,KAAK,MAAQ,GACb,KAAK,QAAU,GACf,KAAK,iBAAmB,IACxB,KAAK,QAAU,GACf,KAAK,SAAW,IACpB,CACA,OAAQ,CACC,KAAK,UACN,KAAK,aAAa,MAAM,EACxB,KAAK,cAAc,MAAM,EACzB,KAAK,sBAAsB,MAAM,EACjC,KAAK,kBAAkB,MAAM,EAC7B,KAAK,mBAAmB,MAAM,EAC9B,KAAK,eAAe,MAAM,EAC1B,KAAK,eAAe,MAAM,EAC1B,KAAK,gBAAgB,MAAM,EAC3B,KAAK,QAAQ,MAAM,EACnB,KAAK,UAAU,MAAM,EACrB,KAAK,QAAU,GACf,KAAK,QAAU,GAEvB,CACA,SAAU,CACN,KAAK,QAAU,EACnB,CACA,MAAO,CACC,KAAK,UACL,KAAK,aAAa,KAAK,EACvB,KAAK,cAAc,KAAK,EACxB,KAAK,sBAAsB,KAAK,EAChC,KAAK,kBAAkB,KAAK,EAC5B,KAAK,mBAAmB,KAAK,EAC7B,KAAK,eAAe,KAAK,EACzB,KAAK,eAAe,KAAK,EACzB,KAAK,gBAAgB,KAAK,EAC1B,KAAK,QAAQ,KAAK,EAClB,KAAK,QAAU,GAEvB,CACA,gBAAgBuB,EAAS,CACrB,KAAK,QAAUA,CACnB,CACA,MAAMzQ,EAAU+H,EAAU,CAAC,EAAG,CAC1B,IAAM+B,EAAe/B,EAAQ,MAAQ,SAAS,eAAeA,EAAQ,KAAK,EAAI,KAC1E+B,aAAwBnL,IACxBmL,EAAa,IAAM9J,EAAS,SAAS,EACrC8J,EAAa,QAGb,KAAK,UAAU,aAAa7K,GAAUe,CAAQ,EAAG+H,CAAO,CAEhE,CACA,oBAAoB6D,EAAQ,CACxB,KAAK,eAAe,oBAAoBA,CAAM,CAClD,CACA,uBAAuBA,EAAQ,CAC3B,KAAK,eAAe,uBAAuBA,CAAM,CACrD,CACA,oBAAoB3N,EAAS,CACzB,KAAK,sBAAsB,OAAOyG,GAAc,KAAKzG,CAAO,CAAC,CACjE,CACA,YAAa,CACT,KAAK,KAAK,mBAAmB,CACjC,CACA,oBAAoByS,EAAO,CACvB,KAAK,iBAAmBA,CAC5B,CACA,YAAYC,EAAM,CACd,KAAK,SAAWA,CACpB,CACA,IAAI,UAAW,CACX,OAAO,KAAK,QAAQ,QACxB,CACA,IAAI,uBAAwB,CACxB,OAAO,KAAK,QAAQ,qBACxB,CACA,iDAAiD3Q,EAAUqM,EAAuB,CAC1E,KAAK,QACL,KAAK,UAAU,WAAWrM,EAAUqM,EAAuB,CACvD,OAAQ,UACR,eAAgB,EACpB,CAAC,EAGD,KAAK,QAAQ,gBAAgB,CACzB,OAAQ,gBACZ,CAAC,CAET,CACA,sBAAsB4C,EAAU,CAC5B,KAAK,QAAQ,sBAAsB,CAAE,eAAgBA,CAAS,CAAC,CACnE,CACA,6BAA6B5G,EAAMrI,EAAU,CACzC,OAAO,KAAK,qBAAqBqI,CAAI,GAAKtI,GAAoBC,EAAU,KAAK,SAAS,YAAY,CACtG,CACA,6BAA8B,CAAE,CAChC,yBAAyBqI,EAAMrI,EAAUvB,EAAO,CAC5C,OAAQ,KAAK,qBAAqB4J,CAAI,GAClCtI,GAAoBC,EAAU,KAAK,SAAS,YAAY,GACxD,KAAK,yCAAyCqI,EAAMrI,EAAUvB,CAAK,CAC3E,CACA,uBAAuB4J,EAAMrI,EAAU,CACnC,IAAMT,EAAS,KAAK,iBAAiB8I,CAAI,EACnCuE,EAAwBvE,EAAK,aAAa,mBAAmB,EACnE,KAAK,MAAMrI,EAAS,KAAM,CAAE,OAAAT,EAAQ,sBAAAqN,CAAsB,CAAC,CAC/D,CACA,iCAAiC5M,EAAUT,EAAQ,CAC/C,OAAO,KAAK,6BAA6BS,EAAUT,CAAM,GAAK,KAAK,kCAAkCS,CAAQ,CACjH,CACA,wBAAwBA,EAAU+H,EAAS,CACvC6I,GAAkC5Q,CAAQ,EAC1C,KAAK,QAAQ,wBAAwBA,EAAU+H,CAAO,CAC1D,CACA,aAAayF,EAAO,CACXA,EAAM,uBACPvK,GAAW,SAAS,eAAe,EAEvC2N,GAAkCpD,EAAM,QAAQ,EAC3CA,EAAM,QACP,KAAK,uCAAuCA,EAAM,SAAUA,EAAM,MAAM,CAEhF,CACA,eAAeA,EAAO,CAClBtK,GAAe,SAAS,eAAe,EACvC,KAAK,+BAA+BsK,EAAM,iBAAiB,CAAC,CAChE,CACA,6BAA6BxN,EAAUT,EAAQ,CAC3C,OAAO,KAAK,UAAU,6BAA6BS,EAAUT,CAAM,CACvE,CACA,gCAAgCoP,EAAQC,EAAQ,CAC5C,KAAK,+CAA+CD,EAAQC,CAAM,CACtE,CACA,eAAe9Q,EAAMF,EAAW,CAC5B,IAAM2B,EAASD,GAAUxB,EAAMF,CAAS,EACxC,OAAQ,KAAK,wBAAwBE,EAAMF,CAAS,GAChDmC,GAAoBd,GAAUM,CAAM,EAAG,KAAK,SAAS,YAAY,CACzE,CACA,cAAczB,EAAMF,EAAW,CAC3B,KAAK,UAAU,WAAWE,EAAMF,CAAS,CAC7C,CACA,uBAAwB,CACpB,KAAK,KAAK,qBAAuB,KAAK,SACtC,KAAK,+BAA+B,CACxC,CACA,YAAa,CACT,KAAK,QAAQ,iCAAiC,CAClD,CACA,gBAAiB,CACb,KAAK,QAAQ,qCAAqC,CACtD,CACA,0BAA0BK,EAAS,CAC/B,KAAK,oBAAoBA,CAAO,CACpC,CACA,uBAAwB,CACpB,IAAIa,EACG,GAAAA,EAAK,KAAK,UAAU,gBAAkB,MAAQA,IAAO,SAAkBA,EAAG,QAC7E,KAAK,uCAAuC,CAEpD,CACA,sBAAsB,CAAE,QAAAR,CAAQ,EAAGyJ,EAAS,CACxC,IAAMtJ,EAAQ,KAAK,8BAA8BH,EAASyJ,CAAO,EAC3D,CAAE,iBAAA8I,EAAkB,OAAQ,CAAE,OAAAC,CAAO,CAAG,EAAIrS,EAClD,OAAI,KAAK,KAAK,UAAYqS,IACtB,KAAK,KAAK,SAAS,cAAgBA,GAEhC,CAACD,CACZ,CACA,qBAAqBE,EAAWC,EAAY,CACxC,KAAK,KAAK,qBAAuB,KAAK,QAAQ,SAC9C,KAAK,6BAA6B,CACtC,CACA,0BAA0B1S,EAAS,CAC/B,KAAK,UAAU,0BAA0BA,CAAO,CACpD,CACA,gBAAgB0J,EAAQ,CACpB,KAAK,QAAQ,gBAAgBA,CAAM,CACvC,CACA,YAAY+F,EAAO,CACf,KAAK,gCAAgCA,CAAK,CAC9C,CACA,cAAc3J,EAAe2J,EAAO,CAChC,KAAK,kCAAkC3J,EAAe2J,CAAK,CAC/D,CACA,yCAAyC1F,EAAMrI,EAAUiR,EAAI,CAEzD,MAAO,CADO,KAAK,6CAA6C5I,EAAMrI,EAAUiR,CAAE,EACpE,gBAClB,CACA,kCAAkCjR,EAAU,CAExC,MAAO,CADO,KAAK,wCAAwCA,CAAQ,EACrD,gBAClB,CACA,6CAA6CqI,EAAMrI,EAAUvB,EAAO,CAChE,OAAO8C,GAAS,cAAe,CAC3B,OAAQ8G,EACR,OAAQ,CAAE,IAAKrI,EAAS,KAAM,cAAevB,CAAM,EACnD,WAAY,EAChB,CAAC,CACL,CACA,wCAAwCuB,EAAU,CAC9C,OAAOuB,GAAS,qBAAsB,CAClC,OAAQ,CAAE,IAAKvB,EAAS,IAAK,EAC7B,WAAY,EAChB,CAAC,CACL,CACA,uCAAuCA,EAAUT,EAAQ,CACrD,OAAOgC,GAAS,cAAe,CAAE,OAAQ,CAAE,IAAKvB,EAAS,KAAM,OAAAT,CAAO,CAAE,CAAC,CAC7E,CACA,wCAAyC,CACrC,OAAOgC,GAAS,oBAAoB,CACxC,CACA,8BAA8B2P,EAASnJ,EAAS,CAC5C,OAAOxG,GAAS,sBAAuB,CACnC,OAAQ,OAAO,OAAO,CAAE,QAAA2P,CAAQ,EAAGnJ,CAAO,EAC1C,WAAY,EAChB,CAAC,CACL,CACA,8BAA+B,CAC3B,OAAOxG,GAAS,cAAc,CAClC,CACA,+BAA+B4P,EAAS,CAAC,EAAG,CACxC,OAAO5P,GAAS,aAAc,CAC1B,OAAQ,CAAE,IAAK,KAAK,SAAS,KAAM,OAAA4P,CAAO,CAC9C,CAAC,CACL,CACA,+CAA+CxC,EAAQC,EAAQ,CAC3D,cAAc,IAAI,gBAAgB,aAAc,CAC5C,OAAQD,EAAO,SAAS,EACxB,OAAQC,EAAO,SAAS,CAC5B,CAAC,CAAC,CACN,CACA,gCAAgCb,EAAO,CACnC,OAAOxM,GAAS,mBAAoB,CAAE,OAAQwM,CAAM,CAAC,CACzD,CACA,kCAAkC3J,EAAe2J,EAAO,CACpD,OAAOxM,GAAS,qBAAsB,CAClC,OAAQ,CAAE,cAAA6C,CAAc,EACxB,OAAQ2J,EACR,WAAY,EAChB,CAAC,CACL,CACA,wBAAwBjQ,EAAMF,EAAW,CACrC,GAAI,KAAK,UAAY,MACjB,MAAO,GAEN,CACD,IAAMwT,EAAyBxT,EAAY,KAAK,qBAAqBA,CAAS,EAAI,GAClF,OAAI,KAAK,UAAY,QACVwT,GAA0BtT,EAAK,QAAQ,qBAAqB,GAAK,KAGjEsT,GAA0B,KAAK,qBAAqBtT,CAAI,CAEvE,CACJ,CACA,qBAAqBQ,EAAS,CAC1B,IAAM+S,EAAY/S,EAAQ,QAAQ,cAAc,EAC1CgT,EAAchT,EAAQ,QAAQ,aAAa,EACjD,OAAI,KAAK,OAASgT,EACVD,EACOA,EAAU,aAAa,YAAY,GAAK,QAGxC,GAIPA,EACOA,EAAU,aAAa,YAAY,GAAK,OAGxC,EAGnB,CACA,iBAAiBhJ,EAAM,CACnB,IAAM9I,EAAS8I,EAAK,aAAa,mBAAmB,EACpD,OAAOzH,GAASrB,CAAM,EAAIA,EAAS,SACvC,CACA,IAAI,UAAW,CACX,OAAO,KAAK,KAAK,QACrB,CACJ,EACA,SAASqR,GAAkCxR,EAAK,CAC5C,OAAO,iBAAiBA,EAAKmS,EAAqC,CACtE,CACA,IAAMA,GAAwC,CAC1C,YAAa,CACT,KAAM,CACF,OAAO,KAAK,SAAS,CACzB,CACJ,CACJ,EAEMC,GAAN,KAAY,CACR,YAAYjE,EAAS,CACjB,KAAK,QAAUA,CACnB,CACA,OAAQ,CACJ,KAAK,QAAQ,WAAW,CAC5B,CACA,mBAAoB,CAChB,KAAK,gBAAgB,EAAE,CAC3B,CACA,qBAAsB,CAClB,KAAK,gBAAgB,UAAU,CACnC,CACA,uBAAwB,CACpB,KAAK,gBAAgB,YAAY,CACrC,CACA,gBAAgB3O,EAAO,CACnB6E,GAAe,sBAAuB7E,CAAK,CAC/C,CACJ,EAEM6S,GAAgB,CAClB,OAAQ,CACJ,KAAK,eAAe,QAASC,GAAM,CAAE,IAAI5S,EAAI,OAAQA,EAAK4S,EAAE,iBAAmB,MAAQ5S,IAAO,OAAS,OAASA,EAAG,aAAa,KAAK,gBAAiB4S,EAAE,WAAW,CAAG,CAAC,CAC3K,EACA,QAAS,CACL,KAAK,8BAA8B,EACnC,KAAK,eAAe,QAASA,GAAMA,EAAE,OAAO,KAAK,eAAe,CAAC,CACrE,EACA,QAAS,CACL,KAAK,eAAe,QAASA,GAAM,CAAE,IAAI5S,EAAI,OAAQA,EAAK4S,EAAE,iBAAmB,MAAQ5S,IAAO,OAAS,OAASA,EAAG,aAAa,KAAK,gBAAiB4S,CAAC,CAAG,CAAC,CAC/J,EACA,SAAU,CACN,KAAK,8BAA8B,EACnC,KAAK,eAAe,QAASA,GAAMA,EAAE,QAAQ,KAAK,eAAe,CAAC,CACtE,EACA,QAAS,CACL,KAAK,eAAe,QAASA,GAAMA,EAAE,OAAO,CAAC,CACjD,EACA,SAAU,CACN,KAAK,eAAe,QAASA,GAAMA,EAAE,YAAY,KAAK,eAAe,CAAC,CAC1E,EACA,QAAS,CACL,KAAK,eAAe,QAASA,GAAMA,EAAE,gBAAgB,KAAK,eAAe,CAAC,CAC9E,CACJ,EAEMnE,GAAU,IAAIiD,GACdmB,GAAQ,IAAIH,GAAMjE,EAAO,EACzB,CAAE,UAAWqE,EAAY,EAAIrE,GACnC,SAASsE,IAAQ,CACbtE,GAAQ,MAAM,CAClB,CACA,SAASuE,GAAgBrB,EAAS,CAC9BlD,GAAQ,gBAAgBkD,CAAO,CACnC,CACA,SAASjD,GAAMxN,EAAU+H,EAAS,CAC9BwF,GAAQ,MAAMvN,EAAU+H,CAAO,CACnC,CACA,SAASgK,GAAoBnG,EAAQ,CACjC2B,GAAQ,oBAAoB3B,CAAM,CACtC,CACA,SAASoG,GAAuBpG,EAAQ,CACpC2B,GAAQ,uBAAuB3B,CAAM,CACzC,CACA,SAASqG,GAAoBhU,EAAS,CAClCsP,GAAQ,oBAAoBtP,CAAO,CACvC,CACA,SAASiU,IAAa,CAClB,QAAQ,KAAK,yJAAyJ,EACtK3E,GAAQ,WAAW,CACvB,CACA,SAAS4E,GAAoBzB,EAAO,CAChCnD,GAAQ,oBAAoBmD,CAAK,CACrC,CACA,SAAS0B,GAAiBC,EAAe,CACrClN,GAAe,cAAgBkN,CACnC,CACA,SAASC,GAAY3B,EAAM,CACvBpD,GAAQ,YAAYoD,CAAI,CAC5B,CAEA,IAAI4B,GAAqB,OAAO,OAAO,CACnC,UAAW,KACX,UAAWX,GACX,QAASrE,GACT,MAAOoE,GACP,aAAc7B,GACd,aAAczE,GACd,cAAe3B,GACf,MAAOmI,GACP,gBAAiBC,GACjB,MAAOtE,GACP,oBAAqBuE,GACrB,uBAAwBC,GACxB,oBAAqBC,GACrB,WAAYC,GACZ,oBAAqBC,GACrB,iBAAkBC,GAClB,YAAaE,GACb,cAAeb,EACnB,CAAC,EAEKe,GAAN,KAAsB,CAClB,YAAYlU,EAAS,CACjB,KAAK,oBAAuBmU,GAAmB,CAAE,EACjD,KAAK,oBAAsB,KAC3B,KAAK,oBAAsB,IAAM,CAAE,EACnC,KAAK,UAAY,GACjB,KAAK,cAAgB,GACrB,KAAK,kBAAoB,IAAI,IAC7B,KAAK,OAAS,KACd,KAAK,oBAAsB,CAAC,CAAE,QAAAnU,CAAQ,IAAM,CACxC,IAAMyP,EAAQzP,EAAQ,cAAc,IAAM,KAAK,QAAQ,EAAE,EACrDyP,GAAS,KAAK,sBACdA,EAAM,gBAAgB,GAAG,KAAK,qBAAqB,QAAQ,EAE/D,OAAO,KAAK,oBAChB,EACA,KAAK,QAAUzP,EACf,KAAK,KAAO,IAAI2J,GAAU,KAAM,KAAK,OAAO,EAC5C,KAAK,mBAAqB,IAAI1D,GAAmB,KAAM,KAAK,OAAO,EACnE,KAAK,sBAAwB,IAAIgE,GAAsB,KAAM,KAAK,OAAO,EACzE,KAAK,gBAAkB,IAAIL,GAAgB,KAAM,KAAK,OAAO,EAC7D,KAAK,sBAAwBvF,GAAK,EAClC,KAAK,mBAAqB,IAAIyE,GAAmB,KAAM,KAAK,OAAO,CACvE,CACA,SAAU,CACD,KAAK,YACN,KAAK,UAAY,GACb,KAAK,cAAgB1I,GAAkB,KACvC,KAAK,mBAAmB,MAAM,EAG9B,KAAK,cAAc,EAEvB,KAAK,sBAAsB,MAAM,EACjC,KAAK,gBAAgB,MAAM,EAC3B,KAAK,mBAAmB,MAAM,EAEtC,CACA,YAAa,CACL,KAAK,YACL,KAAK,UAAY,GACjB,KAAK,mBAAmB,KAAK,EAC7B,KAAK,sBAAsB,KAAK,EAChC,KAAK,gBAAgB,KAAK,EAC1B,KAAK,mBAAmB,KAAK,EAErC,CACA,iBAAkB,CACV,KAAK,cAAgBA,GAAkB,OACvC,KAAK,cAAc,CAE3B,CACA,kBAAmB,CACX,KAAK,oBAAoB,KAAK,IAE9B,KAAK,QAAQ,cACb,KAAK,SAAW,KAEhB,KAAK,cAAgBA,GAAkB,OAAS,KAAK,gBACrD,KAAK,cAAc,EAE3B,CACA,mBAAoB,CAChB,GAAM,CAAE,IAAAgU,CAAI,EAAI,KAAK,QACrB,YAAK,2BAA2B,WAAY,IAAM,CAC9C,KAAK,QAAQ,gBAAgB,UAAU,CAC3C,CAAC,EACD,KAAK,QAAQ,IAAM,KACnB,KAAK,QAAQ,IAAMA,EACZ,KAAK,QAAQ,MACxB,CACA,iBAAkB,CACV,KAAK,oBAAoB,UAAU,GAEvC,KAAK,cAAc,CACvB,CACA,qBAAsB,CACd,KAAK,cAAgBhU,GAAkB,KACvC,KAAK,mBAAmB,MAAM,GAG9B,KAAK,mBAAmB,KAAK,EAC7B,KAAK,cAAc,EAE3B,CACA,MAAM,eAAgB,CACd,KAAK,SAAW,KAAK,UAAY,CAAC,KAAK,UAAY,KAAK,YACxD,KAAK,QAAQ,OAAS,KAAK,MAAMO,GAAU,KAAK,SAAS,CAAC,EAC1D,KAAK,mBAAmB,KAAK,EAC7B,MAAM,KAAK,QAAQ,OACnB,KAAK,cAAgB,GAE7B,CACA,MAAM,aAAamF,EAAe,EAC1BA,EAAc,YAAeA,EAAc,WAAaA,EAAc,UACtE,KAAK,UAAYA,EAAc,SAAS,KAE5C,GAAI,CACA,IAAM/C,EAAO,MAAM+C,EAAc,aACjC,GAAI/C,EAAM,CACN,GAAM,CAAE,KAAA2C,CAAK,EAAIjC,GAAkBV,CAAI,EACjCsR,EAAkB,MAAM,KAAK,2BAA2B3O,CAAI,EAClE,GAAI2O,EAAiB,CACjB,IAAM5L,EAAW,IAAIL,GAASiM,CAAe,EACvChL,EAAW,IAAI+B,GAAc,KAAM,KAAK,KAAK,SAAU3C,EAAU2C,GAAc,cAAe,GAAO,EAAK,EAC5G,KAAK,KAAK,eACV,MAAM,KAAK,KAAK,cACpB,KAAK,cAAc,EACnB,MAAM,KAAK,KAAK,OAAO/B,CAAQ,EAC/B,KAAK,SAAW,GAChB4F,GAAQ,cAAcnJ,EAAe,KAAK,OAAO,EACjDmJ,GAAQ,YAAY,KAAK,OAAO,EAChC,KAAK,oBAAoBnJ,CAAa,CAC1C,MACS,KAAK,mCAAmCA,CAAa,IAC1D,QAAQ,KAAK,yBAAyB,KAAK,QAAQ,sEAAsE,EACzH,KAAK,cAAcA,EAAc,QAAQ,EAEjD,CACJ,OACOD,EAAP,CACI,QAAQ,MAAMA,CAAK,EACnB,KAAK,KAAK,WAAW,CACzB,QACA,CACI,KAAK,oBAAsB,IAAM,CAAE,CACvC,CACJ,CACA,0BAA0BqB,EAAU,CAChC,KAAK,cAAc,CACvB,CACA,6BAA6B6C,EAAM,CAC/B,OAAO,KAAK,0BAA0BA,CAAI,CAC9C,CACA,4BAA4BA,EAAMyF,EAAWhQ,EAAM,CAC/C,IAAMiQ,EAAQ,KAAK,iBAAiB1F,CAAI,EACpC0F,GACAjQ,EAAK,aAAa,mBAAoBiQ,EAAM,EAAE,CACtD,CACA,yBAAyBzP,EAASwP,EAAW3F,EAAQ,CACjD,OAAO,KAAK,0BAA0B7J,CAAO,CACjD,CACA,qBAAqBA,EAAS0B,EAAU,CACpC,KAAK,cAAc1B,EAAS0B,CAAQ,CACxC,CACA,eAAe1B,EAASV,EAAW,CAC/B,OAAOU,EAAQ,QAAQ,aAAa,GAAK,KAAK,SAAW,KAAK,0BAA0BA,EAASV,CAAS,CAC9G,CACA,cAAcU,EAASV,EAAW,CAC1B,KAAK,gBACL,KAAK,eAAe,KAAK,EAE7B,KAAK,eAAiB,IAAIuH,GAAe,KAAM7G,EAASV,CAAS,EACjE,GAAM,CAAE,aAAAgV,CAAa,EAAI,KAAK,eAC9B,KAAK,yBAAyBA,EAAa,QAASA,CAAY,EAChE,KAAK,eAAe,MAAM,CAC9B,CACA,yBAAyB5M,EAASC,EAAS,CACvC,IAAInH,EACJkH,EAAQ,eAAiB,KAAK,GACzB,GAAAlH,EAAK,KAAK,4BAA8B,MAAQA,IAAO,SAAkBA,EAAG,aAAa,mBAAmB,GAC7GmH,EAAQ,mBAAmBvB,GAAc,WAAW,CAE5D,CACA,eAAe0B,EAAU,CACrBnD,GAAW,KAAK,OAAO,CAC3B,CACA,iCAAiCmD,EAAU6G,EAAW,CAClD,KAAK,oBAAoB,CAC7B,CACA,MAAM,6BAA6BhH,EAAStF,EAAU,CAClD,MAAM,KAAK,aAAaA,CAAQ,EAChC,KAAK,oBAAoB,CAC7B,CACA,MAAM,0BAA0BsF,EAAStF,EAAU,CAC/C,QAAQ,MAAMA,CAAQ,EACtB,MAAM,KAAK,aAAaA,CAAQ,EAChC,KAAK,oBAAoB,CAC7B,CACA,eAAesF,EAAS9B,EAAO,CAC3B,QAAQ,MAAMA,CAAK,EACnB,KAAK,oBAAoB,CAC7B,CACA,gBAAgBiC,EAAU,CACtBlD,GAAe,KAAK,OAAO,CAC/B,CACA,sBAAsB,CAAE,YAAAkC,CAAY,EAAG,CACnCnC,GAAWmC,EAAa,KAAK,iBAAiBA,CAAW,CAAC,CAC9D,CACA,oCAAoCmJ,EAAgB5N,EAAU,CAC1D,IAAMoN,EAAQ,KAAK,iBAAiBQ,EAAe,YAAaA,EAAe,SAAS,EACxFR,EAAM,SAAS,kCAAkCA,EAAOQ,EAAe,YAAaA,EAAe,SAAS,EAC5GR,EAAM,SAAS,aAAapN,CAAQ,CACxC,CACA,iCAAiC4N,EAAgBnK,EAAe,CAC5D,KAAK,QAAQ,SAAS,aAAaA,CAAa,CACpD,CACA,sBAAsBmK,EAAgBpK,EAAO,CACzC,QAAQ,MAAMA,CAAK,CACvB,CACA,uBAAuB,CAAE,YAAAiB,CAAY,EAAG,CACpClC,GAAekC,EAAa,KAAK,iBAAiBA,CAAW,CAAC,CAClE,CACA,sBAAsB,CAAE,QAASyN,CAAS,EAAG9K,EAAS,CAClD,IAAMtJ,EAAQ8C,GAAS,4BAA6B,CAChD,OAAQ,KAAK,QACb,OAAQ,OAAO,OAAO,CAAE,SAAAsR,CAAS,EAAG9K,CAAO,EAC3C,WAAY,EAChB,CAAC,EACK,CAAE,iBAAA8I,EAAkB,OAAQ,CAAE,OAAAC,CAAO,CAAG,EAAIrS,EAClD,OAAI,KAAK,KAAK,UAAYqS,IACtB,KAAK,KAAK,SAAS,cAAgBA,GAEhC,CAACD,CACZ,CACA,qBAAqBE,EAAWC,EAAY,CAAE,CAC9C,0BAA0B1S,EAAS,CAC/BiP,GAAQ,0BAA0BjP,CAAO,CAC7C,CACA,iBAAkB,CAAE,CACpB,gBAAgBqL,EAAgBmJ,EAAa,CACzC,KAAK,qBAAuBnJ,EAAe,UAAU,EAAI,CAC7D,CACA,MAAM,MAAMvK,EAAK,CACb,IAAIN,EACJ,IAAMmH,EAAU,IAAInC,GAAa,KAAMH,GAAY,IAAKvE,EAAK,IAAI,gBAAmB,KAAK,OAAO,EAChG,OAACN,EAAK,KAAK,uBAAyB,MAAQA,IAAO,QAAkBA,EAAG,OAAO,EAC/E,KAAK,oBAAsBmH,EACpB,IAAI,QAASrE,GAAY,CAC5B,KAAK,oBAAsB,IAAM,CAC7B,KAAK,oBAAsB,IAAM,CAAE,EACnC,KAAK,oBAAsB,KAC3BA,EAAQ,CACZ,EACAqE,EAAQ,QAAQ,CACpB,CAAC,CACL,CACA,cAAc3H,EAASc,EAAKxB,EAAW,CACnC,IAAMmQ,EAAQ,KAAK,iBAAiBzP,EAASV,CAAS,EACtD,KAAK,aAAeyN,GAAa,YAAY0C,CAAK,EAAE,MAAM,EAC1DA,EAAM,SAAS,kCAAkCA,EAAOzP,EAASV,CAAS,EAC1E,KAAK,6BAA6BU,EAAS,IAAM,CAC7CyP,EAAM,IAAM3O,CAChB,CAAC,CACL,CACA,kCAAkC2O,EAAOzP,EAASV,EAAW,CAEzD,GADA,KAAK,OAAS2F,GAAe3F,EAAWU,EAASyP,CAAK,EAClDnN,GAAS,KAAK,MAAM,EAAG,CACvB,GAAM,CAAE,oBAAA6L,CAAoB,EAAIsB,EAAM,SACtCA,EAAM,SAAS,oBAAuB3J,GAAkB,CACpD,GAAI2J,EAAM,IAAK,CACX,GAAM,CAAE,WAAAjB,EAAY,WAAAI,CAAW,EAAI9I,EAC7B4I,EAAee,EAAM,cAAc,gBAAgB,UAEnDhG,EAAU,CACZ,SAFa,CAAE,WAAA+E,EAAY,WAAAI,EAAY,aAAAF,CAAa,EAGpD,oBAAAP,EACA,WAAY,GACZ,cAAe,GACf,sBAAuB,KAAK,sBAC5B,SAAU,KAAK,YACnB,EACI,KAAK,SACL1E,EAAQ,OAAS,KAAK,QAC1BwF,GAAQ,MAAMQ,EAAM,IAAKhG,CAAO,CACpC,CACJ,CACJ,CACJ,CACA,eAAgB,CACZ,GAAI,KAAK,OAAQ,CACb,IAAMlE,EAASP,GAA0B,KAAK,MAAM,EACpDiK,GAAQ,QAAQ,OAAO1J,EAAQ5E,GAAU,KAAK,QAAQ,KAAO,EAAE,EAAG,KAAK,qBAAqB,CAChG,CACJ,CACA,mCAAmCmF,EAAe,CAC9C,KAAK,QAAQ,aAAa,WAAY,EAAE,EACxC,IAAMzD,EAAWyD,EAAc,SACzBoJ,EAAQ,MAAOpO,EAAK2I,EAAU,CAAC,IAAM,CACnC3I,aAAe,SACf,KAAK,cAAcA,CAAG,EAGtBmO,GAAQ,MAAMnO,EAAK2I,CAAO,CAElC,EAMA,MAAO,CALOxG,GAAS,sBAAuB,CAC1C,OAAQ,KAAK,QACb,OAAQ,CAAE,SAAAZ,EAAU,MAAA6M,CAAM,EAC1B,WAAY,EAChB,CAAC,EACa,gBAClB,CACA,MAAM,cAAc7M,EAAU,CAC1B,IAAMoS,EAAU,IAAIrS,GAAcC,CAAQ,EACpCqM,EAAe,MAAM+F,EAAQ,aAC7B,CAAE,SAAA/S,EAAU,WAAAkN,EAAY,WAAAJ,CAAW,EAAIiG,EAC7C,OAAOxF,GAAQ,MAAMvN,EAAU,CAAE,SAAU,CAAE,WAAAkN,EAAY,WAAAJ,EAAY,aAAAE,CAAa,CAAE,CAAC,CACzF,CACA,iBAAiB1O,EAASV,EAAW,CACjC,IAAIkB,EACJ,IAAM+H,EAAKhE,GAAa,mBAAoBjF,EAAWU,CAAO,GAAK,KAAK,QAAQ,aAAa,QAAQ,EACrG,OAAQQ,EAAKkU,GAAoBnM,CAAE,KAAO,MAAQ/H,IAAO,OAASA,EAAK,KAAK,OAChF,CACA,MAAM,2BAA2BuS,EAAW,CACxC,IAAI/S,EACEuI,EAAK,IAAI,OAAO,KAAK,EAAE,EAC7B,GAAI,CAEA,GADAvI,EAAU2U,GAAgB5B,EAAU,cAAc,eAAexK,GAAI,EAAG,KAAK,SAAS,EAClFvI,EACA,OAAOA,EAGX,GADAA,EAAU2U,GAAgB5B,EAAU,cAAc,6BAA6BxK,IAAK,EAAG,KAAK,SAAS,EACjGvI,EACA,aAAMA,EAAQ,OACP,MAAM,KAAK,2BAA2BA,CAAO,CAE5D,OACO6F,EAAP,CACI,eAAQ,MAAMA,CAAK,EACZ,IAAIxF,EACf,CACA,OAAO,IACX,CACA,sBAAsBb,EAAMF,EAAW,CACnC,IAAM2B,EAASD,GAAUxB,EAAMF,CAAS,EACxC,OAAOmC,GAAoBd,GAAUM,CAAM,EAAG,KAAK,YAAY,CACnE,CACA,0BAA0BjB,EAASV,EAAW,CAC1C,IAAMiJ,EAAKhE,GAAa,mBAAoBjF,EAAWU,CAAO,GAAK,KAAK,QAAQ,aAAa,QAAQ,EAIrG,GAHIA,aAAmB,iBAAmB,CAAC,KAAK,sBAAsBA,EAASV,CAAS,GAGpF,CAAC,KAAK,SAAWiJ,GAAM,OACvB,MAAO,GAEX,GAAIA,EAAI,CACJ,IAAMiD,EAAekJ,GAAoBnM,CAAE,EAC3C,GAAIiD,EACA,MAAO,CAACA,EAAa,QAE7B,CAIA,MAHI,GAACyD,GAAQ,qBAAqBjP,CAAO,GAGrCV,GAAa,CAAC2P,GAAQ,qBAAqB3P,CAAS,EAI5D,CACA,IAAI,IAAK,CACL,OAAO,KAAK,QAAQ,EACxB,CACA,IAAI,SAAU,CACV,MAAO,CAAC,KAAK,QAAQ,QACzB,CACA,IAAI,WAAY,CACZ,GAAI,KAAK,QAAQ,IACb,OAAO,KAAK,QAAQ,GAE5B,CACA,IAAI,UAAUsV,EAAW,CACrB,KAAK,2BAA2B,MAAO,IAAM,CACzC,KAAK,QAAQ,IAAMA,GAAyD,IAChF,CAAC,CACL,CACA,IAAI,cAAe,CACf,OAAO,KAAK,QAAQ,OACxB,CACA,IAAI,WAAY,CACZ,OAAO,KAAK,iBAAmB,QAAa,KAAK,oBAAoB,IAAM,MAC/E,CACA,IAAI,UAAW,CACX,OAAO,KAAK,QAAQ,aAAa,UAAU,CAC/C,CACA,IAAI,SAAStU,EAAO,CAChB,KAAK,2BAA2B,WAAY,IAAM,CAC1CA,EACA,KAAK,QAAQ,aAAa,WAAY,EAAE,EAGxC,KAAK,QAAQ,gBAAgB,UAAU,CAE/C,CAAC,CACL,CACA,IAAI,UAAW,CACX,OAAO,KAAK,QAAQ,UAAY,KAAK,SACzC,CACA,IAAI,cAAe,CACf,IAAIE,EACJ,IAAMkP,EAAO,KAAK,QAAQ,cAAc,cAAc,yBAAyB,EACzEjC,GAAQjN,EAAiDkP,GAAK,WAAa,MAAQlP,IAAO,OAASA,EAAK,IAC9G,OAAOG,GAAU8M,CAAI,CACzB,CACA,oBAAoBjJ,EAAe,CAC/B,OAAO,KAAK,kBAAkB,IAAIA,CAAa,CACnD,CACA,2BAA2BA,EAAe+F,EAAU,CAChD,KAAK,kBAAkB,IAAI/F,CAAa,EACxC+F,EAAS,EACT,KAAK,kBAAkB,OAAO/F,CAAa,CAC/C,CACA,6BAA6BxE,EAASuK,EAAU,CAC5C,KAAK,yBAA2BvK,EAChCuK,EAAS,EACT,OAAO,KAAK,wBAChB,CACJ,EACA,SAASmK,GAAoBnM,EAAI,CAC7B,GAAIA,GAAM,KAAM,CACZ,IAAMvI,EAAU,SAAS,eAAeuI,CAAE,EAC1C,GAAIvI,aAAmBK,GACnB,OAAOL,CAEf,CACJ,CACA,SAAS2U,GAAgB3U,EAAS6U,EAAY,CAC1C,GAAI7U,EAAS,CACT,IAAMoU,EAAMpU,EAAQ,aAAa,KAAK,EACtC,GAAIoU,GAAO,MAAQS,GAAc,MAAQ9S,GAAaqS,EAAKS,CAAU,EACjE,MAAM,IAAI,MAAM,6BAA6B7U,EAAQ,uDAAuD,EAKhH,GAHIA,EAAQ,gBAAkB,WAC1BA,EAAU,SAAS,WAAWA,EAAS,EAAI,GAE3CA,aAAmBK,GACnB,OAAAL,EAAQ,kBAAkB,EAC1BA,EAAQ,qBAAqB,EACtBA,CAEf,CACJ,CAEA,IAAM8U,GAAN,cAA4B,WAAY,CACpC,aAAa,cAAcxJ,EAAY,CACnC,MAAMA,EAAW,cAAc,CACnC,CACA,MAAM,mBAAoB,CACtB,GAAI,CACA,MAAM,KAAK,OAAO,CACtB,OACOzF,EAAP,CACI,QAAQ,MAAMA,CAAK,CACvB,QACA,CACI,KAAK,WAAW,CACpB,CACJ,CACA,MAAM,QAAS,CACX,IAAIrF,EACJ,OAASA,EAAK,KAAK,iBAAmB,MAAQA,IAAO,OAASA,EAAM,KAAK,eAAiB,SAAY,CAClG,IAAML,EAAQ,KAAK,kBACf,KAAK,cAAcA,CAAK,IACxB,MAAMkD,GAAmB,EACzB,MAAMlD,EAAM,OAAO,OAAO,IAAI,EAEtC,GAAG,CACP,CACA,YAAa,CACT,GAAI,CACA,KAAK,OAAO,CAChB,MACA,CAAa,CACjB,CACA,+BAAgC,CAC5B,KAAK,kBAAkB,QAAS4U,GAAMA,EAAE,OAAO,CAAC,CACpD,CACA,IAAI,mBAAoB,CACpB,IAAIvU,EACJ,IAAMwU,EAAmB,KAAK,eAAe,QAAS5B,GAAM,CAAC,GAAGA,EAAE,QAAQ,CAAC,EAAE,OAAQ2B,GAAM,CAAC,CAACA,EAAE,EAAE,EAC3FE,EAAiB,CAAC,KAAMzU,EAAK,KAAK,mBAAqB,MAAQA,IAAO,OAAS,OAASA,EAAG,WAAa,CAAC,CAAE,EAAE,OAAQuU,GAAM,CAAC,CAACA,EAAE,EAAE,EAAE,IAAKA,GAAMA,EAAE,EAAE,EACxJ,OAAOC,EAAiB,OAAQD,GAAME,EAAe,SAASF,EAAE,EAAE,CAAC,CACvE,CACA,IAAI,eAAgB,CAChB,GAAI,KAAK,OAAQ,CACb,IAAMG,EAAiB/B,GAAc,KAAK,QAC1C,GAAI+B,EACA,OAAOA,EAEX,KAAK,MAAM,gBAAgB,CAC/B,CACA,KAAK,MAAM,6BAA6B,CAC5C,CACA,IAAI,gBAAiB,CACjB,GAAI,KAAK,OACL,OAAO,KAAK,mBAEX,GAAI,KAAK,QACV,OAAO,KAAK,sBAGZ,KAAK,MAAM,wCAAwC,CAE3D,CACA,IAAI,iBAAkB,CAClB,OAAO,KAAK,gBAAgB,QAAQ,UAAU,EAAI,CACtD,CACA,IAAI,iBAAkB,CAClB,GAAI,KAAK,oBAAsB,KAAM,CACjC,IAAMlS,EAAW,KAAK,cAAc,cAAc,UAAU,EAC5D,YAAK,YAAYA,CAAQ,EAClBA,CACX,SACS,KAAK,6BAA6B,oBACvC,OAAO,KAAK,kBAEhB,KAAK,MAAM,kDAAkD,CACjE,CACA,IAAI,QAAS,CACT,OAAO,KAAK,aAAa,QAAQ,CACrC,CACA,IAAI,QAAS,CACT,OAAO,KAAK,aAAa,QAAQ,CACrC,CACA,IAAI,SAAU,CACV,OAAO,KAAK,aAAa,SAAS,CACtC,CACA,MAAMrD,EAAS,CACX,MAAM,IAAI,MAAM,GAAG,KAAK,gBAAgBA,GAAS,CACrD,CACA,IAAI,aAAc,CACd,IAAIa,EAAIC,EACR,OAAQA,IAAOD,EAAK,KAAK,UAAU,MAAM,SAAS,KAAO,MAAQA,IAAO,OAASA,EAAK,CAAC,GAAG,MAAQ,MAAQC,IAAO,OAASA,EAAK,gBACnI,CACA,IAAI,mBAAoB,CACpB,OAAO,IAAI,YAAY,6BAA8B,CACjD,QAAS,GACT,WAAY,GACZ,OAAQ,CAAE,UAAW,KAAM,OAAQqU,GAAc,aAAc,CACnE,CAAC,CACL,CACA,IAAI,oBAAqB,CACrB,IAAItU,EACJ,IAAMR,GAAWQ,EAAK,KAAK,iBAAmB,MAAQA,IAAO,OAAS,OAASA,EAAG,eAAe,KAAK,MAAM,EAC5G,OAAIR,IAAY,KACL,CAACA,CAAO,EAGR,CAAC,CAEhB,CACA,IAAI,uBAAwB,CACxB,IAAIQ,EACJ,IAAMiE,GAAYjE,EAAK,KAAK,iBAAmB,MAAQA,IAAO,OAAS,OAASA,EAAG,iBAAiB,KAAK,OAAO,EAChH,OAAIiE,EAAS,SAAW,EACb,MAAM,UAAU,MAAM,KAAKA,CAAQ,EAGnC,CAAC,CAEhB,CACJ,EAEM0Q,GAAN,cAAkC,WAAY,CAC1C,aAAc,CACV,MAAM,GAAG,SAAS,EAClB,KAAK,aAAe,IACxB,CACA,mBAAoB,CAChB,KAAK,aAAe,KAAK,IAAI,MAAM,WAAW,EAAI,IAAI,UAAU,KAAK,GAAG,EAAI,IAAI,YAAY,KAAK,GAAG,EACpG1B,GAAoB,KAAK,YAAY,CACzC,CACA,sBAAuB,CACf,KAAK,cACLC,GAAuB,KAAK,YAAY,CAEhD,CACA,IAAI,KAAM,CACN,OAAO,KAAK,aAAa,KAAK,GAAK,EACvC,CACJ,EAEArT,GAAa,oBAAsB6T,GAC/B,eAAe,IAAI,aAAa,IAAM,QACtC,eAAe,OAAO,cAAe7T,EAAY,EAEjD,eAAe,IAAI,cAAc,IAAM,QACvC,eAAe,OAAO,eAAgByU,EAAa,EAEnD,eAAe,IAAI,qBAAqB,IAAM,QAC9C,eAAe,OAAO,sBAAuBK,EAAmB,GAGnE,IAAM,CACH,IAAInV,EAAU,SAAS,cACvB,GAAKA,GAED,CAAAA,EAAQ,aAAa,6BAA6B,EAGtD,IADAA,EAAUA,EAAQ,cACXA,GAAS,CACZ,GAAIA,GAAW,SAAS,KACpB,OAAO,QAAQ,KAAK0D;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,QASvB1D,EAAQ,SAAS,EAElBA,EAAUA,EAAQ,aACtB,CACJ,GAAG,EAEH,OAAO,MAAQiU,GACfV,GAAM,EC5wHN,IAAM6B,GAAN,KAAoB,CAChB,YAAYC,EAAaC,EAAWC,EAAc,CAC9C,KAAK,YAAcF,EACnB,KAAK,UAAYC,EACjB,KAAK,aAAeC,EACpB,KAAK,kBAAoB,IAAI,GACjC,CACA,SAAU,CACN,KAAK,YAAY,iBAAiB,KAAK,UAAW,KAAM,KAAK,YAAY,CAC7E,CACA,YAAa,CACT,KAAK,YAAY,oBAAoB,KAAK,UAAW,KAAM,KAAK,YAAY,CAChF,CACA,iBAAiBC,EAAS,CACtB,KAAK,kBAAkB,IAAIA,CAAO,CACtC,CACA,oBAAoBA,EAAS,CACzB,KAAK,kBAAkB,OAAOA,CAAO,CACzC,CACA,YAAYC,EAAO,CACf,IAAMC,EAAgBC,GAAYF,CAAK,EACvC,QAAWD,KAAW,KAAK,SAAU,CACjC,GAAIE,EAAc,4BACd,MAGAF,EAAQ,YAAYE,CAAa,CAEzC,CACJ,CACA,aAAc,CACV,OAAO,KAAK,kBAAkB,KAAO,CACzC,CACA,IAAI,UAAW,CACX,OAAO,MAAM,KAAK,KAAK,iBAAiB,EAAE,KAAK,CAACE,EAAMC,IAAU,CAC5D,IAAMC,EAAYF,EAAK,MAAOG,EAAaF,EAAM,MACjD,OAAOC,EAAYC,EAAa,GAAKD,EAAYC,EAAa,EAAI,CACtE,CAAC,CACL,CACJ,EACA,SAASJ,GAAYF,EAAO,CACxB,GAAI,gCAAiCA,EACjC,OAAOA,EAEN,CACD,GAAM,CAAE,yBAAAO,CAAyB,EAAIP,EACrC,OAAO,OAAO,OAAOA,EAAO,CACxB,4BAA6B,GAC7B,0BAA2B,CACvB,KAAK,4BAA8B,GACnCO,EAAyB,KAAK,IAAI,CACtC,CACJ,CAAC,CACL,CACJ,CAEA,IAAMC,GAAN,KAAiB,CACb,YAAYC,EAAa,CACrB,KAAK,YAAcA,EACnB,KAAK,kBAAoB,IAAI,IAC7B,KAAK,QAAU,EACnB,CACA,OAAQ,CACC,KAAK,UACN,KAAK,QAAU,GACf,KAAK,eAAe,QAASC,GAAkBA,EAAc,QAAQ,CAAC,EAE9E,CACA,MAAO,CACC,KAAK,UACL,KAAK,QAAU,GACf,KAAK,eAAe,QAASA,GAAkBA,EAAc,WAAW,CAAC,EAEjF,CACA,IAAI,gBAAiB,CACjB,OAAO,MAAM,KAAK,KAAK,kBAAkB,OAAO,CAAC,EAAE,OAAO,CAACC,EAAWC,IAAQD,EAAU,OAAO,MAAM,KAAKC,EAAI,OAAO,CAAC,CAAC,EAAG,CAAC,CAAC,CAChI,CACA,iBAAiBb,EAAS,CACtB,KAAK,6BAA6BA,CAAO,EAAE,iBAAiBA,CAAO,CACvE,CACA,oBAAoBA,EAASc,EAAsB,GAAO,CACtD,KAAK,6BAA6Bd,CAAO,EAAE,oBAAoBA,CAAO,EAClEc,GACA,KAAK,8BAA8Bd,CAAO,CAClD,CACA,YAAYe,EAAOC,EAASC,EAAS,CAAC,EAAG,CACrC,KAAK,YAAY,YAAYF,EAAO,SAASC,IAAWC,CAAM,CAClE,CACA,8BAA8BjB,EAAS,CACnC,IAAMW,EAAgB,KAAK,6BAA6BX,CAAO,EAC1DW,EAAc,YAAY,IAC3BA,EAAc,WAAW,EACzB,KAAK,6BAA6BX,CAAO,EAEjD,CACA,6BAA6BA,EAAS,CAClC,GAAM,CAAE,YAAAH,EAAa,UAAAC,EAAW,aAAAC,CAAa,EAAIC,EAC3CkB,EAAmB,KAAK,oCAAoCrB,CAAW,EACvEsB,EAAW,KAAK,SAASrB,EAAWC,CAAY,EACtDmB,EAAiB,OAAOC,CAAQ,EAC5BD,EAAiB,MAAQ,GACzB,KAAK,kBAAkB,OAAOrB,CAAW,CACjD,CACA,6BAA6BG,EAAS,CAClC,GAAM,CAAE,YAAAH,EAAa,UAAAC,EAAW,aAAAC,CAAa,EAAIC,EACjD,OAAO,KAAK,mBAAmBH,EAAaC,EAAWC,CAAY,CACvE,CACA,mBAAmBF,EAAaC,EAAWC,EAAc,CACrD,IAAMmB,EAAmB,KAAK,oCAAoCrB,CAAW,EACvEsB,EAAW,KAAK,SAASrB,EAAWC,CAAY,EAClDY,EAAgBO,EAAiB,IAAIC,CAAQ,EACjD,OAAKR,IACDA,EAAgB,KAAK,oBAAoBd,EAAaC,EAAWC,CAAY,EAC7EmB,EAAiB,IAAIC,EAAUR,CAAa,GAEzCA,CACX,CACA,oBAAoBd,EAAaC,EAAWC,EAAc,CACtD,IAAMY,EAAgB,IAAIf,GAAcC,EAAaC,EAAWC,CAAY,EAC5E,OAAI,KAAK,SACLY,EAAc,QAAQ,EAEnBA,CACX,CACA,oCAAoCd,EAAa,CAC7C,IAAIqB,EAAmB,KAAK,kBAAkB,IAAIrB,CAAW,EAC7D,OAAKqB,IACDA,EAAmB,IAAI,IACvB,KAAK,kBAAkB,IAAIrB,EAAaqB,CAAgB,GAErDA,CACX,CACA,SAASpB,EAAWC,EAAc,CAC9B,IAAMqB,EAAQ,CAACtB,CAAS,EACxB,cAAO,KAAKC,CAAY,EACnB,KAAK,EACL,QAASsB,GAAQ,CAClBD,EAAM,KAAK,GAAGrB,EAAasB,GAAO,GAAK,MAAMA,GAAK,CACtD,CAAC,EACMD,EAAM,KAAK,GAAG,CACzB,CACJ,EAEME,GAAiC,CACnC,KAAK,CAAE,MAAArB,EAAO,MAAAsB,CAAM,EAAG,CACnB,OAAIA,GACAtB,EAAM,gBAAgB,EACnB,EACX,EACA,QAAQ,CAAE,MAAAA,EAAO,MAAAsB,CAAM,EAAG,CACtB,OAAIA,GACAtB,EAAM,eAAe,EAClB,EACX,EACA,KAAK,CAAE,MAAAA,EAAO,MAAAsB,EAAO,QAAAC,CAAQ,EAAG,CAC5B,OAAID,EACOC,IAAYvB,EAAM,OAGlB,EAEf,CACJ,EACMwB,GAAoB,gFAC1B,SAASC,GAA4BC,EAAkB,CAEnD,IAAMC,EADSD,EAAiB,KAAK,EACd,MAAMF,EAAiB,GAAK,CAAC,EAChD3B,EAAY8B,EAAQ,GACpBC,EAAYD,EAAQ,GACxB,OAAIC,GAAa,CAAC,CAAC,UAAW,QAAS,UAAU,EAAE,SAAS/B,CAAS,IACjEA,GAAa,IAAI+B,IACjBA,EAAY,IAET,CACH,YAAaC,GAAiBF,EAAQ,EAAE,EACxC,UAAA9B,EACA,aAAc8B,EAAQ,GAAKG,GAAkBH,EAAQ,EAAE,EAAI,CAAC,EAC5D,WAAYA,EAAQ,GACpB,WAAYA,EAAQ,GACpB,UAAAC,CACJ,CACJ,CACA,SAASC,GAAiBE,EAAiB,CACvC,GAAIA,GAAmB,SACnB,OAAO,OAEN,GAAIA,GAAmB,WACxB,OAAO,QAEf,CACA,SAASD,GAAkBhC,EAAc,CACrC,OAAOA,EACF,MAAM,GAAG,EACT,OAAO,CAACkC,EAASC,IAAU,OAAO,OAAOD,EAAS,CAAE,CAACC,EAAM,QAAQ,KAAM,EAAE,GAAI,CAAC,KAAK,KAAKA,CAAK,CAAE,CAAC,EAAG,CAAC,CAAC,CAChH,CACA,SAASC,GAAqBtC,EAAa,CACvC,GAAIA,GAAe,OACf,MAAO,SAEN,GAAIA,GAAe,SACpB,MAAO,UAEf,CAEA,SAASuC,GAASb,EAAO,CACrB,OAAOA,EAAM,QAAQ,sBAAuB,CAACc,EAAGC,IAASA,EAAK,YAAY,CAAC,CAC/E,CACA,SAASC,GAAkBhB,EAAO,CAC9B,OAAOa,GAASb,EAAM,QAAQ,MAAO,GAAG,EAAE,QAAQ,MAAO,GAAG,CAAC,CACjE,CACA,SAASiB,GAAWjB,EAAO,CACvB,OAAOA,EAAM,OAAO,CAAC,EAAE,YAAY,EAAIA,EAAM,MAAM,CAAC,CACxD,CACA,SAASkB,GAAUlB,EAAO,CACtB,OAAOA,EAAM,QAAQ,WAAY,CAACc,EAAGC,IAAS,IAAIA,EAAK,YAAY,GAAG,CAC1E,CACA,SAASI,GAASnB,EAAO,CACrB,OAAOA,EAAM,MAAM,SAAS,GAAK,CAAC,CACtC,CAEA,IAAMoB,GAAN,KAAa,CACT,YAAYnB,EAASoB,EAAOC,EAAYC,EAAQ,CAC5C,KAAK,QAAUtB,EACf,KAAK,MAAQoB,EACb,KAAK,YAAcC,EAAW,aAAerB,EAC7C,KAAK,UAAYqB,EAAW,WAAaE,GAA8BvB,CAAO,GAAKT,GAAM,oBAAoB,EAC7G,KAAK,aAAe8B,EAAW,cAAgB,CAAC,EAChD,KAAK,WAAaA,EAAW,YAAc9B,GAAM,oBAAoB,EACrE,KAAK,WAAa8B,EAAW,YAAc9B,GAAM,qBAAqB,EACtE,KAAK,UAAY8B,EAAW,WAAa,GACzC,KAAK,OAASC,CAClB,CACA,OAAO,SAASZ,EAAOY,EAAQ,CAC3B,OAAO,IAAI,KAAKZ,EAAM,QAASA,EAAM,MAAOR,GAA4BQ,EAAM,OAAO,EAAGY,CAAM,CAClG,CACA,UAAW,CACP,IAAME,EAAc,KAAK,UAAY,IAAI,KAAK,YAAc,GACtDnD,EAAc,KAAK,gBAAkB,IAAI,KAAK,kBAAoB,GACxE,MAAO,GAAG,KAAK,YAAYmD,IAAcnD,MAAgB,KAAK,cAAc,KAAK,YACrF,CACA,eAAeI,EAAO,CAClB,GAAI,CAAC,KAAK,UACN,MAAO,GAEX,IAAMgD,EAAW,KAAK,UAAU,MAAM,GAAG,EACnCC,EAAY,CAAC,OAAQ,OAAQ,MAAO,OAAO,EAC3C,CAACC,EAAMC,EAAMC,EAAKC,CAAK,EAAIJ,EAAU,IAAKK,GAAaN,EAAS,SAASM,CAAQ,CAAC,EACxF,GAAItD,EAAM,UAAYkD,GAAQlD,EAAM,UAAYmD,GAAQnD,EAAM,SAAWoD,GAAOpD,EAAM,WAAaqD,EAC/F,MAAO,GAEX,IAAME,EAAiBP,EAAS,OAAQ5B,GAAQ,CAAC6B,EAAU,SAAS7B,CAAG,CAAC,EAAE,GAC1E,OAAKmC,GAGA,OAAO,UAAU,eAAe,KAAK,KAAK,YAAaA,CAAc,GACtEzC,GAAM,gCAAgC,KAAK,WAAW,EAEnD,KAAK,YAAYyC,GAAgB,YAAY,IAAMvD,EAAM,IAAI,YAAY,GALrE,EAMf,CACA,IAAI,QAAS,CACT,IAAMwD,EAAS,CAAC,EACVC,EAAU,IAAI,OAAO,SAAS,KAAK,yBAA0B,GAAG,EACtE,OAAW,CAAE,KAAAC,EAAM,MAAApC,CAAM,IAAK,MAAM,KAAK,KAAK,QAAQ,UAAU,EAAG,CAC/D,IAAMqC,EAAQD,EAAK,MAAMD,CAAO,EAC1BrC,EAAMuC,GAASA,EAAM,GACvBvC,IACAoC,EAAOrB,GAASf,CAAG,GAAKwC,GAAStC,CAAK,EAE9C,CACA,OAAOkC,CACX,CACA,IAAI,iBAAkB,CAClB,OAAOtB,GAAqB,KAAK,WAAW,CAChD,CACA,IAAI,aAAc,CACd,OAAO,KAAK,OAAO,WACvB,CACJ,EACM2B,GAAoB,CACtB,EAAG,IAAM,QACT,OAAQ,IAAM,QACd,KAAM,IAAM,SACZ,QAAS,IAAM,SACf,MAAQC,GAAOA,EAAE,aAAa,MAAM,GAAK,SAAW,QAAU,QAC9D,OAAQ,IAAM,SACd,SAAU,IAAM,OACpB,EACA,SAAShB,GAA8BvB,EAAS,CAC5C,IAAMwC,EAAUxC,EAAQ,QAAQ,YAAY,EAC5C,GAAIwC,KAAWF,GACX,OAAOA,GAAkBE,GAASxC,CAAO,CAEjD,CACA,SAAST,GAAMC,EAAS,CACpB,MAAM,IAAI,MAAMA,CAAO,CAC3B,CACA,SAAS6C,GAAStC,EAAO,CACrB,GAAI,CACA,OAAO,KAAK,MAAMA,CAAK,CAC3B,MACA,CACI,OAAOA,CACX,CACJ,CAEA,IAAM0C,GAAN,KAAc,CACV,YAAYC,EAASC,EAAQ,CACzB,KAAK,QAAUD,EACf,KAAK,OAASC,CAClB,CACA,IAAI,OAAQ,CACR,OAAO,KAAK,OAAO,KACvB,CACA,IAAI,aAAc,CACd,OAAO,KAAK,OAAO,WACvB,CACA,IAAI,cAAe,CACf,OAAO,KAAK,OAAO,YACvB,CACA,IAAI,YAAa,CACb,OAAO,KAAK,QAAQ,UACxB,CACA,YAAYlE,EAAO,CACX,KAAK,qBAAqBA,CAAK,GAAK,KAAK,oBAAoBA,CAAK,GAClE,KAAK,gBAAgBA,CAAK,CAElC,CACA,IAAI,WAAY,CACZ,OAAO,KAAK,OAAO,SACvB,CACA,IAAI,QAAS,CACT,IAAMmE,EAAS,KAAK,WAAW,KAAK,YACpC,GAAI,OAAOA,GAAU,WACjB,OAAOA,EAEX,MAAM,IAAI,MAAM,WAAW,KAAK,wCAAwC,KAAK,aAAa,CAC9F,CACA,oBAAoBnE,EAAO,CACvB,GAAM,CAAE,QAAAuB,CAAQ,EAAI,KAAK,OACnB,CAAE,wBAAA6C,CAAwB,EAAI,KAAK,QAAQ,YAC7CC,EAAS,GACb,OAAW,CAACX,EAAMpC,CAAK,IAAK,OAAO,QAAQ,KAAK,YAAY,EACxD,GAAIoC,KAAQU,EAAyB,CACjC,IAAME,EAASF,EAAwBV,GACvCW,EAASA,GAAUC,EAAO,CAAE,KAAAZ,EAAM,MAAApC,EAAO,MAAAtB,EAAO,QAAAuB,CAAQ,CAAC,CAC7D,KAEI,UAGR,OAAO8C,CACX,CACA,gBAAgBrE,EAAO,CACnB,GAAM,CAAE,OAAAuE,EAAQ,cAAAC,CAAc,EAAIxE,EAClC,GAAI,CACA,GAAM,CAAE,OAAAwD,CAAO,EAAI,KAAK,OAClBiB,EAAc,OAAO,OAAOzE,EAAO,CAAE,OAAAwD,CAAO,CAAC,EACnD,KAAK,OAAO,KAAK,KAAK,WAAYiB,CAAW,EAC7C,KAAK,QAAQ,iBAAiB,KAAK,WAAY,CAAE,MAAAzE,EAAO,OAAAuE,EAAQ,cAAAC,EAAe,OAAQ,KAAK,UAAW,CAAC,CAC5G,OACO1D,EAAP,CACI,GAAM,CAAE,WAAA4D,EAAY,WAAAC,EAAY,QAAApD,EAAS,MAAAoB,CAAM,EAAI,KAC7C3B,EAAS,CAAE,WAAA0D,EAAY,WAAAC,EAAY,QAAApD,EAAS,MAAAoB,EAAO,MAAA3C,CAAM,EAC/D,KAAK,QAAQ,YAAYc,EAAO,oBAAoB,KAAK,UAAWE,CAAM,CAC9E,CACJ,CACA,qBAAqBhB,EAAO,CACxB,IAAMJ,EAAcI,EAAM,OAC1B,OAAIA,aAAiB,eAAiB,KAAK,OAAO,eAAeA,CAAK,EAC3D,GAEP,KAAK,UAAYJ,EACV,GAEFA,aAAuB,SAAW,KAAK,QAAQ,SAASA,CAAW,EACjE,KAAK,MAAM,gBAAgBA,CAAW,EAGtC,KAAK,MAAM,gBAAgB,KAAK,OAAO,OAAO,CAE7D,CACA,IAAI,YAAa,CACb,OAAO,KAAK,QAAQ,UACxB,CACA,IAAI,YAAa,CACb,OAAO,KAAK,OAAO,UACvB,CACA,IAAI,SAAU,CACV,OAAO,KAAK,MAAM,OACtB,CACA,IAAI,OAAQ,CACR,OAAO,KAAK,QAAQ,KACxB,CACJ,EAEMgF,GAAN,KAAsB,CAClB,YAAYrD,EAASsD,EAAU,CAC3B,KAAK,qBAAuB,CAAE,WAAY,GAAM,UAAW,GAAM,QAAS,EAAK,EAC/E,KAAK,QAAUtD,EACf,KAAK,QAAU,GACf,KAAK,SAAWsD,EAChB,KAAK,SAAW,IAAI,IACpB,KAAK,iBAAmB,IAAI,iBAAkBC,GAAc,KAAK,iBAAiBA,CAAS,CAAC,CAChG,CACA,OAAQ,CACC,KAAK,UACN,KAAK,QAAU,GACf,KAAK,iBAAiB,QAAQ,KAAK,QAAS,KAAK,oBAAoB,EACrE,KAAK,QAAQ,EAErB,CACA,MAAMC,EAAU,CACR,KAAK,UACL,KAAK,iBAAiB,WAAW,EACjC,KAAK,QAAU,IAEnBA,EAAS,EACJ,KAAK,UACN,KAAK,iBAAiB,QAAQ,KAAK,QAAS,KAAK,oBAAoB,EACrE,KAAK,QAAU,GAEvB,CACA,MAAO,CACC,KAAK,UACL,KAAK,iBAAiB,YAAY,EAClC,KAAK,iBAAiB,WAAW,EACjC,KAAK,QAAU,GAEvB,CACA,SAAU,CACN,GAAI,KAAK,QAAS,CACd,IAAMpD,EAAU,IAAI,IAAI,KAAK,oBAAoB,CAAC,EAClD,QAAWJ,KAAW,MAAM,KAAK,KAAK,QAAQ,EACrCI,EAAQ,IAAIJ,CAAO,GACpB,KAAK,cAAcA,CAAO,EAGlC,QAAWA,KAAW,MAAM,KAAKI,CAAO,EACpC,KAAK,WAAWJ,CAAO,CAE/B,CACJ,CACA,iBAAiBuD,EAAW,CACxB,GAAI,KAAK,QACL,QAAWE,KAAYF,EACnB,KAAK,gBAAgBE,CAAQ,CAGzC,CACA,gBAAgBA,EAAU,CAClBA,EAAS,MAAQ,aACjB,KAAK,uBAAuBA,EAAS,OAAQA,EAAS,aAAa,EAE9DA,EAAS,MAAQ,cACtB,KAAK,oBAAoBA,EAAS,YAAY,EAC9C,KAAK,kBAAkBA,EAAS,UAAU,EAElD,CACA,uBAAuBC,EAAMC,EAAe,CACxC,IAAM3D,EAAU0D,EACZ,KAAK,SAAS,IAAI1D,CAAO,EACrB,KAAK,SAAS,yBAA2B,KAAK,aAAaA,CAAO,EAClE,KAAK,SAAS,wBAAwBA,EAAS2D,CAAa,EAG5D,KAAK,cAAc3D,CAAO,EAGzB,KAAK,aAAaA,CAAO,GAC9B,KAAK,WAAWA,CAAO,CAE/B,CACA,oBAAoB4D,EAAO,CACvB,QAAWF,KAAQ,MAAM,KAAKE,CAAK,EAAG,CAClC,IAAM5D,EAAU,KAAK,gBAAgB0D,CAAI,EACrC1D,GACA,KAAK,YAAYA,EAAS,KAAK,aAAa,CAEpD,CACJ,CACA,kBAAkB4D,EAAO,CACrB,QAAWF,KAAQ,MAAM,KAAKE,CAAK,EAAG,CAClC,IAAM5D,EAAU,KAAK,gBAAgB0D,CAAI,EACrC1D,GAAW,KAAK,gBAAgBA,CAAO,GACvC,KAAK,YAAYA,EAAS,KAAK,UAAU,CAEjD,CACJ,CACA,aAAaA,EAAS,CAClB,OAAO,KAAK,SAAS,aAAaA,CAAO,CAC7C,CACA,oBAAoB6D,EAAO,KAAK,QAAS,CACrC,OAAO,KAAK,SAAS,oBAAoBA,CAAI,CACjD,CACA,YAAYA,EAAMC,EAAW,CACzB,QAAW9D,KAAW,KAAK,oBAAoB6D,CAAI,EAC/CC,EAAU,KAAK,KAAM9D,CAAO,CAEpC,CACA,gBAAgB0D,EAAM,CAClB,GAAIA,EAAK,UAAY,KAAK,aACtB,OAAOA,CAEf,CACA,gBAAgB1D,EAAS,CACrB,OAAIA,EAAQ,aAAe,KAAK,QAAQ,YAC7B,GAGA,KAAK,QAAQ,SAASA,CAAO,CAE5C,CACA,WAAWA,EAAS,CACX,KAAK,SAAS,IAAIA,CAAO,GACtB,KAAK,gBAAgBA,CAAO,IAC5B,KAAK,SAAS,IAAIA,CAAO,EACrB,KAAK,SAAS,gBACd,KAAK,SAAS,eAAeA,CAAO,EAIpD,CACA,cAAcA,EAAS,CACf,KAAK,SAAS,IAAIA,CAAO,IACzB,KAAK,SAAS,OAAOA,CAAO,EACxB,KAAK,SAAS,kBACd,KAAK,SAAS,iBAAiBA,CAAO,EAGlD,CACJ,EAEM+D,GAAN,KAAwB,CACpB,YAAY/D,EAAS2D,EAAeL,EAAU,CAC1C,KAAK,cAAgBK,EACrB,KAAK,SAAWL,EAChB,KAAK,gBAAkB,IAAID,GAAgBrD,EAAS,IAAI,CAC5D,CACA,IAAI,SAAU,CACV,OAAO,KAAK,gBAAgB,OAChC,CACA,IAAI,UAAW,CACX,MAAO,IAAI,KAAK,gBACpB,CACA,OAAQ,CACJ,KAAK,gBAAgB,MAAM,CAC/B,CACA,MAAMwD,EAAU,CACZ,KAAK,gBAAgB,MAAMA,CAAQ,CACvC,CACA,MAAO,CACH,KAAK,gBAAgB,KAAK,CAC9B,CACA,SAAU,CACN,KAAK,gBAAgB,QAAQ,CACjC,CACA,IAAI,SAAU,CACV,OAAO,KAAK,gBAAgB,OAChC,CACA,aAAaxD,EAAS,CAClB,OAAOA,EAAQ,aAAa,KAAK,aAAa,CAClD,CACA,oBAAoB6D,EAAM,CACtB,IAAMzB,EAAQ,KAAK,aAAayB,CAAI,EAAI,CAACA,CAAI,EAAI,CAAC,EAC5CzD,EAAU,MAAM,KAAKyD,EAAK,iBAAiB,KAAK,QAAQ,CAAC,EAC/D,OAAOzB,EAAM,OAAOhC,CAAO,CAC/B,CACA,eAAeJ,EAAS,CAChB,KAAK,SAAS,yBACd,KAAK,SAAS,wBAAwBA,EAAS,KAAK,aAAa,CAEzE,CACA,iBAAiBA,EAAS,CAClB,KAAK,SAAS,2BACd,KAAK,SAAS,0BAA0BA,EAAS,KAAK,aAAa,CAE3E,CACA,wBAAwBA,EAAS2D,EAAe,CACxC,KAAK,SAAS,8BAAgC,KAAK,eAAiBA,GACpE,KAAK,SAAS,6BAA6B3D,EAAS2D,CAAa,CAEzE,CACJ,EAEA,SAASK,GAAI3E,EAAKQ,EAAKE,EAAO,CAC1BkE,GAAM5E,EAAKQ,CAAG,EAAE,IAAIE,CAAK,CAC7B,CACA,SAASmE,GAAI7E,EAAKQ,EAAKE,EAAO,CAC1BkE,GAAM5E,EAAKQ,CAAG,EAAE,OAAOE,CAAK,EAC5BoE,GAAM9E,EAAKQ,CAAG,CAClB,CACA,SAASoE,GAAM5E,EAAKQ,EAAK,CACrB,IAAIuE,EAAS/E,EAAI,IAAIQ,CAAG,EACxB,OAAKuE,IACDA,EAAS,IAAI,IACb/E,EAAI,IAAIQ,EAAKuE,CAAM,GAEhBA,CACX,CACA,SAASD,GAAM9E,EAAKQ,EAAK,CACrB,IAAMuE,EAAS/E,EAAI,IAAIQ,CAAG,EACtBuE,GAAU,MAAQA,EAAO,MAAQ,GACjC/E,EAAI,OAAOQ,CAAG,CAEtB,CAEA,IAAMwE,GAAN,KAAe,CACX,aAAc,CACV,KAAK,YAAc,IAAI,GAC3B,CACA,IAAI,MAAO,CACP,OAAO,MAAM,KAAK,KAAK,YAAY,KAAK,CAAC,CAC7C,CACA,IAAI,QAAS,CAET,OADa,MAAM,KAAK,KAAK,YAAY,OAAO,CAAC,EACrC,OAAO,CAACD,EAAQE,IAAQF,EAAO,OAAO,MAAM,KAAKE,CAAG,CAAC,EAAG,CAAC,CAAC,CAC1E,CACA,IAAI,MAAO,CAEP,OADa,MAAM,KAAK,KAAK,YAAY,OAAO,CAAC,EACrC,OAAO,CAACC,EAAMD,IAAQC,EAAOD,EAAI,KAAM,CAAC,CACxD,CACA,IAAIzE,EAAKE,EAAO,CACZiE,GAAI,KAAK,YAAanE,EAAKE,CAAK,CACpC,CACA,OAAOF,EAAKE,EAAO,CACfmE,GAAI,KAAK,YAAarE,EAAKE,CAAK,CACpC,CACA,IAAIF,EAAKE,EAAO,CACZ,IAAMqE,EAAS,KAAK,YAAY,IAAIvE,CAAG,EACvC,OAAOuE,GAAU,MAAQA,EAAO,IAAIrE,CAAK,CAC7C,CACA,OAAOF,EAAK,CACR,OAAO,KAAK,YAAY,IAAIA,CAAG,CACnC,CACA,SAASE,EAAO,CAEZ,OADa,MAAM,KAAK,KAAK,YAAY,OAAO,CAAC,EACrC,KAAMuE,GAAQA,EAAI,IAAIvE,CAAK,CAAC,CAC5C,CACA,gBAAgBF,EAAK,CACjB,IAAMuE,EAAS,KAAK,YAAY,IAAIvE,CAAG,EACvC,OAAOuE,EAAS,MAAM,KAAKA,CAAM,EAAI,CAAC,CAC1C,CACA,gBAAgBrE,EAAO,CACnB,OAAO,MAAM,KAAK,KAAK,WAAW,EAC7B,OAAO,CAAC,CAACyE,EAAMJ,CAAM,IAAMA,EAAO,IAAIrE,CAAK,CAAC,EAC5C,IAAI,CAAC,CAACF,EAAK4E,CAAO,IAAM5E,CAAG,CACpC,CACJ,EA2BA,IAAM6E,GAAN,KAAuB,CACnB,YAAYC,EAASC,EAAUC,EAAUC,EAAU,CAAC,EAAG,CACnD,KAAK,SAAWF,EAChB,KAAK,QAAUE,EACf,KAAK,gBAAkB,IAAIC,GAAgBJ,EAAS,IAAI,EACxD,KAAK,SAAWE,EAChB,KAAK,iBAAmB,IAAIG,EAChC,CACA,IAAI,SAAU,CACV,OAAO,KAAK,gBAAgB,OAChC,CACA,OAAQ,CACJ,KAAK,gBAAgB,MAAM,CAC/B,CACA,MAAMC,EAAU,CACZ,KAAK,gBAAgB,MAAMA,CAAQ,CACvC,CACA,MAAO,CACH,KAAK,gBAAgB,KAAK,CAC9B,CACA,SAAU,CACN,KAAK,gBAAgB,QAAQ,CACjC,CACA,IAAI,SAAU,CACV,OAAO,KAAK,gBAAgB,OAChC,CACA,aAAaN,EAAS,CAClB,IAAMO,EAAUP,EAAQ,QAAQ,KAAK,QAAQ,EAC7C,OAAI,KAAK,SAAS,qBACPO,GAAW,KAAK,SAAS,qBAAqBP,EAAS,KAAK,OAAO,EAEvEO,CACX,CACA,oBAAoBC,EAAM,CACtB,IAAMC,EAAQ,KAAK,aAAaD,CAAI,EAAI,CAACA,CAAI,EAAI,CAAC,EAC5CD,EAAU,MAAM,KAAKC,EAAK,iBAAiB,KAAK,QAAQ,CAAC,EAAE,OAAQC,GAAU,KAAK,aAAaA,CAAK,CAAC,EAC3G,OAAOA,EAAM,OAAOF,CAAO,CAC/B,CACA,eAAeP,EAAS,CACpB,KAAK,gBAAgBA,CAAO,CAChC,CACA,iBAAiBA,EAAS,CACtB,KAAK,kBAAkBA,CAAO,CAClC,CACA,wBAAwBA,EAASU,EAAgB,CAC7C,IAAMH,EAAU,KAAK,aAAaP,CAAO,EACnCW,EAAgB,KAAK,iBAAiB,IAAI,KAAK,SAAUX,CAAO,EAClE,CAACO,GAAWI,GACZ,KAAK,kBAAkBX,CAAO,CAEtC,CACA,gBAAgBA,EAAS,CACjB,KAAK,SAAS,kBACd,KAAK,SAAS,gBAAgBA,EAAS,KAAK,SAAU,KAAK,OAAO,EAClE,KAAK,iBAAiB,IAAI,KAAK,SAAUA,CAAO,EAExD,CACA,kBAAkBA,EAAS,CACvB,KAAK,SAAS,kBAAkBA,EAAS,KAAK,SAAU,KAAK,OAAO,EACpE,KAAK,iBAAiB,OAAO,KAAK,SAAUA,CAAO,CACvD,CACJ,EAEMY,GAAN,KAAwB,CACpB,YAAYZ,EAASE,EAAU,CAC3B,KAAK,QAAUF,EACf,KAAK,SAAWE,EAChB,KAAK,QAAU,GACf,KAAK,UAAY,IAAI,IACrB,KAAK,iBAAmB,IAAI,iBAAkBW,GAAc,KAAK,iBAAiBA,CAAS,CAAC,CAChG,CACA,OAAQ,CACC,KAAK,UACN,KAAK,QAAU,GACf,KAAK,iBAAiB,QAAQ,KAAK,QAAS,CAAE,WAAY,GAAM,kBAAmB,EAAK,CAAC,EACzF,KAAK,QAAQ,EAErB,CACA,MAAO,CACC,KAAK,UACL,KAAK,iBAAiB,YAAY,EAClC,KAAK,iBAAiB,WAAW,EACjC,KAAK,QAAU,GAEvB,CACA,SAAU,CACN,GAAI,KAAK,QACL,QAAWC,KAAiB,KAAK,oBAC7B,KAAK,iBAAiBA,EAAe,IAAI,CAGrD,CACA,iBAAiBD,EAAW,CACxB,GAAI,KAAK,QACL,QAAWE,KAAYF,EACnB,KAAK,gBAAgBE,CAAQ,CAGzC,CACA,gBAAgBA,EAAU,CACtB,IAAMD,EAAgBC,EAAS,cAC3BD,GACA,KAAK,iBAAiBA,EAAeC,EAAS,QAAQ,CAE9D,CACA,iBAAiBD,EAAeE,EAAU,CACtC,IAAMC,EAAM,KAAK,SAAS,4BAA4BH,CAAa,EACnE,GAAIG,GAAO,KAAM,CACR,KAAK,UAAU,IAAIH,CAAa,GACjC,KAAK,kBAAkBG,EAAKH,CAAa,EAE7C,IAAMI,EAAQ,KAAK,QAAQ,aAAaJ,CAAa,EAIrD,GAHI,KAAK,UAAU,IAAIA,CAAa,GAAKI,GACrC,KAAK,sBAAsBA,EAAOD,EAAKD,CAAQ,EAE/CE,GAAS,KAAM,CACf,IAAMF,EAAW,KAAK,UAAU,IAAIF,CAAa,EACjD,KAAK,UAAU,OAAOA,CAAa,EAC/BE,GACA,KAAK,oBAAoBC,EAAKH,EAAeE,CAAQ,CAC7D,MAEI,KAAK,UAAU,IAAIF,EAAeI,CAAK,CAE/C,CACJ,CACA,kBAAkBD,EAAKH,EAAe,CAC9B,KAAK,SAAS,mBACd,KAAK,SAAS,kBAAkBG,EAAKH,CAAa,CAE1D,CACA,sBAAsBI,EAAOD,EAAKD,EAAU,CACpC,KAAK,SAAS,uBACd,KAAK,SAAS,sBAAsBE,EAAOD,EAAKD,CAAQ,CAEhE,CACA,oBAAoBC,EAAKH,EAAeE,EAAU,CAC1C,KAAK,SAAS,qBACd,KAAK,SAAS,oBAAoBC,EAAKH,EAAeE,CAAQ,CAEtE,CACA,IAAI,qBAAsB,CACtB,OAAO,MAAM,KAAK,IAAI,IAAI,KAAK,sBAAsB,OAAO,KAAK,sBAAsB,CAAC,CAAC,CAC7F,CACA,IAAI,uBAAwB,CACxB,OAAO,MAAM,KAAK,KAAK,QAAQ,UAAU,EAAE,IAAKG,GAAcA,EAAU,IAAI,CAChF,CACA,IAAI,wBAAyB,CACzB,OAAO,MAAM,KAAK,KAAK,UAAU,KAAK,CAAC,CAC3C,CACJ,EAEMC,GAAN,KAAwB,CACpB,YAAYpB,EAASc,EAAeZ,EAAU,CAC1C,KAAK,kBAAoB,IAAImB,GAAkBrB,EAASc,EAAe,IAAI,EAC3E,KAAK,SAAWZ,EAChB,KAAK,gBAAkB,IAAIG,EAC/B,CACA,IAAI,SAAU,CACV,OAAO,KAAK,kBAAkB,OAClC,CACA,OAAQ,CACJ,KAAK,kBAAkB,MAAM,CACjC,CACA,MAAMC,EAAU,CACZ,KAAK,kBAAkB,MAAMA,CAAQ,CACzC,CACA,MAAO,CACH,KAAK,kBAAkB,KAAK,CAChC,CACA,SAAU,CACN,KAAK,kBAAkB,QAAQ,CACnC,CACA,IAAI,SAAU,CACV,OAAO,KAAK,kBAAkB,OAClC,CACA,IAAI,eAAgB,CAChB,OAAO,KAAK,kBAAkB,aAClC,CACA,wBAAwBN,EAAS,CAC7B,KAAK,cAAc,KAAK,qBAAqBA,CAAO,CAAC,CACzD,CACA,6BAA6BA,EAAS,CAClC,GAAM,CAACsB,EAAiBC,CAAa,EAAI,KAAK,wBAAwBvB,CAAO,EAC7E,KAAK,gBAAgBsB,CAAe,EACpC,KAAK,cAAcC,CAAa,CACpC,CACA,0BAA0BvB,EAAS,CAC/B,KAAK,gBAAgB,KAAK,gBAAgB,gBAAgBA,CAAO,CAAC,CACtE,CACA,cAAcwB,EAAQ,CAClBA,EAAO,QAASC,GAAU,KAAK,aAAaA,CAAK,CAAC,CACtD,CACA,gBAAgBD,EAAQ,CACpBA,EAAO,QAASC,GAAU,KAAK,eAAeA,CAAK,CAAC,CACxD,CACA,aAAaA,EAAO,CAChB,KAAK,SAAS,aAAaA,CAAK,EAChC,KAAK,gBAAgB,IAAIA,EAAM,QAASA,CAAK,CACjD,CACA,eAAeA,EAAO,CAClB,KAAK,SAAS,eAAeA,CAAK,EAClC,KAAK,gBAAgB,OAAOA,EAAM,QAASA,CAAK,CACpD,CACA,wBAAwBzB,EAAS,CAC7B,IAAM0B,EAAiB,KAAK,gBAAgB,gBAAgB1B,CAAO,EAC7D2B,EAAgB,KAAK,qBAAqB3B,CAAO,EACjD4B,EAAsBC,GAAIH,EAAgBC,CAAa,EAAE,UAAU,CAAC,CAACG,EAAeC,CAAY,IAAM,CAACC,GAAeF,EAAeC,CAAY,CAAC,EACxJ,OAAIH,GAAuB,GAChB,CAAC,CAAC,EAAG,CAAC,CAAC,EAGP,CAACF,EAAe,MAAME,CAAmB,EAAGD,EAAc,MAAMC,CAAmB,CAAC,CAEnG,CACA,qBAAqB5B,EAAS,CAC1B,IAAMc,EAAgB,KAAK,cACrBmB,EAAcjC,EAAQ,aAAac,CAAa,GAAK,GAC3D,OAAOoB,GAAiBD,EAAajC,EAASc,CAAa,CAC/D,CACJ,EACA,SAASoB,GAAiBD,EAAajC,EAASc,EAAe,CAC3D,OAAOmB,EACF,KAAK,EACL,MAAM,KAAK,EACX,OAAQE,GAAYA,EAAQ,MAAM,EAClC,IAAI,CAACA,EAASC,KAAW,CAAE,QAAApC,EAAS,cAAAc,EAAe,QAAAqB,EAAS,MAAAC,CAAM,EAAE,CAC7E,CACA,SAASP,GAAIQ,EAAMC,EAAO,CACtB,IAAMC,EAAS,KAAK,IAAIF,EAAK,OAAQC,EAAM,MAAM,EACjD,OAAO,MAAM,KAAK,CAAE,OAAAC,CAAO,EAAG,CAACC,EAAGJ,IAAU,CAACC,EAAKD,GAAQE,EAAMF,EAAM,CAAC,CAC3E,CACA,SAASJ,GAAeK,EAAMC,EAAO,CACjC,OAAOD,GAAQC,GAASD,EAAK,OAASC,EAAM,OAASD,EAAK,SAAWC,EAAM,OAC/E,CAEA,IAAMG,GAAN,KAAwB,CACpB,YAAYzC,EAASc,EAAeZ,EAAU,CAC1C,KAAK,kBAAoB,IAAIkB,GAAkBpB,EAASc,EAAe,IAAI,EAC3E,KAAK,SAAWZ,EAChB,KAAK,oBAAsB,IAAI,QAC/B,KAAK,uBAAyB,IAAI,OACtC,CACA,IAAI,SAAU,CACV,OAAO,KAAK,kBAAkB,OAClC,CACA,OAAQ,CACJ,KAAK,kBAAkB,MAAM,CACjC,CACA,MAAO,CACH,KAAK,kBAAkB,KAAK,CAChC,CACA,SAAU,CACN,KAAK,kBAAkB,QAAQ,CACnC,CACA,IAAI,SAAU,CACV,OAAO,KAAK,kBAAkB,OAClC,CACA,IAAI,eAAgB,CAChB,OAAO,KAAK,kBAAkB,aAClC,CACA,aAAauB,EAAO,CAChB,GAAM,CAAE,QAAAzB,CAAQ,EAAIyB,EACd,CAAE,MAAAP,CAAM,EAAI,KAAK,yBAAyBO,CAAK,EACjDP,IACA,KAAK,6BAA6BlB,CAAO,EAAE,IAAIyB,EAAOP,CAAK,EAC3D,KAAK,SAAS,oBAAoBlB,EAASkB,CAAK,EAExD,CACA,eAAeO,EAAO,CAClB,GAAM,CAAE,QAAAzB,CAAQ,EAAIyB,EACd,CAAE,MAAAP,CAAM,EAAI,KAAK,yBAAyBO,CAAK,EACjDP,IACA,KAAK,6BAA6BlB,CAAO,EAAE,OAAOyB,CAAK,EACvD,KAAK,SAAS,sBAAsBzB,EAASkB,CAAK,EAE1D,CACA,yBAAyBO,EAAO,CAC5B,IAAIiB,EAAc,KAAK,oBAAoB,IAAIjB,CAAK,EACpD,OAAKiB,IACDA,EAAc,KAAK,WAAWjB,CAAK,EACnC,KAAK,oBAAoB,IAAIA,EAAOiB,CAAW,GAE5CA,CACX,CACA,6BAA6B1C,EAAS,CAClC,IAAI2C,EAAgB,KAAK,uBAAuB,IAAI3C,CAAO,EAC3D,OAAK2C,IACDA,EAAgB,IAAI,IACpB,KAAK,uBAAuB,IAAI3C,EAAS2C,CAAa,GAEnDA,CACX,CACA,WAAWlB,EAAO,CACd,GAAI,CAEA,MAAO,CAAE,MADK,KAAK,SAAS,mBAAmBA,CAAK,CACrC,CACnB,OACOmB,EAAP,CACI,MAAO,CAAE,MAAAA,CAAM,CACnB,CACJ,CACJ,EAEMC,GAAN,KAAsB,CAClB,YAAYC,EAAS5C,EAAU,CAC3B,KAAK,QAAU4C,EACf,KAAK,SAAW5C,EAChB,KAAK,iBAAmB,IAAI,GAChC,CACA,OAAQ,CACC,KAAK,oBACN,KAAK,kBAAoB,IAAIuC,GAAkB,KAAK,QAAS,KAAK,gBAAiB,IAAI,EACvF,KAAK,kBAAkB,MAAM,EAErC,CACA,MAAO,CACC,KAAK,oBACL,KAAK,kBAAkB,KAAK,EAC5B,OAAO,KAAK,kBACZ,KAAK,qBAAqB,EAElC,CACA,IAAI,SAAU,CACV,OAAO,KAAK,QAAQ,OACxB,CACA,IAAI,YAAa,CACb,OAAO,KAAK,QAAQ,UACxB,CACA,IAAI,iBAAkB,CAClB,OAAO,KAAK,OAAO,eACvB,CACA,IAAI,QAAS,CACT,OAAO,KAAK,QAAQ,MACxB,CACA,IAAI,UAAW,CACX,OAAO,MAAM,KAAK,KAAK,iBAAiB,OAAO,CAAC,CACpD,CACA,cAAcM,EAAQ,CAClB,IAAMC,EAAU,IAAIC,GAAQ,KAAK,QAASF,CAAM,EAChD,KAAK,iBAAiB,IAAIA,EAAQC,CAAO,EACzC,KAAK,SAAS,iBAAiBA,CAAO,CAC1C,CACA,iBAAiBD,EAAQ,CACrB,IAAMC,EAAU,KAAK,iBAAiB,IAAID,CAAM,EAC5CC,IACA,KAAK,iBAAiB,OAAOD,CAAM,EACnC,KAAK,SAAS,oBAAoBC,CAAO,EAEjD,CACA,sBAAuB,CACnB,KAAK,SAAS,QAASA,GAAY,KAAK,SAAS,oBAAoBA,EAAS,EAAI,CAAC,EACnF,KAAK,iBAAiB,MAAM,CAChC,CACA,mBAAmBvB,EAAO,CACtB,IAAMsB,EAASG,GAAO,SAASzB,EAAO,KAAK,MAAM,EACjD,GAAIsB,EAAO,YAAc,KAAK,WAC1B,OAAOA,CAEf,CACA,oBAAoB/C,EAAS+C,EAAQ,CACjC,KAAK,cAAcA,CAAM,CAC7B,CACA,sBAAsB/C,EAAS+C,EAAQ,CACnC,KAAK,iBAAiBA,CAAM,CAChC,CACJ,EAEMI,GAAN,KAAoB,CAChB,YAAYL,EAASM,EAAU,CAC3B,KAAK,QAAUN,EACf,KAAK,SAAWM,EAChB,KAAK,kBAAoB,IAAIxC,GAAkB,KAAK,QAAS,IAAI,EACjE,KAAK,mBAAqB,KAAK,WAAW,kBAC9C,CACA,OAAQ,CACJ,KAAK,kBAAkB,MAAM,EAC7B,KAAK,uCAAuC,CAChD,CACA,MAAO,CACH,KAAK,kBAAkB,KAAK,CAChC,CACA,IAAI,SAAU,CACV,OAAO,KAAK,QAAQ,OACxB,CACA,IAAI,YAAa,CACb,OAAO,KAAK,QAAQ,UACxB,CACA,4BAA4BE,EAAe,CACvC,GAAIA,KAAiB,KAAK,mBACtB,OAAO,KAAK,mBAAmBA,GAAe,IAEtD,CACA,kBAAkBG,EAAKH,EAAe,CAClC,IAAMuC,EAAa,KAAK,mBAAmBvC,GACtC,KAAK,SAASG,CAAG,GAClB,KAAK,sBAAsBA,EAAKoC,EAAW,OAAO,KAAK,SAASpC,EAAI,EAAGoC,EAAW,OAAOA,EAAW,YAAY,CAAC,CAEzH,CACA,sBAAsBnC,EAAOoC,EAAMtC,EAAU,CACzC,IAAMqC,EAAa,KAAK,uBAAuBC,GAC3CpC,IAAU,OAEVF,IAAa,OACbA,EAAWqC,EAAW,OAAOA,EAAW,YAAY,GAExD,KAAK,sBAAsBC,EAAMpC,EAAOF,CAAQ,EACpD,CACA,oBAAoBC,EAAKH,EAAeE,EAAU,CAC9C,IAAMqC,EAAa,KAAK,uBAAuBpC,GAC3C,KAAK,SAASA,CAAG,EACjB,KAAK,sBAAsBA,EAAKoC,EAAW,OAAO,KAAK,SAASpC,EAAI,EAAGD,CAAQ,EAG/E,KAAK,sBAAsBC,EAAKoC,EAAW,OAAOA,EAAW,YAAY,EAAGrC,CAAQ,CAE5F,CACA,wCAAyC,CACrC,OAAW,CAAE,IAAAC,EAAK,KAAAqC,EAAM,aAAAC,EAAc,OAAAC,CAAO,IAAK,KAAK,iBAC/CD,GAAgB,MAAa,CAAC,KAAK,WAAW,KAAK,IAAItC,CAAG,GAC1D,KAAK,sBAAsBqC,EAAME,EAAOD,CAAY,EAAG,MAAS,CAG5E,CACA,sBAAsBD,EAAMG,EAAUC,EAAa,CAC/C,IAAMC,EAAoB,GAAGL,WACvBM,EAAgB,KAAK,SAASD,GACpC,GAAI,OAAOC,GAAiB,WAAY,CACpC,IAAMP,EAAa,KAAK,uBAAuBC,GAC/C,GAAI,CACA,IAAMpC,EAAQmC,EAAW,OAAOI,CAAQ,EACpCzC,EAAW0C,EACXA,IACA1C,EAAWqC,EAAW,OAAOK,CAAW,GAE5CE,EAAc,KAAK,KAAK,SAAU1C,EAAOF,CAAQ,CACrD,OACO4B,EAAP,CACI,MAAIA,aAAiB,YACjBA,EAAM,QAAU,mBAAmB,KAAK,QAAQ,cAAcS,EAAW,WAAWT,EAAM,WAExFA,CACV,CACJ,CACJ,CACA,IAAI,kBAAmB,CACnB,GAAM,CAAE,mBAAAiB,CAAmB,EAAI,KAC/B,OAAO,OAAO,KAAKA,CAAkB,EAAE,IAAK5C,GAAQ4C,EAAmB5C,EAAI,CAC/E,CACA,IAAI,wBAAyB,CACzB,IAAM6C,EAAc,CAAC,EACrB,cAAO,KAAK,KAAK,kBAAkB,EAAE,QAAS7C,GAAQ,CAClD,IAAMoC,EAAa,KAAK,mBAAmBpC,GAC3C6C,EAAYT,EAAW,MAAQA,CACnC,CAAC,EACMS,CACX,CACA,SAAShD,EAAe,CACpB,IAAMuC,EAAa,KAAK,uBAAuBvC,GACzCiD,EAAgB,MAAMC,GAAWX,EAAW,IAAI,IACtD,OAAO,KAAK,SAASU,EACzB,CACJ,EAEME,GAAN,KAAqB,CACjB,YAAYnB,EAAS5C,EAAU,CAC3B,KAAK,QAAU4C,EACf,KAAK,SAAW5C,EAChB,KAAK,cAAgB,IAAIG,EAC7B,CACA,OAAQ,CACC,KAAK,oBACN,KAAK,kBAAoB,IAAIe,GAAkB,KAAK,QAAS,KAAK,cAAe,IAAI,EACrF,KAAK,kBAAkB,MAAM,EAErC,CACA,MAAO,CACC,KAAK,oBACL,KAAK,qBAAqB,EAC1B,KAAK,kBAAkB,KAAK,EAC5B,OAAO,KAAK,kBAEpB,CACA,aAAa,CAAE,QAAApB,EAAS,QAASsD,CAAK,EAAG,CACjC,KAAK,MAAM,gBAAgBtD,CAAO,GAClC,KAAK,cAAcA,EAASsD,CAAI,CAExC,CACA,eAAe,CAAE,QAAAtD,EAAS,QAASsD,CAAK,EAAG,CACvC,KAAK,iBAAiBtD,EAASsD,CAAI,CACvC,CACA,cAActD,EAASsD,EAAM,CACzB,IAAIY,EACC,KAAK,cAAc,IAAIZ,EAAMtD,CAAO,IACrC,KAAK,cAAc,IAAIsD,EAAMtD,CAAO,GACnCkE,EAAK,KAAK,qBAAuB,MAAQA,IAAO,QAAkBA,EAAG,MAAM,IAAM,KAAK,SAAS,gBAAgBlE,EAASsD,CAAI,CAAC,EAEtI,CACA,iBAAiBtD,EAASsD,EAAM,CAC5B,IAAIY,EACA,KAAK,cAAc,IAAIZ,EAAMtD,CAAO,IACpC,KAAK,cAAc,OAAOsD,EAAMtD,CAAO,GACtCkE,EAAK,KAAK,qBAAuB,MAAQA,IAAO,QAAkBA,EAAG,MAAM,IAAM,KAAK,SAAS,mBAAmBlE,EAASsD,CAAI,CAAC,EAEzI,CACA,sBAAuB,CACnB,QAAWA,KAAQ,KAAK,cAAc,KAClC,QAAWtD,KAAW,KAAK,cAAc,gBAAgBsD,CAAI,EACzD,KAAK,iBAAiBtD,EAASsD,CAAI,CAG/C,CACA,IAAI,eAAgB,CAChB,MAAO,QAAQ,KAAK,QAAQ,mBAChC,CACA,IAAI,SAAU,CACV,OAAO,KAAK,QAAQ,OACxB,CACA,IAAI,OAAQ,CACR,OAAO,KAAK,QAAQ,KACxB,CACJ,EAEA,SAASa,GAAiCC,EAAaC,EAAc,CACjE,IAAMC,EAAYC,GAA2BH,CAAW,EACxD,OAAO,MAAM,KAAKE,EAAU,OAAO,CAACE,EAAQJ,KACxCK,GAAwBL,EAAaC,CAAY,EAAE,QAASf,GAASkB,EAAO,IAAIlB,CAAI,CAAC,EAC9EkB,GACR,IAAI,GAAK,CAAC,CACjB,CACA,SAASE,GAAiCN,EAAaC,EAAc,CAEjE,OADkBE,GAA2BH,CAAW,EACvC,OAAO,CAACO,EAAOP,KAC5BO,EAAM,KAAK,GAAGC,GAAwBR,EAAaC,CAAY,CAAC,EACzDM,GACR,CAAC,CAAC,CACT,CACA,SAASJ,GAA2BH,EAAa,CAC7C,IAAME,EAAY,CAAC,EACnB,KAAOF,GACHE,EAAU,KAAKF,CAAW,EAC1BA,EAAc,OAAO,eAAeA,CAAW,EAEnD,OAAOE,EAAU,QAAQ,CAC7B,CACA,SAASG,GAAwBL,EAAaC,EAAc,CACxD,IAAMQ,EAAaT,EAAYC,GAC/B,OAAO,MAAM,QAAQQ,CAAU,EAAIA,EAAa,CAAC,CACrD,CACA,SAASD,GAAwBR,EAAaC,EAAc,CACxD,IAAMQ,EAAaT,EAAYC,GAC/B,OAAOQ,EAAa,OAAO,KAAKA,CAAU,EAAE,IAAK5D,GAAQ,CAACA,EAAK4D,EAAW5D,EAAI,CAAC,EAAI,CAAC,CACxF,CAEA,IAAM6D,GAAN,KAAqB,CACjB,YAAYhC,EAAS5C,EAAU,CAC3B,KAAK,QAAU4C,EACf,KAAK,SAAW5C,EAChB,KAAK,cAAgB,IAAIG,GACzB,KAAK,qBAAuB,IAAIA,GAChC,KAAK,oBAAsB,IAAI,GACnC,CACA,OAAQ,CACA,KAAK,oBAAoB,OAAS,IAClC,KAAK,kBAAkB,QAAS0E,GAAe,CAC3C,IAAM9E,EAAW,KAAK,SAAS8E,CAAU,EACnC5E,EAAU,CAAE,WAAA4E,CAAW,EACzB9E,GACA,KAAK,oBAAoB,IAAI8E,EAAY,IAAIhF,GAAiB,SAAS,KAAME,EAAU,KAAME,CAAO,CAAC,CAE7G,CAAC,EACD,KAAK,oBAAoB,QAAS6E,GAAaA,EAAS,MAAM,CAAC,GAEnE,KAAK,kBAAkB,QAASlC,GAAYA,EAAQ,QAAQ,CAAC,CACjE,CACA,MAAO,CACC,KAAK,oBAAoB,KAAO,IAChC,KAAK,qBAAqB,EAC1B,KAAK,oBAAoB,QAASkC,GAAaA,EAAS,KAAK,CAAC,EAC9D,KAAK,oBAAoB,MAAM,EAEvC,CACA,SAAU,CACN,KAAK,oBAAoB,QAASA,GAAaA,EAAS,QAAQ,CAAC,CACrE,CACA,gBAAgBhF,EAASiF,EAAW,CAAE,WAAAF,CAAW,EAAG,CAChD,IAAMG,EAAS,KAAK,UAAUlF,EAAS+E,CAAU,EAC7CG,GACA,KAAK,cAAcA,EAAQlF,EAAS+E,CAAU,CAEtD,CACA,kBAAkB/E,EAASiF,EAAW,CAAE,WAAAF,CAAW,EAAG,CAClD,IAAMG,EAAS,KAAK,iBAAiBlF,EAAS+E,CAAU,EACpDG,GACA,KAAK,iBAAiBA,EAAQlF,EAAS+E,CAAU,CAEzD,CACA,qBAAqB/E,EAAS,CAAE,WAAA+E,CAAW,EAAG,CAC1C,OAAQ,KAAK,UAAU/E,EAAS+E,CAAU,GACtC/E,EAAQ,QAAQ,IAAI,KAAK,QAAQ,YAAY,OAAO,wBAAwB+E,IAAa,CACjG,CACA,cAAcG,EAAQlF,EAAS+E,EAAY,CACvC,IAAIb,EACC,KAAK,qBAAqB,IAAIa,EAAY/E,CAAO,IAClD,KAAK,cAAc,IAAI+E,EAAYG,CAAM,EACzC,KAAK,qBAAqB,IAAIH,EAAY/E,CAAO,GAChDkE,EAAK,KAAK,oBAAoB,IAAIa,CAAU,KAAO,MAAQb,IAAO,QAAkBA,EAAG,MAAM,IAAM,KAAK,SAAS,gBAAgBgB,EAAQlF,EAAS+E,CAAU,CAAC,EAEtK,CACA,iBAAiBG,EAAQlF,EAAS+E,EAAY,CAC1C,IAAIb,EACA,KAAK,qBAAqB,IAAIa,EAAY/E,CAAO,IACjD,KAAK,cAAc,OAAO+E,EAAYG,CAAM,EAC5C,KAAK,qBAAqB,OAAOH,EAAY/E,CAAO,GACnDkE,EAAK,KAAK,oBACN,IAAIa,CAAU,KAAO,MAAQb,IAAO,QAAkBA,EAAG,MAAM,IAAM,KAAK,SAAS,mBAAmBgB,EAAQlF,EAAS+E,CAAU,CAAC,EAE/I,CACA,sBAAuB,CACnB,QAAWA,KAAc,KAAK,qBAAqB,KAC/C,QAAW/E,KAAW,KAAK,qBAAqB,gBAAgB+E,CAAU,EACtE,QAAWG,KAAU,KAAK,cAAc,gBAAgBH,CAAU,EAC9D,KAAK,iBAAiBG,EAAQlF,EAAS+E,CAAU,CAIjE,CACA,SAASA,EAAY,CACjB,OAAO,KAAK,MAAM,QAAQ,yBAAyBA,CAAU,CACjE,CACA,IAAI,oBAAqB,CACrB,IAAMI,EAAe,IAAI9E,GACzB,YAAK,OAAO,QAAQ,QAAS+E,GAAW,CACpC,IAAMhB,EAAcgB,EAAO,WAAW,sBACtBjB,GAAiCC,EAAa,SAAS,EAC/D,QAASc,GAAWC,EAAa,IAAID,EAAQE,EAAO,UAAU,CAAC,CAC3E,CAAC,EACMD,CACX,CACA,IAAI,mBAAoB,CACpB,OAAO,KAAK,mBAAmB,gBAAgB,KAAK,UAAU,CAClE,CACA,IAAI,gCAAiC,CACjC,OAAO,KAAK,mBAAmB,gBAAgB,KAAK,UAAU,CAClE,CACA,IAAI,mBAAoB,CACpB,IAAME,EAAc,KAAK,+BACzB,OAAO,KAAK,OAAO,SAAS,OAAQvC,GAAYuC,EAAY,SAASvC,EAAQ,UAAU,CAAC,CAC5F,CACA,UAAU9C,EAAS+E,EAAY,CAC3B,MAAO,CAAC,CAAC,KAAK,UAAU/E,EAAS+E,CAAU,GAAK,CAAC,CAAC,KAAK,iBAAiB/E,EAAS+E,CAAU,CAC/F,CACA,UAAU/E,EAAS+E,EAAY,CAC3B,OAAO,KAAK,YAAY,qCAAqC/E,EAAS+E,CAAU,CACpF,CACA,iBAAiB/E,EAAS+E,EAAY,CAClC,OAAO,KAAK,cAAc,gBAAgBA,CAAU,EAAE,KAAMG,GAAWA,EAAO,UAAYlF,CAAO,CACrG,CACA,IAAI,OAAQ,CACR,OAAO,KAAK,QAAQ,KACxB,CACA,IAAI,YAAa,CACb,OAAO,KAAK,QAAQ,UACxB,CACA,IAAI,aAAc,CACd,OAAO,KAAK,QAAQ,WACxB,CACA,IAAI,QAAS,CACT,OAAO,KAAK,YAAY,MAC5B,CACJ,EAEMsF,GAAN,KAAc,CACV,YAAYF,EAAQG,EAAO,CACvB,KAAK,iBAAmB,CAACC,EAAcC,EAAS,CAAC,IAAM,CACnD,GAAM,CAAE,WAAAC,EAAY,WAAAC,EAAY,QAAA3F,CAAQ,EAAI,KAC5CyF,EAAS,OAAO,OAAO,CAAE,WAAAC,EAAY,WAAAC,EAAY,QAAA3F,CAAQ,EAAGyF,CAAM,EAClE,KAAK,YAAY,iBAAiB,KAAK,WAAYD,EAAcC,CAAM,CAC3E,EACA,KAAK,OAASL,EACd,KAAK,MAAQG,EACb,KAAK,WAAa,IAAIH,EAAO,sBAAsB,IAAI,EACvD,KAAK,gBAAkB,IAAIvC,GAAgB,KAAM,KAAK,UAAU,EAChE,KAAK,cAAgB,IAAIM,GAAc,KAAM,KAAK,UAAU,EAC5D,KAAK,eAAiB,IAAIc,GAAe,KAAM,IAAI,EACnD,KAAK,eAAiB,IAAIa,GAAe,KAAM,IAAI,EACnD,GAAI,CACA,KAAK,WAAW,WAAW,EAC3B,KAAK,iBAAiB,YAAY,CACtC,OACOlC,EAAP,CACI,KAAK,YAAYA,EAAO,yBAAyB,CACrD,CACJ,CACA,SAAU,CACN,KAAK,gBAAgB,MAAM,EAC3B,KAAK,cAAc,MAAM,EACzB,KAAK,eAAe,MAAM,EAC1B,KAAK,eAAe,MAAM,EAC1B,GAAI,CACA,KAAK,WAAW,QAAQ,EACxB,KAAK,iBAAiB,SAAS,CACnC,OACOA,EAAP,CACI,KAAK,YAAYA,EAAO,uBAAuB,CACnD,CACJ,CACA,SAAU,CACN,KAAK,eAAe,QAAQ,CAChC,CACA,YAAa,CACT,GAAI,CACA,KAAK,WAAW,WAAW,EAC3B,KAAK,iBAAiB,YAAY,CACtC,OACOA,EAAP,CACI,KAAK,YAAYA,EAAO,0BAA0B,CACtD,CACA,KAAK,eAAe,KAAK,EACzB,KAAK,eAAe,KAAK,EACzB,KAAK,cAAc,KAAK,EACxB,KAAK,gBAAgB,KAAK,CAC9B,CACA,IAAI,aAAc,CACd,OAAO,KAAK,OAAO,WACvB,CACA,IAAI,YAAa,CACb,OAAO,KAAK,OAAO,UACvB,CACA,IAAI,QAAS,CACT,OAAO,KAAK,YAAY,MAC5B,CACA,IAAI,YAAa,CACb,OAAO,KAAK,YAAY,UAC5B,CACA,IAAI,SAAU,CACV,OAAO,KAAK,MAAM,OACtB,CACA,IAAI,eAAgB,CAChB,OAAO,KAAK,QAAQ,aACxB,CACA,YAAYA,EAAOgD,EAASH,EAAS,CAAC,EAAG,CACrC,GAAM,CAAE,WAAAC,EAAY,WAAAC,EAAY,QAAA3F,CAAQ,EAAI,KAC5CyF,EAAS,OAAO,OAAO,CAAE,WAAAC,EAAY,WAAAC,EAAY,QAAA3F,CAAQ,EAAGyF,CAAM,EAClE,KAAK,YAAY,YAAY7C,EAAO,SAASgD,IAAWH,CAAM,CAClE,CACA,gBAAgBzF,EAASsD,EAAM,CAC3B,KAAK,uBAAuB,GAAGA,mBAAuBtD,CAAO,CACjE,CACA,mBAAmBA,EAASsD,EAAM,CAC9B,KAAK,uBAAuB,GAAGA,sBAA0BtD,CAAO,CACpE,CACA,gBAAgBkF,EAAQlF,EAASsD,EAAM,CACnC,KAAK,uBAAuB,GAAGuC,GAAkBvC,CAAI,mBAAoB4B,EAAQlF,CAAO,CAC5F,CACA,mBAAmBkF,EAAQlF,EAASsD,EAAM,CACtC,KAAK,uBAAuB,GAAGuC,GAAkBvC,CAAI,sBAAuB4B,EAAQlF,CAAO,CAC/F,CACA,uBAAuB8F,KAAeC,EAAM,CACxC,IAAMJ,EAAa,KAAK,WACpB,OAAOA,EAAWG,IAAe,YACjCH,EAAWG,GAAY,GAAGC,CAAI,CAEtC,CACJ,EAEA,SAASC,GAAM5B,EAAa,CACxB,OAAO6B,GAAO7B,EAAa8B,GAAqB9B,CAAW,CAAC,CAChE,CACA,SAAS6B,GAAO7B,EAAa+B,EAAY,CACrC,IAAMC,EAAoBC,GAAOjC,CAAW,EACtCkC,EAAmBC,GAAoBnC,EAAY,UAAW+B,CAAU,EAC9E,cAAO,iBAAiBC,EAAkB,UAAWE,CAAgB,EAC9DF,CACX,CACA,SAASF,GAAqB9B,EAAa,CAEvC,OADkBD,GAAiCC,EAAa,WAAW,EAC1D,OAAO,CAACoC,EAAmBC,IAAa,CACrD,IAAMN,EAAaM,EAASrC,CAAW,EACvC,QAAWnD,KAAOkF,EAAY,CAC1B,IAAM9C,EAAamD,EAAkBvF,IAAQ,CAAC,EAC9CuF,EAAkBvF,GAAO,OAAO,OAAOoC,EAAY8C,EAAWlF,EAAI,CACtE,CACA,OAAOuF,CACX,EAAG,CAAC,CAAC,CACT,CACA,SAASD,GAAoBG,EAAWP,EAAY,CAChD,OAAOQ,GAAWR,CAAU,EAAE,OAAO,CAACG,EAAkBrF,IAAQ,CAC5D,IAAMoC,EAAauD,GAAsBF,EAAWP,EAAYlF,CAAG,EACnE,OAAIoC,GACA,OAAO,OAAOiD,EAAkB,CAAE,CAACrF,GAAMoC,CAAW,CAAC,EAElDiD,CACX,EAAG,CAAC,CAAC,CACT,CACA,SAASM,GAAsBF,EAAWP,EAAYlF,EAAK,CACvD,IAAM4F,EAAsB,OAAO,yBAAyBH,EAAWzF,CAAG,EAE1E,GAAI,EADoB4F,GAAuB,UAAWA,GACpC,CAClB,IAAMxD,EAAa,OAAO,yBAAyB8C,EAAYlF,CAAG,EAAE,MACpE,OAAI4F,IACAxD,EAAW,IAAMwD,EAAoB,KAAOxD,EAAW,IACvDA,EAAW,IAAMwD,EAAoB,KAAOxD,EAAW,KAEpDA,CACX,CACJ,CACA,IAAMsD,IAAc,IACZ,OAAO,OAAO,uBAAyB,WAC/BG,GAAW,CAAC,GAAG,OAAO,oBAAoBA,CAAM,EAAG,GAAG,OAAO,sBAAsBA,CAAM,CAAC,EAG3F,OAAO,qBAEnB,EACGT,IAAU,IAAM,CAClB,SAASU,EAAkB3C,EAAa,CACpC,SAAS4C,GAAW,CAChB,OAAO,QAAQ,UAAU5C,EAAa,UAAW,UAAU,CAC/D,CACA,OAAA4C,EAAS,UAAY,OAAO,OAAO5C,EAAY,UAAW,CACtD,YAAa,CAAE,MAAO4C,CAAS,CACnC,CAAC,EACD,QAAQ,eAAeA,EAAU5C,CAAW,EACrC4C,CACX,CACA,SAASC,GAAuB,CAI5B,IAAMC,EAAIH,EAHA,UAAY,CAClB,KAAK,EAAE,KAAK,IAAI,CACpB,CAC6B,EAC7B,OAAAG,EAAE,UAAU,EAAI,UAAY,CAAE,EACvB,IAAIA,CACf,CACA,GAAI,CACA,OAAAD,EAAqB,EACdF,CACX,MACA,CACI,OAAQ3C,GAAgB,cAAuBA,CAAY,CAC3D,CACJ,CACJ,GAAG,EAEH,SAAS+C,GAAgBtC,EAAY,CACjC,MAAO,CACH,WAAYA,EAAW,WACvB,sBAAuBmB,GAAMnB,EAAW,qBAAqB,CACjE,CACJ,CAEA,IAAMuC,GAAN,KAAa,CACT,YAAYC,EAAaxC,EAAY,CACjC,KAAK,YAAcwC,EACnB,KAAK,WAAaF,GAAgBtC,CAAU,EAC5C,KAAK,gBAAkB,IAAI,QAC3B,KAAK,kBAAoB,IAAI,GACjC,CACA,IAAI,YAAa,CACb,OAAO,KAAK,WAAW,UAC3B,CACA,IAAI,uBAAwB,CACxB,OAAO,KAAK,WAAW,qBAC3B,CACA,IAAI,UAAW,CACX,OAAO,MAAM,KAAK,KAAK,iBAAiB,CAC5C,CACA,uBAAuBU,EAAO,CAC1B,IAAMzC,EAAU,KAAK,qBAAqByC,CAAK,EAC/C,KAAK,kBAAkB,IAAIzC,CAAO,EAClCA,EAAQ,QAAQ,CACpB,CACA,0BAA0ByC,EAAO,CAC7B,IAAMzC,EAAU,KAAK,gBAAgB,IAAIyC,CAAK,EAC1CzC,IACA,KAAK,kBAAkB,OAAOA,CAAO,EACrCA,EAAQ,WAAW,EAE3B,CACA,qBAAqByC,EAAO,CACxB,IAAIzC,EAAU,KAAK,gBAAgB,IAAIyC,CAAK,EAC5C,OAAKzC,IACDA,EAAU,IAAIwC,GAAQ,KAAMC,CAAK,EACjC,KAAK,gBAAgB,IAAIA,EAAOzC,CAAO,GAEpCA,CACX,CACJ,EAEMwE,GAAN,KAAe,CACX,YAAY/B,EAAO,CACf,KAAK,MAAQA,CACjB,CACA,IAAIjC,EAAM,CACN,OAAO,KAAK,KAAK,IAAI,KAAK,WAAWA,CAAI,CAAC,CAC9C,CACA,IAAIA,EAAM,CACN,OAAO,KAAK,OAAOA,CAAI,EAAE,EAC7B,CACA,OAAOA,EAAM,CACT,IAAMrB,EAAc,KAAK,KAAK,IAAI,KAAK,WAAWqB,CAAI,CAAC,GAAK,GAC5D,OAAOiE,GAAStF,CAAW,CAC/B,CACA,iBAAiBqB,EAAM,CACnB,OAAO,KAAK,KAAK,uBAAuB,KAAK,WAAWA,CAAI,CAAC,CACjE,CACA,WAAWA,EAAM,CACb,MAAO,GAAGA,SACd,CACA,IAAI,MAAO,CACP,OAAO,KAAK,MAAM,IACtB,CACJ,EAEMkE,GAAN,KAAc,CACV,YAAYjC,EAAO,CACf,KAAK,MAAQA,CACjB,CACA,IAAI,SAAU,CACV,OAAO,KAAK,MAAM,OACtB,CACA,IAAI,YAAa,CACb,OAAO,KAAK,MAAM,UACtB,CACA,IAAItE,EAAK,CACL,IAAMqC,EAAO,KAAK,uBAAuBrC,CAAG,EAC5C,OAAO,KAAK,QAAQ,aAAaqC,CAAI,CACzC,CACA,IAAIrC,EAAKC,EAAO,CACZ,IAAMoC,EAAO,KAAK,uBAAuBrC,CAAG,EAC5C,YAAK,QAAQ,aAAaqC,EAAMpC,CAAK,EAC9B,KAAK,IAAID,CAAG,CACvB,CACA,IAAIA,EAAK,CACL,IAAMqC,EAAO,KAAK,uBAAuBrC,CAAG,EAC5C,OAAO,KAAK,QAAQ,aAAaqC,CAAI,CACzC,CACA,OAAOrC,EAAK,CACR,GAAI,KAAK,IAAIA,CAAG,EAAG,CACf,IAAMqC,EAAO,KAAK,uBAAuBrC,CAAG,EAC5C,YAAK,QAAQ,gBAAgBqC,CAAI,EAC1B,EACX,KAEI,OAAO,EAEf,CACA,uBAAuBrC,EAAK,CACxB,MAAO,QAAQ,KAAK,cAAcwG,GAAUxG,CAAG,GACnD,CACJ,EAEMyG,GAAN,KAAY,CACR,YAAYC,EAAQ,CAChB,KAAK,mBAAqB,IAAI,QAC9B,KAAK,OAASA,CAClB,CACA,KAAKb,EAAQ7F,EAAK2E,EAAS,CACvB,IAAIgC,EAAa,KAAK,mBAAmB,IAAId,CAAM,EAC9Cc,IACDA,EAAa,IAAI,IACjB,KAAK,mBAAmB,IAAId,EAAQc,CAAU,GAE7CA,EAAW,IAAI3G,CAAG,IACnB2G,EAAW,IAAI3G,CAAG,EAClB,KAAK,OAAO,KAAK2E,EAASkB,CAAM,EAExC,CACJ,EAEA,SAASe,GAA4B/G,EAAeW,EAAO,CACvD,MAAO,IAAIX,OAAmBW,KAClC,CAEA,IAAMqG,GAAN,KAAgB,CACZ,YAAYvC,EAAO,CACf,KAAK,MAAQA,CACjB,CACA,IAAI,SAAU,CACV,OAAO,KAAK,MAAM,OACtB,CACA,IAAI,YAAa,CACb,OAAO,KAAK,MAAM,UACtB,CACA,IAAI,QAAS,CACT,OAAO,KAAK,MAAM,MACtB,CACA,IAAIwC,EAAY,CACZ,OAAO,KAAK,KAAKA,CAAU,GAAK,IACpC,CACA,QAAQC,EAAa,CACjB,OAAOA,EAAY,OAAO,CAACC,EAAQF,IAAeE,GAAU,KAAK,WAAWF,CAAU,GAAK,KAAK,iBAAiBA,CAAU,EAAG,MAAS,CAC3I,CACA,WAAWC,EAAa,CACpB,OAAOA,EAAY,OAAO,CAACE,EAASH,IAAe,CAC/C,GAAGG,EACH,GAAG,KAAK,eAAeH,CAAU,EACjC,GAAG,KAAK,qBAAqBA,CAAU,CAC3C,EAAG,CAAC,CAAC,CACT,CACA,WAAWA,EAAY,CACnB,IAAM9H,EAAW,KAAK,yBAAyB8H,CAAU,EACzD,OAAO,KAAK,MAAM,YAAY9H,CAAQ,CAC1C,CACA,eAAe8H,EAAY,CACvB,IAAM9H,EAAW,KAAK,yBAAyB8H,CAAU,EACzD,OAAO,KAAK,MAAM,gBAAgB9H,CAAQ,CAC9C,CACA,yBAAyB8H,EAAY,CACjC,IAAMjH,EAAgB,KAAK,OAAO,wBAAwB,KAAK,UAAU,EACzE,OAAO+G,GAA4B/G,EAAeiH,CAAU,CAChE,CACA,iBAAiBA,EAAY,CACzB,IAAM9H,EAAW,KAAK,+BAA+B8H,CAAU,EAC/D,OAAO,KAAK,UAAU,KAAK,MAAM,YAAY9H,CAAQ,EAAG8H,CAAU,CACtE,CACA,qBAAqBA,EAAY,CAC7B,IAAM9H,EAAW,KAAK,+BAA+B8H,CAAU,EAC/D,OAAO,KAAK,MAAM,gBAAgB9H,CAAQ,EAAE,IAAKD,GAAY,KAAK,UAAUA,EAAS+H,CAAU,CAAC,CACpG,CACA,+BAA+BA,EAAY,CACvC,IAAMI,EAAmB,GAAG,KAAK,cAAcJ,IAC/C,OAAOF,GAA4B,KAAK,OAAO,gBAAiBM,CAAgB,CACpF,CACA,UAAUnI,EAAS+H,EAAY,CAC3B,GAAI/H,EAAS,CACT,GAAM,CAAE,WAAA0F,CAAW,EAAI,KACjB5E,EAAgB,KAAK,OAAO,gBAC5BsH,EAAuB,KAAK,OAAO,wBAAwB1C,CAAU,EAC3E,KAAK,MAAM,KAAK1F,EAAS,UAAU+H,IAAc,kBAAkBjH,MAAkB4E,KAAcqC,WAAoBK,MAAyBL,WACrIjH,gFAA4F,CAC3G,CACA,OAAOd,CACX,CACA,IAAI,OAAQ,CACR,OAAO,KAAK,MAAM,KACtB,CACJ,EAEMqI,GAAN,KAAgB,CACZ,YAAY9C,EAAO+C,EAAmB,CAClC,KAAK,MAAQ/C,EACb,KAAK,kBAAoB+C,CAC7B,CACA,IAAI,SAAU,CACV,OAAO,KAAK,MAAM,OACtB,CACA,IAAI,YAAa,CACb,OAAO,KAAK,MAAM,UACtB,CACA,IAAI,QAAS,CACT,OAAO,KAAK,MAAM,MACtB,CACA,IAAIvD,EAAY,CACZ,OAAO,KAAK,KAAKA,CAAU,GAAK,IACpC,CACA,QAAQwD,EAAa,CACjB,OAAOA,EAAY,OAAO,CAACrD,EAAQH,IAAeG,GAAU,KAAK,WAAWH,CAAU,EAAG,MAAS,CACtG,CACA,WAAWwD,EAAa,CACpB,OAAOA,EAAY,OAAO,CAACC,EAASzD,IAAe,CAAC,GAAGyD,EAAS,GAAG,KAAK,eAAezD,CAAU,CAAC,EAAG,CAAC,CAAC,CAC3G,CACA,yBAAyBA,EAAY,CACjC,IAAMjE,EAAgB,KAAK,OAAO,wBAAwB,KAAK,WAAYiE,CAAU,EACrF,OAAO,KAAK,kBAAkB,aAAajE,CAAa,CAC5D,CACA,WAAWiE,EAAY,CACnB,IAAM9E,EAAW,KAAK,yBAAyB8E,CAAU,EACzD,GAAI9E,EACA,OAAO,KAAK,YAAYA,EAAU8E,CAAU,CACpD,CACA,eAAeA,EAAY,CACvB,IAAM9E,EAAW,KAAK,yBAAyB8E,CAAU,EACzD,OAAO9E,EAAW,KAAK,gBAAgBA,EAAU8E,CAAU,EAAI,CAAC,CACpE,CACA,YAAY9E,EAAU8E,EAAY,CAE9B,OADiB,KAAK,MAAM,cAAc9E,CAAQ,EAClC,OAAQD,GAAY,KAAK,eAAeA,EAASC,EAAU8E,CAAU,CAAC,EAAE,EAC5F,CACA,gBAAgB9E,EAAU8E,EAAY,CAElC,OADiB,KAAK,MAAM,cAAc9E,CAAQ,EAClC,OAAQD,GAAY,KAAK,eAAeA,EAASC,EAAU8E,CAAU,CAAC,CAC1F,CACA,eAAe/E,EAASC,EAAU8E,EAAY,CAC1C,IAAM0D,EAAsBzI,EAAQ,aAAa,KAAK,MAAM,OAAO,mBAAmB,GAAK,GAC3F,OAAOA,EAAQ,QAAQC,CAAQ,GAAKwI,EAAoB,MAAM,GAAG,EAAE,SAAS1D,CAAU,CAC1F,CACJ,EAEM2D,GAAN,KAAY,CACR,YAAYC,EAAQ3I,EAAS0F,EAAYiC,EAAQ,CAC7C,KAAK,QAAU,IAAIG,GAAU,IAAI,EACjC,KAAK,QAAU,IAAIR,GAAS,IAAI,EAChC,KAAK,KAAO,IAAIE,GAAQ,IAAI,EAC5B,KAAK,gBAAmBxH,GACbA,EAAQ,QAAQ,KAAK,kBAAkB,IAAM,KAAK,QAE7D,KAAK,OAAS2I,EACd,KAAK,QAAU3I,EACf,KAAK,WAAa0F,EAClB,KAAK,MAAQ,IAAIgC,GAAMC,CAAM,EAC7B,KAAK,QAAU,IAAIU,GAAU,KAAK,cAAerI,CAAO,CAC5D,CACA,YAAYC,EAAU,CAClB,OAAO,KAAK,QAAQ,QAAQA,CAAQ,EAAI,KAAK,QAAU,KAAK,cAAcA,CAAQ,EAAE,KAAK,KAAK,eAAe,CACjH,CACA,gBAAgBA,EAAU,CACtB,MAAO,CACH,GAAI,KAAK,QAAQ,QAAQA,CAAQ,EAAI,CAAC,KAAK,OAAO,EAAI,CAAC,EACvD,GAAG,KAAK,cAAcA,CAAQ,EAAE,OAAO,KAAK,eAAe,CAC/D,CACJ,CACA,cAAcA,EAAU,CACpB,OAAO,MAAM,KAAK,KAAK,QAAQ,iBAAiBA,CAAQ,CAAC,CAC7D,CACA,IAAI,oBAAqB,CACrB,OAAO4H,GAA4B,KAAK,OAAO,oBAAqB,KAAK,UAAU,CACvF,CACA,IAAI,iBAAkB,CAClB,OAAO,KAAK,UAAY,SAAS,eACrC,CACA,IAAI,eAAgB,CAChB,OAAO,KAAK,gBACN,KACA,IAAIa,GAAM,KAAK,OAAQ,SAAS,gBAAiB,KAAK,WAAY,KAAK,MAAM,MAAM,CAC7F,CACJ,EAEME,GAAN,KAAoB,CAChB,YAAY5I,EAAS2I,EAAQzI,EAAU,CACnC,KAAK,QAAUF,EACf,KAAK,OAAS2I,EACd,KAAK,SAAWzI,EAChB,KAAK,kBAAoB,IAAIuC,GAAkB,KAAK,QAAS,KAAK,oBAAqB,IAAI,EAC3F,KAAK,4BAA8B,IAAI,QACvC,KAAK,qBAAuB,IAAI,OACpC,CACA,OAAQ,CACJ,KAAK,kBAAkB,MAAM,CACjC,CACA,MAAO,CACH,KAAK,kBAAkB,KAAK,CAChC,CACA,IAAI,qBAAsB,CACtB,OAAO,KAAK,OAAO,mBACvB,CACA,mBAAmBhB,EAAO,CACtB,GAAM,CAAE,QAAAzB,EAAS,QAAS0F,CAAW,EAAIjE,EACnCoH,EAAqB,KAAK,kCAAkC7I,CAAO,EACrEuF,EAAQsD,EAAmB,IAAInD,CAAU,EAC7C,OAAKH,IACDA,EAAQ,KAAK,SAAS,mCAAmCvF,EAAS0F,CAAU,EAC5EmD,EAAmB,IAAInD,EAAYH,CAAK,GAErCA,CACX,CACA,oBAAoBvF,EAASkB,EAAO,CAChC,IAAM4H,GAAkB,KAAK,qBAAqB,IAAI5H,CAAK,GAAK,GAAK,EACrE,KAAK,qBAAqB,IAAIA,EAAO4H,CAAc,EAC/CA,GAAkB,GAClB,KAAK,SAAS,eAAe5H,CAAK,CAE1C,CACA,sBAAsBlB,EAASkB,EAAO,CAClC,IAAM4H,EAAiB,KAAK,qBAAqB,IAAI5H,CAAK,EACtD4H,IACA,KAAK,qBAAqB,IAAI5H,EAAO4H,EAAiB,CAAC,EACnDA,GAAkB,GAClB,KAAK,SAAS,kBAAkB5H,CAAK,EAGjD,CACA,kCAAkClB,EAAS,CACvC,IAAI6I,EAAqB,KAAK,4BAA4B,IAAI7I,CAAO,EACrE,OAAK6I,IACDA,EAAqB,IAAI,IACzB,KAAK,4BAA4B,IAAI7I,EAAS6I,CAAkB,GAE7DA,CACX,CACJ,EAEME,GAAN,KAAa,CACT,YAAY1B,EAAa,CACrB,KAAK,YAAcA,EACnB,KAAK,cAAgB,IAAIuB,GAAc,KAAK,QAAS,KAAK,OAAQ,IAAI,EACtE,KAAK,mBAAqB,IAAIvI,GAC9B,KAAK,oBAAsB,IAAI,GACnC,CACA,IAAI,SAAU,CACV,OAAO,KAAK,YAAY,OAC5B,CACA,IAAI,QAAS,CACT,OAAO,KAAK,YAAY,MAC5B,CACA,IAAI,QAAS,CACT,OAAO,KAAK,YAAY,MAC5B,CACA,IAAI,qBAAsB,CACtB,OAAO,KAAK,OAAO,mBACvB,CACA,IAAI,SAAU,CACV,OAAO,MAAM,KAAK,KAAK,oBAAoB,OAAO,CAAC,CACvD,CACA,IAAI,UAAW,CACX,OAAO,KAAK,QAAQ,OAAO,CAAC2I,EAAU5D,IAAW4D,EAAS,OAAO5D,EAAO,QAAQ,EAAG,CAAC,CAAC,CACzF,CACA,OAAQ,CACJ,KAAK,cAAc,MAAM,CAC7B,CACA,MAAO,CACH,KAAK,cAAc,KAAK,CAC5B,CACA,eAAeP,EAAY,CACvB,KAAK,iBAAiBA,EAAW,UAAU,EAC3C,IAAMO,EAAS,IAAIgC,GAAO,KAAK,YAAavC,CAAU,EACtD,KAAK,cAAcO,CAAM,EACzB,IAAM6D,EAAYpE,EAAW,sBAAsB,UAC/CoE,GACAA,EAAUpE,EAAW,WAAY,KAAK,WAAW,CAEzD,CACA,iBAAiBa,EAAY,CACzB,IAAMN,EAAS,KAAK,oBAAoB,IAAIM,CAAU,EAClDN,GACA,KAAK,iBAAiBA,CAAM,CAEpC,CACA,kCAAkCpF,EAAS0F,EAAY,CACnD,IAAMN,EAAS,KAAK,oBAAoB,IAAIM,CAAU,EACtD,GAAIN,EACA,OAAOA,EAAO,SAAS,KAAMtC,GAAYA,EAAQ,SAAW9C,CAAO,CAE3E,CACA,YAAY4C,EAAOgD,EAASH,EAAQ,CAChC,KAAK,YAAY,YAAY7C,EAAOgD,EAASH,CAAM,CACvD,CACA,mCAAmCzF,EAAS0F,EAAY,CACpD,OAAO,IAAIgD,GAAM,KAAK,OAAQ1I,EAAS0F,EAAY,KAAK,MAAM,CAClE,CACA,eAAeH,EAAO,CAClB,KAAK,mBAAmB,IAAIA,EAAM,WAAYA,CAAK,EACnD,IAAMH,EAAS,KAAK,oBAAoB,IAAIG,EAAM,UAAU,EACxDH,GACAA,EAAO,uBAAuBG,CAAK,CAE3C,CACA,kBAAkBA,EAAO,CACrB,KAAK,mBAAmB,OAAOA,EAAM,WAAYA,CAAK,EACtD,IAAMH,EAAS,KAAK,oBAAoB,IAAIG,EAAM,UAAU,EACxDH,GACAA,EAAO,0BAA0BG,CAAK,CAE9C,CACA,cAAcH,EAAQ,CAClB,KAAK,oBAAoB,IAAIA,EAAO,WAAYA,CAAM,EACvC,KAAK,mBAAmB,gBAAgBA,EAAO,UAAU,EACjE,QAASG,GAAUH,EAAO,uBAAuBG,CAAK,CAAC,CAClE,CACA,iBAAiBH,EAAQ,CACrB,KAAK,oBAAoB,OAAOA,EAAO,UAAU,EAClC,KAAK,mBAAmB,gBAAgBA,EAAO,UAAU,EACjE,QAASG,GAAUH,EAAO,0BAA0BG,CAAK,CAAC,CACrE,CACJ,EAEM2D,GAAgB,CAClB,oBAAqB,kBACrB,gBAAiB,cACjB,gBAAiB,cACjB,wBAA0BxD,GAAe,QAAQA,WACjD,wBAAyB,CAACA,EAAYR,IAAW,QAAQQ,KAAcR,WACvE,YAAa,OAAO,OAAO,OAAO,OAAO,CAAE,MAAO,QAAS,IAAK,MAAO,IAAK,SAAU,MAAO,IAAK,GAAI,UAAW,KAAM,YAAa,KAAM,YAAa,MAAO,aAAc,KAAM,OAAQ,IAAK,KAAM,EAAGiE,GAAkB,6BAA6B,MAAM,EAAE,EAAE,IAAKC,GAAM,CAACA,EAAGA,CAAC,CAAC,CAAC,CAAC,EAAGD,GAAkB,aAAa,MAAM,EAAE,EAAE,IAAKE,GAAM,CAACA,EAAGA,CAAC,CAAC,CAAC,CAAC,CACvV,EACA,SAASF,GAAkBG,EAAO,CAC9B,OAAOA,EAAM,OAAO,CAACC,EAAM,CAACC,EAAGC,CAAC,IAAO,OAAO,OAAO,OAAO,OAAO,CAAC,EAAGF,CAAI,EAAG,CAAE,CAACC,GAAIC,CAAE,CAAC,EAAI,CAAC,CAAC,CAClG,CAEA,IAAMC,GAAN,KAAkB,CACd,YAAY1J,EAAU,SAAS,gBAAiB2I,EAASO,GAAe,CACpE,KAAK,OAAS,QACd,KAAK,MAAQ,GACb,KAAK,iBAAmB,CAACxD,EAAYF,EAAcC,EAAS,CAAC,IAAM,CAC3D,KAAK,OACL,KAAK,oBAAoBC,EAAYF,EAAcC,CAAM,CAEjE,EACA,KAAK,QAAUzF,EACf,KAAK,OAAS2I,EACd,KAAK,WAAa,IAAIgB,GAAW,IAAI,EACrC,KAAK,OAAS,IAAIZ,GAAO,IAAI,EAC7B,KAAK,wBAA0B,OAAO,OAAO,CAAC,EAAGa,EAA8B,CACnF,CACA,OAAO,MAAM5J,EAAS2I,EAAQ,CAC1B,IAAMtB,EAAc,IAAI,KAAKrH,EAAS2I,CAAM,EAC5C,OAAAtB,EAAY,MAAM,EACXA,CACX,CACA,MAAM,OAAQ,CACV,MAAMwC,GAAS,EACf,KAAK,iBAAiB,cAAe,UAAU,EAC/C,KAAK,WAAW,MAAM,EACtB,KAAK,OAAO,MAAM,EAClB,KAAK,iBAAiB,cAAe,OAAO,CAChD,CACA,MAAO,CACH,KAAK,iBAAiB,cAAe,UAAU,EAC/C,KAAK,WAAW,KAAK,EACrB,KAAK,OAAO,KAAK,EACjB,KAAK,iBAAiB,cAAe,MAAM,CAC/C,CACA,SAASnE,EAAYoE,EAAuB,CACxC,KAAK,KAAK,CAAE,WAAApE,EAAY,sBAAAoE,CAAsB,CAAC,CACnD,CACA,qBAAqBxG,EAAMyG,EAAQ,CAC/B,KAAK,wBAAwBzG,GAAQyG,CACzC,CACA,KAAKC,KAASC,EAAM,EACI,MAAM,QAAQD,CAAI,EAAIA,EAAO,CAACA,EAAM,GAAGC,CAAI,GACnD,QAASpF,GAAe,CAC5BA,EAAW,sBAAsB,YACjC,KAAK,OAAO,eAAeA,CAAU,CAE7C,CAAC,CACL,CACA,OAAOmF,KAASC,EAAM,EACE,MAAM,QAAQD,CAAI,EAAIA,EAAO,CAACA,EAAM,GAAGC,CAAI,GACnD,QAASvE,GAAe,KAAK,OAAO,iBAAiBA,CAAU,CAAC,CAChF,CACA,IAAI,aAAc,CACd,OAAO,KAAK,OAAO,SAAS,IAAK5C,GAAYA,EAAQ,UAAU,CACnE,CACA,qCAAqC9C,EAAS0F,EAAY,CACtD,IAAM5C,EAAU,KAAK,OAAO,kCAAkC9C,EAAS0F,CAAU,EACjF,OAAO5C,EAAUA,EAAQ,WAAa,IAC1C,CACA,YAAYF,EAAOgD,EAASH,EAAQ,CAChC,IAAIvB,EACJ,KAAK,OAAO,MAAM;AAAA;AAAA;AAAA;AAAA,IAAkB0B,EAAShD,EAAO6C,CAAM,GACzDvB,EAAK,OAAO,WAAa,MAAQA,IAAO,QAAkBA,EAAG,KAAK,OAAQ0B,EAAS,GAAI,EAAG,EAAGhD,CAAK,CACvG,CACA,oBAAoB8C,EAAYF,EAAcC,EAAS,CAAC,EAAG,CACvDA,EAAS,OAAO,OAAO,CAAE,YAAa,IAAK,EAAGA,CAAM,EACpD,KAAK,OAAO,eAAe,GAAGC,MAAeF,GAAc,EAC3D,KAAK,OAAO,IAAI,WAAY,OAAO,OAAO,CAAC,EAAGC,CAAM,CAAC,EACrD,KAAK,OAAO,SAAS,CACzB,CACJ,EACA,SAASoE,IAAW,CAChB,OAAO,IAAI,QAASK,GAAY,CACxB,SAAS,YAAc,UACvB,SAAS,iBAAiB,mBAAoB,IAAMA,EAAQ,CAAC,EAG7DA,EAAQ,CAEhB,CAAC,CACL,CAEA,SAASC,GAAwB/F,EAAa,CAE1C,OADgBD,GAAiCC,EAAa,SAAS,EACxD,OAAO,CAAC+B,EAAYiE,IACxB,OAAO,OAAOjE,EAAYkE,GAA6BD,CAAe,CAAC,EAC/E,CAAC,CAAC,CACT,CACA,SAASC,GAA6BpJ,EAAK,CACvC,MAAO,CACH,CAAC,GAAGA,UAAa,CACb,KAAM,CACF,GAAM,CAAE,QAAAqJ,CAAQ,EAAI,KACpB,GAAIA,EAAQ,IAAIrJ,CAAG,EACf,OAAOqJ,EAAQ,IAAIrJ,CAAG,EAErB,CACD,IAAME,EAAYmJ,EAAQ,iBAAiBrJ,CAAG,EAC9C,MAAM,IAAI,MAAM,sBAAsBE,IAAY,CACtD,CACJ,CACJ,EACA,CAAC,GAAGF,YAAe,CACf,KAAM,CACF,OAAO,KAAK,QAAQ,OAAOA,CAAG,CAClC,CACJ,EACA,CAAC,MAAM+C,GAAW/C,CAAG,UAAW,CAC5B,KAAM,CACF,OAAO,KAAK,QAAQ,IAAIA,CAAG,CAC/B,CACJ,CACJ,CACJ,CAEA,SAASsJ,GAAyBnG,EAAa,CAE3C,OADgBD,GAAiCC,EAAa,SAAS,EACxD,OAAO,CAAC+B,EAAYqE,IACxB,OAAO,OAAOrE,EAAYsE,GAA8BD,CAAgB,CAAC,EACjF,CAAC,CAAC,CACT,CACA,SAASC,GAA8BnH,EAAM,CACzC,IAAMoH,EAAgB7E,GAAkBvC,CAAI,EAC5C,MAAO,CACH,CAAC,GAAGoH,WAAwB,CACxB,KAAM,CACF,IAAMxF,EAAS,KAAK,QAAQ,KAAK5B,CAAI,EACrC,GAAI4B,EAAQ,CACR,IAAMyF,EAAmB,KAAK,YAAY,qCAAqCzF,EAAQ5B,CAAI,EAC3F,GAAIqH,EACA,OAAOA,EAGP,MAAM,IAAI,MAAM,4BAA4BrH,uCAA0C,KAAK,wBAAwB,CAE3H,CACA,MAAM,IAAI,MAAM,2BAA2BA,WAAc,KAAK,wBAAwB,CAC1F,CACJ,EACA,CAAC,GAAGoH,YAAyB,CACzB,KAAM,CACF,IAAMlC,EAAU,KAAK,QAAQ,QAAQlF,CAAI,EACzC,OAAIkF,EAAQ,OAAS,EACVA,EACF,IAAKtD,GAAW,CACjB,IAAMS,EAAa,KAAK,YAAY,qCAAqCT,EAAQ5B,CAAI,EACrF,GAAIqC,EACA,OAAOA,EAGP,QAAQ,KAAK,iEAAiErC,WAAc,KAAK,cAAe4B,CAAM,CAE9H,CAAC,EACI,OAAQS,GAAeA,CAAU,EAEnC,CAAC,CACZ,CACJ,EACA,CAAC,GAAG+E,kBAA+B,CAC/B,KAAM,CACF,IAAMxF,EAAS,KAAK,QAAQ,KAAK5B,CAAI,EACrC,GAAI4B,EACA,OAAOA,EAGP,MAAM,IAAI,MAAM,2BAA2B5B,WAAc,KAAK,wBAAwB,CAE9F,CACJ,EACA,CAAC,GAAGoH,mBAAgC,CAChC,KAAM,CACF,OAAO,KAAK,QAAQ,QAAQpH,CAAI,CACpC,CACJ,EACA,CAAC,MAAMU,GAAW0G,CAAa,WAAY,CACvC,KAAM,CACF,OAAO,KAAK,QAAQ,IAAIpH,CAAI,CAChC,CACJ,CACJ,CACJ,CAEA,SAASsH,GAAyBxG,EAAa,CAE3C,OADgBD,GAAiCC,EAAa,SAAS,EACxD,OAAO,CAAC+B,EAAY0E,IACxB,OAAO,OAAO1E,EAAY2E,GAA8BD,CAAgB,CAAC,EACjF,CAAC,CAAC,CACT,CACA,SAASC,GAA8BxH,EAAM,CACzC,MAAO,CACH,CAAC,GAAGA,WAAe,CACf,KAAM,CACF,IAAM2E,EAAS,KAAK,QAAQ,KAAK3E,CAAI,EACrC,GAAI2E,EACA,OAAOA,EAGP,MAAM,IAAI,MAAM,2BAA2B3E,WAAc,KAAK,wBAAwB,CAE9F,CACJ,EACA,CAAC,GAAGA,YAAgB,CAChB,KAAM,CACF,OAAO,KAAK,QAAQ,QAAQA,CAAI,CACpC,CACJ,EACA,CAAC,MAAMU,GAAWV,CAAI,WAAY,CAC9B,KAAM,CACF,OAAO,KAAK,QAAQ,IAAIA,CAAI,CAChC,CACJ,CACJ,CACJ,CAEA,SAASyH,GAAwB3G,EAAa,CAC1C,IAAM4G,EAAuBtG,GAAiCN,EAAa,QAAQ,EAC7E6G,EAAwB,CAC1B,mBAAoB,CAChB,KAAM,CACF,OAAOD,EAAqB,OAAO,CAACE,EAAQC,IAAwB,CAChE,IAAMC,EAAkBC,GAAyBF,EAAqB,KAAK,UAAU,EAC/ErK,EAAgB,KAAK,KAAK,uBAAuBsK,EAAgB,GAAG,EAC1E,OAAO,OAAO,OAAOF,EAAQ,CAAE,CAACpK,GAAgBsK,CAAgB,CAAC,CACrE,EAAG,CAAC,CAAC,CACT,CACJ,CACJ,EACA,OAAOJ,EAAqB,OAAO,CAAC7E,EAAYgF,IACrC,OAAO,OAAOhF,EAAYmF,GAAiCH,CAAmB,CAAC,EACvFF,CAAqB,CAC5B,CACA,SAASK,GAAiCH,EAAqBxF,EAAY,CACvE,IAAMd,EAAawG,GAAyBF,EAAqBxF,CAAU,EACrE,CAAE,IAAA1E,EAAK,KAAAqC,EAAM,OAAQiI,EAAM,OAAQC,CAAM,EAAI3G,EACnD,MAAO,CACH,CAACvB,GAAO,CACJ,KAAM,CACF,IAAMpC,EAAQ,KAAK,KAAK,IAAID,CAAG,EAC/B,OAAIC,IAAU,KACHqK,EAAKrK,CAAK,EAGV2D,EAAW,YAE1B,EACA,IAAI3D,EAAO,CACHA,IAAU,OACV,KAAK,KAAK,OAAOD,CAAG,EAGpB,KAAK,KAAK,IAAIA,EAAKuK,EAAMtK,CAAK,CAAC,CAEvC,CACJ,EACA,CAAC,MAAM8C,GAAWV,CAAI,KAAM,CACxB,KAAM,CACF,OAAO,KAAK,KAAK,IAAIrC,CAAG,GAAK4D,EAAW,qBAC5C,CACJ,CACJ,CACJ,CACA,SAASwG,GAAyB,CAAC5J,EAAOgK,CAAc,EAAG9F,EAAY,CACnE,OAAO+F,GAAyC,CAC5C,WAAA/F,EACA,MAAAlE,EACA,eAAAgK,CACJ,CAAC,CACL,CACA,SAASE,GAAuBC,EAAU,CACtC,OAAQA,EAAU,CACd,KAAK,MACD,MAAO,QACX,KAAK,QACD,MAAO,UACX,KAAK,OACD,MAAO,SACX,KAAK,OACD,MAAO,SACX,KAAK,OACD,MAAO,QACf,CACJ,CACA,SAASC,GAAsBtI,EAAc,CACzC,OAAQ,OAAOA,EAAc,CACzB,IAAK,UACD,MAAO,UACX,IAAK,SACD,MAAO,SACX,IAAK,SACD,MAAO,QACf,CACA,GAAI,MAAM,QAAQA,CAAY,EAC1B,MAAO,QACX,GAAI,OAAO,UAAU,SAAS,KAAKA,CAAY,IAAM,kBACjD,MAAO,QACf,CACA,SAASuI,GAAqBC,EAAS,CACnC,IAAMC,EAAiBL,GAAuBI,EAAQ,WAAW,IAAI,EACrE,GAAI,CAACC,EACD,OACJ,IAAMC,EAAmBJ,GAAsBE,EAAQ,WAAW,OAAO,EACzE,GAAIC,IAAmBC,EAAkB,CACrC,IAAMC,EAAeH,EAAQ,WAAa,GAAGA,EAAQ,cAAcA,EAAQ,QAAUA,EAAQ,MAC7F,MAAM,IAAI,MAAM,uDAAuDG,mCAA8CF,sCAAmDD,EAAQ,WAAW,wBAAwBE,KAAoB,CAC3O,CACA,OAAOD,CACX,CACA,SAASG,GAAyBJ,EAAS,CACvC,IAAMC,EAAiBF,GAAqB,CACxC,WAAYC,EAAQ,WACpB,MAAOA,EAAQ,MACf,WAAYA,EAAQ,cACxB,CAAC,EACKK,EAAuBP,GAAsBE,EAAQ,cAAc,EACnEM,EAAmBV,GAAuBI,EAAQ,cAAc,EAChEO,EAAON,GAAkBI,GAAwBC,EACvD,GAAIC,EACA,OAAOA,EACX,IAAMJ,EAAeH,EAAQ,WAAa,GAAGA,EAAQ,cAAcA,EAAQ,iBAAmBA,EAAQ,MACtG,MAAM,IAAI,MAAM,uBAAuBG,WAAsBH,EAAQ,cAAc,CACvF,CACA,SAASQ,GAA0Bd,EAAgB,CAC/C,IAAMG,EAAWD,GAAuBF,CAAc,EACtD,GAAIG,EACA,OAAOY,GAAoBZ,GAC/B,IAAMrI,EAAekI,EAAe,QACpC,OAAIlI,IAAiB,OACVA,EACJkI,CACX,CACA,SAASC,GAAyCK,EAAS,CACvD,IAAM9K,EAAM,GAAGwG,GAAUsE,EAAQ,KAAK,UAChCO,EAAOH,GAAyBJ,CAAO,EAC7C,MAAO,CACH,KAAAO,EACA,IAAArL,EACA,KAAMwL,GAASxL,CAAG,EAClB,IAAI,cAAe,CACf,OAAOsL,GAA0BR,EAAQ,cAAc,CAC3D,EACA,IAAI,uBAAwB,CACxB,OAAOF,GAAsBE,EAAQ,cAAc,IAAM,MAC7D,EACA,OAAQW,GAAQJ,GAChB,OAAQK,GAAQL,IAASK,GAAQ,OACrC,CACJ,CACA,IAAMH,GAAsB,CACxB,IAAI,OAAQ,CACR,MAAO,CAAC,CACZ,EACA,QAAS,GACT,OAAQ,EACR,IAAI,QAAS,CACT,MAAO,CAAC,CACZ,EACA,OAAQ,EACZ,EACME,GAAU,CACZ,MAAMxL,EAAO,CACT,IAAMoI,EAAQ,KAAK,MAAMpI,CAAK,EAC9B,GAAI,CAAC,MAAM,QAAQoI,CAAK,EACpB,MAAM,IAAI,UAAU,yDAAyDpI,eAAmB2K,GAAsBvC,CAAK,IAAI,EAEnI,OAAOA,CACX,EACA,QAAQpI,EAAO,CACX,MAAO,EAAEA,GAAS,KAAO,OAAOA,CAAK,EAAE,YAAY,GAAK,QAC5D,EACA,OAAOA,EAAO,CACV,OAAO,OAAOA,CAAK,CACvB,EACA,OAAOA,EAAO,CACV,IAAM4F,EAAS,KAAK,MAAM5F,CAAK,EAC/B,GAAI4F,IAAW,MAAQ,OAAOA,GAAU,UAAY,MAAM,QAAQA,CAAM,EACpE,MAAM,IAAI,UAAU,0DAA0D5F,eAAmB2K,GAAsB/E,CAAM,IAAI,EAErI,OAAOA,CACX,EACA,OAAO5F,EAAO,CACV,OAAOA,CACX,CACJ,EACMyL,GAAU,CACZ,QAASC,GACT,MAAOC,GACP,OAAQA,EACZ,EACA,SAASA,GAAU3L,EAAO,CACtB,OAAO,KAAK,UAAUA,CAAK,CAC/B,CACA,SAAS0L,GAAY1L,EAAO,CACxB,MAAO,GAAGA,GACd,CAEA,IAAM4L,GAAN,KAAiB,CACb,YAAYhK,EAAS,CACjB,KAAK,QAAUA,CACnB,CACA,WAAW,YAAa,CACpB,MAAO,EACX,CACA,OAAO,UAAUiK,EAAaC,EAAc,CAE5C,CACA,IAAI,aAAc,CACd,OAAO,KAAK,QAAQ,WACxB,CACA,IAAI,OAAQ,CACR,OAAO,KAAK,QAAQ,KACxB,CACA,IAAI,SAAU,CACV,OAAO,KAAK,MAAM,OACtB,CACA,IAAI,YAAa,CACb,OAAO,KAAK,MAAM,UACtB,CACA,IAAI,SAAU,CACV,OAAO,KAAK,MAAM,OACtB,CACA,IAAI,SAAU,CACV,OAAO,KAAK,MAAM,OACtB,CACA,IAAI,SAAU,CACV,OAAO,KAAK,MAAM,OACtB,CACA,IAAI,MAAO,CACP,OAAO,KAAK,MAAM,IACtB,CACA,YAAa,CACb,CACA,SAAU,CACV,CACA,YAAa,CACb,CACA,SAASC,EAAW,CAAE,OAAAhF,EAAS,KAAK,QAAS,OAAAxC,EAAS,CAAC,EAAG,OAAAyH,EAAS,KAAK,WAAY,QAAAC,EAAU,GAAM,WAAAC,EAAa,EAAK,EAAI,CAAC,EAAG,CAC1H,IAAMd,EAAOY,EAAS,GAAGA,KAAUD,IAAcA,EAC3CI,EAAQ,IAAI,YAAYf,EAAM,CAAE,OAAA7G,EAAQ,QAAA0H,EAAS,WAAAC,CAAW,CAAC,EACnE,OAAAnF,EAAO,cAAcoF,CAAK,EACnBA,CACX,CACJ,EACAP,GAAW,UAAY,CACnB3C,GACAS,GACAG,GACAR,EACJ,EACAuC,GAAW,QAAU,CAAC,EACtBA,GAAW,QAAU,CAAC,EACtBA,GAAW,OAAS,CAAC,EC/1ErB,IAAOQ,GAAP,cAA6BC,EAAW,CAWtC,sBAAsBC,EAAc,CAClCA,EAAa,SAAW,GACnB,KAAK,cAAa,KAAK,YAAcA,EAAa,OACvD,KAAK,mBAAqB,KAAK,WAI/B,KAAK,cAAgB,YAAY,IAAM,CACrC,IAAMC,EAAQ,KAAK,WAEf,KAAK,YAAc,GACrB,cAAc,KAAK,aAAa,EAChCD,EAAa,SAAW,GACxBA,EAAa,MAAQ,KAAK,aAE1B,KAAK,WAAaC,EAAQ,CAE9B,EAAG,GAAI,CACT,CAEA,yBAAyBD,EAAc,CACrC,KAAK,WAAa,KAAK,kBACzB,CAEA,kBAAkBE,EAAUC,EAAU,CAChCD,IAAaC,GACb,KAAK,gBAAkB,IAE3B,KAAK,aAAa,MAAQ,GAAG,KAAK,gBAAgBD,KACpD,CACF,EAxCEE,GADKN,GACE,UAAU,CAAC,QAAQ,GAC1BM,GAFKN,GAEE,SAAS,CACd,MAAO,CACL,KAAM,OACN,QAAS,EACX,EACA,OAAQ,OACR,SAAU,MACZ,GCbF,IAAOO,GAAP,cAA6BC,EAAW,CAatC,SAAU,CACR,KAAK,QAAQ,MAAM,OAAS,IAE5B,KAAK,iBAAiB,UAAY,OAAO,OAAO,OAAO,KACvD,KAAK,oBAAoB,UAAY,OAAO,OAAO,OAAO,QAC1D,KAAK,aAAa,UAAY,OAAO,OAAO,GAAG,KAC/C,KAAK,gBAAgB,UAAY,OAAO,OAAO,GAAG,QAClD,KAAK,iBAAiB,UAAY,OAAO,OAAO,OAAO,KAEvD,KAAK,oBAAoB,UAAY,OAAO,WAC5C,KAAK,qBAAqB,UAAY,OAAO,YAC7C,KAAK,uBAAuB,UAAY,OAAO,gBACjD,CAEA,QAASC,EAAO,CACd,KAAK,oBAAoB,UAAY,OAAO,WAC5C,KAAK,qBAAqB,UAAY,OAAO,WAC/C,CAEA,QAASA,EAAO,CACd,IAAIC,EAAQ,SAAS,KAAK,cAAc,eAAe,EAEpDA,EACDA,EAAM,OAAO,GAEbA,EAAQ,SAAS,cAAc,OAAO,EACtCA,EAAM,GAAK,UACXA,EAAM,OAAO,+BAA+B,EAE5C,SAAS,KAAK,YAAYA,CAAK,EAEnC,CAEA,WAAYD,EAAO,CACjB,KAAK,WAAW,OAAS,CAAC,KAAK,WAAW,MAC5C,CACF,EAhDEE,GADKJ,GACE,UAAU,CACf,aACA,gBACA,SACA,YACA,gBACA,iBACA,mBACA,aACA,MACF,GCXF,IAAOK,GAAP,cAA6BC,EAAW,CAMtC,uBAAuBC,EAAe,CACpC,KAAK,gBAAkBA,EAAc,GACvC,CAEA,SAASC,EAAO,CACdA,GAAO,eAAe,EAEtB,IAAMC,EAAU,WACVC,EAAO,CAAC,GAAGF,EAAM,aAAa,KAAK,EAAE,KAAMG,GAAMF,EAAQ,KAAKE,EAAE,IAAI,CAAC,EAE3E,GAAKD,IAED,KAAK,mBACP,KAAK,cAAc,IAAM,OAAO,IAAI,gBAAgBA,CAAI,GAGtD,KAAK,oBACP,KAAK,gBAAgB,UAAU,OAAO,QAAQ,EAG5C,KAAK,gBAAgB,CACvB,IAAME,EAAe,IAAI,aAEzBA,EAAa,MAAM,IAAIF,CAAI,EAE3B,KAAK,YAAY,MAAQE,EAAa,KACxC,CACF,CAEA,cAAcJ,EAAO,CACd,KAAK,mBAEV,KAAK,cAAc,IAAM,OAAO,IAAI,gBAAgB,KAAK,YAAY,MAAM,EAAE,EAEzE,KAAK,oBACP,KAAK,gBAAgB,UAAU,OAAO,QAAQ,EAElD,CAEA,mBAAmBA,EAAO,CACxBA,EAAM,eAAe,CACvB,CAEA,MAAMA,EAAO,CACP,KAAK,mBAAkB,KAAK,cAAc,IAAM,KAAK,iBACrD,KAAK,oBAAoB,KAAK,gBAAgB,UAAU,IAAI,QAAQ,CAC1E,CACF,EApDEK,GADKR,GACE,UAAU,CAAC,UAAW,QAAS,WAAW,GACjDQ,GAFKR,GAEE,SAAS,CACd,WAAY,MACd,GCLF,IAAAS,GAAqC,SCAxBC,IC2BAC,GCjBPC,ECRFC,GAgGSC,GC+ETC,GAWAC,GAEEC,GA0BAC,GCvNKC,GLUEC,GAAgC,CAAA,EAChCC,GAAY,CAAA,EACZC,GACZ,oECbYC,GAAUC,MAAMD,QAStB,SAASE,GAAOC,EAAKC,EAAAA,CAE3B,QAASR,KAAKQ,EAAOD,EAAIP,GAAKQ,EAAMR,GACpC,OAA6BO,CAC7B,CAAA,SAQeE,GAAWC,EAAAA,CAC1B,IAAIC,EAAaD,EAAKC,WAClBA,GAAYA,EAAWC,YAAYF,CAAAA,CACvC,CEZM,SAASG,GAAcC,EAAMN,EAAOO,EAAAA,CAC1C,IACCC,EACAC,EACAjB,EAHGkB,EAAkB,CAAA,EAItB,IAAKlB,KAAKQ,EACLR,GAAK,MAAOgB,EAAMR,EAAMR,GACnBA,GAAK,MAAOiB,EAAMT,EAAMR,GAC5BkB,EAAgBlB,GAAKQ,EAAMR,GAUjC,GAPImB,UAAUC,OAAS,IACtBF,EAAgBH,SACfI,UAAUC,OAAS,EAAI5B,GAAM6B,KAAKF,UAAW,CAAA,EAAKJ,GAKjC,OAARD,GAAQ,YAAcA,EAAKQ,cAAgB,KACrD,IAAKtB,KAAKc,EAAKQ,aACVJ,EAAgBlB,KADNsB,SAEbJ,EAAgBlB,GAAKc,EAAKQ,aAAatB,IAK1C,OAAOuB,GAAYT,EAAMI,EAAiBF,EAAKC,EAAK,IAAA,CACpD,CAceM,SAAAA,GAAYT,EAAMN,EAAOQ,EAAKC,EAAKO,EAAAA,CAIlD,IAAMC,EAAQ,CACbX,KAAAA,EACAN,MAAAA,EACAQ,IAAAA,EACAC,IAAAA,EACAS,IAAW,KACXC,GAAS,KACTC,IAAQ,EACRC,IAAM,KAKNC,IAAAA,OACAC,IAAY,KACZC,YAAAA,OACAC,IAAWT,GAAAA,EAAqB9B,GAChCwC,IAAAA,GACAC,IAAQ,CAAA,EAMT,OAFIX,GAAY,MAAQ/B,EAAQgC,OAAS,MAAMhC,EAAQgC,MAAMA,CAAAA,EAEtDA,CACP,CAMeW,SAAAA,GAASC,EAAAA,CACxB,OAAOA,EAAMC,QACb,CC/EeC,SAAAA,GAAcF,EAAOG,EAAAA,CACpCC,KAAKJ,MAAQA,EACbI,KAAKD,QAAUA,CACf,CA0EM,SAASE,GAAcC,EAAOC,EAAAA,CACpC,GAAIA,GAAc,KAEjB,OAAOD,EAAAE,GACJH,GAAcC,EAAeA,GAAAA,EAAAA,IAAe,CAAA,EAC5C,KAIJ,QADIG,EACGF,EAAaD,EAAAI,IAAgBC,OAAQJ,IAG3C,IAFAE,EAAUH,EAAAI,IAAgBH,KAEX,MAAQE,EAAAG,KAAgB,KAItC,OAAOH,EACPG,IAQF,OAA4B,OAAdN,EAAMO,MAAQ,WAAaR,GAAcC,CAAAA,EAAS,IAChE,CA2CD,SAASQ,GAAwBR,EAAAA,CAAjC,IAGWS,EACJC,EAHN,IAAKV,EAAQA,EAAHE,KAAqB,MAAQF,EAAKW,KAAe,KAAM,CAEhE,IADAX,EAAKM,IAAQN,EAAKW,IAAYC,KAAO,KAC5BH,EAAI,EAAGA,EAAIT,EAAKI,IAAWC,OAAQI,IAE3C,IADIC,EAAQV,EAAAI,IAAgBK,KACf,MAAQC,EAAAJ,KAAc,KAAM,CACxCN,EAAKM,IAAQN,EAAKW,IAAYC,KAAOF,EAArCJ,IACA,KACA,CAGF,OAAOE,GAAwBR,CAAAA,CAC/B,CACD,CAAA,SA4Bea,GAAcC,EAAAA,EAAAA,CAE1BA,EAADC,MACCD,EAAAC,IAAAA,KACDC,GAAcC,KAAKH,CAAAA,GAAAA,CAClBI,GAAAA,OACFC,KAAiBC,EAAQC,sBAEzBF,GAAeC,EAAQC,oBACNC,IAAOJ,EAAAA,CAEzB,CASD,SAASA,IAAAA,CAAT,IACKJ,EAMES,EAzGkBC,EAQjBC,EAPHC,EACHC,EACAC,EACAC,EACAC,EAkGD,IAHAd,GAAce,KAAKC,EAAAA,EAGXlB,EAAIE,GAAciB,MAAAA,GACrBnB,EAAAA,MACCS,EAAoBP,GAAcX,OAjGjCoB,EAAAA,OANNE,GADGD,GADoBF,EA0GNV,GAzGNoB,KAAZ5B,IAGCuB,EAAc,CAAA,EACdC,EAAW,CAAA,GAFXF,EAAYJ,EAFbW,QAOOV,EAAWW,GAAO,CAAD,EAAKV,CAAAA,GACpBQ,IAAaR,EAAQQ,IAAa,EACtCd,EAAQpB,OAAOoB,EAAQpB,MAAMyB,CAAAA,EAEjCY,GACCT,EACAH,EACAC,EACAF,EAJGc,IAKHV,EAAUW,kBALPD,OJrIsB,GI2IzBZ,EAAQc,IAAyB,CAACb,CAAAA,EAAU,KAC5CE,EACAF,GAAiB5B,GAAc2B,CAAAA,EAAYC,CAAAA,EJ7IlB,GI8ItBD,EAAAc,KACHV,CAAAA,EAGDL,EAAAvB,GAAAE,IAA2BqB,EAA3BgB,KAA8ChB,EAC9CiB,GAAWb,EAAaJ,EAAUK,CAAAA,EAE9BL,EAAQnB,KAASqB,GACpBnB,GAAwBiB,CAAAA,GA8EpBT,GAAcX,OAASkB,GAI1BP,GAAce,KAAKC,EAAAA,GAItBd,GAAAA,IAAyB,CACzB,CElNeyB,SAAAA,GACff,EACAgB,EACAC,EACAC,EACAC,EACAC,EACAC,EACApB,EACAF,EACAuB,EACApB,EAAAA,CAXea,IAaXlC,EAEHiB,EAEAyB,EAEAC,EAEAC,EAKGC,EAAeR,GAAkBA,EAAnB1C,KAAgDmD,GAE9DC,EAAoBZ,EAAavC,OAMrC,IAJAwC,EAAc9B,IAAYY,EAC1B8B,GAA0BZ,EAAgBD,EAAcU,CAAAA,EACxD3B,EAASkB,EAAAA,IAEJpC,EAAI,EAAGA,EAAI+C,EAAmB/C,KAClC0C,EAAaN,EAAczC,IAAWK,KAGvB,MACO,OAAd0C,GAAc,WACA,OAAdA,GAAc,aAQrBzB,EADGyB,EAAAV,MACHf,GAAWgC,GAEAJ,EAAYH,EAAAA,MAAsBO,GAI9CP,EAAAA,IAAoB1C,EAGpB4B,GACCT,EACAuB,EACAzB,EACAqB,EACAC,EACAC,EACApB,EACAF,EACAuB,EACApB,CAAAA,EAIDsB,EAASD,EAAH7C,IACF6C,EAAWQ,KAAOjC,EAASiC,KAAOR,EAAWQ,MAC5CjC,EAASiC,KACZC,GAASlC,EAASiC,IAAK,KAAMR,CAAAA,EAE9BrB,EAASb,KACRkC,EAAWQ,IACXR,EAAAA,KAAyBC,EACzBD,CAAAA,GAIEE,GAAiB,MAAQD,GAAU,OACtCC,EAAgBD,GN3GS,MM+GzBD,EAAAX,KACAd,EAAAA,MAAuByB,EAAAA,IAEvBxB,EAASkC,GAAOV,EAAYxB,EAAQC,CAAAA,EAEV,OAAnBuB,EAAW5C,MAAQ,YAC1B4C,EAAAA,MADkB5C,OAMlBoB,EAASwB,EACTpC,IAAUqC,IACVzB,EAASyB,EAAOU,aAQjBX,EAAApC,IAAAA,OAGAoC,EAAAX,KAAAA,SAaDK,EAAAA,IAA0BlB,EAC1BkB,EAAAA,IAAsBQ,CACtB,CAOD,SAASI,GAA0BZ,EAAgBD,EAAcU,EAAAA,CAAjE,IAEK7C,EAEA0C,EAEAzB,EA2FGqC,EACAC,EA1FDR,EAAoBZ,EAAavC,OACnC4D,EAAoBX,EAAYjD,OACnC6D,EAAuBD,EAEpBE,EAAO,EAGX,IADAtB,EAAAA,IAA2B,CAAA,EACtBpC,EAAI,EAAGA,EAAI+C,EAAmB/C,KAUjC0C,EAAaN,EAAAzC,IAAyBK,IAPvC0C,EAAaP,EAAanC,KAGX,MACO,OAAd0C,GAAc,WACA,OAAdA,GAAc,WAEsB,KAMtB,OAAdA,GAAc,UACA,OAAdA,GAAc,UAEA,OAAdA,GAAc,UACrBA,EAAWiB,aAAeC,OAEiBC,GAC1C,KACAnB,EACA,KACA,KACAA,CAAAA,EAESoB,GAAQpB,CAAAA,EACyBmB,GAC1C7E,GACA,CAAEE,SAAUwD,CAAAA,EACZ,KACA,KACA,IAAA,EAESA,EAAUqB,IAAU,EAKaF,GAC1CnB,EAAW5C,KACX4C,EAAWzD,MACXyD,EAAWsB,IACXtB,EAAWQ,IAAMR,EAAWQ,IAAM,KAClCR,EAEDjB,GAAAA,EAC2CiB,IAI1B,MAyBlBA,EAAAA,GAAqBN,EACrBM,EAAUqB,IAAU3B,EAAAA,IAAwB,EAGtCmB,EAAgBU,GACrBvB,EACAG,EAHKS,EAActD,EAAI0D,EAKvBD,CAAAA,EAMDf,EAAAV,IAAoBuB,EAEpBtC,EAAW,KACPsC,IADO,KAGVE,KADAxC,EAAW4B,EAAYU,MAGtBtC,EAAAc,KN9QmB,SMqRFd,GAAY,MAAQA,EAAAA,MAAuB,MAGzDsC,GAHkCtC,IAIrCyC,IAI6B,OAAnBhB,EAAW5C,MAAQ,aAC7B4C,EAAAX,KNhSwB,QMkSfwB,IAAkBD,IACxBC,IAAkBD,EAAc,EACnCI,IACUH,EAAgBD,EACtBG,EAAuBV,EAAoBO,EAC9CI,GAAQH,EAAgBD,EAGxBI,IAIAA,EAFSH,EAAgBD,GACtBC,GAAiBD,EAAc,EAC3BC,EAAgBD,EAKjB,EAKJC,IAAkBvD,EAAI0D,IACzBhB,EAAUX,KNzTc,UMmOzBd,EAAW4B,EAAY7C,KACPiB,EAAS+C,KAAO,MAAQ/C,EAAxCpB,MACKoB,EAAApB,KAAiBuC,EAArB9B,MACC8B,EAAAA,IAA0B9C,GAAc2B,CAAAA,GAGzCiD,GAAQjD,EAAUA,EAAAA,EAAU,EAW5B4B,EAAY7C,GAAK,KACjByD,KA6EH,GAAIA,EACH,IAAKzD,EAAI,EAAGA,EAAIwD,EAAmBxD,KAClCiB,EAAW4B,EAAY7C,KACP,MNnUI,SMmUKiB,EAAAA,OACpBA,EAAApB,KAAiBuC,EAArB9B,MACC8B,EAAAA,IAA0B9C,GAAc2B,CAAAA,GAGzCiD,GAAQjD,EAAUA,CAAAA,EAIrB,CAQD,SAASmC,GAAOe,EAAajD,EAAQC,EAAAA,CAArC,IAIMjC,EACKc,EAFV,GAA+B,OAApBmE,EAAYrE,MAAQ,WAAY,CAE1C,IADIZ,EAAWiF,EAAHxE,IACHK,EAAI,EAAGd,GAAYc,EAAId,EAASU,OAAQI,IAC5Cd,EAASc,KAKZd,EAASc,GAAamE,GAAAA,EACtBjD,EAASkC,GAAOlE,EAASc,GAAIkB,EAAQC,CAAAA,GAIvC,OAAOD,CACP,CAKD,OALWiD,EAAAtE,KAAoBqB,IAC9BC,EAAUiD,aAAaD,EAAkBjD,IAAAA,GAAU,IAAA,EACnDA,EAASiD,EAAAA,KAGHjD,GAAUA,EAAOmC,WACxB,CA4BD,SAASgB,GACRC,EACAC,EACAC,EACAC,EAAAA,CAJD,IAMOC,EAAMJ,EAAWI,IACjBC,EAAOL,EAAWK,KACpBC,EAAIJ,EAAc,EAClBK,EAAIL,EAAc,EAClBM,EAAWP,EAAYC,GAc3B,GACCM,IAAa,MACZA,GAAYJ,GAAOI,EAASJ,KAAOC,IAASG,EAASH,KAEtD,OAAOH,EAAAA,GAPPC,GACCK,GAAY,MN7ZQ,SM6ZCA,EAAAA,KAAmC,EAAI,GAQ7D,KAAOF,GAAK,GAAKC,EAAIN,EAAYQ,QAAQ,CACxC,GAAIH,GAAK,EAAG,CAEX,IADAE,EAAWP,EAAYK,KNvaJ,SM0ajBE,EAAAE,MACDN,GAAOI,EAASJ,KAChBC,IAASG,EAASH,KAElB,OAAOC,EAERA,GACA,CAED,GAAIC,EAAIN,EAAYQ,OAAQ,CAE3B,IADAD,EAAWP,EAAYM,KNpbJ,SMubjBC,EAAAE,MACDN,GAAOI,EAASJ,KAChBC,IAASG,EAASH,KAElB,OAAOE,EAERA,GACA,CACD,CAGF,MAAA,EACA,CCvcD,SAASI,GAASC,EAAOR,EAAKS,EAAAA,CACzBT,EAAI,KAAO,IACdQ,EAAME,YAAYV,EAAKS,GAAgB,EAAKA,EAE5CD,EAAMR,GADIS,GAAS,KACN,GACa,OAATA,GAAS,UAAYE,GAAmBC,KAAKZ,CAAAA,EACjDS,EAEAA,EAAQ,IAEtB,CAUM,SAASC,GAAYG,EAAKC,EAAML,EAAOM,EAAUC,EAAAA,CAAjD,IACFC,EAEJC,EAAG,GAAIJ,IAAS,QACf,GAAoB,OAATL,GAAS,SACnBI,EAAIL,MAAMW,QAAUV,MACd,CAKN,GAJuB,OAAZM,GAAY,WACtBF,EAAIL,MAAMW,QAAUJ,EAAW,IAG5BA,EACH,IAAKD,KAAQC,EACNN,GAASK,KAAQL,GACtBF,GAASM,EAAIL,MAAOM,EAAM,EAAA,EAK7B,GAAIL,EACH,IAAKK,KAAQL,EACPM,GAAYN,EAAMK,KAAUC,EAASD,IACzCP,GAASM,EAAIL,MAAOM,EAAML,EAAMK,EAAAA,CAInC,SAGOA,EAAK,KAAO,KAAOA,EAAK,KAAO,IACvCG,EACCH,KAAUA,EAAOA,EAAKM,QAAQ,6BAA8B,IAAA,GAG9BN,EAA3BA,EAAKO,YAAAA,IAAiBR,EAAYC,EAAKO,YAAAA,EAAcC,MAAM,CAAA,EACnDR,EAAKQ,MAAM,CAAA,EAElBT,EAALU,IAAqBV,EAAGU,EAAc,CAAA,GACtCV,EAAGU,EAAYT,EAAOG,GAAcR,EAEhCA,EACEM,EAKJN,EAAMe,EAAYT,EAASS,GAJ3Bf,EAAMe,EAAYC,KAAKC,IAAAA,EAEvBb,EAAIc,iBAAiBb,EADLG,EAAaW,GAAoBC,GACbZ,CAAAA,GAMrCJ,EAAIiB,oBAAoBhB,EADRG,EAAaW,GAAoBC,GACVZ,CAAAA,MAElC,CACN,GAAID,EAIHF,EAAOA,EAAKM,QAAQ,cAAe,GAAA,EAAKA,QAAQ,SAAU,GAAA,UAE1DN,IAAS,SACTA,IAAS,UACTA,IAAS,QACTA,IAAS,QACTA,IAAS,QAGTA,IAAS,YACTA,IAAS,YACTA,IAAS,WACTA,IAAS,WACTA,IAAS,QACTA,KAAQD,EAER,GAAA,CACCA,EAAIC,GAAQL,GAAgB,GAE5B,MAAMS,CACK,MAAV,CAAU,CAUO,OAATT,GAAS,aAETA,GAAS,MAASA,IAAlBA,IAAqCK,EAAK,KAAO,IAG3DD,EAAIkB,gBAAgBjB,CAAAA,EAFpBD,EAAImB,aAAalB,EAAML,CAAAA,EAIxB,CACD,CAOD,SAASoB,GAAWI,EAAAA,CACnB,IAAMC,EAAeC,KAAAZ,EAAgBU,EAAEhC,KAAAA,IAMvC,GAAKgC,EAAEG,GAMA,GAAIH,EAAEG,GAAeF,EAAaV,EACxC,YAJAS,EAAEG,EAAcX,KAAKC,IAAAA,EAMtB,OAAOQ,EAAaG,EAAQC,MAAQD,EAAQC,MAAML,CAAAA,EAAKA,CAAAA,CACvD,CAOD,SAASL,GAAkBK,EAAAA,CAC1B,OAAOE,KAAAZ,EAAgBU,EAAEhC,KAAAA,IAAaoC,EAAQC,MAAQD,EAAQC,MAAML,CAAAA,EAAKA,CAAAA,CACzE,CCxHM,SAASM,GACfC,EACAC,EACArC,EACAsC,EACA1B,EACA2B,EACAC,EACAC,EACAC,EACAC,EAAAA,CAVM,IAaFC,EAkBEC,EAAGC,EAAOC,EAAUC,EAAUC,EAAUC,EACxCC,EAKAC,EACAC,EAuGOC,EA4BPC,GACHC,GASSF,GA6BNG,GAlMLC,EAAUrB,EAASxC,KAIpB,GAAIwC,EAASsB,cAAb,OAAwC,OAAA,KR9CX,IQiDzB3D,EAAAA,MACH0C,EAAAA,CAAAA,ERpD0B,GQoDT1C,EAAQE,KAEzBqC,EAAoB,CADpBE,EAASJ,EAAAuB,IAAgB5D,EAAhB4D,GAAAA,IAILhB,EAAMX,EAAX4B,MAA2BjB,EAAIP,CAAAA,EAE/ByB,EAAO,GAAsB,OAAXJ,GAAW,WAC5B,GAAA,CAgEC,GA9DIP,EAAWd,EAAS0B,MAKpBX,GADJR,EAAMc,EAAQM,cACQ1B,EAAcM,EAApCqB,KACIZ,EAAmBT,EACpBQ,EACCA,EAASW,MAAM1D,MACfuC,EAFOsB,GAGR5B,EAGCtC,EAAJiE,IAECf,GADAL,EAAIR,EAAA4B,IAAsBjE,EAAtBiE,KACwBC,GAAwBrB,EACpDsB,KAEI,cAAeT,GAAWA,EAAQU,UAAUC,OAE/ChC,EAAA4B,IAAsBpB,EAAI,IAAIa,EAAQP,EAAUE,CAAAA,GAGhDhB,EAAQ4B,IAAcpB,EAAI,IAAIyB,GAC7BnB,EACAE,CAAAA,EAEDR,EAAEc,YAAcD,EAChBb,EAAEwB,OAASE,IAERnB,GAAUA,EAASoB,IAAI3B,CAAAA,EAE3BA,EAAEkB,MAAQZ,EACLN,EAAE4B,QAAO5B,EAAE4B,MAAQ,CAAA,GACxB5B,EAAE6B,QAAUrB,EACZR,EAAA8B,IAAmBrC,EACnBQ,EAAQD,EAAA+B,IAAAA,GACR/B,EAACgC,IAAoB,CAAA,EACrBhC,EAACiC,IAAmB,CAAA,GAIjBjC,EAAAkC,KAAgB,OACnBlC,EAAAkC,IAAelC,EAAE4B,OAGdf,EAAQsB,0BAA4B,OACnCnC,EAACkC,KAAelC,EAAE4B,QACrB5B,EAACkC,IAAcE,GAAO,CAAD,EAAKpC,EAALkC,GAAAA,GAGtBE,GACCpC,EACAa,IAAAA,EAAQsB,yBAAyB7B,EAAUN,EAAAA,GAAAA,CAAAA,GAI7CE,EAAWF,EAAEkB,MACbf,EAAWH,EAAE4B,MACb5B,EAAAqC,IAAW7C,EAGPS,EAEFY,EAAQsB,0BAA4B,MACpCnC,EAAEsC,oBAAsB,MAExBtC,EAAEsC,mBAAAA,EAGCtC,EAAEuC,mBAAqB,MAC1BvC,EAAAA,IAAmBwC,KAAKxC,EAAEuC,iBAAAA,MAErB,CASN,GAPC1B,EAAQsB,0BAA4B,MACpC7B,IAAaJ,GACbF,EAAEyC,2BAA6B,MAE/BzC,EAAEyC,0BAA0BnC,EAAUE,CAAAA,EAAAA,CAIrCR,EACCA,MAAAA,EAAE0C,uBAAyB,MAC5B1C,EAAE0C,sBACDpC,EACAN,EAFDkC,IAGC1B,CAAAA,IAJEkC,IAMHlD,EAAQ6C,MAAelF,EAPxBkF,KAQC,CAkBD,IAhBI7C,EAAQ6C,MAAelF,EAA3BkF,MAKCrC,EAAEkB,MAAQZ,EACVN,EAAE4B,MAAQ5B,EAAVkC,IACAlC,EAAC+B,IAAAA,IAGFvC,EAAAA,IAAgBrC,EAChBqC,IAAAA,EAAAmD,IAAqBxF,EAArBwF,IACAnD,EAAAmD,IAAmBC,QAAQ,SAAAC,EAAAA,CACtBA,IAAOA,EAAAxB,GAAgB7B,EAC3B,CAAA,EAEQiB,EAAI,EAAGA,EAAIT,EAAAiC,IAAkB7E,OAAQqD,IAC7CT,EAAAgC,IAAmBQ,KAAKxC,EAACiC,IAAiBxB,EAAAA,EAE3CT,EAAAiC,IAAoB,CAAA,EAEhBjC,EAACgC,IAAkB5E,QACtBuC,EAAY6C,KAAKxC,CAAAA,EAGlB,MAAMiB,CACN,CAEGjB,EAAE8C,qBAAuB,MAC5B9C,EAAE8C,oBAAoBxC,EAAUN,EAAAA,IAAcQ,CAAAA,EAG3CR,EAAE+C,oBAAsB,MAC3B/C,EAAAgC,IAAmBQ,KAAK,UAAA,CACvBxC,EAAE+C,mBAAmB7C,EAAUC,EAAUC,CAAAA,CACzC,CAAA,CAEF,CASD,GAPAJ,EAAE6B,QAAUrB,EACZR,EAAEkB,MAAQZ,EACVN,EAAAgD,IAAezD,EACfS,EAACe,IAAAA,GAEGL,GAAatB,EAAH6D,IACbtC,GAAQ,EACL,cAAeE,GAAWA,EAAQU,UAAUC,OAAQ,CAQvD,IAPAxB,EAAE4B,MAAQ5B,EAAVkC,IACAlC,EAAC+B,IAAAA,GAEGrB,IAAYA,GAAWlB,CAAAA,EAE3BO,EAAMC,EAAEwB,OAAOxB,EAAEkB,MAAOlB,EAAE4B,MAAO5B,EAAE6B,OAAAA,EAE1BpB,GAAI,EAAGA,GAAIT,EAAAiC,IAAkB7E,OAAQqD,KAC7CT,EAACgC,IAAkBQ,KAAKxC,EAACiC,IAAiBxB,GAAAA,EAE3CT,EAAAiC,IAAoB,CAAA,CACpB,KACA,IACCjC,EAAA+B,IAAAA,GACIrB,IAAYA,GAAWlB,CAAAA,EAE3BO,EAAMC,EAAEwB,OAAOxB,EAAEkB,MAAOlB,EAAE4B,MAAO5B,EAAE6B,OAAAA,EAGnC7B,EAAE4B,MAAQ5B,EAAVkC,UACQlC,EAAC+B,KAAAA,EAAapB,GAAQ,IAIhCX,EAAE4B,MAAQ5B,EAAVkC,IAEIlC,EAAEkD,iBAAmB,OACxBzD,EAAgB2C,GAAOA,GAAO,CAAD,EAAK3C,CAAAA,EAAgBO,EAAEkD,gBAAAA,CAAAA,GAGhDjD,GAASD,EAAEmD,yBAA2B,OAC1C/C,EAAWJ,EAAEmD,wBAAwBjD,EAAUC,CAAAA,GAOhDiD,GACC7D,EACA8D,GAJGzC,GADHb,GAAO,MAAQA,EAAI/C,OAASsG,IAAYvD,EAAIhD,KAAO,KACZgD,EAAImB,MAAMqC,SAAWxD,CAAAA,EAIpCa,GAAe,CAACA,EAAAA,EACxCpB,EACArC,EACAsC,EACA1B,EACA2B,EACAC,EACAC,EACAC,EACAC,CAAAA,EAGDE,EAAEwD,KAAOhE,EAATuB,IAGAvB,EAAQnC,KAAAA,KAEJ2C,EAACgC,IAAkB5E,QACtBuC,EAAY6C,KAAKxC,CAAAA,EAGdK,IACHL,EAACsB,IAAiBtB,EAAAqB,GAAyB,KAkB5C,OAhBQrC,EAAP,CACDQ,EAAQ6C,IAAa,KAEjBxC,GAAeH,GAAqB,MACvCF,EAAQuB,IAAQnB,EAChBJ,EAAAnC,KAAmBwC,EAChB4D,IRhRqB,GQkRxB/D,EAAkBA,EAAkBgE,QAAQ9D,CAAAA,GAAW,OAIvDJ,EAAQuB,IAAQ5D,EAAAA,IAChBqC,EAAQmD,IAAaxF,EACrBwF,KACDvD,EAAO2B,IAAa/B,EAAGQ,EAAUrC,CAAAA,CACjC,MAEDuC,GAAqB,MACrBF,EAAQ6C,MAAelF,EAFjBkF,KAIN7C,EAAAmD,IAAqBxF,EACrBqC,IAAAA,EAAAuB,IAAgB5D,EAAhB4D,KAEAvB,EAAQuB,IAAQ4C,GACfxG,EACAqC,IAAAA,EACArC,EACAsC,EACA1B,EACA2B,EACAC,EACAE,EACAC,CAAAA,GAIGC,EAAMX,EAAQwE,SAAS7D,EAAIP,CAAAA,CAChC,CAOM,SAASqE,GAAWlE,EAAamE,EAAMhE,EAAAA,CAC7CgE,EAAA/B,IAAAA,OAEA,QAAStB,EAAI,EAAGA,EAAIX,EAAS1C,OAAQqD,IACpCsD,GAASjE,EAASW,GAAIX,EAAAA,EAAWW,GAAIX,EAAAA,EAAWW,EAAAA,EAG7CrB,EAAJgC,KAAqBhC,EAAAgC,IAAgB0C,EAAMnE,CAAAA,EAE3CA,EAAYqE,KAAK,SAAAhE,EAAAA,CAChB,GAAA,CAECL,EAAcK,EAAdgC,IACAhC,EAACgC,IAAoB,CAAA,EACrBrC,EAAYqE,KAAK,SAAAC,EAAAA,CAEhBA,EAAGC,KAAKlE,CAAAA,CACR,CAAA,CAGD,OAFQhB,EAAP,CACDI,EAAO2B,IAAa/B,EAAGgB,EAAvBqC,GAAAA,CACA,CACD,CAAA,CACD,CAiBD,SAASsB,GACR/F,EACA4B,EACArC,EACAsC,EACA1B,EACA2B,EACAC,EACAE,EACAC,EAAAA,CATD,IAeKW,EAEA0D,EAEAC,EAEAC,EACA7G,EACA8G,EACAC,EAbArE,EAAW/C,EAAS+D,MACpBZ,EAAWd,EAAS0B,MACpBsD,EAAkChF,EAASxC,KAgB/C,GAFIwH,IAAa,QAAOzG,EAAAA,IAEpB2B,GAAqB,MACxB,IAAKe,EAAI,EAAGA,EAAIf,EAAkBtC,OAAQqD,IAMzC,IALAjD,EAAQkC,EAAkBe,KAOzB,iBAAkBjD,GAAAA,CAAAA,CAAYgH,IAC7BA,EAAWhH,EAAMiH,YAAcD,EAAWhH,EAAMgH,WAAa,GAC7D,CACD5G,EAAMJ,EACNkC,EAAkBe,GAAK,KACvB,KACA,EAIH,GAAI7C,GAAO,KAAM,CAChB,GAAI4G,IAAa,KAChB,OAAOE,SAASC,eAAerE,CAAAA,EAI/B1C,EADGG,EACG2G,SAASE,gBAAgB,6BAA8BJ,CAAAA,EAEvDE,SAASG,cAAcL,EAAUlE,EAASwE,IAAMxE,CAAAA,EAIvDZ,EAAoB,KAGpBG,EAAAA,EACA,CAED,GAAI2E,IAAa,KAEZtE,IAAaI,GAAcT,GAAejC,EAAImH,OAASzE,IAC1D1C,EAAImH,KAAOzE,OAEN,CASN,GAPAZ,EAAoBA,GAAqBrB,GAAM6F,KAAKtG,EAAIoH,UAAAA,EAExD9E,EAAW/C,EAAS+D,OAAS+D,GAAAA,CAKxBpF,GAAeH,GAAqB,KAExC,IADAQ,EAAW,CAAA,EACNO,EAAI,EAAGA,EAAI7C,EAAIsH,WAAW9H,OAAQqD,IAEtCP,GADA1C,EAAQI,EAAIsH,WAAWzE,IACR5C,MAAQL,EAAMA,MAI/B,IAAKiD,KAAKP,EACT1C,EAAQ0C,EAASO,GACbA,GAAK,aACEA,GAAK,0BACf2D,EAAU5G,EACAiD,IAAM,OAAWA,KAAKH,GAChC7C,GAAYG,EAAK6C,EAAG,KAAMjD,EAAOO,CAAAA,GAMnC,IAAK0C,KAAKH,EACT9C,EAAQ8C,EAASG,GACbA,GAAK,WACR4D,EAAc7G,EACJiD,GAAK,0BACf0D,EAAU3G,EACAiD,GAAK,QACf6D,EAAa9G,EACHiD,GAAK,UACf8D,EAAU/G,EAEViD,IAAM,OACJZ,GAA+B,OAATrC,GAAS,YACjC0C,EAASO,KAAOjD,GAEhBC,GAAYG,EAAK6C,EAAGjD,EAAO0C,EAASO,GAAI1C,CAAAA,EAK1C,GAAIoG,EAGDtE,GACCuE,IACAD,EAAAgB,SAAmBf,EAAnBe,QACAhB,EAAOgB,SAAYvH,EAAIwH,aAEzBxH,EAAIwH,UAAYjB,EAAhBgB,QAGD3F,EAAAmD,IAAqB,CAAA,UAEjByB,IAASxG,EAAIwH,UAAY,IAE7BhC,GACCxF,EACAyF,GAAQgB,CAAAA,EAAeA,EAAc,CAACA,CAAAA,EACtC7E,EACArC,EACAsC,EACA1B,GAASyG,IAAa,gBACtB9E,EACAC,EACAD,EACGA,EAAkB,GAClBvC,EAAAA,KAAsBkI,GAAclI,EAAU,CAAA,EACjD0C,EACAC,CAAAA,EAIGJ,GAAqB,KACxB,IAAKe,EAAIf,EAAkBtC,OAAQqD,KAC9Bf,EAAkBe,IAAM,MAAM6E,GAAW5F,EAAkBe,EAAAA,EAM7DZ,IACJY,EAAI,QAEH6D,IAFG,SAOFA,IAAe1G,EAAI6C,IAClB+D,IAAa,YAAbA,CAA4BF,GAI5BE,IAAa,UAAYF,IAAepE,EAASO,KAEnDhD,GAAYG,EAAK6C,EAAG6D,EAAYpE,EAASO,GAAAA,EAAI,EAG9CA,EAAI,UACA8D,IADA,QACyBA,IAAY3G,EAAI6C,IAC5ChD,GAAYG,EAAK6C,EAAG8D,EAASrE,EAASO,GAAAA,EAAI,EAG5C,CAED,OAAO7C,CACP,CAQM,SAASmG,GAASwB,EAAK/H,EAAOqF,EAAAA,CACpC,GAAA,CACmB,OAAP0C,GAAO,WAAYA,EAAI/H,CAAAA,EAC7B+H,EAAIC,QAAUhI,CAGnB,OAFQwB,EAAP,CACDI,EAAA2B,IAAoB/B,EAAG6D,CAAAA,CACvB,CACD,CASe4C,SAAAA,GAAQ5C,EAAO6C,EAAaC,EAAAA,CAA5BF,IACXG,EAuBMnF,EAdV,GARIrB,EAAQqG,SAASrG,EAAQqG,QAAQ5C,CAAAA,GAEhC+C,EAAI/C,EAAM0C,OACTK,EAAEJ,SAAWI,EAAEJ,UAAY3C,EAAd9B,KACjBgD,GAAS6B,EAAG,KAAMF,CAAAA,IAIfE,EAAI/C,EAAHzB,MAAwB,KAAM,CACnC,GAAIwE,EAAEC,qBACL,GAAA,CACCD,EAAEC,qBAAAA,CAGF,OAFQ7G,EAAP,CACDI,EAAA2B,IAAoB/B,EAAG0G,CAAAA,CACvB,CAGFE,EAAEpC,KAAOoC,EAAC5C,IAAc,KACxBH,EAAKzB,IAAAA,MACL,CAED,GAAKwE,EAAI/C,EAAHF,IACL,IAASlC,EAAI,EAAGA,EAAImF,EAAExI,OAAQqD,IACzBmF,EAAEnF,IACLgF,GACCG,EAAEnF,GACFiF,EACAC,GAAoC,OAAf9C,EAAM7F,MAAS,UAATA,EAM1B2I,GAAc9C,EAAK9B,KAAS,MAChCuE,GAAWzC,EACX9B,GAAAA,EAID8B,EAAKxB,GAAWwB,EAAA9B,IAAa8B,EAAKd,IAAAA,MAClC,CAGD,SAASL,GAASR,EAAOU,EAAOC,EAAAA,CAC/B,OAAO3C,KAAK4B,YAAYI,EAAOW,CAAAA,CAC/B,CCnlBeL,SAAAA,GAAOqB,EAAOtD,EAAWuG,EAAAA,CAAzBtE,IAMX3B,EAOA1C,EAQAwC,EACHG,EArBGV,EAAeA,IAAAA,EAAAiC,GAAcwB,EAAOtD,CAAAA,EAYpCpC,GAPA0C,EAAoC,OAAfiG,GAAe,YAQrC,KACCA,GAAeA,EAAJnD,KAA8BpD,EAAAA,IAMzCI,EAAc,CAAA,EACjBG,EAAW,CAAA,EACZR,GACCC,EAPDsD,GAAAA,CAAWhD,GAAeiG,GAAgBvG,GACzCsF,IAAAA,GAAcvB,GAAU,KAAM,CAACT,CAAAA,CAAAA,EAU/B1F,GAAY8H,GACZA,GACA1F,EAAUwG,kBADVd,OACUc,CACTlG,GAAeiG,EACb,CAACA,CAAAA,EACD3I,EACA,KACAoC,EAAUyG,WACV3H,GAAM6F,KAAK3E,EAAUyF,UAAAA,EACrB,KACHrF,EAAAA,CACCE,GAAeiG,EACbA,EACA3I,EACAA,EACAoC,IAAAA,EAAUyG,WACbnG,EACAC,CAAAA,EAID+D,GAAWlE,EAAakD,EAAO/C,CAAAA,CAC/B,CRnCYmG,GAAQC,GAAUD,MCjBzBE,EAAU,CACfC,ISHM,SAAqBC,EAAOC,EAAOC,EAAUC,EAAAA,CAQnD,QANIC,EAEHC,EAEAC,EAEOL,EAAQA,EAAhBM,IACC,IAAKH,EAAYH,EAAHO,MAAAA,CAAyBJ,EAADG,GACrC,GAAA,CAcC,IAbAF,EAAOD,EAAUK,cAELJ,EAAKK,0BAA4B,OAC5CN,EAAUO,SAASN,EAAKK,yBAAyBV,CAAAA,CAAAA,EACjDM,EAAUF,EAAHQ,KAGJR,EAAUS,mBAAqB,OAClCT,EAAUS,kBAAkBb,EAAOG,GAAa,CAAhD,CAAA,EACAG,EAAUF,EACVQ,KAGGN,EACH,OAAQF,EAASU,IAAiBV,CAInC,OAFQW,EAAP,CACDf,EAAQe,CACR,CAIH,MAAMf,CACN,CAAA,ERxCGgB,GAAU,EAgGDC,GAAiB,SAAAhB,EAAAA,CAC7BA,OAAAA,GAAS,MAAQA,EAAMQ,aAAeS,IADJ,ECxEnCC,GAAcC,UAAUT,SAAW,SAAUU,EAAQC,EAAAA,CAEpD,IAAIC,EAEHA,EADGC,KAAAC,KAAmB,MAAQD,KAAAC,MAAoBD,KAAKE,MACnDF,KAAHC,IAEGD,KAAAC,IAAkBE,GAAO,CAAA,EAAIH,KAAKE,KAAAA,EAGlB,OAAVL,GAAU,aAGpBA,EAASA,EAAOM,GAAO,CAAD,EAAKJ,CAAAA,EAAIC,KAAKI,KAAAA,GAGjCP,GACHM,GAAOJ,EAAGF,CAAAA,EAIPA,GAAU,MAEVG,KAAJK,MACKP,GACHE,KAAAM,IAAqBC,KAAKT,CAAAA,EAE3BU,GAAcR,IAAAA,EAEf,EAQDL,GAAcC,UAAUa,YAAc,SAAUX,EAAAA,CAC3CE,KAAAA,MAIHA,KAAAzB,IAAAA,GACIuB,GAAUE,KAAAU,IAAsBH,KAAKT,CAAAA,EACzCU,GAAcR,IAAAA,EAEf,EAYDL,GAAcC,UAAUe,OAASC,GA8F7BC,GAAgB,CAAA,EAadC,GACa,OAAXC,SAAW,WACfA,QAAQnB,UAAUoB,KAAKC,KAAKF,QAAQG,QAAAA,CAAAA,EACpCC,WAuBEC,GAAY,SAACC,EAAGC,EAAAA,CAAMD,OAAAA,EAAAhB,IAAAkB,IAAkBD,EAA5BjB,IAAAkB,GAAA,EAuBlBC,GAAOC,IAAkB,EC9OdC,GAAI,EOCf,IAAIC,GAGAC,GAGAC,GAiBAC,GAdAC,GAAc,EAGdC,GAAoB,CAAA,EAEpBC,GAAQ,CAAA,EAERC,GAAgBC,EAApBC,IACIC,GAAkBF,EAAtBG,IACIC,GAAeJ,EAAQK,OACvBC,GAAYN,EAAhBO,IACIC,GAAmBR,EAAQS,QAqG/B,SAASC,GAAaC,EAAOC,EAAAA,CACxBZ,EAAea,KAClBb,EAAAa,IAAcpB,GAAkBkB,EAAOf,IAAegB,CAAAA,EAEvDhB,GAAc,EAOd,IAAMkB,EACLrB,GAAgBsB,MACftB,GAAgBsB,IAAW,CAC3BC,GAAO,CAAA,EACPH,IAAiB,CAAA,CAAA,GAMnB,OAHIF,GAASG,EAAKE,GAAOC,QACxBH,EAAAE,GAAYE,KAAK,CAAEC,IAAerB,EAAAA,CAAAA,EAE5BgB,EAAAA,GAAYH,EACnB,CAKM,SAASS,GAASC,EAAAA,CAExB,OADAzB,GAAc,EACP0B,GAAWC,GAAgBF,CAAAA,CAClC,CAQeC,SAAAA,GAAWE,EAASH,EAAcI,EAAAA,CAEjD,IAAMC,EAAYhB,GAAalB,KAAgB,CAAA,EAE/C,GADAkC,EAAUC,EAAWH,EAAAA,CAChBE,EAALnB,MACCmB,EAAAV,GAAmB,CACjBS,EAAiDA,EAAKJ,CAAAA,EAA/CE,GAAAA,OAA0BF,CAAAA,EAElC,SAAAO,EAAAA,CACC,IAAMC,EAAeH,EAAAI,IAClBJ,EAASI,IAAY,GACrBJ,EAASV,GAAQ,GACde,EAAYL,EAAUC,EAASE,EAAcD,CAAAA,EAE/CC,IAAiBE,IACpBL,EAASI,IAAc,CAACC,EAAWL,EAASV,GAAQ,EAAA,EACpDU,EAASnB,IAAYyB,SAAS,CAA9B,CAAA,EAED,CAAA,EAGFN,EAAAnB,IAAuBd,GAAAA,CAElBA,GAAiBwC,GAAkB,CAgC9BC,IAAAA,EAAT,SAAyBC,EAAGC,EAAGC,EAAAA,CAC9B,GAAA,CAAKX,EAADnB,IAAAQ,IAA+B,MAAA,GAEnC,IAAMuB,EAAaZ,EAASnB,IAA0BgC,IAAAA,GAAAA,OACrD,SAAAC,EAAAA,CAAKA,OAAAA,EAAJjC,GAAA,CAAA,EAKF,GAHsB+B,EAAWG,MAAM,SAAAD,EAAAA,CAAK,MAAA,CAACA,EAADV,GAAJ,CAAA,EAIvC,MAAA,CAAOY,GAAUA,EAAQC,KAAKC,KAAMT,EAAGC,EAAGC,CAAAA,EAM3C,IAAIQ,EAAAA,GAUJ,OATAP,EAAWQ,QAAQ,SAAAC,EAAAA,CAClB,GAAIA,EAAAA,IAAqB,CACxB,IAAMlB,EAAekB,EAAAA,GAAgB,GACrCA,EAAQ/B,GAAU+B,EAClBA,IAAAA,EAAAjB,IAAAA,OACID,IAAiBkB,EAAQ/B,GAAQ,KAAI6B,EAAAA,GACzC,CACD,CAAA,EAAA,EAAA,CAEMA,GAAgBnB,EAASnB,IAAYyC,QAAUb,KAAAA,CACnDO,GACCA,EAAQC,KAAKC,KAAMT,EAAGC,EAAGC,CAAAA,EAG7B,EA9DD5C,GAAiBwC,EAAAA,GACjB,IAAIS,EAAUjD,GAAiBwD,sBACzBC,EAAUzD,GAAiB0D,oBAKjC1D,GAAiB0D,oBAAsB,SAAUhB,EAAGC,EAAGC,EAAAA,CACtD,GAAIO,KAAaQ,IAAA,CAChB,IAAIC,EAAMX,EAEVA,EAAAA,OACAR,EAAgBC,EAAGC,EAAGC,CAAAA,EACtBK,EAAUW,CACV,CAEGH,GAASA,EAAQP,KAAKC,KAAMT,EAAGC,EAAGC,CAAAA,CACtC,EA+CD5C,GAAiBwD,sBAAwBf,CACzC,CAGF,OAAOR,EAAAI,KAAwBJ,EAAxBV,EACP,CAMesC,SAAAA,GAAUC,EAAUC,EAAAA,CAEnC,IAAMC,EAAQ/C,GAAalB,KAAgB,CAAA,EAAA,CACtCQ,EAAD0D,KAAyBC,GAAYF,EAAD1C,IAAcyC,CAAAA,IACrDC,EAAKzC,GAAUuC,EACfE,EAAMG,EAAeJ,EAErB/D,GAAAsB,IAAAF,IAAyCK,KAAKuC,CAAAA,EAE/C,CA+ID,SAASI,IAAAA,CAER,QADIC,EACIA,EAAYC,GAAkBC,MAAAA,GACrC,GAAKF,EAAwBG,KAACH,EAA9BI,IACA,GAAA,CACCJ,EAAAI,IAAAC,IAAkCC,QAAQC,EAAAA,EAC1CP,EAASI,IAAAA,IAAyBE,QAAQE,EAAAA,EAC1CR,EAASI,IAAAA,IAA2B,CAAA,CAIpC,OAHQK,EAAP,CACDT,EAAAI,IAAAC,IAAoC,CAAA,EACpCK,EAAOC,IAAaF,EAAGT,EACvBY,GAAAA,CAAA,CAEF,CA9YDF,EAAOG,IAAS,SAAAC,EAAAA,CACfC,GAAmB,KACfC,IAAeA,GAAcF,CAAAA,CACjC,EAEDJ,EAAAO,IAAkB,SAAAH,EAAAA,CACbI,IAAiBA,GAAgBJ,CAAAA,EAGrCK,GAAe,EAEf,IAAMC,GAHNL,GAAmBD,EAAnBO,KAGWjB,IACPgB,IACCE,KAAsBP,IACzBK,EAAAA,IAAwB,CAAA,EACxBL,GAAAV,IAAoC,CAAA,EACpCe,EAAAG,GAAYjB,QAAQ,SAAAkB,EAAAA,CACfA,EAAJC,MACCD,EAAAD,GAAkBC,EAAlBC,KAEDD,EAAAA,IAAyBE,GACzBF,EAAAC,IAAsBD,EAASG,EAAAA,MAC/B,CAAA,IAEDP,EAAKf,IAAiBC,QAAQC,EAAAA,EAC9Ba,EAAAf,IAAsBC,QAAQE,EAAAA,EAC9BY,EAAAf,IAAwB,CAAA,EACxBc,GAAe,IAGjBG,GAAoBP,EACpB,EAEDL,EAAQkB,OAAS,SAAAd,EAAAA,CACZe,IAAcA,GAAaf,CAAAA,EAE/B,IAAMgB,EAAIhB,EAAHO,IACHS,GAAKA,EAAT1B,MACK0B,EAAC1B,IAAyB2B,IAAAA,SAAmB9B,GAAkB+B,KAAKF,CAAAA,IA4YlD,GAAKG,KAAYvB,EAAQwB,yBAC/CD,GAAUvB,EAAQwB,wBACNC,IAAgBpC,EAAAA,GA7Y5B+B,EAAC1B,IAAAA,GAAeE,QAAQ,SAAAkB,EAAAA,CACnBA,EAASG,IACZH,EAAApB,IAAiBoB,EAASG,GAEvBH,EAAAA,MAA2BE,KAC9BF,EAAQD,GAAUC,EAAlBY,KAEDZ,EAASG,EAAAA,OACTH,EAAQY,IAAiBV,EACzB,CAAA,GAEFJ,GAAoBP,GAAmB,IACvC,EAEDL,EAAAW,IAAkB,SAACP,EAAOuB,EAAAA,CACzBA,EAAYC,KAAK,SAAAtC,EAAAA,CAChB,GAAA,CACCA,EAASK,IAAkBC,QAAQC,EAAAA,EACnCP,EAAAA,IAA6BA,EAAAK,IAA2BkC,OAAO,SAAAC,EAAAA,CAAE,MAAA,CAChEA,EAAAjB,IAAYf,GAAagC,CAAAA,CADuC,CAAA,CASjE,OANQ/B,EAAP,CACD4B,EAAYC,KAAK,SAAAR,EAAAA,CACZA,EAAoBA,MAAAA,EAAAzB,IAAqB,CAAA,EAC7C,CAAA,EACDgC,EAAc,CAAA,EACd3B,EAAOC,IAAaF,EAAGT,EACvBY,GAAAA,CAAA,CACD,CAAA,EAEG6B,IAAWA,GAAU3B,EAAOuB,CAAAA,CAChC,EAED3B,EAAQgC,QAAU,SAAA5B,EAAAA,CACb6B,IAAkBA,GAAiB7B,CAAAA,EAEvC,IAEK8B,EAFCd,EAAIhB,EAAVO,IACIS,GAAKA,EAAT1B,MAEC0B,EAAC1B,IAAeE,GAAAA,QAAQ,SAAAuC,EAAAA,CACvB,GAAA,CACCtC,GAAcsC,CAAAA,CAGd,OAFQpC,EAAP,CACDmC,EAAanC,CACb,CACD,CAAA,EACDqB,EAAC1B,IAAAA,OACGwC,GAAYlC,EAAAC,IAAoBiC,EAAYd,EAAhClB,GAAAA,EAEjB,EAwTD,IAAIkC,GAA0C,OAAzBZ,uBAAyB,WAY9C,SAASC,GAAeY,EAAAA,CACvB,IAOIC,EAPEC,EAAO,UAAA,CACZC,aAAaC,CAAAA,EACTL,IAASM,qBAAqBJ,CAAAA,EAClCK,WAAWN,CAAAA,CACX,EACKI,EAAUE,WAAWJ,EAraR,GAAA,EAwafH,KACHE,EAAMd,sBAAsBe,CAAAA,EAE7B,CAmBD,SAAS1C,GAAc+C,EAAAA,CAGtB,IAAMC,EAAOxC,GACTyC,EAAUF,EAAdjC,IACsB,OAAXmC,GAAW,aACrBF,EAAAjC,IAAAA,OACAmC,EAAAA,GAGDzC,GAAmBwC,CACnB,CAMD,SAAS/C,GAAa8C,EAAAA,CAGrB,IAAMC,EAAOxC,GACbuC,EAAAjC,IAAgBiC,EAAI/B,GAAAA,EACpBR,GAAmBwC,CACnB,CAMD,SAASE,GAAYC,EAASC,EAAAA,CAC7B,MAAA,CACED,GACDA,EAAQ3B,SAAW4B,EAAQ5B,QAC3B4B,EAAQrB,KAAK,SAACsB,EAAKC,EAAAA,CAAUD,OAAAA,IAAQF,EAAQG,EAAhC,CAAA,CAEd,CAED,SAASC,GAAeF,EAAKG,EAAAA,CAC5B,OAAmB,OAALA,GAAK,WAAaA,EAAEH,CAAAA,EAAOG,CACzC,CC9fc,SAARC,GAAyB,EAAG,CAGjC,OAAOA,GAAwB,OAAO,QAArB,YAA2C,OAAO,OAAO,UAA1B,SAAqC,SAAUC,EAAG,CAChG,OAAO,OAAOA,CAChB,EAAI,SAAUA,EAAG,CACf,OAAOA,GAAmB,OAAO,QAArB,YAA+BA,EAAE,cAAgB,QAAUA,IAAM,OAAO,UAAY,SAAW,OAAOA,CACpH,EAAGD,GAAQ,CAAC,CACd,CCRe,SAARE,GAA2BC,EAAa,CAC7C,GAAIA,IAAgB,MAAQA,IAAgB,IAAQA,IAAgB,GAClE,MAAO,KAET,IAAIC,EAAS,OAAOD,CAAW,EAC/B,OAAI,MAAMC,CAAM,EACPA,EAEFA,EAAS,EAAI,KAAK,KAAKA,CAAM,EAAI,KAAK,MAAMA,CAAM,CAC3D,CCTe,SAARC,EAA8BC,EAAUC,EAAM,CACnD,GAAIA,EAAK,OAASD,EAChB,MAAM,IAAI,UAAUA,EAAW,aAAeA,EAAW,EAAI,IAAM,IAAM,uBAAyBC,EAAK,OAAS,UAAU,CAE9H,CC4Be,SAARC,GAAwBC,EAAU,CACvCC,EAAa,EAAG,SAAS,EACzB,IAAIC,EAAS,OAAO,UAAU,SAAS,KAAKF,CAAQ,EAGpD,OAAIA,aAAoB,MAAQG,GAAQH,CAAQ,IAAM,UAAYE,IAAW,gBAEpE,IAAI,KAAKF,EAAS,QAAQ,CAAC,EACzB,OAAOA,GAAa,UAAYE,IAAW,kBAC7C,IAAI,KAAKF,CAAQ,IAEnB,OAAOA,GAAa,UAAYE,IAAW,oBAAsB,OAAO,QAAY,MAEvF,QAAQ,KAAK,oNAAoN,EAEjO,QAAQ,KAAK,IAAI,MAAM,EAAE,KAAK,GAEzB,IAAI,KAAK,GAAG,EAEvB,CC9Be,SAARE,GAAiCC,EAAWC,EAAa,CAC9DC,EAAa,EAAG,SAAS,EACzB,IAAIC,EAAYC,GAAOJ,CAAS,EAAE,QAAQ,EACtCK,EAASC,GAAUL,CAAW,EAClC,OAAO,IAAI,KAAKE,EAAYE,CAAM,CACpC,CC1BA,IAAIE,GAAiB,CAAC,EACf,SAASC,IAAoB,CAClC,OAAOD,EACT,CCQe,SAARE,GAAiDC,EAAM,CAC5D,IAAIC,EAAU,IAAI,KAAK,KAAK,IAAID,EAAK,YAAY,EAAGA,EAAK,SAAS,EAAGA,EAAK,QAAQ,EAAGA,EAAK,SAAS,EAAGA,EAAK,WAAW,EAAGA,EAAK,WAAW,EAAGA,EAAK,gBAAgB,CAAC,CAAC,EACnK,OAAAC,EAAQ,eAAeD,EAAK,YAAY,CAAC,EAClCA,EAAK,QAAQ,EAAIC,EAAQ,QAAQ,CAC1C,CCKe,SAARC,GAA4BC,EAAW,CAC5CC,EAAa,EAAG,SAAS,EACzB,IAAIC,EAAOC,GAAOH,CAAS,EAC3B,OAAAE,EAAK,SAAS,EAAG,EAAG,EAAG,CAAC,EACjBA,CACT,CCtBA,IAAIE,GAAsB,MAgCX,SAARC,GAA0CC,EAAeC,EAAgB,CAC9EC,EAAa,EAAG,SAAS,EACzB,IAAIC,EAAiBC,GAAWJ,CAAa,EACzCK,EAAkBD,GAAWH,CAAc,EAC3CK,EAAgBH,EAAe,QAAQ,EAAII,GAAgCJ,CAAc,EACzFK,EAAiBH,EAAgB,QAAQ,EAAIE,GAAgCF,CAAe,EAKhG,OAAO,KAAK,OAAOC,EAAgBE,GAAkBV,EAAmB,CAC1E,CCxBO,IAAIW,GAAa,SAUbC,GAAU,KAAK,IAAI,GAAI,CAAC,EAAI,GAAK,GAAK,GAAK,IAU3CC,GAAuB,IAUvBC,GAAqB,KAoBzB,IAAIC,GAAU,CAACC,GAkDf,IAAIC,GAAgB,KAoBpB,IAAIC,GAAeC,GAAgB,GAU/BC,GAAgBF,GAAe,EAU/BG,GAAgBH,GAAeI,GAU/BC,GAAiBF,GAAgB,GAUjCG,GAAmBD,GAAiB,ECpJhC,SAARE,GAAwBC,EAAO,CACpC,OAAAC,EAAa,EAAG,SAAS,EAClBD,aAAiB,MAAQE,GAAQF,CAAK,IAAM,UAAY,OAAO,UAAU,SAAS,KAAKA,CAAK,IAAM,eAC3G,CCHe,SAARG,GAAyBC,EAAW,CAEzC,GADAC,EAAa,EAAG,SAAS,EACrB,CAACC,GAAOF,CAAS,GAAK,OAAOA,GAAc,SAC7C,MAAO,GAET,IAAIG,EAAOC,GAAOJ,CAAS,EAC3B,MAAO,CAAC,MAAM,OAAOG,CAAI,CAAC,CAC5B,CCpBe,SAARE,GAAiCC,EAAWC,EAAa,CAC9DC,EAAa,EAAG,SAAS,EACzB,IAAIC,EAASC,GAAUH,CAAW,EAClC,OAAOI,GAAgBL,EAAW,CAACG,CAAM,CAC3C,CCvBA,IAAIG,GAAsB,MACX,SAARC,GAAiCC,EAAW,CACjDC,EAAa,EAAG,SAAS,EACzB,IAAIC,EAAOC,GAAOH,CAAS,EACvBI,EAAYF,EAAK,QAAQ,EAC7BA,EAAK,YAAY,EAAG,CAAC,EACrBA,EAAK,YAAY,EAAG,EAAG,EAAG,CAAC,EAC3B,IAAIG,EAAuBH,EAAK,QAAQ,EACpCI,EAAaF,EAAYC,EAC7B,OAAO,KAAK,MAAMC,EAAaR,EAAmB,EAAI,CACxD,CCVe,SAARS,GAAmCC,EAAW,CACnDC,EAAa,EAAG,SAAS,EACzB,IAAIC,EAAe,EACfC,EAAOC,GAAOJ,CAAS,EACvBK,EAAMF,EAAK,UAAU,EACrBG,GAAQD,EAAMH,EAAe,EAAI,GAAKG,EAAMH,EAChD,OAAAC,EAAK,WAAWA,EAAK,WAAW,EAAIG,CAAI,EACxCH,EAAK,YAAY,EAAG,EAAG,EAAG,CAAC,EACpBA,CACT,CCRe,SAARI,GAAmCC,EAAW,CACnDC,EAAa,EAAG,SAAS,EACzB,IAAIC,EAAOC,GAAOH,CAAS,EACvBI,EAAOF,EAAK,eAAe,EAC3BG,EAA4B,IAAI,KAAK,CAAC,EAC1CA,EAA0B,eAAeD,EAAO,EAAG,EAAG,CAAC,EACvDC,EAA0B,YAAY,EAAG,EAAG,EAAG,CAAC,EAChD,IAAIC,EAAkBC,GAAkBF,CAAyB,EAC7DG,EAA4B,IAAI,KAAK,CAAC,EAC1CA,EAA0B,eAAeJ,EAAM,EAAG,CAAC,EACnDI,EAA0B,YAAY,EAAG,EAAG,EAAG,CAAC,EAChD,IAAIC,EAAkBF,GAAkBC,CAAyB,EACjE,OAAIN,EAAK,QAAQ,GAAKI,EAAgB,QAAQ,EACrCF,EAAO,EACLF,EAAK,QAAQ,GAAKO,EAAgB,QAAQ,EAC5CL,EAEAA,EAAO,CAElB,CCnBe,SAARM,GAAuCC,EAAW,CACvDC,EAAa,EAAG,SAAS,EACzB,IAAIC,EAAOC,GAAkBH,CAAS,EAClCI,EAAkB,IAAI,KAAK,CAAC,EAChCA,EAAgB,eAAeF,EAAM,EAAG,CAAC,EACzCE,EAAgB,YAAY,EAAG,EAAG,EAAG,CAAC,EACtC,IAAIC,EAAOC,GAAkBF,CAAe,EAC5C,OAAOC,CACT,CCPA,IAAIE,GAAuB,OACZ,SAARC,GAA+BC,EAAW,CAC/CC,EAAa,EAAG,SAAS,EACzB,IAAIC,EAAOC,GAAOH,CAAS,EACvBI,EAAOC,GAAkBH,CAAI,EAAE,QAAQ,EAAII,GAAsBJ,CAAI,EAAE,QAAQ,EAKnF,OAAO,KAAK,MAAME,EAAON,EAAoB,EAAI,CACnD,CCVe,SAARS,GAAgCC,EAAWC,EAAS,CACzD,IAAIC,EAAMC,EAAOC,EAAOC,EAAuBC,EAAiBC,EAAuBC,EAAuBC,EAC9GC,EAAa,EAAG,SAAS,EACzB,IAAIC,EAAiBC,GAAkB,EACnCC,EAAeC,IAAWZ,GAAQC,GAASC,GAASC,EAA0EJ,GAAQ,gBAAkB,MAAQI,IAA0B,OAASA,EAAwBJ,GAAY,OAAuCK,EAAkBL,EAAQ,UAAY,MAAQK,IAAoB,SAAmBC,EAAwBD,EAAgB,WAAa,MAAQC,IAA0B,OAAtL,OAAwMA,EAAsB,gBAAkB,MAAQH,IAAU,OAASA,EAAQO,EAAe,gBAAkB,MAAQR,IAAU,OAASA,GAASK,EAAwBG,EAAe,UAAY,MAAQH,IAA0B,SAAmBC,EAAyBD,EAAsB,WAAa,MAAQC,IAA2B,OAAzG,OAA2HA,EAAuB,gBAAkB,MAAQP,IAAS,OAASA,EAAO,CAAC,EAGp4B,GAAI,EAAEW,GAAgB,GAAKA,GAAgB,GACzC,MAAM,IAAI,WAAW,kDAAkD,EAEzE,IAAIE,EAAOC,GAAOhB,CAAS,EACvBiB,EAAMF,EAAK,UAAU,EACrBG,GAAQD,EAAMJ,EAAe,EAAI,GAAKI,EAAMJ,EAChD,OAAAE,EAAK,WAAWA,EAAK,WAAW,EAAIG,CAAI,EACxCH,EAAK,YAAY,EAAG,EAAG,EAAG,CAAC,EACpBA,CACT,CCfe,SAARI,GAAgCC,EAAWC,EAAS,CACzD,IAAIC,EAAMC,EAAOC,EAAOC,EAAuBC,EAAiBC,EAAuBC,EAAuBC,EAC9GC,EAAa,EAAG,SAAS,EACzB,IAAIC,EAAOC,GAAOZ,CAAS,EACvBa,EAAOF,EAAK,eAAe,EAC3BG,EAAiBC,GAAkB,EACnCC,EAAwBC,IAAWf,GAAQC,GAASC,GAASC,EAA0EJ,GAAQ,yBAA2B,MAAQI,IAA0B,OAASA,EAAwBJ,GAAY,OAAuCK,EAAkBL,EAAQ,UAAY,MAAQK,IAAoB,SAAmBC,EAAwBD,EAAgB,WAAa,MAAQC,IAA0B,OAAtL,OAAwMA,EAAsB,yBAA2B,MAAQH,IAAU,OAASA,EAAQU,EAAe,yBAA2B,MAAQX,IAAU,OAASA,GAASK,EAAwBM,EAAe,UAAY,MAAQN,IAA0B,SAAmBC,EAAyBD,EAAsB,WAAa,MAAQC,IAA2B,OAAzG,OAA2HA,EAAuB,yBAA2B,MAAQP,IAAS,OAASA,EAAO,CAAC,EAGj7B,GAAI,EAAEc,GAAyB,GAAKA,GAAyB,GAC3D,MAAM,IAAI,WAAW,2DAA2D,EAElF,IAAIE,EAAsB,IAAI,KAAK,CAAC,EACpCA,EAAoB,eAAeL,EAAO,EAAG,EAAGG,CAAqB,EACrEE,EAAoB,YAAY,EAAG,EAAG,EAAG,CAAC,EAC1C,IAAIC,EAAkBC,GAAeF,EAAqBjB,CAAO,EAC7DoB,EAAsB,IAAI,KAAK,CAAC,EACpCA,EAAoB,eAAeR,EAAM,EAAGG,CAAqB,EACjEK,EAAoB,YAAY,EAAG,EAAG,EAAG,CAAC,EAC1C,IAAIC,EAAkBF,GAAeC,EAAqBpB,CAAO,EACjE,OAAIU,EAAK,QAAQ,GAAKQ,EAAgB,QAAQ,EACrCN,EAAO,EACLF,EAAK,QAAQ,GAAKW,EAAgB,QAAQ,EAC5CT,EAEAA,EAAO,CAElB,CC3Be,SAARU,GAAoCC,EAAWC,EAAS,CAC7D,IAAIC,EAAMC,EAAOC,EAAOC,EAAuBC,EAAiBC,EAAuBC,EAAuBC,EAC9GC,EAAa,EAAG,SAAS,EACzB,IAAIC,EAAiBC,GAAkB,EACnCC,EAAwBC,IAAWZ,GAAQC,GAASC,GAASC,EAA0EJ,GAAQ,yBAA2B,MAAQI,IAA0B,OAASA,EAAwBJ,GAAY,OAAuCK,EAAkBL,EAAQ,UAAY,MAAQK,IAAoB,SAAmBC,EAAwBD,EAAgB,WAAa,MAAQC,IAA0B,OAAtL,OAAwMA,EAAsB,yBAA2B,MAAQH,IAAU,OAASA,EAAQO,EAAe,yBAA2B,MAAQR,IAAU,OAASA,GAASK,EAAwBG,EAAe,UAAY,MAAQH,IAA0B,SAAmBC,EAAyBD,EAAsB,WAAa,MAAQC,IAA2B,OAAzG,OAA2HA,EAAuB,yBAA2B,MAAQP,IAAS,OAASA,EAAO,CAAC,EAC76Ba,EAAOC,GAAehB,EAAWC,CAAO,EACxCgB,EAAY,IAAI,KAAK,CAAC,EAC1BA,EAAU,eAAeF,EAAM,EAAGF,CAAqB,EACvDI,EAAU,YAAY,EAAG,EAAG,EAAG,CAAC,EAChC,IAAIC,EAAOC,GAAeF,EAAWhB,CAAO,EAC5C,OAAOiB,CACT,CCZA,IAAIE,GAAuB,OACZ,SAARC,GAA4BC,EAAWC,EAAS,CACrDC,EAAa,EAAG,SAAS,EACzB,IAAIC,EAAOC,GAAOJ,CAAS,EACvBK,EAAOC,GAAeH,EAAMF,CAAO,EAAE,QAAQ,EAAIM,GAAmBJ,EAAMF,CAAO,EAAE,QAAQ,EAK/F,OAAO,KAAK,MAAMI,EAAOP,EAAoB,EAAI,CACnD,CCde,SAARU,EAAiCC,EAAQC,EAAc,CAG5D,QAFIC,EAAOF,EAAS,EAAI,IAAM,GAC1BG,EAAS,KAAK,IAAIH,CAAM,EAAE,SAAS,EAChCG,EAAO,OAASF,GACrBE,EAAS,IAAMA,EAEjB,OAAOD,EAAOC,CAChB,CCMA,IAAIC,GAAa,CAEf,EAAG,SAAWC,EAAMC,EAAO,CAUzB,IAAIC,EAAaF,EAAK,eAAe,EAEjCG,EAAOD,EAAa,EAAIA,EAAa,EAAIA,EAC7C,OAAOE,EAAgBH,IAAU,KAAOE,EAAO,IAAMA,EAAMF,EAAM,MAAM,CACzE,EAEA,EAAG,SAAWD,EAAMC,EAAO,CACzB,IAAII,EAAQL,EAAK,YAAY,EAC7B,OAAOC,IAAU,IAAM,OAAOI,EAAQ,CAAC,EAAID,EAAgBC,EAAQ,EAAG,CAAC,CACzE,EAEA,EAAG,SAAWL,EAAMC,EAAO,CACzB,OAAOG,EAAgBJ,EAAK,WAAW,EAAGC,EAAM,MAAM,CACxD,EAEA,EAAG,SAAWD,EAAMC,EAAO,CACzB,IAAIK,EAAqBN,EAAK,YAAY,EAAI,IAAM,EAAI,KAAO,KAC/D,OAAQC,EAAO,CACb,IAAK,IACL,IAAK,KACH,OAAOK,EAAmB,YAAY,EACxC,IAAK,MACH,OAAOA,EACT,IAAK,QACH,OAAOA,EAAmB,GAC5B,IAAK,OACL,QACE,OAAOA,IAAuB,KAAO,OAAS,MAClD,CACF,EAEA,EAAG,SAAWN,EAAMC,EAAO,CACzB,OAAOG,EAAgBJ,EAAK,YAAY,EAAI,IAAM,GAAIC,EAAM,MAAM,CACpE,EAEA,EAAG,SAAWD,EAAMC,EAAO,CACzB,OAAOG,EAAgBJ,EAAK,YAAY,EAAGC,EAAM,MAAM,CACzD,EAEA,EAAG,SAAWD,EAAMC,EAAO,CACzB,OAAOG,EAAgBJ,EAAK,cAAc,EAAGC,EAAM,MAAM,CAC3D,EAEA,EAAG,SAAWD,EAAMC,EAAO,CACzB,OAAOG,EAAgBJ,EAAK,cAAc,EAAGC,EAAM,MAAM,CAC3D,EAEA,EAAG,SAAWD,EAAMC,EAAO,CACzB,IAAIM,EAAiBN,EAAM,OACvBO,EAAeR,EAAK,mBAAmB,EACvCS,EAAoB,KAAK,MAAMD,EAAe,KAAK,IAAI,GAAID,EAAiB,CAAC,CAAC,EAClF,OAAOH,EAAgBK,EAAmBR,EAAM,MAAM,CACxD,CACF,EACOS,GAAQX,GCxEf,IAAIY,GAAgB,CAClB,GAAI,KACJ,GAAI,KACJ,SAAU,WACV,KAAM,OACN,QAAS,UACT,UAAW,YACX,QAAS,UACT,MAAO,OACT,EA+CIC,GAAa,CAEf,EAAG,SAAWC,EAAMC,EAAOC,EAAU,CACnC,IAAIC,EAAMH,EAAK,eAAe,EAAI,EAAI,EAAI,EAC1C,OAAQC,EAAO,CAEb,IAAK,IACL,IAAK,KACL,IAAK,MACH,OAAOC,EAAS,IAAIC,EAAK,CACvB,MAAO,aACT,CAAC,EAEH,IAAK,QACH,OAAOD,EAAS,IAAIC,EAAK,CACvB,MAAO,QACT,CAAC,EAEH,IAAK,OACL,QACE,OAAOD,EAAS,IAAIC,EAAK,CACvB,MAAO,MACT,CAAC,CACL,CACF,EAEA,EAAG,SAAWH,EAAMC,EAAOC,EAAU,CAEnC,GAAID,IAAU,KAAM,CAClB,IAAIG,EAAaJ,EAAK,eAAe,EAEjCK,EAAOD,EAAa,EAAIA,EAAa,EAAIA,EAC7C,OAAOF,EAAS,cAAcG,EAAM,CAClC,KAAM,MACR,CAAC,CACH,CACA,OAAOC,GAAgB,EAAEN,EAAMC,CAAK,CACtC,EAEA,EAAG,SAAWD,EAAMC,EAAOC,EAAUK,EAAS,CAC5C,IAAIC,EAAiBC,GAAeT,EAAMO,CAAO,EAE7CG,EAAWF,EAAiB,EAAIA,EAAiB,EAAIA,EAGzD,GAAIP,IAAU,KAAM,CAClB,IAAIU,EAAeD,EAAW,IAC9B,OAAOE,EAAgBD,EAAc,CAAC,CACxC,CAGA,OAAIV,IAAU,KACLC,EAAS,cAAcQ,EAAU,CACtC,KAAM,MACR,CAAC,EAIIE,EAAgBF,EAAUT,EAAM,MAAM,CAC/C,EAEA,EAAG,SAAWD,EAAMC,EAAO,CACzB,IAAIY,EAAcC,GAAkBd,CAAI,EAGxC,OAAOY,EAAgBC,EAAaZ,EAAM,MAAM,CAClD,EAUA,EAAG,SAAWD,EAAMC,EAAO,CACzB,IAAII,EAAOL,EAAK,eAAe,EAC/B,OAAOY,EAAgBP,EAAMJ,EAAM,MAAM,CAC3C,EAEA,EAAG,SAAWD,EAAMC,EAAOC,EAAU,CACnC,IAAIa,EAAU,KAAK,MAAMf,EAAK,YAAY,EAAI,GAAK,CAAC,EACpD,OAAQC,EAAO,CAEb,IAAK,IACH,OAAO,OAAOc,CAAO,EAEvB,IAAK,KACH,OAAOH,EAAgBG,EAAS,CAAC,EAEnC,IAAK,KACH,OAAOb,EAAS,cAAca,EAAS,CACrC,KAAM,SACR,CAAC,EAEH,IAAK,MACH,OAAOb,EAAS,QAAQa,EAAS,CAC/B,MAAO,cACP,QAAS,YACX,CAAC,EAEH,IAAK,QACH,OAAOb,EAAS,QAAQa,EAAS,CAC/B,MAAO,SACP,QAAS,YACX,CAAC,EAEH,IAAK,OACL,QACE,OAAOb,EAAS,QAAQa,EAAS,CAC/B,MAAO,OACP,QAAS,YACX,CAAC,CACL,CACF,EAEA,EAAG,SAAWf,EAAMC,EAAOC,EAAU,CACnC,IAAIa,EAAU,KAAK,MAAMf,EAAK,YAAY,EAAI,GAAK,CAAC,EACpD,OAAQC,EAAO,CAEb,IAAK,IACH,OAAO,OAAOc,CAAO,EAEvB,IAAK,KACH,OAAOH,EAAgBG,EAAS,CAAC,EAEnC,IAAK,KACH,OAAOb,EAAS,cAAca,EAAS,CACrC,KAAM,SACR,CAAC,EAEH,IAAK,MACH,OAAOb,EAAS,QAAQa,EAAS,CAC/B,MAAO,cACP,QAAS,YACX,CAAC,EAEH,IAAK,QACH,OAAOb,EAAS,QAAQa,EAAS,CAC/B,MAAO,SACP,QAAS,YACX,CAAC,EAEH,IAAK,OACL,QACE,OAAOb,EAAS,QAAQa,EAAS,CAC/B,MAAO,OACP,QAAS,YACX,CAAC,CACL,CACF,EAEA,EAAG,SAAWf,EAAMC,EAAOC,EAAU,CACnC,IAAIc,EAAQhB,EAAK,YAAY,EAC7B,OAAQC,EAAO,CACb,IAAK,IACL,IAAK,KACH,OAAOK,GAAgB,EAAEN,EAAMC,CAAK,EAEtC,IAAK,KACH,OAAOC,EAAS,cAAcc,EAAQ,EAAG,CACvC,KAAM,OACR,CAAC,EAEH,IAAK,MACH,OAAOd,EAAS,MAAMc,EAAO,CAC3B,MAAO,cACP,QAAS,YACX,CAAC,EAEH,IAAK,QACH,OAAOd,EAAS,MAAMc,EAAO,CAC3B,MAAO,SACP,QAAS,YACX,CAAC,EAEH,IAAK,OACL,QACE,OAAOd,EAAS,MAAMc,EAAO,CAC3B,MAAO,OACP,QAAS,YACX,CAAC,CACL,CACF,EAEA,EAAG,SAAWhB,EAAMC,EAAOC,EAAU,CACnC,IAAIc,EAAQhB,EAAK,YAAY,EAC7B,OAAQC,EAAO,CAEb,IAAK,IACH,OAAO,OAAOe,EAAQ,CAAC,EAEzB,IAAK,KACH,OAAOJ,EAAgBI,EAAQ,EAAG,CAAC,EAErC,IAAK,KACH,OAAOd,EAAS,cAAcc,EAAQ,EAAG,CACvC,KAAM,OACR,CAAC,EAEH,IAAK,MACH,OAAOd,EAAS,MAAMc,EAAO,CAC3B,MAAO,cACP,QAAS,YACX,CAAC,EAEH,IAAK,QACH,OAAOd,EAAS,MAAMc,EAAO,CAC3B,MAAO,SACP,QAAS,YACX,CAAC,EAEH,IAAK,OACL,QACE,OAAOd,EAAS,MAAMc,EAAO,CAC3B,MAAO,OACP,QAAS,YACX,CAAC,CACL,CACF,EAEA,EAAG,SAAWhB,EAAMC,EAAOC,EAAUK,EAAS,CAC5C,IAAIU,EAAOC,GAAWlB,EAAMO,CAAO,EACnC,OAAIN,IAAU,KACLC,EAAS,cAAce,EAAM,CAClC,KAAM,MACR,CAAC,EAEIL,EAAgBK,EAAMhB,EAAM,MAAM,CAC3C,EAEA,EAAG,SAAWD,EAAMC,EAAOC,EAAU,CACnC,IAAIiB,EAAUC,GAAcpB,CAAI,EAChC,OAAIC,IAAU,KACLC,EAAS,cAAciB,EAAS,CACrC,KAAM,MACR,CAAC,EAEIP,EAAgBO,EAASlB,EAAM,MAAM,CAC9C,EAEA,EAAG,SAAWD,EAAMC,EAAOC,EAAU,CACnC,OAAID,IAAU,KACLC,EAAS,cAAcF,EAAK,WAAW,EAAG,CAC/C,KAAM,MACR,CAAC,EAEIM,GAAgB,EAAEN,EAAMC,CAAK,CACtC,EAEA,EAAG,SAAWD,EAAMC,EAAOC,EAAU,CACnC,IAAImB,EAAYC,GAAgBtB,CAAI,EACpC,OAAIC,IAAU,KACLC,EAAS,cAAcmB,EAAW,CACvC,KAAM,WACR,CAAC,EAEIT,EAAgBS,EAAWpB,EAAM,MAAM,CAChD,EAEA,EAAG,SAAWD,EAAMC,EAAOC,EAAU,CACnC,IAAIqB,EAAYvB,EAAK,UAAU,EAC/B,OAAQC,EAAO,CAEb,IAAK,IACL,IAAK,KACL,IAAK,MACH,OAAOC,EAAS,IAAIqB,EAAW,CAC7B,MAAO,cACP,QAAS,YACX,CAAC,EAEH,IAAK,QACH,OAAOrB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,SACP,QAAS,YACX,CAAC,EAEH,IAAK,SACH,OAAOrB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,QACP,QAAS,YACX,CAAC,EAEH,IAAK,OACL,QACE,OAAOrB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,OACP,QAAS,YACX,CAAC,CACL,CACF,EAEA,EAAG,SAAWvB,EAAMC,EAAOC,EAAUK,EAAS,CAC5C,IAAIgB,EAAYvB,EAAK,UAAU,EAC3BwB,GAAkBD,EAAYhB,EAAQ,aAAe,GAAK,GAAK,EACnE,OAAQN,EAAO,CAEb,IAAK,IACH,OAAO,OAAOuB,CAAc,EAE9B,IAAK,KACH,OAAOZ,EAAgBY,EAAgB,CAAC,EAE1C,IAAK,KACH,OAAOtB,EAAS,cAAcsB,EAAgB,CAC5C,KAAM,KACR,CAAC,EACH,IAAK,MACH,OAAOtB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,cACP,QAAS,YACX,CAAC,EAEH,IAAK,QACH,OAAOrB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,SACP,QAAS,YACX,CAAC,EAEH,IAAK,SACH,OAAOrB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,QACP,QAAS,YACX,CAAC,EAEH,IAAK,OACL,QACE,OAAOrB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,OACP,QAAS,YACX,CAAC,CACL,CACF,EAEA,EAAG,SAAWvB,EAAMC,EAAOC,EAAUK,EAAS,CAC5C,IAAIgB,EAAYvB,EAAK,UAAU,EAC3BwB,GAAkBD,EAAYhB,EAAQ,aAAe,GAAK,GAAK,EACnE,OAAQN,EAAO,CAEb,IAAK,IACH,OAAO,OAAOuB,CAAc,EAE9B,IAAK,KACH,OAAOZ,EAAgBY,EAAgBvB,EAAM,MAAM,EAErD,IAAK,KACH,OAAOC,EAAS,cAAcsB,EAAgB,CAC5C,KAAM,KACR,CAAC,EACH,IAAK,MACH,OAAOtB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,cACP,QAAS,YACX,CAAC,EAEH,IAAK,QACH,OAAOrB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,SACP,QAAS,YACX,CAAC,EAEH,IAAK,SACH,OAAOrB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,QACP,QAAS,YACX,CAAC,EAEH,IAAK,OACL,QACE,OAAOrB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,OACP,QAAS,YACX,CAAC,CACL,CACF,EAEA,EAAG,SAAWvB,EAAMC,EAAOC,EAAU,CACnC,IAAIqB,EAAYvB,EAAK,UAAU,EAC3ByB,EAAeF,IAAc,EAAI,EAAIA,EACzC,OAAQtB,EAAO,CAEb,IAAK,IACH,OAAO,OAAOwB,CAAY,EAE5B,IAAK,KACH,OAAOb,EAAgBa,EAAcxB,EAAM,MAAM,EAEnD,IAAK,KACH,OAAOC,EAAS,cAAcuB,EAAc,CAC1C,KAAM,KACR,CAAC,EAEH,IAAK,MACH,OAAOvB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,cACP,QAAS,YACX,CAAC,EAEH,IAAK,QACH,OAAOrB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,SACP,QAAS,YACX,CAAC,EAEH,IAAK,SACH,OAAOrB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,QACP,QAAS,YACX,CAAC,EAEH,IAAK,OACL,QACE,OAAOrB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,OACP,QAAS,YACX,CAAC,CACL,CACF,EAEA,EAAG,SAAWvB,EAAMC,EAAOC,EAAU,CACnC,IAAIwB,EAAQ1B,EAAK,YAAY,EACzB2B,EAAqBD,EAAQ,IAAM,EAAI,KAAO,KAClD,OAAQzB,EAAO,CACb,IAAK,IACL,IAAK,KACH,OAAOC,EAAS,UAAUyB,EAAoB,CAC5C,MAAO,cACP,QAAS,YACX,CAAC,EACH,IAAK,MACH,OAAOzB,EAAS,UAAUyB,EAAoB,CAC5C,MAAO,cACP,QAAS,YACX,CAAC,EAAE,YAAY,EACjB,IAAK,QACH,OAAOzB,EAAS,UAAUyB,EAAoB,CAC5C,MAAO,SACP,QAAS,YACX,CAAC,EACH,IAAK,OACL,QACE,OAAOzB,EAAS,UAAUyB,EAAoB,CAC5C,MAAO,OACP,QAAS,YACX,CAAC,CACL,CACF,EAEA,EAAG,SAAW3B,EAAMC,EAAOC,EAAU,CACnC,IAAIwB,EAAQ1B,EAAK,YAAY,EACzB2B,EAQJ,OAPID,IAAU,GACZC,EAAqB7B,GAAc,KAC1B4B,IAAU,EACnBC,EAAqB7B,GAAc,SAEnC6B,EAAqBD,EAAQ,IAAM,EAAI,KAAO,KAExCzB,EAAO,CACb,IAAK,IACL,IAAK,KACH,OAAOC,EAAS,UAAUyB,EAAoB,CAC5C,MAAO,cACP,QAAS,YACX,CAAC,EACH,IAAK,MACH,OAAOzB,EAAS,UAAUyB,EAAoB,CAC5C,MAAO,cACP,QAAS,YACX,CAAC,EAAE,YAAY,EACjB,IAAK,QACH,OAAOzB,EAAS,UAAUyB,EAAoB,CAC5C,MAAO,SACP,QAAS,YACX,CAAC,EACH,IAAK,OACL,QACE,OAAOzB,EAAS,UAAUyB,EAAoB,CAC5C,MAAO,OACP,QAAS,YACX,CAAC,CACL,CACF,EAEA,EAAG,SAAW3B,EAAMC,EAAOC,EAAU,CACnC,IAAIwB,EAAQ1B,EAAK,YAAY,EACzB2B,EAUJ,OATID,GAAS,GACXC,EAAqB7B,GAAc,QAC1B4B,GAAS,GAClBC,EAAqB7B,GAAc,UAC1B4B,GAAS,EAClBC,EAAqB7B,GAAc,QAEnC6B,EAAqB7B,GAAc,MAE7BG,EAAO,CACb,IAAK,IACL,IAAK,KACL,IAAK,MACH,OAAOC,EAAS,UAAUyB,EAAoB,CAC5C,MAAO,cACP,QAAS,YACX,CAAC,EACH,IAAK,QACH,OAAOzB,EAAS,UAAUyB,EAAoB,CAC5C,MAAO,SACP,QAAS,YACX,CAAC,EACH,IAAK,OACL,QACE,OAAOzB,EAAS,UAAUyB,EAAoB,CAC5C,MAAO,OACP,QAAS,YACX,CAAC,CACL,CACF,EAEA,EAAG,SAAW3B,EAAMC,EAAOC,EAAU,CACnC,GAAID,IAAU,KAAM,CAClB,IAAIyB,EAAQ1B,EAAK,YAAY,EAAI,GACjC,OAAI0B,IAAU,IAAGA,EAAQ,IAClBxB,EAAS,cAAcwB,EAAO,CACnC,KAAM,MACR,CAAC,CACH,CACA,OAAOpB,GAAgB,EAAEN,EAAMC,CAAK,CACtC,EAEA,EAAG,SAAWD,EAAMC,EAAOC,EAAU,CACnC,OAAID,IAAU,KACLC,EAAS,cAAcF,EAAK,YAAY,EAAG,CAChD,KAAM,MACR,CAAC,EAEIM,GAAgB,EAAEN,EAAMC,CAAK,CACtC,EAEA,EAAG,SAAWD,EAAMC,EAAOC,EAAU,CACnC,IAAIwB,EAAQ1B,EAAK,YAAY,EAAI,GACjC,OAAIC,IAAU,KACLC,EAAS,cAAcwB,EAAO,CACnC,KAAM,MACR,CAAC,EAEId,EAAgBc,EAAOzB,EAAM,MAAM,CAC5C,EAEA,EAAG,SAAWD,EAAMC,EAAOC,EAAU,CACnC,IAAIwB,EAAQ1B,EAAK,YAAY,EAE7B,OADI0B,IAAU,IAAGA,EAAQ,IACrBzB,IAAU,KACLC,EAAS,cAAcwB,EAAO,CACnC,KAAM,MACR,CAAC,EAEId,EAAgBc,EAAOzB,EAAM,MAAM,CAC5C,EAEA,EAAG,SAAWD,EAAMC,EAAOC,EAAU,CACnC,OAAID,IAAU,KACLC,EAAS,cAAcF,EAAK,cAAc,EAAG,CAClD,KAAM,QACR,CAAC,EAEIM,GAAgB,EAAEN,EAAMC,CAAK,CACtC,EAEA,EAAG,SAAWD,EAAMC,EAAOC,EAAU,CACnC,OAAID,IAAU,KACLC,EAAS,cAAcF,EAAK,cAAc,EAAG,CAClD,KAAM,QACR,CAAC,EAEIM,GAAgB,EAAEN,EAAMC,CAAK,CACtC,EAEA,EAAG,SAAWD,EAAMC,EAAO,CACzB,OAAOK,GAAgB,EAAEN,EAAMC,CAAK,CACtC,EAEA,EAAG,SAAWD,EAAMC,EAAO2B,EAAWrB,EAAS,CAC7C,IAAIsB,EAAetB,EAAQ,eAAiBP,EACxC8B,EAAiBD,EAAa,kBAAkB,EACpD,GAAIC,IAAmB,EACrB,MAAO,IAET,OAAQ7B,EAAO,CAEb,IAAK,IACH,OAAO8B,GAAkCD,CAAc,EAKzD,IAAK,OACL,IAAK,KAEH,OAAOE,GAAeF,CAAc,EAKtC,IAAK,QACL,IAAK,MACL,QACE,OAAOE,GAAeF,EAAgB,GAAG,CAC7C,CACF,EAEA,EAAG,SAAW9B,EAAMC,EAAO2B,EAAWrB,EAAS,CAC7C,IAAIsB,EAAetB,EAAQ,eAAiBP,EACxC8B,EAAiBD,EAAa,kBAAkB,EACpD,OAAQ5B,EAAO,CAEb,IAAK,IACH,OAAO8B,GAAkCD,CAAc,EAKzD,IAAK,OACL,IAAK,KAEH,OAAOE,GAAeF,CAAc,EAKtC,IAAK,QACL,IAAK,MACL,QACE,OAAOE,GAAeF,EAAgB,GAAG,CAC7C,CACF,EAEA,EAAG,SAAW9B,EAAMC,EAAO2B,EAAWrB,EAAS,CAC7C,IAAIsB,EAAetB,EAAQ,eAAiBP,EACxC8B,EAAiBD,EAAa,kBAAkB,EACpD,OAAQ5B,EAAO,CAEb,IAAK,IACL,IAAK,KACL,IAAK,MACH,MAAO,MAAQgC,GAAoBH,EAAgB,GAAG,EAExD,IAAK,OACL,QACE,MAAO,MAAQE,GAAeF,EAAgB,GAAG,CACrD,CACF,EAEA,EAAG,SAAW9B,EAAMC,EAAO2B,EAAWrB,EAAS,CAC7C,IAAIsB,EAAetB,EAAQ,eAAiBP,EACxC8B,EAAiBD,EAAa,kBAAkB,EACpD,OAAQ5B,EAAO,CAEb,IAAK,IACL,IAAK,KACL,IAAK,MACH,MAAO,MAAQgC,GAAoBH,EAAgB,GAAG,EAExD,IAAK,OACL,QACE,MAAO,MAAQE,GAAeF,EAAgB,GAAG,CACrD,CACF,EAEA,EAAG,SAAW9B,EAAMC,EAAO2B,EAAWrB,EAAS,CAC7C,IAAIsB,EAAetB,EAAQ,eAAiBP,EACxCkC,EAAY,KAAK,MAAML,EAAa,QAAQ,EAAI,GAAI,EACxD,OAAOjB,EAAgBsB,EAAWjC,EAAM,MAAM,CAChD,EAEA,EAAG,SAAWD,EAAMC,EAAO2B,EAAWrB,EAAS,CAC7C,IAAIsB,EAAetB,EAAQ,eAAiBP,EACxCkC,EAAYL,EAAa,QAAQ,EACrC,OAAOjB,EAAgBsB,EAAWjC,EAAM,MAAM,CAChD,CACF,EACA,SAASgC,GAAoBE,EAAQC,EAAgB,CACnD,IAAIC,EAAOF,EAAS,EAAI,IAAM,IAC1BG,EAAY,KAAK,IAAIH,CAAM,EAC3BT,EAAQ,KAAK,MAAMY,EAAY,EAAE,EACjCC,EAAUD,EAAY,GAC1B,GAAIC,IAAY,EACd,OAAOF,EAAO,OAAOX,CAAK,EAE5B,IAAIc,EAAYJ,GAAkB,GAClC,OAAOC,EAAO,OAAOX,CAAK,EAAIc,EAAY5B,EAAgB2B,EAAS,CAAC,CACtE,CACA,SAASR,GAAkCI,EAAQC,EAAgB,CACjE,GAAID,EAAS,KAAO,EAAG,CACrB,IAAIE,EAAOF,EAAS,EAAI,IAAM,IAC9B,OAAOE,EAAOzB,EAAgB,KAAK,IAAIuB,CAAM,EAAI,GAAI,CAAC,CACxD,CACA,OAAOH,GAAeG,EAAQC,CAAc,CAC9C,CACA,SAASJ,GAAeG,EAAQC,EAAgB,CAC9C,IAAII,EAAYJ,GAAkB,GAC9BC,EAAOF,EAAS,EAAI,IAAM,IAC1BG,EAAY,KAAK,IAAIH,CAAM,EAC3BT,EAAQd,EAAgB,KAAK,MAAM0B,EAAY,EAAE,EAAG,CAAC,EACrDC,EAAU3B,EAAgB0B,EAAY,GAAI,CAAC,EAC/C,OAAOD,EAAOX,EAAQc,EAAYD,CACpC,CACA,IAAOE,GAAQ1C,GCnwBf,IAAI2C,GAAoB,SAA2BC,EAASC,EAAY,CACtE,OAAQD,EAAS,CACf,IAAK,IACH,OAAOC,EAAW,KAAK,CACrB,MAAO,OACT,CAAC,EACH,IAAK,KACH,OAAOA,EAAW,KAAK,CACrB,MAAO,QACT,CAAC,EACH,IAAK,MACH,OAAOA,EAAW,KAAK,CACrB,MAAO,MACT,CAAC,EACH,IAAK,OACL,QACE,OAAOA,EAAW,KAAK,CACrB,MAAO,MACT,CAAC,CACL,CACF,EACIC,GAAoB,SAA2BF,EAASC,EAAY,CACtE,OAAQD,EAAS,CACf,IAAK,IACH,OAAOC,EAAW,KAAK,CACrB,MAAO,OACT,CAAC,EACH,IAAK,KACH,OAAOA,EAAW,KAAK,CACrB,MAAO,QACT,CAAC,EACH,IAAK,MACH,OAAOA,EAAW,KAAK,CACrB,MAAO,MACT,CAAC,EACH,IAAK,OACL,QACE,OAAOA,EAAW,KAAK,CACrB,MAAO,MACT,CAAC,CACL,CACF,EACIE,GAAwB,SAA+BH,EAASC,EAAY,CAC9E,IAAIG,EAAcJ,EAAQ,MAAM,WAAW,GAAK,CAAC,EAC7CK,EAAcD,EAAY,GAC1BE,EAAcF,EAAY,GAC9B,GAAI,CAACE,EACH,OAAOP,GAAkBC,EAASC,CAAU,EAE9C,IAAIM,EACJ,OAAQF,EAAa,CACnB,IAAK,IACHE,EAAiBN,EAAW,SAAS,CACnC,MAAO,OACT,CAAC,EACD,MACF,IAAK,KACHM,EAAiBN,EAAW,SAAS,CACnC,MAAO,QACT,CAAC,EACD,MACF,IAAK,MACHM,EAAiBN,EAAW,SAAS,CACnC,MAAO,MACT,CAAC,EACD,MACF,IAAK,OACL,QACEM,EAAiBN,EAAW,SAAS,CACnC,MAAO,MACT,CAAC,EACD,KACJ,CACA,OAAOM,EAAe,QAAQ,WAAYR,GAAkBM,EAAaJ,CAAU,CAAC,EAAE,QAAQ,WAAYC,GAAkBI,EAAaL,CAAU,CAAC,CACtJ,EACIO,GAAiB,CACnB,EAAGN,GACH,EAAGC,EACL,EACOM,GAAQD,GC/Ef,IAAIE,GAA2B,CAAC,IAAK,IAAI,EACrCC,GAA0B,CAAC,KAAM,MAAM,EACpC,SAASC,GAA0BC,EAAO,CAC/C,OAAOH,GAAyB,QAAQG,CAAK,IAAM,EACrD,CACO,SAASC,GAAyBD,EAAO,CAC9C,OAAOF,GAAwB,QAAQE,CAAK,IAAM,EACpD,CACO,SAASE,GAAoBF,EAAOG,EAAQC,EAAO,CACxD,GAAIJ,IAAU,OACZ,MAAM,IAAI,WAAW,qCAAqC,OAAOG,EAAQ,wCAAwC,EAAE,OAAOC,EAAO,gFAAgF,CAAC,EAC7M,GAAIJ,IAAU,KACnB,MAAM,IAAI,WAAW,iCAAiC,OAAOG,EAAQ,wCAAwC,EAAE,OAAOC,EAAO,gFAAgF,CAAC,EACzM,GAAIJ,IAAU,IACnB,MAAM,IAAI,WAAW,+BAA+B,OAAOG,EAAQ,oDAAoD,EAAE,OAAOC,EAAO,gFAAgF,CAAC,EACnN,GAAIJ,IAAU,KACnB,MAAM,IAAI,WAAW,iCAAiC,OAAOG,EAAQ,oDAAoD,EAAE,OAAOC,EAAO,gFAAgF,CAAC,CAE9N,CClBA,IAAIC,GAAuB,CACzB,iBAAkB,CAChB,IAAK,qBACL,MAAO,6BACT,EACA,SAAU,CACR,IAAK,WACL,MAAO,mBACT,EACA,YAAa,gBACb,iBAAkB,CAChB,IAAK,qBACL,MAAO,6BACT,EACA,SAAU,CACR,IAAK,WACL,MAAO,mBACT,EACA,YAAa,CACX,IAAK,eACL,MAAO,uBACT,EACA,OAAQ,CACN,IAAK,SACL,MAAO,iBACT,EACA,MAAO,CACL,IAAK,QACL,MAAO,gBACT,EACA,YAAa,CACX,IAAK,eACL,MAAO,uBACT,EACA,OAAQ,CACN,IAAK,SACL,MAAO,iBACT,EACA,aAAc,CACZ,IAAK,gBACL,MAAO,wBACT,EACA,QAAS,CACP,IAAK,UACL,MAAO,kBACT,EACA,YAAa,CACX,IAAK,eACL,MAAO,uBACT,EACA,OAAQ,CACN,IAAK,SACL,MAAO,iBACT,EACA,WAAY,CACV,IAAK,cACL,MAAO,sBACT,EACA,aAAc,CACZ,IAAK,gBACL,MAAO,wBACT,CACF,EACIC,GAAiB,SAAwBC,EAAOC,EAAOC,EAAS,CAClE,IAAIC,EACAC,EAAaN,GAAqBE,GAQtC,OAPI,OAAOI,GAAe,SACxBD,EAASC,EACAH,IAAU,EACnBE,EAASC,EAAW,IAEpBD,EAASC,EAAW,MAAM,QAAQ,YAAaH,EAAM,SAAS,CAAC,EAE7DC,GAAY,MAA8BA,EAAQ,UAChDA,EAAQ,YAAcA,EAAQ,WAAa,EACtC,MAAQC,EAERA,EAAS,OAGbA,CACT,EACOE,GAAQN,GClFA,SAARO,GAAmCC,EAAM,CAC9C,OAAO,UAAY,CACjB,IAAIC,EAAU,UAAU,OAAS,GAAK,UAAU,KAAO,OAAY,UAAU,GAAK,CAAC,EAE/EC,EAAQD,EAAQ,MAAQ,OAAOA,EAAQ,KAAK,EAAID,EAAK,aACrDG,EAASH,EAAK,QAAQE,IAAUF,EAAK,QAAQA,EAAK,cACtD,OAAOG,CACT,CACF,CCPA,IAAIC,GAAc,CAChB,KAAM,mBACN,KAAM,aACN,OAAQ,WACR,MAAO,YACT,EACIC,GAAc,CAChB,KAAM,iBACN,KAAM,cACN,OAAQ,YACR,MAAO,QACT,EACIC,GAAkB,CACpB,KAAM,yBACN,KAAM,yBACN,OAAQ,qBACR,MAAO,oBACT,EACIC,GAAa,CACf,KAAMC,GAAkB,CACtB,QAASJ,GACT,aAAc,MAChB,CAAC,EACD,KAAMI,GAAkB,CACtB,QAASH,GACT,aAAc,MAChB,CAAC,EACD,SAAUG,GAAkB,CAC1B,QAASF,GACT,aAAc,MAChB,CAAC,CACH,EACOG,GAAQF,GCjCf,IAAIG,GAAuB,CACzB,SAAU,qBACV,UAAW,mBACX,MAAO,eACP,SAAU,kBACV,SAAU,cACV,MAAO,GACT,EACIC,GAAiB,SAAwBC,EAAOC,EAAOC,EAAWC,EAAU,CAC9E,OAAOL,GAAqBE,EAC9B,EACOI,GAAQL,GCXA,SAARM,GAAiCC,EAAM,CAC5C,OAAO,SAAUC,EAAYC,EAAS,CACpC,IAAIC,EAAUD,GAAY,MAA8BA,EAAQ,QAAU,OAAOA,EAAQ,OAAO,EAAI,aAChGE,EACJ,GAAID,IAAY,cAAgBH,EAAK,iBAAkB,CACrD,IAAIK,EAAeL,EAAK,wBAA0BA,EAAK,aACnDM,EAAQJ,GAAY,MAA8BA,EAAQ,MAAQ,OAAOA,EAAQ,KAAK,EAAIG,EAC9FD,EAAcJ,EAAK,iBAAiBM,IAAUN,EAAK,iBAAiBK,EACtE,KAAO,CACL,IAAIE,EAAgBP,EAAK,aACrBQ,EAASN,GAAY,MAA8BA,EAAQ,MAAQ,OAAOA,EAAQ,KAAK,EAAIF,EAAK,aACpGI,EAAcJ,EAAK,OAAOQ,IAAWR,EAAK,OAAOO,EACnD,CACA,IAAIE,EAAQT,EAAK,iBAAmBA,EAAK,iBAAiBC,CAAU,EAAIA,EAExE,OAAOG,EAAYK,EACrB,CACF,CChBA,IAAIC,GAAY,CACd,OAAQ,CAAC,IAAK,GAAG,EACjB,YAAa,CAAC,KAAM,IAAI,EACxB,KAAM,CAAC,gBAAiB,aAAa,CACvC,EACIC,GAAgB,CAClB,OAAQ,CAAC,IAAK,IAAK,IAAK,GAAG,EAC3B,YAAa,CAAC,KAAM,KAAM,KAAM,IAAI,EACpC,KAAM,CAAC,cAAe,cAAe,cAAe,aAAa,CACnE,EAMIC,GAAc,CAChB,OAAQ,CAAC,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,GAAG,EACnE,YAAa,CAAC,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,KAAK,EAChG,KAAM,CAAC,UAAW,WAAY,QAAS,QAAS,MAAO,OAAQ,OAAQ,SAAU,YAAa,UAAW,WAAY,UAAU,CACjI,EACIC,GAAY,CACd,OAAQ,CAAC,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,GAAG,EAC1C,MAAO,CAAC,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,IAAI,EAChD,YAAa,CAAC,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,KAAK,EAC7D,KAAM,CAAC,SAAU,SAAU,UAAW,YAAa,WAAY,SAAU,UAAU,CACrF,EACIC,GAAkB,CACpB,OAAQ,CACN,GAAI,IACJ,GAAI,IACJ,SAAU,KACV,KAAM,IACN,QAAS,UACT,UAAW,YACX,QAAS,UACT,MAAO,OACT,EACA,YAAa,CACX,GAAI,KACJ,GAAI,KACJ,SAAU,WACV,KAAM,OACN,QAAS,UACT,UAAW,YACX,QAAS,UACT,MAAO,OACT,EACA,KAAM,CACJ,GAAI,OACJ,GAAI,OACJ,SAAU,WACV,KAAM,OACN,QAAS,UACT,UAAW,YACX,QAAS,UACT,MAAO,OACT,CACF,EACIC,GAA4B,CAC9B,OAAQ,CACN,GAAI,IACJ,GAAI,IACJ,SAAU,KACV,KAAM,IACN,QAAS,iBACT,UAAW,mBACX,QAAS,iBACT,MAAO,UACT,EACA,YAAa,CACX,GAAI,KACJ,GAAI,KACJ,SAAU,WACV,KAAM,OACN,QAAS,iBACT,UAAW,mBACX,QAAS,iBACT,MAAO,UACT,EACA,KAAM,CACJ,GAAI,OACJ,GAAI,OACJ,SAAU,WACV,KAAM,OACN,QAAS,iBACT,UAAW,mBACX,QAAS,iBACT,MAAO,UACT,CACF,EACIC,GAAgB,SAAuBC,EAAaC,EAAU,CAChE,IAAIC,EAAS,OAAOF,CAAW,EAS3BG,EAASD,EAAS,IACtB,GAAIC,EAAS,IAAMA,EAAS,GAC1B,OAAQA,EAAS,GAAI,CACnB,IAAK,GACH,OAAOD,EAAS,KAClB,IAAK,GACH,OAAOA,EAAS,KAClB,IAAK,GACH,OAAOA,EAAS,IACpB,CAEF,OAAOA,EAAS,IAClB,EACIE,GAAW,CACb,cAAeL,GACf,IAAKM,GAAgB,CACnB,OAAQZ,GACR,aAAc,MAChB,CAAC,EACD,QAASY,GAAgB,CACvB,OAAQX,GACR,aAAc,OACd,iBAAkB,SAA0BY,EAAS,CACnD,OAAOA,EAAU,CACnB,CACF,CAAC,EACD,MAAOD,GAAgB,CACrB,OAAQV,GACR,aAAc,MAChB,CAAC,EACD,IAAKU,GAAgB,CACnB,OAAQT,GACR,aAAc,MAChB,CAAC,EACD,UAAWS,GAAgB,CACzB,OAAQR,GACR,aAAc,OACd,iBAAkBC,GAClB,uBAAwB,MAC1B,CAAC,CACH,EACOS,GAAQH,GC9IA,SAARI,GAA8BC,EAAM,CACzC,OAAO,SAAUC,EAAQ,CACvB,IAAIC,EAAU,UAAU,OAAS,GAAK,UAAU,KAAO,OAAY,UAAU,GAAK,CAAC,EAC/EC,EAAQD,EAAQ,MAChBE,EAAeD,GAASH,EAAK,cAAcG,IAAUH,EAAK,cAAcA,EAAK,mBAC7EK,EAAcJ,EAAO,MAAMG,CAAY,EAC3C,GAAI,CAACC,EACH,OAAO,KAET,IAAIC,EAAgBD,EAAY,GAC5BE,EAAgBJ,GAASH,EAAK,cAAcG,IAAUH,EAAK,cAAcA,EAAK,mBAC9EQ,EAAM,MAAM,QAAQD,CAAa,EAAIE,GAAUF,EAAe,SAAUG,EAAS,CACnF,OAAOA,EAAQ,KAAKJ,CAAa,CACnC,CAAC,EAAIK,GAAQJ,EAAe,SAAUG,EAAS,CAC7C,OAAOA,EAAQ,KAAKJ,CAAa,CACnC,CAAC,EACGM,EACJA,EAAQZ,EAAK,cAAgBA,EAAK,cAAcQ,CAAG,EAAIA,EACvDI,EAAQV,EAAQ,cAAgBA,EAAQ,cAAcU,CAAK,EAAIA,EAC/D,IAAIC,EAAOZ,EAAO,MAAMK,EAAc,MAAM,EAC5C,MAAO,CACL,MAAOM,EACP,KAAMC,CACR,CACF,CACF,CACA,SAASF,GAAQG,EAAQC,EAAW,CAClC,QAASP,KAAOM,EACd,GAAIA,EAAO,eAAeN,CAAG,GAAKO,EAAUD,EAAON,EAAI,EACrD,OAAOA,CAIb,CACA,SAASC,GAAUO,EAAOD,EAAW,CACnC,QAASP,EAAM,EAAGA,EAAMQ,EAAM,OAAQR,IACpC,GAAIO,EAAUC,EAAMR,EAAI,EACtB,OAAOA,CAIb,CCzCe,SAARS,GAAqCC,EAAM,CAChD,OAAO,SAAUC,EAAQ,CACvB,IAAIC,EAAU,UAAU,OAAS,GAAK,UAAU,KAAO,OAAY,UAAU,GAAK,CAAC,EAC/EC,EAAcF,EAAO,MAAMD,EAAK,YAAY,EAChD,GAAI,CAACG,EAAa,OAAO,KACzB,IAAIC,EAAgBD,EAAY,GAC5BE,EAAcJ,EAAO,MAAMD,EAAK,YAAY,EAChD,GAAI,CAACK,EAAa,OAAO,KACzB,IAAIC,EAAQN,EAAK,cAAgBA,EAAK,cAAcK,EAAY,EAAE,EAAIA,EAAY,GAClFC,EAAQJ,EAAQ,cAAgBA,EAAQ,cAAcI,CAAK,EAAIA,EAC/D,IAAIC,EAAON,EAAO,MAAMG,EAAc,MAAM,EAC5C,MAAO,CACL,MAAOE,EACP,KAAMC,CACR,CACF,CACF,CCdA,IAAIC,GAA4B,wBAC5BC,GAA4B,OAC5BC,GAAmB,CACrB,OAAQ,UACR,YAAa,6DACb,KAAM,4DACR,EACIC,GAAmB,CACrB,IAAK,CAAC,MAAO,SAAS,CACxB,EACIC,GAAuB,CACzB,OAAQ,WACR,YAAa,YACb,KAAM,gCACR,EACIC,GAAuB,CACzB,IAAK,CAAC,KAAM,KAAM,KAAM,IAAI,CAC9B,EACIC,GAAqB,CACvB,OAAQ,eACR,YAAa,sDACb,KAAM,2FACR,EACIC,GAAqB,CACvB,OAAQ,CAAC,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,KAAK,EAC3F,IAAK,CAAC,OAAQ,MAAO,QAAS,OAAQ,QAAS,QAAS,QAAS,OAAQ,MAAO,MAAO,MAAO,KAAK,CACrG,EACIC,GAAmB,CACrB,OAAQ,YACR,MAAO,2BACP,YAAa,kCACb,KAAM,8DACR,EACIC,GAAmB,CACrB,OAAQ,CAAC,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,KAAK,EACxD,IAAK,CAAC,OAAQ,MAAO,OAAQ,MAAO,OAAQ,MAAO,MAAM,CAC3D,EACIC,GAAyB,CAC3B,OAAQ,6DACR,IAAK,gFACP,EACIC,GAAyB,CAC3B,IAAK,CACH,GAAI,MACJ,GAAI,MACJ,SAAU,OACV,KAAM,OACN,QAAS,WACT,UAAW,aACX,QAAS,WACT,MAAO,QACT,CACF,EACIC,GAAQ,CACV,cAAeC,GAAoB,CACjC,aAAcb,GACd,aAAcC,GACd,cAAe,SAAuBa,EAAO,CAC3C,OAAO,SAASA,EAAO,EAAE,CAC3B,CACF,CAAC,EACD,IAAKC,GAAa,CAChB,cAAeb,GACf,kBAAmB,OACnB,cAAeC,GACf,kBAAmB,KACrB,CAAC,EACD,QAASY,GAAa,CACpB,cAAeX,GACf,kBAAmB,OACnB,cAAeC,GACf,kBAAmB,MACnB,cAAe,SAAuBW,EAAO,CAC3C,OAAOA,EAAQ,CACjB,CACF,CAAC,EACD,MAAOD,GAAa,CAClB,cAAeT,GACf,kBAAmB,OACnB,cAAeC,GACf,kBAAmB,KACrB,CAAC,EACD,IAAKQ,GAAa,CAChB,cAAeP,GACf,kBAAmB,OACnB,cAAeC,GACf,kBAAmB,KACrB,CAAC,EACD,UAAWM,GAAa,CACtB,cAAeL,GACf,kBAAmB,MACnB,cAAeC,GACf,kBAAmB,KACrB,CAAC,CACH,EACOM,GAAQL,GCnFf,IAAIM,GAAS,CACX,KAAM,QACN,eAAgBC,GAChB,WAAYC,GACZ,eAAgBC,GAChB,SAAUC,GACV,MAAOC,GACP,QAAS,CACP,aAAc,EACd,sBAAuB,CACzB,CACF,EACOC,GAAQN,GCzBf,IAAOO,GAAQC,GCoBf,IAAIC,GAAyB,wDAIzBC,GAA6B,oCAC7BC,GAAsB,eACtBC,GAAoB,MACpBC,GAAgC,WAsSrB,SAARC,GAAwBC,EAAWC,EAAgBC,EAAS,CACjE,IAAIC,EAAMC,EAAiBC,EAAOC,EAAOC,EAAOC,EAAuBC,EAAkBC,EAAuBC,EAAuBC,EAAwBC,EAAOC,EAAOC,EAAOC,EAAuBC,EAAkBC,EAAuBC,EAAwBC,EAC5QC,EAAa,EAAG,SAAS,EACzB,IAAIC,GAAY,OAAOrB,CAAc,EACjCsB,GAAiBC,GAAkB,EACnCC,IAAUtB,GAAQC,EAAoEF,GAAQ,UAAY,MAAQE,IAAoB,OAASA,EAAkBmB,GAAe,UAAY,MAAQpB,IAAS,OAASA,EAAOuB,GAC7NC,GAAwBC,IAAWvB,GAASC,GAASC,GAASC,EAA0EN,GAAQ,yBAA2B,MAAQM,IAA0B,OAASA,EAAwBN,GAAY,OAAuCO,EAAmBP,EAAQ,UAAY,MAAQO,IAAqB,SAAmBC,EAAwBD,EAAiB,WAAa,MAAQC,IAA0B,OAAzL,OAA2MA,EAAsB,yBAA2B,MAAQH,IAAU,OAASA,EAAQgB,GAAe,yBAA2B,MAAQjB,IAAU,OAASA,GAASK,EAAwBY,GAAe,UAAY,MAAQZ,IAA0B,SAAmBC,EAAyBD,EAAsB,WAAa,MAAQC,IAA2B,OAAzG,OAA2HA,EAAuB,yBAA2B,MAAQP,IAAU,OAASA,EAAQ,CAAC,EAGv7B,GAAI,EAAEsB,IAAyB,GAAKA,IAAyB,GAC3D,MAAM,IAAI,WAAW,2DAA2D,EAElF,IAAIE,EAAeD,IAAWf,GAASC,GAASC,GAASC,EAA0Ed,GAAQ,gBAAkB,MAAQc,IAA0B,OAASA,EAAwBd,GAAY,OAAuCe,EAAmBf,EAAQ,UAAY,MAAQe,IAAqB,SAAmBC,EAAwBD,EAAiB,WAAa,MAAQC,IAA0B,OAAzL,OAA2MA,EAAsB,gBAAkB,MAAQH,IAAU,OAASA,EAAQQ,GAAe,gBAAkB,MAAQT,IAAU,OAASA,GAASK,EAAyBI,GAAe,UAAY,MAAQJ,IAA2B,SAAmBC,EAAyBD,EAAuB,WAAa,MAAQC,IAA2B,OAA1G,OAA4HA,EAAuB,gBAAkB,MAAQP,IAAU,OAASA,EAAQ,CAAC,EAG74B,GAAI,EAAEgB,GAAgB,GAAKA,GAAgB,GACzC,MAAM,IAAI,WAAW,kDAAkD,EAEzE,GAAI,CAACJ,GAAO,SACV,MAAM,IAAI,WAAW,uCAAuC,EAE9D,GAAI,CAACA,GAAO,WACV,MAAM,IAAI,WAAW,yCAAyC,EAEhE,IAAIK,EAAeC,GAAO/B,CAAS,EACnC,GAAI,CAACgC,GAAQF,CAAY,EACvB,MAAM,IAAI,WAAW,oBAAoB,EAM3C,IAAIG,EAAiBC,GAAgCJ,CAAY,EAC7DK,EAAUC,GAAgBN,EAAcG,CAAc,EACtDI,GAAmB,CACrB,sBAAuBV,GACvB,aAAcE,EACd,OAAQJ,GACR,cAAeK,CACjB,EACIQ,EAAShB,GAAU,MAAM3B,EAA0B,EAAE,IAAI,SAAU4C,EAAW,CAChF,IAAIC,EAAiBD,EAAU,GAC/B,GAAIC,IAAmB,KAAOA,IAAmB,IAAK,CACpD,IAAIC,GAAgBC,GAAeF,GACnC,OAAOC,GAAcF,EAAWd,GAAO,UAAU,CACnD,CACA,OAAOc,CACT,CAAC,EAAE,KAAK,EAAE,EAAE,MAAM7C,EAAsB,EAAE,IAAI,SAAU6C,EAAW,CAEjE,GAAIA,IAAc,KAChB,MAAO,IAET,IAAIC,EAAiBD,EAAU,GAC/B,GAAIC,IAAmB,IACrB,OAAOG,GAAmBJ,CAAS,EAErC,IAAIK,GAAYC,GAAWL,GAC3B,GAAII,GACF,MAAI,EAAE1C,GAAY,MAA8BA,EAAQ,8BAAgC4C,GAAyBP,CAAS,GACxHQ,GAAoBR,EAAWtC,EAAgB,OAAOD,CAAS,CAAC,EAE9D,EAAEE,GAAY,MAA8BA,EAAQ,+BAAiC8C,GAA0BT,CAAS,GAC1HQ,GAAoBR,EAAWtC,EAAgB,OAAOD,CAAS,CAAC,EAE3D4C,GAAUT,EAASI,EAAWd,GAAO,SAAUY,EAAgB,EAExE,GAAIG,EAAe,MAAM1C,EAA6B,EACpD,MAAM,IAAI,WAAW,iEAAmE0C,EAAiB,GAAG,EAE9G,OAAOD,CACT,CAAC,EAAE,KAAK,EAAE,EACV,OAAOD,CACT,CACA,SAASK,GAAmBM,EAAO,CACjC,IAAIC,EAAUD,EAAM,MAAMrD,EAAmB,EAC7C,OAAKsD,EAGEA,EAAQ,GAAG,QAAQrD,GAAmB,GAAG,EAFvCoD,CAGX,CCpWe,SAARE,GAAgCC,EAAWC,EAAeC,EAAS,CACxE,IAAIC,EAAMC,EAAiBC,EAAOC,EAAOC,EAAOC,EAAuBC,EAAkBC,EAAuBC,EAAuBC,EACvIC,EAAa,EAAG,SAAS,EACzB,IAAIC,EAAOC,GAAOf,CAAS,EACvBgB,EAAWD,GAAOd,CAAa,EAC/BgB,EAAiBC,GAAkB,EACnCC,GAAUhB,GAAQC,EAAoEF,GAAQ,UAAY,MAAQE,IAAoB,OAASA,EAAkBa,EAAe,UAAY,MAAQd,IAAS,OAASA,EAAOiB,GAC7NC,EAAeC,IAAWjB,GAASC,GAASC,GAASC,EAA0EN,GAAQ,gBAAkB,MAAQM,IAA0B,OAASA,EAAwBN,GAAY,OAAuCO,EAAmBP,EAAQ,UAAY,MAAQO,IAAqB,SAAmBC,EAAwBD,EAAiB,WAAa,MAAQC,IAA0B,OAAzL,OAA2MA,EAAsB,gBAAkB,MAAQH,IAAU,OAASA,EAAQU,EAAe,gBAAkB,MAAQX,IAAU,OAASA,GAASK,EAAwBM,EAAe,UAAY,MAAQN,IAA0B,SAAmBC,EAAyBD,EAAsB,WAAa,MAAQC,IAA2B,OAAzG,OAA2HA,EAAuB,gBAAkB,MAAQP,IAAU,OAASA,EAAQ,CAAC,EAC14B,GAAI,CAACc,EAAO,SACV,MAAM,IAAI,WAAW,uCAAuC,EAE9D,GAAI,CAACA,EAAO,WACV,MAAM,IAAI,WAAW,yCAAyC,EAEhE,GAAI,CAACA,EAAO,eACV,MAAM,IAAI,WAAW,6CAA6C,EAEpE,IAAII,EAAOC,GAAyBV,EAAME,CAAQ,EAClD,GAAI,MAAMO,CAAI,EACZ,MAAM,IAAI,WAAW,oBAAoB,EAE3C,IAAIE,EACAF,EAAO,GACTE,EAAQ,QACCF,EAAO,GAChBE,EAAQ,WACCF,EAAO,EAChBE,EAAQ,YACCF,EAAO,EAChBE,EAAQ,QACCF,EAAO,EAChBE,EAAQ,WACCF,EAAO,EAChBE,EAAQ,WAERA,EAAQ,QAEV,IAAIC,EAAUC,GAAgBb,EAAMc,GAAgCd,CAAI,CAAC,EACrEe,GAAcF,GAAgBX,EAAUY,GAAgCZ,CAAQ,CAAC,EACjFc,GAAYX,EAAO,eAAeM,EAAOC,EAASG,GAAa,CACjE,OAAQV,EACR,aAAcE,CAChB,CAAC,EACD,OAAOU,GAAOjB,EAAMgB,GAAW,CAC7B,OAAQX,EACR,aAAcE,CAChB,CAAC,CACH,CCzDe,SAARW,GAA0BC,EAAUC,EAAS,CAClD,IAAIC,EACJC,EAAa,EAAG,SAAS,EACzB,IAAIC,EAAmBC,IAAWH,EAA0ED,GAAQ,oBAAsB,MAAQC,IAA0B,OAASA,EAAwB,CAAC,EAC9M,GAAIE,IAAqB,GAAKA,IAAqB,GAAKA,IAAqB,EAC3E,MAAM,IAAI,WAAW,oCAAoC,EAE3D,GAAI,EAAE,OAAOJ,GAAa,UAAY,OAAO,UAAU,SAAS,KAAKA,CAAQ,IAAM,mBACjF,OAAO,IAAI,KAAK,GAAG,EAErB,IAAIM,EAAcC,GAAgBP,CAAQ,EACtCQ,EACJ,GAAIF,EAAY,KAAM,CACpB,IAAIG,EAAkBC,GAAUJ,EAAY,KAAMF,CAAgB,EAClEI,EAAOG,GAAUF,EAAgB,eAAgBA,EAAgB,IAAI,CACvE,CACA,GAAI,CAACD,GAAQ,MAAMA,EAAK,QAAQ,CAAC,EAC/B,OAAO,IAAI,KAAK,GAAG,EAErB,IAAII,EAAYJ,EAAK,QAAQ,EACzBK,EAAO,EACPC,EACJ,GAAIR,EAAY,OACdO,EAAOE,GAAUT,EAAY,IAAI,EAC7B,MAAMO,CAAI,GACZ,OAAO,IAAI,KAAK,GAAG,EAGvB,GAAIP,EAAY,UAEd,GADAQ,EAASE,GAAcV,EAAY,QAAQ,EACvC,MAAMQ,CAAM,EACd,OAAO,IAAI,KAAK,GAAG,MAEhB,CACL,IAAIG,EAAY,IAAI,KAAKL,EAAYC,CAAI,EAMrCK,EAAS,IAAI,KAAK,CAAC,EACvB,OAAAA,EAAO,YAAYD,EAAU,eAAe,EAAGA,EAAU,YAAY,EAAGA,EAAU,WAAW,CAAC,EAC9FC,EAAO,SAASD,EAAU,YAAY,EAAGA,EAAU,cAAc,EAAGA,EAAU,cAAc,EAAGA,EAAU,mBAAmB,CAAC,EACtHC,CACT,CACA,OAAO,IAAI,KAAKN,EAAYC,EAAOC,CAAM,CAC3C,CACA,IAAIK,GAAW,CACb,kBAAmB,OACnB,kBAAmB,QACnB,SAAU,YACZ,EACIC,GAAY,gEACZC,GAAY,4EACZC,GAAgB,gCACpB,SAASf,GAAgBgB,EAAY,CACnC,IAAIjB,EAAc,CAAC,EACfkB,EAAQD,EAAW,MAAMJ,GAAS,iBAAiB,EACnDM,EAIJ,GAAID,EAAM,OAAS,EACjB,OAAOlB,EAYT,GAVI,IAAI,KAAKkB,EAAM,EAAE,EACnBC,EAAaD,EAAM,IAEnBlB,EAAY,KAAOkB,EAAM,GACzBC,EAAaD,EAAM,GACfL,GAAS,kBAAkB,KAAKb,EAAY,IAAI,IAClDA,EAAY,KAAOiB,EAAW,MAAMJ,GAAS,iBAAiB,EAAE,GAChEM,EAAaF,EAAW,OAAOjB,EAAY,KAAK,OAAQiB,EAAW,MAAM,IAGzEE,EAAY,CACd,IAAIC,EAAQP,GAAS,SAAS,KAAKM,CAAU,EACzCC,GACFpB,EAAY,KAAOmB,EAAW,QAAQC,EAAM,GAAI,EAAE,EAClDpB,EAAY,SAAWoB,EAAM,IAE7BpB,EAAY,KAAOmB,CAEvB,CACA,OAAOnB,CACT,CACA,SAASI,GAAUa,EAAYnB,EAAkB,CAC/C,IAAIuB,EAAQ,IAAI,OAAO,wBAA0B,EAAIvB,GAAoB,uBAAyB,EAAIA,GAAoB,MAAM,EAC5HwB,EAAWL,EAAW,MAAMI,CAAK,EAErC,GAAI,CAACC,EAAU,MAAO,CACpB,KAAM,IACN,eAAgB,EAClB,EACA,IAAIC,EAAOD,EAAS,GAAK,SAASA,EAAS,EAAE,EAAI,KAC7CE,EAAUF,EAAS,GAAK,SAASA,EAAS,EAAE,EAAI,KAGpD,MAAO,CACL,KAAME,IAAY,KAAOD,EAAOC,EAAU,IAC1C,eAAgBP,EAAW,OAAOK,EAAS,IAAMA,EAAS,IAAI,MAAM,CACtE,CACF,CACA,SAASjB,GAAUY,EAAYM,EAAM,CAEnC,GAAIA,IAAS,KAAM,OAAO,IAAI,KAAK,GAAG,EACtC,IAAID,EAAWL,EAAW,MAAMH,EAAS,EAEzC,GAAI,CAACQ,EAAU,OAAO,IAAI,KAAK,GAAG,EAClC,IAAIG,EAAa,CAAC,CAACH,EAAS,GACxBI,EAAYC,GAAcL,EAAS,EAAE,EACrCM,EAAQD,GAAcL,EAAS,EAAE,EAAI,EACrCO,EAAMF,GAAcL,EAAS,EAAE,EAC/BQ,EAAOH,GAAcL,EAAS,EAAE,EAChCS,EAAYJ,GAAcL,EAAS,EAAE,EAAI,EAC7C,GAAIG,EACF,OAAKO,GAAiBT,EAAMO,EAAMC,CAAS,EAGpCE,GAAiBV,EAAMO,EAAMC,CAAS,EAFpC,IAAI,KAAK,GAAG,EAIrB,IAAI7B,EAAO,IAAI,KAAK,CAAC,EACrB,MAAI,CAACgC,GAAaX,EAAMK,EAAOC,CAAG,GAAK,CAACM,GAAsBZ,EAAMG,CAAS,EACpE,IAAI,KAAK,GAAG,GAErBxB,EAAK,eAAeqB,EAAMK,EAAO,KAAK,IAAIF,EAAWG,CAAG,CAAC,EAClD3B,EAEX,CACA,SAASyB,GAAcS,EAAO,CAC5B,OAAOA,EAAQ,SAASA,CAAK,EAAI,CACnC,CACA,SAAS3B,GAAUU,EAAY,CAC7B,IAAIG,EAAWH,EAAW,MAAMJ,EAAS,EACzC,GAAI,CAACO,EAAU,MAAO,KAEtB,IAAIe,EAAQC,GAAchB,EAAS,EAAE,EACjCiB,EAAUD,GAAchB,EAAS,EAAE,EACnCkB,EAAUF,GAAchB,EAAS,EAAE,EACvC,OAAKmB,GAAaJ,EAAOE,EAASC,CAAO,EAGlCH,EAAQK,GAAqBH,EAAUI,GAAuBH,EAAU,IAFtE,GAGX,CACA,SAASF,GAAcF,EAAO,CAC5B,OAAOA,GAAS,WAAWA,EAAM,QAAQ,IAAK,GAAG,CAAC,GAAK,CACzD,CACA,SAAS1B,GAAckC,EAAgB,CACrC,GAAIA,IAAmB,IAAK,MAAO,GACnC,IAAItB,EAAWsB,EAAe,MAAM5B,EAAa,EACjD,GAAI,CAACM,EAAU,MAAO,GACtB,IAAIuB,EAAOvB,EAAS,KAAO,IAAM,GAAK,EAClCe,EAAQ,SAASf,EAAS,EAAE,EAC5BiB,EAAUjB,EAAS,IAAM,SAASA,EAAS,EAAE,GAAK,EACtD,OAAKwB,GAAiBT,EAAOE,CAAO,EAG7BM,GAAQR,EAAQK,GAAqBH,EAAUI,IAF7C,GAGX,CACA,SAASV,GAAiBc,EAAajB,EAAMD,EAAK,CAChD,IAAI3B,EAAO,IAAI,KAAK,CAAC,EACrBA,EAAK,eAAe6C,EAAa,EAAG,CAAC,EACrC,IAAIC,EAAqB9C,EAAK,UAAU,GAAK,EACzC+C,GAAQnB,EAAO,GAAK,EAAID,EAAM,EAAImB,EACtC,OAAA9C,EAAK,WAAWA,EAAK,WAAW,EAAI+C,CAAI,EACjC/C,CACT,CAKA,IAAIgD,GAAe,CAAC,GAAI,KAAM,GAAI,GAAI,GAAI,GAAI,GAAI,GAAI,GAAI,GAAI,GAAI,EAAE,EACpE,SAASC,GAAgB5B,EAAM,CAC7B,OAAOA,EAAO,MAAQ,GAAKA,EAAO,IAAM,GAAKA,EAAO,MAAQ,CAC9D,CACA,SAASW,GAAaX,EAAMK,EAAO1B,EAAM,CACvC,OAAO0B,GAAS,GAAKA,GAAS,IAAM1B,GAAQ,GAAKA,IAASgD,GAAatB,KAAWuB,GAAgB5B,CAAI,EAAI,GAAK,IACjH,CACA,SAASY,GAAsBZ,EAAMG,EAAW,CAC9C,OAAOA,GAAa,GAAKA,IAAcyB,GAAgB5B,CAAI,EAAI,IAAM,IACvE,CACA,SAASS,GAAiBoB,EAAOtB,EAAMD,EAAK,CAC1C,OAAOC,GAAQ,GAAKA,GAAQ,IAAMD,GAAO,GAAKA,GAAO,CACvD,CACA,SAASY,GAAaJ,EAAOE,EAASC,EAAS,CAC7C,OAAIH,IAAU,GACLE,IAAY,GAAKC,IAAY,EAE/BA,GAAW,GAAKA,EAAU,IAAMD,GAAW,GAAKA,EAAU,IAAMF,GAAS,GAAKA,EAAQ,EAC/F,CACA,SAASS,GAAiBO,EAAQd,EAAS,CACzC,OAAOA,GAAW,GAAKA,GAAW,EACpC,CCnOA,IAAIe,GAAuB,CACzB,iBAAkB,CAChB,IAAK,sBACL,MAAO,6BACT,EACA,SAAU,CACR,IAAK,YACL,MAAO,oBACT,EACA,YAAa,eACb,iBAAkB,CAChB,IAAK,qBACL,MAAO,4BACT,EACA,SAAU,CACR,IAAK,WACL,MAAO,mBACT,EACA,YAAa,CACX,IAAK,sBACL,MAAO,8BACT,EACA,OAAQ,CACN,IAAK,SACL,MAAO,iBACT,EACA,MAAO,CACL,IAAK,WACL,MAAO,mBACT,EACA,YAAa,CACX,IAAK,wBACL,MAAO,gCACT,EACA,OAAQ,CACN,IAAK,WACL,MAAO,mBACT,EACA,aAAc,CACZ,IAAK,qBACL,MAAO,8BACT,EACA,QAAS,CACP,IAAK,QACL,MAAO,iBACT,EACA,YAAa,CACX,IAAK,wBACL,MAAO,gCACT,EACA,OAAQ,CACN,IAAK,WACL,MAAO,mBACT,EACA,WAAY,CACV,IAAK,qBACL,MAAO,6BACT,EACA,aAAc,CACZ,IAAK,gBACL,MAAO,wBACT,CACF,EACIC,GAAiB,SAAwBC,EAAOC,EAAOC,EAAS,CAClE,IAAIC,EACAC,EAAaN,GAAqBE,GAQtC,OAPI,OAAOI,GAAe,SACxBD,EAASC,EACAH,IAAU,EACnBE,EAASC,EAAW,IAEpBD,EAASC,EAAW,MAAM,QAAQ,YAAaH,EAAM,SAAS,CAAC,EAE7DC,GAAY,MAA8BA,EAAQ,UAChDA,EAAQ,YAAcA,EAAQ,WAAa,EACtC,MAAQC,EAER,QAAUA,EAGdA,CACT,EACOE,GAAQN,GCjFf,IAAIO,GAAc,CAChB,KAAM,2BACN,KAAM,qBACN,OAAQ,UACR,MAAO,SACT,EACIC,GAAc,CAChB,KAAM,gBACN,KAAM,aACN,OAAQ,WACR,MAAO,OACT,EACIC,GAAkB,CACpB,KAAM,4BACN,KAAM,4BACN,OAAQ,qBACR,MAAO,oBACT,EACIC,GAAa,CACf,KAAMC,GAAkB,CACtB,QAASJ,GACT,aAAc,MAChB,CAAC,EACD,KAAMI,GAAkB,CACtB,QAASH,GACT,aAAc,MAChB,CAAC,EACD,SAAUG,GAAkB,CAC1B,QAASF,GACT,aAAc,MAChB,CAAC,CACH,EACOG,GAAQF,GCjCf,IAAIG,GAAuB,CACzB,SAAU,4BACV,UAAW,gBACX,MAAO,eACP,SAAU,qBACV,SAAU,gBACV,MAAO,GACT,EACIC,GAA6B,CAC/B,SAAU,6BACV,UAAW,iBACX,MAAO,gBACP,SAAU,sBACV,SAAU,iBACV,MAAO,GACT,EACIC,GAAiB,SAAwBC,EAAOC,EAAMC,EAAWC,EAAU,CAC7E,OAAIF,EAAK,YAAY,IAAM,EAClBH,GAA2BE,GAE3BH,GAAqBG,EAEhC,EACOI,GAAQL,GCtBf,IAAIM,GAAY,CACd,OAAQ,CAAC,KAAM,IAAI,EACnB,YAAa,CAAC,KAAM,IAAI,EACxB,KAAM,CAAC,kBAAmB,sBAAmB,CAC/C,EACIC,GAAgB,CAClB,OAAQ,CAAC,IAAK,IAAK,IAAK,GAAG,EAC3B,YAAa,CAAC,KAAM,KAAM,KAAM,IAAI,EACpC,KAAM,CAAC,kBAAgB,kBAAgB,kBAAgB,iBAAc,CACvE,EACIC,GAAc,CAChB,OAAQ,CAAC,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,GAAG,EACnE,YAAa,CAAC,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,KAAK,EAChG,KAAM,CAAC,QAAS,UAAW,QAAS,QAAS,OAAQ,QAAS,QAAS,SAAU,aAAc,UAAW,YAAa,WAAW,CACpI,EACIC,GAAY,CACd,OAAQ,CAAC,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,GAAG,EAC1C,MAAO,CAAC,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,OAAI,EAChD,YAAa,CAAC,MAAO,MAAO,MAAO,SAAO,MAAO,MAAO,QAAK,EAC7D,KAAM,CAAC,UAAW,QAAS,SAAU,eAAa,SAAU,UAAW,WAAQ,CACjF,EACIC,GAAkB,CACpB,OAAQ,CACN,GAAI,IACJ,GAAI,IACJ,SAAU,KACV,KAAM,KACN,QAAS,YACT,UAAW,QACX,QAAS,QACT,MAAO,OACT,EACA,YAAa,CACX,GAAI,KACJ,GAAI,KACJ,SAAU,aACV,KAAM,WACN,QAAS,YACT,UAAW,QACX,QAAS,QACT,MAAO,OACT,EACA,KAAM,CACJ,GAAI,OACJ,GAAI,OACJ,SAAU,aACV,KAAM,WACN,QAAS,YACT,UAAW,QACX,QAAS,QACT,MAAO,OACT,CACF,EACIC,GAA4B,CAC9B,OAAQ,CACN,GAAI,IACJ,GAAI,IACJ,SAAU,KACV,KAAM,KACN,QAAS,kBACT,UAAW,cACX,QAAS,cACT,MAAO,aACT,EACA,YAAa,CACX,GAAI,KACJ,GAAI,KACJ,SAAU,aACV,KAAM,WACN,QAAS,kBACT,UAAW,cACX,QAAS,cACT,MAAO,aACT,EACA,KAAM,CACJ,GAAI,OACJ,GAAI,OACJ,SAAU,aACV,KAAM,WACN,QAAS,kBACT,UAAW,cACX,QAAS,cACT,MAAO,aACT,CACF,EACIC,GAAgB,SAAuBC,EAAaC,EAAU,CAChE,IAAIC,EAAS,OAAOF,CAAW,EAC/B,OAAOE,EAAS,MAClB,EACIC,GAAW,CACb,cAAeJ,GACf,IAAKK,GAAgB,CACnB,OAAQX,GACR,aAAc,MAChB,CAAC,EACD,QAASW,GAAgB,CACvB,OAAQV,GACR,aAAc,OACd,iBAAkB,SAA0BW,EAAS,CACnD,OAAO,OAAOA,CAAO,EAAI,CAC3B,CACF,CAAC,EACD,MAAOD,GAAgB,CACrB,OAAQT,GACR,aAAc,MAChB,CAAC,EACD,IAAKS,GAAgB,CACnB,OAAQR,GACR,aAAc,MAChB,CAAC,EACD,UAAWQ,GAAgB,CACzB,OAAQP,GACR,aAAc,OACd,iBAAkBC,GAClB,uBAAwB,MAC1B,CAAC,CACH,EACOQ,GAAQH,GCpHf,IAAII,GAA4B,cAC5BC,GAA4B,OAC5BC,GAAmB,CACrB,OAAQ,gBACR,YAAa,6DACb,KAAM,gFACR,EACIC,GAAmB,CACrB,IAAK,CAAC,OAAQ,MAAM,EACpB,KAAM,CAAC,+CAAgD,uCAAuC,CAChG,EACIC,GAAuB,CACzB,OAAQ,WACR,YAAa,YACb,KAAM,wBACR,EACIC,GAAuB,CACzB,IAAK,CAAC,KAAM,KAAM,KAAM,IAAI,CAC9B,EACIC,GAAqB,CACvB,OAAQ,gBACR,YAAa,sDACb,KAAM,8FACR,EACIC,GAAqB,CACvB,OAAQ,CAAC,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,KAAK,EAC3F,IAAK,CAAC,OAAQ,QAAS,QAAS,QAAS,QAAS,QAAS,QAAS,QAAS,QAAS,QAAS,QAAS,OAAO,CACjH,EACIC,GAAmB,CACrB,OAAQ,aACR,MAAO,8BACP,YAAa,wCACb,KAAM,gEACR,EACIC,GAAmB,CACrB,OAAQ,CAAC,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,KAAK,EACxD,IAAK,CAAC,OAAQ,OAAQ,OAAQ,OAAQ,OAAQ,OAAQ,MAAM,CAC9D,EACIC,GAAyB,CAC3B,OAAQ,mDACR,IAAK,2EACP,EACIC,GAAyB,CAC3B,IAAK,CACH,GAAI,MACJ,GAAI,MACJ,SAAU,OACV,KAAM,OACN,QAAS,UACT,UAAW,SACX,QAAS,SACT,MAAO,QACT,CACF,EACIC,GAAQ,CACV,cAAeC,GAAoB,CACjC,aAAcb,GACd,aAAcC,GACd,cAAe,SAAuBa,EAAO,CAC3C,OAAO,SAASA,EAAO,EAAE,CAC3B,CACF,CAAC,EACD,IAAKC,GAAa,CAChB,cAAeb,GACf,kBAAmB,OACnB,cAAeC,GACf,kBAAmB,KACrB,CAAC,EACD,QAASY,GAAa,CACpB,cAAeX,GACf,kBAAmB,OACnB,cAAeC,GACf,kBAAmB,MACnB,cAAe,SAAuBW,EAAO,CAC3C,OAAOA,EAAQ,CACjB,CACF,CAAC,EACD,MAAOD,GAAa,CAClB,cAAeT,GACf,kBAAmB,OACnB,cAAeC,GACf,kBAAmB,KACrB,CAAC,EACD,IAAKQ,GAAa,CAChB,cAAeP,GACf,kBAAmB,OACnB,cAAeC,GACf,kBAAmB,KACrB,CAAC,EACD,UAAWM,GAAa,CACtB,cAAeL,GACf,kBAAmB,MACnB,cAAeC,GACf,kBAAmB,KACrB,CAAC,CACH,EACOM,GAAQL,GCjFf,IAAIM,GAAS,CACX,KAAM,KACN,eAAgBC,GAChB,WAAYC,GACZ,eAAgBC,GAChB,SAAUC,GACV,MAAOC,GACP,QAAS,CACP,aAAc,EACd,sBAAuB,CACzB,CACF,EACOC,GAAQN,GCzBT,IAAOO,GAAP,cAAmCC,KAAAA,CAOrC,YAAYC,EAAAA,CACRC,MAAM,qBAAA,EAPVC,KAAGC,IAA8B,GACjCD,KAAME,OAA2B,EACjCF,KAAQG,SAAyB,CAAA,EACjCH,KAAOI,QAAAA,GACPJ,KAAaK,cAAoB,KAO7BC,OAAOC,eAAeP,KAAMJ,GAAoBY,SAAAA,EAE5CV,IAAY,MAA2B,OAAZA,GAAY,WACvCE,KAAKC,IAAuC,OAAhBH,EAAQG,KAAQ,SAAWH,EAAQG,IAAM,GACrED,KAAKE,OAA0C,OAAnBJ,EAAQI,QAAW,SAAWJ,EAAQI,OAAS,EAC3EF,KAAKI,QAAAA,CAAAA,CAAkBN,EAAQM,QAC/BJ,KAAKK,cAAgBP,EAAQO,cAEzBP,EAAQK,WAAa,MAAoC,OAArBL,EAAQK,UAAa,SACzDH,KAAKG,SAAYL,EAAQK,SAClBL,EAAQW,OAAS,MAAgC,OAAjBX,EAAQW,MAAS,SACxDT,KAAKG,SAAYL,EAAQW,KAEzBT,KAAKG,SAAY,CAAA,GAIpBH,KAAKK,eAAmBP,aAAmBF,KAC5CI,KAAKK,cAAgBP,GAGG,OAAjBY,aAAiB,KAAeZ,aAAmBY,eAC1DV,KAAKI,QAAAA,IAGTJ,KAAKW,KAAO,uBAAyBX,KAAKE,OAC1CF,KAAKY,QAAUZ,KAAKG,UAAUS,QACzBZ,KAAKY,UACFZ,KAAKI,QACLJ,KAAKY,QAAU,mHACRZ,KAAKK,eAAeQ,OAAOD,SAASE,SAAS,kBAAA,EACpDd,KAAKY,QAAU,qJAEfZ,KAAKY,QAAU,sDAG1B,CAKD,IAAA,MAAIH,CACA,OAAOT,KAAKG,QACf,CAMD,QAAAY,CACI,MAAO,CAAA,GAAKf,IAAAA,CACf,CAAA,ECrDCgB,GAAqB,wCAUX,SAAAC,GAAYC,EAAaC,EAAAA,CACrC,IAAMC,EAAiC,CAAA,EAEvC,GAAmB,OAARF,GAAQ,SACf,OAAOE,EAGX,IACMC,EADSf,OAAOgB,OAAO,CAAA,EAAIH,GAAW,CAAA,CAAA,EACzBE,QAAUE,GAEzBC,EAAQ,EACZ,KAAOA,EAAQN,EAAIO,QAAQ,CACvB,IAAMC,EAAQR,EAAIS,QAAQ,IAAKH,CAAAA,EAG/B,GAAIE,IAAJ,GACI,MAGJ,IAAIE,EAASV,EAAIS,QAAQ,IAAKH,CAAAA,EAE9B,GAAII,IAAJ,GACIA,EAASV,EAAIO,eACNG,EAASF,EAAO,CAEvBF,EAAQN,EAAIW,YAAY,IAAKH,EAAQ,CAAA,EAAK,EAC1C,QACH,CAED,IAAMI,EAAMZ,EAAIa,MAAMP,EAAOE,CAAAA,EAAOM,KAAAA,EAGpC,GAAkBZ,EAAOU,KAAzB,OAA+B,CAC3B,IAAIG,EAAMf,EAAIa,MAAML,EAAQ,EAAGE,CAAAA,EAAQI,KAAAA,EAGnCC,EAAIC,WAAW,CAAA,IAAO,KACtBD,EAAMA,EAAIF,MAAM,EAAA,EAAI,GAGxB,GAAA,CACIX,EAAOU,GAAOT,EAAOY,CAAAA,CACxB,MAAC,CACEb,EAAOU,GAAOG,CACjB,CACJ,CAEDT,EAAQI,EAAS,CACpB,CAED,OAAOR,CACX,CAAA,SAwBgBe,GAAgBxB,EAAcsB,EAAad,EAAAA,CACvD,IAAMiB,EAAS9B,OAAOgB,OAAO,CAAA,EAAIH,GAAW,CAAA,CAAA,EACtCkB,EAASD,EAAIC,QAAUC,GAE7B,GAAA,CAAKtB,GAAmBuB,KAAK5B,CAAAA,EACzB,MAAM,IAAI6B,UAAU,0BAAA,EAGxB,IAAMC,EAAQJ,EAAOJ,CAAAA,EAErB,GAAIQ,GAAAA,CAAUzB,GAAmBuB,KAAKE,CAAAA,EAClC,MAAM,IAAID,UAAU,yBAAA,EAGxB,IAAIpB,EAAST,EAAO,IAAM8B,EAE1B,GAAIL,EAAIM,QAAU,KAAM,CACpB,IAAMA,EAASN,EAAIM,OAAS,EAE5B,GAAIC,MAAMD,CAAAA,GAAAA,CAAYE,SAASF,CAAAA,EAC3B,MAAM,IAAIF,UAAU,0BAAA,EAGxBpB,GAAU,aAAeyB,KAAKC,MAAMJ,CAAAA,CACvC,CAED,GAAIN,EAAIW,OAAQ,CACZ,GAAA,CAAK/B,GAAmBuB,KAAKH,EAAIW,MAAAA,EAC7B,MAAM,IAAIP,UAAU,0BAAA,EAGxBpB,GAAU,YAAcgB,EAAIW,MAC/B,CAED,GAAIX,EAAIY,KAAM,CACV,GAAA,CAAKhC,GAAmBuB,KAAKH,EAAIY,IAAAA,EAC7B,MAAM,IAAIR,UAAU,wBAAA,EAGxBpB,GAAU,UAAYgB,EAAIY,IAC7B,CAED,GAAIZ,EAAIa,QAAS,CACb,GAAA,CA6ER,SAAgBhB,EAAAA,CACZ,OACI3B,OAAOE,UAAU0C,SAASC,KAAKlB,CAAAA,IAAS,iBACxCA,aAAemB,IAEvB,EAlFoBhB,EAAIa,OAAAA,GAAYN,MAAMP,EAAIa,QAAQI,QAAAA,CAAAA,EAC1C,MAAM,IAAIb,UAAU,2BAAA,EAGxBpB,GAAU,aAAegB,EAAIa,QAAQK,YAAAA,CACxC,CAUD,GARIlB,EAAImB,WACJnC,GAAU,cAGVgB,EAAIoB,SACJpC,GAAU,YAGVgB,EAAIqB,SAGJ,OAFyC,OAAjBrB,EAAIqB,UAAa,SAAWrB,EAAIqB,SAASC,YAAAA,EAAgBtB,EAAIqB,SAAAA,CAGjF,IAAK,MACDrC,GAAU,iBACV,MACJ,IAAK,SACDA,GAAU,oBACV,MACJ,IAAK,OACDA,GAAU,kBACV,MACJ,QACI,MAAM,IAAIoB,UAAU,4BAAA,CAAA,CAIhC,GAAIJ,EAAIuB,SAGJ,OAFyC,OAAjBvB,EAAIuB,UAAa,SAAWvB,EAAIuB,SAASD,YAAAA,EAAgBtB,EAAIuB,SAAAA,CAGjF,IAAA,GACIvC,GAAU,oBACV,MACJ,IAAK,MACDA,GAAU,iBACV,MACJ,IAAK,SACDA,GAAU,oBACV,MACJ,IAAK,OACDA,GAAU,kBACV,MACJ,QACI,MAAM,IAAIoB,UAAU,4BAAA,CAAA,CAIhC,OAAOpB,CACX,CAMA,SAASG,GAAcU,EAAAA,CACnB,OAAOA,EAAIN,QAAQ,GAAA,IAAnB,GACMiC,mBAAmB3B,CAAAA,EACnBA,CACV,CAKA,SAASK,GAAcL,EAAAA,CACnB,OAAO4B,mBAAmB5B,CAAAA,CAC9B,CCtNA,IAAI6B,GAyCE,SAAUC,GAAgBC,EAAAA,CAC5B,GAAIA,EACA,GAAA,CACI,IAAMC,EAAiBL,mBAAmBE,GAAaE,EAAME,MAAM,GAAA,EAAK,EAAA,EAAIA,MAAM,EAAA,EAAIC,IAAI,SAAUC,EAAAA,CAChG,MAAO,KAAO,KAAOA,EAAElC,WAAW,CAAA,EAAGgB,SAAS,EAAA,GAAKnB,MAAAA,EAAO,CAC9D,CAAA,EAAGsC,KAAK,EAAA,CAAA,EAER,OAAOC,KAAKC,MAAMN,CAAAA,GAAmB,CAAA,CACxC,MAAC,CACD,CAGL,MAAO,CAAA,CACX,CAAA,SAUgBO,GAAeR,EAAeS,EAAsB,EAAA,CAChE,IAAIC,EAAUX,GAAgBC,CAAAA,EAE9B,MAAA,EACI1D,OAAOqE,KAAKD,CAAAA,EAASjD,OAAS,IAAA,CAC5BiD,EAAQE,KAAQF,EAAQE,IAAMH,EAAwBrB,KAAKyB,IAAAA,EAAQ,KAM7E,CAzEIf,GADgB,OAATgB,MAAS,WACDA,KAMCC,GAAAA,CAGZ,IAAI7D,EAAM8D,OAAOD,CAAAA,EAAOE,QAAQ,MAAO,EAAA,EACvC,GAAI/D,EAAIO,OAAS,GAAK,EAClB,MAAM,IAAI5B,MAAM,mEAAA,EAGpB,QAEgBqF,EAAIC,EAAZC,EAAK,EAAeC,EAAM,EAAGC,EAAS,GAEzCH,EAASjE,EAAIqE,OAAOF,GAAAA,EAAAA,CAEpBF,IACCD,EAAKE,EAAK,EAAkB,GAAbF,EAAkBC,EAASA,EAGxCC,IAAO,GACVE,GAAUN,OAAOQ,aAAa,IAAON,IAAAA,GAAaE,EAAM,EAAA,EACzD,EAGAD,EAtBU,oEAsBKxD,QAAQwD,CAAAA,EAG3B,OAAOG,CAAM,EC3BrB,IAAMG,GAAmB,UAMHC,GANG,KAMHA,CAAtB,aAAAC,CACc3F,KAAS4F,UAAW,GACpB5F,KAAS6F,UAAc,KAEzB7F,KAAkB8F,mBAA6B,CAAA,CAwL1D,CAnLG,IAAA,OAAI9B,CACA,OAAOhE,KAAK4F,SACf,CAKD,IAAA,OAAIG,CACA,OAAO/F,KAAK6F,SACf,CAKD,IAAA,SAAIG,CACA,MAAA,CAAQxB,GAAexE,KAAKgE,KAAAA,CAC/B,CAKD,IAAA,SAAIiC,CACA,OAAOlC,GAAgB/D,KAAKgE,KAAAA,EAAOkC,OAAS,OAC/C,CAKD,IAAA,cAAIC,CACA,OAAOpC,GAAgB/D,KAAKgE,KAAAA,EAAOkC,OAAS,YAC/C,CAKD,KAAKlC,EAAe+B,EAAAA,CAChB/F,KAAK4F,UAAY5B,GAAS,GAC1BhE,KAAK6F,UAAYE,GAAS,KAE1B/F,KAAKoG,cAAAA,CACR,CAKD,OAAAC,CACIrG,KAAK4F,UAAY,GACjB5F,KAAK6F,UAAY,KACjB7F,KAAKoG,cAAAA,CACR,CA0BD,eAAeE,EAAgBxE,EAAM2D,GAAAA,CACjC,IAAMc,EAAUtF,GAAYqF,GAAU,EAAA,EAAIxE,IAAQ,GAE9CrB,EAA+B,CAAA,EACnC,GAAA,CACIA,EAAO6D,KAAKC,MAAMgC,CAAAA,GAEE,OAAT9F,IAAS,MAAwB,OAATA,GAAS,UAAY+F,MAAMC,QAAQhG,CAAAA,KAClEA,EAAO,CAAA,EAEd,MAAC,CAAY,CAEdT,KAAK0G,KAAKjG,EAAKuD,OAAS,GAAIvD,EAAKsF,OAAS,IAAA,CAC7C,CAgBD,eAAe5E,EAA4BW,EAAM2D,GAAAA,CAC7C,IAAMkB,EAAmC,CACrCnD,OAAAA,GACAG,SAAAA,GACAJ,SAAAA,GACAP,KAAU,GAAA,EAIR0B,EAAUX,GAAgB/D,KAAKgE,KAAAA,EAEjC2C,EAAe1D,QADfyB,GAASE,IACgB,IAAIxB,KAAmB,IAAdsB,EAAQE,GAAAA,EAEjB,IAAIxB,KAAK,YAAA,EAItCjC,EAAUb,OAAOgB,OAAO,CAAE,EAAEqF,EAAgBxF,CAAAA,EAE5C,IAAMoF,EAAU,CACZvC,MAAOhE,KAAKgE,MACZ+B,MAAO/F,KAAK+F,MAAQzB,KAAKC,MAAMD,KAAKsC,UAAU5G,KAAK+F,KAAAA,CAAAA,EAAU,IAAA,EAG7D3E,EAASe,GAAgBL,EAAKwC,KAAKsC,UAAUL,CAAAA,EAAUpF,CAAAA,EAErD0F,EAA+B,OAATC,KAAS,IACjC,IAAKA,KAAK,CAAC1F,CAAAA,CAAAA,EAAU2F,KAAO3F,EAAOK,OAGvC,GAAI8E,EAAQR,OAASc,EAAe,KAAM,CACtCN,EAAQR,MAAQ,CAACiB,GAAIT,GAASR,OAAOiB,GAAIC,MAAOV,GAASR,OAAOkB,KAAAA,EAChE,IAAMC,EAAa,CAAC,eAAgB,WAAY,UAAA,EAChD,QAAWC,KAAQnH,KAAK+F,MAChBmB,EAAWpG,SAASqG,CAAAA,IACpBZ,EAAQR,MAAMoB,GAAQnH,KAAK+F,MAAMoB,IAGzC/F,EAASe,GAAgBL,EAAKwC,KAAKsC,UAAUL,CAAAA,EAAUpF,CAAAA,CAC1D,CAED,OAAOC,CACV,CAUD,SAASgG,EAA6BC,EAAAA,GAAkB,CAOpD,OANArH,KAAK8F,mBAAmBwB,KAAKF,CAAAA,EAEzBC,GACAD,EAASpH,KAAKgE,MAAOhE,KAAK+F,KAAAA,EAGvB,IAAA,CACH,QAASwB,EAAIvH,KAAK8F,mBAAmBrE,OAAS,EAAG8F,GAAK,EAAGA,IACrD,GAAIvH,KAAK8F,mBAAmByB,IAAMH,EAG9B,OAAA,OAFOpH,KAAK8F,mBAAmByB,GAAAA,KAC/BvH,KAAK8F,mBAAmB0B,OAAOD,EAAG,CAAA,CAGzC,CAER,CAES,eAAAnB,CACN,QAAWgB,KAAYpH,KAAK8F,mBACxBsB,GAAYA,EAASpH,KAAKgE,MAAOhE,KAAK+F,KAAAA,CAE7C,CAAA,EClMQ0B,GAAP,cAA8B/B,EAAAA,CAIhC,YAAYgC,EAAa,kBAAA,CACrB3H,MAAAA,EAJIC,KAAe2H,gBAA2B,CAAA,EAM9C3H,KAAK0H,WAAaA,EAElB1H,KAAK4H,kBAAAA,CACR,CAKD,IAAA,OAAI5D,CAGA,OAFahE,KAAK6H,YAAY7H,KAAK0H,UAAAA,GAAe,CAAA,GAEtC1D,OAAS,EACxB,CAKD,IAAA,OAAI+B,CAGA,OAFa/F,KAAK6H,YAAY7H,KAAK0H,UAAAA,GAAe,CAAA,GAEtC3B,OAAS,IACxB,CAKD,KAAK/B,EAAe+B,EAAAA,CAChB/F,KAAK8H,YAAY9H,KAAK0H,WAAY,CAC9B1D,MAASA,EACT+B,MAASA,CAAAA,CAAAA,EAGbhG,MAAM2G,KAAK1C,EAAO+B,CAAAA,CACrB,CAKD,OAAAM,CACIrG,KAAK+H,eAAe/H,KAAK0H,UAAAA,EAEzB3H,MAAMsG,MAAAA,CACT,CAUO,YAAYvE,EAAAA,CAChB,GAAsB,OAAXkG,OAAW,KAAeA,QAAQC,aAAc,CACvD,IAAMC,EAAWF,OAAOC,aAAaE,QAAQrG,CAAAA,GAAQ,GACrD,GAAA,CACI,OAAOwC,KAAKC,MAAM2D,CAAAA,CACrB,MAAC,CACE,OAAOA,CACV,CACJ,CAGD,OAAOlI,KAAK2H,gBAAgB7F,EAC/B,CAMO,YAAYA,EAAaW,EAAAA,CAC7B,GAAsB,OAAXuF,OAAW,KAAeA,QAAQC,aAAc,CAEvD,IAAIG,EAAgB3F,EACC,OAAVA,GAAU,WACjB2F,EAAgB9D,KAAKsC,UAAUnE,CAAAA,GAEnCuF,OAAOC,aAAaI,QAAQvG,EAAKsG,CAAAA,CACpC,MAEGpI,KAAK2H,gBAAgB7F,GAAOW,CAEnC,CAKO,eAAeX,EAAAA,CAEG,OAAXkG,OAAW,KAAeA,QAAQC,cACzCD,OAAOC,cAAcK,WAAWxG,CAAAA,EAAAA,OAI7B9B,KAAK2H,gBAAgB7F,EAC/B,CAKO,mBAAA8F,CACkB,OAAXI,OAAW,KAAgBA,QAAQC,cAAiBD,OAAOO,kBAItEP,OAAOO,iBAAiB,UAAYC,GAAAA,CAChC,GAAIA,EAAE1G,KAAO9B,KAAK0H,WACd,OAGJ,IAAMjH,EAAOT,KAAK6H,YAAY7H,KAAK0H,UAAAA,GAAe,CAAA,EAElD3H,MAAM2G,KAAKjG,EAAKuD,OAAS,GAAIvD,EAAKsF,OAAS,IAAA,CAAK,CAAA,CAEvD,CAAA,EC1HiB0C,GD0HjB,KC1HiBA,CAGlB,YAAYC,EAAAA,CACR1I,KAAK0I,OAASA,CACjB,CAAA,ECHQC,GAAP,cAA+BF,EAAAA,CAIjC,OAAOtH,EAAAA,CAKH,OAJAA,EAAUb,OAAOgB,OAAO,CACpBsH,OAAU,KAAA,EACXzH,CAAAA,EAEInB,KAAK0I,OAAOG,KAAK,gBAAiB1H,CAAAA,CAC5C,CAKD,OACI2H,EACA3H,EAAAA,CAOA,OALAA,EAAUb,OAAOgB,OAAO,CACpBsH,OAAU,QACVG,KAAUD,CAAAA,EACX3H,CAAAA,EAEInB,KAAK0I,OAAOG,KAAK,gBAAiB1H,CAAAA,CAC5C,CAOD,OAAO6H,EAAqB,UAAW7H,EAAAA,CAQnC,OAPAA,EAAUb,OAAOgB,OAAO,CACpBsH,OAAU,OACVG,KAAQ,CACJC,WAAcA,CAAAA,CAAAA,EAEnB7H,CAAAA,EAEInB,KAAK0I,OAAOG,KAAK,wBAAyB1H,CAAAA,EAC5C8H,KAAK,IAAA,EAAM,CACnB,CAUD,UAAUC,EAAiBC,EAAuBhI,EAAAA,CAS9C,OARAA,EAAUb,OAAOgB,OAAO,CACpBsH,OAAU,OACVG,KAAQ,CACJ9B,MAAYiC,EACZE,SAAYD,CAAAA,CAAAA,EAEjBhI,CAAAA,EAEInB,KAAK0I,OAAOG,KAAK,2BAA4B1H,CAAAA,EAC/C8H,KAAK,IAAA,EAAM,CACnB,CAKD,0BACII,EACAC,EACAC,EACAC,EACAC,EACAtI,EAAAA,CAaA,OAXAA,EAAUb,OAAOgB,OAAO,CACpBsH,OAAU,OACVG,KAAQ,CACJM,SAAAA,EACAC,OAAAA,EACAC,MAAAA,EACAC,WAAAA,EACAC,SAAAA,CAAAA,CAAAA,EAELtI,CAAAA,EAEInB,KAAK0I,OAAOG,KAAK,6CAA8C1H,CAAAA,CACzE,CAAA,ECtFiBuI,GAAhB,cAAuCjB,EAAAA,CASzC,OAAchI,EAAAA,CACV,OAAOA,CACV,CAeD,YAAmBkJ,EAA6CxI,EAAAA,CAC5D,GAAiC,OAAtBwI,GAAsB,SAC7B,OAAO3J,KAAK4J,aAAgBD,EAAoBxI,CAAAA,EAKpD,IAAI0I,EAAQ,IAMZ,OARA1I,EAAUb,OAAOgB,OAAO,CAAE,EAAEqI,EAAoBxI,CAAAA,GAGpC0I,QACRA,EAAQ1I,EAAQ0I,MAAAA,OACT1I,EAAQ0I,OAGZ7J,KAAK4J,aAAgBC,EAAO1I,CAAAA,CACtC,CAOD,QAAe2I,EAAO,EAAGC,EAAU,GAAI5I,EAAAA,CAUnC,OATAA,EAAUb,OAAOgB,OAAO,CACpBsH,OAAQ,KAAA,EACTzH,CAAAA,GAEK6I,MAAQ1J,OAAOgB,OAAO,CAC1BwI,KAAWA,EACXC,QAAWA,CAAAA,EACZ5I,EAAQ6I,KAAAA,EAEJhK,KAAK0I,OAAOG,KAAK7I,KAAKiK,aAAc9I,CAAAA,EACtC8H,KAAMiB,IACHA,EAAaC,MAAQD,EAAaC,OAAOhG,IAAKiG,GACnCpK,KAAKqB,OAAU+I,CAAAA,CAAAA,GACpB,CAAA,EAECF,EAAAA,CAElB,CAaD,iBAAwBG,EAAgBlJ,EAAAA,CAUpC,OATAA,EAAUb,OAAOgB,OAAO,CACpBgJ,WAAc,iBAAmBtK,KAAKiK,aAAe,IAAMI,CAAAA,EAC5DlJ,CAAAA,GAEK6I,MAAQ1J,OAAOgB,OAAO,CAC1B+I,OAAcA,EACdE,UAAc,CAAA,EACfpJ,EAAQ6I,KAAAA,EAEJhK,KAAKwK,QAAW,EAAG,EAAGrJ,CAAAA,EACxB8H,KAAM7H,GAAAA,CACH,GAAA,CAAKA,GAAQ+I,OAAO1I,OAChB,MAAM,IAAI7B,GAAoB,CAC1BM,OAAQ,IACRO,KAAM,CACFgK,KAAM,IACN7J,QAAS,uCACTH,KAAM,CAAE,CAAA,CAAA,CAAA,EAKpB,OAAOW,EAAO+I,MAAM,EAAE,CAAA,CAEjC,CAOD,OAAcnD,EAAY7F,EAAAA,CAKtB,OAJAA,EAAUb,OAAOgB,OAAO,CACpBsH,OAAU,KAAA,EACXzH,CAAAA,EAEInB,KAAK0I,OAAOG,KAAK7I,KAAKiK,aAAe,IAAMpG,mBAAmBmD,CAAAA,EAAK7F,CAAAA,EACrE8H,KAAMiB,GAAsBlK,KAAKqB,OAAU6I,CAAAA,CAAAA,CACnD,CAOD,OACIpB,EACA3H,EAAAA,CAOA,OALAA,EAAUb,OAAOgB,OAAO,CACpBsH,OAAU,OACVG,KAAUD,CAAAA,EACX3H,CAAAA,EAEInB,KAAK0I,OAAOG,KAAK7I,KAAKiK,aAAc9I,CAAAA,EACtC8H,KAAMiB,GAAsBlK,KAAKqB,OAAU6I,CAAAA,CAAAA,CACnD,CAOD,OACIlD,EACA8B,EACA3H,EAAAA,CAOA,OALAA,EAAUb,OAAOgB,OAAO,CACpBsH,OAAU,QACVG,KAAUD,CAAAA,EACX3H,CAAAA,EAEInB,KAAK0I,OAAOG,KAAK7I,KAAKiK,aAAe,IAAMpG,mBAAmBmD,CAAAA,EAAK7F,CAAAA,EACrE8H,KAAMiB,GAAsBlK,KAAKqB,OAAU6I,CAAAA,CAAAA,CACnD,CAKD,OAAOlD,EAAY7F,EAAAA,CAKf,OAJAA,EAAUb,OAAOgB,OAAO,CACpBsH,OAAU,QAAA,EACXzH,CAAAA,EAEInB,KAAK0I,OAAOG,KAAK7I,KAAKiK,aAAe,IAAMpG,mBAAmBmD,CAAAA,EAAK7F,CAAAA,EACrE8H,KAAK,IAAA,EAAM,CACnB,CAKS,aAAoByB,EAAY,IAAKvJ,EAAAA,EAC3CA,EAAUA,GAAW,CAAA,GACb6I,MAAQ1J,OAAOgB,OAAO,CAC1BiJ,UAAa,CAAA,EACdpJ,EAAQ6I,KAAAA,EAEX,IAAI5I,EAAmB,CAAA,EAEnBuJ,EAAUC,MAAOd,GACV9J,KAAKwK,QAAQV,EAAMY,GAAa,IAAKvJ,CAAAA,EAAS8H,KAAM4B,GAAAA,CACvD,IACMV,EADcU,EACUV,MAI9B,OAFA/I,EAASA,EAAO0J,OAAOX,CAAAA,EAEnBA,EAAM1I,QAAUoJ,EAAKd,QACdY,EAAQb,EAAO,CAAA,EAGnB1I,CAAM,CAAA,EAIrB,OAAOuJ,EAAQ,CAAA,CAClB,CAAA,EC1MC,SAAUI,GAA2BC,EAAoBC,EAA0BC,EAAqBlB,EAAAA,CAC1G,IACMmB,EAAkBnB,IAAlBmB,OAEN,OAAKA,GAH2BD,IAG3BC,OAIDA,GACAC,QAAQC,KAAKL,CAAAA,EACbC,EAAYlC,KAAOzI,OAAOgB,OAAO,CAAE,EAAE2J,EAAYlC,KAAMmC,CAAAA,EACvDD,EAAYjB,MAAQ1J,OAAOgB,OAAO,CAAE,EAAE2J,EAAYjB,MAAOA,CAAAA,EAElDiB,GAGJ3K,OAAOgB,OAAO2J,EAAaC,CAAAA,EAXvBD,CAYf,CCfM,SAAUK,GAAiB5C,EAAAA,CAC5BA,EAAe6C,oBAAAA,CACpB,CCOM,IAAOC,GAAP,cAA4B9B,EAAAA,CAI9B,IAAA,cAAIO,CACA,MAAO,aACV,CAYD,OACIjD,EACA8B,EACA3H,EAAAA,CAEA,OAAOpB,MAAM0L,OAAOzE,EAAI8B,EAAY3H,CAAAA,EAAS8H,KAAMmB,IAG3CpK,KAAK0I,OAAOgD,UAAU3F,OAAOiB,KAAOoD,EAAKpD,IAClChH,KAAK0I,OAAOgD,UAAU3F,OAAO4F,eADK3E,QAGzChH,KAAK0I,OAAOgD,UAAUhF,KAAK1G,KAAK0I,OAAOgD,UAAU1H,MAAOoG,CAAAA,EAGrDA,EAAAA,CAEd,CAQD,OAAOpD,EAAY7F,EAAAA,CACf,OAAOpB,MAAM6L,OAAO5E,EAAI7F,CAAAA,EAAS8H,KAAM4C,IAG/BA,GACA7L,KAAK0I,OAAOgD,UAAU3F,OAAOiB,KAAOA,GAC7BhH,KAAK0I,OAAOgD,UAAU3F,OAAO4F,eADA3E,QAGpChH,KAAK0I,OAAOgD,UAAUrF,MAAAA,EAGnBwF,EAAAA,CAEd,CASS,aAAa3B,EAAAA,CACnB,IAAM4B,EAAQ9L,KAAKqB,OAAO6I,GAAc4B,OAAS,CAAA,CAAA,EAMjD,OAJI5B,GAAclG,OAASkG,GAAc4B,OACrC9L,KAAK0I,OAAOgD,UAAUhF,KAAKwD,EAAalG,MAAO8H,CAAAA,EAG5CxL,OAAOgB,OAAO,CAAE,EAAE4I,EAAc,CAEnClG,MAASkG,GAAclG,OAAS,GAChC8H,MAASA,CAAAA,CAAAA,CAEhB,CAgBD,MAAA,iBACI7E,EACA8E,EACAb,EACAlB,EAAAA,CAEA,IAAI7I,EAAe,CACfyH,OAAU,OACVG,KAAQ,CACJiD,SAAY/E,EACZ8E,SAAYA,CAAAA,CAAAA,EAIpB5K,EAAU4J,GACN,+IACA5J,EACA+J,EACAlB,CAAAA,EAGJ,IAAMiC,EAAuB9K,EAAQ8K,qBAAAA,OAC9B9K,EAAQ8K,qBAGV9K,EAAQ+K,aACTZ,GAAiBtL,KAAK0I,MAAAA,EAG1B,IAAIyD,EAAAA,MAAiBnM,KAAK0I,OAAOG,KAAK7I,KAAKiK,aAAe,sBAAuB9I,CAAAA,EAajF,OAXAgL,EAAWnM,KAAKoM,aAAaD,CAAAA,EAEzBF,GDlIN,SACJvD,EACA2D,EACAC,EACAC,EAAAA,CAEEjB,GAAiB5C,CAAAA,EAEjB,IAAM8D,EAAgB9D,EAAO+D,WACvBC,EAAWhE,EAAOgD,UAAU3F,MAI5B4G,EAAmBjE,EAAOgD,UAAUkB,SAAS,CAACC,EAAU9G,IAAAA,EAAAA,CAErD8G,GACD9G,GAAOiB,IAAM0F,GAAU1F,KAErBjB,GAAO4F,cAAgBe,GAAUf,eAAiB5F,GAAO4F,cAAgBe,GAAUf,eAErFL,GAAiB5C,CAAAA,CACpB,CAAA,EAIJA,EAAe6C,kBAAoB,UAAA,CAChCoB,EAAAA,EACAjE,EAAO+D,WAAaD,EAAAA,OACZ9D,EAAe6C,iBAC3B,EAEA7C,EAAO+D,WAAa7B,MAAO3K,EAAK6M,IAAAA,CAC5B,IAAMC,EAAWrE,EAAOgD,UAAU1H,MAElC,GAAI8I,EAAY9C,OAAOkC,YACnB,OAAOM,EAAgBA,EAAcvM,EAAK6M,CAAAA,EAAe,CAAE7M,IAAAA,EAAK6M,YAAAA,CAAAA,EAGpE,IAAI9G,EAAU0C,EAAOgD,UAAU1F,QAC/B,GAEIA,GAEAxB,GAAekE,EAAOgD,UAAU1H,MAAOqI,CAAAA,EAEvC,GAAA,CAAA,MACUC,EAAAA,CACT,MAAC,CACEtG,EAAAA,EACH,CAIAA,GAAAA,MACKuG,EAAAA,EAIV,IAAMS,EAAUF,EAAYE,SAAW,CAAA,EACvC,QAASlL,MAAOkL,EACZ,GACIlL,GAAI4B,YAAAA,GAAiB,iBAErBqJ,GAAYC,EAAQlL,KACpB4G,EAAOgD,UAAU1H,MACnB,CAEEgJ,EAAQlL,IAAO4G,EAAOgD,UAAU1H,MAChC,KACH,CAIL,OAFA8I,EAAYE,QAAUA,EAEfR,EAAgBA,EAAcvM,EAAK6M,CAAAA,EAAe,CAAE7M,IAAAA,EAAK6M,YAAAA,CAAAA,CAAa,CAErF,ECyDgB9M,KAAK0I,OACLuD,EACA,IAAMjM,KAAKiN,YAAY,CAACf,YAAAA,EAAa,CAAA,EACrC,IAAMlM,KAAKkN,iBAAiBjG,EAAO8E,EAAUzL,OAAOgB,OAAO,CAAC4K,YAAAA,EAAa,EAAO/K,CAAAA,CAAAA,CAAAA,EAIjFgL,CACV,CAgBD,YAAYjB,EAAqBlB,EAAAA,CAC7B,IAAI7I,EAAe,CACfyH,OAAU,MAAA,EAUd,OAPAzH,EAAU4J,GACN,2GACA5J,EACA+J,EACAlB,CAAAA,EAGGhK,KAAK0I,OAAOG,KAAK7I,KAAKiK,aAAe,gBAAiB9I,CAAAA,EACxD8H,KAAKjJ,KAAKoM,aAAae,KAAKnN,IAAAA,CAAAA,CACpC,CAaD,qBAAqBiH,EAAeiE,EAAqBlB,EAAAA,CACrD,IAAI7I,EAAe,CACfyH,OAAU,OACVG,KAAQ,CACJ9B,MAASA,CAAAA,CAAAA,EAWjB,OAPA9F,EAAU4J,GACN,2IACA5J,EACA+J,EACAlB,CAAAA,EAGGhK,KAAK0I,OAAOG,KAAK7I,KAAKiK,aAAe,0BAA2B9I,CAAAA,EAClE8H,KAAK,IAAA,EAAM,CACnB,CAaD,qBAAqBmE,EAAoBrB,EAAkBsB,EAAyBnC,EAAqBlB,EAAAA,CACrG,IAAI7I,EAAe,CACfyH,OAAU,OACVG,KAAQ,CACJ/E,MAAmBoJ,EACnBrB,SAAmBA,EACnBsB,gBAAmBA,CAAAA,CAAAA,EAW3B,OAPAlM,EAAU4J,GACN,2MACA5J,EACA+J,EACAlB,CAAAA,EAGGhK,KAAK0I,OAAOG,KAAK7I,KAAKiK,aAAe,0BAA2B9I,CAAAA,EAClE8H,KAAK,IAAA,EAAM,CACnB,CAAA,ECtOQqE,GAAP,cAA+B7E,EAAAA,CAArC,aAAA9C,CAAAA,MAAAA,GAAAA,SAAAA,EACI3F,KAAQqJ,SAAW,GAEXrJ,KAAWuN,YAAuB,KAClCvN,KAAawN,cAA4C,CAAA,EACzDxN,KAAcyN,eAAkB,CAAA,EAEhCzN,KAAiB0N,kBAAW,KAE5B1N,KAAiB2N,kBAAW,EAC5B3N,KAAoB4N,qBAAWC,EAAAA,EAC/B7N,KAAA8N,6BAA8C,CAClD,IAAK,IAAK,IAAK,IAAM,KAAM,KAAM,GAAA,EAE7B9N,KAAe+N,gBAA4B,CAAA,CAkYtD,CA7XG,IAAA,aAAIC,CACA,MAAA,CAAA,CAAShO,KAAKuN,aAAAA,CAAAA,CAAiBvN,KAAKqJ,UAAAA,CAAarJ,KAAK+N,gBAAgBtM,MACzE,CAUD,MAAA,UAAgBwM,EAAe7G,EAAAA,CAC3B,GAAA,CAAK6G,EACD,MAAM,IAAIpO,MAAM,oBAAA,EAGpB,IAAMqO,EAAW,SAAU1F,EAAAA,CACvB,IAAM2F,EAAY3F,EAEd/H,EACJ,GAAA,CACIA,EAAO6D,KAAKC,MAAM4J,GAAU1N,IAAAA,CAC/B,MAAC,CAAQ,CAEV2G,EAAS3G,GAAQ,CAAA,CAAA,CACrB,EAmBA,OAhBKT,KAAKwN,cAAcS,KACpBjO,KAAKwN,cAAcS,GAAS,CAAA,GAEhCjO,KAAKwN,cAAcS,GAAO3G,KAAK4G,CAAAA,EAE1BlO,KAAKgO,YAGChO,KAAKwN,cAAcS,GAAOxM,SAAW,EAAXA,MAE3BzB,KAAKoO,oBAAAA,EAGXpO,KAAKuN,aAAahF,iBAAiB0F,EAAOC,CAAAA,EAAAA,MANpClO,KAAKqO,QAAAA,EASRzD,SACI5K,KAAKsO,8BAA8BL,EAAOC,CAAAA,CAExD,CAaD,MAAA,YAAkBD,EAAAA,CACd,GAAKjO,KAAKuO,yBAAyBN,CAAAA,EAAnC,CAIA,GAAKA,EAGE,CAEH,QAASC,KAAYlO,KAAKwN,cAAcS,GACpCjO,KAAKuN,aAAaiB,oBAAoBP,EAAOC,CAAAA,EAAAA,OAE1ClO,KAAKwN,cAAcS,EAC7B,MAPGjO,KAAKwN,cAAgB,CAAA,EASpBxN,KAAKuO,yBAAAA,EAGEvO,KAAKuO,yBAAyBN,CAAAA,GAAAA,MAEhCjO,KAAKoO,oBAAAA,EAHXpO,KAAKyO,WAAAA,CAfR,CAoBJ,CAUD,MAAA,oBAA0BC,EAAAA,CACtB,IAAIC,EAAAA,GACJ,QAASV,KAASjO,KAAKwN,cACnB,GAAKS,EAAMW,WAAWF,CAAAA,EAAtB,CAIAC,EAAAA,GACA,QAAST,KAAYlO,KAAKwN,cAAcS,GACpCjO,KAAKuN,aAAaiB,oBAAoBP,EAAOC,CAAAA,EAAAA,OAE1ClO,KAAKwN,cAAcS,EANzB,CASAU,IAID3O,KAAKuO,yBAAAA,EAAAA,MAECvO,KAAKoO,oBAAAA,EAGXpO,KAAKyO,WAAAA,EAEZ,CAWD,MAAA,8BAAoCR,EAAeC,EAAAA,CAC/C,GAAA,CAAK1H,MAAMC,QAAQzG,KAAKwN,cAAcS,EAAAA,GAAAA,CAAYjO,KAAKwN,cAAcS,GAAOxM,OACxE,OAGJ,IAAIoN,EAAAA,GACJ,QAAStH,EAAIvH,KAAKwN,cAAcS,GAAOxM,OAAS,EAAG8F,GAAK,EAAGA,IACnDvH,KAAKwN,cAAcS,GAAO1G,KAAO2G,IAIrCW,EAAAA,GAAQ,OACD7O,KAAKwN,cAAcS,GAAO1G,GACjCvH,KAAKwN,cAAcS,GAAOzG,OAAOD,EAAG,CAAA,EACpCvH,KAAKuN,aAAaiB,oBAAoBP,EAAOC,CAAAA,GAE5CW,IAKA7O,KAAKwN,cAAcS,GAAOxM,QAAAA,OACpBzB,KAAKwN,cAAcS,GAGzBjO,KAAKuO,yBAAAA,EAGEvO,KAAKuO,yBAAyBN,CAAAA,GAAAA,MAEhCjO,KAAKoO,oBAAAA,EAHXpO,KAAKyO,WAAAA,EAKZ,CAEO,yBAAyBK,EAAAA,CAI7B,GAHA9O,KAAKwN,cAAgBxN,KAAKwN,eAAiB,CAAA,EAGvCsB,EACA,MAAA,CAAA,CAAS9O,KAAKwN,cAAcsB,IAAerN,OAI/C,QAASwM,KAASjO,KAAKwN,cACnB,GAAMxN,KAAKwN,cAAcS,IAAQxM,OAC7B,MAAA,GAIR,MAAA,EACH,CAEO,MAAA,qBAAM2M,CACV,GAAKpO,KAAKqJ,SASV,OAJArJ,KAAK+O,4BAAAA,EAEL/O,KAAKyN,eAAiBzN,KAAKgP,8BAAAA,EAEpBhP,KAAK0I,OAAOG,KAAK,gBAAiB,CACrCD,OAAQ,OACRG,KAAM,CACFM,SAAYrJ,KAAKqJ,SACjBmE,cAAiBxN,KAAKyN,cAAAA,EAE1BnD,WAAYtK,KAAKiP,0BAAAA,CAAAA,CAAAA,EAClBC,MAAOC,GAAAA,CACN,GAAA,CAAIA,GAAK/O,QAGT,MAAM+O,CAAG,CAAA,CAEhB,CAEO,2BAAAF,CACJ,MAAO,YAAcjP,KAAKqJ,QAC7B,CAEO,+BAAA2F,CACJ,IAAM5N,EAAyB,CAAA,EAE/B,QAAS6M,KAASjO,KAAKwN,cACfxN,KAAKwN,cAAcS,GAAOxM,QAC1BL,EAAOkG,KAAK2G,CAAAA,EAIpB,OAAO7M,CACV,CAEO,6BAAA2N,CACJ,GAAK/O,KAAKuN,YAAV,CAIAvN,KAAKoP,+BAAAA,EAEL,QAASnB,KAASjO,KAAKwN,cACnB,QAASU,KAAYlO,KAAKwN,cAAcS,GACpCjO,KAAKuN,YAAYhF,iBAAiB0F,EAAOC,CAAAA,CANhD,CASJ,CAEO,gCAAAkB,CACJ,GAAKpP,KAAKuN,YAIV,QAASU,KAASjO,KAAKwN,cACnB,QAASU,KAAYlO,KAAKwN,cAAcS,GACpCjO,KAAKuN,YAAYiB,oBAAoBP,EAAOC,CAAAA,CAGvD,CAEO,MAAA,SAAMG,CACV,GAAA,EAAIrO,KAAK2N,kBAAoB,GAM7B,OAAO,IAAI0B,QAAQ,CAACC,EAASC,IAAAA,CACzBvP,KAAK+N,gBAAgBzG,KAAK,CAAEgI,QAAAA,EAASC,OAAAA,CAAAA,CAAAA,EAEjCvP,KAAK+N,gBAAgBtM,OAAS,GAKlCzB,KAAKwP,YAAAA,CAAa,CAAA,CAEzB,CAEO,aAAAA,CACJxP,KAAKyO,WAAAA,EAAW,EAGhBgB,aAAazP,KAAK0P,gBAAAA,EAClB1P,KAAK0P,iBAAmBC,WAAW,IAAA,CAC/B3P,KAAK4P,oBAAoB,IAAI/P,MAAM,oCAAA,CAAA,CAAsC,EAC1EG,KAAK0N,iBAAAA,EAER1N,KAAKuN,YAAc,IAAIsC,YAAY7P,KAAK0I,OAAOoH,SAAS,eAAA,CAAA,EAExD9P,KAAKuN,YAAYwC,QAAWC,GAAAA,CACxBhQ,KAAK4P,oBAAoB,IAAI/P,MAAM,0CAAA,CAAA,CAA4C,EAGnFG,KAAKuN,YAAYhF,iBAAiB,aAAeC,GAAAA,CAC7C,IAAM2F,EAAY3F,EAClBxI,KAAKqJ,SAAW8E,GAAU8B,YAE1BjQ,KAAKoO,oBAAAA,EACJnF,KAAK2B,SAAAA,CACF,IAAIsF,EAAU,EACd,KAAOlQ,KAAKmQ,uBAAAA,GAA4BD,EAAU,GAC9CA,IAAAA,MAMMlQ,KAAKoO,oBAAAA,CACd,CAAA,EACFnF,KAAK,IAAA,CACJ,QAASmH,KAAKpQ,KAAK+N,gBACfqC,EAAEd,QAAAA,EAINtP,KAAK+N,gBAAkB,CAAA,EACvB/N,KAAK2N,kBAAoB,EACzB8B,aAAazP,KAAKqQ,kBAAAA,EAClBZ,aAAazP,KAAK0P,gBAAAA,CAAiB,CAAA,EACpCR,MAAOC,GAAAA,CACNnP,KAAKqJ,SAAW,GAChBrJ,KAAK4P,oBAAoBT,CAAAA,CAAI,CAAA,CAC/B,CAAA,CAET,CAEO,wBAAAgB,CACJ,IAAMG,EAAetQ,KAAKgP,8BAAAA,EAC1B,GAAIsB,EAAa7O,QAAUzB,KAAKyN,eAAehM,OAC3C,MAAA,GAGJ,QAAW8O,KAAKD,EACZ,GAAA,CAAKtQ,KAAKyN,eAAe3M,SAASyP,CAAAA,EAC9B,MAAA,GAIR,MAAA,EACH,CAEO,oBAAoBpB,EAAAA,CAIxB,GAHAM,aAAazP,KAAK0P,gBAAAA,EAClBD,aAAazP,KAAKqQ,kBAAAA,EAAAA,CAIZrQ,KAAKqJ,UAAAA,CAAarJ,KAAK2N,mBAEzB3N,KAAK2N,kBAAoB3N,KAAK4N,qBAChC,CACE,QAASwC,KAAKpQ,KAAK+N,gBACfqC,EAAEb,OAAO,IAAI3P,GAAoBuP,CAAAA,CAAAA,EAIrC,OAFAnP,KAAK+N,gBAAkB,CAAA,EAAA,KACvB/N,KAAKyO,WAAAA,CAER,CAGDzO,KAAKyO,WAAAA,EAAW,EAChB,IAAM+B,EAAUxQ,KAAK8N,6BAA6B9N,KAAK2N,oBAAsB3N,KAAK8N,6BAA6B9N,KAAK8N,6BAA6BrM,OAAS,GAC1JzB,KAAK2N,oBACL3N,KAAKqQ,mBAAqBV,WAAW,IAAA,CACjC3P,KAAKwP,YAAAA,CAAa,EACnBgB,CAAAA,CACN,CAEO,WAAWC,EAAAA,GAAgB,CAS/B,GARAhB,aAAazP,KAAK0P,gBAAAA,EAClBD,aAAazP,KAAKqQ,kBAAAA,EAClBrQ,KAAKoP,+BAAAA,EACLpP,KAAK0I,OAAOgI,cAAc1Q,KAAKiP,0BAAAA,CAAAA,EAC/BjP,KAAKuN,aAAaoD,MAAAA,EAClB3Q,KAAKuN,YAAc,KACnBvN,KAAKqJ,SAAW,GAAA,CAEXoH,EAAe,CAChBzQ,KAAK2N,kBAAoB,EAOzB,QAASyC,KAAKpQ,KAAK+N,gBACfqC,EAAEd,QAAAA,EAENtP,KAAK+N,gBAAkB,CAAA,CAC1B,CACJ,CAAA,EChVQ6C,GAAP,cAA8ClH,EAAAA,CAGhD,YAAYhB,EAAgBmI,EAAAA,CACxB9Q,MAAM2I,CAAAA,EAEN1I,KAAK6Q,mBAAqBA,CAC7B,CAKD,IAAA,cAAI5G,CACA,OAAOjK,KAAK8Q,mBAAqB,UACpC,CAKD,IAAA,oBAAIA,CACA,MAAO,oBAAsBjN,mBAAmB7D,KAAK6Q,kBAAAA,CACxD,CAWD,MAAA,aAA0BE,EAAkB3J,EAAAA,CAExC,OADAgE,QAAQC,KAAK,mHAAA,EACNrL,KAAK0I,OAAOsI,SAASC,UAAUjR,KAAK6Q,mBAAqB,IAAME,EAAU3J,CAAAA,CACnF,CAsBD,MAAA,UACI8J,EACA9J,EAAAA,CAEA,GAA+B,OAApB8J,GAAoB,WAE3B,OADA9F,QAAQC,KAAK,iGAAA,EACNrL,KAAK0I,OAAOsI,SAASC,UAAUjR,KAAK6Q,mBAAoBK,CAAAA,EAGnE,GAAA,CAAK9J,EACD,MAAM,IAAIvH,MAAM,gCAAA,EAGpB,GAAIqR,IAAoB,GACpB,MAAM,IAAIrR,MAAM,gBAAA,EAGpB,IAAIoO,EAAQjO,KAAK6Q,mBAKjB,OAJIK,IAAoB,MACpBjD,GAAU,IAAMiD,GAGblR,KAAK0I,OAAOsI,SAASC,UAAUhD,EAAO7G,CAAAA,CAChD,CASD,MAAA,YAAkB6G,EAAAA,CAEd,OAAIA,IAAU,IACHjO,KAAK0I,OAAOsI,SAASG,YAAYnR,KAAK6Q,kBAAAA,EAI7C5C,EACOjO,KAAK0I,OAAOsI,SAASG,YAAYnR,KAAK6Q,mBAAqB,IAAM5C,CAAAA,EAIrEjO,KAAK0I,OAAOsI,SAASI,oBAAoBpR,KAAK6Q,kBAAAA,CACxD,CAkBD,YAAmBQ,EAA+ClQ,EAAAA,CAC9D,GAA6B,OAAlBkQ,GAAkB,SACzB,OAAOtR,MAAMuR,YAAeD,EAAgBlQ,CAAAA,EAGhD,IAAMoQ,EAASjR,OAAOgB,OAAO,CAAA,EAAI+P,EAAgBlQ,CAAAA,EAEjD,OAAOpB,MAAMuR,YAAeC,CAAAA,CAC/B,CAKD,QAAezH,EAAO,EAAGC,EAAU,GAAI5I,EAAAA,CACnC,OAAOpB,MAAMyK,QAAWV,EAAMC,EAAS5I,CAAAA,CAC1C,CAKD,iBAAwBkJ,EAAgBlJ,EAAAA,CACpC,OAAOpB,MAAMyR,iBAAoBnH,EAAQlJ,CAAAA,CAC5C,CAKD,OAAc6F,EAAY7F,EAAAA,CACtB,OAAOpB,MAAM0R,OAAUzK,EAAI7F,CAAAA,CAC9B,CAKD,OAAc2H,EAA0C3H,EAAAA,CACpD,OAAOpB,MAAM2R,OAAU5I,EAAY3H,CAAAA,CACtC,CAQD,OAAc6F,EAAY8B,EAA0C3H,EAAAA,CAChE,OAAOpB,MAAM0L,OAAoBzE,EAAI8B,EAAY3H,CAAAA,EAAS8H,KAAMmB,IAGxDpK,KAAK0I,OAAOgD,UAAU3F,OAAOiB,KAAOoD,GAAMpD,IAEtChH,KAAK0I,OAAOgD,UAAU3F,OAAO4F,eAAiB3L,KAAK6Q,oBACnD7Q,KAAK0I,OAAOgD,UAAU3F,OAAO4L,iBAAmB3R,KAAK6Q,oBAGzD7Q,KAAK0I,OAAOgD,UAAUhF,KAAK1G,KAAK0I,OAAOgD,UAAU1H,MAAOoG,CAAAA,EAGrDA,EAAAA,CAEd,CAQD,OAAOpD,EAAY7F,EAAAA,CACf,OAAOpB,MAAM6L,OAAO5E,EAAI7F,CAAAA,EAAS8H,KAAM4C,IAAAA,CAE/BA,GAEA7L,KAAK0I,OAAOgD,UAAU3F,OAAOiB,KAAOA,GAEhChH,KAAK0I,OAAOgD,UAAU3F,OAAO4F,eAAiB3L,KAAK6Q,oBACnD7Q,KAAK0I,OAAOgD,UAAU3F,OAAO4L,iBAAmB3R,KAAK6Q,oBAGzD7Q,KAAK0I,OAAOgD,UAAUrF,MAAAA,EAGnBwF,EAAAA,CAEd,CASS,aAAoB3B,EAAAA,CAC1B,IAAM0H,EAAS5R,KAAKqB,OAAO6I,GAAc0H,QAAU,CAAA,CAAA,EAInD,OAFA5R,KAAK0I,OAAOgD,UAAUhF,KAAKwD,GAAclG,MAAO4N,CAAAA,EAEzCtR,OAAOgB,OAAO,CAAE,EAAE4I,EAAc,CAEnClG,MAAUkG,GAAclG,OAAS,GACjC4N,OAAUA,CAAAA,CAAAA,CAEjB,CAKD,gBAAgBzQ,EAAAA,CAKZ,OAJAA,EAAUb,OAAOgB,OAAO,CACpBsH,OAAU,KAAA,EACXzH,CAAAA,EAEInB,KAAK0I,OAAOG,KAAK7I,KAAK8Q,mBAAqB,gBAAiB3P,CAAAA,EAC9D8H,KAAMiB,GACI5J,OAAOgB,OAAO,CAAE,EAAE4I,EAAc,CAEnC2H,iBAAAA,CAAAA,CAAsB3H,GAAc2H,iBACpCC,cAAAA,CAAAA,CAAsB5H,GAAc4H,cACpCC,cAAoBvL,MAAMC,QAAQyD,GAAc6H,aAAAA,EAAiB7H,GAAc6H,cAAgB,CAAA,CAAA,CAAA,CAAA,CAG9G,CAkBD,iBAAwBC,EAAyBjG,EAAkBb,EAAqBlB,EAAAA,CACpF,IAAI7I,EAAe,CACfyH,OAAU,OACVG,KAAQ,CACJiD,SAAYgG,EACZjG,SAAYA,CAAAA,CAAAA,EAWpB,OAPA5K,EAAU4J,GACN,mKACA5J,EACA+J,EACAlB,CAAAA,EAGGhK,KAAK0I,OAAOG,KAAK7I,KAAK8Q,mBAAqB,sBAAuB3P,CAAAA,EACpE8H,KAAMxI,GAAST,KAAKoM,aAAgB3L,CAAAA,CAAAA,CAC5C,CAoCD,mBACIwR,EACAxH,EACAyH,EACAC,EACAC,EACAlH,EACAlB,EAAAA,CAEA,IAAI7I,EAAe,CACfyH,OAAU,OACVG,KAAQ,CACJkJ,SAAgBA,EAChBxH,KAAgBA,EAChByH,aAAgBA,EAChBC,YAAgBA,EAChBC,WAAgBA,CAAAA,CAAAA,EAWxB,OAPAjR,EAAU4J,GACN,yOACA5J,EACA+J,EACAlB,CAAAA,EAGGhK,KAAK0I,OAAOG,KAAK7I,KAAK8Q,mBAAqB,oBAAqB3P,CAAAA,EAClE8H,KAAMxI,GAAST,KAAKoM,aAAgB3L,CAAAA,CAAAA,CAC5C,CAmDD,MAAA,kBAA+B4R,EAAAA,CAE3B,GAAIA,EAAK5Q,OAAS,GAA0B,OAAd4Q,IAAO,IAAO,SAExC,OADAjH,QAAQC,KAAK,0PAAA,EACNrL,KAAKsS,mBACRD,IAAO,IAAM,GACbA,IAAO,IAAM,GACbA,IAAO,IAAM,GACbA,IAAO,IAAM,GACbA,IAAO,IAAM,CAAA,EACbA,IAAO,IAAM,CAAA,EACbA,IAAO,IAAM,CAAE,CAAA,EAIvB,IAAME,EAASF,IAAO,IAAM,CAAA,EAItBJ,GAAAA,MAFoBjS,KAAKwS,gBAAAA,GAEFT,cAAcU,KAAMrC,GAAMA,EAAEzP,OAAS4R,EAAON,QAAAA,EACzE,GAAA,CAAKA,EACD,MAAM,IAAIrS,GAAoB,IAAIC,MAAM,gCAAgC0S,EAAON,YAAAA,CAAAA,EAGnF,IAAME,EAAcnS,KAAK0I,OAAOoH,SAAS,sBAAA,EAGnCkB,EAAW,IAAI1D,GAAgBtN,KAAK0I,MAAAA,EAMtCgK,EAAiC,KAKrC,SAASC,GAAAA,CACLD,GAAmB/B,MAAAA,EACnBK,EAASG,YAAAA,CACZ,CAED,OATKoB,EAAOK,cACRF,EAAoBG,GAAAA,MAAiBC,GAQlC,IAAIzD,QAAQzE,MAAO0E,EAASC,IAAAA,CAC/B,GAAA,CAAA,MACUyB,EAASC,UAAU,UAAWrG,MAAOpC,GAAAA,CACvC,IAAMuK,EAAW/B,EAAS3H,SAE1B,GAAA,CACI,GAAA,CAAKb,EAAEwK,OAASD,IAAavK,EAAEwK,MAC3B,MAAM,IAAInT,MAAM,+BAAA,EAIpB,IAAMsB,EAAUb,OAAOgB,OAAO,CAAE,EAAEiR,CAAAA,EAAAA,OAC3BpR,EAAQ8Q,SAAAA,OACR9Q,EAAQ8R,OAAAA,OACR9R,EAAQiR,WAAAA,OACRjR,EAAQyR,YAEf,IAAMzG,EAAAA,MAAiBnM,KAAKsS,mBACxBL,EAAStR,KACT6H,EAAEiC,KACFwH,EAASC,aACTC,EACAI,EAAOH,WACPjR,CAAAA,EAGJmO,EAAQnD,CAAAA,CACX,OAAQgD,EAAP,CACEI,EAAO,IAAI3P,GAAoBuP,CAAAA,CAAAA,CAClC,CAEDwD,EAAAA,CAAS,CAAA,EAGb,IAAMO,EAAqC,CACvCF,MAAShC,EAAS3H,QAAAA,EAElBkJ,EAAOU,QAAQxR,SACfyR,EAAoB,MAAIX,EAAOU,OAAO5O,KAAK,GAAA,GAG/C,IAAMpE,EAAMD,KAAKmT,oBAAoBlB,EAASmB,QAAUjB,EAAae,CAAAA,EAUrE,MARkBX,EAAOK,aAAe,SAAU3S,EAAAA,CAC1CyS,EACDA,EAAkBW,SAASC,KAAOrT,EAIjCyS,EAAoBG,GAAiB5S,CAAAA,CAE7C,GAEkBA,CAAAA,CACrB,OAAQkP,EAAP,CACEwD,EAAAA,EACApD,EAAO,IAAI3P,GAAoBuP,CAAAA,CAAAA,CAClC,CAAA,CAAA,CAER,CAgBD,YAAmBjE,EAAqBlB,EAAAA,CACpC,IAAI7I,EAAe,CACfyH,OAAU,MAAA,EAUd,OAPAzH,EAAU4J,GACN,2GACA5J,EACA+J,EACAlB,CAAAA,EAGGhK,KAAK0I,OAAOG,KAAK7I,KAAK8Q,mBAAqB,gBAAiB3P,CAAAA,EAC9D8H,KAAMxI,GAAST,KAAKoM,aAAgB3L,CAAAA,CAAAA,CAC5C,CAaD,qBAAqBwG,EAAeiE,EAAqBlB,EAAAA,CACrD,IAAI7I,EAAe,CACfyH,OAAU,OACVG,KAAQ,CACJ9B,MAASA,CAAAA,CAAAA,EAWjB,OAPA9F,EAAU4J,GACN,2IACA5J,EACA+J,EACAlB,CAAAA,EAGGhK,KAAK0I,OAAOG,KAAK7I,KAAK8Q,mBAAqB,0BAA2B3P,CAAAA,EAAS8H,KAAK,IAAA,EAAM,CACpG,CAwBD,qBACIsK,EACAxH,EACAsB,EACAnC,EACAlB,EAAAA,CAEA,IAAI7I,EAAe,CACfyH,OAAU,OACVG,KAAQ,CACJ/E,MAAmBuP,EACnBxH,SAAmBA,EACnBsB,gBAAmBA,CAAAA,CAAAA,EAW3B,OAPAlM,EAAU4J,GACN,iMACA5J,EACA+J,EACAlB,CAAAA,EAGGhK,KAAK0I,OAAOG,KAAK7I,KAAK8Q,mBAAqB,0BAA2B3P,CAAAA,EACxE8H,KAAK,IAAA,EAAM,CACnB,CAaD,oBAAoBhC,EAAeiE,EAAqBlB,EAAAA,CACpD,IAAI7I,EAAe,CACfyH,OAAU,OACVG,KAAQ,CACJ9B,MAASA,CAAAA,CAAAA,EAWjB,OAPA9F,EAAU4J,GACN,yIACA5J,EACA+J,EACAlB,CAAAA,EAGGhK,KAAK0I,OAAOG,KAAK7I,KAAK8Q,mBAAqB,wBAAyB3P,CAAAA,EACtE8H,KAAK,IAAA,EAAM,CACnB,CAaD,oBAAoBuK,EAA2BtI,EAAqBlB,EAAAA,CAChE,IAAI7I,EAAe,CACfyH,OAAU,OACVG,KAAQ,CACJ/E,MAASwP,CAAAA,CAAAA,EAWjB,OAPArS,EAAU4J,GACN,yIACA5J,EACA+J,EACAlB,CAAAA,EAGGhK,KAAK0I,OAAOG,KAAK7I,KAAK8Q,mBAAqB,wBAAyB3P,CAAAA,EACtE8H,KAAK,IAAA,EAAM,CACnB,CAaD,mBAAmBwK,EAAkBvI,EAAqBlB,EAAAA,CACtD,IAAI7I,EAAe,CACfyH,OAAU,OACVG,KAAQ,CACJ0K,SAAYA,CAAAA,CAAAA,EAWpB,OAPAtS,EAAU4J,GACN,6IACA5J,EACA+J,EACAlB,CAAAA,EAGGhK,KAAK0I,OAAOG,KAAK7I,KAAK8Q,mBAAqB,wBAAyB3P,CAAAA,EACtE8H,KAAK,IAAA,EAAM,CACnB,CAcD,mBAAmByK,EAA0B3H,EAAkBb,EAAqBlB,EAAAA,CAChF,IAAI7I,EAAe,CACfyH,OAAU,OACVG,KAAQ,CACJ/E,MAAY0P,EACZ3H,SAAYA,CAAAA,CAAAA,EAWpB,OAPA5K,EAAU4J,GACN,2JACA5J,EACA+J,EACAlB,CAAAA,EAGGhK,KAAK0I,OAAOG,KAAK7I,KAAK8Q,mBAAqB,wBAAyB3P,CAAAA,EACtE8H,KAAK,IAAA,EAAM,CACnB,CAKD,kBAAkB8H,EAAkB5P,EAAAA,CAKhC,OAJAA,EAAUb,OAAOgB,OAAO,CACpBsH,OAAU,KAAA,EACXzH,CAAAA,EAEInB,KAAK0I,OAAOG,KAAK7I,KAAKiK,aAAe,IAAMpG,mBAAmBkN,CAAAA,EAAY,kBAAmB5P,CAAAA,CACvG,CAKD,mBAAmB4P,EAAkBkB,EAAkB9Q,EAAAA,CAKnD,OAJAA,EAAUb,OAAOgB,OAAO,CACpBsH,OAAU,QAAA,EACXzH,CAAAA,EAEInB,KAAK0I,OAAOG,KAAK7I,KAAKiK,aAAe,IAAMpG,mBAAmBkN,CAAAA,EAAY,mBAAqBlN,mBAAmBoO,CAAAA,EAAW9Q,CAAAA,EAC/H8H,KAAK,IAAA,EAAM,CACnB,CAQO,oBAAoBhJ,EAAaiT,EAAqC,CAAA,EAAA,CAC1E,IAAIS,EAAU1T,EACV+J,EAAQ,GAEO/J,EAAI0B,QAAQ,GAAA,GACb,IACdgS,EAAU1T,EAAI2T,UAAU,EAAG3T,EAAI0B,QAAQ,GAAA,CAAA,EACvCqI,EAAQ/J,EAAI2T,UAAU3T,EAAI0B,QAAQ,GAAA,EAAO,CAAA,GAG7C,IAAMkS,EAAwC,CAAA,EAGxCC,EAAY9J,EAAM9F,MAAM,GAAA,EAC9B,QAAW6P,KAASD,EAAW,CAC3B,GAAIC,GAAS,GACT,SAGJ,IAAMC,EAAOD,EAAM7P,MAAM,GAAA,EACzB2P,EAAajQ,mBAAmBoQ,EAAK,GAAG/O,QAAQ,MAAM,GAAA,CAAA,GAASrB,oBAAoBoQ,EAAK,IAAM,IAAI/O,QAAQ,MAAM,GAAA,CAAA,CACnH,CAGD,QAASnD,KAAOoR,EACPA,EAAae,eAAenS,CAAAA,IAI7BoR,EAAapR,IAAQ,KAARA,OACN+R,EAAa/R,GAEpB+R,EAAa/R,GAAOoR,EAAapR,IAKzCkI,EAAQ,GACR,QAASlI,KAAO+R,EACPA,EAAaI,eAAenS,CAAAA,IAI7BkI,GAAS,KACTA,GAAS,KAGbA,GAASnG,mBAAmB/B,EAAImD,QAAQ,OAAO,GAAA,CAAA,EAAQ,IAAMpB,mBAAmBgQ,EAAa/R,GAAKmD,QAAQ,OAAO,GAAA,CAAA,GAGrH,OAAO+E,GAAS,GAAM2J,EAAU,IAAM3J,EAAS2J,CAClD,CAAA,EAGL,SAASd,GAAiB5S,EAAAA,CACtB,GAAsB,OAAX+H,OAAW,KAAXA,CAA2BA,QAAQkM,KAC1C,MAAM,IAAItU,GAAoB,IAAIC,MAAM,uEAAA,CAAA,EAG5C,IAAIsU,EAAS,KACTC,EAAS,IAETC,EAAerM,OAAOsM,WACtBC,EAAevM,OAAOwM,YAG1BL,EAASA,EAAQE,EAAcA,EAAcF,EAC7CC,EAASA,EAASG,EAAeA,EAAeH,EAEhD,IAAIK,EAAQJ,EAAc,EAAMF,EAAQ,EACpCO,EAAQH,EAAe,EAAMH,EAAS,EAI1C,OAAOpM,OAAOkM,KACVjU,EACA,eACA,SAASkU,EAAM,WAAWC,EAAO,QAAQM,EAAI,SAASD,EAAK,uBAAA,CAEnE,CCx4BM,IAAOE,GAAP,cAAiCjL,EAAAA,CAInC,IAAA,cAAIO,CACA,MAAO,kBACV,CASD,MAAA,OACI2K,EACAC,EAAAA,GACA1T,EAAAA,CAUA,OARAA,EAAUb,OAAOgB,OAAO,CACpBsH,OAAU,MACVG,KAAQ,CACJ6L,YAAiBA,EACjBC,cAAiBA,CAAAA,CAAAA,EAEtB1T,CAAAA,EAEInB,KAAK0I,OAAOG,KAAK7I,KAAKiK,aAAe,UAAW9I,CAAAA,EAClD8H,KAAK,IAAA,EAAM,CACnB,CAAA,ECrBQ6L,GAAP,cAA0BrM,EAAAA,CAI5B,gBAAgBqB,EAAO,EAAGC,EAAU,GAAI5I,EAAAA,CAQpC,OAPAA,EAAUb,OAAOgB,OAAO,CAACsH,OAAU,KAAA,EAAQzH,CAAAA,GAEnC6I,MAAQ1J,OAAOgB,OAAO,CAC1BwI,KAAWA,EACXC,QAAWA,CAAAA,EACZ5I,EAAQ6I,KAAAA,EAEJhK,KAAK0I,OAAOG,KAAK,qBAAsB1H,CAAAA,CACjD,CAKD,WAAW6F,EAAY7F,EAAAA,CAKnB,OAJAA,EAAUb,OAAOgB,OAAO,CACpBsH,OAAU,KAAA,EACXzH,CAAAA,EAEInB,KAAK0I,OAAOG,KAAK,sBAAwBhF,mBAAmBmD,CAAAA,EAAK7F,CAAAA,CAC3E,CAKD,iBAAiBA,EAAAA,CAKb,OAJAA,EAAUb,OAAOgB,OAAO,CACpBsH,OAAU,KAAA,EACXzH,CAAAA,EAEInB,KAAK0I,OAAOG,KAAK,2BAA4B1H,CAAAA,CACvD,CAAA,ECvCQ4T,GAAP,cAA6BtM,EAAAA,CAI/B,MAAMtH,EAAAA,CAKF,OAJAA,EAAUb,OAAOgB,OAAO,CACpBsH,OAAU,KAAA,EACXzH,CAAAA,EAEInB,KAAK0I,OAAOG,KAAK,cAAe1H,CAAAA,CAC1C,CAAA,EChBQ6T,GAAP,cAA2BvM,EAAAA,CAI7B,OACImJ,EACAqD,EACAC,EAA2B,CAAA,EAAA,CAE3B,GAAA,CACKD,GAAAA,CACArD,GAAQ5K,IAAAA,CACP4K,GAAQjG,cAAAA,CAAgBiG,GAAQD,eAElC,MAAO,GAGX,IAAMwD,EAAQ,CAAA,EACdA,EAAM7N,KAAK,KAAA,EACX6N,EAAM7N,KAAK,OAAA,EACX6N,EAAM7N,KAAKzD,mBAAmB+N,EAAOjG,cAAgBiG,EAAOD,cAAAA,CAAAA,EAC5DwD,EAAM7N,KAAKzD,mBAAmB+N,EAAO5K,EAAAA,CAAAA,EACrCmO,EAAM7N,KAAKzD,mBAAmBoR,CAAAA,CAAAA,EAE9B,IAAI7T,EAASpB,KAAK0I,OAAOoH,SAASqF,EAAM9Q,KAAK,GAAA,CAAA,EAE7C,GAAI/D,OAAOqE,KAAKuQ,CAAAA,EAAazT,OAAQ,CAE7ByT,EAAYE,WAFiB,IAEjBA,OACLF,EAAoB,SAG/B,IAAM3D,EAAS,IAAI8D,gBAAgBH,CAAAA,EAEnC9T,IAAWA,EAAON,SAAS,GAAA,EAAO,IAAM,KAAOyQ,CAClD,CAED,OAAOnQ,CACV,CAKD,SAASD,EAAAA,CAKL,OAJAA,EAAUb,OAAOgB,OAAO,CACpBsH,OAAU,MAAA,EACXzH,CAAAA,EAEInB,KAAK0I,OAAOG,KAAK,mBAAoB1H,CAAAA,EACvC8H,KAAMxI,GAASA,GAAMuD,OAAS,EAAA,CACtC,CAAA,EC5CQsR,GAAP,cAA6B7M,EAAAA,CAI/B,YAAYtH,EAAAA,CAKR,OAJAA,EAAUb,OAAOgB,OAAO,CACpBsH,OAAU,KAAA,EACXzH,CAAAA,EAEInB,KAAK0I,OAAOG,KAAK,eAAgB1H,CAAAA,CAC3C,CAKD,OAAOoU,EAAkBpU,EAAAA,CAQrB,OAPAA,EAAUb,OAAOgB,OAAO,CACpBsH,OAAU,OACVG,KAAU,CACNpI,KAAQ4U,CAAAA,CAAAA,EAEbpU,CAAAA,EAEInB,KAAK0I,OAAOG,KAAK,eAAgB1H,CAAAA,EACnC8H,KAAK,IAAA,EAAM,CACnB,CAaD,OAAOH,EAAyC3H,EAAAA,CAM5C,OALAA,EAAUb,OAAOgB,OAAO,CACpBsH,OAAU,OACVG,KAAUD,CAAAA,EACX3H,CAAAA,EAEInB,KAAK0I,OAAOG,KAAK,sBAAuB1H,CAAAA,EAC1C8H,KAAK,IAAA,EAAM,CACnB,CAKD,OAAOnH,EAAaX,EAAAA,CAKhB,OAJAA,EAAUb,OAAOgB,OAAO,CACpBsH,OAAU,QAAA,EACXzH,CAAAA,EAEInB,KAAK0I,OAAOG,KAAK,gBAAgBhF,mBAAmB/B,CAAAA,IAAQX,CAAAA,EAC9D8H,KAAK,IAAA,EAAM,CACnB,CAKD,QAAQnH,EAAaX,EAAAA,CAKjB,OAJAA,EAAUb,OAAOgB,OAAO,CACpBsH,OAAU,MAAA,EACXzH,CAAAA,EAEInB,KAAK0I,OAAOG,KAAK,gBAAgBhF,mBAAmB/B,CAAAA,YAAgBX,CAAAA,EACtE8H,KAAK,IAAA,EAAM,CACnB,CAQD,eAAejF,EAAelC,EAAAA,CAC1B,OAAO9B,KAAK0I,OAAOoH,SAAS,gBAAgBjM,mBAAmB/B,CAAAA,WAAc+B,mBAAmBG,CAAAA,GAAAA,CACnG,CAAA,ECzECwR,GAAuB,CACzB,aACA,aACA,cACA,QACA,UACA,OACA,QACA,SAEA,QACA,cACA,UACA,YACA,YACA,SACA,OACA,WACA,WACA,iBACA,SACA,QAAA,EAYiBC,GAAP,KAAOA,CAyGjB,YACIC,EAAU,IACVhK,EACAiK,EAAO,QAAA,CAPH3V,KAAiB4V,kBAAuC,CAAA,EACxD5V,KAAc6V,eAAqC,CAAA,EACnD7V,KAAsB8V,uBAAAA,GAO1B9V,KAAK0V,QAAYA,EACjB1V,KAAK2V,KAAYA,EACjB3V,KAAK0L,UAAYA,GAAa,IAAIjE,GAGlCzH,KAAK+V,OAAc,IAAIvK,GAAaxL,IAAAA,EACpCA,KAAK4U,YAAc,IAAID,GAAkB3U,IAAAA,EACzCA,KAAKgW,MAAc,IAAIhB,GAAYhV,IAAAA,EACnCA,KAAKiW,KAAc,IAAInB,GAAW9U,IAAAA,EAClCA,KAAKkW,SAAc,IAAIvN,GAAgB3I,IAAAA,EACvCA,KAAKgR,SAAc,IAAI1D,GAAgBtN,IAAAA,EACvCA,KAAKmW,OAAc,IAAIpB,GAAc/U,IAAAA,EACrCA,KAAKoW,QAAc,IAAId,GAActV,IAAAA,CACxC,CAQD,WAA4BqW,EAAAA,CAKxB,OAJKrW,KAAK6V,eAAeQ,KACrBrW,KAAK6V,eAAeQ,GAAY,IAAIzF,GAAc5Q,KAAMqW,CAAAA,GAGrDrW,KAAK6V,eAAeQ,EAC9B,CAKD,iBAAiBC,EAAAA,CAGb,OAFAtW,KAAK8V,uBAAAA,CAAAA,CAA2BQ,EAEzBtW,IACV,CAKD,cAAcsK,EAAAA,CAMV,OALItK,KAAK4V,kBAAkBtL,KACvBtK,KAAK4V,kBAAkBtL,GAAYiM,MAAAA,EAAAA,OAC5BvW,KAAK4V,kBAAkBtL,IAG3BtK,IACV,CAKD,mBAAAwW,CACI,QAASC,KAAKzW,KAAK4V,kBACf5V,KAAK4V,kBAAkBa,GAAGF,MAAAA,EAK9B,OAFAvW,KAAK4V,kBAAoB,CAAA,EAElB5V,IACV,CAuBD,OAAO0W,EAAanF,EAAAA,CAChB,GAAA,CAAKA,EACD,OAAOmF,EAGX,QAAS5U,KAAOyP,EAAQ,CACpB,IAAItP,EAAMsP,EAAOzP,GACjB,OAAA,OAAeG,EAAAA,CACX,IAAK,UACL,IAAK,SACDA,EAAM,GAAKA,EACX,MACJ,IAAK,SACDA,EAAM,IAAMA,EAAIgD,QAAQ,KAAM,KAAA,EAAS,IACvC,MACJ,QAEQhD,EADAA,IAAQ,KACF,OACCA,aAAemB,KAChB,IAAMnB,EAAI0U,YAAAA,EAAc1R,QAAQ,IAAK,GAAA,EAAO,IAE5C,IAAMX,KAAKsC,UAAU3E,CAAAA,EAAKgD,QAAQ,KAAM,KAAA,EAAS,GAAA,CAGnEyR,EAAMA,EAAIE,WAAW,KAAO9U,EAAM,IAAKG,CAAAA,CAC1C,CAED,OAAOyU,CACV,CAKD,WACI9E,EACAqD,EACAC,EAA2B,CAAA,EAAA,CAE3B,OAAOlV,KAAKgW,MAAMa,OAAOjF,EAAQqD,EAAUC,CAAAA,CAC9C,CAKD,SAASlS,EAAAA,CACL,IAAI/C,EAAMD,KAAK0V,QA2Bf,OAvBsB,OAAX1N,OAAW,KAAXA,CACLA,OAAOqL,UACRpT,EAAI2O,WAAW,UAAA,GACf3O,EAAI2O,WAAW,SAAA,IAEhB3O,EAAM+H,OAAOqL,SAASyD,QAAQC,SAAS,GAAA,EACnC/O,OAAOqL,SAASyD,OAAOlD,UAAU,EAAG5L,OAAOqL,SAASyD,OAAOrV,OAAS,CAAA,EACnEuG,OAAOqL,SAASyD,QAAU,GAE1B9W,KAAK0V,QAAQ9G,WAAW,GAAA,IACzB3O,GAAO+H,OAAOqL,SAAS2D,UAAY,IACnC/W,GAAOA,EAAI8W,SAAS,GAAA,EAAO,GAAK,KAGpC9W,GAAOD,KAAK0V,SAIZ1S,IACA/C,GAAOA,EAAI8W,SAAS,GAAA,EAAO,GAAK,IAChC9W,GAAO+C,EAAK4L,WAAW,GAAA,EAAO5L,EAAK4Q,UAAU,CAAA,EAAK5Q,GAG/C/C,CACV,CAKD,MAAA,KAAoB+C,EAAc7B,EAAAA,CAC9BA,EAAUnB,KAAKiX,gBAAgBjU,EAAM7B,CAAAA,EAGrC,IAAIlB,EAAMD,KAAK8P,SAAS9M,CAAAA,EAExB,GAAIhD,KAAKyM,WAAY,CACjB,IAAMrL,EAASd,OAAOgB,OAAO,CAAE,EAAA,MAAQtB,KAAKyM,WAAWxM,EAAKkB,CAAAA,CAAAA,EACjDC,EAAOnB,MAD0CkB,QACZC,EAAOD,UAArClB,QACdA,EAAMmB,EAAOnB,KAAOA,EACpBkB,EAAUC,EAAOD,SAAWA,GACrBb,OAAOqE,KAAKvD,CAAAA,EAAQK,SAE3BN,EAAUC,EACVgK,SAASC,MAAQD,QAAQC,KAAK,4GAAA,EAErC,CAGD,GAAWlK,EAAQ6I,QAAnB,OAA0C,CACtC,IAAMA,EAAQhK,KAAKkX,qBAAqB/V,EAAQ6I,KAAAA,EAC5CA,IACA/J,IAAQA,EAAIa,SAAS,GAAA,EAAO,IAAM,KAAOkJ,GAAAA,OAEtC7I,EAAQ6I,KAClB,CAIsD,OAAnDhK,KAAKmX,UAAUhW,EAAQ6L,QAAS,cAAA,GAAmB,oBACnD7L,EAAQ4H,MAAgC,OAAjB5H,EAAQ4H,MAAS,WAExC5H,EAAQ4H,KAAOzE,KAAKsC,UAAUzF,EAAQ4H,IAAAA,IAGxB5H,EAAQiW,OAASA,OAGlBnX,EAAKkB,CAAAA,EACjB8H,KAAK2B,MAAOzK,GAAAA,CACT,IAAIM,EAAa,CAAA,EAEjB,GAAA,CACIA,EAAAA,MAAaN,EAASkX,KAAAA,CACzB,MAAC,CAGD,CAMD,GAJIrX,KAAKsX,YACL7W,EAAAA,MAAaT,KAAKsX,UAAUnX,EAAUM,CAAAA,GAGtCN,EAASD,QAAU,IACnB,MAAM,IAAIN,GAAoB,CAC1BK,IAAUE,EAASF,IACnBC,OAAUC,EAASD,OACnBO,KAAUA,CAAAA,CAAAA,EAIlB,OAAOA,CAAS,CAAA,EACjByO,MAAOC,GAAAA,CAEN,MAAM,IAAIvP,GAAoBuP,CAAAA,CAAI,CAAA,CAE7C,CASO,gBAAgBnM,EAAc7B,EAAAA,EAClCA,EAAUb,OAAOgB,OAAO,CAAEsH,OAAQ,KAAA,EAAwBzH,CAAAA,GAClD6I,MAAQ7I,EAAQ6I,OAAS,CAAA,EAGjC7I,EAAQ4H,KAAO/I,KAAKuX,0BAA0BpW,EAAQ4H,IAAAA,EAGtD,QAASjH,KAAOX,EACRqU,GAAqB1U,SAASgB,CAAAA,IAIlCX,EAAQ6I,MAAMlI,GAAOX,EAAQW,GAAAA,OACrBX,EAAQW,IAmDpB,GA9CAX,EAAQ6I,MAAQ1J,OAAOgB,OAAO,CAAA,EAAIH,EAAQoQ,OAAQpQ,EAAQ6I,KAAAA,EAC/C7I,EAAQmJ,aADuCN,SAElD7I,EAAQqW,cADGlN,IACsBnJ,EAAQ6I,MAAMwN,cAAvCA,GACRrW,EAAQmJ,WAAa,MACdnJ,EAAQsW,YAActW,EAAQ6I,MAAMyN,cAC3CtW,EAAQmJ,WAAanJ,EAAQsW,YAActW,EAAQ6I,MAAMyN,aAAAA,OAI1DtW,EAAQqW,YAAAA,OACRrW,EAAQ6I,MAAMwN,YAAAA,OACdrW,EAAQsW,WAAAA,OACRtW,EAAQ6I,MAAMyN,WAMjBzX,KAAKmX,UAAUhW,EAAQ6L,QAAS,cAAA,IAAoB,MACnDhN,KAAK0X,WAAWvW,EAAQ4H,IAAAA,IAEzB5H,EAAQ6L,QAAU1M,OAAOgB,OAAO,CAAE,EAAEH,EAAQ6L,QAAS,CACjD,eAAgB,kBAAA,CAAA,GAKpBhN,KAAKmX,UAAUhW,EAAQ6L,QAAS,iBAAA,IAAuB,OACvD7L,EAAQ6L,QAAU1M,OAAOgB,OAAO,CAAE,EAAEH,EAAQ6L,QAAS,CACjD,kBAAmBhN,KAAK2V,IAAAA,CAAAA,GAO5B3V,KAAK0L,UAAU1H,OAEdhE,KAAKmX,UAAUhW,EAAQ6L,QAAS,eAAA,IAAqB,OAEtD7L,EAAQ6L,QAAU1M,OAAOgB,OAAO,CAAE,EAAEH,EAAQ6L,QAAS,CACjD2K,cAAiB3X,KAAK0L,UAAU1H,KAAAA,CAAAA,GAKpChE,KAAK8V,wBAA0B3U,EAAQmJ,aAAe,KAAM,CAC5D,IAAMA,EAAanJ,EAAQmJ,aAAgBnJ,EAAQyH,QAAU,OAAS5F,EAAAA,OAE/D7B,EAAQmJ,WAGftK,KAAK0Q,cAAcpG,CAAAA,EAEnB,IAAMsN,EAAa,IAAIC,gBACvB7X,KAAK4V,kBAAkBtL,GAAcsN,EACrCzW,EAAQ2W,OAASF,EAAWE,MAC/B,CAED,OAAO3W,CACV,CAMO,0BAA0B4H,EAAAA,CAC9B,GACwB,OAAbgP,SAAa,KACbhP,IADAgP,QAES,OAAThP,GAAS,UAChBA,IAAS,MACT/I,KAAK0X,WAAW3O,CAAAA,GAAAA,CACf/I,KAAKgY,aAAajP,CAAAA,EAEnB,OAAOA,EAGX,IAAMkP,EAAO,IAAIF,SAEjB,QAASjW,KAAOiH,EAAM,CAElB,IAAMmP,EAAS1R,MAAMC,QAAQsC,EAAKjH,EAAAA,EAAQiH,EAAKjH,GAAO,CAACiH,EAAKjH,EAAAA,EAC5D,QAASG,KAAOiW,EACZD,EAAKE,OAAOrW,EAAKG,CAAAA,CAExB,CAED,OAAOgW,CACV,CAKO,aAAalP,EAAAA,CACjB,QAASjH,KAAOiH,EAAM,CAClB,IAAMmP,EAAS1R,MAAMC,QAAQsC,EAAKjH,EAAAA,EAAQiH,EAAKjH,GAAO,CAACiH,EAAKjH,EAAAA,EAC5D,QAASsW,KAAKF,EACV,GACqB,OAATpR,KAAS,KAAesR,aAAatR,MAC5B,OAATuR,KAAS,KAAeD,aAAaC,KAE7C,MAAA,EAGX,CAED,MAAA,EACH,CAMO,UAAUrL,EAA0CrM,EAAAA,CACxDqM,EAAUA,GAAW,CAAA,EACrBrM,EAAOA,EAAK+C,YAAAA,EAEZ,QAAS5B,KAAOkL,EACZ,GAAIlL,EAAI4B,YAAAA,GAAiB/C,EACrB,OAAOqM,EAAQlL,GAIvB,OAAO,IACV,CAKO,WAAWiH,EAAAA,CACf,OAAOA,IAIHA,EAAKpD,YAAYhF,OAAS,YAIL,OAAboX,SAAa,KAAehP,aAAgBgP,SAE3D,CAKO,qBAAqBxG,EAAAA,CACzB,IAAMnQ,EAAwB,CAAA,EAC9B,QAAWU,KAAOyP,EAAQ,CACtB,GAAIA,EAAOzP,KAAS,KAEhB,SAGJ,IAAMW,EAAQ8O,EAAOzP,GACfwW,EAAazU,mBAAmB/B,CAAAA,EAEtC,GAAI0E,MAAMC,QAAQhE,CAAAA,EAEd,QAAW2V,KAAK3V,EACZrB,EAAOkG,KAAKgR,EAAa,IAAMzU,mBAAmBuU,CAAAA,CAAAA,OAE/C3V,aAAiBW,KACxBhC,EAAOkG,KAAKgR,EAAa,IAAMzU,mBAAmBpB,EAAMkU,YAAAA,CAAAA,CAAAA,EAChC,OAAVlU,IAAU,MAAyB,OAAVA,GAAU,SACjDrB,EAAOkG,KAAKgR,EAAa,IAAMzU,mBAAmBS,KAAKsC,UAAUnE,CAAAA,CAAAA,CAAAA,EAEjErB,EAAOkG,KAAKgR,EAAa,IAAMzU,mBAAmBpB,CAAAA,CAAAA,CAEzD,CAED,OAAOrB,EAAOiD,KAAK,GAAA,CACtB,CAAA,EExkBL,IAAMkU,GAAM,IAAI,IAAI,SAAS,MAAM,EACnCA,GAAI,KAAO,cAAcA,GAAI,OACtB,IAAMC,GAAK,IAAIC,GAAWF,GAAI,SAAS,CAAC,EAC/C,OAAO,GAAKC,GAEZ,eAAsBE,IAAc,CAClC,IAAMC,EAAM,MAAMH,GAAG,WAAW,OAAO,EAAE,eAAe,CACtD,SAAU,QACZ,CAAC,EACD,GAAI,CAEF,MAAMA,GAAG,WAAW,OAAO,EAAE,OAAOG,EAAI,OAAO,GAAI,CAAE,KAAMA,EAAI,KAAK,IAAK,CAAC,CAC5E,MAAE,CAEF,CACF,CAEO,SAASC,IAAU,CACxB,GAAM,CAACC,EAAMC,CAAO,EAAIC,GAASP,GAAG,UAAU,KAAK,EAEnD,OAAAQ,GAAU,IACDR,GAAG,UAAU,SAAS,CAACS,EAAGC,IAAUJ,EAAQI,CAAK,CAAC,CAC1D,EAEM,CAACL,CAAI,CACd,CEdO,ICVHM,GAAU,EAERC,GAAUC,MAAMD,QAsBtB,SAASE,EAAYC,EAAMC,EAAOC,EAAKC,EAAkBC,EAAUC,EAAAA,CAIlE,IACCC,EACAC,EAFGC,EAAkB,CAAA,EAGtB,IAAKD,KAAKN,EACLM,GAAK,MACRD,EAAML,EAAMM,GAEZC,EAAgBD,GAAKN,EAAMM,GAK7B,IAAME,EAAQ,CACbT,KAAAA,EACAC,MAAOO,EACPN,IAAAA,EACAI,IAAAA,EACAI,IAAW,KACXC,GAAS,KACTC,IAAQ,EACRC,IAAM,KACNC,IAAAA,OACAC,IAAY,KACZC,YAAAA,OACAC,IAAAA,EAAarB,GACbsB,IAAAA,GACAC,IAAQ,EACRf,SAAAA,EACAC,OAAAA,CAAAA,EAKD,GAAoB,OAATL,GAAS,aAAeM,EAAMN,EAAKoB,cAC7C,IAAKb,KAAKD,EACEE,EAAgBD,KADlBD,SAERE,EAAgBD,GAAKD,EAAIC,IAK5B,OADIc,EAAQZ,OAAOY,EAAQZ,MAAMA,CAAAA,EAC1BA,CACP,CpFlED,IAAMa,GAAe,ylBACfC,GAAkB,sBAAsBD,KAkBzBE,GAArB,cAAuDC,EAAW,CAAlE,kCAmBE,KAAQ,YAA0B,CAAC,EAEnC,SAAU,CACR,KAAK,mBAAmB,EAExBC,GAAOC,EAACC,GAAA,CAAoB,WAAY,KAAM,EAAI,KAAK,mBAAmB,CAC5E,CAEA,MAAM,oBAAqB,CACzB,GAAM,CAAE,MAAAC,CAAM,EAAI,MAAMC,GACrB,WAAmB,UAAU,EAC7B,QAAQ,EAAG,IAAO,CACjB,OAAQA,GAAG,OAAO,wBAAyB,CACzC,KAAM,KAAK,SACb,CAAC,CACH,CAAC,EACH,KAAK,YAAY,QAASC,GAAMA,EAAE,OAAO,CAAC,EAC1C,KAAK,YAAcF,EAAM,IAAKG,GAAS,CACrC,IAAMC,EAAO,GAAAC,QAAE,KAAK,CAClB,QAASX,GACT,SAAU,CAAC,GAAI,EAAE,EACjB,WAAY,CAAC,GAAI,EAAE,CACrB,CAAC,EACD,OAAO,GAAAW,QAAE,OAAO,CAACF,EAAK,EAAGA,EAAK,CAAC,EAAG,CAAE,KAAAC,CAAK,CAAC,EACvC,GAAG,QAAS,IAAM,CACjB,KAAK,gBAAgBD,CAAI,CAC3B,CAAC,EACA,MAAM,KAAK,GAAG,CACnB,CAAC,CACH,CAEA,gBAAgBG,EAAgB,CAC9B,IAAMC,EAAQ,SAAS,cAAc,KAAK,EAC1C,SAAS,KAAK,YAAYA,CAAK,EAC/BV,GACEC,EAACU,GAAA,CAAY,OAAQF,EAAQ,OAAQC,EAAO,WAAY,KAAM,EAC9DA,CACF,CACF,CAEA,OAAOE,EAAO,CACZ,KAAK,IAAI,eAAe,CAC1B,CAEA,IAAI,QAAU,CACZ,GAAI,CAAC,KAAK,QAAS,CACjB,IAAMC,EAAS,IAAI,GAAAL,QAAE,OAAO,EAAG,CAAC,EAC1BM,EAAS,IAAI,GAAAN,QAAE,OAAO,KAAK,YAAa,KAAK,UAAU,EAE7D,KAAK,QAAU,IAAI,GAAAA,QAAE,aAAaK,EAAOC,CAAG,CAC9C,CAEA,OAAO,KAAK,OACd,CAEA,mBAAmBC,EAAK,CACtB,KAAK,GACP,CAEA,IAAI,KAAM,CACR,GAAI,CAAC,KAAK,KAAM,CACd,IAAMC,EAAS,EAAI,KAAK,IAAI,EAAG,KAAK,iBAAiB,EAErD,KAAK,KAAO,GAAAR,QAAE,OAAO,CAAC,EAAG,GAAAA,QAAE,IAAI,OAAQ,CACrC,eAAgB,IAAI,GAAAA,QAAE,eAAeQ,EAAQ,EAAGA,EAAQ,CAAC,CAC3D,CAAC,CACH,CAEA,OAAO,KAAK,IACd,CAEA,mBAAoB,CACd,KAAK,SACP,KAAK,IAAI,YAAY,KAAK,MAAM,EAChC,KAAK,OAAS,QAGhB,KAAK,KACP,CAEA,IAAI,QAAU,CACZ,OAAK,KAAK,UACR,KAAK,QAAU,KAAK,KAAK,KAAK,YAAc,GAAG,EAAI,KAG9C,KAAK,OACd,CAEA,IAAI,OAAS,CACX,OAAK,KAAK,SACR,KAAK,OAAS,KAAK,KAAK,KAAK,WAAa,GAAG,EAAI,KAG5C,KAAK,MACd,CAEA,IAAI,KAAM,CACR,OAAK,KAAK,OACR,KAAK,KAAO,GAAAR,QAAE,IAAI,KAAK,UAAW,CAChC,OAAQ,KAAK,OAAO,UAAU,EAC9B,UAAW,KAAK,OAChB,IAAK,KAAK,IACV,KAAM,KAAK,kBACX,QAAS,EACT,QAAS,KAAK,kBACd,mBAAoB,EACtB,CAAC,GAGI,KAAK,IACd,CAEA,IAAI,OAAQ,CACV,OAAK,KAAK,SACR,KAAK,OAAS,GAAAA,QAAE,UAAU,KAAK,WAAY,CACzC,cAAe,EACf,cAAe,EACf,OAAQ,GACR,OAAQ,KAAK,MACf,CAAC,EAAE,MAAM,KAAK,GAAG,EAEjB,GAAAA,QAAE,QACC,YAAY,CAAE,OAAQ,EAAM,CAAC,EAC7B,eAAe,KAAK,gBAAgB,EACpC,MAAM,KAAK,GAAG,GAGZ,KAAK,MACd,CACF,EApJqBV,GACZ,OAAS,CACd,MAAO,OACP,YAAa,OACb,KAAM,OACN,iBAAkB,OAClB,aAAc,OACd,MAAO,OACP,OAAQ,MACV,EATmBA,GAcZ,QAAU,CAAC,MAAO,eAAe,EAwI1C,SAASa,GAAY,CACnB,OAAAF,EACA,OAAAQ,EACA,WAAAC,CACF,EAIG,CACD,IAAMC,EAAc,IAAM,CACxBnB,GAAO,KAAMiB,CAAM,EACnBA,EAAO,OAAO,CAChB,EAEM,CAACG,EAAYC,CAAgB,EAAIC,GAAS,CAAC,EAC3CC,EAAkB,IAAMF,EAAiBD,EAAa,CAAC,EAEvD,CAACI,EAAUC,CAAW,EAAIH,GAA2B,IAAI,EACzDI,EAAiBF,GAAU,KAC/B,CAACG,EAAG,IAAM,CAACC,GAASD,EAAE,OAAO,EAAI,CAACC,GAAS,EAAE,OAAO,CACtD,EACAC,GAAU,IAAM,EACb,SAAY,CACX,GAAM,CAAE,MAAA1B,CAAM,EAAI,MAAMC,GACrB,WAAoB,aAAa,EACjC,QAAQ,EAAG,IAAO,CACjB,OAAQA,GAAG,OAAO,4BAA6B,CAC7C,SAAUK,EAAO,EACnB,CAAC,EACD,OAAQ,UACV,CAAC,EACHgB,EAAYtB,CAAK,CACnB,GAAG,CACL,EAAG,CAACiB,CAAU,CAAC,EAEf,GAAM,CAACU,CAAI,EAAIC,GAAQ,EACjBC,EAASF,GAAM,GAErB,eAAeG,GAAe,CACvB,QAAQ,iJAA+H,IAC5I,MAAM7B,GAAG,WAAmB,UAAU,EAAE,OAAOK,EAAO,EAAE,EACxD,MAAMS,EAAW,mBAAmB,EACpCC,EAAY,EACd,CAEA,OACElB,EAAC,OAAI,MAAM,6IACT,SAAAA,EAAC,OAAI,MAAM,YACT,UAAAA,EAAC,OAAI,MAAM,iEACT,UAAAA,EAAC,OACE,SAAAQ,EAAO,WAAauB,GACnB/B,EAAC,UACC,KAAK,SACL,MAAM,iBACN,QAASgC,EACV,6BAED,EAEJ,EACAhC,EAAC,OAAI,MAAM,kEACT,SAAAA,EAAC,UACC,KAAK,SACL,MAAM,QACN,eAAa,QACb,aAAW,QACX,QAAS,IAAMkB,EAAY,EAE3B,SAAAlB,EAAC,QAAK,cAAY,OAAO,MAAM,OAAO,gBAAC,EACzC,EACF,GACF,EACAA,EAAC,OAAI,MAAM,0EACT,UAAAA,EAACiC,GAAA,CAAgB,OAAQzB,EAAQ,gBAAiBc,EAAiB,EAEnEtB,EAAC,OAAI,MAAM,gCACR,SAAAyB,EACGA,EAAe,OAAS,EACtBA,EAAe,IAAKS,GAClBlC,EAACmC,GAAA,CAAQ,QAASD,EAAG,gBAAiBZ,EAAiB,CACxD,EACD,kDACF,cACN,GACF,GACF,EACF,CAEJ,CAEA,SAASW,GAAgB,CACvB,OAAAzB,EACA,gBAAAc,CACF,EAGG,CACD,GAAM,CAACc,EAASC,CAAU,EAAIhB,GAAS,EAAK,EACtC,CAACiB,EAAOC,CAAQ,EAAIlB,GAAS,EAAE,EAC/B,CAACQ,CAAI,EAAIC,GAAQ,EACvB,eAAeU,GAAc,CAC3BH,EAAW,EAAI,EACVlC,GAAG,UAAU,OAAO,IAAI,MAAMsC,GAAY,EAE/C,GAAI,CACF,MAAMtC,GAAG,WAAW,aAAa,EAAE,OAAO,CACxC,MAAAmC,EACA,SAAU9B,EAAO,GACjB,SAAUL,GAAG,UAAU,MAAM,EAC/B,CAAC,EACDoC,EAAS,EAAE,EACXjB,EAAgB,CAClB,OAASoB,EAAP,CACA,MAAMA,CAAK,CACb,QAAE,CACAL,EAAW,EAAK,CAClB,CACF,CACA,SAASM,EAAahC,EAAc,CAClCA,EAAM,eAAe,EACrB6B,EAAY,CACd,CACA,OACExC,EAAC,QACC,MAAM,+DACN,SAAU2C,EAEV,SAAA3C,EAAC,OAAI,MAAM,+BACT,UAAAA,EAAC,SACC,MAAM,eACN,SAAS,WACT,KAAK,OACL,YAAY,uCACZ,MAAOsC,EACP,QAAUM,GAAML,EAAUK,EAAE,OAAe,KAAK,EAChD,SAAUR,EACZ,EACCP,GAAM,GACL7B,EAAC,UAAO,MAAM,4BAA4B,SAAUoC,EAAS,kBAE7D,EAEApC,EAAC,UAAO,MAAM,yBAAyB,SAAUoC,EAAS,sCAE1D,GAEJ,EACF,CAEJ,CAEA,SAASD,GAAQ,CACf,QAAAU,EACA,gBAAAvB,CACF,EAGG,CACD,GAAM,CAACO,CAAI,EAAIC,GAAQ,EACjBC,EAASF,GAAM,GACf,CAACiB,EAASC,CAAU,EAAI1B,GAAS,EAAK,EACtC,CAAC2B,EAASC,CAAU,EAAI5B,GAAoC,EAAK,EAEjE6B,EAAYL,EAAQ,UAAYA,EAAQ,QAE9C,eAAeM,GAAgB,CAC7B,GAAK,QAAQ,0BAAuB,EACpC,CAAAJ,EAAW,EAAI,EACf,GAAI,CACF,MAAM5C,GAAG,WAAW,aAAa,EAAE,OAAO0C,EAAQ,EAAE,EACpDvB,EAAgB,CAClB,OAASoB,EAAP,CACA,MAAMA,CAAK,CACb,QAAE,CACAK,EAAW,EAAK,CAClB,EACF,CAEA,eAAeK,GAAW,CACxB,GAAKJ,EACL,CAAAD,EAAW,EAAI,EACf,GAAI,CACF,MAAM5C,GAAG,WAAW,aAAa,EAAE,OAAO0C,EAAQ,GAAIG,CAAO,EAC7D1B,EAAgB,EAChB2B,EAAW,EAAK,CAClB,OAASP,EAAP,CACA,MAAMA,CAAK,CACb,QAAE,CACAK,EAAW,EAAK,CAClB,EACF,CAEA,SAASM,GAAsB,CAC7BJ,EAAW,EAAK,CAClB,CAEA,OACEjD,EAAC,OAAI,MAAM,0GACT,UAAAA,EAAC,OAAI,MAAM,0DACT,UAAAA,EAAC,OAAI,MAAM,qBACT,UAAAA,EAAC,OAAI,MAAM,iBACR,SAAA6C,EAAQ,QAAQ,UAAU,MACzBA,EAAQ,QAAQ,UAAU,UAC1BA,EAAQ,SACZ,EACA7C,EAAC,OAAI,MAAM,eACR,UAAAsD,GAAe3B,GAASkB,EAAQ,OAAO,EAAG,IAAI,KAAQ,CACrD,OAAQU,EACV,CAAC,EACAL,GACClD,EAAAwD,GAAA,CACG,cAAI,WACI,IACRF,GAAe3B,GAASkB,EAAQ,OAAO,EAAG,IAAI,KAAQ,CACrD,OAAQU,EACV,CAAC,EAAE,KAEL,GAEJ,GACF,EACCxB,GAAUc,EAAQ,WAAad,GAC9B/B,EAAC,OAAI,MAAM,4BACR,SAAAgD,EACChD,EAAAwD,GAAA,CACE,UAAAxD,EAAC,UACC,KAAK,SACL,MAAM,uCACN,aAAW,UACX,QAASoD,EACT,SAAUN,EAEV,SAAA9C,EAAC,KAAE,MAAM,cAAc,cAAY,OAAO,EAC5C,EACAA,EAAC,UACC,KAAK,SACL,MAAM,mCACN,aAAW,WACX,QAASqD,EACT,SAAUP,EAEV,SAAA9C,EAAC,KAAE,MAAM,cAAc,cAAY,OAAO,EAC5C,GACF,EAEAA,EAAAwD,GAAA,CACE,UAAAxD,EAAC,UACC,KAAK,SACL,MAAM,uCACN,aAAW,SACX,QAAS,IAAMiD,EAAW,CAAE,MAAOJ,EAAQ,KAAM,CAAC,EAClD,SAAUC,EAEV,SAAA9C,EAAC,KAAE,MAAM,wBAAwB,cAAY,OAAO,EACtD,EACAA,EAAC,UACC,KAAK,SACL,MAAM,qCACN,aAAW,WACX,QAASmD,EACT,SAAUL,EAEV,SAAA9C,EAAC,KAAE,MAAM,cAAc,cAAY,OAAO,EAC5C,GACF,EAEJ,GAEJ,EACCgD,EACChD,EAAC,YACC,MAAM,aACN,MAAOgD,EAAQ,MACf,QAAUJ,GAAMK,EAAW,CAAE,MAAQL,EAAE,OAAe,KAAM,CAAC,EAC7D,KAAM,IACR,EAEA5C,EAAC,OAAI,MAAM,uBACR,SAAA6C,EAAQ,MACX,GAEJ,CAEJ,CAEA,SAAS5C,GAAoB,CAC3B,WAAAgB,CACF,EAEG,CACD,GAAM,CAACwC,EAAUC,CAAW,EAAIrC,GAAS,EAAK,EAE9CO,GAAU,IAAM,CACd,GAAI6B,EAAU,CACZxC,EAAW,UAAU,MAAM,OAAS,YAEpC,IAAM0C,EAAoB,MAAOhD,GAA6B,CAK5D,GAJA+C,EAAY,EAAK,EAEjBzC,EAAW,UAAU,MAAM,OAAS,GAEhC,EAACA,EAAW,OAAO,SAASN,EAAM,MAAM,EAE5C,GAAI,CACF,IAAMiD,EAAM,MAAMzD,GAAG,WAAW,UAAU,EAAE,OAAe,CACzD,YAAac,EAAW,UACxB,EAAGN,EAAM,OAAO,IAChB,EAAGA,EAAM,OAAO,IAChB,SAAUR,GAAG,UAAU,OAAO,EAChC,CAAC,EACD,MAAMc,EAAW,mBAAmB,EACpCA,EAAW,gBAAgB2C,CAAG,CAChC,OAASlB,EAAP,CACA,MAAMA,CAAK,CACb,CACF,EAEA,OAAAzB,EAAW,IAAI,GAAG,QAAS0C,CAAiB,EACrC,IAAM1C,EAAW,IAAI,IAAI,QAAS0C,CAAiB,CAC5D,CACF,EAAG,CAACF,CAAQ,CAAC,EAEb,eAAeI,GAAc,CACtB1D,GAAG,UAAU,OAAO,IACvB,MAAMsC,GAAY,EAEpBiB,EAAY,EAAI,CAClB,CACA,SAASI,GAAa,CACpBJ,EAAY,EAAK,CACnB,CAEA,OACE1D,EAAAwD,GAAA,CACG,SAAAC,EACCzD,EAAC,UACC,KAAK,SACL,MAAM,qDACN,MAAM,kEACN,QAAS8D,EACV,6FAED,EAEA9D,EAAC,OAAI,MAAM,+DACT,SAAAA,EAAC,UACC,MAAM,qCACN,QAAS6D,EAET,SAAA7D,EAAC,OACC,UAAAA,EAAC,OAAI,MAAM,wBAAwB,aAAC,EACpCA,EAAC,OAAK,SAAAiB,EAAW,sBAAsB,GACzC,EACF,EACF,EAEJ,CAEJ,CqFnhBA,IAAO8C,GAAP,cAA6BC,EAAW,CAGtC,SAAU,CACR,GAAIC,GAAG,UAAU,MAAO,CACtB,IAAMC,EAAOD,GAAG,UAAU,OAAO,KACjC,KAAK,WAAW,YAAc,YAASC,KACvC,KAAK,cAAc,QAAU,MAC/B,KAAO,CACL,IAAMC,EAAM,IAAI,IAAI,SAAS,MAAM,EACnCA,EAAI,SAAW,UACfA,EAAI,aAAa,IAAI,OAAQ,SAAS,QAAQ,EACxCC,GAAMD,CAAG,CACjB,CACF,CACF,EAdEE,GADKN,GACE,UAAU,CAAC,OAAQ,SAAS,GCArC,IAAOO,GAAP,cAA6BC,EAAW,CACtC,MAAM,aAAc,CAClB,GAAI,CACF,MAAMC,GAAY,EAElB,IAAIC,EADW,IAAI,gBAAgB,SAAS,MAAM,EAChC,IAAI,MAAM,GAAK,IAC3BC,GAAMD,CAAI,CAClB,OAASE,EAAP,CACA,MAAMA,CAAK,CACb,CACF,CACF,ECZA,IAAOC,GAAP,cAA6BC,EAAW,CACtC,SAAU,CACR,GAAIC,GAAG,UAAU,MAAO,CACtB,GAAM,CAAE,KAAAC,EAAM,MAAAC,CAAM,EAAIF,GAAG,UAAU,MACjC,KAAK,QAAQ,YAAcC,IAAM,KAAK,QAAQ,WAAW,MAAQA,GACjE,KAAK,QAAQ,OAASC,IAAO,KAAK,QAAQ,MAAM,MAAQA,EAC9D,KAAO,CACL,IAAMC,EAAM,IAAI,IAAI,SAAS,MAAM,EACnCA,EAAI,SAAW,UACfA,EAAI,aAAa,IAAI,OAAQ,SAAS,QAAQ,EACxCC,GAAMD,CAAG,CACjB,CACF,CACF,ECbA,IAAOE,GAAP,cAA6BC,EAAW,CACtC,QAAS,CACPC,GAAG,UAAU,MAAM,EACbC,GAAM,GAAG,CACjB,CACF,E1HNA,OAAO,eAAiB,IAAI,GAAAC,QAC5B,OAAO,OAAS,OAAO,eAAe,MAAM,UAAU,SAAS,EAE/D,GAAI,CAAC,OAAO,OAAO,KAAO,OAAO,IAAI,aAAe,aAClD,GAAI,CACF,OAAO,SAAW,IAAIC,GAAS,CAC7B,UAAW,OAAO,IAAI,oBACtB,WAAY,OAAO,IAAI,qBACvB,KAAM,wBACR,CAAC,EAED,QAAQ,cAAgB,QAAQ,MAChC,QAAQ,MAAQ,IAAIC,KAClB,OAAO,SAAS,OAAOA,EAAE,KAAK,GAAG,CAAC,EAC3B,QAAQ,cAAc,GAAGA,CAAC,EAErC,OAASA,EAAP,CACA,QAAQ,MAAMA,CAAC,CACjB,CAIIC,GAAM,EAGZ,OAAO,SAAWC,GAAY,MAAM,EAWpC,SAAS,MAAQ,OAAO,IAAI,aAAe,aAC3C,SAAS,SAAS,UAAWC,EAAiB,EAC9C,SAAS,SAAS,kBAAmBC,EAAwB,EAC7D,SAAS,SAAS,OAAQC,EAAc,EACxC,SAAS,SAAS,uBAAwBC,EAA4B,EACtE,SAAS,SAAS,eAAgBC,EAAqB,EACvD,SAAS,SAAS,mBAAoBC,EAAyB,EAC/D,SAAS,SAAS,QAASC,EAAe,EAC1C,SAAS,SAAS,SAAUC,EAAgB,EAE5C,SAAS,iBAAiB,aAAeC,GAAU,CACjD,SACG,iBAAiB,sDAAsD,EACvE,QAASC,GAAM,CACdA,EAAE,IAAM,WACRA,EAAE,OAAS,QACb,CAAC,CACL,CAAC",
6
+ "names": ["require_trim", "__commonJSMin", "exports", "str", "char", "require_version", "__commonJSMin", "exports", "trim_1", "version", "versionTruncation", "versionString", "versionParts", "userAgent", "engine", "geckoVersionRegex", "match", "regex", "require_variable_replacement", "__commonJSMin", "exports", "template", "variables", "regex", "match", "index", "require_memory_cache", "__commonJSMin", "exports", "memoryCacheBucket", "key", "value", "require_user_agent", "__commonJSMin", "exports", "memory_cache_1", "cache", "getRegexInstance", "rawRegex", "cachedRegexInstance", "regexInstance", "userAgent", "match", "require_browser", "__commonJSMin", "exports", "__importDefault", "mod", "version_1", "variable_replacement_1", "user_agent_1", "browsers_json_1", "browser_engine_json_1", "available_browsers_json_1", "mobile_only_browsers_json_1", "BrowserParser", "options", "userAgent", "result", "browser", "match", "vrpVersion", "version", "shortVersion", "sortedEngineVersions", "a", "b", "versionThreshold", "engineByVersion", "browserEngine", "browserName", "shortName", "name", "require_mobile_apps", "__commonJSMin", "exports", "__importDefault", "mod", "mobile_apps_json_1", "version_1", "variable_replacement_1", "user_agent_1", "MobileAppParser", "options", "userAgent", "result", "mobileApp", "match", "require_feed_readers", "__commonJSMin", "exports", "__importDefault", "mod", "feed_readers_json_1", "version_1", "variable_replacement_1", "user_agent_1", "FeedReaderParser", "options", "userAgent", "result", "feedReader", "match", "require_libraries", "__commonJSMin", "exports", "__importDefault", "mod", "libraries_json_1", "version_1", "variable_replacement_1", "user_agent_1", "LibraryParser", "options", "userAgent", "result", "library", "match", "require_media_players", "__commonJSMin", "exports", "__importDefault", "mod", "mediaplayers_json_1", "version_1", "variable_replacement_1", "user_agent_1", "MediaPlayerParser", "options", "userAgent", "result", "mediaPlayer", "match", "require_personal_information_managers", "__commonJSMin", "exports", "__importDefault", "mod", "pim_json_1", "version_1", "variable_replacement_1", "user_agent_1", "PersonalInformationManagerParser", "options", "userAgent", "result", "personalInformationManager", "match", "require_client", "__commonJSMin", "exports", "__importDefault", "mod", "browser_1", "mobile_apps_1", "feed_readers_1", "libraries_1", "media_players_1", "personal_information_managers_1", "clientParsers", "ClientParser", "options", "userAgent", "Parser", "client", "require_cameras", "__commonJSMin", "exports", "__importDefault", "mod", "cameras_json_1", "variable_replacement_1", "user_agent_1", "CameraParser", "userAgent", "result", "brand", "camera", "match", "model", "modelMatch", "require_model", "__commonJSMin", "exports", "model", "require_mobiles", "__commonJSMin", "exports", "__importDefault", "mod", "mobiles_json_1", "variable_replacement_1", "user_agent_1", "model_1", "MobileParser", "userAgent", "result", "resultType", "brand", "mobile", "match", "model", "modelMatch", "require_televisions", "__commonJSMin", "exports", "__importDefault", "mod", "televisions_json_1", "variable_replacement_1", "user_agent_1", "model_1", "TelevisionParser", "userAgent", "result", "brand", "television", "match", "model", "modelMatch", "require_cars", "__commonJSMin", "exports", "__importDefault", "mod", "car_browsers_json_1", "variable_replacement_1", "user_agent_1", "CarParser", "userAgent", "result", "brand", "car", "model", "match", "require_consoles", "__commonJSMin", "exports", "__importDefault", "mod", "consoles_json_1", "variable_replacement_1", "user_agent_1", "ConsoleParser", "userAgent", "result", "brand", "gameConsole", "match", "model", "modelMatch", "require_notebooks", "__commonJSMin", "exports", "__importDefault", "mod", "notebooks_json_1", "variable_replacement_1", "user_agent_1", "model_1", "NotebooksParser", "userAgent", "result", "brand", "notebook", "match", "model", "require_portable_media_players", "__commonJSMin", "exports", "__importDefault", "mod", "portable_media_player_json_1", "variable_replacement_1", "user_agent_1", "PortableMediaPlayersParser", "userAgent", "result", "brand", "portableMediaPlayer", "match", "model", "modelMatch", "require_device", "__commonJSMin", "exports", "__importDefault", "mod", "cameras_1", "mobiles_1", "televisions_1", "cars_1", "consoles_1", "notebooks_1", "portable_media_players_1", "deviceParsers", "ClientParser", "userAgent", "Parser", "device", "require_operating_system", "__commonJSMin", "exports", "__importDefault", "mod", "oss_json_1", "version_1", "variable_replacement_1", "user_agent_1", "operating_system_json_1", "desktopOsArray", "shortOsNames", "osFamilies", "OperatingSystemParser", "options", "userAgent", "result", "operatingSystem", "match", "osName", "osShortName", "osFamily", "shortNames", "shortName", "name", "require_vendor_fragment", "__commonJSMin", "exports", "__importDefault", "mod", "vendorfragments_json_1", "user_agent_1", "VendorFragmentParser", "userAgent", "brand", "vendorFragment", "regex", "require_bot", "__commonJSMin", "exports", "module", "__importDefault", "mod", "bots_json_1", "user_agent_1", "BotParser", "userAgent", "_a", "_b", "_c", "_d", "bot", "require_version_compare", "__commonJSMin", "exports", "v1", "v2", "operator", "x", "compare", "vm", "prepVersion", "v", "numVersion", "require_dist", "__commonJSMin", "exports", "module", "__importDefault", "mod", "client_1", "device_1", "operating_system_1", "vendor_fragment_1", "browser_1", "BotParser", "user_agent_1", "version_compare_1", "DeviceDetector", "options", "userAgent", "_a", "_b", "_c", "_d", "_e", "_f", "_g", "_h", "_j", "_k", "_l", "_m", "_o", "_p", "result", "osName", "osVersion", "osFamily", "brand", "client", "require_stackframe", "__commonJSMin", "exports", "module", "root", "factory", "_isNumber", "n", "_capitalize", "str", "_getter", "p", "booleanProps", "numericProps", "stringProps", "arrayProps", "objectProps", "props", "StackFrame", "obj", "i", "fileName", "lineNumber", "columnNumber", "functionName", "argsStartIndex", "argsEndIndex", "args", "locationString", "parts", "v", "j", "k", "require_error_stack_parser", "__commonJSMin", "exports", "module", "root", "factory", "StackFrame", "FIREFOX_SAFARI_STACK_REGEXP", "CHROME_IE_STACK_REGEXP", "SAFARI_NATIVE_CODE_REGEXP", "error", "urlLike", "regExp", "parts", "filtered", "line", "sanitizedLine", "location", "locationParts", "functionName", "fileName", "functionNameRegex", "matches", "e", "lineRE", "lines", "result", "i", "len", "match", "tokens", "functionCall", "argsRaw", "args", "require_browser_ponyfill", "__commonJSMin", "exports", "module", "global", "__self__", "F", "self", "irrelevant", "support", "isDataView", "obj", "viewClasses", "isArrayBufferView", "normalizeName", "name", "normalizeValue", "value", "iteratorFor", "items", "iterator", "Headers", "headers", "header", "oldValue", "callback", "thisArg", "consumed", "body", "fileReaderReady", "reader", "resolve", "reject", "readBlobAsArrayBuffer", "blob", "promise", "readBlobAsText", "readArrayBufferAsText", "buf", "view", "chars", "i", "bufferClone", "Body", "rejected", "decode", "methods", "normalizeMethod", "method", "upcased", "Request", "input", "options", "form", "bytes", "split", "parseHeaders", "rawHeaders", "preProcessedHeaders", "line", "parts", "key", "Response", "bodyInit", "response", "redirectStatuses", "url", "status", "message", "error", "fetch", "init", "request", "xhr", "abortXhr", "ctx", "require_treebase", "__commonJSMin", "exports", "module", "TreeBase", "data", "res", "c", "iter", "item", "cur", "cmp", "i", "Iterator", "cb", "it", "tree", "root", "save", "start", "require_rbtree", "__commonJSMin", "exports", "module", "TreeBase", "Node", "data", "dir", "val", "RBTree", "comparator", "ret", "head", "last", "gp", "ggp", "p", "node", "is_red", "dir2", "single_rotate", "double_rotate", "cmp", "found", "sr", "sibling", "gpc", "root", "save", "require_bintree", "__commonJSMin", "exports", "module", "TreeBase", "Node", "data", "dir", "val", "BinTree", "comparator", "p", "node", "head", "found", "cmp", "require_bintrees", "__commonJSMin", "exports", "module", "require_tdigest", "__commonJSMin", "exports", "module", "RBTree", "TDigest", "delta", "K", "CX", "compare_centroid_means", "everything", "result", "c", "approx", "s", "a", "b", "compare_centroid_mean_cumns", "x", "n", "i", "exact", "cumn", "iter", "prev", "nearest", "min", "max", "p", "max_n", "lower", "upper", "x_or_xlist", "xs", "ps", "bound", "p_or_plist", "qs", "h", "pop_random", "choices", "idx", "points", "Digest", "config", "extend", "dest", "i", "j", "len", "src", "create", "F", "proto", "bind", "fn", "obj", "slice", "args", "lastId", "stamp", "throttle", "time", "context", "lock", "wrapperFn", "later", "wrapNum", "x", "range", "includeMax", "max", "min", "d", "falseFn", "formatNum", "num", "precision", "pow", "trim", "str", "splitWords", "setOptions", "options", "getParamString", "existingUrl", "uppercase", "params", "templateRe", "template", "data", "key", "value", "isArray", "indexOf", "array", "el", "emptyImageUrl", "getPrefixed", "name", "lastTime", "timeoutDefer", "timeToCall", "requestFn", "cancelFn", "id", "requestAnimFrame", "immediate", "cancelAnimFrame", "Class", "props", "NewClass", "Util.setOptions", "parentProto", "Util.create", "Util.extend", "checkDeprecatedMixinEvents", "parentOptions", "init", "includes", "Util.isArray", "Events", "types", "type", "Util.splitWords", "removeAll", "_once", "newListener", "listeners", "Util.falseFn", "index", "listener", "propagate", "event", "l", "_fn", "Util.stamp", "e", "Evented", "Point", "y", "round", "trunc", "v", "point", "toPoint", "Bounds", "a", "b", "points", "min2", "max2", "toBounds", "bounds", "xIntersects", "yIntersects", "xOverlaps", "yOverlaps", "bufferRatio", "heightBuffer", "widthBuffer", "LatLngBounds", "corner1", "corner2", "latlngs", "sw", "ne", "sw2", "ne2", "LatLng", "toLatLng", "toLatLngBounds", "latIntersects", "lngIntersects", "latOverlaps", "lngOverlaps", "maxMargin", "lat", "lng", "alt", "margin", "Util.formatNum", "other", "Earth", "sizeInMeters", "latAccuracy", "lngAccuracy", "c", "CRS", "latlng", "zoom", "projectedPoint", "scale", "untransformedPoint", "Util.wrapNum", "center", "newCenter", "latShift", "lngShift", "newSw", "newNe", "latlng1", "latlng2", "rad", "lat1", "lat2", "sinDLat", "sinDLon", "earthRadius", "SphericalMercator", "sin", "Transformation", "toTransformation", "EPSG3857", "EPSG900913", "svgCreate", "pointsToPath", "rings", "closed", "len2", "p", "Browser", "style", "ie", "ielt9", "edge", "webkit", "userAgentContains", "android", "android23", "webkitVer", "androidStock", "opera", "chrome", "gecko", "safari", "phantom", "opera12", "win", "ie3d", "webkit3d", "gecko3d", "any3d", "mobile", "mobileWebkit", "mobileWebkit3d", "msPointer", "pointer", "touchNative", "touch", "mobileOpera", "mobileGecko", "retina", "passiveEvents", "supportsPassiveOption", "opts", "canvas", "svg", "inlineSvg", "div", "vml", "shape", "mac", "linux", "POINTER_DOWN", "POINTER_MOVE", "POINTER_UP", "POINTER_CANCEL", "pEvent", "handle", "_onPointerStart", "_handlePointer", "_pointers", "_pointerDocListener", "addPointerListener", "handler", "_addPointerDocListener", "removePointerListener", "_globalPointerDown", "_globalPointerMove", "_globalPointerUp", "DomEvent.preventDefault", "makeDblclick", "newEvent", "prop", "delay", "addDoubleTapListener", "last", "detail", "simDblclick", "path", "DomEvent.getPropagationPath", "now", "removeDoubleTapListener", "handlers", "TRANSFORM", "testProp", "TRANSITION", "TRANSITION_END", "get", "getStyle", "css", "tagName", "className", "container", "remove", "parent", "empty", "toFront", "toBack", "hasClass", "getClass", "addClass", "classes", "setClass", "removeClass", "Util.trim", "setOpacity", "_setOpacityIE", "filter", "filterName", "setTransform", "offset", "pos", "setPosition", "getPosition", "disableTextSelection", "enableTextSelection", "_userSelect", "DomEvent.on", "DomEvent.off", "userSelectProperty", "disableImageDrag", "enableImageDrag", "_outlineElement", "_outlineStyle", "preventOutline", "element", "restoreOutline", "getSizedParentNode", "getScale", "rect", "on", "addOne", "eventsKey", "off", "batchRemove", "removeOne", "Util.indexOf", "filterFn", "mouseSubst", "originalHandler", "isExternalTarget", "stopPropagation", "disableScrollPropagation", "disableClickPropagation", "preventDefault", "stop", "getPropagationPath", "ev", "getMousePosition", "wheelPxFactor", "getWheelDelta", "related", "PosAnimation", "newPos", "duration", "easeLinearity", "DomUtil.getPosition", "Util.requestAnimFrame", "elapsed", "progress", "DomUtil.setPosition", "Util.cancelAnimFrame", "t", "Map", "Util.bind", "DomUtil.TRANSITION", "DomUtil.TRANSITION_END", "moved", "delta", "viewHalf", "containerPoint", "centerOffset", "paddingTL", "paddingBR", "paddingOffset", "swPoint", "nePoint", "target", "DomUtil.addClass", "targetCenter", "targetZoom", "from", "to", "size", "startZoom", "w0", "w1", "u1", "rho", "rho2", "r", "s1", "s2", "t1", "b1", "sq", "log", "sinh", "n", "cosh", "tanh", "r0", "w", "s", "u", "easeOut", "start", "S", "frame", "oldZoom", "pixelCenter", "pixelPoint", "pixelBounds", "paddedBounds", "paddedSize", "oldSize", "newSize", "oldCenter", "onResponse", "onError", "error", "message", "HandlerClass", "DomUtil.remove", "pane", "DomUtil.create", "inside", "padding", "nw", "se", "boundsSize", "snap", "scalex", "scaley", "topLeftPoint", "toZoom", "fromZoom", "crs", "layerPoint", "DomEvent.getMousePosition", "DomUtil.get", "position", "DomUtil.getStyle", "panes", "noMoveStart", "loading", "zoomChanged", "supressEvent", "onOff", "targets", "isHover", "dragging", "DomEvent.isExternalTarget", "DomUtil.preventOutline", "canvasTargets", "synth", "filtered", "isMarker", "callback", "pixelOrigin", "topLeft", "latLngBounds", "centerPoint", "viewBounds", "newBounds", "pxBounds", "maxBounds", "projectedMaxBounds", "minOffset", "maxOffset", "dx", "dy", "left", "right", "DomUtil.removeClass", "proxy", "DomUtil.TRANSFORM", "transform", "DomUtil.setTransform", "z", "startAnim", "noUpdate", "createMap", "Control", "map", "corner", "control", "corners", "createCorner", "vSide", "hSide", "Layers", "layerA", "layerB", "nameA", "nameB", "baseLayers", "overlays", "layer", "acceptableHeight", "collapsed", "DomEvent.disableClickPropagation", "DomEvent.disableScrollPropagation", "section", "link", "overlay", "DomUtil.empty", "baseLayersPresent", "overlaysPresent", "baseLayersCount", "checked", "radioHtml", "radioFragment", "label", "input", "holder", "inputs", "addedLayers", "removedLayers", "that", "layers", "Zoom", "zoomName", "html", "title", "DomEvent.stop", "Scale", "maxMeters", "meters", "maxFeet", "maxMiles", "miles", "feet", "text", "ratio", "pow10", "ukrainianFlag", "Attribution", "prefix", "attribs", "prefixAndAttribs", "attribution", "Handler", "Mixin", "START", "Draggable", "dragStartTarget", "DomUtil.hasClass", "DomUtil.disableImageDrag", "DomUtil.disableTextSelection", "first", "sizedParent", "DomUtil.getSizedParentNode", "DomUtil.getScale", "mouseevent", "noInertia", "DomUtil.enableImageDrag", "DomUtil.enableTextSelection", "fireDragend", "clipPolygon", "clippedPoints", "edges", "k", "LineUtil._getBitCode", "LineUtil._getEdgeIntersection", "polygonCenter", "p1", "p2", "f", "area", "LineUtil.isFlat", "centroidLatLng", "areaBounds", "centroid", "latlngCenter", "coords", "latSum", "lngSum", "simplify", "tolerance", "sqTolerance", "_reducePoints", "_simplifyDP", "pointToSegmentDistance", "_sqClosestPointOnSegment", "closestPointOnSegment", "ArrayConstructor", "markers", "_simplifyDPStep", "newPoints", "maxSqDist", "sqDist", "reducedPoints", "prev", "_sqDist", "_lastCode", "clipSegment", "useLastCode", "codeA", "_getBitCode", "codeB", "codeOut", "newCode", "_getEdgeIntersection", "code", "dot", "isFlat", "_flat", "polylineCenter", "halfDist", "segDist", "dist", "LonLat", "Mercator", "tmp", "con", "ts", "phi", "dphi", "EPSG3395", "EPSG4326", "Simple", "Layer", "targetEl", "events", "method", "minZoom", "maxZoom", "oldZoomSpan", "LayerGroup", "layerId", "methodName", "zIndex", "layerGroup", "FeatureGroup", "featureGroup", "Icon", "oldIcon", "img", "sizeOption", "anchor", "icon", "IconDefault", "strip", "re", "idx", "match", "MarkerDrag", "marker", "speed", "iconPos", "origin", "panBounds", "movement", "shadow", "Marker", "latLng", "oldLatLng", "classToAdd", "addIcon", "newShadow", "addShadow", "opt", "draggable", "opacity", "DomUtil.setOpacity", "iconOpts", "Path", "CircleMarker", "radius", "r2", "circleMarker", "Circle", "legacyOptions", "half", "latR", "top", "bottom", "lngR", "circle", "Polyline", "minDistance", "minPoint", "closest", "LineUtil._sqClosestPointOnSegment", "jLen", "LineUtil.polylineCenter", "result", "flat", "projectedBounds", "ring", "parts", "segment", "LineUtil.clipSegment", "LineUtil.simplify", "part", "LineUtil.pointToSegmentDistance", "polyline", "LineUtil._flat", "Polygon", "PolyUtil.polygonCenter", "clipped", "PolyUtil.clipPolygon", "polygon", "GeoJSON", "geojson", "features", "feature", "geometryToLayer", "asFeature", "geometry", "pointToLayer", "_coordsToLatLng", "coordsToLatLng", "_pointToLayer", "coordsToLatLngs", "geoLayer", "featureLayer", "pointToLayerFn", "levelsDeep", "latLngToCoords", "latLngsToCoords", "getFeature", "newGeometry", "PointToGeoJSON", "multi", "holes", "isGeometryCollection", "jsons", "json", "geoJSON", "geoJson", "ImageOverlay", "url", "styleOpts", "DomUtil.toFront", "DomUtil.toBack", "wasElementSupplied", "image", "errorUrl", "imageOverlay", "VideoOverlay", "vid", "sourceElements", "sources", "source", "videoOverlay", "video", "SVGOverlay", "svgOverlay", "DivOverlay", "content", "node", "OverlayClass", "old", "Popup", "DomEvent.stopPropagation", "wrapper", "closeButton", "width", "height", "maxHeight", "scrolledClass", "marginBottom", "containerHeight", "containerWidth", "layerPos", "containerPos", "popup", "Tooltip", "subX", "subY", "tooltipPoint", "direction", "tooltipWidth", "tooltipHeight", "tooltip", "DivIcon", "bgPos", "divIcon", "GridLayer", "tileZoom", "Util.throttle", "compare", "edgeZIndex", "nextFrame", "willPrune", "tile", "fade", "level", "x2", "y2", "z2", "coords2", "animating", "noPrune", "tileZoomChanged", "translate", "tileSize", "mapZoom", "halfSize", "tileRange", "tileCenter", "queue", "noPruneRange", "fragment", "tileBounds", "nwPoint", "sePoint", "bp", "tilePos", "err", "newCoords", "gridLayer", "TileLayer", "noRedraw", "done", "invertedY", "Util.template", "zoomReverse", "zoomOffset", "tilePoint", "Util.emptyImageUrl", "tileLayer", "TileLayerWMS", "wmsParams", "realRetina", "projectionKey", "bbox", "tileLayerWMS", "Renderer", "currentCenterPoint", "topLeftOffset", "Canvas", "m", "order", "next", "dashArray", "dashValue", "ctx", "clickedLayer", "candidateHoveredLayer", "vmlCreate", "vmlMixin", "stroke", "fill", "SVG", "arc", "renderer", "Rectangle", "rectangle", "BoxZoom", "DoubleClickZoom", "Drag", "pxCenter", "pxWorldCenter", "threshold", "limit", "worldWidth", "halfWidth", "newX1", "newX2", "newX", "ease", "speedVector", "limitedSpeed", "limitedSpeedVector", "decelerationDuration", "Keyboard", "body", "docEl", "panDelta", "keys", "codes", "zoomDelta", "newLatLng", "ScrollWheelZoom", "DomEvent.getWheelDelta", "debounce", "d2", "d3", "d4", "tapHoldDelay", "TapHold", "cancelClickPrevent", "simulatedEvent", "TouchZoom", "moveFn", "import_device_detector_js", "finallyConstructor", "callback", "constructor", "value", "reason", "finally_default", "allSettled", "arr", "P", "resolve", "reject", "args", "remaining", "res", "i", "val", "then", "e", "allSettled_default", "setTimeoutFunc", "isArray", "x", "noop", "bind", "fn", "thisArg", "Promise", "doResolve", "handle", "self", "deferred", "cb", "resolve", "reject", "ret", "e", "newValue", "then", "finale", "i", "len", "Handler", "onFulfilled", "onRejected", "promise", "done", "value", "reason", "ex", "prom", "finally_default", "arr", "args", "remaining", "res", "val", "allSettled_default", "err", "src_default", "FILTERED", "MAX_OBJ_LENGTH", "jsonifyNotice", "notice", "_a", "_b", "_c", "maxLength", "_d", "keysBlocklist", "i", "t", "Truncator", "s", "keys", "level", "opts", "_i", "keys_1", "key", "obj", "truncate", "params", "_e", "keys_2", "err", "scale", "num", "value", "depth", "type", "objectType", "saved", "index", "path", "sub", "getAttr", "arr", "length", "dst", "el", "isBlocklisted", "attr", "keysBlocklist_1", "v", "Span", "metric", "name", "startTime", "endTime", "now", "BaseMetric", "endTime", "name", "startTime", "span", "Span", "ms", "NoopMetric", "_name", "_startTime", "_ms", "Scope", "NoopMetric", "clone", "__assign", "context", "ctx", "state", "key", "metric", "import_error_stack_parser", "hasConsole", "parse", "err", "ErrorStackParser", "parseErr", "espProcessor", "backtrace", "frames_2", "fakeErr", "_i", "frames_1", "frame", "type", "msg", "re", "angularMessageFilter", "notice", "err", "m", "makeDebounceFilter", "lastNoticeJSON", "timeout", "notice", "s", "IGNORED_MESSAGES", "ignoreNoiseFilter", "notice", "err", "frame", "re", "uncaughtMessageFilter", "notice", "err", "m", "import_cross_fetch", "errors", "rateLimitReset", "request", "req", "utime", "src_default", "errors", "opt", "fetch", "resp", "s", "n", "json", "err", "body", "makeRequester", "api", "req", "request", "rateLimitReset", "utime", "src_default", "errors", "resolve", "reject", "error", "resp", "body", "s", "n", "json", "err", "makeRequester", "opts", "request", "tdigest", "hasTdigest", "TDigestStat", "ms", "tdigestCentroids", "TDigestStatGroups", "_super", "__extends", "_this", "totalMs", "groups", "name_1", "name", "ms", "stat", "TDigestStat", "tdigestCentroids", "tdigestCentroids", "td", "means", "counts", "c", "FLUSH_INTERVAL", "QueryInfo", "query", "QueriesStats", "opt", "makeRequester", "query", "QueryInfo", "q", "_this", "hasTdigest", "ms", "minute", "startTime", "key", "keyStr", "stat", "TDigestStat", "FLUSH_INTERVAL", "queries", "v", "__assign", "outJSON", "req", "_resp", "err", "FLUSH_INTERVAL", "QueueMetric", "_super", "__extends", "queue", "_this", "BaseMetric", "QueuesStats", "opt", "makeRequester", "q", "_this", "hasTdigest", "ms", "minute", "startTime", "key", "keyStr", "stat", "TDigestStatGroups", "FLUSH_INTERVAL", "queues", "v", "__assign", "outJSON", "req", "_resp", "err", "FLUSH_INTERVAL", "RouteMetric", "_super", "__extends", "method", "route", "statusCode", "contentType", "_this", "BaseMetric", "RoutesStats", "opt", "makeRequester", "req", "_this", "hasTdigest", "ms", "minute", "startTime", "key", "keyStr", "stat", "TDigestStat", "FLUSH_INTERVAL", "routes", "v", "__assign", "outJSON", "_resp", "err", "RoutesBreakdowns", "opt", "makeRequester", "req", "_this", "hasTdigest", "ms", "minute", "startTime", "key", "keyStr", "stat", "TDigestStatGroups", "FLUSH_INTERVAL", "routes", "v", "__assign", "outJSON", "_resp", "err", "NOTIFIER_NAME", "NOTIFIER_VERSION", "NOTIFIER_URL", "BaseNotifier", "opt", "_this", "Scope", "espProcessor", "makeRequester", "ignoreNoiseFilter", "makeDebounceFilter", "uncaughtMessageFilter", "angularMessageFilter", "notice", "NOTIFIER_NAME", "NOTIFIER_VERSION", "NOTIFIER_URL", "Routes", "Queues", "QueriesStats", "_i", "_a", "fn", "scope", "filter", "performanceFilter", "err", "__assign", "src_default", "error", "r", "body", "jsonifyNotice", "req", "resp", "props", "client", "airbrakeWrapper", "fnArgs", "wrappedArgs", "prop", "props_1", "args", "i", "arg", "_args", "wrapper", "Routes", "notifier", "RoutesStats", "RoutesBreakdowns", "method", "route", "statusCode", "contentType", "metric", "RouteMetric", "scope", "req", "_i", "_a", "performanceFilter", "Queues", "QueuesStats", "queue", "QueueMetric", "q", "windowFilter", "notice", "CONSOLE_METHODS", "instrumentConsole", "notifier", "m", "oldFn", "newFn", "args", "_i", "CONSOLE_METHODS_1", "elemAttrs", "instrumentDOM", "notifier", "handler", "makeEventHandler", "event", "getProp", "target", "state", "elemPath", "err", "elemName", "elem", "s", "str", "classNameString", "_i", "elemAttrs_1", "attr", "value", "name", "maxLen", "path", "parent", "name_1", "obj", "prop", "instrumentFetch", "notifier", "oldFetch", "req", "options", "state", "resp", "err", "lastLocation", "getCurrentLocation", "instrumentLocation", "notifier", "oldFn", "_event", "url", "recordLocation", "oldPushState", "_state", "_title", "index", "instrumentXHR", "notifier", "recordReq", "req", "state", "oldOpen", "method", "url", "_async", "_user", "_password", "oldSend", "_data", "oldFn", "_ev", "Notifier", "_super", "__extends", "opt", "_this", "windowFilter", "isDevEnv", "enabled", "self_1", "oldHandler_1", "instrumentDOM", "instrumentFetch", "instrumentLocation", "instrumentConsole", "instrumentXHR", "err", "src_default", "resolve", "reject", "j", "this_1", "notice", "_i", "_a", "e", "reason", "msg", "__assign", "message", "filename", "line", "column", "BaseNotifier", "isDevEnv", "env", "enabled", "v", "BuiltInHTMLElement", "wrapperForTheName", "prototype", "submitter", "validateSubmitter", "form", "raise", "errorConstructor", "message", "name", "submittersByForm", "findSubmitterFromClickTarget", "target", "element", "candidate", "clickCaptured", "event", "FrameLoadingStyle", "FrameElement", "value", "frameLoadingStyleFromString", "_a", "_b", "style", "expandURL", "locatable", "getAnchor", "url", "anchorMatch", "getAction", "action", "getExtension", "getLastPathComponent", "isHTML", "isPrefixedBy", "baseURL", "prefix", "getPrefix", "locationIsVisitable", "location", "rootLocation", "getRequestURL", "anchor", "toCacheKey", "urlsAreEqual", "left", "right", "getPathComponents", "addTrailingSlash", "FetchResponse", "response", "isAction", "activateScriptElement", "createdScriptElement", "cspNonce", "getMetaContent", "copyElementAttributes", "destinationElement", "sourceElement", "createDocumentFragment", "html", "template", "dispatch", "eventName", "cancelable", "detail", "nextAnimationFrame", "resolve", "nextEventLoopTick", "nextMicrotask", "parseHTMLDocument", "unindent", "strings", "values", "lines", "interpolate", "match", "indent", "line", "result", "string", "i", "uuid", "_", "getAttribute", "attributeName", "elements", "hasAttribute", "markAsBusy", "clearBusyState", "waitForLoad", "timeoutInMilliseconds", "onComplete", "getHistoryMethodForAction", "getVisitAction", "getMetaElement", "setMetaContent", "content", "FetchMethod", "fetchMethodFromString", "method", "FetchRequest", "delegate", "body", "_value", "fetchOptions", "error", "fetchResponse", "mimeType", "requestInterception", "AppearanceObserver", "entries", "lastEntry", "StreamMessage", "fragment", "importStreamElements", "streamElement", "inertScriptElement", "FormSubmissionState", "FormEnctype", "formEnctypeFromString", "encoding", "FormSubmission", "formElement", "mustRedirect", "buildFormData", "mergeFormDataEntries", "_element", "_submitter", "formElementAction", "initialized", "requesting", "confirmationMessage", "stopping", "stopped", "headers", "request", "token", "getCookieValue", "_request", "responseSucceededWithoutRedirect", "formData", "cookieName", "cookie", "searchParams", "Snapshot", "inertDisabledOrHidden", "queryPermanentElementsAll", "id", "getPermanentElementById", "snapshot", "permanentElementMap", "currentPermanentElement", "newPermanentElement", "node", "FormSubmitObserver", "eventTarget", "submissionDoesNotDismissDialog", "submissionDoesNotTargetIFrame", "View", "x", "y", "renderer", "isPreview", "shouldRender", "renderInterception", "options", "reason", "FrameView", "LinkInterceptor", "_event", "LinkClickObserver", "link", "doesNotTargetIFrame", "FormLinkClickObserver", "originalEvent", "turboFrame", "turboAction", "turboConfirm", "Bardo", "callback", "bardo", "permanentElement", "placeholder", "createPlaceholderForPermanentElement", "clone", "Renderer", "currentSnapshot", "newSnapshot", "renderElement", "willRender", "reject", "elementIsFocusable", "FrameRenderer", "currentElement", "newElement", "destinationRange", "frameElement", "sourceRange", "block", "readScrollLogicalPosition", "behavior", "readScrollBehavior", "activatedScriptElement", "defaultValue", "ProgressBar", "HeadSnapshot", "elementIsNoscript", "elementWithoutNonce", "outerHTML", "details", "elementType", "elementIsTracked", "matchedType", "type", "tracked", "elementIsMetaElementWithName", "elementIsScript", "elementIsStylesheet", "tagName", "PageSnapshot", "headSnapshot", "head", "clonedElement", "selectElements", "clonedSelectElements", "index", "source", "option", "clonedPasswordInput", "root", "TimingMetric", "VisitState", "defaultOptions", "SystemStatusCode", "Visit", "restorationIdentifier", "historyChanged", "referrer", "snapshotHTML", "visitCachedSnapshot", "updateHistory", "shouldCacheSnapshot", "acceptsStreamResponse", "actionForHistory", "statusCode", "isSuccessful", "responseHTML", "_response", "redirected", "_error", "scrollPosition", "metric", "BrowserAdapter", "session", "visit", "_visit", "_formSubmission", "CacheObserver", "staleElements", "FrameRedirector", "_location", "frame", "meta", "History", "turbo", "state", "additionalData", "restorationData", "Navigator", "formSubmission", "visitOptions", "currentAnchor", "isRestorationToTop", "oldURL", "newURL", "PageStage", "PageObserver", "readyState", "ScrollObserver", "position", "StreamMessageRenderer", "getPermanentElementMapForFragment", "permanentElementsInDocument", "permanentElementInDocument", "elementInStream", "StreamObserver", "fetchResponseFromEvent", "fetchResponseIsStream", "ErrorRenderer", "documentElement", "replaceableElement", "parentNode", "PageRenderer", "newStylesheetElements", "loadingElements", "SnapshotCache", "size", "key", "PageView", "cachedSnapshot", "Preloader", "responseText", "Session", "adapter", "delay", "mode", "extendURLWithDeprecatedProperties", "defaultPrevented", "render", "_snapshot", "_isPreview", "ev", "newBody", "timing", "submitterIsNavigatable", "container", "withinFrame", "deprecatedLocationPropertyDescriptors", "Cache", "StreamActions", "e", "cache", "navigator$1", "start", "registerAdapter", "connectStreamSource", "disconnectStreamSource", "renderStreamMessage", "clearCache", "setProgressBarDelay", "setConfirmMethod", "confirmMethod", "setFormMode", "Turbo", "FrameController", "_fetchResponse", "src", "newFrameElement", "fetchRequest", "newFrame", "_newElement", "wrapped", "getFrameElementById", "activateElement", "sourceURL", "currentURL", "StreamElement", "c", "existingChildren", "newChildrenIds", "actionFunction", "StreamSourceElement", "EventListener", "eventTarget", "eventName", "eventOptions", "binding", "event", "extendedEvent", "extendEvent", "left", "right", "leftIndex", "rightIndex", "stopImmediatePropagation", "Dispatcher", "application", "eventListener", "listeners", "map", "clearEventListeners", "error", "message", "detail", "eventListenerMap", "cacheKey", "parts", "key", "defaultActionDescriptorFilters", "value", "element", "descriptorPattern", "parseActionDescriptorString", "descriptorString", "matches", "keyFilter", "parseEventTarget", "parseEventOptions", "eventTargetName", "options", "token", "stringifyEventTarget", "camelize", "_", "char", "namespaceCamelize", "capitalize", "dasherize", "tokenize", "Action", "index", "descriptor", "schema", "getDefaultEventNameForElement", "eventFilter", "filteres", "modifiers", "meta", "ctrl", "alt", "shift", "modifier", "standardFilter", "params", "pattern", "name", "match", "typecast", "defaultEventNames", "e", "tagName", "Binding", "context", "action", "method", "actionDescriptorFilters", "passes", "filter", "target", "currentTarget", "actionEvent", "identifier", "controller", "ElementObserver", "delegate", "mutations", "callback", "mutation", "node", "attributeName", "nodes", "tree", "processor", "AttributeObserver", "add", "fetch", "del", "prune", "values", "Multimap", "set", "size", "_key", "_values", "SelectorObserver", "element", "selector", "delegate", "details", "ElementObserver", "Multimap", "callback", "matches", "tree", "match", "_attributeName", "matchedBefore", "StringMapObserver", "mutations", "attributeName", "mutation", "oldValue", "key", "value", "attribute", "TokenListObserver", "AttributeObserver", "unmatchedTokens", "matchedTokens", "tokens", "token", "previousTokens", "currentTokens", "firstDifferingIndex", "zip", "previousToken", "currentToken", "tokensAreEqual", "tokenString", "parseTokenString", "content", "index", "left", "right", "length", "_", "ValueListObserver", "parseResult", "valuesByToken", "error", "BindingObserver", "context", "action", "binding", "Binding", "Action", "ValueObserver", "receiver", "descriptor", "name", "defaultValue", "writer", "rawValue", "rawOldValue", "changedMethodName", "changedMethod", "valueDescriptorMap", "descriptors", "hasMethodName", "capitalize", "TargetObserver", "_a", "readInheritableStaticArrayValues", "constructor", "propertyName", "ancestors", "getAncestorsForConstructor", "values", "getOwnStaticArrayValues", "readInheritableStaticObjectPairs", "pairs", "getOwnStaticObjectPairs", "definition", "OutletObserver", "outletName", "observer", "_selector", "outlet", "dependencies", "module", "identifiers", "Context", "scope", "functionName", "detail", "identifier", "controller", "message", "namespaceCamelize", "methodName", "args", "bless", "shadow", "getBlessedProperties", "properties", "shadowConstructor", "extend", "shadowProperties", "getShadowProperties", "blessedProperties", "blessing", "prototype", "getOwnKeys", "getShadowedDescriptor", "shadowingDescriptor", "object", "extendWithReflect", "extended", "testReflectExtension", "b", "blessDefinition", "Module", "application", "ClassMap", "tokenize", "DataMap", "dasherize", "Guide", "logger", "warnedKeys", "attributeValueContainsToken", "TargetSet", "targetName", "targetNames", "target", "targets", "targetDescriptor", "revisedAttributeName", "OutletSet", "controllerElement", "outletNames", "outlets", "controllerAttribute", "Scope", "schema", "ScopeObserver", "scopesByIdentifier", "referenceCount", "Router", "contexts", "afterLoad", "defaultSchema", "objectFromEntries", "c", "n", "array", "memo", "k", "v", "Application", "Dispatcher", "defaultActionDescriptorFilters", "domReady", "controllerConstructor", "filter", "head", "rest", "resolve", "ClassPropertiesBlessing", "classDefinition", "propertiesForClassDefinition", "classes", "OutletPropertiesBlessing", "outletDefinition", "propertiesForOutletDefinition", "camelizedName", "outletController", "TargetPropertiesBlessing", "targetDefinition", "propertiesForTargetDefinition", "ValuePropertiesBlessing", "valueDefinitionPairs", "propertyDescriptorMap", "result", "valueDefinitionPair", "valueDescriptor", "parseValueDefinitionPair", "propertiesForValueDefinitionPair", "read", "write", "typeDefinition", "valueDescriptorForTokenAndTypeDefinition", "parseValueTypeConstant", "constant", "parseValueTypeDefault", "parseValueTypeObject", "payload", "typeFromObject", "defaultValueType", "propertyPath", "parseValueTypeDefinition", "typeFromDefaultValue", "typeFromConstant", "type", "defaultValueForDefinition", "defaultValuesByType", "camelize", "readers", "writers", "writeString", "writeJSON", "Controller", "_identifier", "_application", "eventName", "prefix", "bubbles", "cancelable", "event", "contact_controller_default", "Controller", "submitTarget", "delay", "newValue", "oldValue", "__publicField", "device_detector_controller_default", "Controller", "event", "style", "__publicField", "drop_controller_default", "Controller", "previewTarget", "event", "imageRe", "file", "f", "dataTransfer", "__publicField", "import_leaflet", "MODE_HYDRATE", "slice", "options", "vnodeId", "isValidElement", "rerenderQueue", "prevDebounce", "defer", "depthSort", "i", "EMPTY_OBJ", "EMPTY_ARR", "IS_NON_DIMENSIONAL", "isArray", "Array", "assign", "obj", "props", "removeNode", "node", "parentNode", "removeChild", "createElement", "type", "children", "key", "ref", "normalizedProps", "arguments", "length", "call", "defaultProps", "createVNode", "original", "vnode", "__k", "__", "__b", "__e", "__d", "__c", "constructor", "__v", "__i", "__u", "Fragment", "props", "children", "BaseComponent", "context", "this", "getDomSibling", "vnode", "childIndex", "__", "sibling", "__k", "length", "__e", "type", "updateParentDomPointers", "i", "child", "__c", "base", "enqueueRender", "c", "__d", "rerenderQueue", "push", "process", "prevDebounce", "options", "debounceRendering", "defer", "renderQueueLength", "component", "newVNode", "oldVNode", "oldDom", "parentDom", "commitQueue", "refQueue", "sort", "depthSort", "shift", "__v", "__P", "assign", "diff", "__n", "ownerSVGElement", "__u", "__i", "commitRoot", "diffChildren", "renderResult", "newParentVNode", "oldParentVNode", "globalContext", "isSvg", "excessDomChildren", "isHydrating", "childVNode", "newDom", "firstChildDom", "oldChildren", "EMPTY_ARR", "newChildrenLength", "constructNewChildrenArray", "EMPTY_OBJ", "ref", "applyRef", "insert", "nextSibling", "skewedIndex", "matchingIndex", "oldChildrenLength", "remainingOldChildren", "skew", "constructor", "String", "createVNode", "isArray", "__b", "key", "findMatchingIndex", "unmount", "parentVNode", "insertBefore", "findMatchingIndex", "childVNode", "oldChildren", "skewedIndex", "remainingOldChildren", "key", "type", "x", "y", "oldVNode", "length", "__u", "setStyle", "style", "value", "setProperty", "IS_NON_DIMENSIONAL", "test", "dom", "name", "oldValue", "isSvg", "useCapture", "o", "cssText", "replace", "toLowerCase", "slice", "l", "_attached", "Date", "now", "addEventListener", "eventProxyCapture", "eventProxy", "removeEventListener", "removeAttribute", "setAttribute", "e", "eventHandler", "this", "_dispatched", "options", "event", "diff", "parentDom", "newVNode", "globalContext", "excessDomChildren", "commitQueue", "oldDom", "isHydrating", "refQueue", "tmp", "c", "isNew", "oldProps", "oldState", "snapshot", "clearProcessingException", "newProps", "provider", "componentContext", "i", "renderHook", "count", "renderResult", "newType", "constructor", "__e", "__b", "outer", "props", "contextType", "__c", "__", "__E", "prototype", "render", "BaseComponent", "doRender", "sub", "state", "context", "__n", "__d", "__h", "_sb", "__s", "getDerivedStateFromProps", "assign", "__v", "componentWillMount", "componentDidMount", "push", "componentWillReceiveProps", "shouldComponentUpdate", "__k", "forEach", "vnode", "componentWillUpdate", "componentDidUpdate", "__P", "__r", "getChildContext", "getSnapshotBeforeUpdate", "diffChildren", "isArray", "Fragment", "children", "base", "MODE_HYDRATE", "indexOf", "diffElementNodes", "diffed", "commitRoot", "root", "applyRef", "some", "cb", "call", "newHtml", "oldHtml", "newChildren", "inputValue", "checked", "nodeType", "localName", "document", "createTextNode", "createElementNS", "createElement", "is", "data", "childNodes", "EMPTY_OBJ", "attributes", "__html", "innerHTML", "getDomSibling", "removeNode", "ref", "current", "unmount", "parentVNode", "skipRemove", "r", "componentWillUnmount", "replaceNode", "ownerSVGElement", "firstChild", "slice", "EMPTY_ARR", "options", "__e", "error", "vnode", "oldVNode", "errorInfo", "component", "ctor", "handled", "__", "__c", "constructor", "getDerivedStateFromError", "setState", "__d", "componentDidCatch", "__E", "e", "vnodeId", "isValidElement", "undefined", "BaseComponent", "prototype", "update", "callback", "s", "this", "__s", "state", "assign", "props", "__v", "_sb", "push", "enqueueRender", "forceUpdate", "__h", "render", "Fragment", "rerenderQueue", "defer", "Promise", "then", "bind", "resolve", "setTimeout", "depthSort", "a", "b", "__b", "process", "__r", "i", "currentIndex", "currentComponent", "previousComponent", "prevRaf", "currentHook", "afterPaintEffects", "EMPTY", "oldBeforeDiff", "options", "__b", "oldBeforeRender", "__r", "oldAfterDiff", "diffed", "oldCommit", "__c", "oldBeforeUnmount", "unmount", "getHookState", "index", "type", "__h", "hooks", "__H", "__", "length", "push", "__V", "useState", "initialState", "useReducer", "invokeOrReturn", "reducer", "init", "hookState", "_reducer", "action", "currentValue", "__N", "nextValue", "setState", "_hasScuFromHooks", "updateHookState", "p", "s", "c", "stateHooks", "filter", "x", "every", "prevScu", "call", "this", "shouldUpdate", "forEach", "hookItem", "props", "shouldComponentUpdate", "prevCWU", "componentWillUpdate", "__e", "tmp", "useEffect", "callback", "args", "state", "__s", "argsChanged", "_pendingArgs", "flushAfterPaintEffects", "component", "afterPaintEffects", "shift", "__P", "__H", "__h", "forEach", "invokeCleanup", "invokeEffect", "e", "options", "__e", "__v", "__b", "vnode", "currentComponent", "oldBeforeDiff", "__r", "oldBeforeRender", "currentIndex", "hooks", "__c", "previousComponent", "__", "hookItem", "__N", "EMPTY", "_pendingArgs", "diffed", "oldAfterDiff", "c", "length", "push", "prevRaf", "requestAnimationFrame", "afterNextFrame", "__V", "commitQueue", "some", "filter", "cb", "oldCommit", "unmount", "oldBeforeUnmount", "hasErrored", "s", "HAS_RAF", "callback", "raf", "done", "clearTimeout", "timeout", "cancelAnimationFrame", "setTimeout", "hook", "comp", "cleanup", "argsChanged", "oldArgs", "newArgs", "arg", "index", "invokeOrReturn", "f", "_typeof", "o", "toInteger", "dirtyNumber", "number", "requiredArgs", "required", "args", "toDate", "argument", "requiredArgs", "argStr", "_typeof", "addMilliseconds", "dirtyDate", "dirtyAmount", "requiredArgs", "timestamp", "toDate", "amount", "toInteger", "defaultOptions", "getDefaultOptions", "getTimezoneOffsetInMilliseconds", "date", "utcDate", "startOfDay", "dirtyDate", "requiredArgs", "date", "toDate", "MILLISECONDS_IN_DAY", "differenceInCalendarDays", "dirtyDateLeft", "dirtyDateRight", "requiredArgs", "startOfDayLeft", "startOfDay", "startOfDayRight", "timestampLeft", "getTimezoneOffsetInMilliseconds", "timestampRight", "daysInYear", "maxTime", "millisecondsInMinute", "millisecondsInHour", "minTime", "maxTime", "secondsInHour", "secondsInDay", "secondsInHour", "secondsInWeek", "secondsInYear", "daysInYear", "secondsInMonth", "secondsInQuarter", "isDate", "value", "requiredArgs", "_typeof", "isValid", "dirtyDate", "requiredArgs", "isDate", "date", "toDate", "subMilliseconds", "dirtyDate", "dirtyAmount", "requiredArgs", "amount", "toInteger", "addMilliseconds", "MILLISECONDS_IN_DAY", "getUTCDayOfYear", "dirtyDate", "requiredArgs", "date", "toDate", "timestamp", "startOfYearTimestamp", "difference", "startOfUTCISOWeek", "dirtyDate", "requiredArgs", "weekStartsOn", "date", "toDate", "day", "diff", "getUTCISOWeekYear", "dirtyDate", "requiredArgs", "date", "toDate", "year", "fourthOfJanuaryOfNextYear", "startOfNextYear", "startOfUTCISOWeek", "fourthOfJanuaryOfThisYear", "startOfThisYear", "startOfUTCISOWeekYear", "dirtyDate", "requiredArgs", "year", "getUTCISOWeekYear", "fourthOfJanuary", "date", "startOfUTCISOWeek", "MILLISECONDS_IN_WEEK", "getUTCISOWeek", "dirtyDate", "requiredArgs", "date", "toDate", "diff", "startOfUTCISOWeek", "startOfUTCISOWeekYear", "startOfUTCWeek", "dirtyDate", "options", "_ref", "_ref2", "_ref3", "_options$weekStartsOn", "_options$locale", "_options$locale$optio", "_defaultOptions$local", "_defaultOptions$local2", "requiredArgs", "defaultOptions", "getDefaultOptions", "weekStartsOn", "toInteger", "date", "toDate", "day", "diff", "getUTCWeekYear", "dirtyDate", "options", "_ref", "_ref2", "_ref3", "_options$firstWeekCon", "_options$locale", "_options$locale$optio", "_defaultOptions$local", "_defaultOptions$local2", "requiredArgs", "date", "toDate", "year", "defaultOptions", "getDefaultOptions", "firstWeekContainsDate", "toInteger", "firstWeekOfNextYear", "startOfNextYear", "startOfUTCWeek", "firstWeekOfThisYear", "startOfThisYear", "startOfUTCWeekYear", "dirtyDate", "options", "_ref", "_ref2", "_ref3", "_options$firstWeekCon", "_options$locale", "_options$locale$optio", "_defaultOptions$local", "_defaultOptions$local2", "requiredArgs", "defaultOptions", "getDefaultOptions", "firstWeekContainsDate", "toInteger", "year", "getUTCWeekYear", "firstWeek", "date", "startOfUTCWeek", "MILLISECONDS_IN_WEEK", "getUTCWeek", "dirtyDate", "options", "requiredArgs", "date", "toDate", "diff", "startOfUTCWeek", "startOfUTCWeekYear", "addLeadingZeros", "number", "targetLength", "sign", "output", "formatters", "date", "token", "signedYear", "year", "addLeadingZeros", "month", "dayPeriodEnumValue", "numberOfDigits", "milliseconds", "fractionalSeconds", "lightFormatters_default", "dayPeriodEnum", "formatters", "date", "token", "localize", "era", "signedYear", "year", "lightFormatters_default", "options", "signedWeekYear", "getUTCWeekYear", "weekYear", "twoDigitYear", "addLeadingZeros", "isoWeekYear", "getUTCISOWeekYear", "quarter", "month", "week", "getUTCWeek", "isoWeek", "getUTCISOWeek", "dayOfYear", "getUTCDayOfYear", "dayOfWeek", "localDayOfWeek", "isoDayOfWeek", "hours", "dayPeriodEnumValue", "_localize", "originalDate", "timezoneOffset", "formatTimezoneWithOptionalMinutes", "formatTimezone", "formatTimezoneShort", "timestamp", "offset", "dirtyDelimiter", "sign", "absOffset", "minutes", "delimiter", "formatters_default", "dateLongFormatter", "pattern", "formatLong", "timeLongFormatter", "dateTimeLongFormatter", "matchResult", "datePattern", "timePattern", "dateTimeFormat", "longFormatters", "longFormatters_default", "protectedDayOfYearTokens", "protectedWeekYearTokens", "isProtectedDayOfYearToken", "token", "isProtectedWeekYearToken", "throwProtectedError", "format", "input", "formatDistanceLocale", "formatDistance", "token", "count", "options", "result", "tokenValue", "formatDistance_default", "buildFormatLongFn", "args", "options", "width", "format", "dateFormats", "timeFormats", "dateTimeFormats", "formatLong", "buildFormatLongFn", "formatLong_default", "formatRelativeLocale", "formatRelative", "token", "_date", "_baseDate", "_options", "formatRelative_default", "buildLocalizeFn", "args", "dirtyIndex", "options", "context", "valuesArray", "defaultWidth", "width", "_defaultWidth", "_width", "index", "eraValues", "quarterValues", "monthValues", "dayValues", "dayPeriodValues", "formattingDayPeriodValues", "ordinalNumber", "dirtyNumber", "_options", "number", "rem100", "localize", "buildLocalizeFn", "quarter", "localize_default", "buildMatchFn", "args", "string", "options", "width", "matchPattern", "matchResult", "matchedString", "parsePatterns", "key", "findIndex", "pattern", "findKey", "value", "rest", "object", "predicate", "array", "buildMatchPatternFn", "args", "string", "options", "matchResult", "matchedString", "parseResult", "value", "rest", "matchOrdinalNumberPattern", "parseOrdinalNumberPattern", "matchEraPatterns", "parseEraPatterns", "matchQuarterPatterns", "parseQuarterPatterns", "matchMonthPatterns", "parseMonthPatterns", "matchDayPatterns", "parseDayPatterns", "matchDayPeriodPatterns", "parseDayPeriodPatterns", "match", "buildMatchPatternFn", "value", "buildMatchFn", "index", "match_default", "locale", "formatDistance_default", "formatLong_default", "formatRelative_default", "localize_default", "match_default", "en_US_default", "defaultLocale_default", "en_US_default", "formattingTokensRegExp", "longFormattingTokensRegExp", "escapedStringRegExp", "doubleQuoteRegExp", "unescapedLatinCharacterRegExp", "format", "dirtyDate", "dirtyFormatStr", "options", "_ref", "_options$locale", "_ref2", "_ref3", "_ref4", "_options$firstWeekCon", "_options$locale2", "_options$locale2$opti", "_defaultOptions$local", "_defaultOptions$local2", "_ref5", "_ref6", "_ref7", "_options$weekStartsOn", "_options$locale3", "_options$locale3$opti", "_defaultOptions$local3", "_defaultOptions$local4", "requiredArgs", "formatStr", "defaultOptions", "getDefaultOptions", "locale", "defaultLocale_default", "firstWeekContainsDate", "toInteger", "weekStartsOn", "originalDate", "toDate", "isValid", "timezoneOffset", "getTimezoneOffsetInMilliseconds", "utcDate", "subMilliseconds", "formatterOptions", "result", "substring", "firstCharacter", "longFormatter", "longFormatters_default", "cleanEscapedString", "formatter", "formatters_default", "isProtectedWeekYearToken", "throwProtectedError", "isProtectedDayOfYearToken", "input", "matched", "formatRelative", "dirtyDate", "dirtyBaseDate", "options", "_ref", "_options$locale", "_ref2", "_ref3", "_ref4", "_options$weekStartsOn", "_options$locale2", "_options$locale2$opti", "_defaultOptions$local", "_defaultOptions$local2", "requiredArgs", "date", "toDate", "baseDate", "defaultOptions", "getDefaultOptions", "locale", "defaultLocale_default", "weekStartsOn", "toInteger", "diff", "differenceInCalendarDays", "token", "utcDate", "subMilliseconds", "getTimezoneOffsetInMilliseconds", "utcBaseDate", "formatStr", "format", "parseISO", "argument", "options", "_options$additionalDi", "requiredArgs", "additionalDigits", "toInteger", "dateStrings", "splitDateString", "date", "parseYearResult", "parseYear", "parseDate", "timestamp", "time", "offset", "parseTime", "parseTimezone", "dirtyDate", "result", "patterns", "dateRegex", "timeRegex", "timezoneRegex", "dateString", "array", "timeString", "token", "regex", "captures", "year", "century", "isWeekDate", "dayOfYear", "parseDateUnit", "month", "day", "week", "dayOfWeek", "validateWeekDate", "dayOfISOWeekYear", "validateDate", "validateDayOfYearDate", "value", "hours", "parseTimeUnit", "minutes", "seconds", "validateTime", "millisecondsInHour", "millisecondsInMinute", "timezoneString", "sign", "validateTimezone", "isoWeekYear", "fourthOfJanuaryDay", "diff", "daysInMonths", "isLeapYearIndex", "_year", "_hours", "formatDistanceLocale", "formatDistance", "token", "count", "options", "result", "tokenValue", "formatDistance_default", "dateFormats", "timeFormats", "dateTimeFormats", "formatLong", "buildFormatLongFn", "formatLong_default", "formatRelativeLocale", "formatRelativeLocalePlural", "formatRelative", "token", "date", "_baseDate", "_options", "formatRelative_default", "eraValues", "quarterValues", "monthValues", "dayValues", "dayPeriodValues", "formattingDayPeriodValues", "ordinalNumber", "dirtyNumber", "_options", "number", "localize", "buildLocalizeFn", "quarter", "localize_default", "matchOrdinalNumberPattern", "parseOrdinalNumberPattern", "matchEraPatterns", "parseEraPatterns", "matchQuarterPatterns", "parseQuarterPatterns", "matchMonthPatterns", "parseMonthPatterns", "matchDayPatterns", "parseDayPatterns", "matchDayPeriodPatterns", "parseDayPeriodPatterns", "match", "buildMatchPatternFn", "value", "buildMatchFn", "index", "match_default", "locale", "formatDistance_default", "formatLong_default", "formatRelative_default", "localize_default", "match_default", "es_default", "ClientResponseError", "Error", "errData", "super", "this", "url", "status", "response", "isAbort", "originalError", "Object", "setPrototypeOf", "prototype", "data", "DOMException", "name", "message", "cause", "includes", "toJSON", "fieldContentRegExp", "cookieParse", "str", "options", "result", "decode", "assign", "defaultDecode", "index", "length", "eqIdx", "indexOf", "endIdx", "lastIndexOf", "key", "slice", "trim", "val", "charCodeAt", "cookieSerialize", "opt", "encode", "defaultEncode", "test", "TypeError", "value", "maxAge", "isNaN", "isFinite", "Math", "floor", "domain", "path", "expires", "toString", "call", "Date", "valueOf", "toUTCString", "httpOnly", "secure", "priority", "toLowerCase", "sameSite", "decodeURIComponent", "encodeURIComponent", "atobPolyfill", "getTokenPayload", "token", "encodedPayload", "split", "map", "c", "join", "JSON", "parse", "isTokenExpired", "expirationThreshold", "payload", "keys", "exp", "now", "atob", "input", "String", "replace", "bs", "buffer", "bc", "idx", "output", "charAt", "fromCharCode", "defaultCookieKey", "BaseAuthStore", "constructor", "baseToken", "baseModel", "_onChangeCallbacks", "model", "isValid", "isAdmin", "type", "isAuthRecord", "triggerChange", "clear", "cookie", "rawData", "Array", "isArray", "save", "defaultOptions", "stringify", "resultLength", "Blob", "size", "id", "email", "extraProps", "prop", "callback", "fireImmediately", "push", "i", "splice", "LocalAuthStore", "storageKey", "storageFallback", "_bindStorageEvent", "_storageGet", "_storageSet", "_storageRemove", "window", "localStorage", "rawValue", "getItem", "normalizedVal", "setItem", "removeItem", "addEventListener", "e", "BaseService", "client", "SettingsService", "method", "send", "bodyParams", "body", "filesystem", "then", "toEmail", "emailTemplate", "template", "clientId", "teamId", "keyId", "privateKey", "duration", "CrudService", "batchOrqueryParams", "_getFullList", "batch", "page", "perPage", "query", "baseCrudPath", "responseData", "items", "item", "filter", "requestKey", "skipTotal", "getList", "code", "batchSize", "request", "async", "list", "concat", "normalizeLegacyOptionsArgs", "legacyWarn", "baseOptions", "bodyOrOptions", "hasQuery", "console", "warn", "resetAutoRefresh", "_resetAutoRefresh", "AdminService", "update", "authStore", "collectionId", "delete", "success", "admin", "password", "identity", "autoRefreshThreshold", "autoRefresh", "authData", "authResponse", "threshold", "refreshFunc", "reauthenticateFunc", "oldBeforeSend", "beforeSend", "oldModel", "unsubStoreChange", "onChange", "newToken", "sendOptions", "oldToken", "headers", "authRefresh", "authWithPassword", "bind", "resetToken", "passwordConfirm", "RealtimeService", "eventSource", "subscriptions", "lastSentTopics", "maxConnectTimeout", "reconnectAttempts", "maxReconnectAttempts", "Infinity", "predefinedReconnectIntervals", "pendingConnects", "isConnected", "topic", "listener", "msgEvent", "submitSubscriptions", "connect", "unsubscribeByTopicAndListener", "hasSubscriptionListeners", "removeEventListener", "disconnect", "topicPrefix", "hasAtleastOneTopic", "startsWith", "exist", "topicToCheck", "addAllSubscriptionListeners", "getNonEmptySubscriptionTopics", "getSubscriptionsCancelKey", "catch", "err", "removeAllSubscriptionListeners", "Promise", "resolve", "reject", "initConnect", "clearTimeout", "connectTimeoutId", "setTimeout", "connectErrorHandler", "EventSource", "buildUrl", "onerror", "_", "lastEventId", "retries", "hasUnsentSubscriptions", "p", "reconnectTimeoutId", "latestTopics", "t", "timeout", "fromReconnect", "cancelRequest", "close", "RecordService", "collectionIdOrName", "baseCollectionPath", "recordId", "realtime", "subscribe", "topicOrCallback", "unsubscribe", "unsubscribeByPrefix", "batchOrOptions", "getFullList", "params", "getFirstListItem", "getOne", "create", "collectionName", "record", "usernamePassword", "emailPassword", "authProviders", "usernameOrEmail", "provider", "codeVerifier", "redirectUrl", "createData", "args", "authWithOAuth2Code", "config", "listAuthMethods", "find", "eagerDefaultPopup", "cleanup", "urlCallback", "openBrowserPopup", "undefined", "oldState", "state", "scopes", "replacements", "_replaceQueryParams", "authUrl", "location", "href", "passwordResetToken", "verificationToken", "newEmail", "emailChangeToken", "urlPath", "substring", "parsedParams", "rawParams", "param", "pair", "hasOwnProperty", "open", "width", "height", "windowWidth", "innerWidth", "windowHeight", "innerHeight", "left", "top", "CollectionService", "collections", "deleteMissing", "LogService", "HealthService", "FileService", "filename", "queryParams", "parts", "download", "URLSearchParams", "BackupService", "basename", "knownSendOptionsKeys", "Client", "baseUrl", "lang", "cancelControllers", "recordServices", "enableAutoCancellation", "admins", "files", "logs", "settings", "health", "backups", "idOrName", "enable", "abort", "cancelAllRequests", "k", "raw", "toISOString", "replaceAll", "getUrl", "origin", "endsWith", "pathname", "initSendOptions", "serializeQueryParams", "getHeader", "fetch", "json", "afterSend", "convertToFormDataIfNeeded", "$autoCancel", "$cancelKey", "isFormData", "Authorization", "controller", "AbortController", "signal", "FormData", "hasBlobField", "form", "values", "append", "v", "File", "encodedKey", "url", "pb", "Client", "loginGoogle", "res", "useUser", "user", "setUser", "h", "p", "_", "model", "vnodeId", "isArray", "Array", "createVNode", "type", "props", "key", "isStaticChildren", "__source", "__self", "ref", "i", "normalizedProps", "vnode", "__k", "__", "__b", "__e", "__d", "__c", "constructor", "__v", "__i", "__u", "defaultProps", "options", "locationIcon", "locationIconUri", "NonGraphicalMapController", "Controller", "q", "u", "CreateMarkerOverlay", "items", "pb", "m", "item", "icon", "L", "marker", "daddy", "MarkerModal", "event", "start", "end", "map", "factor", "selfEl", "controller", "selfDestroy", "commentKey", "commentRefresher", "h", "refreshComments", "comments", "setComments", "sortedComments", "a", "parseISO", "p", "user", "useUser", "userId", "deleteMarker", "PostCommentForm", "c", "Comment", "posting", "setPosting", "texto", "setTexto", "postComment", "loginGoogle", "error", "_postComment", "e", "comment", "loading", "setLoading", "editing", "setEditing", "wasEdited", "deleteComment", "saveEdit", "cancelEditing", "formatRelative", "es_default", "g", "isAdding", "setIsAdding", "addMarkerListener", "res", "startAdding", "stopAdding", "load_profile_controller_default", "Controller", "pb", "name", "url", "visit", "__publicField", "login_controller_default", "Controller", "loginGoogle", "goTo", "visit", "error", "autofill_profile_controller_default", "Controller", "pb", "name", "email", "url", "visit", "logout_controller_default", "Controller", "pb", "visit", "DeviceDetector", "Notifier", "e", "start", "Application", "contact_controller_default", "device_detector_controller_default", "drop_controller_default", "NonGraphicalMapController", "load_profile_controller_default", "autofill_profile_controller_default", "login_controller_default", "logout_controller_default", "event", "a"]
7
+ }