govuk_publishing_components 51.1.1 → 51.2.0

data/node_modules/govuk-frontend/dist/govuk/govuk-frontend.min.js.map

@@ -1 +1 @@
-{"version":3,"file":"govuk-frontend.min.js","sources":["../../src/govuk/common/govuk-frontend-version.mjs","../../src/govuk/common/normalise-string.mjs","../../src/govuk/common/index.mjs","../../src/govuk/common/normalise-dataset.mjs","../../src/govuk/errors/index.mjs","../../src/govuk/govuk-frontend-component.mjs","../../src/govuk/i18n.mjs","../../src/govuk/components/accordion/accordion.mjs","../../src/govuk/components/button/button.mjs","../../src/govuk/common/closest-attribute-value.mjs","../../src/govuk/components/character-count/character-count.mjs","../../src/govuk/components/checkboxes/checkboxes.mjs","../../src/govuk/components/error-summary/error-summary.mjs","../../src/govuk/components/exit-this-page/exit-this-page.mjs","../../src/govuk/components/header/header.mjs","../../src/govuk/components/notification-banner/notification-banner.mjs","../../src/govuk/components/password-input/password-input.mjs","../../src/govuk/components/radios/radios.mjs","../../src/govuk/components/service-navigation/service-navigation.mjs","../../src/govuk/components/skip-link/skip-link.mjs","../../src/govuk/components/tabs/tabs.mjs","../../src/govuk/init.mjs"],"sourcesContent":["/*\n * This variable is automatically overwritten during builds and releases.\n * It doesn't need to be updated manually.\n */\n\n/**\n * GOV.UK Frontend release version\n *\n * {@link https://github.com/alphagov/govuk-frontend/releases}\n */\nexport const version = 'development'\n","/**\n * Normalise string\n *\n * 'If it looks like a duck, and it quacks like a duck…' 🦆\n *\n * If the passed value looks like a boolean or a number, convert it to a boolean\n * or number.\n *\n * Designed to be used to convert config passed via data attributes (which are\n * always strings) into something sensible.\n *\n * @internal\n * @param {DOMStringMap[string]} value - The value to normalise\n * @param {SchemaProperty} [property] - Component schema property\n * @returns {string | boolean | number | undefined} Normalised data\n */\nexport function normaliseString(value, property) {\n  const trimmedValue = value ? value.trim() : ''\n\n  let output\n  let outputType = property?.type\n\n  // No schema type set? Determine automatically\n  if (!outputType) {\n    if (['true', 'false'].includes(trimmedValue)) {\n      outputType = 'boolean'\n    }\n\n    // Empty / whitespace-only strings are considered finite so we need to check\n    // the length of the trimmed string as well\n    if (trimmedValue.length > 0 && isFinite(Number(trimmedValue))) {\n      outputType = 'number'\n    }\n  }\n\n  switch (outputType) {\n    case 'boolean':\n      output = trimmedValue === 'true'\n      break\n\n    case 'number':\n      output = Number(trimmedValue)\n      break\n\n    default:\n      output = value\n  }\n\n  return output\n}\n\n/**\n * @typedef {import('./index.mjs').SchemaProperty} SchemaProperty\n */\n","import { normaliseString } from './normalise-string.mjs'\n\n/**\n * Common helpers which do not require polyfill.\n *\n * IMPORTANT: If a helper require a polyfill, please isolate it in its own module\n * so that the polyfill can be properly tree-shaken and does not burden\n * the components that do not need that helper\n */\n\n/**\n * Config merging function\n *\n * Takes any number of objects and combines them together, with\n * greatest priority on the LAST item passed in.\n *\n * @internal\n * @param {...{ [key: string]: unknown }} configObjects - Config objects to merge\n * @returns {{ [key: string]: unknown }} A merged config object\n */\nexport function mergeConfigs(...configObjects) {\n  // Start with an empty object as our base\n  /** @type {{ [key: string]: unknown }} */\n  const formattedConfigObject = {}\n\n  // Loop through each of the passed objects\n  for (const configObject of configObjects) {\n    for (const key of Object.keys(configObject)) {\n      const option = formattedConfigObject[key]\n      const override = configObject[key]\n\n      // Push their keys one-by-one into formattedConfigObject. Any duplicate\n      // keys with object values will be merged, otherwise the new value will\n      // override the existing value.\n      if (isObject(option) && isObject(override)) {\n        // @ts-expect-error Index signature for type 'string' is missing\n        formattedConfigObject[key] = mergeConfigs(option, override)\n      } else {\n        // Apply override\n        formattedConfigObject[key] = override\n      }\n    }\n  }\n\n  return formattedConfigObject\n}\n\n/**\n * Extracts keys starting with a particular namespace from dataset ('data-*')\n * object, removing the namespace in the process, normalising all values\n *\n * @internal\n * @param {{ schema: Schema }} Component - Component class\n * @param {DOMStringMap} dataset - The object to extract key-value pairs from\n * @param {string} namespace - The namespace to filter keys with\n * @returns {ObjectNested | undefined} Nested object with dot-separated key namespace removed\n */\nexport function extractConfigByNamespace(Component, dataset, namespace) {\n  const property = Component.schema.properties[namespace]\n\n  // Only extract configs for object schema properties\n  if (property?.type !== 'object') {\n    return\n  }\n\n  // Add default empty config\n  const newObject = {\n    [namespace]: /** @type {ObjectNested} */ ({})\n  }\n\n  for (const [key, value] of Object.entries(dataset)) {\n    /** @type {ObjectNested | ObjectNested[NestedKey]} */\n    let current = newObject\n\n    // Split the key into parts, using . as our namespace separator\n    const keyParts = key.split('.')\n\n    /**\n     * Create new level per part\n     *\n     * e.g. 'i18n.textareaDescription.other' becomes\n     * `{ i18n: { textareaDescription: { other } } }`\n     */\n    for (const [index, name] of keyParts.entries()) {\n      if (typeof current === 'object') {\n        // Drop down to nested object until the last part\n        if (index < keyParts.length - 1) {\n          // New nested object (optionally) replaces existing value\n          if (!isObject(current[name])) {\n            current[name] = {}\n          }\n\n          // Drop down into new or existing nested object\n          current = current[name]\n        } else if (key !== namespace) {\n          // Normalised value (optionally) replaces existing value\n          current[name] = normaliseString(value)\n        }\n      }\n    }\n  }\n\n  return newObject[namespace]\n}\n\n/**\n * Get hash fragment from URL\n *\n * Extract the hash fragment (everything after the hash) from a URL,\n * but not including the hash symbol\n *\n * @private\n * @param {string} url - URL\n * @returns {string | undefined} Fragment from URL, without the hash\n */\nexport function getFragmentFromUrl(url) {\n  if (!url.includes('#')) {\n    return undefined\n  }\n\n  return url.split('#').pop()\n}\n\n/**\n * Get GOV.UK Frontend breakpoint value from CSS custom property\n *\n * @private\n * @param {string} name - Breakpoint name\n * @returns {{ property: string, value?: string }} Breakpoint object\n */\nexport function getBreakpoint(name) {\n  const property = `--govuk-frontend-breakpoint-${name}`\n\n  // Get value from `<html>` with breakpoints on CSS :root\n  const value = window\n    .getComputedStyle(document.documentElement)\n    .getPropertyValue(property)\n\n  return {\n    property,\n    value: value || undefined\n  }\n}\n\n/**\n * Move focus to element\n *\n * Sets tabindex to -1 to make the element programmatically focusable,\n * but removes it on blur as the element doesn't need to be focused again.\n *\n * @private\n * @template {HTMLElement} FocusElement\n * @param {FocusElement} $element - HTML element\n * @param {object} [options] - Handler options\n * @param {function(this: FocusElement): void} [options.onBeforeFocus] - Callback before focus\n * @param {function(this: FocusElement): void} [options.onBlur] - Callback on blur\n */\nexport function setFocus($element, options = {}) {\n  const isFocusable = $element.getAttribute('tabindex')\n\n  if (!isFocusable) {\n    $element.setAttribute('tabindex', '-1')\n  }\n\n  /**\n   * Handle element focus\n   */\n  function onFocus() {\n    $element.addEventListener('blur', onBlur, { once: true })\n  }\n\n  /**\n   * Handle element blur\n   */\n  function onBlur() {\n    options.onBlur?.call($element)\n\n    if (!isFocusable) {\n      $element.removeAttribute('tabindex')\n    }\n  }\n\n  // Add listener to reset element on blur, after focus\n  $element.addEventListener('focus', onFocus, { once: true })\n\n  // Focus element\n  options.onBeforeFocus?.call($element)\n  $element.focus()\n}\n\n/**\n * Checks if component is already initialised\n *\n * @internal\n * @param {Element} $root - HTML element to be checked\n * @param {string} moduleName - name of component module\n * @returns {boolean} Whether component is already initialised\n */\nexport function isInitialised($root, moduleName) {\n  return (\n    $root instanceof HTMLElement &&\n    $root.hasAttribute(`data-${moduleName}-init`)\n  )\n}\n\n/**\n * Checks if GOV.UK Frontend is supported on this page\n *\n * Some browsers will load and run our JavaScript but GOV.UK Frontend\n * won't be supported.\n *\n * @param {HTMLElement | null} [$scope] - (internal) `<body>` HTML element checked for browser support\n * @returns {boolean} Whether GOV.UK Frontend is supported on this page\n */\nexport function isSupported($scope = document.body) {\n  if (!$scope) {\n    return false\n  }\n\n  return $scope.classList.contains('govuk-frontend-supported')\n}\n\n/**\n * Validate component config by schema\n *\n * Follows limited examples in JSON schema for wider support in future\n *\n * {@link https://ajv.js.org/json-schema.html#compound-keywords}\n * {@link https://ajv.js.org/packages/ajv-errors.html#single-message}\n *\n * @internal\n * @param {Schema} schema - Config schema\n * @param {{ [key: string]: unknown }} config - Component config\n * @returns {string[]} List of validation errors\n */\nexport function validateConfig(schema, config) {\n  const validationErrors = []\n\n  // Check errors for each schema\n  for (const [name, conditions] of Object.entries(schema)) {\n    const errors = []\n\n    // Check errors for each schema condition\n    if (Array.isArray(conditions)) {\n      for (const { required, errorMessage } of conditions) {\n        if (!required.every((key) => !!config[key])) {\n          errors.push(errorMessage) // Missing config key value\n        }\n      }\n\n      // Check one condition passes or add errors\n      if (name === 'anyOf' && !(conditions.length - errors.length >= 1)) {\n        validationErrors.push(...errors)\n      }\n    }\n  }\n\n  return validationErrors\n}\n\n/**\n * Check for an array\n *\n * @internal\n * @param {unknown} option - Option to check\n * @returns {boolean} Whether the option is an array\n */\nfunction isArray(option) {\n  return Array.isArray(option)\n}\n\n/**\n * Check for an object\n *\n * @internal\n * @param {unknown} option - Option to check\n * @returns {boolean} Whether the option is an object\n */\nfunction isObject(option) {\n  return !!option && typeof option === 'object' && !isArray(option)\n}\n\n/**\n * Format error message\n *\n * @internal\n * @param {ComponentWithModuleName} Component - Component that threw the error\n * @param {string} message - Error message\n * @returns {string} - Formatted error message\n */\nexport function formatErrorMessage(Component, message) {\n  return `${Component.moduleName}: ${message}`\n}\n\n/**\n * Schema for component config\n *\n * @typedef {object} Schema\n * @property {{ [field: string]: SchemaProperty | undefined }} properties - Schema properties\n * @property {SchemaCondition[]} [anyOf] - List of schema conditions\n */\n\n/**\n * Schema property for component config\n *\n * @typedef {object} SchemaProperty\n * @property {'string' | 'boolean' | 'number' | 'object'} type - Property type\n */\n\n/**\n * Schema condition for component config\n *\n * @typedef {object} SchemaCondition\n * @property {string[]} required - List of required config fields\n * @property {string} errorMessage - Error message when required config fields not provided\n */\n\n/**\n * @internal\n * @typedef {keyof ObjectNested} NestedKey\n * @typedef {{ [key: string]: string | boolean | number | ObjectNested | undefined }} ObjectNested\n */\n\n/* eslint-disable jsdoc/valid-types --\n * `{new(...args: any[] ): object}` is not recognised as valid\n * https://github.com/gajus/eslint-plugin-jsdoc/issues/145#issuecomment-1308722878\n * https://github.com/jsdoc-type-pratt-parser/jsdoc-type-pratt-parser/issues/131\n **/\n\n/**\n * @typedef ComponentWithModuleName\n * @property {string} moduleName - Name of the component\n */\n\n/* eslint-enable jsdoc/valid-types */\n","import { extractConfigByNamespace } from './index.mjs'\nimport { normaliseString } from './normalise-string.mjs'\n\n/**\n * Normalise dataset\n *\n * Loop over an object and normalise each value using {@link normaliseString},\n * optionally expanding nested `i18n.field`\n *\n * @internal\n * @param {{ schema: Schema }} Component - Component class\n * @param {DOMStringMap} dataset - HTML element dataset\n * @returns {ObjectNested} Normalised dataset\n */\nexport function normaliseDataset(Component, dataset) {\n  const out = /** @type {ReturnType<typeof normaliseDataset>} */ ({})\n\n  // Normalise top-level dataset ('data-*') values using schema types\n  for (const [field, property] of Object.entries(Component.schema.properties)) {\n    if (field in dataset) {\n      out[field] = normaliseString(dataset[field], property)\n    }\n\n    /**\n     * Extract and normalise nested object values automatically using\n     * {@link normaliseString} but only schema object types are allowed\n     */\n    if (property?.type === 'object') {\n      out[field] = extractConfigByNamespace(Component, dataset, field)\n    }\n  }\n\n  return out\n}\n\n/**\n * @internal\n * @typedef {import('./index.mjs').ObjectNested} ObjectNested\n * @typedef {import('./index.mjs').Schema} Schema\n */\n","import { formatErrorMessage } from '../common/index.mjs'\n\n/**\n * GOV.UK Frontend error\n *\n * A base class for `Error`s thrown by GOV.UK Frontend.\n *\n * It is meant to be extended into specific types of errors\n * to be thrown by our code.\n *\n * @example\n * ```js\n * class MissingRootError extends GOVUKFrontendError {\n *   // Setting an explicit name is important as extending the class will not\n *   // set a new `name` on the subclass. The `name` property is important\n *   // to ensure intelligible error names even if the class name gets\n *   // mangled by a minifier\n *   name = \"MissingRootError\"\n * }\n * ```\n * @virtual\n */\nexport class GOVUKFrontendError extends Error {\n  name = 'GOVUKFrontendError'\n}\n\n/**\n * Indicates that GOV.UK Frontend is not supported\n */\nexport class SupportError extends GOVUKFrontendError {\n  name = 'SupportError'\n\n  /**\n   * Checks if GOV.UK Frontend is supported on this page\n   *\n   * @param {HTMLElement | null} [$scope] - HTML element `<body>` checked for browser support\n   */\n  constructor($scope = document.body) {\n    const supportMessage =\n      'noModule' in HTMLScriptElement.prototype\n        ? 'GOV.UK Frontend initialised without `<body class=\"govuk-frontend-supported\">` from template `<script>` snippet'\n        : 'GOV.UK Frontend is not supported in this browser'\n\n    super(\n      $scope\n        ? supportMessage\n        : 'GOV.UK Frontend initialised without `<script type=\"module\">`'\n    )\n  }\n}\n\n/**\n * Indicates that a component has received an illegal configuration\n */\nexport class ConfigError extends GOVUKFrontendError {\n  name = 'ConfigError'\n}\n\n/**\n * Indicates an issue with an element (possibly `null` or `undefined`)\n */\nexport class ElementError extends GOVUKFrontendError {\n  name = 'ElementError'\n\n  /**\n   * @internal\n   * @overload\n   * @param {string} message - Element error message\n   */\n\n  /**\n   * @internal\n   * @overload\n   * @param {ElementErrorOptions} options - Element error options\n   */\n\n  /**\n   * @internal\n   * @param {string | ElementErrorOptions} messageOrOptions - Element error message or options\n   */\n  constructor(messageOrOptions) {\n    let message = typeof messageOrOptions === 'string' ? messageOrOptions : ''\n\n    // Build message from options\n    if (typeof messageOrOptions === 'object') {\n      const { component, identifier, element, expectedType } = messageOrOptions\n\n      message = identifier\n\n      // Append reason\n      message += element\n        ? ` is not of type ${expectedType ?? 'HTMLElement'}`\n        : ' not found'\n\n      message = formatErrorMessage(component, message)\n    }\n\n    super(message)\n  }\n}\n\n/**\n * Indicates that a component is already initialised\n */\nexport class InitError extends GOVUKFrontendError {\n  name = 'InitError'\n\n  /**\n   * @internal\n   * @param {ComponentWithModuleName | string} componentOrMessage - name of the component module\n   */\n  constructor(componentOrMessage) {\n    const message =\n      typeof componentOrMessage === 'string'\n        ? componentOrMessage\n        : formatErrorMessage(\n            componentOrMessage,\n            `Root element (\\`$root\\`) already initialised`\n          )\n\n    super(message)\n  }\n}\n\n/**\n * Element error options\n *\n * @internal\n * @typedef {object} ElementErrorOptions\n * @property {string} identifier - An identifier that'll let the user understand which element has an error. This is whatever makes the most sense\n * @property {Element | null} [element] - The element in error\n * @property {string} [expectedType] - The type that was expected for the identifier\n * @property {ComponentWithModuleName} component - Component throwing the error\n */\n\n/**\n * @typedef {import('../common/index.mjs').ComponentWithModuleName} ComponentWithModuleName\n */\n","import { isInitialised, isSupported } from './common/index.mjs'\nimport { ElementError, InitError, SupportError } from './errors/index.mjs'\n\n/**\n * Base Component class\n *\n * Centralises the behaviours shared by our components\n *\n * @virtual\n * @template {Element} [RootElementType=HTMLElement]\n */\nexport class GOVUKFrontendComponent {\n  /**\n   * @type {typeof Element}\n   */\n  static elementType = HTMLElement\n\n  // allows Typescript user to work around the lack of types\n  // in GOVUKFrontend package, Typescript is not aware of $root\n  // in components that extend GOVUKFrontendComponent\n  /**\n   * Returns the root element of the component\n   *\n   * @protected\n   * @returns {RootElementType} - the root element of component\n   */\n  get $root() {\n    return this._$root\n  }\n\n  /**\n   * @protected\n   * @type {RootElementType}\n   */\n  _$root\n\n  /**\n   * Constructs a new component, validating that GOV.UK Frontend is supported\n   *\n   * @internal\n   * @param {Element | null} [$root] - HTML element to use for component\n   */\n  constructor($root) {\n    const childConstructor = /** @type {ChildClassConstructor} */ (\n      this.constructor\n    )\n\n    // TypeScript does not enforce that inheriting classes will define a `moduleName`\n    // (even if we add a `@virtual` `static moduleName` property to this class).\n    // While we trust users to do this correctly, we do a little check to provide them\n    // a helpful error message.\n    //\n    // After this, we'll be sure that `childConstructor` has a `moduleName`\n    // as expected of the `ChildClassConstructor` we've cast `this.constructor` to.\n    if (typeof childConstructor.moduleName !== 'string') {\n      throw new InitError(`\\`moduleName\\` not defined in component`)\n    }\n\n    if (!($root instanceof childConstructor.elementType)) {\n      throw new ElementError({\n        element: $root,\n        component: childConstructor,\n        identifier: 'Root element (`$root`)',\n        expectedType: childConstructor.elementType.name\n      })\n    } else {\n      this._$root = /** @type {RootElementType} */ ($root)\n    }\n\n    childConstructor.checkSupport()\n\n    this.checkInitialised()\n\n    const moduleName = childConstructor.moduleName\n\n    this.$root.setAttribute(`data-${moduleName}-init`, '')\n  }\n\n  /**\n   * Validates whether component is already initialised\n   *\n   * @private\n   * @throws {InitError} when component is already initialised\n   */\n  checkInitialised() {\n    const constructor = /** @type {ChildClassConstructor} */ (this.constructor)\n    const moduleName = constructor.moduleName\n\n    if (moduleName && isInitialised(this.$root, moduleName)) {\n      throw new InitError(constructor)\n    }\n  }\n\n  /**\n   * Validates whether components are supported\n   *\n   * @throws {SupportError} when the components are not supported\n   */\n  static checkSupport() {\n    if (!isSupported()) {\n      throw new SupportError()\n    }\n  }\n}\n\n/**\n * @typedef ChildClass\n * @property {string} moduleName - The module name that'll be looked for in the DOM when initialising the component\n */\n\n/**\n * @typedef {typeof GOVUKFrontendComponent & ChildClass} ChildClassConstructor\n */\n","/**\n * Internal support for selecting messages to render, with placeholder\n * interpolation and locale-aware number formatting and pluralisation\n *\n * @internal\n */\nexport class I18n {\n  translations\n  locale\n\n  /**\n   * @internal\n   * @param {{ [key: string]: string | TranslationPluralForms }} translations - Key-value pairs of the translation strings to use.\n   * @param {object} [config] - Configuration options for the function.\n   * @param {string | null} [config.locale] - An overriding locale for the PluralRules functionality.\n   */\n  constructor(translations = {}, config = {}) {\n    // Make list of translations available throughout function\n    this.translations = translations\n\n    // The locale to use for PluralRules and NumberFormat\n    this.locale = config.locale ?? (document.documentElement.lang || 'en')\n  }\n\n  /**\n   * The most used function - takes the key for a given piece of UI text and\n   * returns the appropriate string.\n   *\n   * @internal\n   * @param {string} lookupKey - The lookup key of the string to use.\n   * @param {{ [key: string]: unknown }} [options] - Any options passed with the translation string, e.g: for string interpolation.\n   * @returns {string} The appropriate translation string.\n   * @throws {Error} Lookup key required\n   * @throws {Error} Options required for `${}` placeholders\n   */\n  t(lookupKey, options) {\n    if (!lookupKey) {\n      // Print a console error if no lookup key has been provided\n      throw new Error('i18n: lookup key missing')\n    }\n\n    // Fetch the translation for that lookup key\n    let translation = this.translations[lookupKey]\n\n    // If the `count` option is set, determine which plural suffix is needed and\n    // change the lookupKey to match. We check to see if it's numeric instead of\n    // falsy, as this could legitimately be 0.\n    if (typeof options?.count === 'number' && typeof translation === 'object') {\n      const translationPluralForm =\n        translation[this.getPluralSuffix(lookupKey, options.count)]\n\n      // Update translation with plural suffix\n      if (translationPluralForm) {\n        translation = translationPluralForm\n      }\n    }\n\n    if (typeof translation === 'string') {\n      // Check for ${} placeholders in the translation string\n      if (translation.match(/%{(.\\S+)}/)) {\n        if (!options) {\n          throw new Error(\n            'i18n: cannot replace placeholders in string if no option data provided'\n          )\n        }\n\n        return this.replacePlaceholders(translation, options)\n      }\n\n      return translation\n    }\n\n    // If the key wasn't found in our translations object,\n    // return the lookup key itself as the fallback\n    return lookupKey\n  }\n\n  /**\n   * Takes a translation string with placeholders, and replaces the placeholders\n   * with the provided data\n   *\n   * @internal\n   * @param {string} translationString - The translation string\n   * @param {{ [key: string]: unknown }} options - Any options passed with the translation string, e.g: for string interpolation.\n   * @returns {string} The translation string to output, with $\\{\\} placeholders replaced\n   */\n  replacePlaceholders(translationString, options) {\n    const formatter = Intl.NumberFormat.supportedLocalesOf(this.locale).length\n      ? new Intl.NumberFormat(this.locale)\n      : undefined\n\n    return translationString.replace(\n      /%{(.\\S+)}/g,\n\n      /**\n       * Replace translation string placeholders\n       *\n       * @internal\n       * @param {string} placeholderWithBraces - Placeholder with braces\n       * @param {string} placeholderKey - Placeholder key\n       * @returns {string} Placeholder value\n       */\n      function (placeholderWithBraces, placeholderKey) {\n        if (Object.prototype.hasOwnProperty.call(options, placeholderKey)) {\n          const placeholderValue = options[placeholderKey]\n\n          // If a user has passed `false` as the value for the placeholder\n          // treat it as though the value should not be displayed\n          if (\n            placeholderValue === false ||\n            (typeof placeholderValue !== 'number' &&\n              typeof placeholderValue !== 'string')\n          ) {\n            return ''\n          }\n\n          // If the placeholder's value is a number, localise the number formatting\n          if (typeof placeholderValue === 'number') {\n            return formatter\n              ? formatter.format(placeholderValue)\n              : `${placeholderValue}`\n          }\n\n          return placeholderValue\n        }\n\n        throw new Error(\n          `i18n: no data found to replace ${placeholderWithBraces} placeholder in string`\n        )\n      }\n    )\n  }\n\n  /**\n   * Check to see if the browser supports Intl.PluralRules\n   *\n   * It requires all conditions to be met in order to be supported:\n   * - The implementation of Intl supports PluralRules (NOT true in Safari 10–12)\n   * - The browser/OS has plural rules for the current locale (browser dependent)\n   *\n   * {@link https://browsersl.ist/#q=supports+es6-module+and+not+supports+intl-pluralrules}\n   *\n   * @internal\n   * @returns {boolean} Returns true if all conditions are met. Returns false otherwise.\n   */\n  hasIntlPluralRulesSupport() {\n    return Boolean(\n      'PluralRules' in window.Intl &&\n        Intl.PluralRules.supportedLocalesOf(this.locale).length\n    )\n  }\n\n  /**\n   * Get the appropriate suffix for the plural form.\n   *\n   * Uses Intl.PluralRules (or our own fallback implementation) to get the\n   * 'preferred' form to use for the given count.\n   *\n   * Checks that a translation has been provided for that plural form – if it\n   * hasn't, it'll fall back to the 'other' plural form (unless that doesn't exist\n   * either, in which case an error will be thrown)\n   *\n   * @internal\n   * @param {string} lookupKey - The lookup key of the string to use.\n   * @param {number} count - Number used to determine which pluralisation to use.\n   * @returns {PluralRule} The suffix associated with the correct pluralisation for this locale.\n   * @throws {Error} Plural form `.other` required when preferred plural form is missing\n   */\n  getPluralSuffix(lookupKey, count) {\n    // Validate that the number is actually a number.\n    //\n    // Number(count) will turn anything that can't be converted to a Number type\n    // into 'NaN'. isFinite filters out NaN, as it isn't a finite number.\n    count = Number(count)\n    if (!isFinite(count)) {\n      return 'other'\n    }\n\n    // Fetch the translation for that lookup key\n    const translation = this.translations[lookupKey]\n\n    // Check to verify that all the requirements for Intl.PluralRules are met.\n    // If so, we can use that instead of our custom implementation. Otherwise,\n    // use the hardcoded fallback.\n    const preferredForm = this.hasIntlPluralRulesSupport()\n      ? new Intl.PluralRules(this.locale).select(count)\n      : this.selectPluralFormUsingFallbackRules(count)\n\n    // Use the correct plural form if provided\n    if (typeof translation === 'object') {\n      if (preferredForm in translation) {\n        return preferredForm\n        // Fall back to `other` if the plural form is missing, but log a warning\n        // to the console\n      } else if ('other' in translation) {\n        console.warn(\n          `i18n: Missing plural form \".${preferredForm}\" for \"${this.locale}\" locale. Falling back to \".other\".`\n        )\n\n        return 'other'\n      }\n    }\n\n    // If the required `other` plural form is missing, all we can do is error\n    throw new Error(\n      `i18n: Plural form \".other\" is required for \"${this.locale}\" locale`\n    )\n  }\n\n  /**\n   * Get the plural form using our fallback implementation\n   *\n   * This is split out into a separate function to make it easier to test the\n   * fallback behaviour in an environment where Intl.PluralRules exists.\n   *\n   * @internal\n   * @param {number} count - Number used to determine which pluralisation to use.\n   * @returns {PluralRule} The pluralisation form for count in this locale.\n   */\n  selectPluralFormUsingFallbackRules(count) {\n    // Currently our custom code can only handle positive integers, so let's\n    // make sure our number is one of those.\n    count = Math.abs(Math.floor(count))\n\n    const ruleset = this.getPluralRulesForLocale()\n\n    if (ruleset) {\n      return I18n.pluralRules[ruleset](count)\n    }\n\n    return 'other'\n  }\n\n  /**\n   * Work out which pluralisation rules to use for the current locale\n   *\n   * The locale may include a regional indicator (such as en-GB), but we don't\n   * usually care about this part, as pluralisation rules are usually the same\n   * regardless of region. There are exceptions, however, (e.g. Portuguese) so\n   * this searches by both the full and shortened locale codes, just to be sure.\n   *\n   * @internal\n   * @returns {string | undefined} The name of the pluralisation rule to use (a key for one\n   *   of the functions in this.pluralRules)\n   */\n  getPluralRulesForLocale() {\n    const localeShort = this.locale.split('-')[0]\n\n    // Look through the plural rules map to find which `pluralRule` is\n    // appropriate for our current `locale`.\n    for (const pluralRule in I18n.pluralRulesMap) {\n      const languages = I18n.pluralRulesMap[pluralRule]\n      if (languages.includes(this.locale) || languages.includes(localeShort)) {\n        return pluralRule\n      }\n    }\n  }\n\n  /**\n   * Map of plural rules to languages where those rules apply.\n   *\n   * Note: These groups are named for the most dominant or recognisable language\n   * that uses each system. The groupings do not imply that the languages are\n   * related to one another. Many languages have evolved the same systems\n   * independently of one another.\n   *\n   * Code to support more languages can be found in the i18n spike:\n   * {@link https://github.com/alphagov/govuk-frontend/blob/spike-i18n-support/src/govuk/i18n.mjs}\n   *\n   * Languages currently supported:\n   *\n   * Arabic: Arabic (ar)\n   * Chinese: Burmese (my), Chinese (zh), Indonesian (id), Japanese (ja),\n   *   Javanese (jv), Korean (ko), Malay (ms), Thai (th), Vietnamese (vi)\n   * French: Armenian (hy), Bangla (bn), French (fr), Gujarati (gu), Hindi (hi),\n   *   Persian Farsi (fa), Punjabi (pa), Zulu (zu)\n   * German: Afrikaans (af), Albanian (sq), Azerbaijani (az), Basque (eu),\n   *   Bulgarian (bg), Catalan (ca), Danish (da), Dutch (nl), English (en),\n   *   Estonian (et), Finnish (fi), Georgian (ka), German (de), Greek (el),\n   *   Hungarian (hu), Luxembourgish (lb), Norwegian (no), Somali (so),\n   *   Swahili (sw), Swedish (sv), Tamil (ta), Telugu (te), Turkish (tr),\n   *   Urdu (ur)\n   * Irish: Irish Gaelic (ga)\n   * Russian: Russian (ru), Ukrainian (uk)\n   * Scottish: Scottish Gaelic (gd)\n   * Spanish: European Portuguese (pt-PT), Italian (it), Spanish (es)\n   * Welsh: Welsh (cy)\n   *\n   * @internal\n   * @type {{ [key: string]: string[] }}\n   */\n  static pluralRulesMap = {\n    arabic: ['ar'],\n    chinese: ['my', 'zh', 'id', 'ja', 'jv', 'ko', 'ms', 'th', 'vi'],\n    french: ['hy', 'bn', 'fr', 'gu', 'hi', 'fa', 'pa', 'zu'],\n    german: [\n      'af',\n      'sq',\n      'az',\n      'eu',\n      'bg',\n      'ca',\n      'da',\n      'nl',\n      'en',\n      'et',\n      'fi',\n      'ka',\n      'de',\n      'el',\n      'hu',\n      'lb',\n      'no',\n      'so',\n      'sw',\n      'sv',\n      'ta',\n      'te',\n      'tr',\n      'ur'\n    ],\n    irish: ['ga'],\n    russian: ['ru', 'uk'],\n    scottish: ['gd'],\n    spanish: ['pt-PT', 'it', 'es'],\n    welsh: ['cy']\n  }\n\n  /**\n   * Different pluralisation rule sets\n   *\n   * Returns the appropriate suffix for the plural form associated with `n`.\n   * Possible suffixes: 'zero', 'one', 'two', 'few', 'many', 'other' (the actual\n   * meaning of each differs per locale). 'other' should always exist, even in\n   * languages without plurals, such as Chinese.\n   * {@link https://cldr.unicode.org/index/cldr-spec/plural-rules}\n   *\n   * The count must be a positive integer. Negative numbers and decimals aren't accounted for\n   *\n   * @internal\n   * @type {{ [key: string]: (count: number) => PluralRule }}\n   */\n  static pluralRules = {\n    arabic(n) {\n      if (n === 0) {\n        return 'zero'\n      }\n      if (n === 1) {\n        return 'one'\n      }\n      if (n === 2) {\n        return 'two'\n      }\n      if (n % 100 >= 3 && n % 100 <= 10) {\n        return 'few'\n      }\n      if (n % 100 >= 11 && n % 100 <= 99) {\n        return 'many'\n      }\n      return 'other'\n    },\n    chinese() {\n      return 'other'\n    },\n    french(n) {\n      return n === 0 || n === 1 ? 'one' : 'other'\n    },\n    german(n) {\n      return n === 1 ? 'one' : 'other'\n    },\n    irish(n) {\n      if (n === 1) {\n        return 'one'\n      }\n      if (n === 2) {\n        return 'two'\n      }\n      if (n >= 3 && n <= 6) {\n        return 'few'\n      }\n      if (n >= 7 && n <= 10) {\n        return 'many'\n      }\n      return 'other'\n    },\n    russian(n) {\n      const lastTwo = n % 100\n      const last = lastTwo % 10\n      if (last === 1 && lastTwo !== 11) {\n        return 'one'\n      }\n      if (last >= 2 && last <= 4 && !(lastTwo >= 12 && lastTwo <= 14)) {\n        return 'few'\n      }\n      if (\n        last === 0 ||\n        (last >= 5 && last <= 9) ||\n        (lastTwo >= 11 && lastTwo <= 14)\n      ) {\n        return 'many'\n      }\n      // Note: The 'other' suffix is only used by decimal numbers in Russian.\n      // We don't anticipate it being used, but it's here for consistency.\n      return 'other'\n    },\n    scottish(n) {\n      if (n === 1 || n === 11) {\n        return 'one'\n      }\n      if (n === 2 || n === 12) {\n        return 'two'\n      }\n      if ((n >= 3 && n <= 10) || (n >= 13 && n <= 19)) {\n        return 'few'\n      }\n      return 'other'\n    },\n    spanish(n) {\n      if (n === 1) {\n        return 'one'\n      }\n      if (n % 1000000 === 0 && n !== 0) {\n        return 'many'\n      }\n      return 'other'\n    },\n    welsh(n) {\n      if (n === 0) {\n        return 'zero'\n      }\n      if (n === 1) {\n        return 'one'\n      }\n      if (n === 2) {\n        return 'two'\n      }\n      if (n === 3) {\n        return 'few'\n      }\n      if (n === 6) {\n        return 'many'\n      }\n      return 'other'\n    }\n  }\n}\n\n/**\n * Plural rule category mnemonic tags\n *\n * @internal\n * @typedef {'zero' | 'one' | 'two' | 'few' | 'many' | 'other'} PluralRule\n */\n\n/**\n * Translated message by plural rule they correspond to.\n *\n * Allows to group pluralised messages under a single key when passing\n * translations to a component's constructor\n *\n * @internal\n * @typedef {object} TranslationPluralForms\n * @property {string} [other] - General plural form\n * @property {string} [zero] - Plural form used with 0\n * @property {string} [one] - Plural form used with 1\n * @property {string} [two] - Plural form used with 2\n * @property {string} [few] - Plural form used for a few\n * @property {string} [many] - Plural form used for many\n */\n","import { mergeConfigs } from '../../common/index.mjs'\nimport { normaliseDataset } from '../../common/normalise-dataset.mjs'\nimport { ElementError } from '../../errors/index.mjs'\nimport { GOVUKFrontendComponent } from '../../govuk-frontend-component.mjs'\nimport { I18n } from '../../i18n.mjs'\n\n/**\n * Accordion component\n *\n * This allows a collection of sections to be collapsed by default, showing only\n * their headers. Sections can be expanded or collapsed individually by clicking\n * their headers. A \"Show all sections\" button is also added to the top of the\n * accordion, which switches to \"Hide all sections\" when all the sections are\n * expanded.\n *\n * The state of each section is saved to the DOM via the `aria-expanded`\n * attribute, which also provides accessibility.\n *\n * @preserve\n */\nexport class Accordion extends GOVUKFrontendComponent {\n  /**\n   * @private\n   * @type {AccordionConfig}\n   */\n  config\n\n  /** @private */\n  i18n\n\n  /** @private */\n  controlsClass = 'govuk-accordion__controls'\n\n  /** @private */\n  showAllClass = 'govuk-accordion__show-all'\n\n  /** @private */\n  showAllTextClass = 'govuk-accordion__show-all-text'\n\n  /** @private */\n  sectionClass = 'govuk-accordion__section'\n\n  /** @private */\n  sectionExpandedClass = 'govuk-accordion__section--expanded'\n\n  /** @private */\n  sectionButtonClass = 'govuk-accordion__section-button'\n\n  /** @private */\n  sectionHeaderClass = 'govuk-accordion__section-header'\n\n  /** @private */\n  sectionHeadingClass = 'govuk-accordion__section-heading'\n\n  /** @private */\n  sectionHeadingDividerClass = 'govuk-accordion__section-heading-divider'\n\n  /** @private */\n  sectionHeadingTextClass = 'govuk-accordion__section-heading-text'\n\n  /** @private */\n  sectionHeadingTextFocusClass = 'govuk-accordion__section-heading-text-focus'\n\n  /** @private */\n  sectionShowHideToggleClass = 'govuk-accordion__section-toggle'\n\n  /** @private */\n  sectionShowHideToggleFocusClass = 'govuk-accordion__section-toggle-focus'\n\n  /** @private */\n  sectionShowHideTextClass = 'govuk-accordion__section-toggle-text'\n\n  /** @private */\n  upChevronIconClass = 'govuk-accordion-nav__chevron'\n\n  /** @private */\n  downChevronIconClass = 'govuk-accordion-nav__chevron--down'\n\n  /** @private */\n  sectionSummaryClass = 'govuk-accordion__section-summary'\n\n  /** @private */\n  sectionSummaryFocusClass = 'govuk-accordion__section-summary-focus'\n\n  /** @private */\n  sectionContentClass = 'govuk-accordion__section-content'\n\n  /** @private */\n  $sections\n\n  /**\n   * @private\n   * @type {HTMLButtonElement | null}\n   */\n  $showAllButton = null\n\n  /**\n   * @private\n   * @type {HTMLElement | null}\n   */\n  $showAllIcon = null\n\n  /**\n   * @private\n   * @type {HTMLElement | null}\n   */\n  $showAllText = null\n\n  /**\n   * @param {Element | null} $root - HTML element to use for accordion\n   * @param {AccordionConfig} [config] - Accordion config\n   */\n  constructor($root, config = {}) {\n    super($root)\n\n    this.config = mergeConfigs(\n      Accordion.defaults,\n      config,\n      normaliseDataset(Accordion, this.$root.dataset)\n    )\n\n    this.i18n = new I18n(this.config.i18n)\n\n    const $sections = this.$root.querySelectorAll(`.${this.sectionClass}`)\n    if (!$sections.length) {\n      throw new ElementError({\n        component: Accordion,\n        identifier: `Sections (\\`<div class=\"${this.sectionClass}\">\\`)`\n      })\n    }\n\n    this.$sections = $sections\n\n    this.initControls()\n    this.initSectionHeaders()\n\n    this.updateShowAllButton(this.areAllSectionsOpen())\n  }\n\n  /**\n   * Initialise controls and set attributes\n   *\n   * @private\n   */\n  initControls() {\n    // Create \"Show all\" button and set attributes\n    this.$showAllButton = document.createElement('button')\n    this.$showAllButton.setAttribute('type', 'button')\n    this.$showAllButton.setAttribute('class', this.showAllClass)\n    this.$showAllButton.setAttribute('aria-expanded', 'false')\n\n    // Create icon, add to element\n    this.$showAllIcon = document.createElement('span')\n    this.$showAllIcon.classList.add(this.upChevronIconClass)\n    this.$showAllButton.appendChild(this.$showAllIcon)\n\n    // Create control wrapper and add controls to it\n    const $accordionControls = document.createElement('div')\n    $accordionControls.setAttribute('class', this.controlsClass)\n    $accordionControls.appendChild(this.$showAllButton)\n    this.$root.insertBefore($accordionControls, this.$root.firstChild)\n\n    // Build additional wrapper for Show all toggle text and place after icon\n    this.$showAllText = document.createElement('span')\n    this.$showAllText.classList.add(this.showAllTextClass)\n    this.$showAllButton.appendChild(this.$showAllText)\n\n    // Handle click events on the show/hide all button\n    this.$showAllButton.addEventListener('click', () =>\n      this.onShowOrHideAllToggle()\n    )\n\n    // Handle 'beforematch' events, if the user agent supports them\n    if ('onbeforematch' in document) {\n      document.addEventListener('beforematch', (event) =>\n        this.onBeforeMatch(event)\n      )\n    }\n  }\n\n  /**\n   * Initialise section headers\n   *\n   * @private\n   */\n  initSectionHeaders() {\n    this.$sections.forEach(($section, i) => {\n      const $header = $section.querySelector(`.${this.sectionHeaderClass}`)\n      if (!$header) {\n        throw new ElementError({\n          component: Accordion,\n          identifier: `Section headers (\\`<div class=\"${this.sectionHeaderClass}\">\\`)`\n        })\n      }\n\n      // Set header attributes\n      this.constructHeaderMarkup($header, i)\n      this.setExpanded(this.isExpanded($section), $section)\n\n      // Handle events\n      $header.addEventListener('click', () => this.onSectionToggle($section))\n\n      // See if there is any state stored in sessionStorage and set the sections\n      // to open or closed.\n      this.setInitialState($section)\n    })\n  }\n\n  /**\n   * Construct section header\n   *\n   * @private\n   * @param {Element} $header - Section header\n   * @param {number} index - Section index\n   */\n  constructHeaderMarkup($header, index) {\n    const $span = $header.querySelector(`.${this.sectionButtonClass}`)\n    const $heading = $header.querySelector(`.${this.sectionHeadingClass}`)\n    const $summary = $header.querySelector(`.${this.sectionSummaryClass}`)\n\n    if (!$heading) {\n      throw new ElementError({\n        component: Accordion,\n        identifier: `Section heading (\\`.${this.sectionHeadingClass}\\`)`\n      })\n    }\n\n    if (!$span) {\n      throw new ElementError({\n        component: Accordion,\n        identifier: `Section button placeholder (\\`<span class=\"${this.sectionButtonClass}\">\\`)`\n      })\n    }\n\n    // Create a button element that will replace the\n    // '.govuk-accordion__section-button' span\n    const $button = document.createElement('button')\n    $button.setAttribute('type', 'button')\n    $button.setAttribute(\n      'aria-controls',\n      `${this.$root.id}-content-${index + 1}`\n    )\n\n    // Copy all attributes from $span to $button (except `id`, which gets added\n    // to the `$headingText` element)\n    for (const attr of Array.from($span.attributes)) {\n      if (attr.name !== 'id') {\n        $button.setAttribute(attr.name, attr.value)\n      }\n    }\n\n    // Create container for heading text so it can be styled\n    const $headingText = document.createElement('span')\n    $headingText.classList.add(this.sectionHeadingTextClass)\n    // Copy the span ID to the heading text to allow it to be referenced by\n    // `aria-labelledby` on the hidden content area without \"Show this section\"\n    $headingText.id = $span.id\n\n    // Create an inner heading text container to limit the width of the focus\n    // state\n    const $headingTextFocus = document.createElement('span')\n    $headingTextFocus.classList.add(this.sectionHeadingTextFocusClass)\n    $headingText.appendChild($headingTextFocus)\n    // span could contain HTML elements\n    // (see https://www.w3.org/TR/2011/WD-html5-20110525/content-models.html#phrasing-content)\n    Array.from($span.childNodes).forEach(($child) =>\n      $headingTextFocus.appendChild($child)\n    )\n\n    // Create container for show / hide icons and text.\n    const $showHideToggle = document.createElement('span')\n    $showHideToggle.classList.add(this.sectionShowHideToggleClass)\n    // Tell Google not to index the 'show' text as part of the heading. Must be\n    // set on the element before it's added to the DOM.\n    // See https://developers.google.com/search/docs/advanced/robots/robots_meta_tag#data-nosnippet-attr\n    $showHideToggle.setAttribute('data-nosnippet', '')\n    // Create an inner container to limit the width of the focus state\n    const $showHideToggleFocus = document.createElement('span')\n    $showHideToggleFocus.classList.add(this.sectionShowHideToggleFocusClass)\n    $showHideToggle.appendChild($showHideToggleFocus)\n    // Create wrapper for the show / hide text. Append text after the show/hide icon\n    const $showHideText = document.createElement('span')\n    const $showHideIcon = document.createElement('span')\n    $showHideIcon.classList.add(this.upChevronIconClass)\n    $showHideToggleFocus.appendChild($showHideIcon)\n    $showHideText.classList.add(this.sectionShowHideTextClass)\n    $showHideToggleFocus.appendChild($showHideText)\n\n    // Append elements to the button:\n    // 1. Heading text\n    // 2. Punctuation\n    // 3. (Optional: Summary line followed by punctuation)\n    // 4. Show / hide toggle\n    $button.appendChild($headingText)\n    $button.appendChild(this.getButtonPunctuationEl())\n\n    // If summary content exists add to DOM in correct order\n    if ($summary) {\n      // Create a new `span` element and copy the summary line content from the\n      // original `div` to the new `span`. This is because the summary line text\n      // is now inside a button element, which can only contain phrasing\n      // content.\n      const $summarySpan = document.createElement('span')\n      // Create an inner summary container to limit the width of the summary\n      // focus state\n      const $summarySpanFocus = document.createElement('span')\n      $summarySpanFocus.classList.add(this.sectionSummaryFocusClass)\n      $summarySpan.appendChild($summarySpanFocus)\n\n      // Get original attributes, and pass them to the replacement\n      for (const attr of Array.from($summary.attributes)) {\n        $summarySpan.setAttribute(attr.name, attr.value)\n      }\n\n      // Copy original contents of summary to the new summary span\n      Array.from($summary.childNodes).forEach(($child) =>\n        $summarySpanFocus.appendChild($child)\n      )\n\n      // Replace the original summary `div` with the new summary `span`\n      $summary.remove()\n\n      $button.appendChild($summarySpan)\n      $button.appendChild(this.getButtonPunctuationEl())\n    }\n\n    $button.appendChild($showHideToggle)\n\n    $heading.removeChild($span)\n    $heading.appendChild($button)\n  }\n\n  /**\n   * When a section is opened by the user agent via the 'beforematch' event\n   *\n   * @private\n   * @param {Event} event - Generic event\n   */\n  onBeforeMatch(event) {\n    const $fragment = event.target\n\n    // Handle elements with `.closest()` support only\n    if (!($fragment instanceof Element)) {\n      return\n    }\n\n    // Handle when fragment is inside section\n    const $section = $fragment.closest(`.${this.sectionClass}`)\n    if ($section) {\n      this.setExpanded(true, $section)\n    }\n  }\n\n  /**\n   * When section toggled, set and store state\n   *\n   * @private\n   * @param {Element} $section - Section element\n   */\n  onSectionToggle($section) {\n    const nowExpanded = !this.isExpanded($section)\n    this.setExpanded(nowExpanded, $section)\n\n    // Store the state in sessionStorage when a change is triggered\n    this.storeState($section, nowExpanded)\n  }\n\n  /**\n   * When Open/Close All toggled, set and store state\n   *\n   * @private\n   */\n  onShowOrHideAllToggle() {\n    const nowExpanded = !this.areAllSectionsOpen()\n\n    this.$sections.forEach(($section) => {\n      this.setExpanded(nowExpanded, $section)\n      this.storeState($section, nowExpanded)\n    })\n\n    this.updateShowAllButton(nowExpanded)\n  }\n\n  /**\n   * Set section attributes when opened/closed\n   *\n   * @private\n   * @param {boolean} expanded - Section expanded\n   * @param {Element} $section - Section element\n   */\n  setExpanded(expanded, $section) {\n    const $showHideIcon = $section.querySelector(`.${this.upChevronIconClass}`)\n    const $showHideText = $section.querySelector(\n      `.${this.sectionShowHideTextClass}`\n    )\n    const $button = $section.querySelector(`.${this.sectionButtonClass}`)\n    const $content = $section.querySelector(`.${this.sectionContentClass}`)\n\n    if (!$content) {\n      throw new ElementError({\n        component: Accordion,\n        identifier: `Section content (\\`<div class=\"${this.sectionContentClass}\">\\`)`\n      })\n    }\n\n    if (!$showHideIcon || !$showHideText || !$button) {\n      // Return early for elements we create\n      return\n    }\n\n    const newButtonText = expanded\n      ? this.i18n.t('hideSection')\n      : this.i18n.t('showSection')\n\n    $showHideText.textContent = newButtonText\n    $button.setAttribute('aria-expanded', `${expanded}`)\n\n    // Update aria-label combining\n    const ariaLabelParts = []\n\n    const $headingText = $section.querySelector(\n      `.${this.sectionHeadingTextClass}`\n    )\n    if ($headingText) {\n      ariaLabelParts.push(`${$headingText.textContent}`.trim())\n    }\n\n    const $summary = $section.querySelector(`.${this.sectionSummaryClass}`)\n    if ($summary) {\n      ariaLabelParts.push(`${$summary.textContent}`.trim())\n    }\n\n    const ariaLabelMessage = expanded\n      ? this.i18n.t('hideSectionAriaLabel')\n      : this.i18n.t('showSectionAriaLabel')\n    ariaLabelParts.push(ariaLabelMessage)\n\n    /*\n     * Join with a comma to add pause for assistive technology.\n     * Example: [heading]Section A ,[pause] Show this section.\n     * https://accessibility.blog.gov.uk/2017/12/18/what-working-on-gov-uk-navigation-taught-us-about-accessibility/\n     */\n    $button.setAttribute('aria-label', ariaLabelParts.join(' , '))\n\n    // Swap icon, change class\n    if (expanded) {\n      $content.removeAttribute('hidden')\n      $section.classList.add(this.sectionExpandedClass)\n      $showHideIcon.classList.remove(this.downChevronIconClass)\n    } else {\n      $content.setAttribute('hidden', 'until-found')\n      $section.classList.remove(this.sectionExpandedClass)\n      $showHideIcon.classList.add(this.downChevronIconClass)\n    }\n\n    // See if \"Show all sections\" button text should be updated\n    this.updateShowAllButton(this.areAllSectionsOpen())\n  }\n\n  /**\n   * Get state of section\n   *\n   * @private\n   * @param {Element} $section - Section element\n   * @returns {boolean} True if expanded\n   */\n  isExpanded($section) {\n    return $section.classList.contains(this.sectionExpandedClass)\n  }\n\n  /**\n   * Check if all sections are open\n   *\n   * @private\n   * @returns {boolean} True if all sections are open\n   */\n  areAllSectionsOpen() {\n    return Array.from(this.$sections).every(($section) =>\n      this.isExpanded($section)\n    )\n  }\n\n  /**\n   * Update \"Show all sections\" button\n   *\n   * @private\n   * @param {boolean} expanded - Section expanded\n   */\n  updateShowAllButton(expanded) {\n    if (!this.$showAllButton || !this.$showAllText || !this.$showAllIcon) {\n      return\n    }\n\n    this.$showAllButton.setAttribute('aria-expanded', expanded.toString())\n    this.$showAllText.textContent = expanded\n      ? this.i18n.t('hideAllSections')\n      : this.i18n.t('showAllSections')\n    this.$showAllIcon.classList.toggle(this.downChevronIconClass, !expanded)\n  }\n\n  /**\n   * Get the identifier for a section\n   *\n   * We need a unique way of identifying each content in the Accordion.\n   * Since an `#id` should be unique and an `id` is required for `aria-`\n   * attributes `id` can be safely used.\n   *\n   * @param {Element} $section - Section element\n   * @returns {string | undefined | null} Identifier for section\n   */\n  getIdentifier($section) {\n    const $button = $section.querySelector(`.${this.sectionButtonClass}`)\n\n    return $button?.getAttribute('aria-controls')\n  }\n\n  /**\n   * Set the state of the accordions in sessionStorage\n   *\n   * @private\n   * @param {Element} $section - Section element\n   * @param {boolean} isExpanded - Whether the section is expanded\n   */\n  storeState($section, isExpanded) {\n    if (!this.config.rememberExpanded) {\n      return\n    }\n\n    const id = this.getIdentifier($section)\n\n    if (id) {\n      try {\n        window.sessionStorage.setItem(id, isExpanded.toString())\n      } catch (exception) {}\n    }\n  }\n\n  /**\n   * Read the state of the accordions from sessionStorage\n   *\n   * @private\n   * @param {Element} $section - Section element\n   */\n  setInitialState($section) {\n    if (!this.config.rememberExpanded) {\n      return\n    }\n\n    const id = this.getIdentifier($section)\n\n    if (id) {\n      try {\n        const state = window.sessionStorage.getItem(id)\n\n        if (state !== null) {\n          this.setExpanded(state === 'true', $section)\n        }\n      } catch (exception) {}\n    }\n  }\n\n  /**\n   * Create an element to improve semantics of the section button with\n   * punctuation\n   *\n   * Adding punctuation to the button can also improve its general semantics by\n   * dividing its contents into thematic chunks. See\n   * https://github.com/alphagov/govuk-frontend/issues/2327#issuecomment-922957442\n   *\n   * @private\n   * @returns {Element} DOM element\n   */\n  getButtonPunctuationEl() {\n    const $punctuationEl = document.createElement('span')\n    $punctuationEl.classList.add(\n      'govuk-visually-hidden',\n      this.sectionHeadingDividerClass\n    )\n    $punctuationEl.textContent = ', '\n    return $punctuationEl\n  }\n\n  /**\n   * Name for the component used when initialising using data-module attributes.\n   */\n  static moduleName = 'govuk-accordion'\n\n  /**\n   * Accordion default config\n   *\n   * @see {@link AccordionConfig}\n   * @constant\n   * @type {AccordionConfig}\n   */\n  static defaults = Object.freeze({\n    i18n: {\n      hideAllSections: 'Hide all sections',\n      hideSection: 'Hide',\n      hideSectionAriaLabel: 'Hide this section',\n      showAllSections: 'Show all sections',\n      showSection: 'Show',\n      showSectionAriaLabel: 'Show this section'\n    },\n    rememberExpanded: true\n  })\n\n  /**\n   * Accordion config schema\n   *\n   * @constant\n   * @satisfies {Schema}\n   */\n  static schema = Object.freeze({\n    properties: {\n      i18n: { type: 'object' },\n      rememberExpanded: { type: 'boolean' }\n    }\n  })\n}\n\n/**\n * Accordion config\n *\n * @see {@link Accordion.defaults}\n * @typedef {object} AccordionConfig\n * @property {AccordionTranslations} [i18n=Accordion.defaults.i18n] - Accordion translations\n * @property {boolean} [rememberExpanded] - Whether the expanded and collapsed\n *   state of each section is remembered and restored when navigating.\n */\n\n/**\n * Accordion translations\n *\n * @see {@link Accordion.defaults.i18n}\n * @typedef {object} AccordionTranslations\n *\n * Messages used by the component for the labels of its buttons. This includes\n * the visible text shown on screen, and text to help assistive technology users\n * for the buttons toggling each section.\n * @property {string} [hideAllSections] - The text content for the 'Hide all\n *   sections' button, used when at least one section is expanded.\n * @property {string} [hideSection] - The text content for the 'Hide'\n *   button, used when a section is expanded.\n * @property {string} [hideSectionAriaLabel] - The text content appended to the\n *   'Hide' button's accessible name when a section is expanded.\n * @property {string} [showAllSections] - The text content for the 'Show all\n *   sections' button, used when all sections are collapsed.\n * @property {string} [showSection] - The text content for the 'Show'\n *   button, used when a section is collapsed.\n * @property {string} [showSectionAriaLabel] - The text content appended to the\n *   'Show' button's accessible name when a section is expanded.\n */\n\n/**\n * @typedef {import('../../common/index.mjs').Schema} Schema\n */\n","import { mergeConfigs } from '../../common/index.mjs'\nimport { normaliseDataset } from '../../common/normalise-dataset.mjs'\nimport { GOVUKFrontendComponent } from '../../govuk-frontend-component.mjs'\n\nconst DEBOUNCE_TIMEOUT_IN_SECONDS = 1\n\n/**\n * JavaScript enhancements for the Button component\n *\n * @preserve\n */\nexport class Button extends GOVUKFrontendComponent {\n  /**\n   * @private\n   * @type {ButtonConfig}\n   */\n  config\n\n  /**\n   * @private\n   * @type {number | null}\n   */\n  debounceFormSubmitTimer = null\n\n  /**\n   * @param {Element | null} $root - HTML element to use for button\n   * @param {ButtonConfig} [config] - Button config\n   */\n  constructor($root, config = {}) {\n    super($root)\n\n    this.config = mergeConfigs(\n      Button.defaults,\n      config,\n      normaliseDataset(Button, this.$root.dataset)\n    )\n\n    this.$root.addEventListener('keydown', (event) => this.handleKeyDown(event))\n    this.$root.addEventListener('click', (event) => this.debounce(event))\n  }\n\n  /**\n   * Trigger a click event when the space key is pressed\n   *\n   * Some screen readers tell users they can use the space bar to activate\n   * things with the 'button' role, so we need to match the functionality of\n   * native HTML buttons.\n   *\n   * See https://github.com/alphagov/govuk_elements/pull/272#issuecomment-233028270\n   *\n   * @private\n   * @param {KeyboardEvent} event - Keydown event\n   */\n  handleKeyDown(event) {\n    const $target = event.target\n\n    // Handle space bar only\n    if (event.key !== ' ') {\n      return\n    }\n\n    // Handle elements with [role=\"button\"] only\n    if (\n      $target instanceof HTMLElement &&\n      $target.getAttribute('role') === 'button'\n    ) {\n      event.preventDefault() // prevent the page from scrolling\n      $target.click()\n    }\n  }\n\n  /**\n   * Debounce double-clicks\n   *\n   * If the click quickly succeeds a previous click then nothing will happen.\n   * This stops people accidentally causing multiple form submissions by double\n   * clicking buttons.\n   *\n   * @private\n   * @param {MouseEvent} event - Mouse click event\n   * @returns {undefined | false} Returns undefined, or false when debounced\n   */\n  debounce(event) {\n    // Check the button that was clicked has preventDoubleClick enabled\n    if (!this.config.preventDoubleClick) {\n      return\n    }\n\n    // If the timer is still running, prevent the click from submitting the form\n    if (this.debounceFormSubmitTimer) {\n      event.preventDefault()\n      return false\n    }\n\n    this.debounceFormSubmitTimer = window.setTimeout(() => {\n      this.debounceFormSubmitTimer = null\n    }, DEBOUNCE_TIMEOUT_IN_SECONDS * 1000)\n  }\n\n  /**\n   * Name for the component used when initialising using data-module attributes.\n   */\n  static moduleName = 'govuk-button'\n\n  /**\n   * Button default config\n   *\n   * @see {@link ButtonConfig}\n   * @constant\n   * @type {ButtonConfig}\n   */\n  static defaults = Object.freeze({\n    preventDoubleClick: false\n  })\n\n  /**\n   * Button config schema\n   *\n   * @constant\n   * @satisfies {Schema}\n   */\n  static schema = Object.freeze({\n    properties: {\n      preventDoubleClick: { type: 'boolean' }\n    }\n  })\n}\n\n/**\n * Button config\n *\n * @typedef {object} ButtonConfig\n * @property {boolean} [preventDoubleClick=false] - Prevent accidental double\n *   clicks on submit buttons from submitting forms multiple times.\n */\n\n/**\n * @typedef {import('../../common/index.mjs').Schema} Schema\n */\n","/**\n * Returns the value of the given attribute closest to the given element (including itself)\n *\n * @internal\n * @param {Element} $element - The element to start walking the DOM tree up\n * @param {string} attributeName - The name of the attribute\n * @returns {string | null} Attribute value\n */\nexport function closestAttributeValue($element, attributeName) {\n  const $closestElementWithAttribute = $element.closest(`[${attributeName}]`)\n  return $closestElementWithAttribute\n    ? $closestElementWithAttribute.getAttribute(attributeName)\n    : null\n}\n","import { closestAttributeValue } from '../../common/closest-attribute-value.mjs'\nimport {\n  formatErrorMessage,\n  mergeConfigs,\n  validateConfig\n} from '../../common/index.mjs'\nimport { normaliseDataset } from '../../common/normalise-dataset.mjs'\nimport { ConfigError, ElementError } from '../../errors/index.mjs'\nimport { GOVUKFrontendComponent } from '../../govuk-frontend-component.mjs'\nimport { I18n } from '../../i18n.mjs'\n\n/**\n * Character count component\n *\n * Tracks the number of characters or words in the `.govuk-js-character-count`\n * `<textarea>` inside the element. Displays a message with the remaining number\n * of characters/words available, or the number of characters/words in excess.\n *\n * You can configure the message to only appear after a certain percentage\n * of the available characters/words has been entered.\n *\n * @preserve\n */\nexport class CharacterCount extends GOVUKFrontendComponent {\n  /** @private */\n  $textarea\n\n  /** @private */\n  $visibleCountMessage\n\n  /** @private */\n  $screenReaderCountMessage\n\n  /**\n   * @private\n   * @type {number | null}\n   */\n  lastInputTimestamp = null\n\n  /** @private */\n  lastInputValue = ''\n\n  /**\n   * @private\n   * @type {number | null}\n   */\n  valueChecker = null\n\n  /**\n   * @private\n   * @type {CharacterCountConfig}\n   */\n  config\n\n  /** @private */\n  i18n\n\n  /** @private */\n  maxLength\n\n  /**\n   * @param {Element | null} $root - HTML element to use for character count\n   * @param {CharacterCountConfig} [config] - Character count config\n   */\n  constructor($root, config = {}) {\n    super($root)\n\n    const $textarea = this.$root.querySelector('.govuk-js-character-count')\n    if (\n      !(\n        $textarea instanceof HTMLTextAreaElement ||\n        $textarea instanceof HTMLInputElement\n      )\n    ) {\n      throw new ElementError({\n        component: CharacterCount,\n        element: $textarea,\n        expectedType: 'HTMLTextareaElement or HTMLInputElement',\n        identifier: 'Form field (`.govuk-js-character-count`)'\n      })\n    }\n\n    // Read config set using dataset ('data-' values)\n    const datasetConfig = normaliseDataset(CharacterCount, this.$root.dataset)\n\n    // To ensure data-attributes take complete precedence, even if they change\n    // the type of count, we need to reset the `maxlength` and `maxwords` from\n    // the JavaScript config.\n    //\n    // We can't mutate `config`, though, as it may be shared across multiple\n    // components inside `initAll`.\n    /** @type {CharacterCountConfig} */\n    let configOverrides = {}\n    if ('maxwords' in datasetConfig || 'maxlength' in datasetConfig) {\n      configOverrides = {\n        maxlength: undefined,\n        maxwords: undefined\n      }\n    }\n\n    this.config = mergeConfigs(\n      CharacterCount.defaults,\n      config,\n      configOverrides,\n      datasetConfig\n    )\n\n    // Check for valid config\n    const errors = validateConfig(CharacterCount.schema, this.config)\n    if (errors[0]) {\n      throw new ConfigError(formatErrorMessage(CharacterCount, errors[0]))\n    }\n\n    this.i18n = new I18n(this.config.i18n, {\n      // Read the fallback if necessary rather than have it set in the defaults\n      locale: closestAttributeValue(this.$root, 'lang')\n    })\n\n    // Determine the limit attribute (characters or words)\n    this.maxLength = this.config.maxwords ?? this.config.maxlength ?? Infinity\n\n    this.$textarea = $textarea\n\n    const textareaDescriptionId = `${this.$textarea.id}-info`\n    const $textareaDescription = document.getElementById(textareaDescriptionId)\n    if (!$textareaDescription) {\n      throw new ElementError({\n        component: CharacterCount,\n        element: $textareaDescription,\n        identifier: `Count message (\\`id=\"${textareaDescriptionId}\"\\`)`\n      })\n    }\n\n    // Inject a description for the textarea if none is present already\n    // for when the component was rendered with no maxlength, maxwords\n    // nor custom textareaDescriptionText\n    if (`${$textareaDescription.textContent}`.match(/^\\s*$/)) {\n      $textareaDescription.textContent = this.i18n.t('textareaDescription', {\n        count: this.maxLength\n      })\n    }\n\n    // Move the textarea description to be immediately after the textarea\n    // Kept for backwards compatibility\n    this.$textarea.insertAdjacentElement('afterend', $textareaDescription)\n\n    // Create the *screen reader* specific live-updating counter\n    // This doesn't need any styling classes, as it is never visible\n    const $screenReaderCountMessage = document.createElement('div')\n    $screenReaderCountMessage.className =\n      'govuk-character-count__sr-status govuk-visually-hidden'\n    $screenReaderCountMessage.setAttribute('aria-live', 'polite')\n    this.$screenReaderCountMessage = $screenReaderCountMessage\n    $textareaDescription.insertAdjacentElement(\n      'afterend',\n      $screenReaderCountMessage\n    )\n\n    // Create our live-updating counter element, copying the classes from the\n    // textarea description for backwards compatibility as these may have been\n    // configured\n    const $visibleCountMessage = document.createElement('div')\n    $visibleCountMessage.className = $textareaDescription.className\n    $visibleCountMessage.classList.add('govuk-character-count__status')\n    $visibleCountMessage.setAttribute('aria-hidden', 'true')\n    this.$visibleCountMessage = $visibleCountMessage\n    $textareaDescription.insertAdjacentElement('afterend', $visibleCountMessage)\n\n    // Hide the textarea description\n    $textareaDescription.classList.add('govuk-visually-hidden')\n\n    // Remove hard limit if set\n    this.$textarea.removeAttribute('maxlength')\n\n    this.bindChangeEvents()\n\n    // When the page is restored after navigating 'back' in some browsers the\n    // state of form controls is not restored until *after* the DOMContentLoaded\n    // event is fired, so we need to sync after the pageshow event.\n    window.addEventListener('pageshow', () => this.updateCountMessage())\n\n    // Although we've set up handlers to sync state on the pageshow event, init\n    // could be called after those events have fired, for example if they are\n    // added to the page dynamically, so update now too.\n    this.updateCountMessage()\n  }\n\n  /**\n   * Bind change events\n   *\n   * Set up event listeners on the $textarea so that the count messages update\n   * when the user types.\n   *\n   * @private\n   */\n  bindChangeEvents() {\n    this.$textarea.addEventListener('keyup', () => this.handleKeyUp())\n\n    // Bind focus/blur events to start/stop polling\n    this.$textarea.addEventListener('focus', () => this.handleFocus())\n    this.$textarea.addEventListener('blur', () => this.handleBlur())\n  }\n\n  /**\n   * Handle key up event\n   *\n   * Update the visible character counter and keep track of when the last update\n   * happened for each keypress\n   *\n   * @private\n   */\n  handleKeyUp() {\n    this.updateVisibleCountMessage()\n    this.lastInputTimestamp = Date.now()\n  }\n\n  /**\n   * Handle focus event\n   *\n   * Speech recognition software such as Dragon NaturallySpeaking will modify\n   * the fields by directly changing its `value`. These changes don't trigger\n   * events in JavaScript, so we need to poll to handle when and if they occur.\n   *\n   * Once the keyup event hasn't been detected for at least 1000 ms (1s), check\n   * if the textarea value has changed and update the count message if it has.\n   *\n   * This is so that the update triggered by the manual comparison doesn't\n   * conflict with debounced KeyboardEvent updates.\n   *\n   * @private\n   */\n  handleFocus() {\n    this.valueChecker = window.setInterval(() => {\n      if (\n        !this.lastInputTimestamp ||\n        Date.now() - 500 >= this.lastInputTimestamp\n      ) {\n        this.updateIfValueChanged()\n      }\n    }, 1000)\n  }\n\n  /**\n   * Handle blur event\n   *\n   * Stop checking the textarea value once the textarea no longer has focus\n   *\n   * @private\n   */\n  handleBlur() {\n    // Cancel value checking on blur\n    if (this.valueChecker) {\n      window.clearInterval(this.valueChecker)\n    }\n  }\n\n  /**\n   * Update count message if textarea value has changed\n   *\n   * @private\n   */\n  updateIfValueChanged() {\n    if (this.$textarea.value !== this.lastInputValue) {\n      this.lastInputValue = this.$textarea.value\n      this.updateCountMessage()\n    }\n  }\n\n  /**\n   * Update count message\n   *\n   * Helper function to update both the visible and screen reader-specific\n   * counters simultaneously (e.g. on init)\n   *\n   * @private\n   */\n  updateCountMessage() {\n    this.updateVisibleCountMessage()\n    this.updateScreenReaderCountMessage()\n  }\n\n  /**\n   * Update visible count message\n   *\n   * @private\n   */\n  updateVisibleCountMessage() {\n    const remainingNumber = this.maxLength - this.count(this.$textarea.value)\n    const isError = remainingNumber < 0\n\n    // If input is over the threshold, remove the disabled class which renders\n    // the counter invisible.\n    this.$visibleCountMessage.classList.toggle(\n      'govuk-character-count__message--disabled',\n      !this.isOverThreshold()\n    )\n\n    // Update styles\n    this.$textarea.classList.toggle('govuk-textarea--error', isError)\n    this.$visibleCountMessage.classList.toggle('govuk-error-message', isError)\n    this.$visibleCountMessage.classList.toggle('govuk-hint', !isError)\n\n    // Update message\n    this.$visibleCountMessage.textContent = this.getCountMessage()\n  }\n\n  /**\n   * Update screen reader count message\n   *\n   * @private\n   */\n  updateScreenReaderCountMessage() {\n    // If over the threshold, remove the aria-hidden attribute, allowing screen\n    // readers to announce the content of the element.\n    if (this.isOverThreshold()) {\n      this.$screenReaderCountMessage.removeAttribute('aria-hidden')\n    } else {\n      this.$screenReaderCountMessage.setAttribute('aria-hidden', 'true')\n    }\n\n    // Update message\n    this.$screenReaderCountMessage.textContent = this.getCountMessage()\n  }\n\n  /**\n   * Count the number of characters (or words, if `config.maxwords` is set)\n   * in the given text\n   *\n   * @private\n   * @param {string} text - The text to count the characters of\n   * @returns {number} the number of characters (or words) in the text\n   */\n  count(text) {\n    if (this.config.maxwords) {\n      const tokens = text.match(/\\S+/g) ?? [] // Matches consecutive non-whitespace chars\n      return tokens.length\n    }\n\n    return text.length\n  }\n\n  /**\n   * Get count message\n   *\n   * @private\n   * @returns {string} Status message\n   */\n  getCountMessage() {\n    const remainingNumber = this.maxLength - this.count(this.$textarea.value)\n    const countType = this.config.maxwords ? 'words' : 'characters'\n    return this.formatCountMessage(remainingNumber, countType)\n  }\n\n  /**\n   * Formats the message shown to users according to what's counted\n   * and how many remain\n   *\n   * @private\n   * @param {number} remainingNumber - The number of words/characaters remaining\n   * @param {string} countType - \"words\" or \"characters\"\n   * @returns {string} Status message\n   */\n  formatCountMessage(remainingNumber, countType) {\n    if (remainingNumber === 0) {\n      return this.i18n.t(`${countType}AtLimit`)\n    }\n\n    const translationKeySuffix =\n      remainingNumber < 0 ? 'OverLimit' : 'UnderLimit'\n\n    return this.i18n.t(`${countType}${translationKeySuffix}`, {\n      count: Math.abs(remainingNumber)\n    })\n  }\n\n  /**\n   * Check if count is over threshold\n   *\n   * Checks whether the value is over the configured threshold for the input.\n   * If there is no configured threshold, it is set to 0 and this function will\n   * always return true.\n   *\n   * @private\n   * @returns {boolean} true if the current count is over the config.threshold\n   *   (or no threshold is set)\n   */\n  isOverThreshold() {\n    // No threshold means we're always above threshold so save some computation\n    if (!this.config.threshold) {\n      return true\n    }\n\n    // Determine the remaining number of characters/words\n    const currentLength = this.count(this.$textarea.value)\n    const maxLength = this.maxLength\n\n    const thresholdValue = (maxLength * this.config.threshold) / 100\n\n    return thresholdValue <= currentLength\n  }\n\n  /**\n   * Name for the component used when initialising using data-module attributes.\n   */\n  static moduleName = 'govuk-character-count'\n\n  /**\n   * Character count default config\n   *\n   * @see {@link CharacterCountConfig}\n   * @constant\n   * @type {CharacterCountConfig}\n   */\n  static defaults = Object.freeze({\n    threshold: 0,\n    i18n: {\n      // Characters\n      charactersUnderLimit: {\n        one: 'You have %{count} character remaining',\n        other: 'You have %{count} characters remaining'\n      },\n      charactersAtLimit: 'You have 0 characters remaining',\n      charactersOverLimit: {\n        one: 'You have %{count} character too many',\n        other: 'You have %{count} characters too many'\n      },\n      // Words\n      wordsUnderLimit: {\n        one: 'You have %{count} word remaining',\n        other: 'You have %{count} words remaining'\n      },\n      wordsAtLimit: 'You have 0 words remaining',\n      wordsOverLimit: {\n        one: 'You have %{count} word too many',\n        other: 'You have %{count} words too many'\n      },\n      textareaDescription: {\n        other: ''\n      }\n    }\n  })\n\n  /**\n   * Character count config schema\n   *\n   * @constant\n   * @satisfies {Schema}\n   */\n  static schema = Object.freeze({\n    properties: {\n      i18n: { type: 'object' },\n      maxwords: { type: 'number' },\n      maxlength: { type: 'number' },\n      threshold: { type: 'number' }\n    },\n    anyOf: [\n      {\n        required: ['maxwords'],\n        errorMessage: 'Either \"maxlength\" or \"maxwords\" must be provided'\n      },\n      {\n        required: ['maxlength'],\n        errorMessage: 'Either \"maxlength\" or \"maxwords\" must be provided'\n      }\n    ]\n  })\n}\n\n/**\n * Character count config\n *\n * @see {@link CharacterCount.defaults}\n * @typedef {object} CharacterCountConfig\n * @property {number} [maxlength] - The maximum number of characters.\n *   If maxwords is provided, the maxlength option will be ignored.\n * @property {number} [maxwords] - The maximum number of words. If maxwords is\n *   provided, the maxlength option will be ignored.\n * @property {number} [threshold=0] - The percentage value of the limit at\n *   which point the count message is displayed. If this attribute is set, the\n *   count message will be hidden by default.\n * @property {CharacterCountTranslations} [i18n=CharacterCount.defaults.i18n] - Character count translations\n */\n\n/**\n * Character count translations\n *\n * @see {@link CharacterCount.defaults.i18n}\n * @typedef {object} CharacterCountTranslations\n *\n * Messages shown to users as they type. It provides feedback on how many words\n * or characters they have remaining or if they are over the limit. This also\n * includes a message used as an accessible description for the textarea.\n * @property {TranslationPluralForms} [charactersUnderLimit] - Message displayed\n *   when the number of characters is under the configured maximum, `maxlength`.\n *   This message is displayed visually and through assistive technologies. The\n *   component will replace the `%{count}` placeholder with the number of\n *   remaining characters. This is a [pluralised list of\n *   messages](https://frontend.design-system.service.gov.uk/localise-govuk-frontend).\n * @property {string} [charactersAtLimit] - Message displayed when the number of\n *   characters reaches the configured maximum, `maxlength`. This message is\n *   displayed visually and through assistive technologies.\n * @property {TranslationPluralForms} [charactersOverLimit] - Message displayed\n *   when the number of characters is over the configured maximum, `maxlength`.\n *   This message is displayed visually and through assistive technologies. The\n *   component will replace the `%{count}` placeholder with the number of\n *   remaining characters. This is a [pluralised list of\n *   messages](https://frontend.design-system.service.gov.uk/localise-govuk-frontend).\n * @property {TranslationPluralForms} [wordsUnderLimit] - Message displayed when\n *   the number of words is under the configured maximum, `maxlength`. This\n *   message is displayed visually and through assistive technologies. The\n *   component will replace the `%{count}` placeholder with the number of\n *   remaining words. This is a [pluralised list of\n *   messages](https://frontend.design-system.service.gov.uk/localise-govuk-frontend).\n * @property {string} [wordsAtLimit] - Message displayed when the number of\n *   words reaches the configured maximum, `maxlength`. This message is\n *   displayed visually and through assistive technologies.\n * @property {TranslationPluralForms} [wordsOverLimit] - Message displayed when\n *   the number of words is over the configured maximum, `maxlength`. This\n *   message is displayed visually and through assistive technologies. The\n *   component will replace the `%{count}` placeholder with the number of\n *   remaining words. This is a [pluralised list of\n *   messages](https://frontend.design-system.service.gov.uk/localise-govuk-frontend).\n * @property {TranslationPluralForms} [textareaDescription] - Message made\n *   available to assistive technologies, if none is already present in the\n *   HTML, to describe that the component accepts only a limited amount of\n *   content. It is visible on the page when JavaScript is unavailable. The\n *   component will replace the `%{count}` placeholder with the value of the\n *   `maxlength` or `maxwords` parameter.\n */\n\n/**\n * @typedef {import('../../common/index.mjs').Schema} Schema\n * @typedef {import('../../i18n.mjs').TranslationPluralForms} TranslationPluralForms\n */\n","import { ElementError } from '../../errors/index.mjs'\nimport { GOVUKFrontendComponent } from '../../govuk-frontend-component.mjs'\n\n/**\n * Checkboxes component\n *\n * @preserve\n */\nexport class Checkboxes extends GOVUKFrontendComponent {\n  /** @private */\n  $inputs\n\n  /**\n   * Checkboxes can be associated with a 'conditionally revealed' content block\n   * – for example, a checkbox for 'Phone' could reveal an additional form field\n   * for the user to enter their phone number.\n   *\n   * These associations are made using a `data-aria-controls` attribute, which\n   * is promoted to an aria-controls attribute during initialisation.\n   *\n   * We also need to restore the state of any conditional reveals on the page\n   * (for example if the user has navigated back), and set up event handlers to\n   * keep the reveal in sync with the checkbox state.\n   *\n   * @param {Element | null} $root - HTML element to use for checkboxes\n   */\n  constructor($root) {\n    super($root)\n\n    const $inputs = this.$root.querySelectorAll('input[type=\"checkbox\"]')\n    if (!$inputs.length) {\n      throw new ElementError({\n        component: Checkboxes,\n        identifier: 'Form inputs (`<input type=\"checkbox\">`)'\n      })\n    }\n\n    this.$inputs = $inputs\n\n    this.$inputs.forEach(($input) => {\n      const targetId = $input.getAttribute('data-aria-controls')\n\n      // Skip radios without data-aria-controls attributes\n      if (!targetId) {\n        return\n      }\n\n      // Throw if target conditional element does not exist.\n      if (!document.getElementById(targetId)) {\n        throw new ElementError({\n          component: Checkboxes,\n          identifier: `Conditional reveal (\\`id=\"${targetId}\"\\`)`\n        })\n      }\n\n      // Promote the data-aria-controls attribute to a aria-controls attribute\n      // so that the relationship is exposed in the AOM\n      $input.setAttribute('aria-controls', targetId)\n      $input.removeAttribute('data-aria-controls')\n    })\n\n    // When the page is restored after navigating 'back' in some browsers the\n    // state of form controls is not restored until *after* the DOMContentLoaded\n    // event is fired, so we need to sync after the pageshow event.\n    window.addEventListener('pageshow', () => this.syncAllConditionalReveals())\n\n    // Although we've set up handlers to sync state on the pageshow event, init\n    // could be called after those events have fired, for example if they are\n    // added to the page dynamically, so sync now too.\n    this.syncAllConditionalReveals()\n\n    // Handle events\n    this.$root.addEventListener('click', (event) => this.handleClick(event))\n  }\n\n  /**\n   * Sync the conditional reveal states for all checkboxes in this component.\n   *\n   * @private\n   */\n  syncAllConditionalReveals() {\n    this.$inputs.forEach(($input) =>\n      this.syncConditionalRevealWithInputState($input)\n    )\n  }\n\n  /**\n   * Sync conditional reveal with the input state\n   *\n   * Synchronise the visibility of the conditional reveal, and its accessible\n   * state, with the input's checked state.\n   *\n   * @private\n   * @param {HTMLInputElement} $input - Checkbox input\n   */\n  syncConditionalRevealWithInputState($input) {\n    const targetId = $input.getAttribute('aria-controls')\n    if (!targetId) {\n      return\n    }\n\n    const $target = document.getElementById(targetId)\n    if ($target?.classList.contains('govuk-checkboxes__conditional')) {\n      const inputIsChecked = $input.checked\n\n      $input.setAttribute('aria-expanded', inputIsChecked.toString())\n      $target.classList.toggle(\n        'govuk-checkboxes__conditional--hidden',\n        !inputIsChecked\n      )\n    }\n  }\n\n  /**\n   * Uncheck other checkboxes\n   *\n   * Find any other checkbox inputs with the same name value, and uncheck them.\n   * This is useful for when a “None of these\" checkbox is checked.\n   *\n   * @private\n   * @param {HTMLInputElement} $input - Checkbox input\n   */\n  unCheckAllInputsExcept($input) {\n    const allInputsWithSameName = document.querySelectorAll(\n      `input[type=\"checkbox\"][name=\"${$input.name}\"]`\n    )\n\n    allInputsWithSameName.forEach(($inputWithSameName) => {\n      const hasSameFormOwner = $input.form === $inputWithSameName.form\n      if (hasSameFormOwner && $inputWithSameName !== $input) {\n        $inputWithSameName.checked = false\n        this.syncConditionalRevealWithInputState($inputWithSameName)\n      }\n    })\n  }\n\n  /**\n   * Uncheck exclusive checkboxes\n   *\n   * Find any checkbox inputs with the same name value and the 'exclusive'\n   * behaviour, and uncheck them. This helps prevent someone checking both a\n   * regular checkbox and a \"None of these\" checkbox in the same fieldset.\n   *\n   * @private\n   * @param {HTMLInputElement} $input - Checkbox input\n   */\n  unCheckExclusiveInputs($input) {\n    const allInputsWithSameNameAndExclusiveBehaviour =\n      document.querySelectorAll(\n        `input[data-behaviour=\"exclusive\"][type=\"checkbox\"][name=\"${$input.name}\"]`\n      )\n\n    allInputsWithSameNameAndExclusiveBehaviour.forEach(($exclusiveInput) => {\n      const hasSameFormOwner = $input.form === $exclusiveInput.form\n      if (hasSameFormOwner) {\n        $exclusiveInput.checked = false\n        this.syncConditionalRevealWithInputState($exclusiveInput)\n      }\n    })\n  }\n\n  /**\n   * Click event handler\n   *\n   * Handle a click within the component root – if the click occurred on a checkbox,\n   * sync the state of any associated conditional reveal with the checkbox\n   * state.\n   *\n   * @private\n   * @param {MouseEvent} event - Click event\n   */\n  handleClick(event) {\n    const $clickedInput = event.target\n\n    // Ignore clicks on things that aren't checkbox inputs\n    if (\n      !($clickedInput instanceof HTMLInputElement) ||\n      $clickedInput.type !== 'checkbox'\n    ) {\n      return\n    }\n\n    // If the checkbox conditionally-reveals some content, sync the state\n    const hasAriaControls = $clickedInput.getAttribute('aria-controls')\n    if (hasAriaControls) {\n      this.syncConditionalRevealWithInputState($clickedInput)\n    }\n\n    // No further behaviour needed for unchecking\n    if (!$clickedInput.checked) {\n      return\n    }\n\n    // Handle 'exclusive' checkbox behaviour (ie \"None of these\")\n    const hasBehaviourExclusive =\n      $clickedInput.getAttribute('data-behaviour') === 'exclusive'\n    if (hasBehaviourExclusive) {\n      this.unCheckAllInputsExcept($clickedInput)\n    } else {\n      this.unCheckExclusiveInputs($clickedInput)\n    }\n  }\n\n  /**\n   * Name for the component used when initialising using data-module attributes.\n   */\n  static moduleName = 'govuk-checkboxes'\n}\n","import {\n  getFragmentFromUrl,\n  mergeConfigs,\n  setFocus\n} from '../../common/index.mjs'\nimport { normaliseDataset } from '../../common/normalise-dataset.mjs'\nimport { GOVUKFrontendComponent } from '../../govuk-frontend-component.mjs'\n\n/**\n * Error summary component\n *\n * Takes focus on initialisation for accessible announcement, unless disabled in\n * configuration.\n *\n * @preserve\n */\nexport class ErrorSummary extends GOVUKFrontendComponent {\n  /**\n   * @private\n   * @type {ErrorSummaryConfig}\n   */\n  config\n\n  /**\n   * @param {Element | null} $root - HTML element to use for error summary\n   * @param {ErrorSummaryConfig} [config] - Error summary config\n   */\n  constructor($root, config = {}) {\n    super($root)\n\n    this.config = mergeConfigs(\n      ErrorSummary.defaults,\n      config,\n      normaliseDataset(ErrorSummary, this.$root.dataset)\n    )\n\n    /**\n     * Focus the error summary\n     */\n    if (!this.config.disableAutoFocus) {\n      setFocus(this.$root)\n    }\n\n    this.$root.addEventListener('click', (event) => this.handleClick(event))\n  }\n\n  /**\n   * Click event handler\n   *\n   * @private\n   * @param {MouseEvent} event - Click event\n   */\n  handleClick(event) {\n    const $target = event.target\n    if ($target && this.focusTarget($target)) {\n      event.preventDefault()\n    }\n  }\n\n  /**\n   * Focus the target element\n   *\n   * By default, the browser will scroll the target into view. Because our\n   * labels or legends appear above the input, this means the user will be\n   * presented with an input without any context, as the label or legend will be\n   * off the top of the screen.\n   *\n   * Manually handling the click event, scrolling the question into view and\n   * then focussing the element solves this.\n   *\n   * This also results in the label and/or legend being announced correctly in\n   * NVDA (as tested in 2018.3.2) - without this only the field type is\n   * announced (e.g. \"Edit, has autocomplete\").\n   *\n   * @private\n   * @param {EventTarget} $target - Event target\n   * @returns {boolean} True if the target was able to be focussed\n   */\n  focusTarget($target) {\n    // If the element that was clicked was not a link, return early\n    if (!($target instanceof HTMLAnchorElement)) {\n      return false\n    }\n\n    const inputId = getFragmentFromUrl($target.href)\n    if (!inputId) {\n      return false\n    }\n\n    const $input = document.getElementById(inputId)\n    if (!$input) {\n      return false\n    }\n\n    const $legendOrLabel = this.getAssociatedLegendOrLabel($input)\n    if (!$legendOrLabel) {\n      return false\n    }\n\n    // Scroll the legend or label into view *before* calling focus on the input\n    // to avoid extra scrolling in browsers that don't support `preventScroll`\n    // (which at time of writing is most of them...)\n    $legendOrLabel.scrollIntoView()\n    $input.focus({ preventScroll: true })\n\n    return true\n  }\n\n  /**\n   * Get associated legend or label\n   *\n   * Returns the first element that exists from this list:\n   *\n   * - The `<legend>` associated with the closest `<fieldset>` ancestor, as long\n   *   as the top of it is no more than half a viewport height away from the\n   *   bottom of the input\n   * - The first `<label>` that is associated with the input using for=\"inputId\"\n   * - The closest parent `<label>`\n   *\n   * @private\n   * @param {Element} $input - The input\n   * @returns {Element | null} Associated legend or label, or null if no\n   *   associated legend or label can be found\n   */\n  getAssociatedLegendOrLabel($input) {\n    const $fieldset = $input.closest('fieldset')\n\n    if ($fieldset) {\n      const $legends = $fieldset.getElementsByTagName('legend')\n\n      if ($legends.length) {\n        const $candidateLegend = $legends[0]\n\n        // If the input type is radio or checkbox, always use the legend if\n        // there is one.\n        if (\n          $input instanceof HTMLInputElement &&\n          ($input.type === 'checkbox' || $input.type === 'radio')\n        ) {\n          return $candidateLegend\n        }\n\n        // For other input types, only scroll to the fieldset’s legend (instead\n        // of the label associated with the input) if the input would end up in\n        // the top half of the screen.\n        //\n        // This should avoid situations where the input either ends up off the\n        // screen, or obscured by a software keyboard.\n        const legendTop = $candidateLegend.getBoundingClientRect().top\n        const inputRect = $input.getBoundingClientRect()\n\n        // If the browser doesn't support Element.getBoundingClientRect().height\n        // or window.innerHeight (like IE8), bail and just link to the label.\n        if (inputRect.height && window.innerHeight) {\n          const inputBottom = inputRect.top + inputRect.height\n\n          if (inputBottom - legendTop < window.innerHeight / 2) {\n            return $candidateLegend\n          }\n        }\n      }\n    }\n\n    return (\n      document.querySelector(`label[for='${$input.getAttribute('id')}']`) ??\n      $input.closest('label')\n    )\n  }\n\n  /**\n   * Name for the component used when initialising using data-module attributes.\n   */\n  static moduleName = 'govuk-error-summary'\n\n  /**\n   * Error summary default config\n   *\n   * @see {@link ErrorSummaryConfig}\n   * @constant\n   * @type {ErrorSummaryConfig}\n   */\n  static defaults = Object.freeze({\n    disableAutoFocus: false\n  })\n\n  /**\n   * Error summary config schema\n   *\n   * @constant\n   * @satisfies {Schema}\n   */\n  static schema = Object.freeze({\n    properties: {\n      disableAutoFocus: { type: 'boolean' }\n    }\n  })\n}\n\n/**\n * Error summary config\n *\n * @typedef {object} ErrorSummaryConfig\n * @property {boolean} [disableAutoFocus=false] - If set to `true` the error\n *   summary will not be focussed when the page loads.\n */\n\n/**\n * @typedef {import('../../common/index.mjs').Schema} Schema\n */\n","import { mergeConfigs } from '../../common/index.mjs'\nimport { normaliseDataset } from '../../common/normalise-dataset.mjs'\nimport { ElementError } from '../../errors/index.mjs'\nimport { GOVUKFrontendComponent } from '../../govuk-frontend-component.mjs'\nimport { I18n } from '../../i18n.mjs'\n\n/**\n * Exit this page component\n *\n * @preserve\n */\nexport class ExitThisPage extends GOVUKFrontendComponent {\n  /**\n   * @private\n   * @type {ExitThisPageConfig}\n   */\n  config\n\n  /** @private */\n  i18n\n\n  /** @private */\n  $button\n\n  /**\n   * @private\n   * @type {HTMLAnchorElement | null}\n   */\n  $skiplinkButton = null\n\n  /**\n   * @private\n   * @type {HTMLElement | null}\n   */\n  $updateSpan = null\n\n  /**\n   * @private\n   * @type {HTMLElement | null}\n   */\n  $indicatorContainer = null\n\n  /**\n   * @private\n   * @type {HTMLElement | null}\n   */\n  $overlay = null\n\n  /** @private */\n  keypressCounter = 0\n\n  /** @private */\n  lastKeyWasModified = false\n\n  /** @private */\n  timeoutTime = 5000 // milliseconds\n\n  // Store the timeout events so that we can clear them to avoid user keypresses overlapping\n  // setTimeout returns an id that we can use to clear it with clearTimeout,\n  // hence the 'Id' suffix\n\n  /**\n   * @private\n   * @type {number | null}\n   */\n  keypressTimeoutId = null\n\n  /**\n   * @private\n   * @type {number | null}\n   */\n  timeoutMessageId = null\n\n  /**\n   * @param {Element | null} $root - HTML element that wraps the Exit This Page button\n   * @param {ExitThisPageConfig} [config] - Exit This Page config\n   */\n  constructor($root, config = {}) {\n    super($root)\n\n    const $button = this.$root.querySelector('.govuk-exit-this-page__button')\n    if (!($button instanceof HTMLAnchorElement)) {\n      throw new ElementError({\n        component: ExitThisPage,\n        element: $button,\n        expectedType: 'HTMLAnchorElement',\n        identifier: 'Button (`.govuk-exit-this-page__button`)'\n      })\n    }\n\n    this.config = mergeConfigs(\n      ExitThisPage.defaults,\n      config,\n      normaliseDataset(ExitThisPage, this.$root.dataset)\n    )\n\n    this.i18n = new I18n(this.config.i18n)\n    this.$button = $button\n\n    const $skiplinkButton = document.querySelector(\n      '.govuk-js-exit-this-page-skiplink'\n    )\n    if ($skiplinkButton instanceof HTMLAnchorElement) {\n      this.$skiplinkButton = $skiplinkButton\n    }\n\n    this.buildIndicator()\n    this.initUpdateSpan()\n    this.initButtonClickHandler()\n\n    // Check to see if this has already been done by a previous initialisation of ExitThisPage\n    if (!('govukFrontendExitThisPageKeypress' in document.body.dataset)) {\n      document.addEventListener('keyup', this.handleKeypress.bind(this), true)\n      document.body.dataset.govukFrontendExitThisPageKeypress = 'true'\n    }\n\n    // When the page is restored after navigating 'back' in some browsers the\n    // blank overlay remains present, rendering the page unusable. Here, we check\n    // to see if it's present on page (re)load, and remove it if so.\n    window.addEventListener('pageshow', this.resetPage.bind(this))\n  }\n\n  /**\n   * Create the <span> we use for screen reader announcements.\n   *\n   * @private\n   */\n  initUpdateSpan() {\n    this.$updateSpan = document.createElement('span')\n    this.$updateSpan.setAttribute('role', 'status')\n    this.$updateSpan.className = 'govuk-visually-hidden'\n\n    this.$root.appendChild(this.$updateSpan)\n  }\n\n  /**\n   * Create button click handlers.\n   *\n   * @private\n   */\n  initButtonClickHandler() {\n    // Main EtP button\n    this.$button.addEventListener('click', this.handleClick.bind(this))\n\n    // EtP secondary link\n    if (this.$skiplinkButton) {\n      this.$skiplinkButton.addEventListener(\n        'click',\n        this.handleClick.bind(this)\n      )\n    }\n  }\n\n  /**\n   * Create the HTML for the 'three lights' indicator on the button.\n   *\n   * @private\n   */\n  buildIndicator() {\n    // Build container\n    // Putting `aria-hidden` on it as it won't contain any readable information\n    this.$indicatorContainer = document.createElement('div')\n    this.$indicatorContainer.className = 'govuk-exit-this-page__indicator'\n    this.$indicatorContainer.setAttribute('aria-hidden', 'true')\n\n    // Create three 'lights' and place them within the container\n    for (let i = 0; i < 3; i++) {\n      const $indicator = document.createElement('div')\n      $indicator.className = 'govuk-exit-this-page__indicator-light'\n      this.$indicatorContainer.appendChild($indicator)\n    }\n\n    // Append it all to the module\n    this.$button.appendChild(this.$indicatorContainer)\n  }\n\n  /**\n   * Update whether the lights are visible and which ones are lit up depending on\n   * the value of `keypressCounter`.\n   *\n   * @private\n   */\n  updateIndicator() {\n    if (!this.$indicatorContainer) {\n      return\n    }\n\n    // Show or hide the indicator container depending on keypressCounter value\n    this.$indicatorContainer.classList.toggle(\n      'govuk-exit-this-page__indicator--visible',\n      this.keypressCounter > 0\n    )\n\n    // Turn on only the indicators we want on\n    const $indicators = this.$indicatorContainer.querySelectorAll(\n      '.govuk-exit-this-page__indicator-light'\n    )\n    $indicators.forEach(($indicator, index) => {\n      $indicator.classList.toggle(\n        'govuk-exit-this-page__indicator-light--on',\n        index < this.keypressCounter\n      )\n    })\n  }\n\n  /**\n   * Initiates the redirection away from the current page.\n   * Includes the loading overlay functionality, which covers the current page with a\n   * white overlay so that the contents are not visible during the loading\n   * process. This is particularly important on slow network connections.\n   *\n   * @private\n   */\n  exitPage() {\n    if (!this.$updateSpan) {\n      return\n    }\n\n    this.$updateSpan.textContent = ''\n\n    // Blank the page\n    // As well as creating an overlay with text, we also set the body to hidden\n    // to prevent screen reader and sequential navigation users potentially\n    // navigating through the page behind the overlay during loading\n    document.body.classList.add('govuk-exit-this-page-hide-content')\n    this.$overlay = document.createElement('div')\n    this.$overlay.className = 'govuk-exit-this-page-overlay'\n    this.$overlay.setAttribute('role', 'alert')\n\n    // we do these this way round, thus incurring a second paint, because changing\n    // the element text after adding it means that screen readers pick up the\n    // announcement more reliably.\n    document.body.appendChild(this.$overlay)\n    this.$overlay.textContent = this.i18n.t('activated')\n\n    window.location.href = this.$button.href\n  }\n\n  /**\n   * Pre-activation logic for when the button is clicked/activated via mouse or\n   * pointer.\n   *\n   * We do this to differentiate it from the keyboard activation event because we\n   * need to run `e.preventDefault` as the button or skiplink are both links and we\n   * want to apply some additional logic in `exitPage` before navigating.\n   *\n   * @private\n   * @param {MouseEvent} event - mouse click event\n   */\n  handleClick(event) {\n    event.preventDefault()\n    this.exitPage()\n  }\n\n  /**\n   * Logic for the 'quick escape' keyboard sequence functionality (pressing the\n   * Shift key three times without interruption, within a time limit).\n   *\n   * @private\n   * @param {KeyboardEvent} event - keyup event\n   */\n  handleKeypress(event) {\n    if (!this.$updateSpan) {\n      return\n    }\n\n    // Detect if the 'Shift' key has been pressed. We want to only do things if it\n    // was pressed by itself and not in a combination with another key—so we keep\n    // track of whether the preceding keyup had shiftKey: true on it, and if it\n    // did, we ignore the next Shift keyup event.\n    //\n    // This works because using Shift as a modifier key (e.g. pressing Shift + A)\n    // will fire TWO keyup events, one for A (with e.shiftKey: true) and the other\n    // for Shift (with e.shiftKey: false).\n    if (event.key === 'Shift' && !this.lastKeyWasModified) {\n      this.keypressCounter += 1\n\n      // Update the indicator before the below if statement can reset it back to 0\n      this.updateIndicator()\n\n      // Clear the timeout for the keypress timeout message clearing itself\n      if (this.timeoutMessageId) {\n        window.clearTimeout(this.timeoutMessageId)\n        this.timeoutMessageId = null\n      }\n\n      if (this.keypressCounter >= 3) {\n        this.keypressCounter = 0\n\n        if (this.keypressTimeoutId) {\n          window.clearTimeout(this.keypressTimeoutId)\n          this.keypressTimeoutId = null\n        }\n\n        this.exitPage()\n      } else {\n        if (this.keypressCounter === 1) {\n          this.$updateSpan.textContent = this.i18n.t('pressTwoMoreTimes')\n        } else {\n          this.$updateSpan.textContent = this.i18n.t('pressOneMoreTime')\n        }\n      }\n\n      this.setKeypressTimer()\n    } else if (this.keypressTimeoutId) {\n      // If the user pressed any key other than 'Shift', after having pressed\n      // 'Shift' and activating the timer, stop and reset the timer.\n      this.resetKeypressTimer()\n    }\n\n    // Keep track of whether the Shift modifier key was held during this keypress\n    this.lastKeyWasModified = event.shiftKey\n  }\n\n  /**\n   * Starts the 'quick escape' keyboard sequence timer.\n   *\n   * This can be invoked several times. We want this to be possible so that the\n   * timer is restarted each time the shortcut key is pressed (e.g. the user has\n   * up to n seconds between each keypress, rather than n seconds to invoke the\n   * entire sequence.)\n   *\n   * @private\n   */\n  setKeypressTimer() {\n    // Clear any existing timeout. This is so only one timer is running even if\n    // there are multiple keypresses in quick succession.\n    if (this.keypressTimeoutId) {\n      window.clearTimeout(this.keypressTimeoutId)\n    }\n\n    // Set a fresh timeout\n    this.keypressTimeoutId = window.setTimeout(\n      this.resetKeypressTimer.bind(this),\n      this.timeoutTime\n    )\n  }\n\n  /**\n   * Stops and resets the 'quick escape' keyboard sequence timer.\n   *\n   * @private\n   */\n  resetKeypressTimer() {\n    if (!this.$updateSpan) {\n      return\n    }\n\n    if (this.keypressTimeoutId) {\n      window.clearTimeout(this.keypressTimeoutId)\n      this.keypressTimeoutId = null\n    }\n\n    const $updateSpan = this.$updateSpan\n\n    this.keypressCounter = 0\n    $updateSpan.textContent = this.i18n.t('timedOut')\n\n    this.timeoutMessageId = window.setTimeout(() => {\n      $updateSpan.textContent = ''\n    }, this.timeoutTime)\n\n    this.updateIndicator()\n  }\n\n  /**\n   * Reset the page using the EtP button\n   *\n   * We use this in situations where a user may re-enter a page using the browser\n   * back button. In these cases, the browser can choose to restore the state of\n   * the page as it was previously, including restoring the 'ghost page' overlay,\n   * the announcement span having it's role set to \"alert\" and the keypress\n   * indicator still active, leaving the page in an unusable state.\n   *\n   * By running this check when the page is shown, we can programatically restore\n   * the page and the component to a \"default\" state\n   *\n   * @private\n   */\n  resetPage() {\n    // If an overlay is set, remove it and reset the value\n    document.body.classList.remove('govuk-exit-this-page-hide-content')\n\n    if (this.$overlay) {\n      this.$overlay.remove()\n      this.$overlay = null\n    }\n\n    // Ensure the announcement span's role is status, not alert and clear any text\n    if (this.$updateSpan) {\n      this.$updateSpan.setAttribute('role', 'status')\n      this.$updateSpan.textContent = ''\n    }\n\n    // Sync the keypress indicator lights\n    this.updateIndicator()\n\n    // If the timeouts are active, clear them\n    if (this.keypressTimeoutId) {\n      window.clearTimeout(this.keypressTimeoutId)\n    }\n\n    if (this.timeoutMessageId) {\n      window.clearTimeout(this.timeoutMessageId)\n    }\n  }\n\n  /**\n   * Name for the component used when initialising using data-module attributes.\n   */\n  static moduleName = 'govuk-exit-this-page'\n\n  /**\n   * Exit this page default config\n   *\n   * @see {@link ExitThisPageConfig}\n   * @constant\n   * @type {ExitThisPageConfig}\n   */\n  static defaults = Object.freeze({\n    i18n: {\n      activated: 'Loading.',\n      timedOut: 'Exit this page expired.',\n      pressTwoMoreTimes: 'Shift, press 2 more times to exit.',\n      pressOneMoreTime: 'Shift, press 1 more time to exit.'\n    }\n  })\n\n  /**\n   * Exit this page config schema\n   *\n   * @constant\n   * @satisfies {Schema}\n   */\n  static schema = Object.freeze({\n    properties: {\n      i18n: { type: 'object' }\n    }\n  })\n}\n\n/**\n * Exit this Page config\n *\n * @see {@link ExitThisPage.defaults}\n * @typedef {object} ExitThisPageConfig\n * @property {ExitThisPageTranslations} [i18n=ExitThisPage.defaults.i18n] - Exit this page translations\n */\n\n/**\n * Exit this Page translations\n *\n * @see {@link ExitThisPage.defaults.i18n}\n * @typedef {object} ExitThisPageTranslations\n *\n * Messages used by the component programatically inserted text, including\n * overlay text and screen reader announcements.\n * @property {string} [activated] - Screen reader announcement for when EtP\n *   keypress functionality has been successfully activated.\n * @property {string} [timedOut] - Screen reader announcement for when the EtP\n *   keypress functionality has timed out.\n * @property {string} [pressTwoMoreTimes] - Screen reader announcement informing\n *   the user they must press the activation key two more times.\n * @property {string} [pressOneMoreTime] - Screen reader announcement informing\n *   the user they must press the activation key one more time.\n */\n\n/**\n * @typedef {import('../../common/index.mjs').Schema} Schema\n */\n","import { getBreakpoint } from '../../common/index.mjs'\nimport { ElementError } from '../../errors/index.mjs'\nimport { GOVUKFrontendComponent } from '../../govuk-frontend-component.mjs'\n\n/**\n * Header component\n *\n * @preserve\n */\nexport class Header extends GOVUKFrontendComponent {\n  /** @private */\n  $menuButton\n\n  /** @private */\n  $menu\n\n  /**\n   * Save the opened/closed state for the nav in memory so that we can\n   * accurately maintain state when the screen is changed from small to big and\n   * back to small\n   *\n   * @private\n   */\n  menuIsOpen = false\n\n  /**\n   * A global const for storing a matchMedia instance which we'll use to detect\n   * when a screen size change happens. We rely on it being null if the feature\n   * isn't available to initially apply hidden attributes\n   *\n   * @private\n   * @type {MediaQueryList | null}\n   */\n  mql = null\n\n  /**\n   * Apply a matchMedia for desktop which will trigger a state sync if the\n   * browser viewport moves between states.\n   *\n   * @param {Element | null} $root - HTML element to use for header\n   */\n  constructor($root) {\n    super($root)\n\n    const $menuButton = this.$root.querySelector('.govuk-js-header-toggle')\n\n    // Headers don't necessarily have a navigation. When they don't, the menu\n    // toggle won't be rendered by our macro (or may be omitted when writing\n    // plain HTML)\n    if (!$menuButton) {\n      return this\n    }\n\n    const menuId = $menuButton.getAttribute('aria-controls')\n    if (!menuId) {\n      throw new ElementError({\n        component: Header,\n        identifier:\n          'Navigation button (`<button class=\"govuk-js-header-toggle\">`) attribute (`aria-controls`)'\n      })\n    }\n\n    const $menu = document.getElementById(menuId)\n    if (!$menu) {\n      throw new ElementError({\n        component: Header,\n        element: $menu,\n        identifier: `Navigation (\\`<ul id=\"${menuId}\">\\`)`\n      })\n    }\n\n    this.$menu = $menu\n    this.$menuButton = $menuButton\n\n    this.setupResponsiveChecks()\n\n    this.$menuButton.addEventListener('click', () =>\n      this.handleMenuButtonClick()\n    )\n  }\n\n  /**\n   * Setup viewport resize check\n   *\n   * @private\n   */\n  setupResponsiveChecks() {\n    const breakpoint = getBreakpoint('desktop')\n\n    if (!breakpoint.value) {\n      throw new ElementError({\n        component: Header,\n        identifier: `CSS custom property (\\`${breakpoint.property}\\`) on pseudo-class \\`:root\\``\n      })\n    }\n\n    // Media query list for GOV.UK Frontend desktop breakpoint\n    this.mql = window.matchMedia(`(min-width: ${breakpoint.value})`)\n\n    // MediaQueryList.addEventListener isn't supported by Safari < 14 so we need\n    // to be able to fall back to the deprecated MediaQueryList.addListener\n    if ('addEventListener' in this.mql) {\n      this.mql.addEventListener('change', () => this.checkMode())\n    } else {\n      // @ts-expect-error Property 'addListener' does not exist\n      // eslint-disable-next-line @typescript-eslint/no-unsafe-call\n      this.mql.addListener(() => this.checkMode())\n    }\n\n    this.checkMode()\n  }\n\n  /**\n   * Sync menu state\n   *\n   * Uses the global variable menuIsOpen to correctly set the accessible and\n   * visual states of the menu and the menu button.\n   * Additionally will force the menu to be visible and the menu button to be\n   * hidden if the matchMedia is triggered to desktop.\n   *\n   * @private\n   */\n  checkMode() {\n    if (!this.mql || !this.$menu || !this.$menuButton) {\n      return\n    }\n\n    if (this.mql.matches) {\n      this.$menu.removeAttribute('hidden')\n      this.$menuButton.setAttribute('hidden', '')\n    } else {\n      this.$menuButton.removeAttribute('hidden')\n      this.$menuButton.setAttribute('aria-expanded', this.menuIsOpen.toString())\n\n      if (this.menuIsOpen) {\n        this.$menu.removeAttribute('hidden')\n      } else {\n        this.$menu.setAttribute('hidden', '')\n      }\n    }\n  }\n\n  /**\n   * Handle menu button click\n   *\n   * When the menu button is clicked, change the visibility of the menu and then\n   * sync the accessibility state and menu button state\n   *\n   * @private\n   */\n  handleMenuButtonClick() {\n    this.menuIsOpen = !this.menuIsOpen\n    this.checkMode()\n  }\n\n  /**\n   * Name for the component used when initialising using data-module attributes.\n   */\n  static moduleName = 'govuk-header'\n}\n","import { mergeConfigs, setFocus } from '../../common/index.mjs'\nimport { normaliseDataset } from '../../common/normalise-dataset.mjs'\nimport { GOVUKFrontendComponent } from '../../govuk-frontend-component.mjs'\n\n/**\n * Notification Banner component\n *\n * @preserve\n */\nexport class NotificationBanner extends GOVUKFrontendComponent {\n  /**\n   * @private\n   * @type {NotificationBannerConfig}\n   */\n  config\n\n  /**\n   * @param {Element | null} $root - HTML element to use for notification banner\n   * @param {NotificationBannerConfig} [config] - Notification banner config\n   */\n  constructor($root, config = {}) {\n    super($root)\n\n    this.config = mergeConfigs(\n      NotificationBanner.defaults,\n      config,\n      normaliseDataset(NotificationBanner, this.$root.dataset)\n    )\n\n    /**\n     * Focus the notification banner\n     *\n     * If `role=\"alert\"` is set, focus the element to help some assistive\n     * technologies prioritise announcing it.\n     *\n     * You can turn off the auto-focus functionality by setting\n     * `data-disable-auto-focus=\"true\"` in the component HTML. You might wish to\n     * do this based on user research findings, or to avoid a clash with another\n     * element which should be focused when the page loads.\n     */\n    if (\n      this.$root.getAttribute('role') === 'alert' &&\n      !this.config.disableAutoFocus\n    ) {\n      setFocus(this.$root)\n    }\n  }\n\n  /**\n   * Name for the component used when initialising using data-module attributes.\n   */\n  static moduleName = 'govuk-notification-banner'\n\n  /**\n   * Notification banner default config\n   *\n   * @see {@link NotificationBannerConfig}\n   * @constant\n   * @type {NotificationBannerConfig}\n   */\n  static defaults = Object.freeze({\n    disableAutoFocus: false\n  })\n\n  /**\n   * Notification banner config schema\n   *\n   * @constant\n   * @satisfies {Schema}\n   */\n  static schema = Object.freeze({\n    properties: {\n      disableAutoFocus: { type: 'boolean' }\n    }\n  })\n}\n\n/**\n * Notification banner config\n *\n * @typedef {object} NotificationBannerConfig\n * @property {boolean} [disableAutoFocus=false] - If set to `true` the\n *   notification banner will not be focussed when the page loads. This only\n *   applies if the component has a `role` of `alert` – in other cases the\n *   component will not be focused on page load, regardless of this option.\n */\n\n/**\n * @typedef {import('../../common/index.mjs').Schema} Schema\n */\n","import { closestAttributeValue } from '../../common/closest-attribute-value.mjs'\nimport { mergeConfigs } from '../../common/index.mjs'\nimport { normaliseDataset } from '../../common/normalise-dataset.mjs'\nimport { ElementError } from '../../errors/index.mjs'\nimport { GOVUKFrontendComponent } from '../../govuk-frontend-component.mjs'\nimport { I18n } from '../../i18n.mjs'\n\n/**\n * Password input component\n *\n * @preserve\n */\nexport class PasswordInput extends GOVUKFrontendComponent {\n  /**\n   * @private\n   * @type {PasswordInputConfig}\n   */\n  config\n\n  /** @private */\n  i18n\n\n  /**\n   * @private\n   * @type {HTMLInputElement}\n   */\n  $input\n\n  /**\n   * @private\n   * @type {HTMLButtonElement}\n   */\n  $showHideButton\n\n  /** @private */\n  $screenReaderStatusMessage\n\n  /**\n   * @param {Element | null} $root - HTML element to use for password input\n   * @param {PasswordInputConfig} [config] - Password input config\n   */\n  constructor($root, config = {}) {\n    super($root)\n\n    const $input = this.$root.querySelector('.govuk-js-password-input-input')\n    if (!($input instanceof HTMLInputElement)) {\n      throw new ElementError({\n        component: PasswordInput,\n        element: $input,\n        expectedType: 'HTMLInputElement',\n        identifier: 'Form field (`.govuk-js-password-input-input`)'\n      })\n    }\n\n    if ($input.type !== 'password') {\n      throw new ElementError(\n        'Password input: Form field (`.govuk-js-password-input-input`) must be of type `password`.'\n      )\n    }\n\n    const $showHideButton = this.$root.querySelector(\n      '.govuk-js-password-input-toggle'\n    )\n    if (!($showHideButton instanceof HTMLButtonElement)) {\n      throw new ElementError({\n        component: PasswordInput,\n        element: $showHideButton,\n        expectedType: 'HTMLButtonElement',\n        identifier: 'Button (`.govuk-js-password-input-toggle`)'\n      })\n    }\n\n    if ($showHideButton.type !== 'button') {\n      throw new ElementError(\n        'Password input: Button (`.govuk-js-password-input-toggle`) must be of type `button`.'\n      )\n    }\n\n    this.$input = $input\n    this.$showHideButton = $showHideButton\n\n    this.config = mergeConfigs(\n      PasswordInput.defaults,\n      config,\n      normaliseDataset(PasswordInput, this.$root.dataset)\n    )\n\n    this.i18n = new I18n(this.config.i18n, {\n      // Read the fallback if necessary rather than have it set in the defaults\n      locale: closestAttributeValue(this.$root, 'lang')\n    })\n\n    // Show the toggle button element\n    this.$showHideButton.removeAttribute('hidden')\n\n    // Create and append the status text for screen readers.\n    // This is injected between the input and button so that users get a sensible reading order if\n    // moving through the page content linearly:\n    // [password input] -> [your password is visible/hidden] -> [show/hide password]\n    const $screenReaderStatusMessage = document.createElement('div')\n    $screenReaderStatusMessage.className =\n      'govuk-password-input__sr-status govuk-visually-hidden'\n    $screenReaderStatusMessage.setAttribute('aria-live', 'polite')\n    this.$screenReaderStatusMessage = $screenReaderStatusMessage\n    this.$input.insertAdjacentElement('afterend', $screenReaderStatusMessage)\n\n    // Bind toggle button\n    this.$showHideButton.addEventListener('click', this.toggle.bind(this))\n\n    // Bind event to revert the password visibility to hidden\n    if (this.$input.form) {\n      this.$input.form.addEventListener('submit', () => this.hide())\n    }\n\n    // If the page is restored from bfcache and the password is visible, hide it again\n    window.addEventListener('pageshow', (event) => {\n      if (event.persisted && this.$input.type !== 'password') {\n        this.hide()\n      }\n    })\n\n    // Default the component to having the password hidden.\n    this.hide()\n  }\n\n  /**\n   * Toggle the visibility of the password input\n   *\n   * @private\n   * @param {MouseEvent} event - Click event\n   */\n  toggle(event) {\n    event.preventDefault()\n\n    // If on this click, the field is type=\"password\", show the value\n    if (this.$input.type === 'password') {\n      this.show()\n      return\n    }\n\n    // Otherwise, hide it\n    // Being defensive - hiding should always be the default\n    this.hide()\n  }\n\n  /**\n   * Show the password input value in plain text.\n   *\n   * @private\n   */\n  show() {\n    this.setType('text')\n  }\n\n  /**\n   * Hide the password input value.\n   *\n   * @private\n   */\n  hide() {\n    this.setType('password')\n  }\n\n  /**\n   * Set the password input type\n   *\n   * @param {'text' | 'password'} type - Input type\n   * @private\n   */\n  setType(type) {\n    if (type === this.$input.type) {\n      return\n    }\n\n    // Update input type\n    this.$input.setAttribute('type', type)\n\n    const isHidden = type === 'password'\n    const prefixButton = isHidden ? 'show' : 'hide'\n    const prefixStatus = isHidden ? 'passwordHidden' : 'passwordShown'\n\n    // Update button text\n    this.$showHideButton.innerText = this.i18n.t(`${prefixButton}Password`)\n\n    // Update button aria-label\n    this.$showHideButton.setAttribute(\n      'aria-label',\n      this.i18n.t(`${prefixButton}PasswordAriaLabel`)\n    )\n\n    // Update status change text\n    this.$screenReaderStatusMessage.innerText = this.i18n.t(\n      `${prefixStatus}Announcement`\n    )\n  }\n\n  /**\n   * Name for the component used when initialising using data-module attributes.\n   */\n  static moduleName = 'govuk-password-input'\n\n  /**\n   * Password input default config\n   *\n   * @see {@link PasswordInputConfig}\n   * @constant\n   * @default\n   * @type {PasswordInputConfig}\n   */\n  static defaults = Object.freeze({\n    i18n: {\n      showPassword: 'Show',\n      hidePassword: 'Hide',\n      showPasswordAriaLabel: 'Show password',\n      hidePasswordAriaLabel: 'Hide password',\n      passwordShownAnnouncement: 'Your password is visible',\n      passwordHiddenAnnouncement: 'Your password is hidden'\n    }\n  })\n\n  /**\n   * Password input config schema\n   *\n   * @constant\n   * @satisfies {Schema}\n   */\n  static schema = Object.freeze({\n    properties: {\n      i18n: { type: 'object' }\n    }\n  })\n}\n\n/**\n * Password input config\n *\n * @typedef {object} PasswordInputConfig\n * @property {PasswordInputTranslations} [i18n=PasswordInput.defaults.i18n] - Password input translations\n */\n\n/**\n * Password input translations\n *\n * @see {@link PasswordInput.defaults.i18n}\n * @typedef {object} PasswordInputTranslations\n *\n * Messages displayed to the user indicating the state of the show/hide toggle.\n * @property {string} [showPassword] - Visible text of the button when the\n *   password is currently hidden. Plain text only.\n * @property {string} [hidePassword] - Visible text of the button when the\n *   password is currently visible. Plain text only.\n * @property {string} [showPasswordAriaLabel] - aria-label of the button when\n *   the password is currently hidden. Plain text only.\n * @property {string} [hidePasswordAriaLabel] - aria-label of the button when\n *   the password is currently visible. Plain text only.\n * @property {string} [passwordShownAnnouncement] - Screen reader\n *   announcement to make when the password has just become visible.\n *   Plain text only.\n * @property {string} [passwordHiddenAnnouncement] - Screen reader\n *   announcement to make when the password has just been hidden.\n *   Plain text only.\n */\n\n/**\n * @typedef {import('../../common/index.mjs').Schema} Schema\n * @typedef {import('../../i18n.mjs').TranslationPluralForms} TranslationPluralForms\n */\n","import { ElementError } from '../../errors/index.mjs'\nimport { GOVUKFrontendComponent } from '../../govuk-frontend-component.mjs'\n\n/**\n * Radios component\n *\n * @preserve\n */\nexport class Radios extends GOVUKFrontendComponent {\n  /** @private */\n  $inputs\n\n  /**\n   * Radios can be associated with a 'conditionally revealed' content block –\n   * for example, a radio for 'Phone' could reveal an additional form field for\n   * the user to enter their phone number.\n   *\n   * These associations are made using a `data-aria-controls` attribute, which\n   * is promoted to an aria-controls attribute during initialisation.\n   *\n   * We also need to restore the state of any conditional reveals on the page\n   * (for example if the user has navigated back), and set up event handlers to\n   * keep the reveal in sync with the radio state.\n   *\n   * @param {Element | null} $root - HTML element to use for radios\n   */\n  constructor($root) {\n    super($root)\n\n    const $inputs = this.$root.querySelectorAll('input[type=\"radio\"]')\n    if (!$inputs.length) {\n      throw new ElementError({\n        component: Radios,\n        identifier: 'Form inputs (`<input type=\"radio\">`)'\n      })\n    }\n\n    this.$inputs = $inputs\n\n    this.$inputs.forEach(($input) => {\n      const targetId = $input.getAttribute('data-aria-controls')\n\n      // Skip radios without data-aria-controls attributes\n      if (!targetId) {\n        return\n      }\n\n      // Throw if target conditional element does not exist.\n      if (!document.getElementById(targetId)) {\n        throw new ElementError({\n          component: Radios,\n          identifier: `Conditional reveal (\\`id=\"${targetId}\"\\`)`\n        })\n      }\n\n      // Promote the data-aria-controls attribute to a aria-controls attribute\n      // so that the relationship is exposed in the AOM\n      $input.setAttribute('aria-controls', targetId)\n      $input.removeAttribute('data-aria-controls')\n    })\n\n    // When the page is restored after navigating 'back' in some browsers the\n    // state of form controls is not restored until *after* the DOMContentLoaded\n    // event is fired, so we need to sync after the pageshow event.\n    window.addEventListener('pageshow', () => this.syncAllConditionalReveals())\n\n    // Although we've set up handlers to sync state on the pageshow event, init\n    // could be called after those events have fired, for example if they are\n    // added to the page dynamically, so sync now too.\n    this.syncAllConditionalReveals()\n\n    // Handle events\n    this.$root.addEventListener('click', (event) => this.handleClick(event))\n  }\n\n  /**\n   * Sync the conditional reveal states for all radio buttons in this component.\n   *\n   * @private\n   */\n  syncAllConditionalReveals() {\n    this.$inputs.forEach(($input) =>\n      this.syncConditionalRevealWithInputState($input)\n    )\n  }\n\n  /**\n   * Sync conditional reveal with the input state\n   *\n   * Synchronise the visibility of the conditional reveal, and its accessible\n   * state, with the input's checked state.\n   *\n   * @private\n   * @param {HTMLInputElement} $input - Radio input\n   */\n  syncConditionalRevealWithInputState($input) {\n    const targetId = $input.getAttribute('aria-controls')\n    if (!targetId) {\n      return\n    }\n\n    const $target = document.getElementById(targetId)\n    if ($target?.classList.contains('govuk-radios__conditional')) {\n      const inputIsChecked = $input.checked\n\n      $input.setAttribute('aria-expanded', inputIsChecked.toString())\n      $target.classList.toggle(\n        'govuk-radios__conditional--hidden',\n        !inputIsChecked\n      )\n    }\n  }\n\n  /**\n   * Click event handler\n   *\n   * Handle a click within the component root – if the click occurred on a radio, sync\n   * the state of the conditional reveal for all radio buttons in the same form\n   * with the same name (because checking one radio could have un-checked a\n   * radio under the root of another Radio component)\n   *\n   * @private\n   * @param {MouseEvent} event - Click event\n   */\n  handleClick(event) {\n    const $clickedInput = event.target\n\n    // Ignore clicks on things that aren't radio buttons\n    if (\n      !($clickedInput instanceof HTMLInputElement) ||\n      $clickedInput.type !== 'radio'\n    ) {\n      return\n    }\n\n    // We only need to consider radios with conditional reveals, which will have\n    // aria-controls attributes.\n    const $allInputs = document.querySelectorAll(\n      'input[type=\"radio\"][aria-controls]'\n    )\n\n    const $clickedInputForm = $clickedInput.form\n    const $clickedInputName = $clickedInput.name\n\n    $allInputs.forEach(($input) => {\n      const hasSameFormOwner = $input.form === $clickedInputForm\n      const hasSameName = $input.name === $clickedInputName\n\n      if (hasSameName && hasSameFormOwner) {\n        this.syncConditionalRevealWithInputState($input)\n      }\n    })\n  }\n\n  /**\n   * Name for the component used when initialising using data-module attributes.\n   */\n  static moduleName = 'govuk-radios'\n}\n","import { getBreakpoint } from '../../common/index.mjs'\nimport { ElementError } from '../../errors/index.mjs'\nimport { GOVUKFrontendComponent } from '../../govuk-frontend-component.mjs'\n\n/**\n * Service Navigation component\n *\n * @preserve\n */\nexport class ServiceNavigation extends GOVUKFrontendComponent {\n  /** @private */\n  $menuButton\n\n  /** @private */\n  $menu\n\n  /**\n   * Remember the open/closed state of the nav so we can maintain it when the\n   * screen is resized.\n   *\n   * @private\n   */\n  menuIsOpen = false\n\n  /**\n   * A global const for storing a matchMedia instance which we'll use to detect\n   * when a screen size change happens. We rely on it being null if the feature\n   * isn't available to initially apply hidden attributes\n   *\n   * @private\n   * @type {MediaQueryList | null}\n   */\n  mql = null\n\n  /**\n   * @param {Element | null} $root - HTML element to use for header\n   */\n  constructor($root) {\n    super($root)\n\n    const $menuButton = this.$root.querySelector(\n      '.govuk-js-service-navigation-toggle'\n    )\n\n    // Headers don't necessarily have a navigation. When they don't, the menu\n    // toggle won't be rendered by our macro (or may be omitted when writing\n    // plain HTML)\n    if (!$menuButton) {\n      return this\n    }\n\n    const menuId = $menuButton.getAttribute('aria-controls')\n    if (!menuId) {\n      throw new ElementError({\n        component: ServiceNavigation,\n        identifier:\n          'Navigation button (`<button class=\"govuk-js-service-navigation-toggle\">`) attribute (`aria-controls`)'\n      })\n    }\n\n    const $menu = document.getElementById(menuId)\n    if (!$menu) {\n      throw new ElementError({\n        component: ServiceNavigation,\n        element: $menu,\n        identifier: `Navigation (\\`<ul id=\"${menuId}\">\\`)`\n      })\n    }\n\n    this.$menu = $menu\n    this.$menuButton = $menuButton\n\n    this.setupResponsiveChecks()\n\n    this.$menuButton.addEventListener('click', () =>\n      this.handleMenuButtonClick()\n    )\n  }\n\n  /**\n   * Setup viewport resize check\n   *\n   * @private\n   */\n  setupResponsiveChecks() {\n    const breakpoint = getBreakpoint('tablet')\n\n    if (!breakpoint.value) {\n      throw new ElementError({\n        component: ServiceNavigation,\n        identifier: `CSS custom property (\\`${breakpoint.property}\\`) on pseudo-class \\`:root\\``\n      })\n    }\n\n    // Media query list for GOV.UK Frontend desktop breakpoint\n    this.mql = window.matchMedia(`(min-width: ${breakpoint.value})`)\n\n    // MediaQueryList.addEventListener isn't supported by Safari < 14 so we need\n    // to be able to fall back to the deprecated MediaQueryList.addListener\n    if ('addEventListener' in this.mql) {\n      this.mql.addEventListener('change', () => this.checkMode())\n    } else {\n      // @ts-expect-error Property 'addListener' does not exist\n      // eslint-disable-next-line @typescript-eslint/no-unsafe-call\n      this.mql.addListener(() => this.checkMode())\n    }\n\n    this.checkMode()\n  }\n\n  /**\n   * Sync menu state\n   *\n   * Uses the global variable menuIsOpen to correctly set the accessible and\n   * visual states of the menu and the menu button.\n   * Additionally will force the menu to be visible and the menu button to be\n   * hidden if the matchMedia is triggered to desktop.\n   *\n   * @private\n   */\n  checkMode() {\n    if (!this.mql || !this.$menu || !this.$menuButton) {\n      return\n    }\n\n    if (this.mql.matches) {\n      this.$menu.removeAttribute('hidden')\n      this.$menuButton.setAttribute('hidden', '')\n    } else {\n      this.$menuButton.removeAttribute('hidden')\n      this.$menuButton.setAttribute('aria-expanded', this.menuIsOpen.toString())\n\n      if (this.menuIsOpen) {\n        this.$menu.removeAttribute('hidden')\n      } else {\n        this.$menu.setAttribute('hidden', '')\n      }\n    }\n  }\n\n  /**\n   * Handle menu button click\n   *\n   * When the menu button is clicked, change the visibility of the menu and then\n   * sync the accessibility state and menu button state\n   *\n   * @private\n   */\n  handleMenuButtonClick() {\n    this.menuIsOpen = !this.menuIsOpen\n    this.checkMode()\n  }\n\n  /**\n   * Name for the component used when initialising using data-module attributes.\n   */\n  static moduleName = 'govuk-service-navigation'\n}\n","import { getFragmentFromUrl, setFocus } from '../../common/index.mjs'\nimport { ElementError } from '../../errors/index.mjs'\nimport { GOVUKFrontendComponent } from '../../govuk-frontend-component.mjs'\n\n/**\n * Skip link component\n *\n * @preserve\n * @augments GOVUKFrontendComponent<HTMLAnchorElement>\n */\nexport class SkipLink extends GOVUKFrontendComponent {\n  static elementType = HTMLAnchorElement\n\n  /**\n   * @param {Element | null} $root - HTML element to use for skip link\n   * @throws {ElementError} when $root is not set or the wrong type\n   * @throws {ElementError} when $root.hash does not contain a hash\n   * @throws {ElementError} when the linked element is missing or the wrong type\n   */\n  constructor($root) {\n    super($root)\n\n    const hash = this.$root.hash\n    const href = this.$root.getAttribute('href') ?? ''\n\n    /** @type {URL | undefined} */\n    let url\n\n    /**\n     * Check for valid link URL\n     *\n     * {@link https://caniuse.com/url}\n     * {@link https://url.spec.whatwg.org}\n     *\n     */\n    try {\n      url = new window.URL(this.$root.href)\n    } catch (error) {\n      throw new ElementError(\n        `Skip link: Target link (\\`href=\"${href}\"\\`) is invalid`\n      )\n    }\n\n    // Return early for external URLs or links to other pages\n    if (\n      url.origin !== window.location.origin ||\n      url.pathname !== window.location.pathname\n    ) {\n      return\n    }\n\n    const linkedElementId = getFragmentFromUrl(hash)\n\n    // Check link path matching current page\n    if (!linkedElementId) {\n      throw new ElementError(\n        `Skip link: Target link (\\`href=\"${href}\"\\`) has no hash fragment`\n      )\n    }\n\n    const $linkedElement = document.getElementById(linkedElementId)\n\n    // Check for link target element\n    if (!$linkedElement) {\n      throw new ElementError({\n        component: SkipLink,\n        element: $linkedElement,\n        identifier: `Target content (\\`id=\"${linkedElementId}\"\\`)`\n      })\n    }\n\n    /**\n     * Focus the linked element on click\n     *\n     * Adds a helper CSS class to hide native focus styles,\n     * but removes it on blur to restore native focus styles\n     */\n    this.$root.addEventListener('click', () =>\n      setFocus($linkedElement, {\n        onBeforeFocus() {\n          $linkedElement.classList.add('govuk-skip-link-focused-element')\n        },\n        onBlur() {\n          $linkedElement.classList.remove('govuk-skip-link-focused-element')\n        }\n      })\n    )\n  }\n\n  /**\n   * Name for the component used when initialising using data-module attributes.\n   */\n  static moduleName = 'govuk-skip-link'\n}\n","import { getBreakpoint, getFragmentFromUrl } from '../../common/index.mjs'\nimport { ElementError } from '../../errors/index.mjs'\nimport { GOVUKFrontendComponent } from '../../govuk-frontend-component.mjs'\n\n/**\n * Tabs component\n *\n * @preserve\n */\nexport class Tabs extends GOVUKFrontendComponent {\n  /** @private */\n  $tabs\n\n  /** @private */\n  $tabList\n\n  /** @private */\n  $tabListItems\n\n  /** @private */\n  jsHiddenClass = 'govuk-tabs__panel--hidden'\n\n  /** @private */\n  changingHash = false\n\n  /** @private */\n  boundTabClick\n\n  /** @private */\n  boundTabKeydown\n\n  /** @private */\n  boundOnHashChange\n\n  /**\n   * @private\n   * @type {MediaQueryList | null}\n   */\n  mql = null\n\n  /**\n   * @param {Element | null} $root - HTML element to use for tabs\n   */\n  constructor($root) {\n    super($root)\n\n    const $tabs = this.$root.querySelectorAll('a.govuk-tabs__tab')\n    if (!$tabs.length) {\n      throw new ElementError({\n        component: Tabs,\n        identifier: 'Links (`<a class=\"govuk-tabs__tab\">`)'\n      })\n    }\n\n    this.$tabs = $tabs\n\n    // Save bound functions so we can remove event listeners during teardown\n    this.boundTabClick = this.onTabClick.bind(this)\n    this.boundTabKeydown = this.onTabKeydown.bind(this)\n    this.boundOnHashChange = this.onHashChange.bind(this)\n\n    const $tabList = this.$root.querySelector('.govuk-tabs__list')\n    const $tabListItems = this.$root.querySelectorAll(\n      'li.govuk-tabs__list-item'\n    )\n\n    if (!$tabList) {\n      throw new ElementError({\n        component: Tabs,\n        identifier: 'List (`<ul class=\"govuk-tabs__list\">`)'\n      })\n    }\n\n    if (!$tabListItems.length) {\n      throw new ElementError({\n        component: Tabs,\n        identifier: 'List items (`<li class=\"govuk-tabs__list-item\">`)'\n      })\n    }\n\n    this.$tabList = $tabList\n    this.$tabListItems = $tabListItems\n\n    this.setupResponsiveChecks()\n  }\n\n  /**\n   * Setup viewport resize check\n   *\n   * @private\n   */\n  setupResponsiveChecks() {\n    const breakpoint = getBreakpoint('tablet')\n\n    if (!breakpoint.value) {\n      throw new ElementError({\n        component: Tabs,\n        identifier: `CSS custom property (\\`${breakpoint.property}\\`) on pseudo-class \\`:root\\``\n      })\n    }\n\n    // Media query list for GOV.UK Frontend tablet breakpoint\n    this.mql = window.matchMedia(`(min-width: ${breakpoint.value})`)\n\n    // MediaQueryList.addEventListener isn't supported by Safari < 14 so we need\n    // to be able to fall back to the deprecated MediaQueryList.addListener\n    if ('addEventListener' in this.mql) {\n      this.mql.addEventListener('change', () => this.checkMode())\n    } else {\n      // @ts-expect-error Property 'addListener' does not exist\n      // eslint-disable-next-line @typescript-eslint/no-unsafe-call\n      this.mql.addListener(() => this.checkMode())\n    }\n\n    this.checkMode()\n  }\n\n  /**\n   * Setup or teardown handler for viewport resize check\n   *\n   * @private\n   */\n  checkMode() {\n    if (this.mql?.matches) {\n      this.setup()\n    } else {\n      this.teardown()\n    }\n  }\n\n  /**\n   * Setup tab component\n   *\n   * @private\n   */\n  setup() {\n    this.$tabList.setAttribute('role', 'tablist')\n\n    this.$tabListItems.forEach(($item) => {\n      $item.setAttribute('role', 'presentation')\n    })\n\n    this.$tabs.forEach(($tab) => {\n      // Set HTML attributes\n      this.setAttributes($tab)\n\n      // Handle events\n      $tab.addEventListener('click', this.boundTabClick, true)\n      $tab.addEventListener('keydown', this.boundTabKeydown, true)\n\n      // Remove old active panels\n      this.hideTab($tab)\n    })\n\n    // Show either the active tab according to the URL's hash or the first tab\n    const $activeTab = this.getTab(window.location.hash) ?? this.$tabs[0]\n\n    this.showTab($activeTab)\n\n    // Handle hashchange events\n    window.addEventListener('hashchange', this.boundOnHashChange, true)\n  }\n\n  /**\n   * Teardown tab component\n   *\n   * @private\n   */\n  teardown() {\n    this.$tabList.removeAttribute('role')\n\n    this.$tabListItems.forEach(($item) => {\n      $item.removeAttribute('role')\n    })\n\n    this.$tabs.forEach(($tab) => {\n      // Remove events\n      $tab.removeEventListener('click', this.boundTabClick, true)\n      $tab.removeEventListener('keydown', this.boundTabKeydown, true)\n\n      // Unset HTML attributes\n      this.unsetAttributes($tab)\n    })\n\n    // Remove hashchange event handler\n    window.removeEventListener('hashchange', this.boundOnHashChange, true)\n  }\n\n  /**\n   * Handle hashchange event\n   *\n   * @private\n   * @returns {void | undefined} Returns void, or undefined when prevented\n   */\n  onHashChange() {\n    const hash = window.location.hash\n    const $tabWithHash = this.getTab(hash)\n    if (!$tabWithHash) {\n      return\n    }\n\n    // Prevent changing the hash\n    if (this.changingHash) {\n      this.changingHash = false\n      return\n    }\n\n    // Show either the active tab according to the URL's hash or the first tab\n    const $previousTab = this.getCurrentTab()\n    if (!$previousTab) {\n      return\n    }\n\n    this.hideTab($previousTab)\n    this.showTab($tabWithHash)\n    $tabWithHash.focus()\n  }\n\n  /**\n   * Hide panel for tab link\n   *\n   * @private\n   * @param {HTMLAnchorElement} $tab - Tab link\n   */\n  hideTab($tab) {\n    this.unhighlightTab($tab)\n    this.hidePanel($tab)\n  }\n\n  /**\n   * Show panel for tab link\n   *\n   * @private\n   * @param {HTMLAnchorElement} $tab - Tab link\n   */\n  showTab($tab) {\n    this.highlightTab($tab)\n    this.showPanel($tab)\n  }\n\n  /**\n   * Get tab link by hash\n   *\n   * @private\n   * @param {string} hash - Hash fragment including #\n   * @returns {HTMLAnchorElement | null} Tab link\n   */\n  getTab(hash) {\n    return this.$root.querySelector(`a.govuk-tabs__tab[href=\"${hash}\"]`)\n  }\n\n  /**\n   * Set tab link and panel attributes\n   *\n   * @private\n   * @param {HTMLAnchorElement} $tab - Tab link\n   */\n  setAttributes($tab) {\n    const panelId = getFragmentFromUrl($tab.href)\n    if (!panelId) {\n      return\n    }\n\n    // Set tab attributes\n    $tab.setAttribute('id', `tab_${panelId}`)\n    $tab.setAttribute('role', 'tab')\n    $tab.setAttribute('aria-controls', panelId)\n    $tab.setAttribute('aria-selected', 'false')\n    $tab.setAttribute('tabindex', '-1')\n\n    // Set panel attributes\n    const $panel = this.getPanel($tab)\n    if (!$panel) {\n      return\n    }\n\n    $panel.setAttribute('role', 'tabpanel')\n    $panel.setAttribute('aria-labelledby', $tab.id)\n    $panel.classList.add(this.jsHiddenClass)\n  }\n\n  /**\n   * Unset tab link and panel attributes\n   *\n   * @private\n   * @param {HTMLAnchorElement} $tab - Tab link\n   */\n  unsetAttributes($tab) {\n    // unset tab attributes\n    $tab.removeAttribute('id')\n    $tab.removeAttribute('role')\n    $tab.removeAttribute('aria-controls')\n    $tab.removeAttribute('aria-selected')\n    $tab.removeAttribute('tabindex')\n\n    // unset panel attributes\n    const $panel = this.getPanel($tab)\n    if (!$panel) {\n      return\n    }\n\n    $panel.removeAttribute('role')\n    $panel.removeAttribute('aria-labelledby')\n    $panel.classList.remove(this.jsHiddenClass)\n  }\n\n  /**\n   * Handle tab link clicks\n   *\n   * @private\n   * @param {MouseEvent} event - Mouse click event\n   * @returns {void} Returns void\n   */\n  onTabClick(event) {\n    const $currentTab = this.getCurrentTab()\n    const $nextTab = event.currentTarget\n\n    if (!$currentTab || !($nextTab instanceof HTMLAnchorElement)) {\n      return\n    }\n\n    event.preventDefault()\n\n    this.hideTab($currentTab)\n    this.showTab($nextTab)\n    this.createHistoryEntry($nextTab)\n  }\n\n  /**\n   * Update browser URL hash fragment for tab\n   *\n   * - Allows back/forward to navigate tabs\n   * - Avoids page jump when hash changes\n   *\n   * @private\n   * @param {HTMLAnchorElement} $tab - Tab link\n   */\n  createHistoryEntry($tab) {\n    const $panel = this.getPanel($tab)\n    if (!$panel) {\n      return\n    }\n\n    // Save and restore the id so the page doesn't jump when a user clicks a tab\n    // (which changes the hash)\n    const panelId = $panel.id\n    $panel.id = ''\n    this.changingHash = true\n    window.location.hash = panelId\n    $panel.id = panelId\n  }\n\n  /**\n   * Handle tab keydown event\n   *\n   * - Press right arrow for next tab\n   * - Press left arrow for previous tab\n   *\n   * @private\n   * @param {KeyboardEvent} event - Keydown event\n   */\n  onTabKeydown(event) {\n    switch (event.key) {\n      // 'Left' and 'Right' required for Edge 16 support.\n      case 'ArrowLeft':\n      case 'Left':\n        this.activatePreviousTab()\n        event.preventDefault()\n        break\n      case 'ArrowRight':\n      case 'Right':\n        this.activateNextTab()\n        event.preventDefault()\n        break\n    }\n  }\n\n  /**\n   * Activate next tab\n   *\n   * @private\n   */\n  activateNextTab() {\n    const $currentTab = this.getCurrentTab()\n    if (!$currentTab?.parentElement) {\n      return\n    }\n\n    const $nextTabListItem = $currentTab.parentElement.nextElementSibling\n    if (!$nextTabListItem) {\n      return\n    }\n\n    const $nextTab = $nextTabListItem.querySelector('a.govuk-tabs__tab')\n    if (!$nextTab) {\n      return\n    }\n\n    this.hideTab($currentTab)\n    this.showTab($nextTab)\n    $nextTab.focus()\n    this.createHistoryEntry($nextTab)\n  }\n\n  /**\n   * Activate previous tab\n   *\n   * @private\n   */\n  activatePreviousTab() {\n    const $currentTab = this.getCurrentTab()\n    if (!$currentTab?.parentElement) {\n      return\n    }\n\n    const $previousTabListItem =\n      $currentTab.parentElement.previousElementSibling\n    if (!$previousTabListItem) {\n      return\n    }\n\n    const $previousTab = $previousTabListItem.querySelector('a.govuk-tabs__tab')\n    if (!$previousTab) {\n      return\n    }\n\n    this.hideTab($currentTab)\n    this.showTab($previousTab)\n    $previousTab.focus()\n    this.createHistoryEntry($previousTab)\n  }\n\n  /**\n   * Get tab panel for tab link\n   *\n   * @private\n   * @param {HTMLAnchorElement} $tab - Tab link\n   * @returns {Element | null} Tab panel\n   */\n  getPanel($tab) {\n    const panelId = getFragmentFromUrl($tab.href)\n    if (!panelId) {\n      return null\n    }\n\n    return this.$root.querySelector(`#${panelId}`)\n  }\n\n  /**\n   * Show tab panel for tab link\n   *\n   * @private\n   * @param {HTMLAnchorElement} $tab - Tab link\n   */\n  showPanel($tab) {\n    const $panel = this.getPanel($tab)\n    if (!$panel) {\n      return\n    }\n\n    $panel.classList.remove(this.jsHiddenClass)\n  }\n\n  /**\n   * Hide tab panel for tab link\n   *\n   * @private\n   * @param {HTMLAnchorElement} $tab - Tab link\n   */\n  hidePanel($tab) {\n    const $panel = this.getPanel($tab)\n    if (!$panel) {\n      return\n    }\n\n    $panel.classList.add(this.jsHiddenClass)\n  }\n\n  /**\n   * Unset 'selected' state for tab link\n   *\n   * @private\n   * @param {HTMLAnchorElement} $tab - Tab link\n   */\n  unhighlightTab($tab) {\n    if (!$tab.parentElement) {\n      return\n    }\n\n    $tab.setAttribute('aria-selected', 'false')\n    $tab.parentElement.classList.remove('govuk-tabs__list-item--selected')\n    $tab.setAttribute('tabindex', '-1')\n  }\n\n  /**\n   * Set 'selected' state for tab link\n   *\n   * @private\n   * @param {HTMLAnchorElement} $tab - Tab link\n   */\n  highlightTab($tab) {\n    if (!$tab.parentElement) {\n      return\n    }\n\n    $tab.setAttribute('aria-selected', 'true')\n    $tab.parentElement.classList.add('govuk-tabs__list-item--selected')\n    $tab.setAttribute('tabindex', '0')\n  }\n\n  /**\n   * Get current tab link\n   *\n   * @private\n   * @returns {HTMLAnchorElement | null} Tab link\n   */\n  getCurrentTab() {\n    return this.$root.querySelector(\n      '.govuk-tabs__list-item--selected a.govuk-tabs__tab'\n    )\n  }\n\n  /**\n   * Name for the component used when initialising using data-module attributes.\n   */\n  static moduleName = 'govuk-tabs'\n}\n","import { isSupported } from './common/index.mjs'\nimport { Accordion } from './components/accordion/accordion.mjs'\nimport { Button } from './components/button/button.mjs'\nimport { CharacterCount } from './components/character-count/character-count.mjs'\nimport { Checkboxes } from './components/checkboxes/checkboxes.mjs'\nimport { ErrorSummary } from './components/error-summary/error-summary.mjs'\nimport { ExitThisPage } from './components/exit-this-page/exit-this-page.mjs'\nimport { Header } from './components/header/header.mjs'\nimport { NotificationBanner } from './components/notification-banner/notification-banner.mjs'\nimport { PasswordInput } from './components/password-input/password-input.mjs'\nimport { Radios } from './components/radios/radios.mjs'\nimport { ServiceNavigation } from './components/service-navigation/service-navigation.mjs'\nimport { SkipLink } from './components/skip-link/skip-link.mjs'\nimport { Tabs } from './components/tabs/tabs.mjs'\nimport { SupportError } from './errors/index.mjs'\n\n/**\n * Initialise all components\n *\n * Use the `data-module` attributes to find, instantiate and init all of the\n * components provided as part of GOV.UK Frontend.\n *\n * @param {Config & { scope?: Element, onError?: OnErrorCallback<CompatibleClass> }} [config] - Config for all components (with optional scope)\n */\nfunction initAll(config) {\n  config = typeof config !== 'undefined' ? config : {}\n\n  // Skip initialisation when GOV.UK Frontend is not supported\n  if (!isSupported()) {\n    if (config.onError) {\n      config.onError(new SupportError(), {\n        config\n      })\n    } else {\n      console.log(new SupportError())\n    }\n    return\n  }\n\n  const components = /** @type {const} */ ([\n    [Accordion, config.accordion],\n    [Button, config.button],\n    [CharacterCount, config.characterCount],\n    [Checkboxes],\n    [ErrorSummary, config.errorSummary],\n    [ExitThisPage, config.exitThisPage],\n    [Header],\n    [NotificationBanner, config.notificationBanner],\n    [PasswordInput, config.passwordInput],\n    [Radios],\n    [ServiceNavigation],\n    [SkipLink],\n    [Tabs]\n  ])\n\n  // Allow the user to initialise GOV.UK Frontend in only certain sections of the page\n  // Defaults to the entire document if nothing is set.\n  // const $scope = config.scope ?? document\n\n  const options = {\n    scope: config.scope ?? document,\n    onError: config.onError\n  }\n\n  components.forEach(([Component, config]) => {\n    createAll(Component, config, options)\n  })\n}\n\n/**\n * Create all instances of a specific component on the page\n *\n * Uses the `data-module` attribute to find all elements matching the specified\n * component on the page, creating instances of the component object for each\n * of them.\n *\n * Any component errors will be caught and logged to the console.\n *\n * @template {CompatibleClass} T\n * @param {T} Component - class of the component to create\n * @param {T[\"defaults\"]} [config] - Config supplied to component\n * @param {OnErrorCallback<T> | Element | Document | CreateAllOptions<T> } [createAllOptions] - options for createAll including scope of the document to search within and callback function if error throw by component on init\n * @returns {Array<InstanceType<T>>} - array of instantiated components\n */\nfunction createAll(Component, config, createAllOptions) {\n  let /** @type {Element | Document} */ $scope = document\n  let /** @type {OnErrorCallback<Component> | undefined} */ onError\n\n  if (typeof createAllOptions === 'object') {\n    createAllOptions = /** @type {CreateAllOptions<Component>} */ (\n      // eslint-disable-next-line no-self-assign\n      createAllOptions\n    )\n\n    $scope = createAllOptions.scope ?? $scope\n    onError = createAllOptions.onError\n  }\n\n  if (typeof createAllOptions === 'function') {\n    onError = createAllOptions\n  }\n\n  if (createAllOptions instanceof HTMLElement) {\n    $scope = createAllOptions\n  }\n\n  const $elements = $scope.querySelectorAll(\n    `[data-module=\"${Component.moduleName}\"]`\n  )\n\n  // Skip initialisation when GOV.UK Frontend is not supported\n  if (!isSupported()) {\n    if (onError) {\n      onError(new SupportError(), {\n        component: Component,\n        config\n      })\n    } else {\n      console.log(new SupportError())\n    }\n    return []\n  }\n\n  /* eslint-disable-next-line @typescript-eslint/no-unsafe-return --\n   * We can't define CompatibleClass as `{new(): CompatibleClass, moduleName: string}`,\n   * as when doing `typeof Accordion` (or any component), TypeScript doesn't seem\n   * to acknowledge the static `moduleName` that's set in our component classes.\n   * This means we have to set the constructor of `CompatibleClass` as `{new(): any}`,\n   * leading to ESLint frowning that we're returning `any[]`.\n   */\n  return Array.from($elements)\n    .map(($element) => {\n      try {\n        // Only pass config to components that accept it\n        // eslint-disable-next-line @typescript-eslint/no-unsafe-return\n        return typeof config !== 'undefined'\n          ? new Component($element, config)\n          : new Component($element)\n      } catch (error) {\n        if (onError) {\n          onError(error, {\n            element: $element,\n            component: Component,\n            config\n          })\n        } else {\n          console.log(error)\n        }\n\n        return null\n      }\n    })\n    .filter(Boolean) // Exclude components that errored\n}\n\nexport { initAll, createAll }\n\n/* eslint-disable jsdoc/valid-types --\n * `{new(...args: any[] ): object}` is not recognised as valid\n * https://github.com/gajus/eslint-plugin-jsdoc/issues/145#issuecomment-1308722878\n * https://github.com/jsdoc-type-pratt-parser/jsdoc-type-pratt-parser/issues/131\n **/\n\n/**\n * @typedef {{new (...args: any[]): any, defaults?: object, moduleName: string}} CompatibleClass\n */\n\n/* eslint-enable jsdoc/valid-types */\n\n/**\n * Config for all components via `initAll()`\n *\n * @typedef {object} Config\n * @property {AccordionConfig} [accordion] - Accordion config\n * @property {ButtonConfig} [button] - Button config\n * @property {CharacterCountConfig} [characterCount] - Character Count config\n * @property {ErrorSummaryConfig} [errorSummary] - Error Summary config\n * @property {ExitThisPageConfig} [exitThisPage] - Exit This Page config\n * @property {NotificationBannerConfig} [notificationBanner] - Notification Banner config\n * @property {PasswordInputConfig} [passwordInput] - Password input config\n */\n\n/**\n * Config for individual components\n *\n * @typedef {import('./components/accordion/accordion.mjs').AccordionConfig} AccordionConfig\n * @typedef {import('./components/accordion/accordion.mjs').AccordionTranslations} AccordionTranslations\n * @typedef {import('./components/button/button.mjs').ButtonConfig} ButtonConfig\n * @typedef {import('./components/character-count/character-count.mjs').CharacterCountConfig} CharacterCountConfig\n * @typedef {import('./components/character-count/character-count.mjs').CharacterCountTranslations} CharacterCountTranslations\n * @typedef {import('./components/error-summary/error-summary.mjs').ErrorSummaryConfig} ErrorSummaryConfig\n * @typedef {import('./components/exit-this-page/exit-this-page.mjs').ExitThisPageConfig} ExitThisPageConfig\n * @typedef {import('./components/exit-this-page/exit-this-page.mjs').ExitThisPageTranslations} ExitThisPageTranslations\n * @typedef {import('./components/notification-banner/notification-banner.mjs').NotificationBannerConfig} NotificationBannerConfig\n * @typedef {import('./components/password-input/password-input.mjs').PasswordInputConfig} PasswordInputConfig\n */\n\n/**\n * Component config keys, e.g. `accordion` and `characterCount`\n *\n * @typedef {keyof Config} ConfigKey\n */\n\n/**\n * @template {CompatibleClass} T\n * @typedef {object} ErrorContext\n * @property {Element} [element] - Element used for component module initialisation\n * @property {T} [component] - Class of component\n * @property {T[\"defaults\"]} config - Config supplied to component\n */\n\n/**\n * @template {CompatibleClass} T\n * @callback OnErrorCallback\n * @param {unknown} error - Thrown error\n * @param {ErrorContext<T>} context - Object containing the element, component class and configuration\n */\n\n/**\n * @template {CompatibleClass} T\n * @typedef {object} CreateAllOptions\n * @property {Element | Document} [scope] - scope of the document to search within\n * @property {OnErrorCallback<T>} [onError] - callback function if error throw by component on init\n */\n"],"names":["version","normaliseString","value","property","trimmedValue","trim","output","outputType","type","includes","length","isFinite","Number","mergeConfigs","configObjects","formattedConfigObject","configObject","key","Object","keys","option","override","isObject","extractConfigByNamespace","Component","dataset","namespace","schema","properties","newObject","entries","current","keyParts","split","index","name","getFragmentFromUrl","url","pop","getBreakpoint","window","getComputedStyle","document","documentElement","getPropertyValue","undefined","setFocus","$element","options","_options$onBeforeFocu","isFocusable","getAttribute","onBlur","_options$onBlur","call","removeAttribute","setAttribute","addEventListener","once","onBeforeFocus","focus","isSupported","$scope","body","classList","contains","Array","isArray","formatErrorMessage","message","moduleName","normaliseDataset","out","field","GOVUKFrontendError","Error","constructor","args","super","this","SupportError","supportMessage","HTMLScriptElement","prototype","ConfigError","ElementError","messageOrOptions","component","identifier","element","expectedType","InitError","componentOrMessage","GOVUKFrontendComponent","$root","_$root","childConstructor","elementType","checkSupport","checkInitialised","HTMLElement","hasAttribute","isInitialised","I18n","translations","config","_config$locale","locale","lang","t","lookupKey","translation","count","translationPluralForm","getPluralSuffix","match","replacePlaceholders","translationString","formatter","Intl","NumberFormat","supportedLocalesOf","replace","placeholderWithBraces","placeholderKey","hasOwnProperty","placeholderValue","format","hasIntlPluralRulesSupport","Boolean","PluralRules","preferredForm","select","selectPluralFormUsingFallbackRules","console","warn","Math","abs","floor","ruleset","getPluralRulesForLocale","pluralRules","localeShort","pluralRule","pluralRulesMap","languages","arabic","chinese","french","german","irish","russian","scottish","spanish","welsh","n","lastTwo","last","Accordion","i18n","controlsClass","showAllClass","showAllTextClass","sectionClass","sectionExpandedClass","sectionButtonClass","sectionHeaderClass","sectionHeadingClass","sectionHeadingDividerClass","sectionHeadingTextClass","sectionHeadingTextFocusClass","sectionShowHideToggleClass","sectionShowHideToggleFocusClass","sectionShowHideTextClass","upChevronIconClass","downChevronIconClass","sectionSummaryClass","sectionSummaryFocusClass","sectionContentClass","$sections","$showAllButton","$showAllIcon","$showAllText","defaults","querySelectorAll","initControls","initSectionHeaders","updateShowAllButton","areAllSectionsOpen","createElement","add","appendChild","$accordionControls","insertBefore","firstChild","onShowOrHideAllToggle","event","onBeforeMatch","forEach","$section","i","$header","querySelector","constructHeaderMarkup","setExpanded","isExpanded","onSectionToggle","setInitialState","$span","$heading","$summary","$button","id","attr","from","attributes","$headingText","$headingTextFocus","childNodes","$child","$showHideToggle","$showHideToggleFocus","$showHideText","$showHideIcon","getButtonPunctuationEl","$summarySpan","$summarySpanFocus","remove","removeChild","$fragment","target","Element","closest","nowExpanded","storeState","expanded","$content","newButtonText","textContent","ariaLabelParts","push","ariaLabelMessage","join","every","toString","toggle","getIdentifier","rememberExpanded","sessionStorage","setItem","exception","state","getItem","$punctuationEl","freeze","hideAllSections","hideSection","hideSectionAriaLabel","showAllSections","showSection","showSectionAriaLabel","Button","debounceFormSubmitTimer","handleKeyDown","debounce","$target","preventDefault","click","preventDoubleClick","setTimeout","DEBOUNCE_TIMEOUT_IN_SECONDS","closestAttributeValue","attributeName","$closestElementWithAttribute","CharacterCount","_ref","_this$config$maxwords","$textarea","$visibleCountMessage","$screenReaderCountMessage","lastInputTimestamp","lastInputValue","valueChecker","maxLength","HTMLTextAreaElement","HTMLInputElement","datasetConfig","configOverrides","maxlength","maxwords","errors","validationErrors","conditions","required","errorMessage","validateConfig","Infinity","textareaDescriptionId","$textareaDescription","getElementById","insertAdjacentElement","className","bindChangeEvents","updateCountMessage","handleKeyUp","handleFocus","handleBlur","updateVisibleCountMessage","Date","now","setInterval","updateIfValueChanged","clearInterval","updateScreenReaderCountMessage","isError","isOverThreshold","getCountMessage","text","_text$match","remainingNumber","countType","formatCountMessage","translationKeySuffix","threshold","currentLength","charactersUnderLimit","one","other","charactersAtLimit","charactersOverLimit","wordsUnderLimit","wordsAtLimit","wordsOverLimit","textareaDescription","anyOf","Checkboxes","$inputs","$input","targetId","syncAllConditionalReveals","handleClick","syncConditionalRevealWithInputState","inputIsChecked","checked","unCheckAllInputsExcept","$inputWithSameName","form","unCheckExclusiveInputs","$exclusiveInput","$clickedInput","ErrorSummary","disableAutoFocus","focusTarget","HTMLAnchorElement","inputId","href","$legendOrLabel","getAssociatedLegendOrLabel","scrollIntoView","preventScroll","_document$querySelect","$fieldset","$legends","getElementsByTagName","$candidateLegend","legendTop","getBoundingClientRect","top","inputRect","height","innerHeight","ExitThisPage","$skiplinkButton","$updateSpan","$indicatorContainer","$overlay","keypressCounter","lastKeyWasModified","timeoutTime","keypressTimeoutId","timeoutMessageId","buildIndicator","initUpdateSpan","initButtonClickHandler","handleKeypress","bind","govukFrontendExitThisPageKeypress","resetPage","$indicator","updateIndicator","exitPage","location","resetKeypressTimer","clearTimeout","setKeypressTimer","shiftKey","activated","timedOut","pressTwoMoreTimes","pressOneMoreTime","Header","$menuButton","$menu","menuIsOpen","mql","menuId","setupResponsiveChecks","handleMenuButtonClick","breakpoint","matchMedia","checkMode","addListener","matches","NotificationBanner","PasswordInput","$showHideButton","$screenReaderStatusMessage","HTMLButtonElement","hide","persisted","show","setType","isHidden","prefixButton","prefixStatus","innerText","showPassword","hidePassword","showPasswordAriaLabel","hidePasswordAriaLabel","passwordShownAnnouncement","passwordHiddenAnnouncement","Radios","$allInputs","$clickedInputForm","$clickedInputName","hasSameFormOwner","ServiceNavigation","SkipLink","_this$$root$getAttrib","hash","URL","error","origin","pathname","linkedElementId","$linkedElement","Tabs","$tabs","$tabList","$tabListItems","jsHiddenClass","changingHash","boundTabClick","boundTabKeydown","boundOnHashChange","onTabClick","onTabKeydown","onHashChange","_this$mql","setup","teardown","_this$getTab","$item","$tab","setAttributes","hideTab","$activeTab","getTab","showTab","removeEventListener","unsetAttributes","$tabWithHash","$previousTab","getCurrentTab","unhighlightTab","hidePanel","highlightTab","showPanel","panelId","$panel","getPanel","$currentTab","$nextTab","currentTarget","createHistoryEntry","activatePreviousTab","activateNextTab","parentElement","$nextTabListItem","nextElementSibling","$previousTabListItem","previousElementSibling","initAll","_config$scope","onError","log","components","accordion","button","characterCount","errorSummary","exitThisPage","notificationBanner","passwordInput","scope","createAll","createAllOptions","_createAllOptions$sco","$elements","map","filter"],"mappings":"AAUO,MAAMA,QAAU,QCMhB,SAASC,gBAAgBC,EAAOC,GACrC,MAAMC,EAAeF,EAAQA,EAAMG,OAAS,GAE5C,IAAIC,EACAC,EAAaJ,MAAAA,OAAAA,EAAAA,EAAUK,KAe3B,OAZKD,IACC,CAAC,OAAQ,SAASE,SAASL,KAC7BG,EAAa,WAKXH,EAAaM,OAAS,GAAKC,SAASC,OAAOR,MAC7CG,EAAa,WAITA,GACN,IAAK,UACHD,EAA0B,SAAjBF,EACT,MAEF,IAAK,SACHE,EAASM,OAAOR,GAChB,MAEF,QACEE,EAASJ,EAGb,OAAOI,CACT,CC7BO,SAASO,gBAAgBC,GAG9B,MAAMC,EAAwB,CAAA,EAG9B,IAAK,MAAMC,KAAgBF,EACzB,IAAK,MAAMG,KAAOC,OAAOC,KAAKH,GAAe,CAC3C,MAAMI,EAASL,EAAsBE,GAC/BI,EAAWL,EAAaC,GAK1BK,SAASF,IAAWE,SAASD,GAE/BN,EAAsBE,GAAOJ,aAAaO,EAAQC,GAGlDN,EAAsBE,GAAOI,CAEjC,CAGF,OAAON,CACT,CAYO,SAASQ,yBAAyBC,UAAWC,EAASC,GAC3D,MAAMvB,EAAWqB,UAAUG,OAAOC,WAAWF,GAG7C,GAAuB,YAAnBvB,MAAAA,OAAAA,EAAAA,EAAUK,MACZ,OAIF,MAAMqB,EAAY,CAChBH,CAACA,GAAyC,CAAE,GAG9C,IAAK,MAAOT,EAAKf,KAAUgB,OAAOY,QAAQL,GAAU,CAElD,IAAIM,EAAUF,EAGd,MAAMG,EAAWf,EAAIgB,MAAM,KAQ3B,IAAK,MAAOC,EAAOC,KAASH,EAASF,UACZ,iBAAZC,IAELG,EAAQF,EAAStB,OAAS,GAEvBY,SAASS,EAAQI,MACpBJ,EAAQI,GAAQ,IAIlBJ,EAAUA,EAAQI,IACTlB,IAAQS,IAEjBK,EAAQI,GAAQlC,gBAAgBC,IAIxC,CAEA,OAAO2B,EAAUH,EACnB,CAYO,SAASU,mBAAmBC,GACjC,GAAKA,EAAI5B,SAAS,KAIlB,OAAO4B,EAAIJ,MAAM,KAAKK,KACxB,CASO,SAASC,cAAcJ,GAC5B,MAAMhC,EAAW,+BAA+BgC,IAOhD,MAAO,CACLhC,WACAD,MANYsC,OACXC,iBAAiBC,SAASC,iBAC1BC,iBAAiBzC,SAIF0C,EAEpB,CAeO,SAASC,SAASC,EAAUC,EAAU,IAAI,IAAAC,EAC/C,MAAMC,EAAcH,EAASI,aAAa,YAgB1C,SAASC,SAAS,IAAAC,EAChBA,OAAAA,EAAAL,EAAQI,SAARC,EAAgBC,KAAKP,GAEhBG,GACHH,EAASQ,gBAAgB,WAE7B,CApBKL,GACHH,EAASS,aAAa,WAAY,MAsBpCT,EAASU,iBAAiB,SAhB1B,WACEV,EAASU,iBAAiB,OAAQL,OAAQ,CAAEM,MAAM,GACpD,GAc4C,CAAEA,MAAM,IAGpDT,OAAAA,EAAAD,EAAQW,gBAARV,EAAuBK,KAAKP,GAC5BA,EAASa,OACX,CA0BO,SAASC,YAAYC,EAASpB,SAASqB,MAC5C,QAAKD,GAIEA,EAAOE,UAAUC,SAAS,2BACnC,CA0DA,SAAS3C,SAASF,GAChB,QAASA,GAA4B,iBAAXA,IAZ5B,SAAiBA,GACf,OAAO8C,MAAMC,QAAQ/C,EACvB,CAUoD+C,CAAQ/C,EAC5D,CAUO,SAASgD,mBAAmB5C,UAAW6C,GAC5C,MAAO,GAAG7C,UAAU8C,eAAeD,GACrC,CCtRO,SAASE,iBAAiB/C,UAAWC,GAC1C,MAAM+C,EAA0D,CAAA,EAGhE,IAAK,MAAOC,EAAOtE,KAAae,OAAOY,QAAQN,UAAUG,OAAOC,YAC1D6C,KAAShD,IACX+C,EAAIC,GAASxE,gBAAgBwB,EAAQgD,GAAQtE,IAOxB,YAAnBA,MAAAA,OAAAA,EAAAA,EAAUK,QACZgE,EAAIC,GAASlD,yBAAyBC,UAAWC,EAASgD,IAI9D,OAAOD,CACT,CCXO,MAAME,2BAA2BC,MAAMC,WAAAA,IAAAC,GAAAC,SAAAD,GAAAE,KAC5C5C,KAAO,oBAAoB,EAMtB,MAAM6C,qBAAqBN,mBAQhCE,WAAAA,CAAYd,EAASpB,SAASqB,MAC5B,MAAMkB,EACJ,aAAcC,kBAAkBC,UAC5B,iHACA,mDAENL,MACEhB,EACImB,EACA,gEACLF,KAjBH5C,KAAO,cAkBP,EAMK,MAAMiD,oBAAoBV,mBAAmBE,WAAAA,IAAAC,GAAAC,SAAAD,GAAAE,KAClD5C,KAAO,aAAa,EAMf,MAAMkD,qBAAqBX,mBAmBhCE,WAAAA,CAAYU,GACV,IAAIjB,EAAsC,iBAArBiB,EAAgCA,EAAmB,GAGxE,GAAgC,iBAArBA,EAA+B,CACxC,MAAMC,UAAEA,EAASC,WAAEA,EAAUC,QAAEA,EAAOC,aAAEA,GAAiBJ,EAEzDjB,EAAUmB,EAGVnB,GAAWoB,EACP,mBAAmBC,MAAAA,EAAAA,EAAgB,gBACnC,aAEJrB,EAAUD,mBAAmBmB,EAAWlB,EAC1C,CAEAS,MAAMT,GAAQU,KAnChB5C,KAAO,cAoCP,EAMK,MAAMwD,kBAAkBjB,mBAO7BE,WAAAA,CAAYgB,GASVd,MAPgC,iBAAvBc,EACHA,EACAxB,mBACEwB,EACA,+CAGMb,KAfhB5C,KAAO,WAgBP,EC9GK,MAAM0D,uBAeX,SAAIC,GACF,OAAOf,KAAKgB,MACd,CAcAnB,WAAAA,CAAYkB,GAAOf,KARnBgB,YAAM,EASJ,MAAMC,EACJjB,KAAKH,YAUP,GAA2C,iBAAhCoB,EAAiB1B,WAC1B,MAAM,IAAIqB,UAAU,yCAGtB,KAAMG,aAAiBE,EAAiBC,aACtC,MAAM,IAAIZ,aAAa,CACrBI,QAASK,EACTP,UAAWS,EACXR,WAAY,yBACZE,aAAcM,EAAiBC,YAAY9D,OAG7C4C,KAAKgB,OAAyCD,EAGhDE,EAAiBE,eAEjBnB,KAAKoB,mBAEL,MAAM7B,EAAa0B,EAAiB1B,WAEpCS,KAAKe,MAAMtC,aAAa,QAAQc,SAAmB,GACrD,CAQA6B,gBAAAA,GACE,MAAMvB,EAAoDG,KAAKH,YACzDN,EAAaM,EAAYN,WAE/B,GAAIA,GH8GD,SAAuBwB,EAAOxB,GACnC,OACEwB,aAAiBM,aACjBN,EAAMO,aAAa,QAAQ/B,SAE/B,CGnHsBgC,CAAcvB,KAAKe,MAAOxB,GAC1C,MAAM,IAAIqB,UAAUf,EAExB,CAOA,mBAAOsB,GACL,IAAKrC,cACH,MAAM,IAAImB,YAEd,EA3FWa,uBAIJI,YAAcG,YCThB,MAAMG,KAUX3B,WAAAA,CAAY4B,EAAe,GAAIC,EAAS,CAAA,GAAI,IAAAC,EAAA3B,KAT5CyB,kBAAY,EAAAzB,KACZ4B,YAAM,EAUJ5B,KAAKyB,aAAeA,EAGpBzB,KAAK4B,OAAsBD,OAAhBA,EAAGD,EAAOE,QAAMD,EAAKhE,SAASC,gBAAgBiE,MAAQ,IACnE,CAaAC,CAAAA,CAAEC,EAAW9D,GACX,IAAK8D,EAEH,MAAM,IAAInC,MAAM,4BAIlB,IAAIoC,EAAchC,KAAKyB,aAAaM,GAKpC,GAA8B,iBAAnB9D,MAAAA,OAAAA,EAAAA,EAASgE,QAA6C,iBAAhBD,EAA0B,CACzE,MAAME,EACJF,EAAYhC,KAAKmC,gBAAgBJ,EAAW9D,EAAQgE,QAGlDC,IACFF,EAAcE,EAElB,CAEA,GAA2B,iBAAhBF,EAA0B,CAEnC,GAAIA,EAAYI,MAAM,aAAc,CAClC,IAAKnE,EACH,MAAM,IAAI2B,MACR,0EAIJ,OAAOI,KAAKqC,oBAAoBL,EAAa/D,EAC/C,CAEA,OAAO+D,CACT,CAIA,OAAOD,CACT,CAWAM,mBAAAA,CAAoBC,EAAmBrE,GACrC,MAAMsE,EAAYC,KAAKC,aAAaC,mBAAmB1C,KAAK4B,QAAQjG,OAChE,IAAI6G,KAAKC,aAAazC,KAAK4B,aAC3B9D,EAEJ,OAAOwE,EAAkBK,QACvB,cAUA,SAAUC,EAAuBC,GAC/B,GAAI1G,OAAOiE,UAAU0C,eAAevE,KAAKN,EAAS4E,GAAiB,CACjE,MAAME,EAAmB9E,EAAQ4E,GAIjC,OACuB,IAArBE,GAC6B,iBAArBA,GACsB,iBAArBA,EAEF,GAIuB,iBAArBA,EACFR,EACHA,EAAUS,OAAOD,GACjB,GAAGA,IAGFA,CACT,CAEA,MAAM,IAAInD,MACR,kCAAkCgD,0BAEtC,GAEJ,CAcAK,yBAAAA,GACE,OAAOC,QACL,gBAAiBzF,OAAO+E,MACtBA,KAAKW,YAAYT,mBAAmB1C,KAAK4B,QAAQjG,OAEvD,CAkBAwG,eAAAA,CAAgBJ,EAAWE,GAMzB,GADAA,EAAQpG,OAAOoG,IACVrG,SAASqG,GACZ,MAAO,QAIT,MAAMD,EAAchC,KAAKyB,aAAaM,GAKhCqB,EAAgBpD,KAAKiD,4BACvB,IAAIT,KAAKW,YAAYnD,KAAK4B,QAAQyB,OAAOpB,GACzCjC,KAAKsD,mCAAmCrB,GAG5C,GAA2B,iBAAhBD,EAA0B,CACnC,GAAIoB,KAAiBpB,EACnB,OAAOoB,EAGF,GAAI,UAAWpB,EAKpB,OAJAuB,QAAQC,KACN,+BAA+BJ,WAAuBpD,KAAK4B,6CAGtD,OAEX,CAGA,MAAM,IAAIhC,MACR,+CAA+CI,KAAK4B,iBAExD,CAYA0B,kCAAAA,CAAmCrB,GAGjCA,EAAQwB,KAAKC,IAAID,KAAKE,MAAM1B,IAE5B,MAAM2B,EAAU5D,KAAK6D,0BAErB,OAAID,EACKpC,KAAKsC,YAAYF,GAAS3B,GAG5B,OACT,CAcA4B,uBAAAA,GACE,MAAME,EAAc/D,KAAK4B,OAAO1E,MAAM,KAAK,GAI3C,IAAK,MAAM8G,KAAcxC,KAAKyC,eAAgB,CAC5C,MAAMC,EAAY1C,KAAKyC,eAAeD,GACtC,GAAIE,EAAUxI,SAASsE,KAAK4B,SAAWsC,EAAUxI,SAASqI,GACxD,OAAOC,CAEX,CACF,EA1PWxC,KA6RJyC,eAAiB,CACtBE,OAAQ,CAAC,MACTC,QAAS,CAAC,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,MAC1DC,OAAQ,CAAC,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,MACnDC,OAAQ,CACN,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,MAEFC,MAAO,CAAC,MACRC,QAAS,CAAC,KAAM,MAChBC,SAAU,CAAC,MACXC,QAAS,CAAC,QAAS,KAAM,MACzBC,MAAO,CAAC,OA/TCnD,KAgVJsC,YAAc,CACnBK,OAAOS,GACK,IAANA,EACK,OAEC,IAANA,EACK,MAEC,IAANA,EACK,MAELA,EAAI,KAAO,GAAKA,EAAI,KAAO,GACtB,MAELA,EAAI,KAAO,IAAMA,EAAI,KAAO,GACvB,OAEF,QAETR,QAAOA,IACE,QAETC,OAAOO,GACQ,IAANA,GAAiB,IAANA,EAAU,MAAQ,QAEtCN,OAAOM,GACQ,IAANA,EAAU,MAAQ,QAE3BL,MAAMK,GACM,IAANA,EACK,MAEC,IAANA,EACK,MAELA,GAAK,GAAKA,GAAK,EACV,MAELA,GAAK,GAAKA,GAAK,GACV,OAEF,QAETJ,OAAAA,CAAQI,GACN,MAAMC,EAAUD,EAAI,IACdE,EAAOD,EAAU,GACvB,OAAa,IAATC,GAA0B,KAAZD,EACT,MAELC,GAAQ,GAAKA,GAAQ,KAAOD,GAAW,IAAMA,GAAW,IACnD,MAGE,IAATC,GACCA,GAAQ,GAAKA,GAAQ,GACrBD,GAAW,IAAMA,GAAW,GAEtB,OAIF,OACR,EACDJ,SAASG,GACG,IAANA,GAAiB,KAANA,EACN,MAEC,IAANA,GAAiB,KAANA,EACN,MAEJA,GAAK,GAAKA,GAAK,IAAQA,GAAK,IAAMA,GAAK,GACnC,MAEF,QAETF,QAAQE,GACI,IAANA,EACK,MAELA,EAAI,KAAY,GAAW,IAANA,EAChB,OAEF,QAETD,MAAMC,GACM,IAANA,EACK,OAEC,IAANA,EACK,MAEC,IAANA,EACK,MAEC,IAANA,EACK,MAEC,IAANA,EACK,OAEF,SCtaN,MAAMG,kBAAkBjE,uBA4F7BjB,WAAAA,CAAYkB,EAAOW,EAAS,IAC1B3B,MAAMgB,GAAMf,KAxFd0B,YAAM,EAAA1B,KAGNgF,UAAI,EAAAhF,KAGJiF,cAAgB,4BAA2BjF,KAG3CkF,aAAe,4BAA2BlF,KAG1CmF,iBAAmB,iCAAgCnF,KAGnDoF,aAAe,2BAA0BpF,KAGzCqF,qBAAuB,qCAAoCrF,KAG3DsF,mBAAqB,kCAAiCtF,KAGtDuF,mBAAqB,kCAAiCvF,KAGtDwF,oBAAsB,mCAAkCxF,KAGxDyF,2BAA6B,2CAA0CzF,KAGvE0F,wBAA0B,wCAAuC1F,KAGjE2F,6BAA+B,8CAA6C3F,KAG5E4F,2BAA6B,kCAAiC5F,KAG9D6F,gCAAkC,wCAAuC7F,KAGzE8F,yBAA2B,uCAAsC9F,KAGjE+F,mBAAqB,+BAA8B/F,KAGnDgG,qBAAuB,qCAAoChG,KAG3DiG,oBAAsB,mCAAkCjG,KAGxDkG,yBAA2B,yCAAwClG,KAGnEmG,oBAAsB,mCAAkCnG,KAGxDoG,eAAS,EAAApG,KAMTqG,eAAiB,KAAIrG,KAMrBsG,aAAe,KAAItG,KAMnBuG,aAAe,KASbvG,KAAK0B,OAAS5F,aACZiJ,UAAUyB,SACV9E,EACAlC,iBAAiBuF,UAAW/E,KAAKe,MAAMrE,UAGzCsD,KAAKgF,KAAO,IAAIxD,KAAKxB,KAAK0B,OAAOsD,MAEjC,MAAMoB,EAAYpG,KAAKe,MAAM0F,iBAAiB,IAAIzG,KAAKoF,gBACvD,IAAKgB,EAAUzK,OACb,MAAM,IAAI2E,aAAa,CACrBE,UAAWuE,UACXtE,WAAY,2BAA2BT,KAAKoF,sBAIhDpF,KAAKoG,UAAYA,EAEjBpG,KAAK0G,eACL1G,KAAK2G,qBAEL3G,KAAK4G,oBAAoB5G,KAAK6G,qBAChC,CAOAH,YAAAA,GAEE1G,KAAKqG,eAAiB1I,SAASmJ,cAAc,UAC7C9G,KAAKqG,eAAe5H,aAAa,OAAQ,UACzCuB,KAAKqG,eAAe5H,aAAa,QAASuB,KAAKkF,cAC/ClF,KAAKqG,eAAe5H,aAAa,gBAAiB,SAGlDuB,KAAKsG,aAAe3I,SAASmJ,cAAc,QAC3C9G,KAAKsG,aAAarH,UAAU8H,IAAI/G,KAAK+F,oBACrC/F,KAAKqG,eAAeW,YAAYhH,KAAKsG,cAGrC,MAAMW,EAAqBtJ,SAASmJ,cAAc,OAClDG,EAAmBxI,aAAa,QAASuB,KAAKiF,eAC9CgC,EAAmBD,YAAYhH,KAAKqG,gBACpCrG,KAAKe,MAAMmG,aAAaD,EAAoBjH,KAAKe,MAAMoG,YAGvDnH,KAAKuG,aAAe5I,SAASmJ,cAAc,QAC3C9G,KAAKuG,aAAatH,UAAU8H,IAAI/G,KAAKmF,kBACrCnF,KAAKqG,eAAeW,YAAYhH,KAAKuG,cAGrCvG,KAAKqG,eAAe3H,iBAAiB,SAAS,IAC5CsB,KAAKoH,0BAIH,kBAAmBzJ,UACrBA,SAASe,iBAAiB,eAAgB2I,GACxCrH,KAAKsH,cAAcD,IAGzB,CAOAV,kBAAAA,GACE3G,KAAKoG,UAAUmB,SAAQ,CAACC,EAAUC,KAChC,MAAMC,EAAUF,EAASG,cAAc,IAAI3H,KAAKuF,sBAChD,IAAKmC,EACH,MAAM,IAAIpH,aAAa,CACrBE,UAAWuE,UACXtE,WAAY,kCAAkCT,KAAKuF,4BAKvDvF,KAAK4H,sBAAsBF,EAASD,GACpCzH,KAAK6H,YAAY7H,KAAK8H,WAAWN,GAAWA,GAG5CE,EAAQhJ,iBAAiB,SAAS,IAAMsB,KAAK+H,gBAAgBP,KAI7DxH,KAAKgI,gBAAgBR,EAAS,GAElC,CASAI,qBAAAA,CAAsBF,EAASvK,GAC7B,MAAM8K,EAAQP,EAAQC,cAAc,IAAI3H,KAAKsF,sBACvC4C,EAAWR,EAAQC,cAAc,IAAI3H,KAAKwF,uBAC1C2C,EAAWT,EAAQC,cAAc,IAAI3H,KAAKiG,uBAEhD,IAAKiC,EACH,MAAM,IAAI5H,aAAa,CACrBE,UAAWuE,UACXtE,WAAY,uBAAuBT,KAAKwF,2BAI5C,IAAKyC,EACH,MAAM,IAAI3H,aAAa,CACrBE,UAAWuE,UACXtE,WAAY,8CAA8CT,KAAKsF,4BAMnE,MAAM8C,EAAUzK,SAASmJ,cAAc,UACvCsB,EAAQ3J,aAAa,OAAQ,UAC7B2J,EAAQ3J,aACN,gBACA,GAAGuB,KAAKe,MAAMsH,cAAclL,EAAQ,KAKtC,IAAK,MAAMmL,KAAQnJ,MAAMoJ,KAAKN,EAAMO,YAChB,OAAdF,EAAKlL,MACPgL,EAAQ3J,aAAa6J,EAAKlL,KAAMkL,EAAKnN,OAKzC,MAAMsN,EAAe9K,SAASmJ,cAAc,QAC5C2B,EAAaxJ,UAAU8H,IAAI/G,KAAK0F,yBAGhC+C,EAAaJ,GAAKJ,EAAMI,GAIxB,MAAMK,EAAoB/K,SAASmJ,cAAc,QACjD4B,EAAkBzJ,UAAU8H,IAAI/G,KAAK2F,8BACrC8C,EAAazB,YAAY0B,GAGzBvJ,MAAMoJ,KAAKN,EAAMU,YAAYpB,SAASqB,GACpCF,EAAkB1B,YAAY4B,KAIhC,MAAMC,EAAkBlL,SAASmJ,cAAc,QAC/C+B,EAAgB5J,UAAU8H,IAAI/G,KAAK4F,4BAInCiD,EAAgBpK,aAAa,iBAAkB,IAE/C,MAAMqK,EAAuBnL,SAASmJ,cAAc,QACpDgC,EAAqB7J,UAAU8H,IAAI/G,KAAK6F,iCACxCgD,EAAgB7B,YAAY8B,GAE5B,MAAMC,EAAgBpL,SAASmJ,cAAc,QACvCkC,EAAgBrL,SAASmJ,cAAc,QAe7C,GAdAkC,EAAc/J,UAAU8H,IAAI/G,KAAK+F,oBACjC+C,EAAqB9B,YAAYgC,GACjCD,EAAc9J,UAAU8H,IAAI/G,KAAK8F,0BACjCgD,EAAqB9B,YAAY+B,GAOjCX,EAAQpB,YAAYyB,GACpBL,EAAQpB,YAAYhH,KAAKiJ,0BAGrBd,EAAU,CAKZ,MAAMe,EAAevL,SAASmJ,cAAc,QAGtCqC,EAAoBxL,SAASmJ,cAAc,QACjDqC,EAAkBlK,UAAU8H,IAAI/G,KAAKkG,0BACrCgD,EAAalC,YAAYmC,GAGzB,IAAK,MAAMb,KAAQnJ,MAAMoJ,KAAKJ,EAASK,YACrCU,EAAazK,aAAa6J,EAAKlL,KAAMkL,EAAKnN,OAI5CgE,MAAMoJ,KAAKJ,EAASQ,YAAYpB,SAASqB,GACvCO,EAAkBnC,YAAY4B,KAIhCT,EAASiB,SAEThB,EAAQpB,YAAYkC,GACpBd,EAAQpB,YAAYhH,KAAKiJ,yBAC3B,CAEAb,EAAQpB,YAAY6B,GAEpBX,EAASmB,YAAYpB,GACrBC,EAASlB,YAAYoB,EACvB,CAQAd,aAAAA,CAAcD,GACZ,MAAMiC,EAAYjC,EAAMkC,OAGxB,KAAMD,aAAqBE,SACzB,OAIF,MAAMhC,EAAW8B,EAAUG,QAAQ,IAAIzJ,KAAKoF,gBACxCoC,GACFxH,KAAK6H,aAAY,EAAML,EAE3B,CAQAO,eAAAA,CAAgBP,GACd,MAAMkC,GAAe1J,KAAK8H,WAAWN,GACrCxH,KAAK6H,YAAY6B,EAAalC,GAG9BxH,KAAK2J,WAAWnC,EAAUkC,EAC5B,CAOAtC,qBAAAA,GACE,MAAMsC,GAAe1J,KAAK6G,qBAE1B7G,KAAKoG,UAAUmB,SAASC,IACtBxH,KAAK6H,YAAY6B,EAAalC,GAC9BxH,KAAK2J,WAAWnC,EAAUkC,EAAY,IAGxC1J,KAAK4G,oBAAoB8C,EAC3B,CASA7B,WAAAA,CAAY+B,EAAUpC,GACpB,MAAMwB,EAAgBxB,EAASG,cAAc,IAAI3H,KAAK+F,sBAChDgD,EAAgBvB,EAASG,cAC7B,IAAI3H,KAAK8F,4BAELsC,EAAUZ,EAASG,cAAc,IAAI3H,KAAKsF,sBAC1CuE,EAAWrC,EAASG,cAAc,IAAI3H,KAAKmG,uBAEjD,IAAK0D,EACH,MAAM,IAAIvJ,aAAa,CACrBE,UAAWuE,UACXtE,WAAY,kCAAkCT,KAAKmG,6BAIvD,IAAK6C,IAAkBD,IAAkBX,EAEvC,OAGF,MAAM0B,EAAgBF,EAClB5J,KAAKgF,KAAKlD,EAAE,eACZ9B,KAAKgF,KAAKlD,EAAE,eAEhBiH,EAAcgB,YAAcD,EAC5B1B,EAAQ3J,aAAa,gBAAiB,GAAGmL,KAGzC,MAAMI,EAAiB,GAEjBvB,EAAejB,EAASG,cAC5B,IAAI3H,KAAK0F,2BAEP+C,GACFuB,EAAeC,KAAK,GAAGxB,EAAasB,cAAczO,QAGpD,MAAM6M,EAAWX,EAASG,cAAc,IAAI3H,KAAKiG,uBAC7CkC,GACF6B,EAAeC,KAAK,GAAG9B,EAAS4B,cAAczO,QAGhD,MAAM4O,EAAmBN,EACrB5J,KAAKgF,KAAKlD,EAAE,wBACZ9B,KAAKgF,KAAKlD,EAAE,wBAChBkI,EAAeC,KAAKC,GAOpB9B,EAAQ3J,aAAa,aAAcuL,EAAeG,KAAK,QAGnDP,GACFC,EAASrL,gBAAgB,UACzBgJ,EAASvI,UAAU8H,IAAI/G,KAAKqF,sBAC5B2D,EAAc/J,UAAUmK,OAAOpJ,KAAKgG,wBAEpC6D,EAASpL,aAAa,SAAU,eAChC+I,EAASvI,UAAUmK,OAAOpJ,KAAKqF,sBAC/B2D,EAAc/J,UAAU8H,IAAI/G,KAAKgG,uBAInChG,KAAK4G,oBAAoB5G,KAAK6G,qBAChC,CASAiB,UAAAA,CAAWN,GACT,OAAOA,EAASvI,UAAUC,SAASc,KAAKqF,qBAC1C,CAQAwB,kBAAAA,GACE,OAAO1H,MAAMoJ,KAAKvI,KAAKoG,WAAWgE,OAAO5C,GACvCxH,KAAK8H,WAAWN,IAEpB,CAQAZ,mBAAAA,CAAoBgD,GACb5J,KAAKqG,gBAAmBrG,KAAKuG,cAAiBvG,KAAKsG,eAIxDtG,KAAKqG,eAAe5H,aAAa,gBAAiBmL,EAASS,YAC3DrK,KAAKuG,aAAawD,YAAcH,EAC5B5J,KAAKgF,KAAKlD,EAAE,mBACZ9B,KAAKgF,KAAKlD,EAAE,mBAChB9B,KAAKsG,aAAarH,UAAUqL,OAAOtK,KAAKgG,sBAAuB4D,GACjE,CAYAW,aAAAA,CAAc/C,GACZ,MAAMY,EAAUZ,EAASG,cAAc,IAAI3H,KAAKsF,sBAEhD,OAAO8C,MAAAA,OAAAA,EAAAA,EAAShK,aAAa,gBAC/B,CASAuL,UAAAA,CAAWnC,EAAUM,GACnB,IAAK9H,KAAK0B,OAAO8I,iBACf,OAGF,MAAMnC,EAAKrI,KAAKuK,cAAc/C,GAE9B,GAAIa,EACF,IACE5K,OAAOgN,eAAeC,QAAQrC,EAAIP,EAAWuC,WAC/C,CAAE,MAAOM,GAAY,CAEzB,CAQA3C,eAAAA,CAAgBR,GACd,IAAKxH,KAAK0B,OAAO8I,iBACf,OAGF,MAAMnC,EAAKrI,KAAKuK,cAAc/C,GAE9B,GAAIa,EACF,IACE,MAAMuC,EAAQnN,OAAOgN,eAAeI,QAAQxC,GAE9B,OAAVuC,GACF5K,KAAK6H,YAAsB,SAAV+C,EAAkBpD,EAEvC,CAAE,MAAOmD,GAAY,CAEzB,CAaA1B,sBAAAA,GACE,MAAM6B,EAAiBnN,SAASmJ,cAAc,QAM9C,OALAgE,EAAe7L,UAAU8H,IACvB,wBACA/G,KAAKyF,4BAEPqF,EAAef,YAAc,KACtBe,CACT,EAhjBW/F,UAqjBJxF,WAAa,kBArjBTwF,UA8jBJyB,SAAWrK,OAAO4O,OAAO,CAC9B/F,KAAM,CACJgG,gBAAiB,oBACjBC,YAAa,OACbC,qBAAsB,oBACtBC,gBAAiB,oBACjBC,YAAa,OACbC,qBAAsB,qBAExBb,kBAAkB,IAvkBTzF,UAglBJnI,OAAST,OAAO4O,OAAO,CAC5BlO,WAAY,CACVmI,KAAM,CAAEvJ,KAAM,UACd+O,iBAAkB,CAAE/O,KAAM,cC5lBzB,MAAM6P,eAAexK,uBAiB1BjB,WAAAA,CAAYkB,EAAOW,EAAS,IAC1B3B,MAAMgB,GAAMf,KAbd0B,YAAM,EAAA1B,KAMNuL,wBAA0B,KASxBvL,KAAK0B,OAAS5F,aACZwP,OAAO9E,SACP9E,EACAlC,iBAAiB8L,OAAQtL,KAAKe,MAAMrE,UAGtCsD,KAAKe,MAAMrC,iBAAiB,WAAY2I,GAAUrH,KAAKwL,cAAcnE,KACrErH,KAAKe,MAAMrC,iBAAiB,SAAU2I,GAAUrH,KAAKyL,SAASpE,IAChE,CAcAmE,aAAAA,CAAcnE,GACZ,MAAMqE,EAAUrE,EAAMkC,OAGJ,MAAdlC,EAAMnL,KAMRwP,aAAmBrK,aACc,WAAjCqK,EAAQtN,aAAa,UAErBiJ,EAAMsE,iBACND,EAAQE,QAEZ,CAaAH,QAAAA,CAASpE,GAEP,GAAKrH,KAAK0B,OAAOmK,mBAKjB,OAAI7L,KAAKuL,yBACPlE,EAAMsE,kBACC,QAGT3L,KAAKuL,wBAA0B9N,OAAOqO,YAAW,KAC/C9L,KAAKuL,wBAA0B,IAAI,GAClCQ,KACL,ECzFK,SAASC,sBAAsBhO,EAAUiO,GAC9C,MAAMC,EAA+BlO,EAASyL,QAAQ,IAAIwC,MAC1D,OAAOC,EACHA,EAA6B9N,aAAa6N,GAC1C,IACN,CDFaX,OA2FJ/L,WAAa,eA3FT+L,OAoGJ9E,SAAWrK,OAAO4O,OAAO,CAC9Bc,oBAAoB,IArGXP,OA8GJ1O,OAAST,OAAO4O,OAAO,CAC5BlO,WAAY,CACVgP,mBAAoB,CAAEpQ,KAAM,cEpG3B,MAAM0Q,uBAAuBrL,uBAyClCjB,WAAAA,CAAYkB,EAAOW,EAAS,IAAI,IAAA0K,EAAAC,EAC9BtM,MAAMgB,GAAMf,KAxCdsM,eAAS,EAAAtM,KAGTuM,0BAAoB,EAAAvM,KAGpBwM,+BAAyB,EAAAxM,KAMzByM,mBAAqB,KAAIzM,KAGzB0M,eAAiB,GAAE1M,KAMnB2M,aAAe,KAAI3M,KAMnB0B,YAAM,EAAA1B,KAGNgF,UAAI,EAAAhF,KAGJ4M,eAAS,EASP,MAAMN,EAAYtM,KAAKe,MAAM4G,cAAc,6BAC3C,KAEI2E,aAAqBO,qBACrBP,aAAqBQ,kBAGvB,MAAM,IAAIxM,aAAa,CACrBE,UAAW2L,eACXzL,QAAS4L,EACT3L,aAAc,0CACdF,WAAY,6CAKhB,MAAMsM,EAAgBvN,iBAAiB2M,eAAgBnM,KAAKe,MAAMrE,SASlE,IAAIsQ,EAAkB,CAAA,GAClB,aAAcD,GAAiB,cAAeA,KAChDC,EAAkB,CAChBC,eAAWnP,EACXoP,cAAUpP,IAIdkC,KAAK0B,OAAS5F,aACZqQ,eAAe3F,SACf9E,EACAsL,EACAD,GAIF,MAAMI,ER+HH,SAAwBvQ,EAAQ8E,GACrC,MAAM0L,EAAmB,GAGzB,IAAK,MAAOhQ,EAAMiQ,KAAelR,OAAOY,QAAQH,GAAS,CACvD,MAAMuQ,EAAS,GAGf,GAAIhO,MAAMC,QAAQiO,GAAa,CAC7B,IAAK,MAAMC,SAAEA,EAAQC,aAAEA,KAAkBF,EAClCC,EAASlD,OAAOlO,KAAUwF,EAAOxF,MACpCiR,EAAOlD,KAAKsD,GAKH,UAATnQ,GAAsBiQ,EAAW1R,OAASwR,EAAOxR,QAAU,GAC7DyR,EAAiBnD,QAAQkD,EAE7B,CACF,CAEA,OAAOC,CACT,CQtJmBI,CAAerB,eAAevP,OAAQoD,KAAK0B,QAC1D,GAAIyL,EAAO,GACT,MAAM,IAAI9M,YAAYhB,mBAAmB8M,eAAgBgB,EAAO,KAGlEnN,KAAKgF,KAAO,IAAIxD,KAAKxB,KAAK0B,OAAOsD,KAAM,CAErCpD,OAAQoK,sBAAsBhM,KAAKe,MAAO,UAI5Cf,KAAK4M,UAAyD,OAAhDR,EAAuBC,OAAvBA,EAAGrM,KAAK0B,OAAOwL,UAAQb,EAAIrM,KAAK0B,OAAOuL,WAASb,EAAIqB,IAElEzN,KAAKsM,UAAYA,EAEjB,MAAMoB,EAAwB,GAAG1N,KAAKsM,UAAUjE,UAC1CsF,EAAuBhQ,SAASiQ,eAAeF,GACrD,IAAKC,EACH,MAAM,IAAIrN,aAAa,CACrBE,UAAW2L,eACXzL,QAASiN,EACTlN,WAAY,wBAAwBiN,UAOpC,GAAGC,EAAqB5D,cAAc3H,MAAM,WAC9CuL,EAAqB5D,YAAc/J,KAAKgF,KAAKlD,EAAE,sBAAuB,CACpEG,MAAOjC,KAAK4M,aAMhB5M,KAAKsM,UAAUuB,sBAAsB,WAAYF,GAIjD,MAAMnB,EAA4B7O,SAASmJ,cAAc,OACzD0F,EAA0BsB,UACxB,yDACFtB,EAA0B/N,aAAa,YAAa,UACpDuB,KAAKwM,0BAA4BA,EACjCmB,EAAqBE,sBACnB,WACArB,GAMF,MAAMD,EAAuB5O,SAASmJ,cAAc,OACpDyF,EAAqBuB,UAAYH,EAAqBG,UACtDvB,EAAqBtN,UAAU8H,IAAI,iCACnCwF,EAAqB9N,aAAa,cAAe,QACjDuB,KAAKuM,qBAAuBA,EAC5BoB,EAAqBE,sBAAsB,WAAYtB,GAGvDoB,EAAqB1O,UAAU8H,IAAI,yBAGnC/G,KAAKsM,UAAU9N,gBAAgB,aAE/BwB,KAAK+N,mBAKLtQ,OAAOiB,iBAAiB,YAAY,IAAMsB,KAAKgO,uBAK/ChO,KAAKgO,oBACP,CAUAD,gBAAAA,GACE/N,KAAKsM,UAAU5N,iBAAiB,SAAS,IAAMsB,KAAKiO,gBAGpDjO,KAAKsM,UAAU5N,iBAAiB,SAAS,IAAMsB,KAAKkO,gBACpDlO,KAAKsM,UAAU5N,iBAAiB,QAAQ,IAAMsB,KAAKmO,cACrD,CAUAF,WAAAA,GACEjO,KAAKoO,4BACLpO,KAAKyM,mBAAqB4B,KAAKC,KACjC,CAiBAJ,WAAAA,GACElO,KAAK2M,aAAelP,OAAO8Q,aAAY,OAElCvO,KAAKyM,oBACN4B,KAAKC,MAAQ,KAAOtO,KAAKyM,qBAEzBzM,KAAKwO,sBACP,GACC,IACL,CASAL,UAAAA,GAEMnO,KAAK2M,cACPlP,OAAOgR,cAAczO,KAAK2M,aAE9B,CAOA6B,oBAAAA,GACMxO,KAAKsM,UAAUnR,QAAU6E,KAAK0M,iBAChC1M,KAAK0M,eAAiB1M,KAAKsM,UAAUnR,MACrC6E,KAAKgO,qBAET,CAUAA,kBAAAA,GACEhO,KAAKoO,4BACLpO,KAAK0O,gCACP,CAOAN,yBAAAA,GACE,MACMO,EADkB3O,KAAK4M,UAAY5M,KAAKiC,MAAMjC,KAAKsM,UAAUnR,OACjC,EAIlC6E,KAAKuM,qBAAqBtN,UAAUqL,OAClC,4CACCtK,KAAK4O,mBAIR5O,KAAKsM,UAAUrN,UAAUqL,OAAO,wBAAyBqE,GACzD3O,KAAKuM,qBAAqBtN,UAAUqL,OAAO,sBAAuBqE,GAClE3O,KAAKuM,qBAAqBtN,UAAUqL,OAAO,cAAeqE,GAG1D3O,KAAKuM,qBAAqBxC,YAAc/J,KAAK6O,iBAC/C,CAOAH,8BAAAA,GAGM1O,KAAK4O,kBACP5O,KAAKwM,0BAA0BhO,gBAAgB,eAE/CwB,KAAKwM,0BAA0B/N,aAAa,cAAe,QAI7DuB,KAAKwM,0BAA0BzC,YAAc/J,KAAK6O,iBACpD,CAUA5M,KAAAA,CAAM6M,GACJ,GAAI9O,KAAK0B,OAAOwL,SAAU,CAAA,IAAA6B,EAExB,OADiCA,OAArBA,EAAGD,EAAK1M,MAAM,SAAO2M,EAAI,IACvBpT,MAChB,CAEA,OAAOmT,EAAKnT,MACd,CAQAkT,eAAAA,GACE,MAAMG,EAAkBhP,KAAK4M,UAAY5M,KAAKiC,MAAMjC,KAAKsM,UAAUnR,OAC7D8T,EAAYjP,KAAK0B,OAAOwL,SAAW,QAAU,aACnD,OAAOlN,KAAKkP,mBAAmBF,EAAiBC,EAClD,CAWAC,kBAAAA,CAAmBF,EAAiBC,GAClC,GAAwB,IAApBD,EACF,OAAOhP,KAAKgF,KAAKlD,EAAE,GAAGmN,YAGxB,MAAME,EACJH,EAAkB,EAAI,YAAc,aAEtC,OAAOhP,KAAKgF,KAAKlD,EAAE,GAAGmN,IAAYE,IAAwB,CACxDlN,MAAOwB,KAAKC,IAAIsL,IAEpB,CAaAJ,eAAAA,GAEE,IAAK5O,KAAK0B,OAAO0N,UACf,OAAO,EAIT,MAAMC,EAAgBrP,KAAKiC,MAAMjC,KAAKsM,UAAUnR,OAKhD,OAJkB6E,KAAK4M,UAEa5M,KAAK0B,OAAO0N,UAAa,KAEpCC,CAC3B,EAxXWlD,eA6XJ5M,WAAa,wBA7XT4M,eAsYJ3F,SAAWrK,OAAO4O,OAAO,CAC9BqE,UAAW,EACXpK,KAAM,CAEJsK,qBAAsB,CACpBC,IAAK,wCACLC,MAAO,0CAETC,kBAAmB,kCACnBC,oBAAqB,CACnBH,IAAK,uCACLC,MAAO,yCAGTG,gBAAiB,CACfJ,IAAK,mCACLC,MAAO,qCAETI,aAAc,6BACdC,eAAgB,CACdN,IAAK,kCACLC,MAAO,oCAETM,oBAAqB,CACnBN,MAAO,OA9ZFrD,eAyaJvP,OAAST,OAAO4O,OAAO,CAC5BlO,WAAY,CACVmI,KAAM,CAAEvJ,KAAM,UACdyR,SAAU,CAAEzR,KAAM,UAClBwR,UAAW,CAAExR,KAAM,UACnB2T,UAAW,CAAE3T,KAAM,WAErBsU,MAAO,CACL,CACEzC,SAAU,CAAC,YACXC,aAAc,qDAEhB,CACED,SAAU,CAAC,aACXC,aAAc,wDCtcf,MAAMyC,mBAAmBlP,uBAkB9BjB,WAAAA,CAAYkB,GACVhB,MAAMgB,GAAMf,KAjBdiQ,aAAO,EAmBL,MAAMA,EAAUjQ,KAAKe,MAAM0F,iBAAiB,0BAC5C,IAAKwJ,EAAQtU,OACX,MAAM,IAAI2E,aAAa,CACrBE,UAAWwP,WACXvP,WAAY,4CAIhBT,KAAKiQ,QAAUA,EAEfjQ,KAAKiQ,QAAQ1I,SAAS2I,IACpB,MAAMC,EAAWD,EAAO9R,aAAa,sBAGrC,GAAK+R,EAAL,CAKA,IAAKxS,SAASiQ,eAAeuC,GAC3B,MAAM,IAAI7P,aAAa,CACrBE,UAAWwP,WACXvP,WAAY,6BAA6B0P,UAM7CD,EAAOzR,aAAa,gBAAiB0R,GACrCD,EAAO1R,gBAAgB,qBAbvB,CAa4C,IAM9Cf,OAAOiB,iBAAiB,YAAY,IAAMsB,KAAKoQ,8BAK/CpQ,KAAKoQ,4BAGLpQ,KAAKe,MAAMrC,iBAAiB,SAAU2I,GAAUrH,KAAKqQ,YAAYhJ,IACnE,CAOA+I,yBAAAA,GACEpQ,KAAKiQ,QAAQ1I,SAAS2I,GACpBlQ,KAAKsQ,oCAAoCJ,IAE7C,CAWAI,mCAAAA,CAAoCJ,GAClC,MAAMC,EAAWD,EAAO9R,aAAa,iBACrC,IAAK+R,EACH,OAGF,MAAMzE,EAAU/N,SAASiQ,eAAeuC,GACxC,GAAIzE,MAAAA,GAAAA,EAASzM,UAAUC,SAAS,iCAAkC,CAChE,MAAMqR,EAAiBL,EAAOM,QAE9BN,EAAOzR,aAAa,gBAAiB8R,EAAelG,YACpDqB,EAAQzM,UAAUqL,OAChB,yCACCiG,EAEL,CACF,CAWAE,sBAAAA,CAAuBP,GACSvS,SAAS8I,iBACrC,gCAAgCyJ,EAAO9S,UAGnBmK,SAASmJ,IACJR,EAAOS,OAASD,EAAmBC,MACpCD,IAAuBR,IAC7CQ,EAAmBF,SAAU,EAC7BxQ,KAAKsQ,oCAAoCI,GAC3C,GAEJ,CAYAE,sBAAAA,CAAuBV,GAEnBvS,SAAS8I,iBACP,4DAA4DyJ,EAAO9S,UAG5BmK,SAASsJ,IACzBX,EAAOS,OAASE,EAAgBF,OAEvDE,EAAgBL,SAAU,EAC1BxQ,KAAKsQ,oCAAoCO,GAC3C,GAEJ,CAYAR,WAAAA,CAAYhJ,GACV,MAAMyJ,EAAgBzJ,EAAMkC,OAG5B,KACIuH,aAAyBhE,mBACJ,aAAvBgE,EAAcrV,KAEd,OAUF,GANwBqV,EAAc1S,aAAa,kBAEjD4B,KAAKsQ,oCAAoCQ,IAItCA,EAAcN,QACjB,OAKiD,cAAjDM,EAAc1S,aAAa,kBAE3B4B,KAAKyQ,uBAAuBK,GAE5B9Q,KAAK4Q,uBAAuBE,EAEhC,EAjMWd,WAsMJzQ,WAAa,mBC9Lf,MAAMwR,qBAAqBjQ,uBAWhCjB,WAAAA,CAAYkB,EAAOW,EAAS,IAC1B3B,MAAMgB,GAAMf,KAPd0B,YAAM,EASJ1B,KAAK0B,OAAS5F,aACZiV,aAAavK,SACb9E,EACAlC,iBAAiBuR,aAAc/Q,KAAKe,MAAMrE,UAMvCsD,KAAK0B,OAAOsP,kBACfjT,SAASiC,KAAKe,OAGhBf,KAAKe,MAAMrC,iBAAiB,SAAU2I,GAAUrH,KAAKqQ,YAAYhJ,IACnE,CAQAgJ,WAAAA,CAAYhJ,GACV,MAAMqE,EAAUrE,EAAMkC,OAClBmC,GAAW1L,KAAKiR,YAAYvF,IAC9BrE,EAAMsE,gBAEV,CAqBAsF,WAAAA,CAAYvF,GAEV,KAAMA,aAAmBwF,mBACvB,OAAO,EAGT,MAAMC,EAAU9T,mBAAmBqO,EAAQ0F,MAC3C,IAAKD,EACH,OAAO,EAGT,MAAMjB,EAASvS,SAASiQ,eAAeuD,GACvC,IAAKjB,EACH,OAAO,EAGT,MAAMmB,EAAiBrR,KAAKsR,2BAA2BpB,GACvD,QAAKmB,IAOLA,EAAeE,iBACfrB,EAAOrR,MAAM,CAAE2S,eAAe,KAEvB,EACT,CAkBAF,0BAAAA,CAA2BpB,GAAQ,IAAAuB,EACjC,MAAMC,EAAYxB,EAAOzG,QAAQ,YAEjC,GAAIiI,EAAW,CACb,MAAMC,EAAWD,EAAUE,qBAAqB,UAEhD,GAAID,EAAShW,OAAQ,CACnB,MAAMkW,EAAmBF,EAAS,GAIlC,GACEzB,aAAkBpD,mBACD,aAAhBoD,EAAOzU,MAAuC,UAAhByU,EAAOzU,MAEtC,OAAOoW,EAST,MAAMC,EAAYD,EAAiBE,wBAAwBC,IACrDC,EAAY/B,EAAO6B,wBAIzB,GAAIE,EAAUC,QAAUzU,OAAO0U,YAAa,CAG1C,GAFoBF,EAAUD,IAAMC,EAAUC,OAE5BJ,EAAYrU,OAAO0U,YAAc,EACjD,OAAON,CAEX,CACF,CACF,CAEA,OACqE,OADrEJ,EACE9T,SAASgK,cAAc,cAAcuI,EAAO9R,aAAa,YAAUqT,EACnEvB,EAAOzG,QAAQ,QAEnB,EAvJWsH,aA4JJxR,WAAa,sBA5JTwR,aAqKJvK,SAAWrK,OAAO4O,OAAO,CAC9BiG,kBAAkB,IAtKTD,aA+KJnU,OAAST,OAAO4O,OAAO,CAC5BlO,WAAY,CACVmU,iBAAkB,CAAEvV,KAAM,cCtLzB,MAAM2W,qBAAqBtR,uBAkEhCjB,WAAAA,CAAYkB,EAAOW,EAAS,IAC1B3B,MAAMgB,GAAMf,KA9Dd0B,YAAM,EAAA1B,KAGNgF,UAAI,EAAAhF,KAGJoI,aAAO,EAAApI,KAMPqS,gBAAkB,KAAIrS,KAMtBsS,YAAc,KAAItS,KAMlBuS,oBAAsB,KAAIvS,KAM1BwS,SAAW,KAAIxS,KAGfyS,gBAAkB,EAACzS,KAGnB0S,oBAAqB,EAAK1S,KAG1B2S,YAAc,IAAI3S,KAUlB4S,kBAAoB,KAAI5S,KAMxB6S,iBAAmB,KASjB,MAAMzK,EAAUpI,KAAKe,MAAM4G,cAAc,iCACzC,KAAMS,aAAmB8I,mBACvB,MAAM,IAAI5Q,aAAa,CACrBE,UAAW4R,aACX1R,QAAS0H,EACTzH,aAAc,oBACdF,WAAY,6CAIhBT,KAAK0B,OAAS5F,aACZsW,aAAa5L,SACb9E,EACAlC,iBAAiB4S,aAAcpS,KAAKe,MAAMrE,UAG5CsD,KAAKgF,KAAO,IAAIxD,KAAKxB,KAAK0B,OAAOsD,MACjChF,KAAKoI,QAAUA,EAEf,MAAMiK,EAAkB1U,SAASgK,cAC/B,qCAEE0K,aAA2BnB,oBAC7BlR,KAAKqS,gBAAkBA,GAGzBrS,KAAK8S,iBACL9S,KAAK+S,iBACL/S,KAAKgT,yBAGC,sCAAuCrV,SAASqB,KAAKtC,UACzDiB,SAASe,iBAAiB,QAASsB,KAAKiT,eAAeC,KAAKlT,OAAO,GACnErC,SAASqB,KAAKtC,QAAQyW,kCAAoC,QAM5D1V,OAAOiB,iBAAiB,WAAYsB,KAAKoT,UAAUF,KAAKlT,MAC1D,CAOA+S,cAAAA,GACE/S,KAAKsS,YAAc3U,SAASmJ,cAAc,QAC1C9G,KAAKsS,YAAY7T,aAAa,OAAQ,UACtCuB,KAAKsS,YAAYxE,UAAY,wBAE7B9N,KAAKe,MAAMiG,YAAYhH,KAAKsS,YAC9B,CAOAU,sBAAAA,GAEEhT,KAAKoI,QAAQ1J,iBAAiB,QAASsB,KAAKqQ,YAAY6C,KAAKlT,OAGzDA,KAAKqS,iBACPrS,KAAKqS,gBAAgB3T,iBACnB,QACAsB,KAAKqQ,YAAY6C,KAAKlT,MAG5B,CAOA8S,cAAAA,GAGE9S,KAAKuS,oBAAsB5U,SAASmJ,cAAc,OAClD9G,KAAKuS,oBAAoBzE,UAAY,kCACrC9N,KAAKuS,oBAAoB9T,aAAa,cAAe,QAGrD,IAAK,IAAIgJ,EAAI,EAAGA,EAAI,EAAGA,IAAK,CAC1B,MAAM4L,EAAa1V,SAASmJ,cAAc,OAC1CuM,EAAWvF,UAAY,wCACvB9N,KAAKuS,oBAAoBvL,YAAYqM,EACvC,CAGArT,KAAKoI,QAAQpB,YAAYhH,KAAKuS,oBAChC,CAQAe,eAAAA,GACE,IAAKtT,KAAKuS,oBACR,OAIFvS,KAAKuS,oBAAoBtT,UAAUqL,OACjC,2CACAtK,KAAKyS,gBAAkB,GAILzS,KAAKuS,oBAAoB9L,iBAC3C,0CAEUc,SAAQ,CAAC8L,EAAYlW,KAC/BkW,EAAWpU,UAAUqL,OACnB,4CACAnN,EAAQ6C,KAAKyS,gBACd,GAEL,CAUAc,QAAAA,GACOvT,KAAKsS,cAIVtS,KAAKsS,YAAYvI,YAAc,GAM/BpM,SAASqB,KAAKC,UAAU8H,IAAI,qCAC5B/G,KAAKwS,SAAW7U,SAASmJ,cAAc,OACvC9G,KAAKwS,SAAS1E,UAAY,+BAC1B9N,KAAKwS,SAAS/T,aAAa,OAAQ,SAKnCd,SAASqB,KAAKgI,YAAYhH,KAAKwS,UAC/BxS,KAAKwS,SAASzI,YAAc/J,KAAKgF,KAAKlD,EAAE,aAExCrE,OAAO+V,SAASpC,KAAOpR,KAAKoI,QAAQgJ,KACtC,CAaAf,WAAAA,CAAYhJ,GACVA,EAAMsE,iBACN3L,KAAKuT,UACP,CASAN,cAAAA,CAAe5L,GACRrH,KAAKsS,cAYQ,UAAdjL,EAAMnL,KAAoB8D,KAAK0S,mBA8BxB1S,KAAK4S,mBAGd5S,KAAKyT,sBAhCLzT,KAAKyS,iBAAmB,EAGxBzS,KAAKsT,kBAGDtT,KAAK6S,mBACPpV,OAAOiW,aAAa1T,KAAK6S,kBACzB7S,KAAK6S,iBAAmB,MAGtB7S,KAAKyS,iBAAmB,GAC1BzS,KAAKyS,gBAAkB,EAEnBzS,KAAK4S,oBACPnV,OAAOiW,aAAa1T,KAAK4S,mBACzB5S,KAAK4S,kBAAoB,MAG3B5S,KAAKuT,YAEwB,IAAzBvT,KAAKyS,gBACPzS,KAAKsS,YAAYvI,YAAc/J,KAAKgF,KAAKlD,EAAE,qBAE3C9B,KAAKsS,YAAYvI,YAAc/J,KAAKgF,KAAKlD,EAAE,oBAI/C9B,KAAK2T,oBAQP3T,KAAK0S,mBAAqBrL,EAAMuM,SAClC,CAYAD,gBAAAA,GAGM3T,KAAK4S,mBACPnV,OAAOiW,aAAa1T,KAAK4S,mBAI3B5S,KAAK4S,kBAAoBnV,OAAOqO,WAC9B9L,KAAKyT,mBAAmBP,KAAKlT,MAC7BA,KAAK2S,YAET,CAOAc,kBAAAA,GACE,IAAKzT,KAAKsS,YACR,OAGEtS,KAAK4S,oBACPnV,OAAOiW,aAAa1T,KAAK4S,mBACzB5S,KAAK4S,kBAAoB,MAG3B,MAAMN,EAActS,KAAKsS,YAEzBtS,KAAKyS,gBAAkB,EACvBH,EAAYvI,YAAc/J,KAAKgF,KAAKlD,EAAE,YAEtC9B,KAAK6S,iBAAmBpV,OAAOqO,YAAW,KACxCwG,EAAYvI,YAAc,EAAE,GAC3B/J,KAAK2S,aAER3S,KAAKsT,iBACP,CAgBAF,SAAAA,GAEEzV,SAASqB,KAAKC,UAAUmK,OAAO,qCAE3BpJ,KAAKwS,WACPxS,KAAKwS,SAASpJ,SACdpJ,KAAKwS,SAAW,MAIdxS,KAAKsS,cACPtS,KAAKsS,YAAY7T,aAAa,OAAQ,UACtCuB,KAAKsS,YAAYvI,YAAc,IAIjC/J,KAAKsT,kBAGDtT,KAAK4S,mBACPnV,OAAOiW,aAAa1T,KAAK4S,mBAGvB5S,KAAK6S,kBACPpV,OAAOiW,aAAa1T,KAAK6S,iBAE7B,EA1YWT,aA+YJ7S,WAAa,uBA/YT6S,aAwZJ5L,SAAWrK,OAAO4O,OAAO,CAC9B/F,KAAM,CACJ6O,UAAW,WACXC,SAAU,0BACVC,kBAAmB,qCACnBC,iBAAkB,uCA7ZX5B,aAuaJxV,OAAST,OAAO4O,OAAO,CAC5BlO,WAAY,CACVmI,KAAM,CAAEvJ,KAAM,aC3ab,MAAMwY,eAAenT,uBAgC1BjB,WAAAA,CAAYkB,GACVhB,MAAMgB,GAAMf,KA/BdkU,iBAAW,EAAAlU,KAGXmU,WAAK,EAAAnU,KASLoU,YAAa,EAAKpU,KAUlBqU,IAAM,KAWJ,MAAMH,EAAclU,KAAKe,MAAM4G,cAAc,2BAK7C,IAAKuM,EACH,OAAOlU,KAGT,MAAMsU,EAASJ,EAAY9V,aAAa,iBACxC,IAAKkW,EACH,MAAM,IAAIhU,aAAa,CACrBE,UAAWyT,OACXxT,WACE,8FAIN,MAAM0T,EAAQxW,SAASiQ,eAAe0G,GACtC,IAAKH,EACH,MAAM,IAAI7T,aAAa,CACrBE,UAAWyT,OACXvT,QAASyT,EACT1T,WAAY,yBAAyB6T,WAIzCtU,KAAKmU,MAAQA,EACbnU,KAAKkU,YAAcA,EAEnBlU,KAAKuU,wBAELvU,KAAKkU,YAAYxV,iBAAiB,SAAS,IACzCsB,KAAKwU,yBAET,CAOAD,qBAAAA,GACE,MAAME,EAAajX,cAAc,WAEjC,IAAKiX,EAAWtZ,MACd,MAAM,IAAImF,aAAa,CACrBE,UAAWyT,OACXxT,WAAY,0BAA0BgU,EAAWrZ,0CAKrD4E,KAAKqU,IAAM5W,OAAOiX,WAAW,eAAeD,EAAWtZ,UAInD,qBAAsB6E,KAAKqU,IAC7BrU,KAAKqU,IAAI3V,iBAAiB,UAAU,IAAMsB,KAAK2U,cAI/C3U,KAAKqU,IAAIO,aAAY,IAAM5U,KAAK2U,cAGlC3U,KAAK2U,WACP,CAYAA,SAAAA,GACO3U,KAAKqU,KAAQrU,KAAKmU,OAAUnU,KAAKkU,cAIlClU,KAAKqU,IAAIQ,SACX7U,KAAKmU,MAAM3V,gBAAgB,UAC3BwB,KAAKkU,YAAYzV,aAAa,SAAU,MAExCuB,KAAKkU,YAAY1V,gBAAgB,UACjCwB,KAAKkU,YAAYzV,aAAa,gBAAiBuB,KAAKoU,WAAW/J,YAE3DrK,KAAKoU,WACPpU,KAAKmU,MAAM3V,gBAAgB,UAE3BwB,KAAKmU,MAAM1V,aAAa,SAAU,KAGxC,CAUA+V,qBAAAA,GACExU,KAAKoU,YAAcpU,KAAKoU,WACxBpU,KAAK2U,WACP,EAhJWV,OAqJJ1U,WAAa,eCrJf,MAAMuV,2BAA2BhU,uBAWtCjB,WAAAA,CAAYkB,EAAOW,EAAS,IAC1B3B,MAAMgB,GAAMf,KAPd0B,YAAM,EASJ1B,KAAK0B,OAAS5F,aACZgZ,mBAAmBtO,SACnB9E,EACAlC,iBAAiBsV,mBAAoB9U,KAAKe,MAAMrE,UAeZ,UAApCsD,KAAKe,MAAM3C,aAAa,SACvB4B,KAAK0B,OAAOsP,kBAEbjT,SAASiC,KAAKe,MAElB,EArCW+T,mBA0CJvV,WAAa,4BA1CTuV,mBAmDJtO,SAAWrK,OAAO4O,OAAO,CAC9BiG,kBAAkB,IApDT8D,mBA6DJlY,OAAST,OAAO4O,OAAO,CAC5BlO,WAAY,CACVmU,iBAAkB,CAAEvV,KAAM,cC5DzB,MAAMsZ,sBAAsBjU,uBA6BjCjB,WAAAA,CAAYkB,EAAOW,EAAS,IAC1B3B,MAAMgB,GAAMf,KAzBd0B,YAAM,EAAA1B,KAGNgF,UAAI,EAAAhF,KAMJkQ,YAAM,EAAAlQ,KAMNgV,qBAAe,EAAAhV,KAGfiV,gCAA0B,EASxB,MAAM/E,EAASlQ,KAAKe,MAAM4G,cAAc,kCACxC,KAAMuI,aAAkBpD,kBACtB,MAAM,IAAIxM,aAAa,CACrBE,UAAWuU,cACXrU,QAASwP,EACTvP,aAAc,mBACdF,WAAY,kDAIhB,GAAoB,aAAhByP,EAAOzU,KACT,MAAM,IAAI6E,aACR,6FAIJ,MAAM0U,EAAkBhV,KAAKe,MAAM4G,cACjC,mCAEF,KAAMqN,aAA2BE,mBAC/B,MAAM,IAAI5U,aAAa,CACrBE,UAAWuU,cACXrU,QAASsU,EACTrU,aAAc,oBACdF,WAAY,+CAIhB,GAA6B,WAAzBuU,EAAgBvZ,KAClB,MAAM,IAAI6E,aACR,wFAIJN,KAAKkQ,OAASA,EACdlQ,KAAKgV,gBAAkBA,EAEvBhV,KAAK0B,OAAS5F,aACZiZ,cAAcvO,SACd9E,EACAlC,iBAAiBuV,cAAe/U,KAAKe,MAAMrE,UAG7CsD,KAAKgF,KAAO,IAAIxD,KAAKxB,KAAK0B,OAAOsD,KAAM,CAErCpD,OAAQoK,sBAAsBhM,KAAKe,MAAO,UAI5Cf,KAAKgV,gBAAgBxW,gBAAgB,UAMrC,MAAMyW,EAA6BtX,SAASmJ,cAAc,OAC1DmO,EAA2BnH,UACzB,wDACFmH,EAA2BxW,aAAa,YAAa,UACrDuB,KAAKiV,2BAA6BA,EAClCjV,KAAKkQ,OAAOrC,sBAAsB,WAAYoH,GAG9CjV,KAAKgV,gBAAgBtW,iBAAiB,QAASsB,KAAKsK,OAAO4I,KAAKlT,OAG5DA,KAAKkQ,OAAOS,MACd3Q,KAAKkQ,OAAOS,KAAKjS,iBAAiB,UAAU,IAAMsB,KAAKmV,SAIzD1X,OAAOiB,iBAAiB,YAAa2I,IAC/BA,EAAM+N,WAAkC,aAArBpV,KAAKkQ,OAAOzU,MACjCuE,KAAKmV,MACP,IAIFnV,KAAKmV,MACP,CAQA7K,MAAAA,CAAOjD,GACLA,EAAMsE,iBAGmB,aAArB3L,KAAKkQ,OAAOzU,KAOhBuE,KAAKmV,OANHnV,KAAKqV,MAOT,CAOAA,IAAAA,GACErV,KAAKsV,QAAQ,OACf,CAOAH,IAAAA,GACEnV,KAAKsV,QAAQ,WACf,CAQAA,OAAAA,CAAQ7Z,GACN,GAAIA,IAASuE,KAAKkQ,OAAOzU,KACvB,OAIFuE,KAAKkQ,OAAOzR,aAAa,OAAQhD,GAEjC,MAAM8Z,EAAoB,aAAT9Z,EACX+Z,EAAeD,EAAW,OAAS,OACnCE,EAAeF,EAAW,iBAAmB,gBAGnDvV,KAAKgV,gBAAgBU,UAAY1V,KAAKgF,KAAKlD,EAAE,GAAG0T,aAGhDxV,KAAKgV,gBAAgBvW,aACnB,aACAuB,KAAKgF,KAAKlD,EAAE,GAAG0T,uBAIjBxV,KAAKiV,2BAA2BS,UAAY1V,KAAKgF,KAAKlD,EACpD,GAAG2T,gBAEP,EAtLWV,cA2LJxV,WAAa,uBA3LTwV,cAqMJvO,SAAWrK,OAAO4O,OAAO,CAC9B/F,KAAM,CACJ2Q,aAAc,OACdC,aAAc,OACdC,sBAAuB,gBACvBC,sBAAuB,gBACvBC,0BAA2B,2BAC3BC,2BAA4B,6BA5MrBjB,cAsNJnY,OAAST,OAAO4O,OAAO,CAC5BlO,WAAY,CACVmI,KAAM,CAAEvJ,KAAM,aC5Nb,MAAMwa,eAAenV,uBAkB1BjB,WAAAA,CAAYkB,GACVhB,MAAMgB,GAAMf,KAjBdiQ,aAAO,EAmBL,MAAMA,EAAUjQ,KAAKe,MAAM0F,iBAAiB,uBAC5C,IAAKwJ,EAAQtU,OACX,MAAM,IAAI2E,aAAa,CACrBE,UAAWyV,OACXxV,WAAY,yCAIhBT,KAAKiQ,QAAUA,EAEfjQ,KAAKiQ,QAAQ1I,SAAS2I,IACpB,MAAMC,EAAWD,EAAO9R,aAAa,sBAGrC,GAAK+R,EAAL,CAKA,IAAKxS,SAASiQ,eAAeuC,GAC3B,MAAM,IAAI7P,aAAa,CACrBE,UAAWyV,OACXxV,WAAY,6BAA6B0P,UAM7CD,EAAOzR,aAAa,gBAAiB0R,GACrCD,EAAO1R,gBAAgB,qBAbvB,CAa4C,IAM9Cf,OAAOiB,iBAAiB,YAAY,IAAMsB,KAAKoQ,8BAK/CpQ,KAAKoQ,4BAGLpQ,KAAKe,MAAMrC,iBAAiB,SAAU2I,GAAUrH,KAAKqQ,YAAYhJ,IACnE,CAOA+I,yBAAAA,GACEpQ,KAAKiQ,QAAQ1I,SAAS2I,GACpBlQ,KAAKsQ,oCAAoCJ,IAE7C,CAWAI,mCAAAA,CAAoCJ,GAClC,MAAMC,EAAWD,EAAO9R,aAAa,iBACrC,IAAK+R,EACH,OAGF,MAAMzE,EAAU/N,SAASiQ,eAAeuC,GACxC,GAAIzE,MAAAA,GAAAA,EAASzM,UAAUC,SAAS,6BAA8B,CAC5D,MAAMqR,EAAiBL,EAAOM,QAE9BN,EAAOzR,aAAa,gBAAiB8R,EAAelG,YACpDqB,EAAQzM,UAAUqL,OAChB,qCACCiG,EAEL,CACF,CAaAF,WAAAA,CAAYhJ,GACV,MAAMyJ,EAAgBzJ,EAAMkC,OAG5B,KACIuH,aAAyBhE,mBACJ,UAAvBgE,EAAcrV,KAEd,OAKF,MAAMya,EAAavY,SAAS8I,iBAC1B,sCAGI0P,EAAoBrF,EAAcH,KAClCyF,EAAoBtF,EAAc1T,KAExC8Y,EAAW3O,SAAS2I,IAClB,MAAMmG,EAAmBnG,EAAOS,OAASwF,EACrBjG,EAAO9S,OAASgZ,GAEjBC,GACjBrW,KAAKsQ,oCAAoCJ,EAC3C,GAEJ,EAhJW+F,OAqJJ1W,WAAa,eCpJf,MAAM+W,0BAA0BxV,uBA4BrCjB,WAAAA,CAAYkB,GACVhB,MAAMgB,GAAMf,KA3BdkU,iBAAW,EAAAlU,KAGXmU,WAAK,EAAAnU,KAQLoU,YAAa,EAAKpU,KAUlBqU,IAAM,KAQJ,MAAMH,EAAclU,KAAKe,MAAM4G,cAC7B,uCAMF,IAAKuM,EACH,OAAOlU,KAGT,MAAMsU,EAASJ,EAAY9V,aAAa,iBACxC,IAAKkW,EACH,MAAM,IAAIhU,aAAa,CACrBE,UAAW8V,kBACX7V,WACE,0GAIN,MAAM0T,EAAQxW,SAASiQ,eAAe0G,GACtC,IAAKH,EACH,MAAM,IAAI7T,aAAa,CACrBE,UAAW8V,kBACX5V,QAASyT,EACT1T,WAAY,yBAAyB6T,WAIzCtU,KAAKmU,MAAQA,EACbnU,KAAKkU,YAAcA,EAEnBlU,KAAKuU,wBAELvU,KAAKkU,YAAYxV,iBAAiB,SAAS,IACzCsB,KAAKwU,yBAET,CAOAD,qBAAAA,GACE,MAAME,EAAajX,cAAc,UAEjC,IAAKiX,EAAWtZ,MACd,MAAM,IAAImF,aAAa,CACrBE,UAAW8V,kBACX7V,WAAY,0BAA0BgU,EAAWrZ,0CAKrD4E,KAAKqU,IAAM5W,OAAOiX,WAAW,eAAeD,EAAWtZ,UAInD,qBAAsB6E,KAAKqU,IAC7BrU,KAAKqU,IAAI3V,iBAAiB,UAAU,IAAMsB,KAAK2U,cAI/C3U,KAAKqU,IAAIO,aAAY,IAAM5U,KAAK2U,cAGlC3U,KAAK2U,WACP,CAYAA,SAAAA,GACO3U,KAAKqU,KAAQrU,KAAKmU,OAAUnU,KAAKkU,cAIlClU,KAAKqU,IAAIQ,SACX7U,KAAKmU,MAAM3V,gBAAgB,UAC3BwB,KAAKkU,YAAYzV,aAAa,SAAU,MAExCuB,KAAKkU,YAAY1V,gBAAgB,UACjCwB,KAAKkU,YAAYzV,aAAa,gBAAiBuB,KAAKoU,WAAW/J,YAE3DrK,KAAKoU,WACPpU,KAAKmU,MAAM3V,gBAAgB,UAE3BwB,KAAKmU,MAAM1V,aAAa,SAAU,KAGxC,CAUA+V,qBAAAA,GACExU,KAAKoU,YAAcpU,KAAKoU,WACxBpU,KAAK2U,WACP,EA9IW2B,kBAmJJ/W,WAAa,2BClJf,MAAMgX,iBAAiBzV,uBAS5BjB,WAAAA,CAAYkB,GAAO,IAAAyV,EACjBzW,MAAMgB,GAEN,MAAM0V,EAAOzW,KAAKe,MAAM0V,KAClBrF,EAAsCoF,OAAlCA,EAAGxW,KAAKe,MAAM3C,aAAa,SAAOoY,EAAI,GAGhD,IAAIlZ,EASJ,IACEA,EAAM,IAAIG,OAAOiZ,IAAI1W,KAAKe,MAAMqQ,KACjC,CAAC,MAAOuF,GACP,MAAM,IAAIrW,aACR,mCAAmC8Q,mBAEvC,CAGA,GACE9T,EAAIsZ,SAAWnZ,OAAO+V,SAASoD,QAC/BtZ,EAAIuZ,WAAapZ,OAAO+V,SAASqD,SAEjC,OAGF,MAAMC,EAAkBzZ,mBAAmBoZ,GAG3C,IAAKK,EACH,MAAM,IAAIxW,aACR,mCAAmC8Q,8BAIvC,MAAM2F,EAAiBpZ,SAASiQ,eAAekJ,GAG/C,IAAKC,EACH,MAAM,IAAIzW,aAAa,CACrBE,UAAW+V,SACX7V,QAASqW,EACTtW,WAAY,yBAAyBqW,UAUzC9W,KAAKe,MAAMrC,iBAAiB,SAAS,IACnCX,SAASgZ,EAAgB,CACvBnY,aAAAA,GACEmY,EAAe9X,UAAU8H,IAAI,kCAC9B,EACD1I,MAAAA,GACE0Y,EAAe9X,UAAUmK,OAAO,kCAClC,KAGN,EA7EWmN,SACJrV,YAAcgQ,kBADVqF,SAkFJhX,WAAa,kBCnFf,MAAMyX,aAAalW,uBAkCxBjB,WAAAA,CAAYkB,GACVhB,MAAMgB,GAAMf,KAjCdiX,WAAK,EAAAjX,KAGLkX,cAAQ,EAAAlX,KAGRmX,mBAAa,EAAAnX,KAGboX,cAAgB,4BAA2BpX,KAG3CqX,cAAe,EAAKrX,KAGpBsX,mBAAa,EAAAtX,KAGbuX,qBAAe,EAAAvX,KAGfwX,uBAAiB,EAAAxX,KAMjBqU,IAAM,KAQJ,MAAM4C,EAAQjX,KAAKe,MAAM0F,iBAAiB,qBAC1C,IAAKwQ,EAAMtb,OACT,MAAM,IAAI2E,aAAa,CACrBE,UAAWwW,KACXvW,WAAY,0CAIhBT,KAAKiX,MAAQA,EAGbjX,KAAKsX,cAAgBtX,KAAKyX,WAAWvE,KAAKlT,MAC1CA,KAAKuX,gBAAkBvX,KAAK0X,aAAaxE,KAAKlT,MAC9CA,KAAKwX,kBAAoBxX,KAAK2X,aAAazE,KAAKlT,MAEhD,MAAMkX,EAAWlX,KAAKe,MAAM4G,cAAc,qBACpCwP,EAAgBnX,KAAKe,MAAM0F,iBAC/B,4BAGF,IAAKyQ,EACH,MAAM,IAAI5W,aAAa,CACrBE,UAAWwW,KACXvW,WAAY,2CAIhB,IAAK0W,EAAcxb,OACjB,MAAM,IAAI2E,aAAa,CACrBE,UAAWwW,KACXvW,WAAY,sDAIhBT,KAAKkX,SAAWA,EAChBlX,KAAKmX,cAAgBA,EAErBnX,KAAKuU,uBACP,CAOAA,qBAAAA,GACE,MAAME,EAAajX,cAAc,UAEjC,IAAKiX,EAAWtZ,MACd,MAAM,IAAImF,aAAa,CACrBE,UAAWwW,KACXvW,WAAY,0BAA0BgU,EAAWrZ,0CAKrD4E,KAAKqU,IAAM5W,OAAOiX,WAAW,eAAeD,EAAWtZ,UAInD,qBAAsB6E,KAAKqU,IAC7BrU,KAAKqU,IAAI3V,iBAAiB,UAAU,IAAMsB,KAAK2U,cAI/C3U,KAAKqU,IAAIO,aAAY,IAAM5U,KAAK2U,cAGlC3U,KAAK2U,WACP,CAOAA,SAAAA,GAAY,IAAAiD,EACNA,OAAJA,EAAI5X,KAAKqU,MAALuD,EAAU/C,QACZ7U,KAAK6X,QAEL7X,KAAK8X,UAET,CAOAD,KAAAA,GAAQ,IAAAE,EACN/X,KAAKkX,SAASzY,aAAa,OAAQ,WAEnCuB,KAAKmX,cAAc5P,SAASyQ,IAC1BA,EAAMvZ,aAAa,OAAQ,eAAe,IAG5CuB,KAAKiX,MAAM1P,SAAS0Q,IAElBjY,KAAKkY,cAAcD,GAGnBA,EAAKvZ,iBAAiB,QAASsB,KAAKsX,eAAe,GACnDW,EAAKvZ,iBAAiB,UAAWsB,KAAKuX,iBAAiB,GAGvDvX,KAAKmY,QAAQF,EAAK,IAIpB,MAAMG,SAAUL,EAAG/X,KAAKqY,OAAO5a,OAAO+V,SAASiD,OAAKsB,EAAI/X,KAAKiX,MAAM,GAEnEjX,KAAKsY,QAAQF,GAGb3a,OAAOiB,iBAAiB,aAAcsB,KAAKwX,mBAAmB,EAChE,CAOAM,QAAAA,GACE9X,KAAKkX,SAAS1Y,gBAAgB,QAE9BwB,KAAKmX,cAAc5P,SAASyQ,IAC1BA,EAAMxZ,gBAAgB,OAAO,IAG/BwB,KAAKiX,MAAM1P,SAAS0Q,IAElBA,EAAKM,oBAAoB,QAASvY,KAAKsX,eAAe,GACtDW,EAAKM,oBAAoB,UAAWvY,KAAKuX,iBAAiB,GAG1DvX,KAAKwY,gBAAgBP,EAAK,IAI5Bxa,OAAO8a,oBAAoB,aAAcvY,KAAKwX,mBAAmB,EACnE,CAQAG,YAAAA,GACE,MAAMlB,EAAOhZ,OAAO+V,SAASiD,KACvBgC,EAAezY,KAAKqY,OAAO5B,GACjC,IAAKgC,EACH,OAIF,GAAIzY,KAAKqX,aAEP,YADArX,KAAKqX,cAAe,GAKtB,MAAMqB,EAAe1Y,KAAK2Y,gBACrBD,IAIL1Y,KAAKmY,QAAQO,GACb1Y,KAAKsY,QAAQG,GACbA,EAAa5Z,QACf,CAQAsZ,OAAAA,CAAQF,GACNjY,KAAK4Y,eAAeX,GACpBjY,KAAK6Y,UAAUZ,EACjB,CAQAK,OAAAA,CAAQL,GACNjY,KAAK8Y,aAAab,GAClBjY,KAAK+Y,UAAUd,EACjB,CASAI,MAAAA,CAAO5B,GACL,OAAOzW,KAAKe,MAAM4G,cAAc,2BAA2B8O,MAC7D,CAQAyB,aAAAA,CAAcD,GACZ,MAAMe,EAAU3b,mBAAmB4a,EAAK7G,MACxC,IAAK4H,EACH,OAIFf,EAAKxZ,aAAa,KAAM,OAAOua,KAC/Bf,EAAKxZ,aAAa,OAAQ,OAC1BwZ,EAAKxZ,aAAa,gBAAiBua,GACnCf,EAAKxZ,aAAa,gBAAiB,SACnCwZ,EAAKxZ,aAAa,WAAY,MAG9B,MAAMwa,EAASjZ,KAAKkZ,SAASjB,GACxBgB,IAILA,EAAOxa,aAAa,OAAQ,YAC5Bwa,EAAOxa,aAAa,kBAAmBwZ,EAAK5P,IAC5C4Q,EAAOha,UAAU8H,IAAI/G,KAAKoX,eAC5B,CAQAoB,eAAAA,CAAgBP,GAEdA,EAAKzZ,gBAAgB,MACrByZ,EAAKzZ,gBAAgB,QACrByZ,EAAKzZ,gBAAgB,iBACrByZ,EAAKzZ,gBAAgB,iBACrByZ,EAAKzZ,gBAAgB,YAGrB,MAAMya,EAASjZ,KAAKkZ,SAASjB,GACxBgB,IAILA,EAAOza,gBAAgB,QACvBya,EAAOza,gBAAgB,mBACvBya,EAAOha,UAAUmK,OAAOpJ,KAAKoX,eAC/B,CASAK,UAAAA,CAAWpQ,GACT,MAAM8R,EAAcnZ,KAAK2Y,gBACnBS,EAAW/R,EAAMgS,cAElBF,GAAiBC,aAAoBlI,oBAI1C7J,EAAMsE,iBAEN3L,KAAKmY,QAAQgB,GACbnZ,KAAKsY,QAAQc,GACbpZ,KAAKsZ,mBAAmBF,GAC1B,CAWAE,kBAAAA,CAAmBrB,GACjB,MAAMgB,EAASjZ,KAAKkZ,SAASjB,GAC7B,IAAKgB,EACH,OAKF,MAAMD,EAAUC,EAAO5Q,GACvB4Q,EAAO5Q,GAAK,GACZrI,KAAKqX,cAAe,EACpB5Z,OAAO+V,SAASiD,KAAOuC,EACvBC,EAAO5Q,GAAK2Q,CACd,CAWAtB,YAAAA,CAAarQ,GACX,OAAQA,EAAMnL,KAEZ,IAAK,YACL,IAAK,OACH8D,KAAKuZ,sBACLlS,EAAMsE,iBACN,MACF,IAAK,aACL,IAAK,QACH3L,KAAKwZ,kBACLnS,EAAMsE,iBAGZ,CAOA6N,eAAAA,GACE,MAAML,EAAcnZ,KAAK2Y,gBACzB,GAAgB,MAAXQ,IAAAA,EAAaM,cAChB,OAGF,MAAMC,EAAmBP,EAAYM,cAAcE,mBACnD,IAAKD,EACH,OAGF,MAAMN,EAAWM,EAAiB/R,cAAc,qBAC3CyR,IAILpZ,KAAKmY,QAAQgB,GACbnZ,KAAKsY,QAAQc,GACbA,EAASva,QACTmB,KAAKsZ,mBAAmBF,GAC1B,CAOAG,mBAAAA,GACE,MAAMJ,EAAcnZ,KAAK2Y,gBACzB,GAAgB,MAAXQ,IAAAA,EAAaM,cAChB,OAGF,MAAMG,EACJT,EAAYM,cAAcI,uBAC5B,IAAKD,EACH,OAGF,MAAMlB,EAAekB,EAAqBjS,cAAc,qBACnD+Q,IAIL1Y,KAAKmY,QAAQgB,GACbnZ,KAAKsY,QAAQI,GACbA,EAAa7Z,QACbmB,KAAKsZ,mBAAmBZ,GAC1B,CASAQ,QAAAA,CAASjB,GACP,MAAMe,EAAU3b,mBAAmB4a,EAAK7G,MACxC,OAAK4H,EAIEhZ,KAAKe,MAAM4G,cAAc,IAAIqR,KAH3B,IAIX,CAQAD,SAAAA,CAAUd,GACR,MAAMgB,EAASjZ,KAAKkZ,SAASjB,GACxBgB,GAILA,EAAOha,UAAUmK,OAAOpJ,KAAKoX,cAC/B,CAQAyB,SAAAA,CAAUZ,GACR,MAAMgB,EAASjZ,KAAKkZ,SAASjB,GACxBgB,GAILA,EAAOha,UAAU8H,IAAI/G,KAAKoX,cAC5B,CAQAwB,cAAAA,CAAeX,GACRA,EAAKwB,gBAIVxB,EAAKxZ,aAAa,gBAAiB,SACnCwZ,EAAKwB,cAAcxa,UAAUmK,OAAO,mCACpC6O,EAAKxZ,aAAa,WAAY,MAChC,CAQAqa,YAAAA,CAAab,GACNA,EAAKwB,gBAIVxB,EAAKxZ,aAAa,gBAAiB,QACnCwZ,EAAKwB,cAAcxa,UAAU8H,IAAI,mCACjCkR,EAAKxZ,aAAa,WAAY,KAChC,CAQAka,aAAAA,GACE,OAAO3Y,KAAKe,MAAM4G,cAChB,qDAEJ,EChfF,SAASmS,QAAQpY,GAAQ,IAAAqY,EAIvB,GAHArY,OAA2B,IAAXA,EAAyBA,EAAS,CAAA,GAG7C5C,cAQH,YAPI4C,EAAOsY,QACTtY,EAAOsY,QAAQ,IAAI/Z,aAAgB,CACjCyB,WAGF6B,QAAQ0W,IAAI,IAAIha,eAKpB,MAAMia,EAAmC,CACvC,CAACnV,UAAWrD,EAAOyY,WACnB,CAAC7O,OAAQ5J,EAAO0Y,QAChB,CAACjO,eAAgBzK,EAAO2Y,gBACxB,CAACrK,YACD,CAACe,aAAcrP,EAAO4Y,cACtB,CAAClI,aAAc1Q,EAAO6Y,cACtB,CAACtG,QACD,CAACa,mBAAoBpT,EAAO8Y,oBAC5B,CAACzF,cAAerT,EAAO+Y,eACvB,CAACxE,QACD,CAACK,mBACD,CAACC,UACD,CAACS,OAOG/Y,EAAU,CACdyc,MAAmB,OAAdX,EAAErY,EAAOgZ,OAAKX,EAAIpc,SACvBqc,QAAStY,EAAOsY,SAGlBE,EAAW3S,SAAQ,EAAE9K,UAAWiF,MAC9BiZ,UAAUle,UAAWiF,EAAQzD,EAAQ,GAEzC,CAiBA,SAAS0c,UAAUle,UAAWiF,EAAQkZ,GACpC,IAC0DZ,EADpBjb,EAASpB,SAGL,IAAAkd,EAAV,iBAArBD,IAMT7b,EAA+B,OAAzB8b,EAAGD,EAAiBF,OAAKG,EAAI9b,EACnCib,EAAUY,EAAiBZ,SAGG,mBAArBY,IACTZ,EAAUY,GAGRA,aAA4BvZ,cAC9BtC,EAAS6b,GAGX,MAAME,EAAY/b,EAAO0H,iBACvB,iBAAiBhK,UAAU8C,gBAI7B,OAAKT,cAmBEK,MAAMoJ,KAAKuS,GACfC,KAAK/c,IACJ,IAGE,YAAyB,IAAX0D,EACV,IAAIjF,UAAUuB,EAAU0D,GACxB,IAAIjF,UAAUuB,EACnB,CAAC,MAAO2Y,GAWP,OAVIqD,EACFA,EAAQrD,EAAO,CACbjW,QAAS1C,EACTwC,UAAW/D,UACXiF,WAGF6B,QAAQ0W,IAAItD,GAGP,IACT,KAEDqE,OAAO9X,UAxCJ8W,EACFA,EAAQ,IAAI/Z,aAAgB,CAC1BO,UAAW/D,UACXiF,WAGF6B,QAAQ0W,IAAI,IAAIha,cAEX,GAiCX,CDhJa+W,KAogBJzX,WAAa,oBC9StBwF,UAAAuG,OAAAa,eAAA6D,WAAAlP,oCAAAiQ,aAAAqB,aAAA6B,OAAAa,mBAAAC,cAAAkB,OAAAK,kBAAAC,SAAAS,KAAA2D,UAAAb,QAAAhb,YAAA7D"}
+{"version":3,"file":"govuk-frontend.min.js","sources":["../../src/govuk/common/govuk-frontend-version.mjs","../../src/govuk/common/index.mjs","../../src/govuk/errors/index.mjs","../../src/govuk/govuk-frontend-component.mjs","../../src/govuk/common/configuration.mjs","../../src/govuk/i18n.mjs","../../src/govuk/components/accordion/accordion.mjs","../../src/govuk/components/button/button.mjs","../../src/govuk/common/closest-attribute-value.mjs","../../src/govuk/components/character-count/character-count.mjs","../../src/govuk/components/checkboxes/checkboxes.mjs","../../src/govuk/components/error-summary/error-summary.mjs","../../src/govuk/components/exit-this-page/exit-this-page.mjs","../../src/govuk/components/header/header.mjs","../../src/govuk/components/notification-banner/notification-banner.mjs","../../src/govuk/components/password-input/password-input.mjs","../../src/govuk/components/radios/radios.mjs","../../src/govuk/components/service-navigation/service-navigation.mjs","../../src/govuk/components/skip-link/skip-link.mjs","../../src/govuk/components/tabs/tabs.mjs","../../src/govuk/init.mjs"],"sourcesContent":["/*\n * This variable is automatically overwritten during builds and releases.\n * It doesn't need to be updated manually.\n */\n\n/**\n * GOV.UK Frontend release version\n *\n * {@link https://github.com/alphagov/govuk-frontend/releases}\n */\nexport const version = 'development'\n","/**\n * Common helpers which do not require polyfill.\n *\n * IMPORTANT: If a helper require a polyfill, please isolate it in its own module\n * so that the polyfill can be properly tree-shaken and does not burden\n * the components that do not need that helper\n */\n\n/**\n * Get hash fragment from URL\n *\n * Extract the hash fragment (everything after the hash) from a URL,\n * but not including the hash symbol\n *\n * @private\n * @param {string} url - URL\n * @returns {string | undefined} Fragment from URL, without the hash\n */\nexport function getFragmentFromUrl(url) {\n  if (!url.includes('#')) {\n    return undefined\n  }\n\n  return url.split('#').pop()\n}\n\n/**\n * Get GOV.UK Frontend breakpoint value from CSS custom property\n *\n * @private\n * @param {string} name - Breakpoint name\n * @returns {{ property: string, value?: string }} Breakpoint object\n */\nexport function getBreakpoint(name) {\n  const property = `--govuk-frontend-breakpoint-${name}`\n\n  // Get value from `<html>` with breakpoints on CSS :root\n  const value = window\n    .getComputedStyle(document.documentElement)\n    .getPropertyValue(property)\n\n  return {\n    property,\n    value: value || undefined\n  }\n}\n\n/**\n * Move focus to element\n *\n * Sets tabindex to -1 to make the element programmatically focusable,\n * but removes it on blur as the element doesn't need to be focused again.\n *\n * @private\n * @template {HTMLElement} FocusElement\n * @param {FocusElement} $element - HTML element\n * @param {object} [options] - Handler options\n * @param {function(this: FocusElement): void} [options.onBeforeFocus] - Callback before focus\n * @param {function(this: FocusElement): void} [options.onBlur] - Callback on blur\n */\nexport function setFocus($element, options = {}) {\n  const isFocusable = $element.getAttribute('tabindex')\n\n  if (!isFocusable) {\n    $element.setAttribute('tabindex', '-1')\n  }\n\n  /**\n   * Handle element focus\n   */\n  function onFocus() {\n    $element.addEventListener('blur', onBlur, { once: true })\n  }\n\n  /**\n   * Handle element blur\n   */\n  function onBlur() {\n    options.onBlur?.call($element)\n\n    if (!isFocusable) {\n      $element.removeAttribute('tabindex')\n    }\n  }\n\n  // Add listener to reset element on blur, after focus\n  $element.addEventListener('focus', onFocus, { once: true })\n\n  // Focus element\n  options.onBeforeFocus?.call($element)\n  $element.focus()\n}\n\n/**\n * Checks if component is already initialised\n *\n * @internal\n * @param {Element} $root - HTML element to be checked\n * @param {string} moduleName - name of component module\n * @returns {boolean} Whether component is already initialised\n */\nexport function isInitialised($root, moduleName) {\n  return (\n    $root instanceof HTMLElement &&\n    $root.hasAttribute(`data-${moduleName}-init`)\n  )\n}\n\n/**\n * Checks if GOV.UK Frontend is supported on this page\n *\n * Some browsers will load and run our JavaScript but GOV.UK Frontend\n * won't be supported.\n *\n * @param {HTMLElement | null} [$scope] - (internal) `<body>` HTML element checked for browser support\n * @returns {boolean} Whether GOV.UK Frontend is supported on this page\n */\nexport function isSupported($scope = document.body) {\n  if (!$scope) {\n    return false\n  }\n\n  return $scope.classList.contains('govuk-frontend-supported')\n}\n\n/**\n * Check for an array\n *\n * @internal\n * @param {unknown} option - Option to check\n * @returns {boolean} Whether the option is an array\n */\nfunction isArray(option) {\n  return Array.isArray(option)\n}\n\n/**\n * Check for an object\n *\n * @internal\n * @param {unknown} option - Option to check\n * @returns {boolean} Whether the option is an object\n */\nexport function isObject(option) {\n  return !!option && typeof option === 'object' && !isArray(option)\n}\n\n/**\n * Format error message\n *\n * @internal\n * @param {ComponentWithModuleName} Component - Component that threw the error\n * @param {string} message - Error message\n * @returns {string} - Formatted error message\n */\nexport function formatErrorMessage(Component, message) {\n  return `${Component.moduleName}: ${message}`\n}\n\n/* eslint-disable jsdoc/valid-types --\n * `{new(...args: any[] ): object}` is not recognised as valid\n * https://github.com/gajus/eslint-plugin-jsdoc/issues/145#issuecomment-1308722878\n * https://github.com/jsdoc-type-pratt-parser/jsdoc-type-pratt-parser/issues/131\n **/\n\n/**\n * @typedef ComponentWithModuleName\n * @property {string} moduleName - Name of the component\n */\n\n/* eslint-enable jsdoc/valid-types */\n","import { formatErrorMessage } from '../common/index.mjs'\n\n/**\n * GOV.UK Frontend error\n *\n * A base class for `Error`s thrown by GOV.UK Frontend.\n *\n * It is meant to be extended into specific types of errors\n * to be thrown by our code.\n *\n * @example\n * ```js\n * class MissingRootError extends GOVUKFrontendError {\n *   // Setting an explicit name is important as extending the class will not\n *   // set a new `name` on the subclass. The `name` property is important\n *   // to ensure intelligible error names even if the class name gets\n *   // mangled by a minifier\n *   name = \"MissingRootError\"\n * }\n * ```\n * @virtual\n */\nexport class GOVUKFrontendError extends Error {\n  name = 'GOVUKFrontendError'\n}\n\n/**\n * Indicates that GOV.UK Frontend is not supported\n */\nexport class SupportError extends GOVUKFrontendError {\n  name = 'SupportError'\n\n  /**\n   * Checks if GOV.UK Frontend is supported on this page\n   *\n   * @param {HTMLElement | null} [$scope] - HTML element `<body>` checked for browser support\n   */\n  constructor($scope = document.body) {\n    const supportMessage =\n      'noModule' in HTMLScriptElement.prototype\n        ? 'GOV.UK Frontend initialised without `<body class=\"govuk-frontend-supported\">` from template `<script>` snippet'\n        : 'GOV.UK Frontend is not supported in this browser'\n\n    super(\n      $scope\n        ? supportMessage\n        : 'GOV.UK Frontend initialised without `<script type=\"module\">`'\n    )\n  }\n}\n\n/**\n * Indicates that a component has received an illegal configuration\n */\nexport class ConfigError extends GOVUKFrontendError {\n  name = 'ConfigError'\n}\n\n/**\n * Indicates an issue with an element (possibly `null` or `undefined`)\n */\nexport class ElementError extends GOVUKFrontendError {\n  name = 'ElementError'\n\n  /**\n   * @internal\n   * @overload\n   * @param {string} message - Element error message\n   */\n\n  /**\n   * @internal\n   * @overload\n   * @param {ElementErrorOptions} options - Element error options\n   */\n\n  /**\n   * @internal\n   * @param {string | ElementErrorOptions} messageOrOptions - Element error message or options\n   */\n  constructor(messageOrOptions) {\n    let message = typeof messageOrOptions === 'string' ? messageOrOptions : ''\n\n    // Build message from options\n    if (typeof messageOrOptions === 'object') {\n      const { component, identifier, element, expectedType } = messageOrOptions\n\n      message = identifier\n\n      // Append reason\n      message += element\n        ? ` is not of type ${expectedType ?? 'HTMLElement'}`\n        : ' not found'\n\n      message = formatErrorMessage(component, message)\n    }\n\n    super(message)\n  }\n}\n\n/**\n * Indicates that a component is already initialised\n */\nexport class InitError extends GOVUKFrontendError {\n  name = 'InitError'\n\n  /**\n   * @internal\n   * @param {ComponentWithModuleName | string} componentOrMessage - name of the component module\n   */\n  constructor(componentOrMessage) {\n    const message =\n      typeof componentOrMessage === 'string'\n        ? componentOrMessage\n        : formatErrorMessage(\n            componentOrMessage,\n            `Root element (\\`$root\\`) already initialised`\n          )\n\n    super(message)\n  }\n}\n\n/**\n * Element error options\n *\n * @internal\n * @typedef {object} ElementErrorOptions\n * @property {string} identifier - An identifier that'll let the user understand which element has an error. This is whatever makes the most sense\n * @property {Element | null} [element] - The element in error\n * @property {string} [expectedType] - The type that was expected for the identifier\n * @property {ComponentWithModuleName} component - Component throwing the error\n */\n\n/**\n * @typedef {import('../common/index.mjs').ComponentWithModuleName} ComponentWithModuleName\n */\n","import { isInitialised, isSupported } from './common/index.mjs'\nimport { ElementError, InitError, SupportError } from './errors/index.mjs'\n\n/**\n * Base Component class\n *\n * Centralises the behaviours shared by our components\n *\n * @virtual\n * @template {Element} [RootElementType=HTMLElement]\n */\nexport class GOVUKFrontendComponent {\n  /**\n   * @type {typeof Element}\n   */\n  static elementType = HTMLElement\n\n  // allows Typescript user to work around the lack of types\n  // in GOVUKFrontend package, Typescript is not aware of $root\n  // in components that extend GOVUKFrontendComponent\n  /**\n   * Returns the root element of the component\n   *\n   * @protected\n   * @returns {RootElementType} - the root element of component\n   */\n  get $root() {\n    return this._$root\n  }\n\n  /**\n   * @protected\n   * @type {RootElementType}\n   */\n  _$root\n\n  /**\n   * Constructs a new component, validating that GOV.UK Frontend is supported\n   *\n   * @internal\n   * @param {Element | null} [$root] - HTML element to use for component\n   */\n  constructor($root) {\n    const childConstructor = /** @type {ChildClassConstructor} */ (\n      this.constructor\n    )\n\n    // TypeScript does not enforce that inheriting classes will define a `moduleName`\n    // (even if we add a `@virtual` `static moduleName` property to this class).\n    // While we trust users to do this correctly, we do a little check to provide them\n    // a helpful error message.\n    //\n    // After this, we'll be sure that `childConstructor` has a `moduleName`\n    // as expected of the `ChildClassConstructor` we've cast `this.constructor` to.\n    if (typeof childConstructor.moduleName !== 'string') {\n      throw new InitError(`\\`moduleName\\` not defined in component`)\n    }\n\n    if (!($root instanceof childConstructor.elementType)) {\n      throw new ElementError({\n        element: $root,\n        component: childConstructor,\n        identifier: 'Root element (`$root`)',\n        expectedType: childConstructor.elementType.name\n      })\n    } else {\n      this._$root = /** @type {RootElementType} */ ($root)\n    }\n\n    childConstructor.checkSupport()\n\n    this.checkInitialised()\n\n    const moduleName = childConstructor.moduleName\n\n    this.$root.setAttribute(`data-${moduleName}-init`, '')\n  }\n\n  /**\n   * Validates whether component is already initialised\n   *\n   * @private\n   * @throws {InitError} when component is already initialised\n   */\n  checkInitialised() {\n    const constructor = /** @type {ChildClassConstructor} */ (this.constructor)\n    const moduleName = constructor.moduleName\n\n    if (moduleName && isInitialised(this.$root, moduleName)) {\n      throw new InitError(constructor)\n    }\n  }\n\n  /**\n   * Validates whether components are supported\n   *\n   * @throws {SupportError} when the components are not supported\n   */\n  static checkSupport() {\n    if (!isSupported()) {\n      throw new SupportError()\n    }\n  }\n}\n\n/**\n * @typedef ChildClass\n * @property {string} moduleName - The module name that'll be looked for in the DOM when initialising the component\n */\n\n/**\n * @typedef {typeof GOVUKFrontendComponent & ChildClass} ChildClassConstructor\n */\n","import { ConfigError } from '../errors/index.mjs'\nimport { GOVUKFrontendComponent } from '../govuk-frontend-component.mjs'\n\nimport { isObject, formatErrorMessage } from './index.mjs'\n\nexport const configOverride = Symbol.for('configOverride')\n\n/**\n * Base Component class\n *\n * Centralises the behaviours shared by our components\n *\n * @virtual\n * @template {ObjectNested} [ConfigurationType={}]\n * @template {Element & { dataset: DOMStringMap }} [RootElementType=HTMLElement]\n * @augments GOVUKFrontendComponent<RootElementType>\n */\nexport class ConfigurableComponent extends GOVUKFrontendComponent {\n  /**\n   * configOverride\n   *\n   * Function which defines configuration overrides to prioritize\n   * properties from the root element's dataset.\n   *\n   * It should take a subset of configuration as input and return\n   * a new configuration object with properties that should be\n   * overridden based on the root element's dataset. A Symbol\n   * is used for indexing to prevent conflicts.\n   *\n   * @internal\n   * @virtual\n   * @param {ObjectNested} [param] - Configuration object\n   * @returns {ObjectNested} return - Configuration object\n   */\n  // eslint-disable-next-line @typescript-eslint/no-unused-vars\n  [configOverride](param) {\n    return {}\n  }\n\n  /**\n   * Returns the root element of the component\n   *\n   * @protected\n   * @returns {ConfigurationType} - the root element of component\n   */\n  get config() {\n    return this._config\n  }\n\n  /**\n   *\n   * @type {ConfigurationType}\n   */\n  _config\n\n  /**\n   * Constructs a new component, validating that GOV.UK Frontend is supported\n   *\n   * @internal\n   * @param {Element | null} [$root] - HTML element to use for component\n   * @param {ConfigurationType} [config] - HTML element to use for component\n   */\n  constructor($root, config) {\n    super($root)\n\n    const childConstructor =\n      /** @type {ChildClassConstructor<ConfigurationType>} */ (this.constructor)\n\n    if (typeof childConstructor.defaults === 'undefined') {\n      throw new ConfigError(\n        formatErrorMessage(\n          childConstructor,\n          'Config passed as parameter into constructor but no defaults defined'\n        )\n      )\n    }\n\n    const datasetConfig = /** @type {ConfigurationType} */ (\n      normaliseDataset(childConstructor, this._$root.dataset)\n    )\n\n    this._config = /** @type {ConfigurationType} */ (\n      mergeConfigs(\n        childConstructor.defaults,\n        config ?? {},\n        this[configOverride](datasetConfig),\n        datasetConfig\n      )\n    )\n  }\n}\n\n/**\n * Normalise string\n *\n * 'If it looks like a duck, and it quacks like a duck…' 🦆\n *\n * If the passed value looks like a boolean or a number, convert it to a boolean\n * or number.\n *\n * Designed to be used to convert config passed via data attributes (which are\n * always strings) into something sensible.\n *\n * @internal\n * @param {DOMStringMap[string]} value - The value to normalise\n * @param {SchemaProperty} [property] - Component schema property\n * @returns {string | boolean | number | undefined} Normalised data\n */\nexport function normaliseString(value, property) {\n  const trimmedValue = value ? value.trim() : ''\n\n  let output\n  let outputType = property?.type\n\n  // No schema type set? Determine automatically\n  if (!outputType) {\n    if (['true', 'false'].includes(trimmedValue)) {\n      outputType = 'boolean'\n    }\n\n    // Empty / whitespace-only strings are considered finite so we need to check\n    // the length of the trimmed string as well\n    if (trimmedValue.length > 0 && isFinite(Number(trimmedValue))) {\n      outputType = 'number'\n    }\n  }\n\n  switch (outputType) {\n    case 'boolean':\n      output = trimmedValue === 'true'\n      break\n\n    case 'number':\n      output = Number(trimmedValue)\n      break\n\n    default:\n      output = value\n  }\n\n  return output\n}\n\n/**\n * Normalise dataset\n *\n * Loop over an object and normalise each value using {@link normaliseString},\n * optionally expanding nested `i18n.field`\n *\n * @internal\n * @param {{ schema?: Schema, moduleName: string }} Component - Component class\n * @param {DOMStringMap} dataset - HTML element dataset\n * @returns {ObjectNested} Normalised dataset\n */\nexport function normaliseDataset(Component, dataset) {\n  if (typeof Component.schema === 'undefined') {\n    throw new ConfigError(\n      formatErrorMessage(\n        Component,\n        'Config passed as parameter into constructor but no schema defined'\n      )\n    )\n  }\n\n  const out = /** @type {ReturnType<typeof normaliseDataset>} */ ({})\n\n  // Normalise top-level dataset ('data-*') values using schema types\n  for (const [field, property] of Object.entries(Component.schema.properties)) {\n    if (field in dataset) {\n      out[field] = normaliseString(dataset[field], property)\n    }\n\n    /**\n     * Extract and normalise nested object values automatically using\n     * {@link normaliseString} but only schema object types are allowed\n     */\n    if (property?.type === 'object') {\n      out[field] = extractConfigByNamespace(Component.schema, dataset, field)\n    }\n  }\n\n  return out\n}\n\n/**\n * Config merging function\n *\n * Takes any number of objects and combines them together, with\n * greatest priority on the LAST item passed in.\n *\n * @internal\n * @param {...{ [key: string]: unknown }} configObjects - Config objects to merge\n * @returns {{ [key: string]: unknown }} A merged config object\n */\nexport function mergeConfigs(...configObjects) {\n  // Start with an empty object as our base\n  /** @type {{ [key: string]: unknown }} */\n  const formattedConfigObject = {}\n\n  // Loop through each of the passed objects\n  for (const configObject of configObjects) {\n    for (const key of Object.keys(configObject)) {\n      const option = formattedConfigObject[key]\n      const override = configObject[key]\n\n      // Push their keys one-by-one into formattedConfigObject. Any duplicate\n      // keys with object values will be merged, otherwise the new value will\n      // override the existing value.\n      if (isObject(option) && isObject(override)) {\n        // @ts-expect-error Index signature for type 'string' is missing\n        formattedConfigObject[key] = mergeConfigs(option, override)\n      } else {\n        // Apply override\n        formattedConfigObject[key] = override\n      }\n    }\n  }\n\n  return formattedConfigObject\n}\n\n/**\n * Validate component config by schema\n *\n * Follows limited examples in JSON schema for wider support in future\n *\n * {@link https://ajv.js.org/json-schema.html#compound-keywords}\n * {@link https://ajv.js.org/packages/ajv-errors.html#single-message}\n *\n * @internal\n * @param {Schema} schema - Config schema\n * @param {{ [key: string]: unknown }} config - Component config\n * @returns {string[]} List of validation errors\n */\nexport function validateConfig(schema, config) {\n  const validationErrors = []\n\n  // Check errors for each schema\n  for (const [name, conditions] of Object.entries(schema)) {\n    const errors = []\n\n    // Check errors for each schema condition\n    if (Array.isArray(conditions)) {\n      for (const { required, errorMessage } of conditions) {\n        if (!required.every((key) => !!config[key])) {\n          errors.push(errorMessage) // Missing config key value\n        }\n      }\n\n      // Check one condition passes or add errors\n      if (name === 'anyOf' && !(conditions.length - errors.length >= 1)) {\n        validationErrors.push(...errors)\n      }\n    }\n  }\n\n  return validationErrors\n}\n\n/**\n * Extracts keys starting with a particular namespace from dataset ('data-*')\n * object, removing the namespace in the process, normalising all values\n *\n * @internal\n * @param {Schema} schema - The schema of a component\n * @param {DOMStringMap} dataset - The object to extract key-value pairs from\n * @param {string} namespace - The namespace to filter keys with\n * @returns {ObjectNested | undefined} Nested object with dot-separated key namespace removed\n */\nexport function extractConfigByNamespace(schema, dataset, namespace) {\n  const property = schema.properties[namespace]\n\n  // Only extract configs for object schema properties\n  if (property?.type !== 'object') {\n    return\n  }\n\n  // Add default empty config\n  const newObject = {\n    [namespace]: /** @type {ObjectNested} */ ({})\n  }\n\n  for (const [key, value] of Object.entries(dataset)) {\n    /** @type {ObjectNested | ObjectNested[NestedKey]} */\n    let current = newObject\n\n    // Split the key into parts, using . as our namespace separator\n    const keyParts = key.split('.')\n\n    /**\n     * Create new level per part\n     *\n     * e.g. 'i18n.textareaDescription.other' becomes\n     * `{ i18n: { textareaDescription: { other } } }`\n     */\n    for (const [index, name] of keyParts.entries()) {\n      if (typeof current === 'object') {\n        // Drop down to nested object until the last part\n        if (index < keyParts.length - 1) {\n          // New nested object (optionally) replaces existing value\n          if (!isObject(current[name])) {\n            current[name] = {}\n          }\n\n          // Drop down into new or existing nested object\n          current = current[name]\n        } else if (key !== namespace) {\n          // Normalised value (optionally) replaces existing value\n          current[name] = normaliseString(value)\n        }\n      }\n    }\n  }\n\n  return newObject[namespace]\n}\n\n/**\n * @internal\n * @typedef {keyof ObjectNested} NestedKey\n * @typedef {{ [key: string]: string | boolean | number | ObjectNested | undefined }} ObjectNested\n */\n\n/**\n * Schema for component config\n *\n * @typedef {object} Schema\n * @property {{ [field: string]: SchemaProperty | undefined }} properties - Schema properties\n * @property {SchemaCondition[]} [anyOf] - List of schema conditions\n */\n\n/**\n * Schema property for component config\n *\n * @typedef {object} SchemaProperty\n * @property {'string' | 'boolean' | 'number' | 'object'} type - Property type\n */\n\n/**\n * Schema condition for component config\n *\n * @typedef {object} SchemaCondition\n * @property {string[]} required - List of required config fields\n * @property {string} errorMessage - Error message when required config fields not provided\n */\n\n/**\n * @template {ObjectNested} [ConfigurationType={}]\n * @typedef ChildClass\n * @property {string} moduleName - The module name that'll be looked for in the DOM when initialising the component\n * @property {Schema} [schema] - The schema of the component configuration\n * @property {ConfigurationType} [defaults] - The default values of the configuration of the component\n */\n\n/**\n * @template {ObjectNested} [ConfigurationType={}]\n * @typedef {typeof GOVUKFrontendComponent & ChildClass<ConfigurationType>} ChildClassConstructor<ConfigurationType>\n */\n","/**\n * Internal support for selecting messages to render, with placeholder\n * interpolation and locale-aware number formatting and pluralisation\n *\n * @internal\n */\nexport class I18n {\n  translations\n  locale\n\n  /**\n   * @internal\n   * @param {{ [key: string]: string | TranslationPluralForms }} translations - Key-value pairs of the translation strings to use.\n   * @param {object} [config] - Configuration options for the function.\n   * @param {string | null} [config.locale] - An overriding locale for the PluralRules functionality.\n   */\n  constructor(translations = {}, config = {}) {\n    // Make list of translations available throughout function\n    this.translations = translations\n\n    // The locale to use for PluralRules and NumberFormat\n    this.locale = config.locale ?? (document.documentElement.lang || 'en')\n  }\n\n  /**\n   * The most used function - takes the key for a given piece of UI text and\n   * returns the appropriate string.\n   *\n   * @internal\n   * @param {string} lookupKey - The lookup key of the string to use.\n   * @param {{ [key: string]: unknown }} [options] - Any options passed with the translation string, e.g: for string interpolation.\n   * @returns {string} The appropriate translation string.\n   * @throws {Error} Lookup key required\n   * @throws {Error} Options required for `${}` placeholders\n   */\n  t(lookupKey, options) {\n    if (!lookupKey) {\n      // Print a console error if no lookup key has been provided\n      throw new Error('i18n: lookup key missing')\n    }\n\n    // Fetch the translation for that lookup key\n    let translation = this.translations[lookupKey]\n\n    // If the `count` option is set, determine which plural suffix is needed and\n    // change the lookupKey to match. We check to see if it's numeric instead of\n    // falsy, as this could legitimately be 0.\n    if (typeof options?.count === 'number' && typeof translation === 'object') {\n      const translationPluralForm =\n        translation[this.getPluralSuffix(lookupKey, options.count)]\n\n      // Update translation with plural suffix\n      if (translationPluralForm) {\n        translation = translationPluralForm\n      }\n    }\n\n    if (typeof translation === 'string') {\n      // Check for ${} placeholders in the translation string\n      if (translation.match(/%{(.\\S+)}/)) {\n        if (!options) {\n          throw new Error(\n            'i18n: cannot replace placeholders in string if no option data provided'\n          )\n        }\n\n        return this.replacePlaceholders(translation, options)\n      }\n\n      return translation\n    }\n\n    // If the key wasn't found in our translations object,\n    // return the lookup key itself as the fallback\n    return lookupKey\n  }\n\n  /**\n   * Takes a translation string with placeholders, and replaces the placeholders\n   * with the provided data\n   *\n   * @internal\n   * @param {string} translationString - The translation string\n   * @param {{ [key: string]: unknown }} options - Any options passed with the translation string, e.g: for string interpolation.\n   * @returns {string} The translation string to output, with $\\{\\} placeholders replaced\n   */\n  replacePlaceholders(translationString, options) {\n    const formatter = Intl.NumberFormat.supportedLocalesOf(this.locale).length\n      ? new Intl.NumberFormat(this.locale)\n      : undefined\n\n    return translationString.replace(\n      /%{(.\\S+)}/g,\n\n      /**\n       * Replace translation string placeholders\n       *\n       * @internal\n       * @param {string} placeholderWithBraces - Placeholder with braces\n       * @param {string} placeholderKey - Placeholder key\n       * @returns {string} Placeholder value\n       */\n      function (placeholderWithBraces, placeholderKey) {\n        if (Object.prototype.hasOwnProperty.call(options, placeholderKey)) {\n          const placeholderValue = options[placeholderKey]\n\n          // If a user has passed `false` as the value for the placeholder\n          // treat it as though the value should not be displayed\n          if (\n            placeholderValue === false ||\n            (typeof placeholderValue !== 'number' &&\n              typeof placeholderValue !== 'string')\n          ) {\n            return ''\n          }\n\n          // If the placeholder's value is a number, localise the number formatting\n          if (typeof placeholderValue === 'number') {\n            return formatter\n              ? formatter.format(placeholderValue)\n              : `${placeholderValue}`\n          }\n\n          return placeholderValue\n        }\n\n        throw new Error(\n          `i18n: no data found to replace ${placeholderWithBraces} placeholder in string`\n        )\n      }\n    )\n  }\n\n  /**\n   * Check to see if the browser supports Intl.PluralRules\n   *\n   * It requires all conditions to be met in order to be supported:\n   * - The implementation of Intl supports PluralRules (NOT true in Safari 10–12)\n   * - The browser/OS has plural rules for the current locale (browser dependent)\n   *\n   * {@link https://browsersl.ist/#q=supports+es6-module+and+not+supports+intl-pluralrules}\n   *\n   * @internal\n   * @returns {boolean} Returns true if all conditions are met. Returns false otherwise.\n   */\n  hasIntlPluralRulesSupport() {\n    return Boolean(\n      'PluralRules' in window.Intl &&\n        Intl.PluralRules.supportedLocalesOf(this.locale).length\n    )\n  }\n\n  /**\n   * Get the appropriate suffix for the plural form.\n   *\n   * Uses Intl.PluralRules (or our own fallback implementation) to get the\n   * 'preferred' form to use for the given count.\n   *\n   * Checks that a translation has been provided for that plural form – if it\n   * hasn't, it'll fall back to the 'other' plural form (unless that doesn't exist\n   * either, in which case an error will be thrown)\n   *\n   * @internal\n   * @param {string} lookupKey - The lookup key of the string to use.\n   * @param {number} count - Number used to determine which pluralisation to use.\n   * @returns {PluralRule} The suffix associated with the correct pluralisation for this locale.\n   * @throws {Error} Plural form `.other` required when preferred plural form is missing\n   */\n  getPluralSuffix(lookupKey, count) {\n    // Validate that the number is actually a number.\n    //\n    // Number(count) will turn anything that can't be converted to a Number type\n    // into 'NaN'. isFinite filters out NaN, as it isn't a finite number.\n    count = Number(count)\n    if (!isFinite(count)) {\n      return 'other'\n    }\n\n    // Fetch the translation for that lookup key\n    const translation = this.translations[lookupKey]\n\n    // Check to verify that all the requirements for Intl.PluralRules are met.\n    // If so, we can use that instead of our custom implementation. Otherwise,\n    // use the hardcoded fallback.\n    const preferredForm = this.hasIntlPluralRulesSupport()\n      ? new Intl.PluralRules(this.locale).select(count)\n      : this.selectPluralFormUsingFallbackRules(count)\n\n    // Use the correct plural form if provided\n    if (typeof translation === 'object') {\n      if (preferredForm in translation) {\n        return preferredForm\n        // Fall back to `other` if the plural form is missing, but log a warning\n        // to the console\n      } else if ('other' in translation) {\n        console.warn(\n          `i18n: Missing plural form \".${preferredForm}\" for \"${this.locale}\" locale. Falling back to \".other\".`\n        )\n\n        return 'other'\n      }\n    }\n\n    // If the required `other` plural form is missing, all we can do is error\n    throw new Error(\n      `i18n: Plural form \".other\" is required for \"${this.locale}\" locale`\n    )\n  }\n\n  /**\n   * Get the plural form using our fallback implementation\n   *\n   * This is split out into a separate function to make it easier to test the\n   * fallback behaviour in an environment where Intl.PluralRules exists.\n   *\n   * @internal\n   * @param {number} count - Number used to determine which pluralisation to use.\n   * @returns {PluralRule} The pluralisation form for count in this locale.\n   */\n  selectPluralFormUsingFallbackRules(count) {\n    // Currently our custom code can only handle positive integers, so let's\n    // make sure our number is one of those.\n    count = Math.abs(Math.floor(count))\n\n    const ruleset = this.getPluralRulesForLocale()\n\n    if (ruleset) {\n      return I18n.pluralRules[ruleset](count)\n    }\n\n    return 'other'\n  }\n\n  /**\n   * Work out which pluralisation rules to use for the current locale\n   *\n   * The locale may include a regional indicator (such as en-GB), but we don't\n   * usually care about this part, as pluralisation rules are usually the same\n   * regardless of region. There are exceptions, however, (e.g. Portuguese) so\n   * this searches by both the full and shortened locale codes, just to be sure.\n   *\n   * @internal\n   * @returns {string | undefined} The name of the pluralisation rule to use (a key for one\n   *   of the functions in this.pluralRules)\n   */\n  getPluralRulesForLocale() {\n    const localeShort = this.locale.split('-')[0]\n\n    // Look through the plural rules map to find which `pluralRule` is\n    // appropriate for our current `locale`.\n    for (const pluralRule in I18n.pluralRulesMap) {\n      const languages = I18n.pluralRulesMap[pluralRule]\n      if (languages.includes(this.locale) || languages.includes(localeShort)) {\n        return pluralRule\n      }\n    }\n  }\n\n  /**\n   * Map of plural rules to languages where those rules apply.\n   *\n   * Note: These groups are named for the most dominant or recognisable language\n   * that uses each system. The groupings do not imply that the languages are\n   * related to one another. Many languages have evolved the same systems\n   * independently of one another.\n   *\n   * Code to support more languages can be found in the i18n spike:\n   * {@link https://github.com/alphagov/govuk-frontend/blob/spike-i18n-support/src/govuk/i18n.mjs}\n   *\n   * Languages currently supported:\n   *\n   * Arabic: Arabic (ar)\n   * Chinese: Burmese (my), Chinese (zh), Indonesian (id), Japanese (ja),\n   *   Javanese (jv), Korean (ko), Malay (ms), Thai (th), Vietnamese (vi)\n   * French: Armenian (hy), Bangla (bn), French (fr), Gujarati (gu), Hindi (hi),\n   *   Persian Farsi (fa), Punjabi (pa), Zulu (zu)\n   * German: Afrikaans (af), Albanian (sq), Azerbaijani (az), Basque (eu),\n   *   Bulgarian (bg), Catalan (ca), Danish (da), Dutch (nl), English (en),\n   *   Estonian (et), Finnish (fi), Georgian (ka), German (de), Greek (el),\n   *   Hungarian (hu), Luxembourgish (lb), Norwegian (no), Somali (so),\n   *   Swahili (sw), Swedish (sv), Tamil (ta), Telugu (te), Turkish (tr),\n   *   Urdu (ur)\n   * Irish: Irish Gaelic (ga)\n   * Russian: Russian (ru), Ukrainian (uk)\n   * Scottish: Scottish Gaelic (gd)\n   * Spanish: European Portuguese (pt-PT), Italian (it), Spanish (es)\n   * Welsh: Welsh (cy)\n   *\n   * @internal\n   * @type {{ [key: string]: string[] }}\n   */\n  static pluralRulesMap = {\n    arabic: ['ar'],\n    chinese: ['my', 'zh', 'id', 'ja', 'jv', 'ko', 'ms', 'th', 'vi'],\n    french: ['hy', 'bn', 'fr', 'gu', 'hi', 'fa', 'pa', 'zu'],\n    german: [\n      'af',\n      'sq',\n      'az',\n      'eu',\n      'bg',\n      'ca',\n      'da',\n      'nl',\n      'en',\n      'et',\n      'fi',\n      'ka',\n      'de',\n      'el',\n      'hu',\n      'lb',\n      'no',\n      'so',\n      'sw',\n      'sv',\n      'ta',\n      'te',\n      'tr',\n      'ur'\n    ],\n    irish: ['ga'],\n    russian: ['ru', 'uk'],\n    scottish: ['gd'],\n    spanish: ['pt-PT', 'it', 'es'],\n    welsh: ['cy']\n  }\n\n  /**\n   * Different pluralisation rule sets\n   *\n   * Returns the appropriate suffix for the plural form associated with `n`.\n   * Possible suffixes: 'zero', 'one', 'two', 'few', 'many', 'other' (the actual\n   * meaning of each differs per locale). 'other' should always exist, even in\n   * languages without plurals, such as Chinese.\n   * {@link https://cldr.unicode.org/index/cldr-spec/plural-rules}\n   *\n   * The count must be a positive integer. Negative numbers and decimals aren't accounted for\n   *\n   * @internal\n   * @type {{ [key: string]: (count: number) => PluralRule }}\n   */\n  static pluralRules = {\n    arabic(n) {\n      if (n === 0) {\n        return 'zero'\n      }\n      if (n === 1) {\n        return 'one'\n      }\n      if (n === 2) {\n        return 'two'\n      }\n      if (n % 100 >= 3 && n % 100 <= 10) {\n        return 'few'\n      }\n      if (n % 100 >= 11 && n % 100 <= 99) {\n        return 'many'\n      }\n      return 'other'\n    },\n    chinese() {\n      return 'other'\n    },\n    french(n) {\n      return n === 0 || n === 1 ? 'one' : 'other'\n    },\n    german(n) {\n      return n === 1 ? 'one' : 'other'\n    },\n    irish(n) {\n      if (n === 1) {\n        return 'one'\n      }\n      if (n === 2) {\n        return 'two'\n      }\n      if (n >= 3 && n <= 6) {\n        return 'few'\n      }\n      if (n >= 7 && n <= 10) {\n        return 'many'\n      }\n      return 'other'\n    },\n    russian(n) {\n      const lastTwo = n % 100\n      const last = lastTwo % 10\n      if (last === 1 && lastTwo !== 11) {\n        return 'one'\n      }\n      if (last >= 2 && last <= 4 && !(lastTwo >= 12 && lastTwo <= 14)) {\n        return 'few'\n      }\n      if (\n        last === 0 ||\n        (last >= 5 && last <= 9) ||\n        (lastTwo >= 11 && lastTwo <= 14)\n      ) {\n        return 'many'\n      }\n      // Note: The 'other' suffix is only used by decimal numbers in Russian.\n      // We don't anticipate it being used, but it's here for consistency.\n      return 'other'\n    },\n    scottish(n) {\n      if (n === 1 || n === 11) {\n        return 'one'\n      }\n      if (n === 2 || n === 12) {\n        return 'two'\n      }\n      if ((n >= 3 && n <= 10) || (n >= 13 && n <= 19)) {\n        return 'few'\n      }\n      return 'other'\n    },\n    spanish(n) {\n      if (n === 1) {\n        return 'one'\n      }\n      if (n % 1000000 === 0 && n !== 0) {\n        return 'many'\n      }\n      return 'other'\n    },\n    welsh(n) {\n      if (n === 0) {\n        return 'zero'\n      }\n      if (n === 1) {\n        return 'one'\n      }\n      if (n === 2) {\n        return 'two'\n      }\n      if (n === 3) {\n        return 'few'\n      }\n      if (n === 6) {\n        return 'many'\n      }\n      return 'other'\n    }\n  }\n}\n\n/**\n * Plural rule category mnemonic tags\n *\n * @internal\n * @typedef {'zero' | 'one' | 'two' | 'few' | 'many' | 'other'} PluralRule\n */\n\n/**\n * Translated message by plural rule they correspond to.\n *\n * Allows to group pluralised messages under a single key when passing\n * translations to a component's constructor\n *\n * @internal\n * @typedef {object} TranslationPluralForms\n * @property {string} [other] - General plural form\n * @property {string} [zero] - Plural form used with 0\n * @property {string} [one] - Plural form used with 1\n * @property {string} [two] - Plural form used with 2\n * @property {string} [few] - Plural form used for a few\n * @property {string} [many] - Plural form used for many\n */\n","import { ConfigurableComponent } from '../../common/configuration.mjs'\nimport { ElementError } from '../../errors/index.mjs'\nimport { I18n } from '../../i18n.mjs'\n\n/**\n * Accordion component\n *\n * This allows a collection of sections to be collapsed by default, showing only\n * their headers. Sections can be expanded or collapsed individually by clicking\n * their headers. A \"Show all sections\" button is also added to the top of the\n * accordion, which switches to \"Hide all sections\" when all the sections are\n * expanded.\n *\n * The state of each section is saved to the DOM via the `aria-expanded`\n * attribute, which also provides accessibility.\n *\n * @preserve\n * @augments ConfigurableComponent<AccordionConfig>\n */\nexport class Accordion extends ConfigurableComponent {\n  /** @private */\n  i18n\n\n  /** @private */\n  controlsClass = 'govuk-accordion__controls'\n\n  /** @private */\n  showAllClass = 'govuk-accordion__show-all'\n\n  /** @private */\n  showAllTextClass = 'govuk-accordion__show-all-text'\n\n  /** @private */\n  sectionClass = 'govuk-accordion__section'\n\n  /** @private */\n  sectionExpandedClass = 'govuk-accordion__section--expanded'\n\n  /** @private */\n  sectionButtonClass = 'govuk-accordion__section-button'\n\n  /** @private */\n  sectionHeaderClass = 'govuk-accordion__section-header'\n\n  /** @private */\n  sectionHeadingClass = 'govuk-accordion__section-heading'\n\n  /** @private */\n  sectionHeadingDividerClass = 'govuk-accordion__section-heading-divider'\n\n  /** @private */\n  sectionHeadingTextClass = 'govuk-accordion__section-heading-text'\n\n  /** @private */\n  sectionHeadingTextFocusClass = 'govuk-accordion__section-heading-text-focus'\n\n  /** @private */\n  sectionShowHideToggleClass = 'govuk-accordion__section-toggle'\n\n  /** @private */\n  sectionShowHideToggleFocusClass = 'govuk-accordion__section-toggle-focus'\n\n  /** @private */\n  sectionShowHideTextClass = 'govuk-accordion__section-toggle-text'\n\n  /** @private */\n  upChevronIconClass = 'govuk-accordion-nav__chevron'\n\n  /** @private */\n  downChevronIconClass = 'govuk-accordion-nav__chevron--down'\n\n  /** @private */\n  sectionSummaryClass = 'govuk-accordion__section-summary'\n\n  /** @private */\n  sectionSummaryFocusClass = 'govuk-accordion__section-summary-focus'\n\n  /** @private */\n  sectionContentClass = 'govuk-accordion__section-content'\n\n  /** @private */\n  $sections\n\n  /**\n   * @private\n   * @type {HTMLButtonElement | null}\n   */\n  $showAllButton = null\n\n  /**\n   * @private\n   * @type {HTMLElement | null}\n   */\n  $showAllIcon = null\n\n  /**\n   * @private\n   * @type {HTMLElement | null}\n   */\n  $showAllText = null\n\n  /**\n   * @param {Element | null} $root - HTML element to use for accordion\n   * @param {AccordionConfig} [config] - Accordion config\n   */\n  constructor($root, config = {}) {\n    super($root, config)\n\n    this.i18n = new I18n(this.config.i18n)\n\n    const $sections = this.$root.querySelectorAll(`.${this.sectionClass}`)\n    if (!$sections.length) {\n      throw new ElementError({\n        component: Accordion,\n        identifier: `Sections (\\`<div class=\"${this.sectionClass}\">\\`)`\n      })\n    }\n\n    this.$sections = $sections\n\n    this.initControls()\n    this.initSectionHeaders()\n\n    this.updateShowAllButton(this.areAllSectionsOpen())\n  }\n\n  /**\n   * Initialise controls and set attributes\n   *\n   * @private\n   */\n  initControls() {\n    // Create \"Show all\" button and set attributes\n    this.$showAllButton = document.createElement('button')\n    this.$showAllButton.setAttribute('type', 'button')\n    this.$showAllButton.setAttribute('class', this.showAllClass)\n    this.$showAllButton.setAttribute('aria-expanded', 'false')\n\n    // Create icon, add to element\n    this.$showAllIcon = document.createElement('span')\n    this.$showAllIcon.classList.add(this.upChevronIconClass)\n    this.$showAllButton.appendChild(this.$showAllIcon)\n\n    // Create control wrapper and add controls to it\n    const $accordionControls = document.createElement('div')\n    $accordionControls.setAttribute('class', this.controlsClass)\n    $accordionControls.appendChild(this.$showAllButton)\n    this.$root.insertBefore($accordionControls, this.$root.firstChild)\n\n    // Build additional wrapper for Show all toggle text and place after icon\n    this.$showAllText = document.createElement('span')\n    this.$showAllText.classList.add(this.showAllTextClass)\n    this.$showAllButton.appendChild(this.$showAllText)\n\n    // Handle click events on the show/hide all button\n    this.$showAllButton.addEventListener('click', () =>\n      this.onShowOrHideAllToggle()\n    )\n\n    // Handle 'beforematch' events, if the user agent supports them\n    if ('onbeforematch' in document) {\n      document.addEventListener('beforematch', (event) =>\n        this.onBeforeMatch(event)\n      )\n    }\n  }\n\n  /**\n   * Initialise section headers\n   *\n   * @private\n   */\n  initSectionHeaders() {\n    this.$sections.forEach(($section, i) => {\n      const $header = $section.querySelector(`.${this.sectionHeaderClass}`)\n      if (!$header) {\n        throw new ElementError({\n          component: Accordion,\n          identifier: `Section headers (\\`<div class=\"${this.sectionHeaderClass}\">\\`)`\n        })\n      }\n\n      // Set header attributes\n      this.constructHeaderMarkup($header, i)\n      this.setExpanded(this.isExpanded($section), $section)\n\n      // Handle events\n      $header.addEventListener('click', () => this.onSectionToggle($section))\n\n      // See if there is any state stored in sessionStorage and set the sections\n      // to open or closed.\n      this.setInitialState($section)\n    })\n  }\n\n  /**\n   * Construct section header\n   *\n   * @private\n   * @param {Element} $header - Section header\n   * @param {number} index - Section index\n   */\n  constructHeaderMarkup($header, index) {\n    const $span = $header.querySelector(`.${this.sectionButtonClass}`)\n    const $heading = $header.querySelector(`.${this.sectionHeadingClass}`)\n    const $summary = $header.querySelector(`.${this.sectionSummaryClass}`)\n\n    if (!$heading) {\n      throw new ElementError({\n        component: Accordion,\n        identifier: `Section heading (\\`.${this.sectionHeadingClass}\\`)`\n      })\n    }\n\n    if (!$span) {\n      throw new ElementError({\n        component: Accordion,\n        identifier: `Section button placeholder (\\`<span class=\"${this.sectionButtonClass}\">\\`)`\n      })\n    }\n\n    // Create a button element that will replace the\n    // '.govuk-accordion__section-button' span\n    const $button = document.createElement('button')\n    $button.setAttribute('type', 'button')\n    $button.setAttribute(\n      'aria-controls',\n      `${this.$root.id}-content-${index + 1}`\n    )\n\n    // Copy all attributes from $span to $button (except `id`, which gets added\n    // to the `$headingText` element)\n    for (const attr of Array.from($span.attributes)) {\n      if (attr.name !== 'id') {\n        $button.setAttribute(attr.name, attr.value)\n      }\n    }\n\n    // Create container for heading text so it can be styled\n    const $headingText = document.createElement('span')\n    $headingText.classList.add(this.sectionHeadingTextClass)\n    // Copy the span ID to the heading text to allow it to be referenced by\n    // `aria-labelledby` on the hidden content area without \"Show this section\"\n    $headingText.id = $span.id\n\n    // Create an inner heading text container to limit the width of the focus\n    // state\n    const $headingTextFocus = document.createElement('span')\n    $headingTextFocus.classList.add(this.sectionHeadingTextFocusClass)\n    $headingText.appendChild($headingTextFocus)\n    // span could contain HTML elements\n    // (see https://www.w3.org/TR/2011/WD-html5-20110525/content-models.html#phrasing-content)\n    Array.from($span.childNodes).forEach(($child) =>\n      $headingTextFocus.appendChild($child)\n    )\n\n    // Create container for show / hide icons and text.\n    const $showHideToggle = document.createElement('span')\n    $showHideToggle.classList.add(this.sectionShowHideToggleClass)\n    // Tell Google not to index the 'show' text as part of the heading. Must be\n    // set on the element before it's added to the DOM.\n    // See https://developers.google.com/search/docs/advanced/robots/robots_meta_tag#data-nosnippet-attr\n    $showHideToggle.setAttribute('data-nosnippet', '')\n    // Create an inner container to limit the width of the focus state\n    const $showHideToggleFocus = document.createElement('span')\n    $showHideToggleFocus.classList.add(this.sectionShowHideToggleFocusClass)\n    $showHideToggle.appendChild($showHideToggleFocus)\n    // Create wrapper for the show / hide text. Append text after the show/hide icon\n    const $showHideText = document.createElement('span')\n    const $showHideIcon = document.createElement('span')\n    $showHideIcon.classList.add(this.upChevronIconClass)\n    $showHideToggleFocus.appendChild($showHideIcon)\n    $showHideText.classList.add(this.sectionShowHideTextClass)\n    $showHideToggleFocus.appendChild($showHideText)\n\n    // Append elements to the button:\n    // 1. Heading text\n    // 2. Punctuation\n    // 3. (Optional: Summary line followed by punctuation)\n    // 4. Show / hide toggle\n    $button.appendChild($headingText)\n    $button.appendChild(this.getButtonPunctuationEl())\n\n    // If summary content exists add to DOM in correct order\n    if ($summary) {\n      // Create a new `span` element and copy the summary line content from the\n      // original `div` to the new `span`. This is because the summary line text\n      // is now inside a button element, which can only contain phrasing\n      // content.\n      const $summarySpan = document.createElement('span')\n      // Create an inner summary container to limit the width of the summary\n      // focus state\n      const $summarySpanFocus = document.createElement('span')\n      $summarySpanFocus.classList.add(this.sectionSummaryFocusClass)\n      $summarySpan.appendChild($summarySpanFocus)\n\n      // Get original attributes, and pass them to the replacement\n      for (const attr of Array.from($summary.attributes)) {\n        $summarySpan.setAttribute(attr.name, attr.value)\n      }\n\n      // Copy original contents of summary to the new summary span\n      Array.from($summary.childNodes).forEach(($child) =>\n        $summarySpanFocus.appendChild($child)\n      )\n\n      // Replace the original summary `div` with the new summary `span`\n      $summary.remove()\n\n      $button.appendChild($summarySpan)\n      $button.appendChild(this.getButtonPunctuationEl())\n    }\n\n    $button.appendChild($showHideToggle)\n\n    $heading.removeChild($span)\n    $heading.appendChild($button)\n  }\n\n  /**\n   * When a section is opened by the user agent via the 'beforematch' event\n   *\n   * @private\n   * @param {Event} event - Generic event\n   */\n  onBeforeMatch(event) {\n    const $fragment = event.target\n\n    // Handle elements with `.closest()` support only\n    if (!($fragment instanceof Element)) {\n      return\n    }\n\n    // Handle when fragment is inside section\n    const $section = $fragment.closest(`.${this.sectionClass}`)\n    if ($section) {\n      this.setExpanded(true, $section)\n    }\n  }\n\n  /**\n   * When section toggled, set and store state\n   *\n   * @private\n   * @param {Element} $section - Section element\n   */\n  onSectionToggle($section) {\n    const nowExpanded = !this.isExpanded($section)\n    this.setExpanded(nowExpanded, $section)\n\n    // Store the state in sessionStorage when a change is triggered\n    this.storeState($section, nowExpanded)\n  }\n\n  /**\n   * When Open/Close All toggled, set and store state\n   *\n   * @private\n   */\n  onShowOrHideAllToggle() {\n    const nowExpanded = !this.areAllSectionsOpen()\n\n    this.$sections.forEach(($section) => {\n      this.setExpanded(nowExpanded, $section)\n      this.storeState($section, nowExpanded)\n    })\n\n    this.updateShowAllButton(nowExpanded)\n  }\n\n  /**\n   * Set section attributes when opened/closed\n   *\n   * @private\n   * @param {boolean} expanded - Section expanded\n   * @param {Element} $section - Section element\n   */\n  setExpanded(expanded, $section) {\n    const $showHideIcon = $section.querySelector(`.${this.upChevronIconClass}`)\n    const $showHideText = $section.querySelector(\n      `.${this.sectionShowHideTextClass}`\n    )\n    const $button = $section.querySelector(`.${this.sectionButtonClass}`)\n    const $content = $section.querySelector(`.${this.sectionContentClass}`)\n\n    if (!$content) {\n      throw new ElementError({\n        component: Accordion,\n        identifier: `Section content (\\`<div class=\"${this.sectionContentClass}\">\\`)`\n      })\n    }\n\n    if (!$showHideIcon || !$showHideText || !$button) {\n      // Return early for elements we create\n      return\n    }\n\n    const newButtonText = expanded\n      ? this.i18n.t('hideSection')\n      : this.i18n.t('showSection')\n\n    $showHideText.textContent = newButtonText\n    $button.setAttribute('aria-expanded', `${expanded}`)\n\n    // Update aria-label combining\n    const ariaLabelParts = []\n\n    const $headingText = $section.querySelector(\n      `.${this.sectionHeadingTextClass}`\n    )\n    if ($headingText) {\n      ariaLabelParts.push(`${$headingText.textContent}`.trim())\n    }\n\n    const $summary = $section.querySelector(`.${this.sectionSummaryClass}`)\n    if ($summary) {\n      ariaLabelParts.push(`${$summary.textContent}`.trim())\n    }\n\n    const ariaLabelMessage = expanded\n      ? this.i18n.t('hideSectionAriaLabel')\n      : this.i18n.t('showSectionAriaLabel')\n    ariaLabelParts.push(ariaLabelMessage)\n\n    /*\n     * Join with a comma to add pause for assistive technology.\n     * Example: [heading]Section A ,[pause] Show this section.\n     * https://accessibility.blog.gov.uk/2017/12/18/what-working-on-gov-uk-navigation-taught-us-about-accessibility/\n     */\n    $button.setAttribute('aria-label', ariaLabelParts.join(' , '))\n\n    // Swap icon, change class\n    if (expanded) {\n      $content.removeAttribute('hidden')\n      $section.classList.add(this.sectionExpandedClass)\n      $showHideIcon.classList.remove(this.downChevronIconClass)\n    } else {\n      $content.setAttribute('hidden', 'until-found')\n      $section.classList.remove(this.sectionExpandedClass)\n      $showHideIcon.classList.add(this.downChevronIconClass)\n    }\n\n    // See if \"Show all sections\" button text should be updated\n    this.updateShowAllButton(this.areAllSectionsOpen())\n  }\n\n  /**\n   * Get state of section\n   *\n   * @private\n   * @param {Element} $section - Section element\n   * @returns {boolean} True if expanded\n   */\n  isExpanded($section) {\n    return $section.classList.contains(this.sectionExpandedClass)\n  }\n\n  /**\n   * Check if all sections are open\n   *\n   * @private\n   * @returns {boolean} True if all sections are open\n   */\n  areAllSectionsOpen() {\n    return Array.from(this.$sections).every(($section) =>\n      this.isExpanded($section)\n    )\n  }\n\n  /**\n   * Update \"Show all sections\" button\n   *\n   * @private\n   * @param {boolean} expanded - Section expanded\n   */\n  updateShowAllButton(expanded) {\n    if (!this.$showAllButton || !this.$showAllText || !this.$showAllIcon) {\n      return\n    }\n\n    this.$showAllButton.setAttribute('aria-expanded', expanded.toString())\n    this.$showAllText.textContent = expanded\n      ? this.i18n.t('hideAllSections')\n      : this.i18n.t('showAllSections')\n    this.$showAllIcon.classList.toggle(this.downChevronIconClass, !expanded)\n  }\n\n  /**\n   * Get the identifier for a section\n   *\n   * We need a unique way of identifying each content in the Accordion.\n   * Since an `#id` should be unique and an `id` is required for `aria-`\n   * attributes `id` can be safely used.\n   *\n   * @param {Element} $section - Section element\n   * @returns {string | undefined | null} Identifier for section\n   */\n  getIdentifier($section) {\n    const $button = $section.querySelector(`.${this.sectionButtonClass}`)\n\n    return $button?.getAttribute('aria-controls')\n  }\n\n  /**\n   * Set the state of the accordions in sessionStorage\n   *\n   * @private\n   * @param {Element} $section - Section element\n   * @param {boolean} isExpanded - Whether the section is expanded\n   */\n  storeState($section, isExpanded) {\n    if (!this.config.rememberExpanded) {\n      return\n    }\n\n    const id = this.getIdentifier($section)\n\n    if (id) {\n      try {\n        window.sessionStorage.setItem(id, isExpanded.toString())\n      } catch (exception) {}\n    }\n  }\n\n  /**\n   * Read the state of the accordions from sessionStorage\n   *\n   * @private\n   * @param {Element} $section - Section element\n   */\n  setInitialState($section) {\n    if (!this.config.rememberExpanded) {\n      return\n    }\n\n    const id = this.getIdentifier($section)\n\n    if (id) {\n      try {\n        const state = window.sessionStorage.getItem(id)\n\n        if (state !== null) {\n          this.setExpanded(state === 'true', $section)\n        }\n      } catch (exception) {}\n    }\n  }\n\n  /**\n   * Create an element to improve semantics of the section button with\n   * punctuation\n   *\n   * Adding punctuation to the button can also improve its general semantics by\n   * dividing its contents into thematic chunks. See\n   * https://github.com/alphagov/govuk-frontend/issues/2327#issuecomment-922957442\n   *\n   * @private\n   * @returns {Element} DOM element\n   */\n  getButtonPunctuationEl() {\n    const $punctuationEl = document.createElement('span')\n    $punctuationEl.classList.add(\n      'govuk-visually-hidden',\n      this.sectionHeadingDividerClass\n    )\n    $punctuationEl.textContent = ', '\n    return $punctuationEl\n  }\n\n  /**\n   * Name for the component used when initialising using data-module attributes.\n   */\n  static moduleName = 'govuk-accordion'\n\n  /**\n   * Accordion default config\n   *\n   * @see {@link AccordionConfig}\n   * @constant\n   * @type {AccordionConfig}\n   */\n  static defaults = Object.freeze({\n    i18n: {\n      hideAllSections: 'Hide all sections',\n      hideSection: 'Hide',\n      hideSectionAriaLabel: 'Hide this section',\n      showAllSections: 'Show all sections',\n      showSection: 'Show',\n      showSectionAriaLabel: 'Show this section'\n    },\n    rememberExpanded: true\n  })\n\n  /**\n   * Accordion config schema\n   *\n   * @constant\n   * @satisfies {Schema}\n   */\n  static schema = Object.freeze({\n    properties: {\n      i18n: { type: 'object' },\n      rememberExpanded: { type: 'boolean' }\n    }\n  })\n}\n\n/**\n * Accordion config\n *\n * @see {@link Accordion.defaults}\n * @typedef {object} AccordionConfig\n * @property {AccordionTranslations} [i18n=Accordion.defaults.i18n] - Accordion translations\n * @property {boolean} [rememberExpanded] - Whether the expanded and collapsed\n *   state of each section is remembered and restored when navigating.\n */\n\n/**\n * Accordion translations\n *\n * @see {@link Accordion.defaults.i18n}\n * @typedef {object} AccordionTranslations\n *\n * Messages used by the component for the labels of its buttons. This includes\n * the visible text shown on screen, and text to help assistive technology users\n * for the buttons toggling each section.\n * @property {string} [hideAllSections] - The text content for the 'Hide all\n *   sections' button, used when at least one section is expanded.\n * @property {string} [hideSection] - The text content for the 'Hide'\n *   button, used when a section is expanded.\n * @property {string} [hideSectionAriaLabel] - The text content appended to the\n *   'Hide' button's accessible name when a section is expanded.\n * @property {string} [showAllSections] - The text content for the 'Show all\n *   sections' button, used when all sections are collapsed.\n * @property {string} [showSection] - The text content for the 'Show'\n *   button, used when a section is collapsed.\n * @property {string} [showSectionAriaLabel] - The text content appended to the\n *   'Show' button's accessible name when a section is expanded.\n */\n\n/**\n * @typedef {import('../../common/configuration.mjs').Schema} Schema\n */\n","import { ConfigurableComponent } from '../../common/configuration.mjs'\n\nconst DEBOUNCE_TIMEOUT_IN_SECONDS = 1\n\n/**\n * JavaScript enhancements for the Button component\n *\n * @preserve\n * @augments ConfigurableComponent<ButtonConfig>\n */\nexport class Button extends ConfigurableComponent {\n  /**\n   * @private\n   * @type {number | null}\n   */\n  debounceFormSubmitTimer = null\n\n  /**\n   * @param {Element | null} $root - HTML element to use for button\n   * @param {ButtonConfig} [config] - Button config\n   */\n  constructor($root, config = {}) {\n    super($root, config)\n\n    this.$root.addEventListener('keydown', (event) => this.handleKeyDown(event))\n    this.$root.addEventListener('click', (event) => this.debounce(event))\n  }\n\n  /**\n   * Trigger a click event when the space key is pressed\n   *\n   * Some screen readers tell users they can use the space bar to activate\n   * things with the 'button' role, so we need to match the functionality of\n   * native HTML buttons.\n   *\n   * See https://github.com/alphagov/govuk_elements/pull/272#issuecomment-233028270\n   *\n   * @private\n   * @param {KeyboardEvent} event - Keydown event\n   */\n  handleKeyDown(event) {\n    const $target = event.target\n\n    // Handle space bar only\n    if (event.key !== ' ') {\n      return\n    }\n\n    // Handle elements with [role=\"button\"] only\n    if (\n      $target instanceof HTMLElement &&\n      $target.getAttribute('role') === 'button'\n    ) {\n      event.preventDefault() // prevent the page from scrolling\n      $target.click()\n    }\n  }\n\n  /**\n   * Debounce double-clicks\n   *\n   * If the click quickly succeeds a previous click then nothing will happen.\n   * This stops people accidentally causing multiple form submissions by double\n   * clicking buttons.\n   *\n   * @private\n   * @param {MouseEvent} event - Mouse click event\n   * @returns {undefined | false} Returns undefined, or false when debounced\n   */\n  debounce(event) {\n    // Check the button that was clicked has preventDoubleClick enabled\n    if (!this.config.preventDoubleClick) {\n      return\n    }\n\n    // If the timer is still running, prevent the click from submitting the form\n    if (this.debounceFormSubmitTimer) {\n      event.preventDefault()\n      return false\n    }\n\n    this.debounceFormSubmitTimer = window.setTimeout(() => {\n      this.debounceFormSubmitTimer = null\n    }, DEBOUNCE_TIMEOUT_IN_SECONDS * 1000)\n  }\n\n  /**\n   * Name for the component used when initialising using data-module attributes.\n   */\n  static moduleName = 'govuk-button'\n\n  /**\n   * Button default config\n   *\n   * @see {@link ButtonConfig}\n   * @constant\n   * @type {ButtonConfig}\n   */\n  static defaults = Object.freeze({\n    preventDoubleClick: false\n  })\n\n  /**\n   * Button config schema\n   *\n   * @constant\n   * @satisfies {Schema}\n   */\n  static schema = Object.freeze({\n    properties: {\n      preventDoubleClick: { type: 'boolean' }\n    }\n  })\n}\n\n/**\n * Button config\n *\n * @typedef {object} ButtonConfig\n * @property {boolean} [preventDoubleClick=false] - Prevent accidental double\n *   clicks on submit buttons from submitting forms multiple times.\n */\n\n/**\n * @typedef {import('../../common/configuration.mjs').Schema} Schema\n */\n","/**\n * Returns the value of the given attribute closest to the given element (including itself)\n *\n * @internal\n * @param {Element} $element - The element to start walking the DOM tree up\n * @param {string} attributeName - The name of the attribute\n * @returns {string | null} Attribute value\n */\nexport function closestAttributeValue($element, attributeName) {\n  const $closestElementWithAttribute = $element.closest(`[${attributeName}]`)\n  return $closestElementWithAttribute\n    ? $closestElementWithAttribute.getAttribute(attributeName)\n    : null\n}\n","import { closestAttributeValue } from '../../common/closest-attribute-value.mjs'\nimport {\n  validateConfig,\n  ConfigurableComponent,\n  configOverride\n} from '../../common/configuration.mjs'\nimport { formatErrorMessage } from '../../common/index.mjs'\nimport { ConfigError, ElementError } from '../../errors/index.mjs'\nimport { I18n } from '../../i18n.mjs'\n\n/**\n * Character count component\n *\n * Tracks the number of characters or words in the `.govuk-js-character-count`\n * `<textarea>` inside the element. Displays a message with the remaining number\n * of characters/words available, or the number of characters/words in excess.\n *\n * You can configure the message to only appear after a certain percentage\n * of the available characters/words has been entered.\n *\n * @preserve\n * @augments ConfigurableComponent<CharacterCountConfig>\n */\nexport class CharacterCount extends ConfigurableComponent {\n  /** @private */\n  $textarea\n\n  /** @private */\n  $visibleCountMessage\n\n  /** @private */\n  $screenReaderCountMessage\n\n  /**\n   * @private\n   * @type {number | null}\n   */\n  lastInputTimestamp = null\n\n  /** @private */\n  lastInputValue = ''\n\n  /**\n   * @private\n   * @type {number | null}\n   */\n  valueChecker = null\n\n  /** @private */\n  i18n\n\n  /** @private */\n  maxLength;\n\n  /**\n   * Character count config override\n   *\n   * To ensure data-attributes take complete precedence, even if they change\n   * the type of count, we need to reset the `maxlength` and `maxwords` from\n   * the JavaScript config.\n   *\n   * @internal\n   * @param {CharacterCountConfig} datasetConfig - configuration specified by dataset\n   * @returns {CharacterCountConfig} - configuration to override by dataset\n   */\n  [configOverride](datasetConfig) {\n    let configOverrides = {}\n    if ('maxwords' in datasetConfig || 'maxlength' in datasetConfig) {\n      configOverrides = {\n        maxlength: undefined,\n        maxwords: undefined\n      }\n    }\n\n    return configOverrides\n  }\n\n  /**\n   * @param {Element | null} $root - HTML element to use for character count\n   * @param {CharacterCountConfig} [config] - Character count config\n   */\n  constructor($root, config = {}) {\n    super($root, config)\n\n    const $textarea = this.$root.querySelector('.govuk-js-character-count')\n    if (\n      !(\n        $textarea instanceof HTMLTextAreaElement ||\n        $textarea instanceof HTMLInputElement\n      )\n    ) {\n      throw new ElementError({\n        component: CharacterCount,\n        element: $textarea,\n        expectedType: 'HTMLTextareaElement or HTMLInputElement',\n        identifier: 'Form field (`.govuk-js-character-count`)'\n      })\n    }\n\n    // Check for valid config\n    const errors = validateConfig(CharacterCount.schema, this.config)\n    if (errors[0]) {\n      throw new ConfigError(formatErrorMessage(CharacterCount, errors[0]))\n    }\n\n    this.i18n = new I18n(this.config.i18n, {\n      // Read the fallback if necessary rather than have it set in the defaults\n      locale: closestAttributeValue(this.$root, 'lang')\n    })\n\n    // Determine the limit attribute (characters or words)\n    this.maxLength = this.config.maxwords ?? this.config.maxlength ?? Infinity\n\n    this.$textarea = $textarea\n\n    const textareaDescriptionId = `${this.$textarea.id}-info`\n    const $textareaDescription = document.getElementById(textareaDescriptionId)\n    if (!$textareaDescription) {\n      throw new ElementError({\n        component: CharacterCount,\n        element: $textareaDescription,\n        identifier: `Count message (\\`id=\"${textareaDescriptionId}\"\\`)`\n      })\n    }\n\n    // Inject a description for the textarea if none is present already\n    // for when the component was rendered with no maxlength, maxwords\n    // nor custom textareaDescriptionText\n    if (`${$textareaDescription.textContent}`.match(/^\\s*$/)) {\n      $textareaDescription.textContent = this.i18n.t('textareaDescription', {\n        count: this.maxLength\n      })\n    }\n\n    // Move the textarea description to be immediately after the textarea\n    // Kept for backwards compatibility\n    this.$textarea.insertAdjacentElement('afterend', $textareaDescription)\n\n    // Create the *screen reader* specific live-updating counter\n    // This doesn't need any styling classes, as it is never visible\n    const $screenReaderCountMessage = document.createElement('div')\n    $screenReaderCountMessage.className =\n      'govuk-character-count__sr-status govuk-visually-hidden'\n    $screenReaderCountMessage.setAttribute('aria-live', 'polite')\n    this.$screenReaderCountMessage = $screenReaderCountMessage\n    $textareaDescription.insertAdjacentElement(\n      'afterend',\n      $screenReaderCountMessage\n    )\n\n    // Create our live-updating counter element, copying the classes from the\n    // textarea description for backwards compatibility as these may have been\n    // configured\n    const $visibleCountMessage = document.createElement('div')\n    $visibleCountMessage.className = $textareaDescription.className\n    $visibleCountMessage.classList.add('govuk-character-count__status')\n    $visibleCountMessage.setAttribute('aria-hidden', 'true')\n    this.$visibleCountMessage = $visibleCountMessage\n    $textareaDescription.insertAdjacentElement('afterend', $visibleCountMessage)\n\n    // Hide the textarea description\n    $textareaDescription.classList.add('govuk-visually-hidden')\n\n    // Remove hard limit if set\n    this.$textarea.removeAttribute('maxlength')\n\n    this.bindChangeEvents()\n\n    // When the page is restored after navigating 'back' in some browsers the\n    // state of form controls is not restored until *after* the DOMContentLoaded\n    // event is fired, so we need to sync after the pageshow event.\n    window.addEventListener('pageshow', () => this.updateCountMessage())\n\n    // Although we've set up handlers to sync state on the pageshow event, init\n    // could be called after those events have fired, for example if they are\n    // added to the page dynamically, so update now too.\n    this.updateCountMessage()\n  }\n\n  /**\n   * Bind change events\n   *\n   * Set up event listeners on the $textarea so that the count messages update\n   * when the user types.\n   *\n   * @private\n   */\n  bindChangeEvents() {\n    this.$textarea.addEventListener('keyup', () => this.handleKeyUp())\n\n    // Bind focus/blur events to start/stop polling\n    this.$textarea.addEventListener('focus', () => this.handleFocus())\n    this.$textarea.addEventListener('blur', () => this.handleBlur())\n  }\n\n  /**\n   * Handle key up event\n   *\n   * Update the visible character counter and keep track of when the last update\n   * happened for each keypress\n   *\n   * @private\n   */\n  handleKeyUp() {\n    this.updateVisibleCountMessage()\n    this.lastInputTimestamp = Date.now()\n  }\n\n  /**\n   * Handle focus event\n   *\n   * Speech recognition software such as Dragon NaturallySpeaking will modify\n   * the fields by directly changing its `value`. These changes don't trigger\n   * events in JavaScript, so we need to poll to handle when and if they occur.\n   *\n   * Once the keyup event hasn't been detected for at least 1000 ms (1s), check\n   * if the textarea value has changed and update the count message if it has.\n   *\n   * This is so that the update triggered by the manual comparison doesn't\n   * conflict with debounced KeyboardEvent updates.\n   *\n   * @private\n   */\n  handleFocus() {\n    this.valueChecker = window.setInterval(() => {\n      if (\n        !this.lastInputTimestamp ||\n        Date.now() - 500 >= this.lastInputTimestamp\n      ) {\n        this.updateIfValueChanged()\n      }\n    }, 1000)\n  }\n\n  /**\n   * Handle blur event\n   *\n   * Stop checking the textarea value once the textarea no longer has focus\n   *\n   * @private\n   */\n  handleBlur() {\n    // Cancel value checking on blur\n    if (this.valueChecker) {\n      window.clearInterval(this.valueChecker)\n    }\n  }\n\n  /**\n   * Update count message if textarea value has changed\n   *\n   * @private\n   */\n  updateIfValueChanged() {\n    if (this.$textarea.value !== this.lastInputValue) {\n      this.lastInputValue = this.$textarea.value\n      this.updateCountMessage()\n    }\n  }\n\n  /**\n   * Update count message\n   *\n   * Helper function to update both the visible and screen reader-specific\n   * counters simultaneously (e.g. on init)\n   *\n   * @private\n   */\n  updateCountMessage() {\n    this.updateVisibleCountMessage()\n    this.updateScreenReaderCountMessage()\n  }\n\n  /**\n   * Update visible count message\n   *\n   * @private\n   */\n  updateVisibleCountMessage() {\n    const remainingNumber = this.maxLength - this.count(this.$textarea.value)\n    const isError = remainingNumber < 0\n\n    // If input is over the threshold, remove the disabled class which renders\n    // the counter invisible.\n    this.$visibleCountMessage.classList.toggle(\n      'govuk-character-count__message--disabled',\n      !this.isOverThreshold()\n    )\n\n    // Update styles\n    this.$textarea.classList.toggle('govuk-textarea--error', isError)\n    this.$visibleCountMessage.classList.toggle('govuk-error-message', isError)\n    this.$visibleCountMessage.classList.toggle('govuk-hint', !isError)\n\n    // Update message\n    this.$visibleCountMessage.textContent = this.getCountMessage()\n  }\n\n  /**\n   * Update screen reader count message\n   *\n   * @private\n   */\n  updateScreenReaderCountMessage() {\n    // If over the threshold, remove the aria-hidden attribute, allowing screen\n    // readers to announce the content of the element.\n    if (this.isOverThreshold()) {\n      this.$screenReaderCountMessage.removeAttribute('aria-hidden')\n    } else {\n      this.$screenReaderCountMessage.setAttribute('aria-hidden', 'true')\n    }\n\n    // Update message\n    this.$screenReaderCountMessage.textContent = this.getCountMessage()\n  }\n\n  /**\n   * Count the number of characters (or words, if `config.maxwords` is set)\n   * in the given text\n   *\n   * @private\n   * @param {string} text - The text to count the characters of\n   * @returns {number} the number of characters (or words) in the text\n   */\n  count(text) {\n    if (this.config.maxwords) {\n      const tokens = text.match(/\\S+/g) ?? [] // Matches consecutive non-whitespace chars\n      return tokens.length\n    }\n\n    return text.length\n  }\n\n  /**\n   * Get count message\n   *\n   * @private\n   * @returns {string} Status message\n   */\n  getCountMessage() {\n    const remainingNumber = this.maxLength - this.count(this.$textarea.value)\n    const countType = this.config.maxwords ? 'words' : 'characters'\n    return this.formatCountMessage(remainingNumber, countType)\n  }\n\n  /**\n   * Formats the message shown to users according to what's counted\n   * and how many remain\n   *\n   * @private\n   * @param {number} remainingNumber - The number of words/characaters remaining\n   * @param {string} countType - \"words\" or \"characters\"\n   * @returns {string} Status message\n   */\n  formatCountMessage(remainingNumber, countType) {\n    if (remainingNumber === 0) {\n      return this.i18n.t(`${countType}AtLimit`)\n    }\n\n    const translationKeySuffix =\n      remainingNumber < 0 ? 'OverLimit' : 'UnderLimit'\n\n    return this.i18n.t(`${countType}${translationKeySuffix}`, {\n      count: Math.abs(remainingNumber)\n    })\n  }\n\n  /**\n   * Check if count is over threshold\n   *\n   * Checks whether the value is over the configured threshold for the input.\n   * If there is no configured threshold, it is set to 0 and this function will\n   * always return true.\n   *\n   * @private\n   * @returns {boolean} true if the current count is over the config.threshold\n   *   (or no threshold is set)\n   */\n  isOverThreshold() {\n    // No threshold means we're always above threshold so save some computation\n    if (!this.config.threshold) {\n      return true\n    }\n\n    // Determine the remaining number of characters/words\n    const currentLength = this.count(this.$textarea.value)\n    const maxLength = this.maxLength\n\n    const thresholdValue = (maxLength * this.config.threshold) / 100\n\n    return thresholdValue <= currentLength\n  }\n\n  /**\n   * Name for the component used when initialising using data-module attributes.\n   */\n  static moduleName = 'govuk-character-count'\n\n  /**\n   * Character count default config\n   *\n   * @see {@link CharacterCountConfig}\n   * @constant\n   * @type {CharacterCountConfig}\n   */\n  static defaults = Object.freeze({\n    threshold: 0,\n    i18n: {\n      // Characters\n      charactersUnderLimit: {\n        one: 'You have %{count} character remaining',\n        other: 'You have %{count} characters remaining'\n      },\n      charactersAtLimit: 'You have 0 characters remaining',\n      charactersOverLimit: {\n        one: 'You have %{count} character too many',\n        other: 'You have %{count} characters too many'\n      },\n      // Words\n      wordsUnderLimit: {\n        one: 'You have %{count} word remaining',\n        other: 'You have %{count} words remaining'\n      },\n      wordsAtLimit: 'You have 0 words remaining',\n      wordsOverLimit: {\n        one: 'You have %{count} word too many',\n        other: 'You have %{count} words too many'\n      },\n      textareaDescription: {\n        other: ''\n      }\n    }\n  })\n\n  /**\n   * Character count config schema\n   *\n   * @constant\n   * @satisfies {Schema}\n   */\n  static schema = Object.freeze({\n    properties: {\n      i18n: { type: 'object' },\n      maxwords: { type: 'number' },\n      maxlength: { type: 'number' },\n      threshold: { type: 'number' }\n    },\n    anyOf: [\n      {\n        required: ['maxwords'],\n        errorMessage: 'Either \"maxlength\" or \"maxwords\" must be provided'\n      },\n      {\n        required: ['maxlength'],\n        errorMessage: 'Either \"maxlength\" or \"maxwords\" must be provided'\n      }\n    ]\n  })\n}\n\n/**\n * Character count config\n *\n * @see {@link CharacterCount.defaults}\n * @typedef {object} CharacterCountConfig\n * @property {number} [maxlength] - The maximum number of characters.\n *   If maxwords is provided, the maxlength option will be ignored.\n * @property {number} [maxwords] - The maximum number of words. If maxwords is\n *   provided, the maxlength option will be ignored.\n * @property {number} [threshold=0] - The percentage value of the limit at\n *   which point the count message is displayed. If this attribute is set, the\n *   count message will be hidden by default.\n * @property {CharacterCountTranslations} [i18n=CharacterCount.defaults.i18n] - Character count translations\n */\n\n/**\n * Character count translations\n *\n * @see {@link CharacterCount.defaults.i18n}\n * @typedef {object} CharacterCountTranslations\n *\n * Messages shown to users as they type. It provides feedback on how many words\n * or characters they have remaining or if they are over the limit. This also\n * includes a message used as an accessible description for the textarea.\n * @property {TranslationPluralForms} [charactersUnderLimit] - Message displayed\n *   when the number of characters is under the configured maximum, `maxlength`.\n *   This message is displayed visually and through assistive technologies. The\n *   component will replace the `%{count}` placeholder with the number of\n *   remaining characters. This is a [pluralised list of\n *   messages](https://frontend.design-system.service.gov.uk/localise-govuk-frontend).\n * @property {string} [charactersAtLimit] - Message displayed when the number of\n *   characters reaches the configured maximum, `maxlength`. This message is\n *   displayed visually and through assistive technologies.\n * @property {TranslationPluralForms} [charactersOverLimit] - Message displayed\n *   when the number of characters is over the configured maximum, `maxlength`.\n *   This message is displayed visually and through assistive technologies. The\n *   component will replace the `%{count}` placeholder with the number of\n *   remaining characters. This is a [pluralised list of\n *   messages](https://frontend.design-system.service.gov.uk/localise-govuk-frontend).\n * @property {TranslationPluralForms} [wordsUnderLimit] - Message displayed when\n *   the number of words is under the configured maximum, `maxlength`. This\n *   message is displayed visually and through assistive technologies. The\n *   component will replace the `%{count}` placeholder with the number of\n *   remaining words. This is a [pluralised list of\n *   messages](https://frontend.design-system.service.gov.uk/localise-govuk-frontend).\n * @property {string} [wordsAtLimit] - Message displayed when the number of\n *   words reaches the configured maximum, `maxlength`. This message is\n *   displayed visually and through assistive technologies.\n * @property {TranslationPluralForms} [wordsOverLimit] - Message displayed when\n *   the number of words is over the configured maximum, `maxlength`. This\n *   message is displayed visually and through assistive technologies. The\n *   component will replace the `%{count}` placeholder with the number of\n *   remaining words. This is a [pluralised list of\n *   messages](https://frontend.design-system.service.gov.uk/localise-govuk-frontend).\n * @property {TranslationPluralForms} [textareaDescription] - Message made\n *   available to assistive technologies, if none is already present in the\n *   HTML, to describe that the component accepts only a limited amount of\n *   content. It is visible on the page when JavaScript is unavailable. The\n *   component will replace the `%{count}` placeholder with the value of the\n *   `maxlength` or `maxwords` parameter.\n */\n\n/**\n * @typedef {import('../../common/configuration.mjs').Schema} Schema\n * @typedef {import('../../i18n.mjs').TranslationPluralForms} TranslationPluralForms\n */\n","import { ElementError } from '../../errors/index.mjs'\nimport { GOVUKFrontendComponent } from '../../govuk-frontend-component.mjs'\n\n/**\n * Checkboxes component\n *\n * @preserve\n */\nexport class Checkboxes extends GOVUKFrontendComponent {\n  /** @private */\n  $inputs\n\n  /**\n   * Checkboxes can be associated with a 'conditionally revealed' content block\n   * – for example, a checkbox for 'Phone' could reveal an additional form field\n   * for the user to enter their phone number.\n   *\n   * These associations are made using a `data-aria-controls` attribute, which\n   * is promoted to an aria-controls attribute during initialisation.\n   *\n   * We also need to restore the state of any conditional reveals on the page\n   * (for example if the user has navigated back), and set up event handlers to\n   * keep the reveal in sync with the checkbox state.\n   *\n   * @param {Element | null} $root - HTML element to use for checkboxes\n   */\n  constructor($root) {\n    super($root)\n\n    const $inputs = this.$root.querySelectorAll('input[type=\"checkbox\"]')\n    if (!$inputs.length) {\n      throw new ElementError({\n        component: Checkboxes,\n        identifier: 'Form inputs (`<input type=\"checkbox\">`)'\n      })\n    }\n\n    this.$inputs = $inputs\n\n    this.$inputs.forEach(($input) => {\n      const targetId = $input.getAttribute('data-aria-controls')\n\n      // Skip radios without data-aria-controls attributes\n      if (!targetId) {\n        return\n      }\n\n      // Throw if target conditional element does not exist.\n      if (!document.getElementById(targetId)) {\n        throw new ElementError({\n          component: Checkboxes,\n          identifier: `Conditional reveal (\\`id=\"${targetId}\"\\`)`\n        })\n      }\n\n      // Promote the data-aria-controls attribute to a aria-controls attribute\n      // so that the relationship is exposed in the AOM\n      $input.setAttribute('aria-controls', targetId)\n      $input.removeAttribute('data-aria-controls')\n    })\n\n    // When the page is restored after navigating 'back' in some browsers the\n    // state of form controls is not restored until *after* the DOMContentLoaded\n    // event is fired, so we need to sync after the pageshow event.\n    window.addEventListener('pageshow', () => this.syncAllConditionalReveals())\n\n    // Although we've set up handlers to sync state on the pageshow event, init\n    // could be called after those events have fired, for example if they are\n    // added to the page dynamically, so sync now too.\n    this.syncAllConditionalReveals()\n\n    // Handle events\n    this.$root.addEventListener('click', (event) => this.handleClick(event))\n  }\n\n  /**\n   * Sync the conditional reveal states for all checkboxes in this component.\n   *\n   * @private\n   */\n  syncAllConditionalReveals() {\n    this.$inputs.forEach(($input) =>\n      this.syncConditionalRevealWithInputState($input)\n    )\n  }\n\n  /**\n   * Sync conditional reveal with the input state\n   *\n   * Synchronise the visibility of the conditional reveal, and its accessible\n   * state, with the input's checked state.\n   *\n   * @private\n   * @param {HTMLInputElement} $input - Checkbox input\n   */\n  syncConditionalRevealWithInputState($input) {\n    const targetId = $input.getAttribute('aria-controls')\n    if (!targetId) {\n      return\n    }\n\n    const $target = document.getElementById(targetId)\n    if ($target?.classList.contains('govuk-checkboxes__conditional')) {\n      const inputIsChecked = $input.checked\n\n      $input.setAttribute('aria-expanded', inputIsChecked.toString())\n      $target.classList.toggle(\n        'govuk-checkboxes__conditional--hidden',\n        !inputIsChecked\n      )\n    }\n  }\n\n  /**\n   * Uncheck other checkboxes\n   *\n   * Find any other checkbox inputs with the same name value, and uncheck them.\n   * This is useful for when a “None of these\" checkbox is checked.\n   *\n   * @private\n   * @param {HTMLInputElement} $input - Checkbox input\n   */\n  unCheckAllInputsExcept($input) {\n    const allInputsWithSameName = document.querySelectorAll(\n      `input[type=\"checkbox\"][name=\"${$input.name}\"]`\n    )\n\n    allInputsWithSameName.forEach(($inputWithSameName) => {\n      const hasSameFormOwner = $input.form === $inputWithSameName.form\n      if (hasSameFormOwner && $inputWithSameName !== $input) {\n        $inputWithSameName.checked = false\n        this.syncConditionalRevealWithInputState($inputWithSameName)\n      }\n    })\n  }\n\n  /**\n   * Uncheck exclusive checkboxes\n   *\n   * Find any checkbox inputs with the same name value and the 'exclusive'\n   * behaviour, and uncheck them. This helps prevent someone checking both a\n   * regular checkbox and a \"None of these\" checkbox in the same fieldset.\n   *\n   * @private\n   * @param {HTMLInputElement} $input - Checkbox input\n   */\n  unCheckExclusiveInputs($input) {\n    const allInputsWithSameNameAndExclusiveBehaviour =\n      document.querySelectorAll(\n        `input[data-behaviour=\"exclusive\"][type=\"checkbox\"][name=\"${$input.name}\"]`\n      )\n\n    allInputsWithSameNameAndExclusiveBehaviour.forEach(($exclusiveInput) => {\n      const hasSameFormOwner = $input.form === $exclusiveInput.form\n      if (hasSameFormOwner) {\n        $exclusiveInput.checked = false\n        this.syncConditionalRevealWithInputState($exclusiveInput)\n      }\n    })\n  }\n\n  /**\n   * Click event handler\n   *\n   * Handle a click within the component root – if the click occurred on a checkbox,\n   * sync the state of any associated conditional reveal with the checkbox\n   * state.\n   *\n   * @private\n   * @param {MouseEvent} event - Click event\n   */\n  handleClick(event) {\n    const $clickedInput = event.target\n\n    // Ignore clicks on things that aren't checkbox inputs\n    if (\n      !($clickedInput instanceof HTMLInputElement) ||\n      $clickedInput.type !== 'checkbox'\n    ) {\n      return\n    }\n\n    // If the checkbox conditionally-reveals some content, sync the state\n    const hasAriaControls = $clickedInput.getAttribute('aria-controls')\n    if (hasAriaControls) {\n      this.syncConditionalRevealWithInputState($clickedInput)\n    }\n\n    // No further behaviour needed for unchecking\n    if (!$clickedInput.checked) {\n      return\n    }\n\n    // Handle 'exclusive' checkbox behaviour (ie \"None of these\")\n    const hasBehaviourExclusive =\n      $clickedInput.getAttribute('data-behaviour') === 'exclusive'\n    if (hasBehaviourExclusive) {\n      this.unCheckAllInputsExcept($clickedInput)\n    } else {\n      this.unCheckExclusiveInputs($clickedInput)\n    }\n  }\n\n  /**\n   * Name for the component used when initialising using data-module attributes.\n   */\n  static moduleName = 'govuk-checkboxes'\n}\n","import { ConfigurableComponent } from '../../common/configuration.mjs'\nimport { getFragmentFromUrl, setFocus } from '../../common/index.mjs'\n\n/**\n * Error summary component\n *\n * Takes focus on initialisation for accessible announcement, unless disabled in\n * configuration.\n *\n * @preserve\n * @augments ConfigurableComponent<ErrorSummaryConfig>\n */\nexport class ErrorSummary extends ConfigurableComponent {\n  /**\n   * @param {Element | null} $root - HTML element to use for error summary\n   * @param {ErrorSummaryConfig} [config] - Error summary config\n   */\n  constructor($root, config = {}) {\n    super($root, config)\n\n    /**\n     * Focus the error summary\n     */\n    if (!this.config.disableAutoFocus) {\n      setFocus(this.$root)\n    }\n\n    this.$root.addEventListener('click', (event) => this.handleClick(event))\n  }\n\n  /**\n   * Click event handler\n   *\n   * @private\n   * @param {MouseEvent} event - Click event\n   */\n  handleClick(event) {\n    const $target = event.target\n    if ($target && this.focusTarget($target)) {\n      event.preventDefault()\n    }\n  }\n\n  /**\n   * Focus the target element\n   *\n   * By default, the browser will scroll the target into view. Because our\n   * labels or legends appear above the input, this means the user will be\n   * presented with an input without any context, as the label or legend will be\n   * off the top of the screen.\n   *\n   * Manually handling the click event, scrolling the question into view and\n   * then focussing the element solves this.\n   *\n   * This also results in the label and/or legend being announced correctly in\n   * NVDA (as tested in 2018.3.2) - without this only the field type is\n   * announced (e.g. \"Edit, has autocomplete\").\n   *\n   * @private\n   * @param {EventTarget} $target - Event target\n   * @returns {boolean} True if the target was able to be focussed\n   */\n  focusTarget($target) {\n    // If the element that was clicked was not a link, return early\n    if (!($target instanceof HTMLAnchorElement)) {\n      return false\n    }\n\n    const inputId = getFragmentFromUrl($target.href)\n    if (!inputId) {\n      return false\n    }\n\n    const $input = document.getElementById(inputId)\n    if (!$input) {\n      return false\n    }\n\n    const $legendOrLabel = this.getAssociatedLegendOrLabel($input)\n    if (!$legendOrLabel) {\n      return false\n    }\n\n    // Scroll the legend or label into view *before* calling focus on the input\n    // to avoid extra scrolling in browsers that don't support `preventScroll`\n    // (which at time of writing is most of them...)\n    $legendOrLabel.scrollIntoView()\n    $input.focus({ preventScroll: true })\n\n    return true\n  }\n\n  /**\n   * Get associated legend or label\n   *\n   * Returns the first element that exists from this list:\n   *\n   * - The `<legend>` associated with the closest `<fieldset>` ancestor, as long\n   *   as the top of it is no more than half a viewport height away from the\n   *   bottom of the input\n   * - The first `<label>` that is associated with the input using for=\"inputId\"\n   * - The closest parent `<label>`\n   *\n   * @private\n   * @param {Element} $input - The input\n   * @returns {Element | null} Associated legend or label, or null if no\n   *   associated legend or label can be found\n   */\n  getAssociatedLegendOrLabel($input) {\n    const $fieldset = $input.closest('fieldset')\n\n    if ($fieldset) {\n      const $legends = $fieldset.getElementsByTagName('legend')\n\n      if ($legends.length) {\n        const $candidateLegend = $legends[0]\n\n        // If the input type is radio or checkbox, always use the legend if\n        // there is one.\n        if (\n          $input instanceof HTMLInputElement &&\n          ($input.type === 'checkbox' || $input.type === 'radio')\n        ) {\n          return $candidateLegend\n        }\n\n        // For other input types, only scroll to the fieldset’s legend (instead\n        // of the label associated with the input) if the input would end up in\n        // the top half of the screen.\n        //\n        // This should avoid situations where the input either ends up off the\n        // screen, or obscured by a software keyboard.\n        const legendTop = $candidateLegend.getBoundingClientRect().top\n        const inputRect = $input.getBoundingClientRect()\n\n        // If the browser doesn't support Element.getBoundingClientRect().height\n        // or window.innerHeight (like IE8), bail and just link to the label.\n        if (inputRect.height && window.innerHeight) {\n          const inputBottom = inputRect.top + inputRect.height\n\n          if (inputBottom - legendTop < window.innerHeight / 2) {\n            return $candidateLegend\n          }\n        }\n      }\n    }\n\n    return (\n      document.querySelector(`label[for='${$input.getAttribute('id')}']`) ??\n      $input.closest('label')\n    )\n  }\n\n  /**\n   * Name for the component used when initialising using data-module attributes.\n   */\n  static moduleName = 'govuk-error-summary'\n\n  /**\n   * Error summary default config\n   *\n   * @see {@link ErrorSummaryConfig}\n   * @constant\n   * @type {ErrorSummaryConfig}\n   */\n  static defaults = Object.freeze({\n    disableAutoFocus: false\n  })\n\n  /**\n   * Error summary config schema\n   *\n   * @constant\n   * @satisfies {Schema}\n   */\n  static schema = Object.freeze({\n    properties: {\n      disableAutoFocus: { type: 'boolean' }\n    }\n  })\n}\n\n/**\n * Error summary config\n *\n * @typedef {object} ErrorSummaryConfig\n * @property {boolean} [disableAutoFocus=false] - If set to `true` the error\n *   summary will not be focussed when the page loads.\n */\n\n/**\n * @typedef {import('../../common/configuration.mjs').Schema} Schema\n */\n","import { ConfigurableComponent } from '../../common/configuration.mjs'\nimport { ElementError } from '../../errors/index.mjs'\nimport { I18n } from '../../i18n.mjs'\n\n/**\n * Exit this page component\n *\n * @preserve\n * @augments ConfigurableComponent<ExitThisPageConfig>\n */\nexport class ExitThisPage extends ConfigurableComponent {\n  /** @private */\n  i18n\n\n  /** @private */\n  $button\n\n  /**\n   * @private\n   * @type {HTMLAnchorElement | null}\n   */\n  $skiplinkButton = null\n\n  /**\n   * @private\n   * @type {HTMLElement | null}\n   */\n  $updateSpan = null\n\n  /**\n   * @private\n   * @type {HTMLElement | null}\n   */\n  $indicatorContainer = null\n\n  /**\n   * @private\n   * @type {HTMLElement | null}\n   */\n  $overlay = null\n\n  /** @private */\n  keypressCounter = 0\n\n  /** @private */\n  lastKeyWasModified = false\n\n  /** @private */\n  timeoutTime = 5000 // milliseconds\n\n  // Store the timeout events so that we can clear them to avoid user keypresses overlapping\n  // setTimeout returns an id that we can use to clear it with clearTimeout,\n  // hence the 'Id' suffix\n\n  /**\n   * @private\n   * @type {number | null}\n   */\n  keypressTimeoutId = null\n\n  /**\n   * @private\n   * @type {number | null}\n   */\n  timeoutMessageId = null\n\n  /**\n   * @param {Element | null} $root - HTML element that wraps the Exit This Page button\n   * @param {ExitThisPageConfig} [config] - Exit This Page config\n   */\n  constructor($root, config = {}) {\n    super($root, config)\n\n    const $button = this.$root.querySelector('.govuk-exit-this-page__button')\n    if (!($button instanceof HTMLAnchorElement)) {\n      throw new ElementError({\n        component: ExitThisPage,\n        element: $button,\n        expectedType: 'HTMLAnchorElement',\n        identifier: 'Button (`.govuk-exit-this-page__button`)'\n      })\n    }\n\n    this.i18n = new I18n(this.config.i18n)\n    this.$button = $button\n\n    const $skiplinkButton = document.querySelector(\n      '.govuk-js-exit-this-page-skiplink'\n    )\n    if ($skiplinkButton instanceof HTMLAnchorElement) {\n      this.$skiplinkButton = $skiplinkButton\n    }\n\n    this.buildIndicator()\n    this.initUpdateSpan()\n    this.initButtonClickHandler()\n\n    // Check to see if this has already been done by a previous initialisation of ExitThisPage\n    if (!('govukFrontendExitThisPageKeypress' in document.body.dataset)) {\n      document.addEventListener('keyup', this.handleKeypress.bind(this), true)\n      document.body.dataset.govukFrontendExitThisPageKeypress = 'true'\n    }\n\n    // When the page is restored after navigating 'back' in some browsers the\n    // blank overlay remains present, rendering the page unusable. Here, we check\n    // to see if it's present on page (re)load, and remove it if so.\n    window.addEventListener('pageshow', this.resetPage.bind(this))\n  }\n\n  /**\n   * Create the <span> we use for screen reader announcements.\n   *\n   * @private\n   */\n  initUpdateSpan() {\n    this.$updateSpan = document.createElement('span')\n    this.$updateSpan.setAttribute('role', 'status')\n    this.$updateSpan.className = 'govuk-visually-hidden'\n\n    this.$root.appendChild(this.$updateSpan)\n  }\n\n  /**\n   * Create button click handlers.\n   *\n   * @private\n   */\n  initButtonClickHandler() {\n    // Main EtP button\n    this.$button.addEventListener('click', this.handleClick.bind(this))\n\n    // EtP secondary link\n    if (this.$skiplinkButton) {\n      this.$skiplinkButton.addEventListener(\n        'click',\n        this.handleClick.bind(this)\n      )\n    }\n  }\n\n  /**\n   * Create the HTML for the 'three lights' indicator on the button.\n   *\n   * @private\n   */\n  buildIndicator() {\n    // Build container\n    // Putting `aria-hidden` on it as it won't contain any readable information\n    this.$indicatorContainer = document.createElement('div')\n    this.$indicatorContainer.className = 'govuk-exit-this-page__indicator'\n    this.$indicatorContainer.setAttribute('aria-hidden', 'true')\n\n    // Create three 'lights' and place them within the container\n    for (let i = 0; i < 3; i++) {\n      const $indicator = document.createElement('div')\n      $indicator.className = 'govuk-exit-this-page__indicator-light'\n      this.$indicatorContainer.appendChild($indicator)\n    }\n\n    // Append it all to the module\n    this.$button.appendChild(this.$indicatorContainer)\n  }\n\n  /**\n   * Update whether the lights are visible and which ones are lit up depending on\n   * the value of `keypressCounter`.\n   *\n   * @private\n   */\n  updateIndicator() {\n    if (!this.$indicatorContainer) {\n      return\n    }\n\n    // Show or hide the indicator container depending on keypressCounter value\n    this.$indicatorContainer.classList.toggle(\n      'govuk-exit-this-page__indicator--visible',\n      this.keypressCounter > 0\n    )\n\n    // Turn on only the indicators we want on\n    const $indicators = this.$indicatorContainer.querySelectorAll(\n      '.govuk-exit-this-page__indicator-light'\n    )\n    $indicators.forEach(($indicator, index) => {\n      $indicator.classList.toggle(\n        'govuk-exit-this-page__indicator-light--on',\n        index < this.keypressCounter\n      )\n    })\n  }\n\n  /**\n   * Initiates the redirection away from the current page.\n   * Includes the loading overlay functionality, which covers the current page with a\n   * white overlay so that the contents are not visible during the loading\n   * process. This is particularly important on slow network connections.\n   *\n   * @private\n   */\n  exitPage() {\n    if (!this.$updateSpan) {\n      return\n    }\n\n    this.$updateSpan.textContent = ''\n\n    // Blank the page\n    // As well as creating an overlay with text, we also set the body to hidden\n    // to prevent screen reader and sequential navigation users potentially\n    // navigating through the page behind the overlay during loading\n    document.body.classList.add('govuk-exit-this-page-hide-content')\n    this.$overlay = document.createElement('div')\n    this.$overlay.className = 'govuk-exit-this-page-overlay'\n    this.$overlay.setAttribute('role', 'alert')\n\n    // we do these this way round, thus incurring a second paint, because changing\n    // the element text after adding it means that screen readers pick up the\n    // announcement more reliably.\n    document.body.appendChild(this.$overlay)\n    this.$overlay.textContent = this.i18n.t('activated')\n\n    window.location.href = this.$button.href\n  }\n\n  /**\n   * Pre-activation logic for when the button is clicked/activated via mouse or\n   * pointer.\n   *\n   * We do this to differentiate it from the keyboard activation event because we\n   * need to run `e.preventDefault` as the button or skiplink are both links and we\n   * want to apply some additional logic in `exitPage` before navigating.\n   *\n   * @private\n   * @param {MouseEvent} event - mouse click event\n   */\n  handleClick(event) {\n    event.preventDefault()\n    this.exitPage()\n  }\n\n  /**\n   * Logic for the 'quick escape' keyboard sequence functionality (pressing the\n   * Shift key three times without interruption, within a time limit).\n   *\n   * @private\n   * @param {KeyboardEvent} event - keyup event\n   */\n  handleKeypress(event) {\n    if (!this.$updateSpan) {\n      return\n    }\n\n    // Detect if the 'Shift' key has been pressed. We want to only do things if it\n    // was pressed by itself and not in a combination with another key—so we keep\n    // track of whether the preceding keyup had shiftKey: true on it, and if it\n    // did, we ignore the next Shift keyup event.\n    //\n    // This works because using Shift as a modifier key (e.g. pressing Shift + A)\n    // will fire TWO keyup events, one for A (with e.shiftKey: true) and the other\n    // for Shift (with e.shiftKey: false).\n    if (event.key === 'Shift' && !this.lastKeyWasModified) {\n      this.keypressCounter += 1\n\n      // Update the indicator before the below if statement can reset it back to 0\n      this.updateIndicator()\n\n      // Clear the timeout for the keypress timeout message clearing itself\n      if (this.timeoutMessageId) {\n        window.clearTimeout(this.timeoutMessageId)\n        this.timeoutMessageId = null\n      }\n\n      if (this.keypressCounter >= 3) {\n        this.keypressCounter = 0\n\n        if (this.keypressTimeoutId) {\n          window.clearTimeout(this.keypressTimeoutId)\n          this.keypressTimeoutId = null\n        }\n\n        this.exitPage()\n      } else {\n        if (this.keypressCounter === 1) {\n          this.$updateSpan.textContent = this.i18n.t('pressTwoMoreTimes')\n        } else {\n          this.$updateSpan.textContent = this.i18n.t('pressOneMoreTime')\n        }\n      }\n\n      this.setKeypressTimer()\n    } else if (this.keypressTimeoutId) {\n      // If the user pressed any key other than 'Shift', after having pressed\n      // 'Shift' and activating the timer, stop and reset the timer.\n      this.resetKeypressTimer()\n    }\n\n    // Keep track of whether the Shift modifier key was held during this keypress\n    this.lastKeyWasModified = event.shiftKey\n  }\n\n  /**\n   * Starts the 'quick escape' keyboard sequence timer.\n   *\n   * This can be invoked several times. We want this to be possible so that the\n   * timer is restarted each time the shortcut key is pressed (e.g. the user has\n   * up to n seconds between each keypress, rather than n seconds to invoke the\n   * entire sequence.)\n   *\n   * @private\n   */\n  setKeypressTimer() {\n    // Clear any existing timeout. This is so only one timer is running even if\n    // there are multiple keypresses in quick succession.\n    if (this.keypressTimeoutId) {\n      window.clearTimeout(this.keypressTimeoutId)\n    }\n\n    // Set a fresh timeout\n    this.keypressTimeoutId = window.setTimeout(\n      this.resetKeypressTimer.bind(this),\n      this.timeoutTime\n    )\n  }\n\n  /**\n   * Stops and resets the 'quick escape' keyboard sequence timer.\n   *\n   * @private\n   */\n  resetKeypressTimer() {\n    if (!this.$updateSpan) {\n      return\n    }\n\n    if (this.keypressTimeoutId) {\n      window.clearTimeout(this.keypressTimeoutId)\n      this.keypressTimeoutId = null\n    }\n\n    const $updateSpan = this.$updateSpan\n\n    this.keypressCounter = 0\n    $updateSpan.textContent = this.i18n.t('timedOut')\n\n    this.timeoutMessageId = window.setTimeout(() => {\n      $updateSpan.textContent = ''\n    }, this.timeoutTime)\n\n    this.updateIndicator()\n  }\n\n  /**\n   * Reset the page using the EtP button\n   *\n   * We use this in situations where a user may re-enter a page using the browser\n   * back button. In these cases, the browser can choose to restore the state of\n   * the page as it was previously, including restoring the 'ghost page' overlay,\n   * the announcement span having it's role set to \"alert\" and the keypress\n   * indicator still active, leaving the page in an unusable state.\n   *\n   * By running this check when the page is shown, we can programatically restore\n   * the page and the component to a \"default\" state\n   *\n   * @private\n   */\n  resetPage() {\n    // If an overlay is set, remove it and reset the value\n    document.body.classList.remove('govuk-exit-this-page-hide-content')\n\n    if (this.$overlay) {\n      this.$overlay.remove()\n      this.$overlay = null\n    }\n\n    // Ensure the announcement span's role is status, not alert and clear any text\n    if (this.$updateSpan) {\n      this.$updateSpan.setAttribute('role', 'status')\n      this.$updateSpan.textContent = ''\n    }\n\n    // Sync the keypress indicator lights\n    this.updateIndicator()\n\n    // If the timeouts are active, clear them\n    if (this.keypressTimeoutId) {\n      window.clearTimeout(this.keypressTimeoutId)\n    }\n\n    if (this.timeoutMessageId) {\n      window.clearTimeout(this.timeoutMessageId)\n    }\n  }\n\n  /**\n   * Name for the component used when initialising using data-module attributes.\n   */\n  static moduleName = 'govuk-exit-this-page'\n\n  /**\n   * Exit this page default config\n   *\n   * @see {@link ExitThisPageConfig}\n   * @constant\n   * @type {ExitThisPageConfig}\n   */\n  static defaults = Object.freeze({\n    i18n: {\n      activated: 'Loading.',\n      timedOut: 'Exit this page expired.',\n      pressTwoMoreTimes: 'Shift, press 2 more times to exit.',\n      pressOneMoreTime: 'Shift, press 1 more time to exit.'\n    }\n  })\n\n  /**\n   * Exit this page config schema\n   *\n   * @constant\n   * @satisfies {Schema}\n   */\n  static schema = Object.freeze({\n    properties: {\n      i18n: { type: 'object' }\n    }\n  })\n}\n\n/**\n * Exit this Page config\n *\n * @see {@link ExitThisPage.defaults}\n * @typedef {object} ExitThisPageConfig\n * @property {ExitThisPageTranslations} [i18n=ExitThisPage.defaults.i18n] - Exit this page translations\n */\n\n/**\n * Exit this Page translations\n *\n * @see {@link ExitThisPage.defaults.i18n}\n * @typedef {object} ExitThisPageTranslations\n *\n * Messages used by the component programatically inserted text, including\n * overlay text and screen reader announcements.\n * @property {string} [activated] - Screen reader announcement for when EtP\n *   keypress functionality has been successfully activated.\n * @property {string} [timedOut] - Screen reader announcement for when the EtP\n *   keypress functionality has timed out.\n * @property {string} [pressTwoMoreTimes] - Screen reader announcement informing\n *   the user they must press the activation key two more times.\n * @property {string} [pressOneMoreTime] - Screen reader announcement informing\n *   the user they must press the activation key one more time.\n */\n\n/**\n * @typedef {import('../../common/configuration.mjs').Schema} Schema\n */\n","import { getBreakpoint } from '../../common/index.mjs'\nimport { ElementError } from '../../errors/index.mjs'\nimport { GOVUKFrontendComponent } from '../../govuk-frontend-component.mjs'\n\n/**\n * Header component\n *\n * @preserve\n */\nexport class Header extends GOVUKFrontendComponent {\n  /** @private */\n  $menuButton\n\n  /** @private */\n  $menu\n\n  /**\n   * Save the opened/closed state for the nav in memory so that we can\n   * accurately maintain state when the screen is changed from small to big and\n   * back to small\n   *\n   * @private\n   */\n  menuIsOpen = false\n\n  /**\n   * A global const for storing a matchMedia instance which we'll use to detect\n   * when a screen size change happens. We rely on it being null if the feature\n   * isn't available to initially apply hidden attributes\n   *\n   * @private\n   * @type {MediaQueryList | null}\n   */\n  mql = null\n\n  /**\n   * Apply a matchMedia for desktop which will trigger a state sync if the\n   * browser viewport moves between states.\n   *\n   * @param {Element | null} $root - HTML element to use for header\n   */\n  constructor($root) {\n    super($root)\n\n    const $menuButton = this.$root.querySelector('.govuk-js-header-toggle')\n\n    // Headers don't necessarily have a navigation. When they don't, the menu\n    // toggle won't be rendered by our macro (or may be omitted when writing\n    // plain HTML)\n    if (!$menuButton) {\n      return this\n    }\n\n    const menuId = $menuButton.getAttribute('aria-controls')\n    if (!menuId) {\n      throw new ElementError({\n        component: Header,\n        identifier:\n          'Navigation button (`<button class=\"govuk-js-header-toggle\">`) attribute (`aria-controls`)'\n      })\n    }\n\n    const $menu = document.getElementById(menuId)\n    if (!$menu) {\n      throw new ElementError({\n        component: Header,\n        element: $menu,\n        identifier: `Navigation (\\`<ul id=\"${menuId}\">\\`)`\n      })\n    }\n\n    this.$menu = $menu\n    this.$menuButton = $menuButton\n\n    this.setupResponsiveChecks()\n\n    this.$menuButton.addEventListener('click', () =>\n      this.handleMenuButtonClick()\n    )\n  }\n\n  /**\n   * Setup viewport resize check\n   *\n   * @private\n   */\n  setupResponsiveChecks() {\n    const breakpoint = getBreakpoint('desktop')\n\n    if (!breakpoint.value) {\n      throw new ElementError({\n        component: Header,\n        identifier: `CSS custom property (\\`${breakpoint.property}\\`) on pseudo-class \\`:root\\``\n      })\n    }\n\n    // Media query list for GOV.UK Frontend desktop breakpoint\n    this.mql = window.matchMedia(`(min-width: ${breakpoint.value})`)\n\n    // MediaQueryList.addEventListener isn't supported by Safari < 14 so we need\n    // to be able to fall back to the deprecated MediaQueryList.addListener\n    if ('addEventListener' in this.mql) {\n      this.mql.addEventListener('change', () => this.checkMode())\n    } else {\n      // @ts-expect-error Property 'addListener' does not exist\n      // eslint-disable-next-line @typescript-eslint/no-unsafe-call\n      this.mql.addListener(() => this.checkMode())\n    }\n\n    this.checkMode()\n  }\n\n  /**\n   * Sync menu state\n   *\n   * Uses the global variable menuIsOpen to correctly set the accessible and\n   * visual states of the menu and the menu button.\n   * Additionally will force the menu to be visible and the menu button to be\n   * hidden if the matchMedia is triggered to desktop.\n   *\n   * @private\n   */\n  checkMode() {\n    if (!this.mql || !this.$menu || !this.$menuButton) {\n      return\n    }\n\n    if (this.mql.matches) {\n      this.$menu.removeAttribute('hidden')\n      this.$menuButton.setAttribute('hidden', '')\n    } else {\n      this.$menuButton.removeAttribute('hidden')\n      this.$menuButton.setAttribute('aria-expanded', this.menuIsOpen.toString())\n\n      if (this.menuIsOpen) {\n        this.$menu.removeAttribute('hidden')\n      } else {\n        this.$menu.setAttribute('hidden', '')\n      }\n    }\n  }\n\n  /**\n   * Handle menu button click\n   *\n   * When the menu button is clicked, change the visibility of the menu and then\n   * sync the accessibility state and menu button state\n   *\n   * @private\n   */\n  handleMenuButtonClick() {\n    this.menuIsOpen = !this.menuIsOpen\n    this.checkMode()\n  }\n\n  /**\n   * Name for the component used when initialising using data-module attributes.\n   */\n  static moduleName = 'govuk-header'\n}\n","import { ConfigurableComponent } from '../../common/configuration.mjs'\nimport { setFocus } from '../../common/index.mjs'\n\n/**\n * Notification Banner component\n *\n * @preserve\n * @augments ConfigurableComponent<NotificationBannerConfig>\n */\nexport class NotificationBanner extends ConfigurableComponent {\n  /**\n   * @param {Element | null} $root - HTML element to use for notification banner\n   * @param {NotificationBannerConfig} [config] - Notification banner config\n   */\n  constructor($root, config = {}) {\n    super($root, config)\n\n    /**\n     * Focus the notification banner\n     *\n     * If `role=\"alert\"` is set, focus the element to help some assistive\n     * technologies prioritise announcing it.\n     *\n     * You can turn off the auto-focus functionality by setting\n     * `data-disable-auto-focus=\"true\"` in the component HTML. You might wish to\n     * do this based on user research findings, or to avoid a clash with another\n     * element which should be focused when the page loads.\n     */\n    if (\n      this.$root.getAttribute('role') === 'alert' &&\n      !this.config.disableAutoFocus\n    ) {\n      setFocus(this.$root)\n    }\n  }\n\n  /**\n   * Name for the component used when initialising using data-module attributes.\n   */\n  static moduleName = 'govuk-notification-banner'\n\n  /**\n   * Notification banner default config\n   *\n   * @see {@link NotificationBannerConfig}\n   * @constant\n   * @type {NotificationBannerConfig}\n   */\n  static defaults = Object.freeze({\n    disableAutoFocus: false\n  })\n\n  /**\n   * Notification banner config schema\n   *\n   * @constant\n   * @satisfies {Schema}\n   */\n  static schema = Object.freeze({\n    properties: {\n      disableAutoFocus: { type: 'boolean' }\n    }\n  })\n}\n\n/**\n * Notification banner config\n *\n * @typedef {object} NotificationBannerConfig\n * @property {boolean} [disableAutoFocus=false] - If set to `true` the\n *   notification banner will not be focussed when the page loads. This only\n *   applies if the component has a `role` of `alert` – in other cases the\n *   component will not be focused on page load, regardless of this option.\n */\n\n/**\n * @typedef {import('../../common/configuration.mjs').Schema} Schema\n */\n","import { closestAttributeValue } from '../../common/closest-attribute-value.mjs'\nimport { ConfigurableComponent } from '../../common/configuration.mjs'\nimport { ElementError } from '../../errors/index.mjs'\nimport { I18n } from '../../i18n.mjs'\n\n/**\n * Password input component\n *\n * @preserve\n * @augments ConfigurableComponent<PasswordInputConfig>\n */\nexport class PasswordInput extends ConfigurableComponent {\n  /** @private */\n  i18n\n\n  /**\n   * @private\n   * @type {HTMLInputElement}\n   */\n  $input\n\n  /**\n   * @private\n   * @type {HTMLButtonElement}\n   */\n  $showHideButton\n\n  /** @private */\n  $screenReaderStatusMessage\n\n  /**\n   * @param {Element | null} $root - HTML element to use for password input\n   * @param {PasswordInputConfig} [config] - Password input config\n   */\n  constructor($root, config = {}) {\n    super($root, config)\n\n    const $input = this.$root.querySelector('.govuk-js-password-input-input')\n    if (!($input instanceof HTMLInputElement)) {\n      throw new ElementError({\n        component: PasswordInput,\n        element: $input,\n        expectedType: 'HTMLInputElement',\n        identifier: 'Form field (`.govuk-js-password-input-input`)'\n      })\n    }\n\n    if ($input.type !== 'password') {\n      throw new ElementError(\n        'Password input: Form field (`.govuk-js-password-input-input`) must be of type `password`.'\n      )\n    }\n\n    const $showHideButton = this.$root.querySelector(\n      '.govuk-js-password-input-toggle'\n    )\n    if (!($showHideButton instanceof HTMLButtonElement)) {\n      throw new ElementError({\n        component: PasswordInput,\n        element: $showHideButton,\n        expectedType: 'HTMLButtonElement',\n        identifier: 'Button (`.govuk-js-password-input-toggle`)'\n      })\n    }\n\n    if ($showHideButton.type !== 'button') {\n      throw new ElementError(\n        'Password input: Button (`.govuk-js-password-input-toggle`) must be of type `button`.'\n      )\n    }\n\n    this.$input = $input\n    this.$showHideButton = $showHideButton\n\n    this.i18n = new I18n(this.config.i18n, {\n      // Read the fallback if necessary rather than have it set in the defaults\n      locale: closestAttributeValue(this.$root, 'lang')\n    })\n\n    // Show the toggle button element\n    this.$showHideButton.removeAttribute('hidden')\n\n    // Create and append the status text for screen readers.\n    // This is injected between the input and button so that users get a sensible reading order if\n    // moving through the page content linearly:\n    // [password input] -> [your password is visible/hidden] -> [show/hide password]\n    const $screenReaderStatusMessage = document.createElement('div')\n    $screenReaderStatusMessage.className =\n      'govuk-password-input__sr-status govuk-visually-hidden'\n    $screenReaderStatusMessage.setAttribute('aria-live', 'polite')\n    this.$screenReaderStatusMessage = $screenReaderStatusMessage\n    this.$input.insertAdjacentElement('afterend', $screenReaderStatusMessage)\n\n    // Bind toggle button\n    this.$showHideButton.addEventListener('click', this.toggle.bind(this))\n\n    // Bind event to revert the password visibility to hidden\n    if (this.$input.form) {\n      this.$input.form.addEventListener('submit', () => this.hide())\n    }\n\n    // If the page is restored from bfcache and the password is visible, hide it again\n    window.addEventListener('pageshow', (event) => {\n      if (event.persisted && this.$input.type !== 'password') {\n        this.hide()\n      }\n    })\n\n    // Default the component to having the password hidden.\n    this.hide()\n  }\n\n  /**\n   * Toggle the visibility of the password input\n   *\n   * @private\n   * @param {MouseEvent} event - Click event\n   */\n  toggle(event) {\n    event.preventDefault()\n\n    // If on this click, the field is type=\"password\", show the value\n    if (this.$input.type === 'password') {\n      this.show()\n      return\n    }\n\n    // Otherwise, hide it\n    // Being defensive - hiding should always be the default\n    this.hide()\n  }\n\n  /**\n   * Show the password input value in plain text.\n   *\n   * @private\n   */\n  show() {\n    this.setType('text')\n  }\n\n  /**\n   * Hide the password input value.\n   *\n   * @private\n   */\n  hide() {\n    this.setType('password')\n  }\n\n  /**\n   * Set the password input type\n   *\n   * @param {'text' | 'password'} type - Input type\n   * @private\n   */\n  setType(type) {\n    if (type === this.$input.type) {\n      return\n    }\n\n    // Update input type\n    this.$input.setAttribute('type', type)\n\n    const isHidden = type === 'password'\n    const prefixButton = isHidden ? 'show' : 'hide'\n    const prefixStatus = isHidden ? 'passwordHidden' : 'passwordShown'\n\n    // Update button text\n    this.$showHideButton.innerText = this.i18n.t(`${prefixButton}Password`)\n\n    // Update button aria-label\n    this.$showHideButton.setAttribute(\n      'aria-label',\n      this.i18n.t(`${prefixButton}PasswordAriaLabel`)\n    )\n\n    // Update status change text\n    this.$screenReaderStatusMessage.innerText = this.i18n.t(\n      `${prefixStatus}Announcement`\n    )\n  }\n\n  /**\n   * Name for the component used when initialising using data-module attributes.\n   */\n  static moduleName = 'govuk-password-input'\n\n  /**\n   * Password input default config\n   *\n   * @see {@link PasswordInputConfig}\n   * @constant\n   * @default\n   * @type {PasswordInputConfig}\n   */\n  static defaults = Object.freeze({\n    i18n: {\n      showPassword: 'Show',\n      hidePassword: 'Hide',\n      showPasswordAriaLabel: 'Show password',\n      hidePasswordAriaLabel: 'Hide password',\n      passwordShownAnnouncement: 'Your password is visible',\n      passwordHiddenAnnouncement: 'Your password is hidden'\n    }\n  })\n\n  /**\n   * Password input config schema\n   *\n   * @constant\n   * @satisfies {Schema}\n   */\n  static schema = Object.freeze({\n    properties: {\n      i18n: { type: 'object' }\n    }\n  })\n}\n\n/**\n * Password input config\n *\n * @typedef {object} PasswordInputConfig\n * @property {PasswordInputTranslations} [i18n=PasswordInput.defaults.i18n] - Password input translations\n */\n\n/**\n * Password input translations\n *\n * @see {@link PasswordInput.defaults.i18n}\n * @typedef {object} PasswordInputTranslations\n *\n * Messages displayed to the user indicating the state of the show/hide toggle.\n * @property {string} [showPassword] - Visible text of the button when the\n *   password is currently hidden. Plain text only.\n * @property {string} [hidePassword] - Visible text of the button when the\n *   password is currently visible. Plain text only.\n * @property {string} [showPasswordAriaLabel] - aria-label of the button when\n *   the password is currently hidden. Plain text only.\n * @property {string} [hidePasswordAriaLabel] - aria-label of the button when\n *   the password is currently visible. Plain text only.\n * @property {string} [passwordShownAnnouncement] - Screen reader\n *   announcement to make when the password has just become visible.\n *   Plain text only.\n * @property {string} [passwordHiddenAnnouncement] - Screen reader\n *   announcement to make when the password has just been hidden.\n *   Plain text only.\n */\n\n/**\n * @typedef {import('../../common/configuration.mjs').Schema} Schema\n * @typedef {import('../../i18n.mjs').TranslationPluralForms} TranslationPluralForms\n */\n","import { ElementError } from '../../errors/index.mjs'\nimport { GOVUKFrontendComponent } from '../../govuk-frontend-component.mjs'\n\n/**\n * Radios component\n *\n * @preserve\n */\nexport class Radios extends GOVUKFrontendComponent {\n  /** @private */\n  $inputs\n\n  /**\n   * Radios can be associated with a 'conditionally revealed' content block –\n   * for example, a radio for 'Phone' could reveal an additional form field for\n   * the user to enter their phone number.\n   *\n   * These associations are made using a `data-aria-controls` attribute, which\n   * is promoted to an aria-controls attribute during initialisation.\n   *\n   * We also need to restore the state of any conditional reveals on the page\n   * (for example if the user has navigated back), and set up event handlers to\n   * keep the reveal in sync with the radio state.\n   *\n   * @param {Element | null} $root - HTML element to use for radios\n   */\n  constructor($root) {\n    super($root)\n\n    const $inputs = this.$root.querySelectorAll('input[type=\"radio\"]')\n    if (!$inputs.length) {\n      throw new ElementError({\n        component: Radios,\n        identifier: 'Form inputs (`<input type=\"radio\">`)'\n      })\n    }\n\n    this.$inputs = $inputs\n\n    this.$inputs.forEach(($input) => {\n      const targetId = $input.getAttribute('data-aria-controls')\n\n      // Skip radios without data-aria-controls attributes\n      if (!targetId) {\n        return\n      }\n\n      // Throw if target conditional element does not exist.\n      if (!document.getElementById(targetId)) {\n        throw new ElementError({\n          component: Radios,\n          identifier: `Conditional reveal (\\`id=\"${targetId}\"\\`)`\n        })\n      }\n\n      // Promote the data-aria-controls attribute to a aria-controls attribute\n      // so that the relationship is exposed in the AOM\n      $input.setAttribute('aria-controls', targetId)\n      $input.removeAttribute('data-aria-controls')\n    })\n\n    // When the page is restored after navigating 'back' in some browsers the\n    // state of form controls is not restored until *after* the DOMContentLoaded\n    // event is fired, so we need to sync after the pageshow event.\n    window.addEventListener('pageshow', () => this.syncAllConditionalReveals())\n\n    // Although we've set up handlers to sync state on the pageshow event, init\n    // could be called after those events have fired, for example if they are\n    // added to the page dynamically, so sync now too.\n    this.syncAllConditionalReveals()\n\n    // Handle events\n    this.$root.addEventListener('click', (event) => this.handleClick(event))\n  }\n\n  /**\n   * Sync the conditional reveal states for all radio buttons in this component.\n   *\n   * @private\n   */\n  syncAllConditionalReveals() {\n    this.$inputs.forEach(($input) =>\n      this.syncConditionalRevealWithInputState($input)\n    )\n  }\n\n  /**\n   * Sync conditional reveal with the input state\n   *\n   * Synchronise the visibility of the conditional reveal, and its accessible\n   * state, with the input's checked state.\n   *\n   * @private\n   * @param {HTMLInputElement} $input - Radio input\n   */\n  syncConditionalRevealWithInputState($input) {\n    const targetId = $input.getAttribute('aria-controls')\n    if (!targetId) {\n      return\n    }\n\n    const $target = document.getElementById(targetId)\n    if ($target?.classList.contains('govuk-radios__conditional')) {\n      const inputIsChecked = $input.checked\n\n      $input.setAttribute('aria-expanded', inputIsChecked.toString())\n      $target.classList.toggle(\n        'govuk-radios__conditional--hidden',\n        !inputIsChecked\n      )\n    }\n  }\n\n  /**\n   * Click event handler\n   *\n   * Handle a click within the component root – if the click occurred on a radio, sync\n   * the state of the conditional reveal for all radio buttons in the same form\n   * with the same name (because checking one radio could have un-checked a\n   * radio under the root of another Radio component)\n   *\n   * @private\n   * @param {MouseEvent} event - Click event\n   */\n  handleClick(event) {\n    const $clickedInput = event.target\n\n    // Ignore clicks on things that aren't radio buttons\n    if (\n      !($clickedInput instanceof HTMLInputElement) ||\n      $clickedInput.type !== 'radio'\n    ) {\n      return\n    }\n\n    // We only need to consider radios with conditional reveals, which will have\n    // aria-controls attributes.\n    const $allInputs = document.querySelectorAll(\n      'input[type=\"radio\"][aria-controls]'\n    )\n\n    const $clickedInputForm = $clickedInput.form\n    const $clickedInputName = $clickedInput.name\n\n    $allInputs.forEach(($input) => {\n      const hasSameFormOwner = $input.form === $clickedInputForm\n      const hasSameName = $input.name === $clickedInputName\n\n      if (hasSameName && hasSameFormOwner) {\n        this.syncConditionalRevealWithInputState($input)\n      }\n    })\n  }\n\n  /**\n   * Name for the component used when initialising using data-module attributes.\n   */\n  static moduleName = 'govuk-radios'\n}\n","import { getBreakpoint } from '../../common/index.mjs'\nimport { ElementError } from '../../errors/index.mjs'\nimport { GOVUKFrontendComponent } from '../../govuk-frontend-component.mjs'\n\n/**\n * Service Navigation component\n *\n * @preserve\n */\nexport class ServiceNavigation extends GOVUKFrontendComponent {\n  /** @private */\n  $menuButton\n\n  /** @private */\n  $menu\n\n  /**\n   * Remember the open/closed state of the nav so we can maintain it when the\n   * screen is resized.\n   *\n   * @private\n   */\n  menuIsOpen = false\n\n  /**\n   * A global const for storing a matchMedia instance which we'll use to detect\n   * when a screen size change happens. We rely on it being null if the feature\n   * isn't available to initially apply hidden attributes\n   *\n   * @private\n   * @type {MediaQueryList | null}\n   */\n  mql = null\n\n  /**\n   * @param {Element | null} $root - HTML element to use for header\n   */\n  constructor($root) {\n    super($root)\n\n    const $menuButton = this.$root.querySelector(\n      '.govuk-js-service-navigation-toggle'\n    )\n\n    // Headers don't necessarily have a navigation. When they don't, the menu\n    // toggle won't be rendered by our macro (or may be omitted when writing\n    // plain HTML)\n    if (!$menuButton) {\n      return this\n    }\n\n    const menuId = $menuButton.getAttribute('aria-controls')\n    if (!menuId) {\n      throw new ElementError({\n        component: ServiceNavigation,\n        identifier:\n          'Navigation button (`<button class=\"govuk-js-service-navigation-toggle\">`) attribute (`aria-controls`)'\n      })\n    }\n\n    const $menu = document.getElementById(menuId)\n    if (!$menu) {\n      throw new ElementError({\n        component: ServiceNavigation,\n        element: $menu,\n        identifier: `Navigation (\\`<ul id=\"${menuId}\">\\`)`\n      })\n    }\n\n    this.$menu = $menu\n    this.$menuButton = $menuButton\n\n    this.setupResponsiveChecks()\n\n    this.$menuButton.addEventListener('click', () =>\n      this.handleMenuButtonClick()\n    )\n  }\n\n  /**\n   * Setup viewport resize check\n   *\n   * @private\n   */\n  setupResponsiveChecks() {\n    const breakpoint = getBreakpoint('tablet')\n\n    if (!breakpoint.value) {\n      throw new ElementError({\n        component: ServiceNavigation,\n        identifier: `CSS custom property (\\`${breakpoint.property}\\`) on pseudo-class \\`:root\\``\n      })\n    }\n\n    // Media query list for GOV.UK Frontend desktop breakpoint\n    this.mql = window.matchMedia(`(min-width: ${breakpoint.value})`)\n\n    // MediaQueryList.addEventListener isn't supported by Safari < 14 so we need\n    // to be able to fall back to the deprecated MediaQueryList.addListener\n    if ('addEventListener' in this.mql) {\n      this.mql.addEventListener('change', () => this.checkMode())\n    } else {\n      // @ts-expect-error Property 'addListener' does not exist\n      // eslint-disable-next-line @typescript-eslint/no-unsafe-call\n      this.mql.addListener(() => this.checkMode())\n    }\n\n    this.checkMode()\n  }\n\n  /**\n   * Sync menu state\n   *\n   * Uses the global variable menuIsOpen to correctly set the accessible and\n   * visual states of the menu and the menu button.\n   * Additionally will force the menu to be visible and the menu button to be\n   * hidden if the matchMedia is triggered to desktop.\n   *\n   * @private\n   */\n  checkMode() {\n    if (!this.mql || !this.$menu || !this.$menuButton) {\n      return\n    }\n\n    if (this.mql.matches) {\n      this.$menu.removeAttribute('hidden')\n      this.$menuButton.setAttribute('hidden', '')\n    } else {\n      this.$menuButton.removeAttribute('hidden')\n      this.$menuButton.setAttribute('aria-expanded', this.menuIsOpen.toString())\n\n      if (this.menuIsOpen) {\n        this.$menu.removeAttribute('hidden')\n      } else {\n        this.$menu.setAttribute('hidden', '')\n      }\n    }\n  }\n\n  /**\n   * Handle menu button click\n   *\n   * When the menu button is clicked, change the visibility of the menu and then\n   * sync the accessibility state and menu button state\n   *\n   * @private\n   */\n  handleMenuButtonClick() {\n    this.menuIsOpen = !this.menuIsOpen\n    this.checkMode()\n  }\n\n  /**\n   * Name for the component used when initialising using data-module attributes.\n   */\n  static moduleName = 'govuk-service-navigation'\n}\n","import { getFragmentFromUrl, setFocus } from '../../common/index.mjs'\nimport { ElementError } from '../../errors/index.mjs'\nimport { GOVUKFrontendComponent } from '../../govuk-frontend-component.mjs'\n\n/**\n * Skip link component\n *\n * @preserve\n * @augments GOVUKFrontendComponent<HTMLAnchorElement>\n */\nexport class SkipLink extends GOVUKFrontendComponent {\n  static elementType = HTMLAnchorElement\n\n  /**\n   * @param {Element | null} $root - HTML element to use for skip link\n   * @throws {ElementError} when $root is not set or the wrong type\n   * @throws {ElementError} when $root.hash does not contain a hash\n   * @throws {ElementError} when the linked element is missing or the wrong type\n   */\n  constructor($root) {\n    super($root)\n\n    const hash = this.$root.hash\n    const href = this.$root.getAttribute('href') ?? ''\n\n    /** @type {URL | undefined} */\n    let url\n\n    /**\n     * Check for valid link URL\n     *\n     * {@link https://caniuse.com/url}\n     * {@link https://url.spec.whatwg.org}\n     *\n     */\n    try {\n      url = new window.URL(this.$root.href)\n    } catch (error) {\n      throw new ElementError(\n        `Skip link: Target link (\\`href=\"${href}\"\\`) is invalid`\n      )\n    }\n\n    // Return early for external URLs or links to other pages\n    if (\n      url.origin !== window.location.origin ||\n      url.pathname !== window.location.pathname\n    ) {\n      return\n    }\n\n    const linkedElementId = getFragmentFromUrl(hash)\n\n    // Check link path matching current page\n    if (!linkedElementId) {\n      throw new ElementError(\n        `Skip link: Target link (\\`href=\"${href}\"\\`) has no hash fragment`\n      )\n    }\n\n    const $linkedElement = document.getElementById(linkedElementId)\n\n    // Check for link target element\n    if (!$linkedElement) {\n      throw new ElementError({\n        component: SkipLink,\n        element: $linkedElement,\n        identifier: `Target content (\\`id=\"${linkedElementId}\"\\`)`\n      })\n    }\n\n    /**\n     * Focus the linked element on click\n     *\n     * Adds a helper CSS class to hide native focus styles,\n     * but removes it on blur to restore native focus styles\n     */\n    this.$root.addEventListener('click', () =>\n      setFocus($linkedElement, {\n        onBeforeFocus() {\n          $linkedElement.classList.add('govuk-skip-link-focused-element')\n        },\n        onBlur() {\n          $linkedElement.classList.remove('govuk-skip-link-focused-element')\n        }\n      })\n    )\n  }\n\n  /**\n   * Name for the component used when initialising using data-module attributes.\n   */\n  static moduleName = 'govuk-skip-link'\n}\n","import { getBreakpoint, getFragmentFromUrl } from '../../common/index.mjs'\nimport { ElementError } from '../../errors/index.mjs'\nimport { GOVUKFrontendComponent } from '../../govuk-frontend-component.mjs'\n\n/**\n * Tabs component\n *\n * @preserve\n */\nexport class Tabs extends GOVUKFrontendComponent {\n  /** @private */\n  $tabs\n\n  /** @private */\n  $tabList\n\n  /** @private */\n  $tabListItems\n\n  /** @private */\n  jsHiddenClass = 'govuk-tabs__panel--hidden'\n\n  /** @private */\n  changingHash = false\n\n  /** @private */\n  boundTabClick\n\n  /** @private */\n  boundTabKeydown\n\n  /** @private */\n  boundOnHashChange\n\n  /**\n   * @private\n   * @type {MediaQueryList | null}\n   */\n  mql = null\n\n  /**\n   * @param {Element | null} $root - HTML element to use for tabs\n   */\n  constructor($root) {\n    super($root)\n\n    const $tabs = this.$root.querySelectorAll('a.govuk-tabs__tab')\n    if (!$tabs.length) {\n      throw new ElementError({\n        component: Tabs,\n        identifier: 'Links (`<a class=\"govuk-tabs__tab\">`)'\n      })\n    }\n\n    this.$tabs = $tabs\n\n    // Save bound functions so we can remove event listeners during teardown\n    this.boundTabClick = this.onTabClick.bind(this)\n    this.boundTabKeydown = this.onTabKeydown.bind(this)\n    this.boundOnHashChange = this.onHashChange.bind(this)\n\n    const $tabList = this.$root.querySelector('.govuk-tabs__list')\n    const $tabListItems = this.$root.querySelectorAll(\n      'li.govuk-tabs__list-item'\n    )\n\n    if (!$tabList) {\n      throw new ElementError({\n        component: Tabs,\n        identifier: 'List (`<ul class=\"govuk-tabs__list\">`)'\n      })\n    }\n\n    if (!$tabListItems.length) {\n      throw new ElementError({\n        component: Tabs,\n        identifier: 'List items (`<li class=\"govuk-tabs__list-item\">`)'\n      })\n    }\n\n    this.$tabList = $tabList\n    this.$tabListItems = $tabListItems\n\n    this.setupResponsiveChecks()\n  }\n\n  /**\n   * Setup viewport resize check\n   *\n   * @private\n   */\n  setupResponsiveChecks() {\n    const breakpoint = getBreakpoint('tablet')\n\n    if (!breakpoint.value) {\n      throw new ElementError({\n        component: Tabs,\n        identifier: `CSS custom property (\\`${breakpoint.property}\\`) on pseudo-class \\`:root\\``\n      })\n    }\n\n    // Media query list for GOV.UK Frontend tablet breakpoint\n    this.mql = window.matchMedia(`(min-width: ${breakpoint.value})`)\n\n    // MediaQueryList.addEventListener isn't supported by Safari < 14 so we need\n    // to be able to fall back to the deprecated MediaQueryList.addListener\n    if ('addEventListener' in this.mql) {\n      this.mql.addEventListener('change', () => this.checkMode())\n    } else {\n      // @ts-expect-error Property 'addListener' does not exist\n      // eslint-disable-next-line @typescript-eslint/no-unsafe-call\n      this.mql.addListener(() => this.checkMode())\n    }\n\n    this.checkMode()\n  }\n\n  /**\n   * Setup or teardown handler for viewport resize check\n   *\n   * @private\n   */\n  checkMode() {\n    if (this.mql?.matches) {\n      this.setup()\n    } else {\n      this.teardown()\n    }\n  }\n\n  /**\n   * Setup tab component\n   *\n   * @private\n   */\n  setup() {\n    this.$tabList.setAttribute('role', 'tablist')\n\n    this.$tabListItems.forEach(($item) => {\n      $item.setAttribute('role', 'presentation')\n    })\n\n    this.$tabs.forEach(($tab) => {\n      // Set HTML attributes\n      this.setAttributes($tab)\n\n      // Handle events\n      $tab.addEventListener('click', this.boundTabClick, true)\n      $tab.addEventListener('keydown', this.boundTabKeydown, true)\n\n      // Remove old active panels\n      this.hideTab($tab)\n    })\n\n    // Show either the active tab according to the URL's hash or the first tab\n    const $activeTab = this.getTab(window.location.hash) ?? this.$tabs[0]\n\n    this.showTab($activeTab)\n\n    // Handle hashchange events\n    window.addEventListener('hashchange', this.boundOnHashChange, true)\n  }\n\n  /**\n   * Teardown tab component\n   *\n   * @private\n   */\n  teardown() {\n    this.$tabList.removeAttribute('role')\n\n    this.$tabListItems.forEach(($item) => {\n      $item.removeAttribute('role')\n    })\n\n    this.$tabs.forEach(($tab) => {\n      // Remove events\n      $tab.removeEventListener('click', this.boundTabClick, true)\n      $tab.removeEventListener('keydown', this.boundTabKeydown, true)\n\n      // Unset HTML attributes\n      this.unsetAttributes($tab)\n    })\n\n    // Remove hashchange event handler\n    window.removeEventListener('hashchange', this.boundOnHashChange, true)\n  }\n\n  /**\n   * Handle hashchange event\n   *\n   * @private\n   * @returns {void | undefined} Returns void, or undefined when prevented\n   */\n  onHashChange() {\n    const hash = window.location.hash\n    const $tabWithHash = this.getTab(hash)\n    if (!$tabWithHash) {\n      return\n    }\n\n    // Prevent changing the hash\n    if (this.changingHash) {\n      this.changingHash = false\n      return\n    }\n\n    // Show either the active tab according to the URL's hash or the first tab\n    const $previousTab = this.getCurrentTab()\n    if (!$previousTab) {\n      return\n    }\n\n    this.hideTab($previousTab)\n    this.showTab($tabWithHash)\n    $tabWithHash.focus()\n  }\n\n  /**\n   * Hide panel for tab link\n   *\n   * @private\n   * @param {HTMLAnchorElement} $tab - Tab link\n   */\n  hideTab($tab) {\n    this.unhighlightTab($tab)\n    this.hidePanel($tab)\n  }\n\n  /**\n   * Show panel for tab link\n   *\n   * @private\n   * @param {HTMLAnchorElement} $tab - Tab link\n   */\n  showTab($tab) {\n    this.highlightTab($tab)\n    this.showPanel($tab)\n  }\n\n  /**\n   * Get tab link by hash\n   *\n   * @private\n   * @param {string} hash - Hash fragment including #\n   * @returns {HTMLAnchorElement | null} Tab link\n   */\n  getTab(hash) {\n    return this.$root.querySelector(`a.govuk-tabs__tab[href=\"${hash}\"]`)\n  }\n\n  /**\n   * Set tab link and panel attributes\n   *\n   * @private\n   * @param {HTMLAnchorElement} $tab - Tab link\n   */\n  setAttributes($tab) {\n    const panelId = getFragmentFromUrl($tab.href)\n    if (!panelId) {\n      return\n    }\n\n    // Set tab attributes\n    $tab.setAttribute('id', `tab_${panelId}`)\n    $tab.setAttribute('role', 'tab')\n    $tab.setAttribute('aria-controls', panelId)\n    $tab.setAttribute('aria-selected', 'false')\n    $tab.setAttribute('tabindex', '-1')\n\n    // Set panel attributes\n    const $panel = this.getPanel($tab)\n    if (!$panel) {\n      return\n    }\n\n    $panel.setAttribute('role', 'tabpanel')\n    $panel.setAttribute('aria-labelledby', $tab.id)\n    $panel.classList.add(this.jsHiddenClass)\n  }\n\n  /**\n   * Unset tab link and panel attributes\n   *\n   * @private\n   * @param {HTMLAnchorElement} $tab - Tab link\n   */\n  unsetAttributes($tab) {\n    // unset tab attributes\n    $tab.removeAttribute('id')\n    $tab.removeAttribute('role')\n    $tab.removeAttribute('aria-controls')\n    $tab.removeAttribute('aria-selected')\n    $tab.removeAttribute('tabindex')\n\n    // unset panel attributes\n    const $panel = this.getPanel($tab)\n    if (!$panel) {\n      return\n    }\n\n    $panel.removeAttribute('role')\n    $panel.removeAttribute('aria-labelledby')\n    $panel.classList.remove(this.jsHiddenClass)\n  }\n\n  /**\n   * Handle tab link clicks\n   *\n   * @private\n   * @param {MouseEvent} event - Mouse click event\n   * @returns {void} Returns void\n   */\n  onTabClick(event) {\n    const $currentTab = this.getCurrentTab()\n    const $nextTab = event.currentTarget\n\n    if (!$currentTab || !($nextTab instanceof HTMLAnchorElement)) {\n      return\n    }\n\n    event.preventDefault()\n\n    this.hideTab($currentTab)\n    this.showTab($nextTab)\n    this.createHistoryEntry($nextTab)\n  }\n\n  /**\n   * Update browser URL hash fragment for tab\n   *\n   * - Allows back/forward to navigate tabs\n   * - Avoids page jump when hash changes\n   *\n   * @private\n   * @param {HTMLAnchorElement} $tab - Tab link\n   */\n  createHistoryEntry($tab) {\n    const $panel = this.getPanel($tab)\n    if (!$panel) {\n      return\n    }\n\n    // Save and restore the id so the page doesn't jump when a user clicks a tab\n    // (which changes the hash)\n    const panelId = $panel.id\n    $panel.id = ''\n    this.changingHash = true\n    window.location.hash = panelId\n    $panel.id = panelId\n  }\n\n  /**\n   * Handle tab keydown event\n   *\n   * - Press right arrow for next tab\n   * - Press left arrow for previous tab\n   *\n   * @private\n   * @param {KeyboardEvent} event - Keydown event\n   */\n  onTabKeydown(event) {\n    switch (event.key) {\n      // 'Left' and 'Right' required for Edge 16 support.\n      case 'ArrowLeft':\n      case 'Left':\n        this.activatePreviousTab()\n        event.preventDefault()\n        break\n      case 'ArrowRight':\n      case 'Right':\n        this.activateNextTab()\n        event.preventDefault()\n        break\n    }\n  }\n\n  /**\n   * Activate next tab\n   *\n   * @private\n   */\n  activateNextTab() {\n    const $currentTab = this.getCurrentTab()\n    if (!$currentTab?.parentElement) {\n      return\n    }\n\n    const $nextTabListItem = $currentTab.parentElement.nextElementSibling\n    if (!$nextTabListItem) {\n      return\n    }\n\n    const $nextTab = $nextTabListItem.querySelector('a.govuk-tabs__tab')\n    if (!$nextTab) {\n      return\n    }\n\n    this.hideTab($currentTab)\n    this.showTab($nextTab)\n    $nextTab.focus()\n    this.createHistoryEntry($nextTab)\n  }\n\n  /**\n   * Activate previous tab\n   *\n   * @private\n   */\n  activatePreviousTab() {\n    const $currentTab = this.getCurrentTab()\n    if (!$currentTab?.parentElement) {\n      return\n    }\n\n    const $previousTabListItem =\n      $currentTab.parentElement.previousElementSibling\n    if (!$previousTabListItem) {\n      return\n    }\n\n    const $previousTab = $previousTabListItem.querySelector('a.govuk-tabs__tab')\n    if (!$previousTab) {\n      return\n    }\n\n    this.hideTab($currentTab)\n    this.showTab($previousTab)\n    $previousTab.focus()\n    this.createHistoryEntry($previousTab)\n  }\n\n  /**\n   * Get tab panel for tab link\n   *\n   * @private\n   * @param {HTMLAnchorElement} $tab - Tab link\n   * @returns {Element | null} Tab panel\n   */\n  getPanel($tab) {\n    const panelId = getFragmentFromUrl($tab.href)\n    if (!panelId) {\n      return null\n    }\n\n    return this.$root.querySelector(`#${panelId}`)\n  }\n\n  /**\n   * Show tab panel for tab link\n   *\n   * @private\n   * @param {HTMLAnchorElement} $tab - Tab link\n   */\n  showPanel($tab) {\n    const $panel = this.getPanel($tab)\n    if (!$panel) {\n      return\n    }\n\n    $panel.classList.remove(this.jsHiddenClass)\n  }\n\n  /**\n   * Hide tab panel for tab link\n   *\n   * @private\n   * @param {HTMLAnchorElement} $tab - Tab link\n   */\n  hidePanel($tab) {\n    const $panel = this.getPanel($tab)\n    if (!$panel) {\n      return\n    }\n\n    $panel.classList.add(this.jsHiddenClass)\n  }\n\n  /**\n   * Unset 'selected' state for tab link\n   *\n   * @private\n   * @param {HTMLAnchorElement} $tab - Tab link\n   */\n  unhighlightTab($tab) {\n    if (!$tab.parentElement) {\n      return\n    }\n\n    $tab.setAttribute('aria-selected', 'false')\n    $tab.parentElement.classList.remove('govuk-tabs__list-item--selected')\n    $tab.setAttribute('tabindex', '-1')\n  }\n\n  /**\n   * Set 'selected' state for tab link\n   *\n   * @private\n   * @param {HTMLAnchorElement} $tab - Tab link\n   */\n  highlightTab($tab) {\n    if (!$tab.parentElement) {\n      return\n    }\n\n    $tab.setAttribute('aria-selected', 'true')\n    $tab.parentElement.classList.add('govuk-tabs__list-item--selected')\n    $tab.setAttribute('tabindex', '0')\n  }\n\n  /**\n   * Get current tab link\n   *\n   * @private\n   * @returns {HTMLAnchorElement | null} Tab link\n   */\n  getCurrentTab() {\n    return this.$root.querySelector(\n      '.govuk-tabs__list-item--selected a.govuk-tabs__tab'\n    )\n  }\n\n  /**\n   * Name for the component used when initialising using data-module attributes.\n   */\n  static moduleName = 'govuk-tabs'\n}\n","import { isSupported } from './common/index.mjs'\nimport { Accordion } from './components/accordion/accordion.mjs'\nimport { Button } from './components/button/button.mjs'\nimport { CharacterCount } from './components/character-count/character-count.mjs'\nimport { Checkboxes } from './components/checkboxes/checkboxes.mjs'\nimport { ErrorSummary } from './components/error-summary/error-summary.mjs'\nimport { ExitThisPage } from './components/exit-this-page/exit-this-page.mjs'\nimport { Header } from './components/header/header.mjs'\nimport { NotificationBanner } from './components/notification-banner/notification-banner.mjs'\nimport { PasswordInput } from './components/password-input/password-input.mjs'\nimport { Radios } from './components/radios/radios.mjs'\nimport { ServiceNavigation } from './components/service-navigation/service-navigation.mjs'\nimport { SkipLink } from './components/skip-link/skip-link.mjs'\nimport { Tabs } from './components/tabs/tabs.mjs'\nimport { SupportError } from './errors/index.mjs'\n\n/**\n * Initialise all components\n *\n * Use the `data-module` attributes to find, instantiate and init all of the\n * components provided as part of GOV.UK Frontend.\n *\n * @param {Config & { scope?: Element, onError?: OnErrorCallback<CompatibleClass> }} [config] - Config for all components (with optional scope)\n */\nfunction initAll(config) {\n  config = typeof config !== 'undefined' ? config : {}\n\n  // Skip initialisation when GOV.UK Frontend is not supported\n  if (!isSupported()) {\n    if (config.onError) {\n      config.onError(new SupportError(), {\n        config\n      })\n    } else {\n      console.log(new SupportError())\n    }\n    return\n  }\n\n  const components = /** @type {const} */ ([\n    [Accordion, config.accordion],\n    [Button, config.button],\n    [CharacterCount, config.characterCount],\n    [Checkboxes],\n    [ErrorSummary, config.errorSummary],\n    [ExitThisPage, config.exitThisPage],\n    [Header],\n    [NotificationBanner, config.notificationBanner],\n    [PasswordInput, config.passwordInput],\n    [Radios],\n    [ServiceNavigation],\n    [SkipLink],\n    [Tabs]\n  ])\n\n  // Allow the user to initialise GOV.UK Frontend in only certain sections of the page\n  // Defaults to the entire document if nothing is set.\n  // const $scope = config.scope ?? document\n\n  const options = {\n    scope: config.scope ?? document,\n    onError: config.onError\n  }\n\n  components.forEach(([Component, config]) => {\n    createAll(Component, config, options)\n  })\n}\n\n/**\n * Create all instances of a specific component on the page\n *\n * Uses the `data-module` attribute to find all elements matching the specified\n * component on the page, creating instances of the component object for each\n * of them.\n *\n * Any component errors will be caught and logged to the console.\n *\n * @template {CompatibleClass} ComponentClass\n * @param {ComponentClass} Component - class of the component to create\n * @param {ComponentConfig<ComponentClass>} [config] - Config supplied to component\n * @param {OnErrorCallback<ComponentClass> | Element | Document | CreateAllOptions<ComponentClass> } [createAllOptions] - options for createAll including scope of the document to search within and callback function if error throw by component on init\n * @returns {Array<InstanceType<ComponentClass>>} - array of instantiated components\n */\nfunction createAll(Component, config, createAllOptions) {\n  let /** @type {Element | Document} */ $scope = document\n  let /** @type {OnErrorCallback<Component> | undefined} */ onError\n\n  if (typeof createAllOptions === 'object') {\n    createAllOptions = /** @type {CreateAllOptions<Component>} */ (\n      // eslint-disable-next-line no-self-assign\n      createAllOptions\n    )\n\n    $scope = createAllOptions.scope ?? $scope\n    onError = createAllOptions.onError\n  }\n\n  if (typeof createAllOptions === 'function') {\n    onError = createAllOptions\n  }\n\n  if (createAllOptions instanceof HTMLElement) {\n    $scope = createAllOptions\n  }\n\n  const $elements = $scope.querySelectorAll(\n    `[data-module=\"${Component.moduleName}\"]`\n  )\n\n  // Skip initialisation when GOV.UK Frontend is not supported\n  if (!isSupported()) {\n    if (onError) {\n      onError(new SupportError(), {\n        component: Component,\n        config\n      })\n    } else {\n      console.log(new SupportError())\n    }\n    return []\n  }\n\n  /* eslint-disable-next-line @typescript-eslint/no-unsafe-return --\n   * We can't define CompatibleClass as `{new(): CompatibleClass, moduleName: string}`,\n   * as when doing `typeof Accordion` (or any component), TypeScript doesn't seem\n   * to acknowledge the static `moduleName` that's set in our component classes.\n   * This means we have to set the constructor of `CompatibleClass` as `{new(): any}`,\n   * leading to ESLint frowning that we're returning `any[]`.\n   */\n  return Array.from($elements)\n    .map(($element) => {\n      try {\n        // Only pass config to components that accept it\n        // eslint-disable-next-line @typescript-eslint/no-unsafe-return\n        return typeof config !== 'undefined'\n          ? new Component($element, config)\n          : new Component($element)\n      } catch (error) {\n        if (onError) {\n          onError(error, {\n            element: $element,\n            component: Component,\n            config\n          })\n        } else {\n          console.log(error)\n        }\n\n        return null\n      }\n    })\n    .filter(Boolean) // Exclude components that errored\n}\n\nexport { initAll, createAll }\n\n/* eslint-disable jsdoc/valid-types --\n * `{new(...args: any[] ): object}` is not recognised as valid\n * https://github.com/gajus/eslint-plugin-jsdoc/issues/145#issuecomment-1308722878\n * https://github.com/jsdoc-type-pratt-parser/jsdoc-type-pratt-parser/issues/131\n **/\n\n/**\n * @typedef {{new (...args: any[]): any, moduleName: string}} CompatibleClass\n */\n\n/* eslint-enable jsdoc/valid-types */\n\n/**\n * Config for all components via `initAll()`\n *\n * @typedef {object} Config\n * @property {AccordionConfig} [accordion] - Accordion config\n * @property {ButtonConfig} [button] - Button config\n * @property {CharacterCountConfig} [characterCount] - Character Count config\n * @property {ErrorSummaryConfig} [errorSummary] - Error Summary config\n * @property {ExitThisPageConfig} [exitThisPage] - Exit This Page config\n * @property {NotificationBannerConfig} [notificationBanner] - Notification Banner config\n * @property {PasswordInputConfig} [passwordInput] - Password input config\n */\n\n/**\n * Config for individual components\n *\n * @typedef {import('./components/accordion/accordion.mjs').AccordionConfig} AccordionConfig\n * @typedef {import('./components/accordion/accordion.mjs').AccordionTranslations} AccordionTranslations\n * @typedef {import('./components/button/button.mjs').ButtonConfig} ButtonConfig\n * @typedef {import('./components/character-count/character-count.mjs').CharacterCountConfig} CharacterCountConfig\n * @typedef {import('./components/character-count/character-count.mjs').CharacterCountTranslations} CharacterCountTranslations\n * @typedef {import('./components/error-summary/error-summary.mjs').ErrorSummaryConfig} ErrorSummaryConfig\n * @typedef {import('./components/exit-this-page/exit-this-page.mjs').ExitThisPageConfig} ExitThisPageConfig\n * @typedef {import('./components/exit-this-page/exit-this-page.mjs').ExitThisPageTranslations} ExitThisPageTranslations\n * @typedef {import('./components/notification-banner/notification-banner.mjs').NotificationBannerConfig} NotificationBannerConfig\n * @typedef {import('./components/password-input/password-input.mjs').PasswordInputConfig} PasswordInputConfig\n */\n\n/**\n * Component config keys, e.g. `accordion` and `characterCount`\n *\n * @typedef {keyof Config} ConfigKey\n */\n\n/**\n * @template {CompatibleClass} ComponentClass\n * @typedef {ConstructorParameters<ComponentClass>[1]} ComponentConfig\n */\n\n/**\n * @template {CompatibleClass} ComponentClass\n * @typedef {object} ErrorContext\n * @property {Element} [element] - Element used for component module initialisation\n * @property {ComponentClass} [component] - Class of component\n * @property {ComponentConfig<ComponentClass>} config - Config supplied to component\n */\n\n/**\n * @template {CompatibleClass} ComponentClass\n * @callback OnErrorCallback\n * @param {unknown} error - Thrown error\n * @param {ErrorContext<ComponentClass>} context - Object containing the element, component class and configuration\n */\n\n/**\n * @template {CompatibleClass} ComponentClass\n * @typedef {object} CreateAllOptions\n * @property {Element | Document} [scope] - scope of the document to search within\n * @property {OnErrorCallback<ComponentClass>} [onError] - callback function if error throw by component on init\n */\n"],"names":["version","getFragmentFromUrl","url","includes","split","pop","getBreakpoint","name","property","value","window","getComputedStyle","document","documentElement","getPropertyValue","undefined","setFocus","$element","options","_options$onBeforeFocu","isFocusable","getAttribute","onBlur","_options$onBlur","call","removeAttribute","setAttribute","addEventListener","once","onBeforeFocus","focus","isSupported","$scope","body","classList","contains","isObject","option","Array","isArray","formatErrorMessage","Component","message","moduleName","GOVUKFrontendError","Error","constructor","args","super","this","SupportError","supportMessage","HTMLScriptElement","prototype","ConfigError","ElementError","messageOrOptions","component","identifier","element","expectedType","InitError","componentOrMessage","GOVUKFrontendComponent","$root","_$root","childConstructor","elementType","checkSupport","checkInitialised","HTMLElement","hasAttribute","isInitialised","configOverride","Symbol","for","ConfigurableComponent","param","config","_config","defaults","datasetConfig","dataset","schema","out","field","Object","entries","properties","normaliseString","type","extractConfigByNamespace","normaliseDataset","mergeConfigs","trimmedValue","trim","output","outputType","length","isFinite","Number","configObjects","formattedConfigObject","configObject","key","keys","override","namespace","newObject","current","keyParts","index","I18n","translations","_config$locale","locale","lang","t","lookupKey","translation","count","translationPluralForm","getPluralSuffix","match","replacePlaceholders","translationString","formatter","Intl","NumberFormat","supportedLocalesOf","replace","placeholderWithBraces","placeholderKey","hasOwnProperty","placeholderValue","format","hasIntlPluralRulesSupport","Boolean","PluralRules","preferredForm","select","selectPluralFormUsingFallbackRules","console","warn","Math","abs","floor","ruleset","getPluralRulesForLocale","pluralRules","localeShort","pluralRule","pluralRulesMap","languages","arabic","chinese","french","german","irish","russian","scottish","spanish","welsh","n","lastTwo","last","Accordion","i18n","controlsClass","showAllClass","showAllTextClass","sectionClass","sectionExpandedClass","sectionButtonClass","sectionHeaderClass","sectionHeadingClass","sectionHeadingDividerClass","sectionHeadingTextClass","sectionHeadingTextFocusClass","sectionShowHideToggleClass","sectionShowHideToggleFocusClass","sectionShowHideTextClass","upChevronIconClass","downChevronIconClass","sectionSummaryClass","sectionSummaryFocusClass","sectionContentClass","$sections","$showAllButton","$showAllIcon","$showAllText","querySelectorAll","initControls","initSectionHeaders","updateShowAllButton","areAllSectionsOpen","createElement","add","appendChild","$accordionControls","insertBefore","firstChild","onShowOrHideAllToggle","event","onBeforeMatch","forEach","$section","i","$header","querySelector","constructHeaderMarkup","setExpanded","isExpanded","onSectionToggle","setInitialState","$span","$heading","$summary","$button","id","attr","from","attributes","$headingText","$headingTextFocus","childNodes","$child","$showHideToggle","$showHideToggleFocus","$showHideText","$showHideIcon","getButtonPunctuationEl","$summarySpan","$summarySpanFocus","remove","removeChild","$fragment","target","Element","closest","nowExpanded","storeState","expanded","$content","newButtonText","textContent","ariaLabelParts","push","ariaLabelMessage","join","every","toString","toggle","getIdentifier","rememberExpanded","sessionStorage","setItem","exception","state","getItem","$punctuationEl","freeze","hideAllSections","hideSection","hideSectionAriaLabel","showAllSections","showSection","showSectionAriaLabel","Button","debounceFormSubmitTimer","handleKeyDown","debounce","$target","preventDefault","click","preventDoubleClick","setTimeout","DEBOUNCE_TIMEOUT_IN_SECONDS","closestAttributeValue","attributeName","$closestElementWithAttribute","CharacterCount","configOverrides","maxlength","maxwords","_ref","_this$config$maxwords","$textarea","$visibleCountMessage","$screenReaderCountMessage","lastInputTimestamp","lastInputValue","valueChecker","maxLength","HTMLTextAreaElement","HTMLInputElement","errors","validationErrors","conditions","required","errorMessage","validateConfig","Infinity","textareaDescriptionId","$textareaDescription","getElementById","insertAdjacentElement","className","bindChangeEvents","updateCountMessage","handleKeyUp","handleFocus","handleBlur","updateVisibleCountMessage","Date","now","setInterval","updateIfValueChanged","clearInterval","updateScreenReaderCountMessage","isError","isOverThreshold","getCountMessage","text","_text$match","remainingNumber","countType","formatCountMessage","translationKeySuffix","threshold","currentLength","charactersUnderLimit","one","other","charactersAtLimit","charactersOverLimit","wordsUnderLimit","wordsAtLimit","wordsOverLimit","textareaDescription","anyOf","Checkboxes","$inputs","$input","targetId","syncAllConditionalReveals","handleClick","syncConditionalRevealWithInputState","inputIsChecked","checked","unCheckAllInputsExcept","$inputWithSameName","form","unCheckExclusiveInputs","$exclusiveInput","$clickedInput","ErrorSummary","disableAutoFocus","focusTarget","HTMLAnchorElement","inputId","href","$legendOrLabel","getAssociatedLegendOrLabel","scrollIntoView","preventScroll","_document$querySelect","$fieldset","$legends","getElementsByTagName","$candidateLegend","legendTop","getBoundingClientRect","top","inputRect","height","innerHeight","ExitThisPage","$skiplinkButton","$updateSpan","$indicatorContainer","$overlay","keypressCounter","lastKeyWasModified","timeoutTime","keypressTimeoutId","timeoutMessageId","buildIndicator","initUpdateSpan","initButtonClickHandler","handleKeypress","bind","govukFrontendExitThisPageKeypress","resetPage","$indicator","updateIndicator","exitPage","location","resetKeypressTimer","clearTimeout","setKeypressTimer","shiftKey","activated","timedOut","pressTwoMoreTimes","pressOneMoreTime","Header","$menuButton","$menu","menuIsOpen","mql","menuId","setupResponsiveChecks","handleMenuButtonClick","breakpoint","matchMedia","checkMode","addListener","matches","NotificationBanner","PasswordInput","$showHideButton","$screenReaderStatusMessage","HTMLButtonElement","hide","persisted","show","setType","isHidden","prefixButton","prefixStatus","innerText","showPassword","hidePassword","showPasswordAriaLabel","hidePasswordAriaLabel","passwordShownAnnouncement","passwordHiddenAnnouncement","Radios","$allInputs","$clickedInputForm","$clickedInputName","hasSameFormOwner","ServiceNavigation","SkipLink","_this$$root$getAttrib","hash","URL","error","origin","pathname","linkedElementId","$linkedElement","Tabs","$tabs","$tabList","$tabListItems","jsHiddenClass","changingHash","boundTabClick","boundTabKeydown","boundOnHashChange","onTabClick","onTabKeydown","onHashChange","_this$mql","setup","teardown","_this$getTab","$item","$tab","setAttributes","hideTab","$activeTab","getTab","showTab","removeEventListener","unsetAttributes","$tabWithHash","$previousTab","getCurrentTab","unhighlightTab","hidePanel","highlightTab","showPanel","panelId","$panel","getPanel","$currentTab","$nextTab","currentTarget","createHistoryEntry","activatePreviousTab","activateNextTab","parentElement","$nextTabListItem","nextElementSibling","$previousTabListItem","previousElementSibling","initAll","_config$scope","onError","log","components","accordion","button","characterCount","errorSummary","exitThisPage","notificationBanner","passwordInput","scope","createAll","createAllOptions","_createAllOptions$sco","$elements","map","filter"],"mappings":"AAUO,MAAMA,QAAU,QCQhB,SAASC,mBAAmBC,GACjC,GAAKA,EAAIC,SAAS,KAIlB,OAAOD,EAAIE,MAAM,KAAKC,KACxB,CASO,SAASC,cAAcC,GAC5B,MAAMC,EAAW,+BAA+BD,IAOhD,MAAO,CACLC,WACAC,MANYC,OACXC,iBAAiBC,SAASC,iBAC1BC,iBAAiBN,SAIFO,EAEpB,CAeO,SAASC,SAASC,EAAUC,EAAU,IAAI,IAAAC,EAC/C,MAAMC,EAAcH,EAASI,aAAa,YAgB1C,SAASC,SAAS,IAAAC,EAChBA,OAAAA,EAAAL,EAAQI,SAARC,EAAgBC,KAAKP,GAEhBG,GACHH,EAASQ,gBAAgB,WAE7B,CApBKL,GACHH,EAASS,aAAa,WAAY,MAsBpCT,EAASU,iBAAiB,SAhB1B,WACEV,EAASU,iBAAiB,OAAQL,OAAQ,CAAEM,MAAM,GACpD,GAc4C,CAAEA,MAAM,IAGpDT,OAAAA,EAAAD,EAAQW,gBAARV,EAAuBK,KAAKP,GAC5BA,EAASa,OACX,CA0BO,SAASC,YAAYC,EAASpB,SAASqB,MAC5C,QAAKD,GAIEA,EAAOE,UAAUC,SAAS,2BACnC,CAoBO,SAASC,SAASC,GACvB,QAASA,GAA4B,iBAAXA,IAZ5B,SAAiBA,GACf,OAAOC,MAAMC,QAAQF,EACvB,CAUoDE,CAAQF,EAC5D,CAUO,SAASG,mBAAmBC,UAAWC,GAC5C,MAAO,GAAGD,UAAUE,eAAeD,GACrC,CCvIO,MAAME,2BAA2BC,MAAMC,WAAAA,IAAAC,GAAAC,SAAAD,GAAAE,KAC5C1C,KAAO,oBAAoB,EAMtB,MAAM2C,qBAAqBN,mBAQhCE,WAAAA,CAAYd,EAASpB,SAASqB,MAC5B,MAAMkB,EACJ,aAAcC,kBAAkBC,UAC5B,iHACA,mDAENL,MACEhB,EACImB,EACA,gEACLF,KAjBH1C,KAAO,cAkBP,EAMK,MAAM+C,oBAAoBV,mBAAmBE,WAAAA,IAAAC,GAAAC,SAAAD,GAAAE,KAClD1C,KAAO,aAAa,EAMf,MAAMgD,qBAAqBX,mBAmBhCE,WAAAA,CAAYU,GACV,IAAId,EAAsC,iBAArBc,EAAgCA,EAAmB,GAGxE,GAAgC,iBAArBA,EAA+B,CACxC,MAAMC,UAAEA,EAASC,WAAEA,EAAUC,QAAEA,EAAOC,aAAEA,GAAiBJ,EAEzDd,EAAUgB,EAGVhB,GAAWiB,EACP,mBAAmBC,MAAAA,EAAAA,EAAgB,gBACnC,aAEJlB,EAAUF,mBAAmBiB,EAAWf,EAC1C,CAEAM,MAAMN,GAAQO,KAnChB1C,KAAO,cAoCP,EAMK,MAAMsD,kBAAkBjB,mBAO7BE,WAAAA,CAAYgB,GASVd,MAPgC,iBAAvBc,EACHA,EACAtB,mBACEsB,EACA,+CAGMb,KAfhB1C,KAAO,WAgBP,EC9GK,MAAMwD,uBAeX,SAAIC,GACF,OAAOf,KAAKgB,MACd,CAcAnB,WAAAA,CAAYkB,GAAOf,KARnBgB,YAAM,EASJ,MAAMC,EACJjB,KAAKH,YAUP,GAA2C,iBAAhCoB,EAAiBvB,WAC1B,MAAM,IAAIkB,UAAU,yCAGtB,KAAMG,aAAiBE,EAAiBC,aACtC,MAAM,IAAIZ,aAAa,CACrBI,QAASK,EACTP,UAAWS,EACXR,WAAY,yBACZE,aAAcM,EAAiBC,YAAY5D,OAG7C0C,KAAKgB,OAAyCD,EAGhDE,EAAiBE,eAEjBnB,KAAKoB,mBAEL,MAAM1B,EAAauB,EAAiBvB,WAEpCM,KAAKe,MAAMtC,aAAa,QAAQiB,SAAmB,GACrD,CAQA0B,gBAAAA,GACE,MAAMvB,EAAoDG,KAAKH,YACzDH,EAAaG,EAAYH,WAE/B,GAAIA,GFaD,SAAuBqB,EAAOrB,GACnC,OACEqB,aAAiBM,aACjBN,EAAMO,aAAa,QAAQ5B,SAE/B,CElBsB6B,CAAcvB,KAAKe,MAAOrB,GAC1C,MAAM,IAAIkB,UAAUf,EAExB,CAOA,mBAAOsB,GACL,IAAKrC,cACH,MAAM,IAAImB,YAEd,EA3FWa,uBAIJI,YAAcG,YCVhB,MAAMG,EAAiBC,OAAOC,IAAI,kBAYlC,MAAMC,8BAA8Bb,uBAkBzC,CAACU,GAAgBI,GACf,MAAO,EACT,CAQA,UAAIC,GACF,OAAO7B,KAAK8B,OACd,CAeAjC,WAAAA,CAAYkB,EAAOc,GACjB9B,MAAMgB,GAAMf,KAVd8B,aAAO,EAYL,MAAMb,EACqDjB,KAAKH,YAEhE,QAAyC,IAA9BoB,EAAiBc,SAC1B,MAAM,IAAI1B,YACRd,mBACE0B,EACA,wEAKN,MAAMe,EA6EH,SAA0BxC,UAAWyC,GAC1C,QAAgC,IAArBzC,UAAU0C,OACnB,MAAM,IAAI7B,YACRd,mBACEC,UACA,sEAKN,MAAM2C,EAA0D,CAAA,EAGhE,IAAK,MAAOC,EAAO7E,KAAa8E,OAAOC,QAAQ9C,UAAU0C,OAAOK,YAC1DH,KAASH,IACXE,EAAIC,GAASI,gBAAgBP,EAAQG,GAAQ7E,IAOxB,YAAnBA,MAAAA,OAAAA,EAAAA,EAAUkF,QACZN,EAAIC,GAASM,yBAAyBlD,UAAU0C,OAAQD,EAASG,IAIrE,OAAOD,CACT,CAxGMQ,CAAiB1B,EAAkBjB,KAAKgB,OAAOiB,SAGjDjC,KAAK8B,QACHc,aACE3B,EAAiBc,SACjBF,MAAAA,EAAAA,EAAU,CAAE,EACZ7B,KAAKwB,GAAgBQ,GACrBA,EAGN,EAmBK,SAASQ,gBAAgBhF,EAAOD,GACrC,MAAMsF,EAAerF,EAAQA,EAAMsF,OAAS,GAE5C,IAAIC,EACAC,EAAazF,MAAAA,OAAAA,EAAAA,EAAUkF,KAe3B,OAZKO,IACC,CAAC,OAAQ,SAAS9F,SAAS2F,KAC7BG,EAAa,WAKXH,EAAaI,OAAS,GAAKC,SAASC,OAAON,MAC7CG,EAAa,WAITA,GACN,IAAK,UACHD,EAA0B,SAAjBF,EACT,MAEF,IAAK,SACHE,EAASI,OAAON,GAChB,MAEF,QACEE,EAASvF,EAGb,OAAOuF,CACT,CAqDO,SAASH,gBAAgBQ,GAG9B,MAAMC,EAAwB,CAAA,EAG9B,IAAK,MAAMC,KAAgBF,EACzB,IAAK,MAAMG,KAAOlB,OAAOmB,KAAKF,GAAe,CAC3C,MAAMlE,EAASiE,EAAsBE,GAC/BE,EAAWH,EAAaC,GAK1BpE,SAASC,IAAWD,SAASsE,GAE/BJ,EAAsBE,GAAOX,aAAaxD,EAAQqE,GAGlDJ,EAAsBE,GAAOE,CAEjC,CAGF,OAAOJ,CACT,CAkDO,SAASX,yBAAyBR,EAAQD,EAASyB,GACxD,MAAMnG,EAAW2E,EAAOK,WAAWmB,GAGnC,GAAuB,YAAnBnG,MAAAA,OAAAA,EAAAA,EAAUkF,MACZ,OAIF,MAAMkB,EAAY,CAChBD,CAACA,GAAyC,CAAE,GAG9C,IAAK,MAAOH,EAAK/F,KAAU6E,OAAOC,QAAQL,GAAU,CAElD,IAAI2B,EAAUD,EAGd,MAAME,EAAWN,EAAIpG,MAAM,KAQ3B,IAAK,MAAO2G,EAAOxG,KAASuG,EAASvB,UACZ,iBAAZsB,IAELE,EAAQD,EAASZ,OAAS,GAEvB9D,SAASyE,EAAQtG,MACpBsG,EAAQtG,GAAQ,IAIlBsG,EAAUA,EAAQtG,IACTiG,IAAQG,IAEjBE,EAAQtG,GAAQkF,gBAAgBhF,IAIxC,CAEA,OAAOmG,EAAUD,EACnB,CCrTO,MAAMK,KAUXlE,WAAAA,CAAYmE,EAAe,GAAInC,EAAS,CAAA,GAAI,IAAAoC,EAAAjE,KAT5CgE,kBAAY,EAAAhE,KACZkE,YAAM,EAUJlE,KAAKgE,aAAeA,EAGpBhE,KAAKkE,OAAsBD,OAAhBA,EAAGpC,EAAOqC,QAAMD,EAAKtG,SAASC,gBAAgBuG,MAAQ,IACnE,CAaAC,CAAAA,CAAEC,EAAWpG,GACX,IAAKoG,EAEH,MAAM,IAAIzE,MAAM,4BAIlB,IAAI0E,EAActE,KAAKgE,aAAaK,GAKpC,GAA8B,iBAAnBpG,MAAAA,OAAAA,EAAAA,EAASsG,QAA6C,iBAAhBD,EAA0B,CACzE,MAAME,EACJF,EAAYtE,KAAKyE,gBAAgBJ,EAAWpG,EAAQsG,QAGlDC,IACFF,EAAcE,EAElB,CAEA,GAA2B,iBAAhBF,EAA0B,CAEnC,GAAIA,EAAYI,MAAM,aAAc,CAClC,IAAKzG,EACH,MAAM,IAAI2B,MACR,0EAIJ,OAAOI,KAAK2E,oBAAoBL,EAAarG,EAC/C,CAEA,OAAOqG,CACT,CAIA,OAAOD,CACT,CAWAM,mBAAAA,CAAoBC,EAAmB3G,GACrC,MAAM4G,EAAYC,KAAKC,aAAaC,mBAAmBhF,KAAKkE,QAAQjB,OAChE,IAAI6B,KAAKC,aAAa/E,KAAKkE,aAC3BpG,EAEJ,OAAO8G,EAAkBK,QACvB,cAUA,SAAUC,EAAuBC,GAC/B,GAAI9C,OAAOjC,UAAUgF,eAAe7G,KAAKN,EAASkH,GAAiB,CACjE,MAAME,EAAmBpH,EAAQkH,GAIjC,OACuB,IAArBE,GAC6B,iBAArBA,GACsB,iBAArBA,EAEF,GAIuB,iBAArBA,EACFR,EACHA,EAAUS,OAAOD,GACjB,GAAGA,IAGFA,CACT,CAEA,MAAM,IAAIzF,MACR,kCAAkCsF,0BAEtC,GAEJ,CAcAK,yBAAAA,GACE,OAAOC,QACL,gBAAiB/H,OAAOqH,MACtBA,KAAKW,YAAYT,mBAAmBhF,KAAKkE,QAAQjB,OAEvD,CAkBAwB,eAAAA,CAAgBJ,EAAWE,GAMzB,GADAA,EAAQpB,OAAOoB,IACVrB,SAASqB,GACZ,MAAO,QAIT,MAAMD,EAActE,KAAKgE,aAAaK,GAKhCqB,EAAgB1F,KAAKuF,4BACvB,IAAIT,KAAKW,YAAYzF,KAAKkE,QAAQyB,OAAOpB,GACzCvE,KAAK4F,mCAAmCrB,GAG5C,GAA2B,iBAAhBD,EAA0B,CACnC,GAAIoB,KAAiBpB,EACnB,OAAOoB,EAGF,GAAI,UAAWpB,EAKpB,OAJAuB,QAAQC,KACN,+BAA+BJ,WAAuB1F,KAAKkE,6CAGtD,OAEX,CAGA,MAAM,IAAItE,MACR,+CAA+CI,KAAKkE,iBAExD,CAYA0B,kCAAAA,CAAmCrB,GAGjCA,EAAQwB,KAAKC,IAAID,KAAKE,MAAM1B,IAE5B,MAAM2B,EAAUlG,KAAKmG,0BAErB,OAAID,EACKnC,KAAKqC,YAAYF,GAAS3B,GAG5B,OACT,CAcA4B,uBAAAA,GACE,MAAME,EAAcrG,KAAKkE,OAAO/G,MAAM,KAAK,GAI3C,IAAK,MAAMmJ,KAAcvC,KAAKwC,eAAgB,CAC5C,MAAMC,EAAYzC,KAAKwC,eAAeD,GACtC,GAAIE,EAAUtJ,SAAS8C,KAAKkE,SAAWsC,EAAUtJ,SAASmJ,GACxD,OAAOC,CAEX,CACF,EA1PWvC,KA6RJwC,eAAiB,CACtBE,OAAQ,CAAC,MACTC,QAAS,CAAC,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,MAC1DC,OAAQ,CAAC,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,MACnDC,OAAQ,CACN,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,KACA,MAEFC,MAAO,CAAC,MACRC,QAAS,CAAC,KAAM,MAChBC,SAAU,CAAC,MACXC,QAAS,CAAC,QAAS,KAAM,MACzBC,MAAO,CAAC,OA/TClD,KAgVJqC,YAAc,CACnBK,OAAOS,GACK,IAANA,EACK,OAEC,IAANA,EACK,MAEC,IAANA,EACK,MAELA,EAAI,KAAO,GAAKA,EAAI,KAAO,GACtB,MAELA,EAAI,KAAO,IAAMA,EAAI,KAAO,GACvB,OAEF,QAETR,QAAOA,IACE,QAETC,OAAOO,GACQ,IAANA,GAAiB,IAANA,EAAU,MAAQ,QAEtCN,OAAOM,GACQ,IAANA,EAAU,MAAQ,QAE3BL,MAAMK,GACM,IAANA,EACK,MAEC,IAANA,EACK,MAELA,GAAK,GAAKA,GAAK,EACV,MAELA,GAAK,GAAKA,GAAK,GACV,OAEF,QAETJ,OAAAA,CAAQI,GACN,MAAMC,EAAUD,EAAI,IACdE,EAAOD,EAAU,GACvB,OAAa,IAATC,GAA0B,KAAZD,EACT,MAELC,GAAQ,GAAKA,GAAQ,KAAOD,GAAW,IAAMA,GAAW,IACnD,MAGE,IAATC,GACCA,GAAQ,GAAKA,GAAQ,GACrBD,GAAW,IAAMA,GAAW,GAEtB,OAIF,OACR,EACDJ,SAASG,GACG,IAANA,GAAiB,KAANA,EACN,MAEC,IAANA,GAAiB,KAANA,EACN,MAEJA,GAAK,GAAKA,GAAK,IAAQA,GAAK,IAAMA,GAAK,GACnC,MAEF,QAETF,QAAQE,GACI,IAANA,EACK,MAELA,EAAI,KAAY,GAAW,IAANA,EAChB,OAEF,QAETD,MAAMC,GACM,IAANA,EACK,OAEC,IAANA,EACK,MAEC,IAANA,EACK,MAEC,IAANA,EACK,MAEC,IAANA,EACK,OAEF,SCvaN,MAAMG,kBAAkB1F,sBAsF7B9B,WAAAA,CAAYkB,EAAOc,EAAS,IAC1B9B,MAAMgB,EAAOc,GAAO7B,KArFtBsH,UAAI,EAAAtH,KAGJuH,cAAgB,4BAA2BvH,KAG3CwH,aAAe,4BAA2BxH,KAG1CyH,iBAAmB,iCAAgCzH,KAGnD0H,aAAe,2BAA0B1H,KAGzC2H,qBAAuB,qCAAoC3H,KAG3D4H,mBAAqB,kCAAiC5H,KAGtD6H,mBAAqB,kCAAiC7H,KAGtD8H,oBAAsB,mCAAkC9H,KAGxD+H,2BAA6B,2CAA0C/H,KAGvEgI,wBAA0B,wCAAuChI,KAGjEiI,6BAA+B,8CAA6CjI,KAG5EkI,2BAA6B,kCAAiClI,KAG9DmI,gCAAkC,wCAAuCnI,KAGzEoI,yBAA2B,uCAAsCpI,KAGjEqI,mBAAqB,+BAA8BrI,KAGnDsI,qBAAuB,qCAAoCtI,KAG3DuI,oBAAsB,mCAAkCvI,KAGxDwI,yBAA2B,yCAAwCxI,KAGnEyI,oBAAsB,mCAAkCzI,KAGxD0I,eAAS,EAAA1I,KAMT2I,eAAiB,KAAI3I,KAMrB4I,aAAe,KAAI5I,KAMnB6I,aAAe,KASb7I,KAAKsH,KAAO,IAAIvD,KAAK/D,KAAK6B,OAAOyF,MAEjC,MAAMoB,EAAY1I,KAAKe,MAAM+H,iBAAiB,IAAI9I,KAAK0H,gBACvD,IAAKgB,EAAUzF,OACb,MAAM,IAAI3C,aAAa,CACrBE,UAAW6G,UACX5G,WAAY,2BAA2BT,KAAK0H,sBAIhD1H,KAAK0I,UAAYA,EAEjB1I,KAAK+I,eACL/I,KAAKgJ,qBAELhJ,KAAKiJ,oBAAoBjJ,KAAKkJ,qBAChC,CAOAH,YAAAA,GAEE/I,KAAK2I,eAAiBhL,SAASwL,cAAc,UAC7CnJ,KAAK2I,eAAelK,aAAa,OAAQ,UACzCuB,KAAK2I,eAAelK,aAAa,QAASuB,KAAKwH,cAC/CxH,KAAK2I,eAAelK,aAAa,gBAAiB,SAGlDuB,KAAK4I,aAAejL,SAASwL,cAAc,QAC3CnJ,KAAK4I,aAAa3J,UAAUmK,IAAIpJ,KAAKqI,oBACrCrI,KAAK2I,eAAeU,YAAYrJ,KAAK4I,cAGrC,MAAMU,EAAqB3L,SAASwL,cAAc,OAClDG,EAAmB7K,aAAa,QAASuB,KAAKuH,eAC9C+B,EAAmBD,YAAYrJ,KAAK2I,gBACpC3I,KAAKe,MAAMwI,aAAaD,EAAoBtJ,KAAKe,MAAMyI,YAGvDxJ,KAAK6I,aAAelL,SAASwL,cAAc,QAC3CnJ,KAAK6I,aAAa5J,UAAUmK,IAAIpJ,KAAKyH,kBACrCzH,KAAK2I,eAAeU,YAAYrJ,KAAK6I,cAGrC7I,KAAK2I,eAAejK,iBAAiB,SAAS,IAC5CsB,KAAKyJ,0BAIH,kBAAmB9L,UACrBA,SAASe,iBAAiB,eAAgBgL,GACxC1J,KAAK2J,cAAcD,IAGzB,CAOAV,kBAAAA,GACEhJ,KAAK0I,UAAUkB,SAAQ,CAACC,EAAUC,KAChC,MAAMC,EAAUF,EAASG,cAAc,IAAIhK,KAAK6H,sBAChD,IAAKkC,EACH,MAAM,IAAIzJ,aAAa,CACrBE,UAAW6G,UACX5G,WAAY,kCAAkCT,KAAK6H,4BAKvD7H,KAAKiK,sBAAsBF,EAASD,GACpC9J,KAAKkK,YAAYlK,KAAKmK,WAAWN,GAAWA,GAG5CE,EAAQrL,iBAAiB,SAAS,IAAMsB,KAAKoK,gBAAgBP,KAI7D7J,KAAKqK,gBAAgBR,EAAS,GAElC,CASAI,qBAAAA,CAAsBF,EAASjG,GAC7B,MAAMwG,EAAQP,EAAQC,cAAc,IAAIhK,KAAK4H,sBACvC2C,EAAWR,EAAQC,cAAc,IAAIhK,KAAK8H,uBAC1C0C,EAAWT,EAAQC,cAAc,IAAIhK,KAAKuI,uBAEhD,IAAKgC,EACH,MAAM,IAAIjK,aAAa,CACrBE,UAAW6G,UACX5G,WAAY,uBAAuBT,KAAK8H,2BAI5C,IAAKwC,EACH,MAAM,IAAIhK,aAAa,CACrBE,UAAW6G,UACX5G,WAAY,8CAA8CT,KAAK4H,4BAMnE,MAAM6C,EAAU9M,SAASwL,cAAc,UACvCsB,EAAQhM,aAAa,OAAQ,UAC7BgM,EAAQhM,aACN,gBACA,GAAGuB,KAAKe,MAAM2J,cAAc5G,EAAQ,KAKtC,IAAK,MAAM6G,KAAQtL,MAAMuL,KAAKN,EAAMO,YAChB,OAAdF,EAAKrN,MACPmN,EAAQhM,aAAakM,EAAKrN,KAAMqN,EAAKnN,OAKzC,MAAMsN,EAAenN,SAASwL,cAAc,QAC5C2B,EAAa7L,UAAUmK,IAAIpJ,KAAKgI,yBAGhC8C,EAAaJ,GAAKJ,EAAMI,GAIxB,MAAMK,EAAoBpN,SAASwL,cAAc,QACjD4B,EAAkB9L,UAAUmK,IAAIpJ,KAAKiI,8BACrC6C,EAAazB,YAAY0B,GAGzB1L,MAAMuL,KAAKN,EAAMU,YAAYpB,SAASqB,GACpCF,EAAkB1B,YAAY4B,KAIhC,MAAMC,EAAkBvN,SAASwL,cAAc,QAC/C+B,EAAgBjM,UAAUmK,IAAIpJ,KAAKkI,4BAInCgD,EAAgBzM,aAAa,iBAAkB,IAE/C,MAAM0M,EAAuBxN,SAASwL,cAAc,QACpDgC,EAAqBlM,UAAUmK,IAAIpJ,KAAKmI,iCACxC+C,EAAgB7B,YAAY8B,GAE5B,MAAMC,EAAgBzN,SAASwL,cAAc,QACvCkC,EAAgB1N,SAASwL,cAAc,QAe7C,GAdAkC,EAAcpM,UAAUmK,IAAIpJ,KAAKqI,oBACjC8C,EAAqB9B,YAAYgC,GACjCD,EAAcnM,UAAUmK,IAAIpJ,KAAKoI,0BACjC+C,EAAqB9B,YAAY+B,GAOjCX,EAAQpB,YAAYyB,GACpBL,EAAQpB,YAAYrJ,KAAKsL,0BAGrBd,EAAU,CAKZ,MAAMe,EAAe5N,SAASwL,cAAc,QAGtCqC,EAAoB7N,SAASwL,cAAc,QACjDqC,EAAkBvM,UAAUmK,IAAIpJ,KAAKwI,0BACrC+C,EAAalC,YAAYmC,GAGzB,IAAK,MAAMb,KAAQtL,MAAMuL,KAAKJ,EAASK,YACrCU,EAAa9M,aAAakM,EAAKrN,KAAMqN,EAAKnN,OAI5C6B,MAAMuL,KAAKJ,EAASQ,YAAYpB,SAASqB,GACvCO,EAAkBnC,YAAY4B,KAIhCT,EAASiB,SAEThB,EAAQpB,YAAYkC,GACpBd,EAAQpB,YAAYrJ,KAAKsL,yBAC3B,CAEAb,EAAQpB,YAAY6B,GAEpBX,EAASmB,YAAYpB,GACrBC,EAASlB,YAAYoB,EACvB,CAQAd,aAAAA,CAAcD,GACZ,MAAMiC,EAAYjC,EAAMkC,OAGxB,KAAMD,aAAqBE,SACzB,OAIF,MAAMhC,EAAW8B,EAAUG,QAAQ,IAAI9L,KAAK0H,gBACxCmC,GACF7J,KAAKkK,aAAY,EAAML,EAE3B,CAQAO,eAAAA,CAAgBP,GACd,MAAMkC,GAAe/L,KAAKmK,WAAWN,GACrC7J,KAAKkK,YAAY6B,EAAalC,GAG9B7J,KAAKgM,WAAWnC,EAAUkC,EAC5B,CAOAtC,qBAAAA,GACE,MAAMsC,GAAe/L,KAAKkJ,qBAE1BlJ,KAAK0I,UAAUkB,SAASC,IACtB7J,KAAKkK,YAAY6B,EAAalC,GAC9B7J,KAAKgM,WAAWnC,EAAUkC,EAAY,IAGxC/L,KAAKiJ,oBAAoB8C,EAC3B,CASA7B,WAAAA,CAAY+B,EAAUpC,GACpB,MAAMwB,EAAgBxB,EAASG,cAAc,IAAIhK,KAAKqI,sBAChD+C,EAAgBvB,EAASG,cAC7B,IAAIhK,KAAKoI,4BAELqC,EAAUZ,EAASG,cAAc,IAAIhK,KAAK4H,sBAC1CsE,EAAWrC,EAASG,cAAc,IAAIhK,KAAKyI,uBAEjD,IAAKyD,EACH,MAAM,IAAI5L,aAAa,CACrBE,UAAW6G,UACX5G,WAAY,kCAAkCT,KAAKyI,6BAIvD,IAAK4C,IAAkBD,IAAkBX,EAEvC,OAGF,MAAM0B,EAAgBF,EAClBjM,KAAKsH,KAAKlD,EAAE,eACZpE,KAAKsH,KAAKlD,EAAE,eAEhBgH,EAAcgB,YAAcD,EAC5B1B,EAAQhM,aAAa,gBAAiB,GAAGwN,KAGzC,MAAMI,EAAiB,GAEjBvB,EAAejB,EAASG,cAC5B,IAAIhK,KAAKgI,2BAEP8C,GACFuB,EAAeC,KAAK,GAAGxB,EAAasB,cAActJ,QAGpD,MAAM0H,EAAWX,EAASG,cAAc,IAAIhK,KAAKuI,uBAC7CiC,GACF6B,EAAeC,KAAK,GAAG9B,EAAS4B,cAActJ,QAGhD,MAAMyJ,EAAmBN,EACrBjM,KAAKsH,KAAKlD,EAAE,wBACZpE,KAAKsH,KAAKlD,EAAE,wBAChBiI,EAAeC,KAAKC,GAOpB9B,EAAQhM,aAAa,aAAc4N,EAAeG,KAAK,QAGnDP,GACFC,EAAS1N,gBAAgB,UACzBqL,EAAS5K,UAAUmK,IAAIpJ,KAAK2H,sBAC5B0D,EAAcpM,UAAUwM,OAAOzL,KAAKsI,wBAEpC4D,EAASzN,aAAa,SAAU,eAChCoL,EAAS5K,UAAUwM,OAAOzL,KAAK2H,sBAC/B0D,EAAcpM,UAAUmK,IAAIpJ,KAAKsI,uBAInCtI,KAAKiJ,oBAAoBjJ,KAAKkJ,qBAChC,CASAiB,UAAAA,CAAWN,GACT,OAAOA,EAAS5K,UAAUC,SAASc,KAAK2H,qBAC1C,CAQAuB,kBAAAA,GACE,OAAO7J,MAAMuL,KAAK5K,KAAK0I,WAAW+D,OAAO5C,GACvC7J,KAAKmK,WAAWN,IAEpB,CAQAZ,mBAAAA,CAAoBgD,GACbjM,KAAK2I,gBAAmB3I,KAAK6I,cAAiB7I,KAAK4I,eAIxD5I,KAAK2I,eAAelK,aAAa,gBAAiBwN,EAASS,YAC3D1M,KAAK6I,aAAauD,YAAcH,EAC5BjM,KAAKsH,KAAKlD,EAAE,mBACZpE,KAAKsH,KAAKlD,EAAE,mBAChBpE,KAAK4I,aAAa3J,UAAU0N,OAAO3M,KAAKsI,sBAAuB2D,GACjE,CAYAW,aAAAA,CAAc/C,GACZ,MAAMY,EAAUZ,EAASG,cAAc,IAAIhK,KAAK4H,sBAEhD,OAAO6C,MAAAA,OAAAA,EAAAA,EAASrM,aAAa,gBAC/B,CASA4N,UAAAA,CAAWnC,EAAUM,GACnB,IAAKnK,KAAK6B,OAAOgL,iBACf,OAGF,MAAMnC,EAAK1K,KAAK4M,cAAc/C,GAE9B,GAAIa,EACF,IACEjN,OAAOqP,eAAeC,QAAQrC,EAAIP,EAAWuC,WAC/C,CAAE,MAAOM,GAAY,CAEzB,CAQA3C,eAAAA,CAAgBR,GACd,IAAK7J,KAAK6B,OAAOgL,iBACf,OAGF,MAAMnC,EAAK1K,KAAK4M,cAAc/C,GAE9B,GAAIa,EACF,IACE,MAAMuC,EAAQxP,OAAOqP,eAAeI,QAAQxC,GAE9B,OAAVuC,GACFjN,KAAKkK,YAAsB,SAAV+C,EAAkBpD,EAEvC,CAAE,MAAOmD,GAAY,CAEzB,CAaA1B,sBAAAA,GACE,MAAM6B,EAAiBxP,SAASwL,cAAc,QAM9C,OALAgE,EAAelO,UAAUmK,IACvB,wBACApJ,KAAK+H,4BAEPoF,EAAef,YAAc,KACtBe,CACT,EApiBW9F,UAyiBJ3H,WAAa,kBAziBT2H,UAkjBJtF,SAAWM,OAAO+K,OAAO,CAC9B9F,KAAM,CACJ+F,gBAAiB,oBACjBC,YAAa,OACbC,qBAAsB,oBACtBC,gBAAiB,oBACjBC,YAAa,OACbC,qBAAsB,qBAExBb,kBAAkB,IA3jBTxF,UAokBJnF,OAASG,OAAO+K,OAAO,CAC5B7K,WAAY,CACV+E,KAAM,CAAE7E,KAAM,UACdoK,iBAAkB,CAAEpK,KAAM,cChlBzB,MAAMkL,eAAehM,sBAW1B9B,WAAAA,CAAYkB,EAAOc,EAAS,IAC1B9B,MAAMgB,EAAOc,GAAO7B,KAPtB4N,wBAA0B,KASxB5N,KAAKe,MAAMrC,iBAAiB,WAAYgL,GAAU1J,KAAK6N,cAAcnE,KACrE1J,KAAKe,MAAMrC,iBAAiB,SAAUgL,GAAU1J,KAAK8N,SAASpE,IAChE,CAcAmE,aAAAA,CAAcnE,GACZ,MAAMqE,EAAUrE,EAAMkC,OAGJ,MAAdlC,EAAMnG,KAMRwK,aAAmB1M,aACc,WAAjC0M,EAAQ3P,aAAa,UAErBsL,EAAMsE,iBACND,EAAQE,QAEZ,CAaAH,QAAAA,CAASpE,GAEP,GAAK1J,KAAK6B,OAAOqM,mBAKjB,OAAIlO,KAAK4N,yBACPlE,EAAMsE,kBACC,QAGThO,KAAK4N,wBAA0BnQ,OAAO0Q,YAAW,KAC/CnO,KAAK4N,wBAA0B,IAAI,GAClCQ,KACL,EC5EK,SAASC,sBAAsBrQ,EAAUsQ,GAC9C,MAAMC,EAA+BvQ,EAAS8N,QAAQ,IAAIwC,MAC1D,OAAOC,EACHA,EAA6BnQ,aAAakQ,GAC1C,IACN,CDHaX,OA+EJjO,WAAa,eA/ETiO,OAwFJ5L,SAAWM,OAAO+K,OAAO,CAC9Bc,oBAAoB,IAzFXP,OAkGJzL,OAASG,OAAO+K,OAAO,CAC5B7K,WAAY,CACV2L,mBAAoB,CAAEzL,KAAM,cEvF3B,MAAM+L,uBAAuB7M,sBA0ClC,CAACH,GAAgBQ,GACf,IAAIyM,EAAkB,CAAA,EAQtB,OAPI,aAAczM,GAAiB,cAAeA,KAChDyM,EAAkB,CAChBC,eAAW5Q,EACX6Q,cAAU7Q,IAIP2Q,CACT,CAMA5O,WAAAA,CAAYkB,EAAOc,EAAS,IAAI,IAAA+M,EAAAC,EAC9B9O,MAAMgB,EAAOc,GAAO7B,KAzDtB8O,eAAS,EAAA9O,KAGT+O,0BAAoB,EAAA/O,KAGpBgP,+BAAyB,EAAAhP,KAMzBiP,mBAAqB,KAAIjP,KAGzBkP,eAAiB,GAAElP,KAMnBmP,aAAe,KAAInP,KAGnBsH,UAAI,EAAAtH,KAGJoP,eAAS,EAgCP,MAAMN,EAAY9O,KAAKe,MAAMiJ,cAAc,6BAC3C,KAEI8E,aAAqBO,qBACrBP,aAAqBQ,kBAGvB,MAAM,IAAIhP,aAAa,CACrBE,UAAWgO,eACX9N,QAASoO,EACTnO,aAAc,0CACdF,WAAY,6CAKhB,MAAM8O,ELsIH,SAAwBrN,EAAQL,GACrC,MAAM2N,EAAmB,GAGzB,IAAK,MAAOlS,EAAMmS,KAAepN,OAAOC,QAAQJ,GAAS,CACvD,MAAMqN,EAAS,GAGf,GAAIlQ,MAAMC,QAAQmQ,GAAa,CAC7B,IAAK,MAAMC,SAAEA,EAAQC,aAAEA,KAAkBF,EAClCC,EAASjD,OAAOlJ,KAAU1B,EAAO0B,MACpCgM,EAAOjD,KAAKqD,GAKH,UAATrS,GAAsBmS,EAAWxM,OAASsM,EAAOtM,QAAU,GAC7DuM,EAAiBlD,QAAQiD,EAE7B,CACF,CAEA,OAAOC,CACT,CK7JmBI,CAAepB,eAAetM,OAAQlC,KAAK6B,QAC1D,GAAI0N,EAAO,GACT,MAAM,IAAIlP,YAAYd,mBAAmBiP,eAAgBe,EAAO,KAGlEvP,KAAKsH,KAAO,IAAIvD,KAAK/D,KAAK6B,OAAOyF,KAAM,CAErCpD,OAAQmK,sBAAsBrO,KAAKe,MAAO,UAI5Cf,KAAKoP,UAAyD,OAAhDR,EAAuBC,OAAvBA,EAAG7O,KAAK6B,OAAO8M,UAAQE,EAAI7O,KAAK6B,OAAO6M,WAASE,EAAIiB,IAElE7P,KAAK8O,UAAYA,EAEjB,MAAMgB,EAAwB,GAAG9P,KAAK8O,UAAUpE,UAC1CqF,EAAuBpS,SAASqS,eAAeF,GACrD,IAAKC,EACH,MAAM,IAAIzP,aAAa,CACrBE,UAAWgO,eACX9N,QAASqP,EACTtP,WAAY,wBAAwBqP,UAOpC,GAAGC,EAAqB3D,cAAc1H,MAAM,WAC9CqL,EAAqB3D,YAAcpM,KAAKsH,KAAKlD,EAAE,sBAAuB,CACpEG,MAAOvE,KAAKoP,aAMhBpP,KAAK8O,UAAUmB,sBAAsB,WAAYF,GAIjD,MAAMf,EAA4BrR,SAASwL,cAAc,OACzD6F,EAA0BkB,UACxB,yDACFlB,EAA0BvQ,aAAa,YAAa,UACpDuB,KAAKgP,0BAA4BA,EACjCe,EAAqBE,sBACnB,WACAjB,GAMF,MAAMD,EAAuBpR,SAASwL,cAAc,OACpD4F,EAAqBmB,UAAYH,EAAqBG,UACtDnB,EAAqB9P,UAAUmK,IAAI,iCACnC2F,EAAqBtQ,aAAa,cAAe,QACjDuB,KAAK+O,qBAAuBA,EAC5BgB,EAAqBE,sBAAsB,WAAYlB,GAGvDgB,EAAqB9Q,UAAUmK,IAAI,yBAGnCpJ,KAAK8O,UAAUtQ,gBAAgB,aAE/BwB,KAAKmQ,mBAKL1S,OAAOiB,iBAAiB,YAAY,IAAMsB,KAAKoQ,uBAK/CpQ,KAAKoQ,oBACP,CAUAD,gBAAAA,GACEnQ,KAAK8O,UAAUpQ,iBAAiB,SAAS,IAAMsB,KAAKqQ,gBAGpDrQ,KAAK8O,UAAUpQ,iBAAiB,SAAS,IAAMsB,KAAKsQ,gBACpDtQ,KAAK8O,UAAUpQ,iBAAiB,QAAQ,IAAMsB,KAAKuQ,cACrD,CAUAF,WAAAA,GACErQ,KAAKwQ,4BACLxQ,KAAKiP,mBAAqBwB,KAAKC,KACjC,CAiBAJ,WAAAA,GACEtQ,KAAKmP,aAAe1R,OAAOkT,aAAY,OAElC3Q,KAAKiP,oBACNwB,KAAKC,MAAQ,KAAO1Q,KAAKiP,qBAEzBjP,KAAK4Q,sBACP,GACC,IACL,CASAL,UAAAA,GAEMvQ,KAAKmP,cACP1R,OAAOoT,cAAc7Q,KAAKmP,aAE9B,CAOAyB,oBAAAA,GACM5Q,KAAK8O,UAAUtR,QAAUwC,KAAKkP,iBAChClP,KAAKkP,eAAiBlP,KAAK8O,UAAUtR,MACrCwC,KAAKoQ,qBAET,CAUAA,kBAAAA,GACEpQ,KAAKwQ,4BACLxQ,KAAK8Q,gCACP,CAOAN,yBAAAA,GACE,MACMO,EADkB/Q,KAAKoP,UAAYpP,KAAKuE,MAAMvE,KAAK8O,UAAUtR,OACjC,EAIlCwC,KAAK+O,qBAAqB9P,UAAU0N,OAClC,4CACC3M,KAAKgR,mBAIRhR,KAAK8O,UAAU7P,UAAU0N,OAAO,wBAAyBoE,GACzD/Q,KAAK+O,qBAAqB9P,UAAU0N,OAAO,sBAAuBoE,GAClE/Q,KAAK+O,qBAAqB9P,UAAU0N,OAAO,cAAeoE,GAG1D/Q,KAAK+O,qBAAqB3C,YAAcpM,KAAKiR,iBAC/C,CAOAH,8BAAAA,GAGM9Q,KAAKgR,kBACPhR,KAAKgP,0BAA0BxQ,gBAAgB,eAE/CwB,KAAKgP,0BAA0BvQ,aAAa,cAAe,QAI7DuB,KAAKgP,0BAA0B5C,YAAcpM,KAAKiR,iBACpD,CAUA1M,KAAAA,CAAM2M,GACJ,GAAIlR,KAAK6B,OAAO8M,SAAU,CAAA,IAAAwC,EAExB,OADiCA,OAArBA,EAAGD,EAAKxM,MAAM,SAAOyM,EAAI,IACvBlO,MAChB,CAEA,OAAOiO,EAAKjO,MACd,CAQAgO,eAAAA,GACE,MAAMG,EAAkBpR,KAAKoP,UAAYpP,KAAKuE,MAAMvE,KAAK8O,UAAUtR,OAC7D6T,EAAYrR,KAAK6B,OAAO8M,SAAW,QAAU,aACnD,OAAO3O,KAAKsR,mBAAmBF,EAAiBC,EAClD,CAWAC,kBAAAA,CAAmBF,EAAiBC,GAClC,GAAwB,IAApBD,EACF,OAAOpR,KAAKsH,KAAKlD,EAAE,GAAGiN,YAGxB,MAAME,EACJH,EAAkB,EAAI,YAAc,aAEtC,OAAOpR,KAAKsH,KAAKlD,EAAE,GAAGiN,IAAYE,IAAwB,CACxDhN,MAAOwB,KAAKC,IAAIoL,IAEpB,CAaAJ,eAAAA,GAEE,IAAKhR,KAAK6B,OAAO2P,UACf,OAAO,EAIT,MAAMC,EAAgBzR,KAAKuE,MAAMvE,KAAK8O,UAAUtR,OAKhD,OAJkBwC,KAAKoP,UAEapP,KAAK6B,OAAO2P,UAAa,KAEpCC,CAC3B,EAhXWjD,eAqXJ9O,WAAa,wBArXT8O,eA8XJzM,SAAWM,OAAO+K,OAAO,CAC9BoE,UAAW,EACXlK,KAAM,CAEJoK,qBAAsB,CACpBC,IAAK,wCACLC,MAAO,0CAETC,kBAAmB,kCACnBC,oBAAqB,CACnBH,IAAK,uCACLC,MAAO,yCAGTG,gBAAiB,CACfJ,IAAK,mCACLC,MAAO,qCAETI,aAAc,6BACdC,eAAgB,CACdN,IAAK,kCACLC,MAAO,oCAETM,oBAAqB,CACnBN,MAAO,OAtZFpD,eAiaJtM,OAASG,OAAO+K,OAAO,CAC5B7K,WAAY,CACV+E,KAAM,CAAE7E,KAAM,UACdkM,SAAU,CAAElM,KAAM,UAClBiM,UAAW,CAAEjM,KAAM,UACnB+O,UAAW,CAAE/O,KAAM,WAErB0P,MAAO,CACL,CACEzC,SAAU,CAAC,YACXC,aAAc,qDAEhB,CACED,SAAU,CAAC,aACXC,aAAc,wDC9bf,MAAMyC,mBAAmBtR,uBAkB9BjB,WAAAA,CAAYkB,GACVhB,MAAMgB,GAAMf,KAjBdqS,aAAO,EAmBL,MAAMA,EAAUrS,KAAKe,MAAM+H,iBAAiB,0BAC5C,IAAKuJ,EAAQpP,OACX,MAAM,IAAI3C,aAAa,CACrBE,UAAW4R,WACX3R,WAAY,4CAIhBT,KAAKqS,QAAUA,EAEfrS,KAAKqS,QAAQzI,SAAS0I,IACpB,MAAMC,EAAWD,EAAOlU,aAAa,sBAGrC,GAAKmU,EAAL,CAKA,IAAK5U,SAASqS,eAAeuC,GAC3B,MAAM,IAAIjS,aAAa,CACrBE,UAAW4R,WACX3R,WAAY,6BAA6B8R,UAM7CD,EAAO7T,aAAa,gBAAiB8T,GACrCD,EAAO9T,gBAAgB,qBAbvB,CAa4C,IAM9Cf,OAAOiB,iBAAiB,YAAY,IAAMsB,KAAKwS,8BAK/CxS,KAAKwS,4BAGLxS,KAAKe,MAAMrC,iBAAiB,SAAUgL,GAAU1J,KAAKyS,YAAY/I,IACnE,CAOA8I,yBAAAA,GACExS,KAAKqS,QAAQzI,SAAS0I,GACpBtS,KAAK0S,oCAAoCJ,IAE7C,CAWAI,mCAAAA,CAAoCJ,GAClC,MAAMC,EAAWD,EAAOlU,aAAa,iBACrC,IAAKmU,EACH,OAGF,MAAMxE,EAAUpQ,SAASqS,eAAeuC,GACxC,GAAIxE,MAAAA,GAAAA,EAAS9O,UAAUC,SAAS,iCAAkC,CAChE,MAAMyT,EAAiBL,EAAOM,QAE9BN,EAAO7T,aAAa,gBAAiBkU,EAAejG,YACpDqB,EAAQ9O,UAAU0N,OAChB,yCACCgG,EAEL,CACF,CAWAE,sBAAAA,CAAuBP,GACS3U,SAASmL,iBACrC,gCAAgCwJ,EAAOhV,UAGnBsM,SAASkJ,IACJR,EAAOS,OAASD,EAAmBC,MACpCD,IAAuBR,IAC7CQ,EAAmBF,SAAU,EAC7B5S,KAAK0S,oCAAoCI,GAC3C,GAEJ,CAYAE,sBAAAA,CAAuBV,GAEnB3U,SAASmL,iBACP,4DAA4DwJ,EAAOhV,UAG5BsM,SAASqJ,IACzBX,EAAOS,OAASE,EAAgBF,OAEvDE,EAAgBL,SAAU,EAC1B5S,KAAK0S,oCAAoCO,GAC3C,GAEJ,CAYAR,WAAAA,CAAY/I,GACV,MAAMwJ,EAAgBxJ,EAAMkC,OAG5B,KACIsH,aAAyB5D,mBACJ,aAAvB4D,EAAczQ,KAEd,OAUF,GANwByQ,EAAc9U,aAAa,kBAEjD4B,KAAK0S,oCAAoCQ,IAItCA,EAAcN,QACjB,OAKiD,cAAjDM,EAAc9U,aAAa,kBAE3B4B,KAAK6S,uBAAuBK,GAE5BlT,KAAKgT,uBAAuBE,EAEhC,EAjMWd,WAsMJ1S,WAAa,mBClMf,MAAMyT,qBAAqBxR,sBAKhC9B,WAAAA,CAAYkB,EAAOc,EAAS,IAC1B9B,MAAMgB,EAAOc,GAKR7B,KAAK6B,OAAOuR,kBACfrV,SAASiC,KAAKe,OAGhBf,KAAKe,MAAMrC,iBAAiB,SAAUgL,GAAU1J,KAAKyS,YAAY/I,IACnE,CAQA+I,WAAAA,CAAY/I,GACV,MAAMqE,EAAUrE,EAAMkC,OAClBmC,GAAW/N,KAAKqT,YAAYtF,IAC9BrE,EAAMsE,gBAEV,CAqBAqF,WAAAA,CAAYtF,GAEV,KAAMA,aAAmBuF,mBACvB,OAAO,EAGT,MAAMC,EAAUvW,mBAAmB+Q,EAAQyF,MAC3C,IAAKD,EACH,OAAO,EAGT,MAAMjB,EAAS3U,SAASqS,eAAeuD,GACvC,IAAKjB,EACH,OAAO,EAGT,MAAMmB,EAAiBzT,KAAK0T,2BAA2BpB,GACvD,QAAKmB,IAOLA,EAAeE,iBACfrB,EAAOzT,MAAM,CAAE+U,eAAe,KAEvB,EACT,CAkBAF,0BAAAA,CAA2BpB,GAAQ,IAAAuB,EACjC,MAAMC,EAAYxB,EAAOxG,QAAQ,YAEjC,GAAIgI,EAAW,CACb,MAAMC,EAAWD,EAAUE,qBAAqB,UAEhD,GAAID,EAAS9Q,OAAQ,CACnB,MAAMgR,EAAmBF,EAAS,GAIlC,GACEzB,aAAkBhD,mBACD,aAAhBgD,EAAO7P,MAAuC,UAAhB6P,EAAO7P,MAEtC,OAAOwR,EAST,MAAMC,EAAYD,EAAiBE,wBAAwBC,IACrDC,EAAY/B,EAAO6B,wBAIzB,GAAIE,EAAUC,QAAU7W,OAAO8W,YAAa,CAG1C,GAFoBF,EAAUD,IAAMC,EAAUC,OAE5BJ,EAAYzW,OAAO8W,YAAc,EACjD,OAAON,CAEX,CACF,CACF,CAEA,OACqE,OADrEJ,EACElW,SAASqM,cAAc,cAAcsI,EAAOlU,aAAa,YAAUyV,EACnEvB,EAAOxG,QAAQ,QAEnB,EA3IWqH,aAgJJzT,WAAa,sBAhJTyT,aAyJJpR,SAAWM,OAAO+K,OAAO,CAC9BgG,kBAAkB,IA1JTD,aAmKJjR,OAASG,OAAO+K,OAAO,CAC5B7K,WAAY,CACV6Q,iBAAkB,CAAE3Q,KAAM,cCvKzB,MAAM+R,qBAAqB7S,sBA4DhC9B,WAAAA,CAAYkB,EAAOc,EAAS,IAC1B9B,MAAMgB,EAAOc,GAAO7B,KA3DtBsH,UAAI,EAAAtH,KAGJyK,aAAO,EAAAzK,KAMPyU,gBAAkB,KAAIzU,KAMtB0U,YAAc,KAAI1U,KAMlB2U,oBAAsB,KAAI3U,KAM1B4U,SAAW,KAAI5U,KAGf6U,gBAAkB,EAAC7U,KAGnB8U,oBAAqB,EAAK9U,KAG1B+U,YAAc,IAAI/U,KAUlBgV,kBAAoB,KAAIhV,KAMxBiV,iBAAmB,KASjB,MAAMxK,EAAUzK,KAAKe,MAAMiJ,cAAc,iCACzC,KAAMS,aAAmB6I,mBACvB,MAAM,IAAIhT,aAAa,CACrBE,UAAWgU,aACX9T,QAAS+J,EACT9J,aAAc,oBACdF,WAAY,6CAIhBT,KAAKsH,KAAO,IAAIvD,KAAK/D,KAAK6B,OAAOyF,MACjCtH,KAAKyK,QAAUA,EAEf,MAAMgK,EAAkB9W,SAASqM,cAC/B,qCAEEyK,aAA2BnB,oBAC7BtT,KAAKyU,gBAAkBA,GAGzBzU,KAAKkV,iBACLlV,KAAKmV,iBACLnV,KAAKoV,yBAGC,sCAAuCzX,SAASqB,KAAKiD,UACzDtE,SAASe,iBAAiB,QAASsB,KAAKqV,eAAeC,KAAKtV,OAAO,GACnErC,SAASqB,KAAKiD,QAAQsT,kCAAoC,QAM5D9X,OAAOiB,iBAAiB,WAAYsB,KAAKwV,UAAUF,KAAKtV,MAC1D,CAOAmV,cAAAA,GACEnV,KAAK0U,YAAc/W,SAASwL,cAAc,QAC1CnJ,KAAK0U,YAAYjW,aAAa,OAAQ,UACtCuB,KAAK0U,YAAYxE,UAAY,wBAE7BlQ,KAAKe,MAAMsI,YAAYrJ,KAAK0U,YAC9B,CAOAU,sBAAAA,GAEEpV,KAAKyK,QAAQ/L,iBAAiB,QAASsB,KAAKyS,YAAY6C,KAAKtV,OAGzDA,KAAKyU,iBACPzU,KAAKyU,gBAAgB/V,iBACnB,QACAsB,KAAKyS,YAAY6C,KAAKtV,MAG5B,CAOAkV,cAAAA,GAGElV,KAAK2U,oBAAsBhX,SAASwL,cAAc,OAClDnJ,KAAK2U,oBAAoBzE,UAAY,kCACrClQ,KAAK2U,oBAAoBlW,aAAa,cAAe,QAGrD,IAAK,IAAIqL,EAAI,EAAGA,EAAI,EAAGA,IAAK,CAC1B,MAAM2L,EAAa9X,SAASwL,cAAc,OAC1CsM,EAAWvF,UAAY,wCACvBlQ,KAAK2U,oBAAoBtL,YAAYoM,EACvC,CAGAzV,KAAKyK,QAAQpB,YAAYrJ,KAAK2U,oBAChC,CAQAe,eAAAA,GACE,IAAK1V,KAAK2U,oBACR,OAIF3U,KAAK2U,oBAAoB1V,UAAU0N,OACjC,2CACA3M,KAAK6U,gBAAkB,GAIL7U,KAAK2U,oBAAoB7L,iBAC3C,0CAEUc,SAAQ,CAAC6L,EAAY3R,KAC/B2R,EAAWxW,UAAU0N,OACnB,4CACA7I,EAAQ9D,KAAK6U,gBACd,GAEL,CAUAc,QAAAA,GACO3V,KAAK0U,cAIV1U,KAAK0U,YAAYtI,YAAc,GAM/BzO,SAASqB,KAAKC,UAAUmK,IAAI,qCAC5BpJ,KAAK4U,SAAWjX,SAASwL,cAAc,OACvCnJ,KAAK4U,SAAS1E,UAAY,+BAC1BlQ,KAAK4U,SAASnW,aAAa,OAAQ,SAKnCd,SAASqB,KAAKqK,YAAYrJ,KAAK4U,UAC/B5U,KAAK4U,SAASxI,YAAcpM,KAAKsH,KAAKlD,EAAE,aAExC3G,OAAOmY,SAASpC,KAAOxT,KAAKyK,QAAQ+I,KACtC,CAaAf,WAAAA,CAAY/I,GACVA,EAAMsE,iBACNhO,KAAK2V,UACP,CASAN,cAAAA,CAAe3L,GACR1J,KAAK0U,cAYQ,UAAdhL,EAAMnG,KAAoBvD,KAAK8U,mBA8BxB9U,KAAKgV,mBAGdhV,KAAK6V,sBAhCL7V,KAAK6U,iBAAmB,EAGxB7U,KAAK0V,kBAGD1V,KAAKiV,mBACPxX,OAAOqY,aAAa9V,KAAKiV,kBACzBjV,KAAKiV,iBAAmB,MAGtBjV,KAAK6U,iBAAmB,GAC1B7U,KAAK6U,gBAAkB,EAEnB7U,KAAKgV,oBACPvX,OAAOqY,aAAa9V,KAAKgV,mBACzBhV,KAAKgV,kBAAoB,MAG3BhV,KAAK2V,YAEwB,IAAzB3V,KAAK6U,gBACP7U,KAAK0U,YAAYtI,YAAcpM,KAAKsH,KAAKlD,EAAE,qBAE3CpE,KAAK0U,YAAYtI,YAAcpM,KAAKsH,KAAKlD,EAAE,oBAI/CpE,KAAK+V,oBAQP/V,KAAK8U,mBAAqBpL,EAAMsM,SAClC,CAYAD,gBAAAA,GAGM/V,KAAKgV,mBACPvX,OAAOqY,aAAa9V,KAAKgV,mBAI3BhV,KAAKgV,kBAAoBvX,OAAO0Q,WAC9BnO,KAAK6V,mBAAmBP,KAAKtV,MAC7BA,KAAK+U,YAET,CAOAc,kBAAAA,GACE,IAAK7V,KAAK0U,YACR,OAGE1U,KAAKgV,oBACPvX,OAAOqY,aAAa9V,KAAKgV,mBACzBhV,KAAKgV,kBAAoB,MAG3B,MAAMN,EAAc1U,KAAK0U,YAEzB1U,KAAK6U,gBAAkB,EACvBH,EAAYtI,YAAcpM,KAAKsH,KAAKlD,EAAE,YAEtCpE,KAAKiV,iBAAmBxX,OAAO0Q,YAAW,KACxCuG,EAAYtI,YAAc,EAAE,GAC3BpM,KAAK+U,aAER/U,KAAK0V,iBACP,CAgBAF,SAAAA,GAEE7X,SAASqB,KAAKC,UAAUwM,OAAO,qCAE3BzL,KAAK4U,WACP5U,KAAK4U,SAASnJ,SACdzL,KAAK4U,SAAW,MAId5U,KAAK0U,cACP1U,KAAK0U,YAAYjW,aAAa,OAAQ,UACtCuB,KAAK0U,YAAYtI,YAAc,IAIjCpM,KAAK0V,kBAGD1V,KAAKgV,mBACPvX,OAAOqY,aAAa9V,KAAKgV,mBAGvBhV,KAAKiV,kBACPxX,OAAOqY,aAAa9V,KAAKiV,iBAE7B,EA9XWT,aAmYJ9U,WAAa,uBAnYT8U,aA4YJzS,SAAWM,OAAO+K,OAAO,CAC9B9F,KAAM,CACJ2O,UAAW,WACXC,SAAU,0BACVC,kBAAmB,qCACnBC,iBAAkB,uCAjZX5B,aA2ZJtS,OAASG,OAAO+K,OAAO,CAC5B7K,WAAY,CACV+E,KAAM,CAAE7E,KAAM,aC9Zb,MAAM4T,eAAevV,uBAgC1BjB,WAAAA,CAAYkB,GACVhB,MAAMgB,GAAMf,KA/BdsW,iBAAW,EAAAtW,KAGXuW,WAAK,EAAAvW,KASLwW,YAAa,EAAKxW,KAUlByW,IAAM,KAWJ,MAAMH,EAActW,KAAKe,MAAMiJ,cAAc,2BAK7C,IAAKsM,EACH,OAAOtW,KAGT,MAAM0W,EAASJ,EAAYlY,aAAa,iBACxC,IAAKsY,EACH,MAAM,IAAIpW,aAAa,CACrBE,UAAW6V,OACX5V,WACE,8FAIN,MAAM8V,EAAQ5Y,SAASqS,eAAe0G,GACtC,IAAKH,EACH,MAAM,IAAIjW,aAAa,CACrBE,UAAW6V,OACX3V,QAAS6V,EACT9V,WAAY,yBAAyBiW,WAIzC1W,KAAKuW,MAAQA,EACbvW,KAAKsW,YAAcA,EAEnBtW,KAAK2W,wBAEL3W,KAAKsW,YAAY5X,iBAAiB,SAAS,IACzCsB,KAAK4W,yBAET,CAOAD,qBAAAA,GACE,MAAME,EAAaxZ,cAAc,WAEjC,IAAKwZ,EAAWrZ,MACd,MAAM,IAAI8C,aAAa,CACrBE,UAAW6V,OACX5V,WAAY,0BAA0BoW,EAAWtZ,0CAKrDyC,KAAKyW,IAAMhZ,OAAOqZ,WAAW,eAAeD,EAAWrZ,UAInD,qBAAsBwC,KAAKyW,IAC7BzW,KAAKyW,IAAI/X,iBAAiB,UAAU,IAAMsB,KAAK+W,cAI/C/W,KAAKyW,IAAIO,aAAY,IAAMhX,KAAK+W,cAGlC/W,KAAK+W,WACP,CAYAA,SAAAA,GACO/W,KAAKyW,KAAQzW,KAAKuW,OAAUvW,KAAKsW,cAIlCtW,KAAKyW,IAAIQ,SACXjX,KAAKuW,MAAM/X,gBAAgB,UAC3BwB,KAAKsW,YAAY7X,aAAa,SAAU,MAExCuB,KAAKsW,YAAY9X,gBAAgB,UACjCwB,KAAKsW,YAAY7X,aAAa,gBAAiBuB,KAAKwW,WAAW9J,YAE3D1M,KAAKwW,WACPxW,KAAKuW,MAAM/X,gBAAgB,UAE3BwB,KAAKuW,MAAM9X,aAAa,SAAU,KAGxC,CAUAmY,qBAAAA,GACE5W,KAAKwW,YAAcxW,KAAKwW,WACxBxW,KAAK+W,WACP,EAhJWV,OAqJJ3W,WAAa,eCrJf,MAAMwX,2BAA2BvV,sBAKtC9B,WAAAA,CAAYkB,EAAOc,EAAS,IAC1B9B,MAAMgB,EAAOc,GAcyB,UAApC7B,KAAKe,MAAM3C,aAAa,SACvB4B,KAAK6B,OAAOuR,kBAEbrV,SAASiC,KAAKe,MAElB,EAzBWmW,mBA8BJxX,WAAa,4BA9BTwX,mBAuCJnV,SAAWM,OAAO+K,OAAO,CAC9BgG,kBAAkB,IAxCT8D,mBAiDJhV,OAASG,OAAO+K,OAAO,CAC5B7K,WAAY,CACV6Q,iBAAkB,CAAE3Q,KAAM,cCjDzB,MAAM0U,sBAAsBxV,sBAuBjC9B,WAAAA,CAAYkB,EAAOc,EAAS,IAC1B9B,MAAMgB,EAAOc,GAAO7B,KAtBtBsH,UAAI,EAAAtH,KAMJsS,YAAM,EAAAtS,KAMNoX,qBAAe,EAAApX,KAGfqX,gCAA0B,EASxB,MAAM/E,EAAStS,KAAKe,MAAMiJ,cAAc,kCACxC,KAAMsI,aAAkBhD,kBACtB,MAAM,IAAIhP,aAAa,CACrBE,UAAW2W,cACXzW,QAAS4R,EACT3R,aAAc,mBACdF,WAAY,kDAIhB,GAAoB,aAAhB6R,EAAO7P,KACT,MAAM,IAAInC,aACR,6FAIJ,MAAM8W,EAAkBpX,KAAKe,MAAMiJ,cACjC,mCAEF,KAAMoN,aAA2BE,mBAC/B,MAAM,IAAIhX,aAAa,CACrBE,UAAW2W,cACXzW,QAAS0W,EACTzW,aAAc,oBACdF,WAAY,+CAIhB,GAA6B,WAAzB2W,EAAgB3U,KAClB,MAAM,IAAInC,aACR,wFAIJN,KAAKsS,OAASA,EACdtS,KAAKoX,gBAAkBA,EAEvBpX,KAAKsH,KAAO,IAAIvD,KAAK/D,KAAK6B,OAAOyF,KAAM,CAErCpD,OAAQmK,sBAAsBrO,KAAKe,MAAO,UAI5Cf,KAAKoX,gBAAgB5Y,gBAAgB,UAMrC,MAAM6Y,EAA6B1Z,SAASwL,cAAc,OAC1DkO,EAA2BnH,UACzB,wDACFmH,EAA2B5Y,aAAa,YAAa,UACrDuB,KAAKqX,2BAA6BA,EAClCrX,KAAKsS,OAAOrC,sBAAsB,WAAYoH,GAG9CrX,KAAKoX,gBAAgB1Y,iBAAiB,QAASsB,KAAK2M,OAAO2I,KAAKtV,OAG5DA,KAAKsS,OAAOS,MACd/S,KAAKsS,OAAOS,KAAKrU,iBAAiB,UAAU,IAAMsB,KAAKuX,SAIzD9Z,OAAOiB,iBAAiB,YAAagL,IAC/BA,EAAM8N,WAAkC,aAArBxX,KAAKsS,OAAO7P,MACjCzC,KAAKuX,MACP,IAIFvX,KAAKuX,MACP,CAQA5K,MAAAA,CAAOjD,GACLA,EAAMsE,iBAGmB,aAArBhO,KAAKsS,OAAO7P,KAOhBzC,KAAKuX,OANHvX,KAAKyX,MAOT,CAOAA,IAAAA,GACEzX,KAAK0X,QAAQ,OACf,CAOAH,IAAAA,GACEvX,KAAK0X,QAAQ,WACf,CAQAA,OAAAA,CAAQjV,GACN,GAAIA,IAASzC,KAAKsS,OAAO7P,KACvB,OAIFzC,KAAKsS,OAAO7T,aAAa,OAAQgE,GAEjC,MAAMkV,EAAoB,aAATlV,EACXmV,EAAeD,EAAW,OAAS,OACnCE,EAAeF,EAAW,iBAAmB,gBAGnD3X,KAAKoX,gBAAgBU,UAAY9X,KAAKsH,KAAKlD,EAAE,GAAGwT,aAGhD5X,KAAKoX,gBAAgB3Y,aACnB,aACAuB,KAAKsH,KAAKlD,EAAE,GAAGwT,uBAIjB5X,KAAKqX,2BAA2BS,UAAY9X,KAAKsH,KAAKlD,EACpD,GAAGyT,gBAEP,EA1KWV,cA+KJzX,WAAa,uBA/KTyX,cAyLJpV,SAAWM,OAAO+K,OAAO,CAC9B9F,KAAM,CACJyQ,aAAc,OACdC,aAAc,OACdC,sBAAuB,gBACvBC,sBAAuB,gBACvBC,0BAA2B,2BAC3BC,2BAA4B,6BAhMrBjB,cA0MJjV,OAASG,OAAO+K,OAAO,CAC5B7K,WAAY,CACV+E,KAAM,CAAE7E,KAAM,aC/Mb,MAAM4V,eAAevX,uBAkB1BjB,WAAAA,CAAYkB,GACVhB,MAAMgB,GAAMf,KAjBdqS,aAAO,EAmBL,MAAMA,EAAUrS,KAAKe,MAAM+H,iBAAiB,uBAC5C,IAAKuJ,EAAQpP,OACX,MAAM,IAAI3C,aAAa,CACrBE,UAAW6X,OACX5X,WAAY,yCAIhBT,KAAKqS,QAAUA,EAEfrS,KAAKqS,QAAQzI,SAAS0I,IACpB,MAAMC,EAAWD,EAAOlU,aAAa,sBAGrC,GAAKmU,EAAL,CAKA,IAAK5U,SAASqS,eAAeuC,GAC3B,MAAM,IAAIjS,aAAa,CACrBE,UAAW6X,OACX5X,WAAY,6BAA6B8R,UAM7CD,EAAO7T,aAAa,gBAAiB8T,GACrCD,EAAO9T,gBAAgB,qBAbvB,CAa4C,IAM9Cf,OAAOiB,iBAAiB,YAAY,IAAMsB,KAAKwS,8BAK/CxS,KAAKwS,4BAGLxS,KAAKe,MAAMrC,iBAAiB,SAAUgL,GAAU1J,KAAKyS,YAAY/I,IACnE,CAOA8I,yBAAAA,GACExS,KAAKqS,QAAQzI,SAAS0I,GACpBtS,KAAK0S,oCAAoCJ,IAE7C,CAWAI,mCAAAA,CAAoCJ,GAClC,MAAMC,EAAWD,EAAOlU,aAAa,iBACrC,IAAKmU,EACH,OAGF,MAAMxE,EAAUpQ,SAASqS,eAAeuC,GACxC,GAAIxE,MAAAA,GAAAA,EAAS9O,UAAUC,SAAS,6BAA8B,CAC5D,MAAMyT,EAAiBL,EAAOM,QAE9BN,EAAO7T,aAAa,gBAAiBkU,EAAejG,YACpDqB,EAAQ9O,UAAU0N,OAChB,qCACCgG,EAEL,CACF,CAaAF,WAAAA,CAAY/I,GACV,MAAMwJ,EAAgBxJ,EAAMkC,OAG5B,KACIsH,aAAyB5D,mBACJ,UAAvB4D,EAAczQ,KAEd,OAKF,MAAM6V,EAAa3a,SAASmL,iBAC1B,sCAGIyP,EAAoBrF,EAAcH,KAClCyF,EAAoBtF,EAAc5V,KAExCgb,EAAW1O,SAAS0I,IAClB,MAAMmG,EAAmBnG,EAAOS,OAASwF,EACrBjG,EAAOhV,OAASkb,GAEjBC,GACjBzY,KAAK0S,oCAAoCJ,EAC3C,GAEJ,EAhJW+F,OAqJJ3Y,WAAa,eCpJf,MAAMgZ,0BAA0B5X,uBA4BrCjB,WAAAA,CAAYkB,GACVhB,MAAMgB,GAAMf,KA3BdsW,iBAAW,EAAAtW,KAGXuW,WAAK,EAAAvW,KAQLwW,YAAa,EAAKxW,KAUlByW,IAAM,KAQJ,MAAMH,EAActW,KAAKe,MAAMiJ,cAC7B,uCAMF,IAAKsM,EACH,OAAOtW,KAGT,MAAM0W,EAASJ,EAAYlY,aAAa,iBACxC,IAAKsY,EACH,MAAM,IAAIpW,aAAa,CACrBE,UAAWkY,kBACXjY,WACE,0GAIN,MAAM8V,EAAQ5Y,SAASqS,eAAe0G,GACtC,IAAKH,EACH,MAAM,IAAIjW,aAAa,CACrBE,UAAWkY,kBACXhY,QAAS6V,EACT9V,WAAY,yBAAyBiW,WAIzC1W,KAAKuW,MAAQA,EACbvW,KAAKsW,YAAcA,EAEnBtW,KAAK2W,wBAEL3W,KAAKsW,YAAY5X,iBAAiB,SAAS,IACzCsB,KAAK4W,yBAET,CAOAD,qBAAAA,GACE,MAAME,EAAaxZ,cAAc,UAEjC,IAAKwZ,EAAWrZ,MACd,MAAM,IAAI8C,aAAa,CACrBE,UAAWkY,kBACXjY,WAAY,0BAA0BoW,EAAWtZ,0CAKrDyC,KAAKyW,IAAMhZ,OAAOqZ,WAAW,eAAeD,EAAWrZ,UAInD,qBAAsBwC,KAAKyW,IAC7BzW,KAAKyW,IAAI/X,iBAAiB,UAAU,IAAMsB,KAAK+W,cAI/C/W,KAAKyW,IAAIO,aAAY,IAAMhX,KAAK+W,cAGlC/W,KAAK+W,WACP,CAYAA,SAAAA,GACO/W,KAAKyW,KAAQzW,KAAKuW,OAAUvW,KAAKsW,cAIlCtW,KAAKyW,IAAIQ,SACXjX,KAAKuW,MAAM/X,gBAAgB,UAC3BwB,KAAKsW,YAAY7X,aAAa,SAAU,MAExCuB,KAAKsW,YAAY9X,gBAAgB,UACjCwB,KAAKsW,YAAY7X,aAAa,gBAAiBuB,KAAKwW,WAAW9J,YAE3D1M,KAAKwW,WACPxW,KAAKuW,MAAM/X,gBAAgB,UAE3BwB,KAAKuW,MAAM9X,aAAa,SAAU,KAGxC,CAUAmY,qBAAAA,GACE5W,KAAKwW,YAAcxW,KAAKwW,WACxBxW,KAAK+W,WACP,EA9IW2B,kBAmJJhZ,WAAa,2BClJf,MAAMiZ,iBAAiB7X,uBAS5BjB,WAAAA,CAAYkB,GAAO,IAAA6X,EACjB7Y,MAAMgB,GAEN,MAAM8X,EAAO7Y,KAAKe,MAAM8X,KAClBrF,EAAsCoF,OAAlCA,EAAG5Y,KAAKe,MAAM3C,aAAa,SAAOwa,EAAI,GAGhD,IAAI3b,EASJ,IACEA,EAAM,IAAIQ,OAAOqb,IAAI9Y,KAAKe,MAAMyS,KACjC,CAAC,MAAOuF,GACP,MAAM,IAAIzY,aACR,mCAAmCkT,mBAEvC,CAGA,GACEvW,EAAI+b,SAAWvb,OAAOmY,SAASoD,QAC/B/b,EAAIgc,WAAaxb,OAAOmY,SAASqD,SAEjC,OAGF,MAAMC,EAAkBlc,mBAAmB6b,GAG3C,IAAKK,EACH,MAAM,IAAI5Y,aACR,mCAAmCkT,8BAIvC,MAAM2F,EAAiBxb,SAASqS,eAAekJ,GAG/C,IAAKC,EACH,MAAM,IAAI7Y,aAAa,CACrBE,UAAWmY,SACXjY,QAASyY,EACT1Y,WAAY,yBAAyByY,UAUzClZ,KAAKe,MAAMrC,iBAAiB,SAAS,IACnCX,SAASob,EAAgB,CACvBva,aAAAA,GACEua,EAAela,UAAUmK,IAAI,kCAC9B,EACD/K,MAAAA,GACE8a,EAAela,UAAUwM,OAAO,kCAClC,KAGN,EA7EWkN,SACJzX,YAAcoS,kBADVqF,SAkFJjZ,WAAa,kBCnFf,MAAM0Z,aAAatY,uBAkCxBjB,WAAAA,CAAYkB,GACVhB,MAAMgB,GAAMf,KAjCdqZ,WAAK,EAAArZ,KAGLsZ,cAAQ,EAAAtZ,KAGRuZ,mBAAa,EAAAvZ,KAGbwZ,cAAgB,4BAA2BxZ,KAG3CyZ,cAAe,EAAKzZ,KAGpB0Z,mBAAa,EAAA1Z,KAGb2Z,qBAAe,EAAA3Z,KAGf4Z,uBAAiB,EAAA5Z,KAMjByW,IAAM,KAQJ,MAAM4C,EAAQrZ,KAAKe,MAAM+H,iBAAiB,qBAC1C,IAAKuQ,EAAMpW,OACT,MAAM,IAAI3C,aAAa,CACrBE,UAAW4Y,KACX3Y,WAAY,0CAIhBT,KAAKqZ,MAAQA,EAGbrZ,KAAK0Z,cAAgB1Z,KAAK6Z,WAAWvE,KAAKtV,MAC1CA,KAAK2Z,gBAAkB3Z,KAAK8Z,aAAaxE,KAAKtV,MAC9CA,KAAK4Z,kBAAoB5Z,KAAK+Z,aAAazE,KAAKtV,MAEhD,MAAMsZ,EAAWtZ,KAAKe,MAAMiJ,cAAc,qBACpCuP,EAAgBvZ,KAAKe,MAAM+H,iBAC/B,4BAGF,IAAKwQ,EACH,MAAM,IAAIhZ,aAAa,CACrBE,UAAW4Y,KACX3Y,WAAY,2CAIhB,IAAK8Y,EAActW,OACjB,MAAM,IAAI3C,aAAa,CACrBE,UAAW4Y,KACX3Y,WAAY,sDAIhBT,KAAKsZ,SAAWA,EAChBtZ,KAAKuZ,cAAgBA,EAErBvZ,KAAK2W,uBACP,CAOAA,qBAAAA,GACE,MAAME,EAAaxZ,cAAc,UAEjC,IAAKwZ,EAAWrZ,MACd,MAAM,IAAI8C,aAAa,CACrBE,UAAW4Y,KACX3Y,WAAY,0BAA0BoW,EAAWtZ,0CAKrDyC,KAAKyW,IAAMhZ,OAAOqZ,WAAW,eAAeD,EAAWrZ,UAInD,qBAAsBwC,KAAKyW,IAC7BzW,KAAKyW,IAAI/X,iBAAiB,UAAU,IAAMsB,KAAK+W,cAI/C/W,KAAKyW,IAAIO,aAAY,IAAMhX,KAAK+W,cAGlC/W,KAAK+W,WACP,CAOAA,SAAAA,GAAY,IAAAiD,EACNA,OAAJA,EAAIha,KAAKyW,MAALuD,EAAU/C,QACZjX,KAAKia,QAELja,KAAKka,UAET,CAOAD,KAAAA,GAAQ,IAAAE,EACNna,KAAKsZ,SAAS7a,aAAa,OAAQ,WAEnCuB,KAAKuZ,cAAc3P,SAASwQ,IAC1BA,EAAM3b,aAAa,OAAQ,eAAe,IAG5CuB,KAAKqZ,MAAMzP,SAASyQ,IAElBra,KAAKsa,cAAcD,GAGnBA,EAAK3b,iBAAiB,QAASsB,KAAK0Z,eAAe,GACnDW,EAAK3b,iBAAiB,UAAWsB,KAAK2Z,iBAAiB,GAGvD3Z,KAAKua,QAAQF,EAAK,IAIpB,MAAMG,SAAUL,EAAGna,KAAKya,OAAOhd,OAAOmY,SAASiD,OAAKsB,EAAIna,KAAKqZ,MAAM,GAEnErZ,KAAK0a,QAAQF,GAGb/c,OAAOiB,iBAAiB,aAAcsB,KAAK4Z,mBAAmB,EAChE,CAOAM,QAAAA,GACEla,KAAKsZ,SAAS9a,gBAAgB,QAE9BwB,KAAKuZ,cAAc3P,SAASwQ,IAC1BA,EAAM5b,gBAAgB,OAAO,IAG/BwB,KAAKqZ,MAAMzP,SAASyQ,IAElBA,EAAKM,oBAAoB,QAAS3a,KAAK0Z,eAAe,GACtDW,EAAKM,oBAAoB,UAAW3a,KAAK2Z,iBAAiB,GAG1D3Z,KAAK4a,gBAAgBP,EAAK,IAI5B5c,OAAOkd,oBAAoB,aAAc3a,KAAK4Z,mBAAmB,EACnE,CAQAG,YAAAA,GACE,MAAMlB,EAAOpb,OAAOmY,SAASiD,KACvBgC,EAAe7a,KAAKya,OAAO5B,GACjC,IAAKgC,EACH,OAIF,GAAI7a,KAAKyZ,aAEP,YADAzZ,KAAKyZ,cAAe,GAKtB,MAAMqB,EAAe9a,KAAK+a,gBACrBD,IAIL9a,KAAKua,QAAQO,GACb9a,KAAK0a,QAAQG,GACbA,EAAahc,QACf,CAQA0b,OAAAA,CAAQF,GACNra,KAAKgb,eAAeX,GACpBra,KAAKib,UAAUZ,EACjB,CAQAK,OAAAA,CAAQL,GACNra,KAAKkb,aAAab,GAClBra,KAAKmb,UAAUd,EACjB,CASAI,MAAAA,CAAO5B,GACL,OAAO7Y,KAAKe,MAAMiJ,cAAc,2BAA2B6O,MAC7D,CAQAyB,aAAAA,CAAcD,GACZ,MAAMe,EAAUpe,mBAAmBqd,EAAK7G,MACxC,IAAK4H,EACH,OAIFf,EAAK5b,aAAa,KAAM,OAAO2c,KAC/Bf,EAAK5b,aAAa,OAAQ,OAC1B4b,EAAK5b,aAAa,gBAAiB2c,GACnCf,EAAK5b,aAAa,gBAAiB,SACnC4b,EAAK5b,aAAa,WAAY,MAG9B,MAAM4c,EAASrb,KAAKsb,SAASjB,GACxBgB,IAILA,EAAO5c,aAAa,OAAQ,YAC5B4c,EAAO5c,aAAa,kBAAmB4b,EAAK3P,IAC5C2Q,EAAOpc,UAAUmK,IAAIpJ,KAAKwZ,eAC5B,CAQAoB,eAAAA,CAAgBP,GAEdA,EAAK7b,gBAAgB,MACrB6b,EAAK7b,gBAAgB,QACrB6b,EAAK7b,gBAAgB,iBACrB6b,EAAK7b,gBAAgB,iBACrB6b,EAAK7b,gBAAgB,YAGrB,MAAM6c,EAASrb,KAAKsb,SAASjB,GACxBgB,IAILA,EAAO7c,gBAAgB,QACvB6c,EAAO7c,gBAAgB,mBACvB6c,EAAOpc,UAAUwM,OAAOzL,KAAKwZ,eAC/B,CASAK,UAAAA,CAAWnQ,GACT,MAAM6R,EAAcvb,KAAK+a,gBACnBS,EAAW9R,EAAM+R,cAElBF,GAAiBC,aAAoBlI,oBAI1C5J,EAAMsE,iBAENhO,KAAKua,QAAQgB,GACbvb,KAAK0a,QAAQc,GACbxb,KAAK0b,mBAAmBF,GAC1B,CAWAE,kBAAAA,CAAmBrB,GACjB,MAAMgB,EAASrb,KAAKsb,SAASjB,GAC7B,IAAKgB,EACH,OAKF,MAAMD,EAAUC,EAAO3Q,GACvB2Q,EAAO3Q,GAAK,GACZ1K,KAAKyZ,cAAe,EACpBhc,OAAOmY,SAASiD,KAAOuC,EACvBC,EAAO3Q,GAAK0Q,CACd,CAWAtB,YAAAA,CAAapQ,GACX,OAAQA,EAAMnG,KAEZ,IAAK,YACL,IAAK,OACHvD,KAAK2b,sBACLjS,EAAMsE,iBACN,MACF,IAAK,aACL,IAAK,QACHhO,KAAK4b,kBACLlS,EAAMsE,iBAGZ,CAOA4N,eAAAA,GACE,MAAML,EAAcvb,KAAK+a,gBACzB,GAAgB,MAAXQ,IAAAA,EAAaM,cAChB,OAGF,MAAMC,EAAmBP,EAAYM,cAAcE,mBACnD,IAAKD,EACH,OAGF,MAAMN,EAAWM,EAAiB9R,cAAc,qBAC3CwR,IAILxb,KAAKua,QAAQgB,GACbvb,KAAK0a,QAAQc,GACbA,EAAS3c,QACTmB,KAAK0b,mBAAmBF,GAC1B,CAOAG,mBAAAA,GACE,MAAMJ,EAAcvb,KAAK+a,gBACzB,GAAgB,MAAXQ,IAAAA,EAAaM,cAChB,OAGF,MAAMG,EACJT,EAAYM,cAAcI,uBAC5B,IAAKD,EACH,OAGF,MAAMlB,EAAekB,EAAqBhS,cAAc,qBACnD8Q,IAIL9a,KAAKua,QAAQgB,GACbvb,KAAK0a,QAAQI,GACbA,EAAajc,QACbmB,KAAK0b,mBAAmBZ,GAC1B,CASAQ,QAAAA,CAASjB,GACP,MAAMe,EAAUpe,mBAAmBqd,EAAK7G,MACxC,OAAK4H,EAIEpb,KAAKe,MAAMiJ,cAAc,IAAIoR,KAH3B,IAIX,CAQAD,SAAAA,CAAUd,GACR,MAAMgB,EAASrb,KAAKsb,SAASjB,GACxBgB,GAILA,EAAOpc,UAAUwM,OAAOzL,KAAKwZ,cAC/B,CAQAyB,SAAAA,CAAUZ,GACR,MAAMgB,EAASrb,KAAKsb,SAASjB,GACxBgB,GAILA,EAAOpc,UAAUmK,IAAIpJ,KAAKwZ,cAC5B,CAQAwB,cAAAA,CAAeX,GACRA,EAAKwB,gBAIVxB,EAAK5b,aAAa,gBAAiB,SACnC4b,EAAKwB,cAAc5c,UAAUwM,OAAO,mCACpC4O,EAAK5b,aAAa,WAAY,MAChC,CAQAyc,YAAAA,CAAab,GACNA,EAAKwB,gBAIVxB,EAAK5b,aAAa,gBAAiB,QACnC4b,EAAKwB,cAAc5c,UAAUmK,IAAI,mCACjCiR,EAAK5b,aAAa,WAAY,KAChC,CAQAsc,aAAAA,GACE,OAAO/a,KAAKe,MAAMiJ,cAChB,qDAEJ,EChfF,SAASkS,QAAQra,GAAQ,IAAAsa,EAIvB,GAHAta,OAA2B,IAAXA,EAAyBA,EAAS,CAAA,GAG7C/C,cAQH,YAPI+C,EAAOua,QACTva,EAAOua,QAAQ,IAAInc,aAAgB,CACjC4B,WAGFgE,QAAQwW,IAAI,IAAIpc,eAKpB,MAAMqc,EAAmC,CACvC,CAACjV,UAAWxF,EAAO0a,WACnB,CAAC5O,OAAQ9L,EAAO2a,QAChB,CAAChO,eAAgB3M,EAAO4a,gBACxB,CAACrK,YACD,CAACe,aAActR,EAAO6a,cACtB,CAAClI,aAAc3S,EAAO8a,cACtB,CAACtG,QACD,CAACa,mBAAoBrV,EAAO+a,oBAC5B,CAACzF,cAAetV,EAAOgb,eACvB,CAACxE,QACD,CAACK,mBACD,CAACC,UACD,CAACS,OAOGnb,EAAU,CACd6e,MAAmB,OAAdX,EAAEta,EAAOib,OAAKX,EAAIxe,SACvBye,QAASva,EAAOua,SAGlBE,EAAW1S,SAAQ,EAAEpK,UAAWqC,MAC9Bkb,UAAUvd,UAAWqC,EAAQ5D,EAAQ,GAEzC,CAiBA,SAAS8e,UAAUvd,UAAWqC,EAAQmb,GACpC,IAC0DZ,EADpBrd,EAASpB,SAGL,IAAAsf,EAAV,iBAArBD,IAMTje,EAA+B,OAAzBke,EAAGD,EAAiBF,OAAKG,EAAIle,EACnCqd,EAAUY,EAAiBZ,SAGG,mBAArBY,IACTZ,EAAUY,GAGRA,aAA4B3b,cAC9BtC,EAASie,GAGX,MAAME,EAAYne,EAAO+J,iBACvB,iBAAiBtJ,UAAUE,gBAI7B,OAAKZ,cAmBEO,MAAMuL,KAAKsS,GACfC,KAAKnf,IACJ,IAGE,YAAyB,IAAX6D,EACV,IAAIrC,UAAUxB,EAAU6D,GACxB,IAAIrC,UAAUxB,EACnB,CAAC,MAAO+a,GAWP,OAVIqD,EACFA,EAAQrD,EAAO,CACbrY,QAAS1C,EACTwC,UAAWhB,UACXqC,WAGFgE,QAAQwW,IAAItD,GAGP,IACT,KAEDqE,OAAO5X,UAxCJ4W,EACFA,EAAQ,IAAInc,aAAgB,CAC1BO,UAAWhB,UACXqC,WAGFgE,QAAQwW,IAAI,IAAIpc,cAEX,GAiCX,CDhJamZ,KAogBJ1Z,WAAa,oBCzStB2H,UAAAsG,OAAAa,eAAA4D,WAAAtR,oCAAAa,sBAAAwR,aAAAqB,aAAA6B,OAAAa,mBAAAC,cAAAkB,OAAAK,kBAAAC,SAAAS,KAAA2D,UAAAb,QAAApd,YAAA/B"}