aw-highstock_rails 7.0.3

data/vendor/assets/javascripts/highstock/modules/draggable-points.js

@@ -0,0 +1,40 @@
+/*
+ Highcharts JS v7.0.3 (2019-02-06)
+
+ (c) 2009-2019 Torstein Honsi
+
+ License: www.highcharts.com/license
+*/
+(function(m){"object"===typeof module&&module.exports?(m["default"]=m,module.exports=m):"function"===typeof define&&define.amd?define(function(){return m}):m("undefined"!==typeof Highcharts?Highcharts:void 0)})(function(m){(function(h){function m(a){return{left:"right",right:"left",top:"bottom",bottom:"top"}[a]}function L(a){var b=["draggableX","draggableY"],c;n(a.dragDropProps,function(a){a.optionName&&b.push(a.optionName)});for(c=b.length;c--;)if(a.options.dragDrop[b[c]])return!0}function M(a){var b=
+a.series?a.series.length:0;if(a.hasCartesianSeries&&!a.polar)for(;b--;)if(a.series[b].options.dragDrop&&L(a.series[b]))return!0}function N(a){var b=a.series,c=b.options.dragDrop||{};a=a.options&&a.options.dragDrop;var e,f;n(b.dragDropProps,function(a){"x"===a.axis&&a.move?e=!0:"y"===a.axis&&a.move&&(f=!0)});return(c.draggableX&&e||c.draggableY&&f)&&!(a&&!1===a.draggableX&&!1===a.draggableY)&&b.yAxis&&b.xAxis}function t(a,b){return void 0===a.chartX||void 0===a.chartY?b.pointer.normalize(a):a}function w(a,
+b,c,e){var f=b.map(function(b){return p(a,b,c,e)});return function(){f.forEach(function(a){a()})}}function O(a,b,c){var e=b.dragDropData.origin;b=e.chartX;var e=e.chartY,f=a.chartX;a=a.chartY;return Math.sqrt((f-b)*(f-b)+(a-e)*(a-e))>c}function P(a,b,c){var e={chartX:a.chartX,chartY:a.chartY,guideBox:c&&{x:c.attr("x"),y:c.attr("y"),width:c.attr("width"),height:c.attr("height")},points:{}};b.forEach(function(a){var b={};n(a.series.dragDropProps,function(c,e){b[e]=a[e]});b.point=a;e.points[a.id]=b});
+return e}function Q(a){var b=a.series,c=b.options.dragDrop.groupBy;return a.options[c]?b.points.filter(function(b){return b.options[c]===a.options[c]}):[a]}function D(a,b){var c=Q(b),e=b.series,f=e.chart,l;u(e.options.dragDrop&&e.options.dragDrop.liveRedraw,!0)||(f.dragGuideBox=l=e.getGuideBox(c),f.setGuideBoxState("default",e.options.dragDrop.guideBox).add(e.group));f.dragDropData={origin:P(a,c,l),point:b,groupedPoints:c,isDragging:!0}}function R(a,b){var c=a.point,e=q(c.series.options.dragDrop,
+c.options.dragDrop),f={},l=a.updateProp,C={};n(c.series.dragDropProps,function(a,b){if(!l||l===b&&a.resize&&(!a.optionName||!1!==e[a.optionName]))if(l||a.move&&("x"===a.axis&&e.draggableX||"y"===a.axis&&e.draggableY))f[b]=a});(l?[c]:a.groupedPoints).forEach(function(c){C[c.id]={point:c,newValues:c.getDropValues(a.origin,b,f)}});return C}function E(a,b){var c=a.dragDropData.newPoints;b=!1===b?!1:q({duration:400},a.options.animation);a.isDragDropAnimating=!0;n(c,function(a){a.point.update(a.newValues,
+!1)});a.redraw(b);setTimeout(function(){delete a.isDragDropAnimating;a.hoverPoint&&!a.dragHandles&&a.hoverPoint.showDragHandles()},b.duration)}function F(a){var b=a.series&&a.series.chart,c=b&&b.dragDropData;!b||!b.dragHandles||c&&(c.isDragging&&c.draggedPastSensitivity||c.isHoveringHandle===a.id)||b.hideDragHandles()}function G(a){var b=0,c;for(c in a)a.hasOwnProperty(c)&&b++;return b}function H(a){for(var b in a)if(a.hasOwnProperty(b))return a[b]}function S(a,b){if(!b.zoomOrPanKeyPressed(a)){var c=
+b.dragDropData,e,f;f=0;c&&c.isDragging&&(e=c.point,f=e.series.options.dragDrop,a.preventDefault(),c.draggedPastSensitivity||(c.draggedPastSensitivity=O(a,b,u(e.options.dragDrop&&e.options.dragDrop.dragSensitivity,f&&f.dragSensitivity,2))),c.draggedPastSensitivity&&(c.newPoints=R(c,a),b=c.newPoints,f=G(b),b=1===f?H(b):null,e.firePointEvent("drag",{origin:c.origin,newPoints:c.newPoints,newPoint:b&&b.newValues,newPointId:b&&b.point.id,numNewPoints:f,chartX:a.chartX,chartY:a.chartY},function(){var b=
+e.series,c=b.chart,f=c.dragDropData,d=q(b.options.dragDrop,e.options.dragDrop),g=d.draggableX,k=d.draggableY,b=f.origin,h=a.chartX-b.chartX,x=a.chartY-b.chartY,r=h,f=f.updateProp;c.inverted&&(h=-x,x=-r);if(u(d.liveRedraw,!0))E(c,!1),e.showDragHandles();else if(f){var g=h,c=x,r=e.series,k=r.chart,f=k.dragDropData,n,p,d=r.dragDropProps[f.updateProp];p=f.newPoints[e.id].newValues;n="function"===typeof d.resizeSide?d.resizeSide(p,e):d.resizeSide;d.beforeResize&&d.beforeResize(k.dragGuideBox,p,e);var k=
+k.dragGuideBox,r="x"===d.axis&&r.xAxis.reversed||"y"===d.axis&&r.yAxis.reversed?m(n):n,g="x"===d.axis?g-(f.origin.prevdX||0):0,c="y"===d.axis?c-(f.origin.prevdY||0):0,v;switch(r){case "left":v={x:k.attr("x")+g,width:Math.max(1,k.attr("width")-g)};break;case "right":v={width:Math.max(1,k.attr("width")+g)};break;case "top":v={y:k.attr("y")+c,height:Math.max(1,k.attr("height")-c)};break;case "bottom":v={height:Math.max(1,k.attr("height")+c)}}k.attr(v)}else c.dragGuideBox.translate(g?h:0,k?x:0);b.prevdX=
+h;b.prevdY=x})))}}function A(a,b){var c=b.dragDropData;if(c&&c.isDragging&&c.draggedPastSensitivity){var e=c.point,f=c.newPoints,l=G(f),d=1===l?H(f):null;b.dragHandles&&b.hideDragHandles();a.preventDefault();b.cancelClick=!0;e.firePointEvent("drop",{origin:c.origin,chartX:a.chartX,chartY:a.chartY,newPoints:f,numNewPoints:l,newPoint:d&&d.newValues,newPointId:d&&d.point.id},function(){E(b)})}delete b.dragDropData;b.dragGuideBox&&(b.dragGuideBox.destroy(),delete b.dragGuideBox)}function T(a){var b=a.container,
+c=h.doc;M(a)&&(w(b,["mousedown","touchstart"],function(b){b=t(b,a);var c=a.hoverPoint,e=h.merge(c.series.options.dragDrop,c.options.dragDrop),d=e.draggableX||!1,e=e.draggableY||!1;a.cancelClick=!1;!d&&!e||a.zoomOrPanKeyPressed(b)||(a.dragDropData&&a.dragDropData.isDragging?A(b,a):c&&N(c)&&(a.mouseIsDown=!1,D(b,c),c.firePointEvent("dragStart",b)))}),w(b,["mousemove","touchmove"],function(b){S(t(b,a),a)}),p(b,"mouseleave",function(b){A(t(b,a),a)}),a.unbindDragDropMouseUp=w(c,["mouseup","touchend"],
+function(b){A(t(b,a),a)}),a.hasAddedDragDropEvents=!0,p(a,"destroy",function(){a.unbindDragDropMouseUp&&a.unbindDragDropMouseUp()}))}var p=h.addEvent,n=h.objectEach,u=h.pick,q=h.merge,d=h.seriesTypes,I=function(a){a=a.shapeArgs||a.graphic.getBBox();var b=a.r||0,c=a.height/2;return["M",0,b,"L",0,c-5,"A",1,1,0,0,0,0,c+5,"A",1,1,0,0,0,0,c-5,"M",0,c+5,"L",0,a.height-b]},z=d.line.prototype.dragDropProps={x:{axis:"x",move:!0},y:{axis:"y",move:!0}};d.flags&&(d.flags.prototype.dragDropProps=z);var g=d.column.prototype.dragDropProps=
+{x:{axis:"x",move:!0},y:{axis:"y",move:!1,resize:!0,beforeResize:function(a,b,c){var e=c.series.translatedThreshold,f=a.attr("y");b.y>=c.series.options.threshold?(b=a.attr("height"),a.attr({height:Math.max(0,Math.round(b+(e?e-(f+b):0)))})):a.attr({y:Math.round(f+(e?e-f:0))})},resizeSide:function(a,b){var c=b.series.chart.dragHandles;a=a.y>=(b.series.options.threshold||0)?"top":"bottom";b=m(a);c[b]&&(c[b].destroy(),delete c[b]);return a},handlePositioner:function(a){var b=a.shapeArgs||a.graphic.getBBox();
+return{x:b.x,y:a.y>=(a.series.options.threshold||0)?b.y:b.y+b.height}},handleFormatter:function(a){a=a.shapeArgs;var b=a.r||0,c=a.width/2;return["M",b,0,"L",c-5,0,"A",1,1,0,0,0,c+5,0,"A",1,1,0,0,0,c-5,0,"M",c+5,0,"L",a.width-b,0]}}};d.bullet&&(d.bullet.prototype.dragDropProps={x:g.x,y:g.y,target:{optionName:"draggableTarget",axis:"y",move:!0,resize:!0,resizeSide:"top",handlePositioner:function(a){var b=a.targetGraphic.getBBox();return{x:a.barX,y:b.y+b.height/2}},handleFormatter:g.y.handleFormatter}});
+d.columnrange&&(d.columnrange.prototype.dragDropProps={x:{axis:"x",move:!0},low:{optionName:"draggableLow",axis:"y",move:!0,resize:!0,resizeSide:"bottom",handlePositioner:function(a){a=a.shapeArgs||a.graphic.getBBox();return{x:a.x,y:a.y+a.height}},handleFormatter:g.y.handleFormatter,propValidate:function(a,b){return a<=b.high}},high:{optionName:"draggableHigh",axis:"y",move:!0,resize:!0,resizeSide:"top",handlePositioner:function(a){a=a.shapeArgs||a.graphic.getBBox();return{x:a.x,y:a.y}},handleFormatter:g.y.handleFormatter,
+propValidate:function(a,b){return a>=b.low}}});d.boxplot&&(d.boxplot.prototype.dragDropProps={x:g.x,low:{optionName:"draggableLow",axis:"y",move:!0,resize:!0,resizeSide:"bottom",handlePositioner:function(a){return{x:a.shapeArgs.x,y:a.lowPlot}},handleFormatter:g.y.handleFormatter,propValidate:function(a,b){return a<=b.q1}},q1:{optionName:"draggableQ1",axis:"y",move:!0,resize:!0,resizeSide:"bottom",handlePositioner:function(a){return{x:a.shapeArgs.x,y:a.q1Plot}},handleFormatter:g.y.handleFormatter,
+propValidate:function(a,b){return a<=b.median&&a>=b.low}},median:{axis:"y",move:!0},q3:{optionName:"draggableQ3",axis:"y",move:!0,resize:!0,resizeSide:"top",handlePositioner:function(a){return{x:a.shapeArgs.x,y:a.q3Plot}},handleFormatter:g.y.handleFormatter,propValidate:function(a,b){return a<=b.high&&a>=b.median}},high:{optionName:"draggableHigh",axis:"y",move:!0,resize:!0,resizeSide:"top",handlePositioner:function(a){return{x:a.shapeArgs.x,y:a.highPlot}},handleFormatter:g.y.handleFormatter,propValidate:function(a,
+b){return a>=b.q3}}});d.ohlc&&(d.ohlc.prototype.dragDropProps={x:g.x,low:{optionName:"draggableLow",axis:"y",move:!0,resize:!0,resizeSide:"bottom",handlePositioner:function(a){return{x:a.shapeArgs.x,y:a.plotLow}},handleFormatter:g.y.handleFormatter,propValidate:function(a,b){return a<=b.open&&a<=b.close}},high:{optionName:"draggableHigh",axis:"y",move:!0,resize:!0,resizeSide:"top",handlePositioner:function(a){return{x:a.shapeArgs.x,y:a.plotHigh}},handleFormatter:g.y.handleFormatter,propValidate:function(a,
+b){return a>=b.open&&a>=b.close}},open:{optionName:"draggableOpen",axis:"y",move:!0,resize:!0,resizeSide:function(a){return a.open>=a.close?"top":"bottom"},handlePositioner:function(a){return{x:a.shapeArgs.x,y:a.plotOpen}},handleFormatter:g.y.handleFormatter,propValidate:function(a,b){return a<=b.high&&a>=b.low}},close:{optionName:"draggableClose",axis:"y",move:!0,resize:!0,resizeSide:function(a){return a.open>=a.close?"bottom":"top"},handlePositioner:function(a){return{x:a.shapeArgs.x,y:a.plotClose}},
+handleFormatter:g.y.handleFormatter,propValidate:function(a,b){return a<=b.high&&a>=b.low}}});if(d.arearange){var z=d.columnrange.prototype.dragDropProps,J=function(a){a=a.graphic?a.graphic.getBBox().width/2+1:4;return["M",0-a,0,"a",a,a,0,1,0,2*a,0,"a",a,a,0,1,0,-2*a,0]};d.arearange.prototype.dragDropProps={x:z.x,low:{optionName:"draggableLow",axis:"y",move:!0,resize:!0,resizeSide:"bottom",handlePositioner:function(a){return(a=a.lowerGraphic&&a.lowerGraphic.getBBox())?{x:a.x+a.width/2,y:a.y+a.height/
+2}:{x:-999,y:-999}},handleFormatter:J,propValidate:z.low.propValidate},high:{optionName:"draggableHigh",axis:"y",move:!0,resize:!0,resizeSide:"top",handlePositioner:function(a){return(a=a.upperGraphic&&a.upperGraphic.getBBox())?{x:a.x+a.width/2,y:a.y+a.height/2}:{x:-999,y:-999}},handleFormatter:J,propValidate:z.high.propValidate}}}d.waterfall&&(d.waterfall.prototype.dragDropProps={x:g.x,y:q(g.y,{handleFormatter:function(a){return a.isSum||a.isIntermediateSum?null:g.y.handleFormatter(a)}})});if(d.xrange)var K=
+function(a,b){var c=a.series,e=c.xAxis,f=c.yAxis,c=c.chart.inverted;b=e.toPixels(a[b],!0);var d=f.toPixels(a.y,!0);c?(b=e.len-b,d=f.len-d-a.shapeArgs.height/2):d-=a.shapeArgs.height/2;return{x:Math.round(b),y:Math.round(d)}},B=d.xrange.prototype.dragDropProps={y:{axis:"y",move:!0},x:{optionName:"draggableX1",axis:"x",move:!0,resize:!0,resizeSide:"left",handlePositioner:function(a){return K(a,"x")},handleFormatter:I,propValidate:function(a,b){return a<=b.x2}},x2:{optionName:"draggableX2",axis:"x",
+move:!0,resize:!0,resizeSide:"right",handlePositioner:function(a){return K(a,"x2")},handleFormatter:I,propValidate:function(a,b){return a>=b.x}}};d.gantt&&(d.gantt.prototype.dragDropProps={y:B.y,start:q(B.x,{optionName:"draggableStart",validateIndividualDrag:function(a){return!a.milestone}}),end:q(B.x2,{optionName:"draggableEnd",validateIndividualDrag:function(a){return!a.milestone}})});"gauge pie sunburst wordcloud sankey histogram pareto vector windbarb treemap bellcurve sma map mapline".split(" ").forEach(function(a){d[a]&&
+(d[a].prototype.dragDropProps=null)});var U={"default":{className:"highcharts-drag-box-default",lineWidth:1,lineColor:"#888",color:"rgba(0, 0, 0, 0.1)",cursor:"move",zIndex:900}},V={className:"highcharts-drag-handle",color:"#fff",lineColor:"rgba(0, 0, 0, 0.6)",lineWidth:1,zIndex:901};h.Chart.prototype.setGuideBoxState=function(a,b){var c=this.dragGuideBox;b=q(U,b);a=q(b.default,b[a]);return c.attr({className:a.className,stroke:a.lineColor,strokeWidth:a.lineWidth,fill:a.color,cursor:a.cursor,zIndex:a.zIndex}).css({pointerEvents:"none"})};
+h.Point.prototype.getDropValues=function(a,b,c){var e=this,f=e.series,d=q(f.options.dragDrop,e.options.dragDrop),g=f.yAxis,y=f.xAxis,h=b.chartX-a.chartX;b=b.chartY-a.chartY;var p=u(a.x,e.x),k=u(a.y,e.y),m=y.toValue(y.toPixels(p,!0)+(y.horiz?h:b),!0)-p,x=g.toValue(g.toPixels(k,!0)+(g.horiz?h:b),!0)-k,r={},t,w=a.points[e.id],v;for(v in c)if(c.hasOwnProperty(v)){if(void 0!==t){t=!1;break}t=!0}n(c,function(a,b){var c=w[b],l;l=c+("x"===a.axis?m:x);var g=a.axis.toUpperCase(),h=f[g.toLowerCase()+"Axis"].categories?
+1:0,h=u(d["dragPrecision"+g],h),y=u(d["dragMin"+g],-Infinity),g=u(d["dragMax"+g],Infinity);h&&(l=Math.round(l/h)*h);l=Math.max(y,Math.min(g,l));t&&a.propValidate&&!a.propValidate(l,e)||void 0===c||(r[b]=l)});return r};h.Series.prototype.getGuideBox=function(a){var b=this.chart,c=Infinity,e=-Infinity,f=Infinity,d=-Infinity,g;a.forEach(function(a){(a=a.graphic&&a.graphic.getBBox()||a.shapeArgs)&&(a.width||a.height||a.x||a.y)&&(g=!0,c=Math.min(a.x,c),e=Math.max(a.x+a.width,e),f=Math.min(a.y,f),d=Math.max(a.y+
+a.height,d))});return g?b.renderer.rect(c,f,e-c,d-f):b.renderer.g()};h.Point.prototype.showDragHandles=function(){var a=this,b=a.series,c=b.chart,e=c.renderer,f=q(b.options.dragDrop,a.options.dragDrop);n(b.dragDropProps,function(d,g){var h=q(V,d.handleOptions,f.dragHandle),l={className:h.className,"stroke-width":h.lineWidth,fill:h.color,stroke:h.lineColor},m=h.pathFormatter||d.handleFormatter,k=d.handlePositioner,n;n=d.validateIndividualDrag?d.validateIndividualDrag(a):!0;d.resize&&n&&d.resizeSide&&
+m&&(f["draggable"+d.axis.toUpperCase()]||f[d.optionName])&&!1!==f[d.optionName]&&(c.dragHandles||(c.dragHandles={group:e.g("drag-drop-handles").add(b.markerGroup||b.group)}),c.dragHandles.point=a.id,k=k(a),l.d=n=m(a),m="function"===typeof d.resizeSide?d.resizeSide(a.options,a):d.resizeSide,!n||0>k.x||0>k.y||(l.cursor=h.cursor||"x"===d.axis!==!!c.inverted?"ew-resize":"ns-resize",(d=c.dragHandles[m])||(d=c.dragHandles[m]=e.path().add(c.dragHandles.group)),d.translate(k.x,k.y).attr(l),w(d.element,["touchstart",
+"mousedown"],function(b){b=t(b,c);var d=a.series.chart;d.zoomOrPanKeyPressed(b)||(d.mouseIsDown=!1,D(b,a),d.dragDropData.updateProp=b.updateProp=g,a.firePointEvent("dragStart",b),b.stopPropagation(),b.preventDefault())}),p(c.dragHandles.group.element,"mouseover",function(){c.dragDropData=c.dragDropData||{};c.dragDropData.isHoveringHandle=a.id}),w(c.dragHandles.group.element,["touchend","mouseout"],function(){var b=a.series.chart;b.dragDropData&&a.id===b.dragDropData.isHoveringHandle&&delete b.dragDropData.isHoveringHandle;
+b.hoverPoint||F(a)})))})};h.Chart.prototype.hideDragHandles=function(){this.dragHandles&&(n(this.dragHandles,function(a,b){"group"!==b&&a.destroy&&a.destroy()}),this.dragHandles.group&&this.dragHandles.group.destroy&&this.dragHandles.group.destroy(),delete this.dragHandles)};p(h.Point,"mouseOver",function(){var a=this;setTimeout(function(){var b=a.series,c=b&&b.chart,d=c&&c.dragDropData;!c||d&&d.isDragging&&d.draggedPastSensitivity||c.isDragDropAnimating||!b.options.dragDrop||c.options&&c.options.chart&&
+c.options.chart.options3d||(c.dragHandles&&c.hideDragHandles(),a.showDragHandles())},12)});p(h.Point,"mouseOut",function(){var a=this;setTimeout(function(){a.series&&F(a)},10)});p(h.Point,"remove",function(){var a=this.series.chart,b=a.dragHandles;b&&b.point===this.id&&a.hideDragHandles()});h.Chart.prototype.zoomOrPanKeyPressed=function(a){var b=this.userOptions.chart||{},c=b.panKey&&b.panKey+"Key";return a[b.zoomKey&&b.zoomKey+"Key"]||a[c]};p(h.Chart,"render",function(){this.hasAddedDragDropEvents||
+T(this)})})(m)});
+//# sourceMappingURL=draggable-points.js.map

data/vendor/assets/javascripts/highstock/modules/draggable-points.js.map

@@ -0,0 +1 @@
+{"version":3,"file":"draggable-points.js.map","lineCount":39,"mappings":"A;;;;;;;AAQC,SAAS,CAACA,CAAD,CAAU,CACM,QAAtB,GAAI,MAAOC,OAAX,EAAkCA,MAAAC,QAAlC,EACIF,CAAA,CAAQ,SAAR,CACA,CADqBA,CACrB,CAAAC,MAAAC,QAAA,CAAiBF,CAFrB,EAG6B,UAAtB,GAAI,MAAOG,OAAX,EAAoCA,MAAAC,IAApC,CACHD,MAAA,CAAO,QAAS,EAAG,CACf,MAAOH,EADQ,CAAnB,CADG,CAKHA,CAAA,CAA8B,WAAtB,GAAA,MAAOK,WAAP,CAAoCA,UAApC,CAAiDC,IAAAA,EAAzD,CATY,CAAnB,CAAA,CAWC,QAAS,CAACD,CAAD,CAAa,CACnB,SAAS,CAACE,CAAD,CAAI,CAkKVC,QAASA,EAAc,CAACC,CAAD,CAAO,CAC1B,MAAO,CACHC,KAAM,OADH,CAEHC,MAAO,MAFJ,CAGHC,IAAK,QAHF,CAIHC,OAAQ,KAJL,CAAA,CAKLJ,CALK,CADmB,CAmkC9BK,QAASA,EAAiB,CAACC,CAAD,CAAS,CAAA,IAC3BC,EAAQ,CAAC,YAAD,CAAe,YAAf,CADmB,CAE3BC,CAGJC,EAAA,CAAWH,CAAAI,cAAX,CAAiC,QAAS,CAACC,CAAD,CAAM,CACxCA,CAAAC,WAAJ,EACIL,CAAAM,KAAA,CAAWF,CAAAC,WAAX,CAFwC,CAAhD,CASA,KADAJ,CACA,CADID,CAAAO,OACJ,CAAON,CAAA,EAAP,CAAA,CACI,GAAIF,CAAAS,QAAAC,SAAA,CAAwBT,CAAA,CAAMC,CAAN,CAAxB,CAAJ,CACI,MAAO,CAAA,CAhBgB,CAmCnCS,QAASA,EAAgB,CAACC,CAAD,CAAQ,CAC7B,IAAIV;AAAIU,CAAAZ,OAAA,CAAeY,CAAAZ,OAAAQ,OAAf,CAAqC,CAE7C,IAAII,CAAAC,mBAAJ,EAAiCC,CAAAF,CAAAE,MAAjC,CACI,IAAA,CAAOZ,CAAA,EAAP,CAAA,CACI,GACIU,CAAAZ,OAAA,CAAaE,CAAb,CAAAO,QAAAC,SADJ,EAEIX,CAAA,CAAkBa,CAAAZ,OAAA,CAAaE,CAAb,CAAlB,CAFJ,CAII,MAAO,CAAA,CATU,CA6BjCa,QAASA,EAAc,CAACC,CAAD,CAAQ,CAAA,IACvBhB,EAASgB,CAAAhB,OADc,CAEvBiB,EAAwBjB,CAAAS,QAAAC,SAAxBO,EAAmD,EACnDC,EAAAA,CAAuBF,CAAAP,QAAvBS,EAAwCF,CAAAP,QAAAC,SAHjB,KAKvBS,CALuB,CAMvBC,CAEJjB,EAAA,CAJkBH,CAAAI,cAIlB,CAAwB,QAAS,CAACiB,CAAD,CAAI,CAClB,GAAf,GAAIA,CAAAC,KAAJ,EAAsBD,CAAAE,KAAtB,CACIJ,CADJ,CACkB,CAAA,CADlB,CAEsB,GAFtB,GAEWE,CAAAC,KAFX,EAE6BD,CAAAE,KAF7B,GAGIH,CAHJ,CAGkB,CAAA,CAHlB,CADiC,CAArC,CAUA,QACIH,CAAAO,WADJ,EACwCL,CADxC,EAEQF,CAAAQ,WAFR,EAE4CL,CAF5C,GAII,EACIF,CADJ,EAEwC,CAAA,CAFxC,GAEIA,CAAAM,WAFJ,EAGwC,CAAA,CAHxC,GAGIN,CAAAO,WAHJ,CAJJ,EASIzB,CAAA0B,MATJ,EAUI1B,CAAA2B,MA5BuB,CA4C/BC,QAASA,EAAkB,CAACC,CAAD,CAAIjB,CAAJ,CAAW,CAClC,MAAoBrB,KAAAA,EAAb,GAAAsC,CAAAC,OAAA,EAAuCvC,IAAAA,EAAvC,GAA0BsC,CAAAE,OAA1B,CACHnB,CAAAoB,QAAAC,UAAA,CAAwBJ,CAAxB,CADG,CAC0BA,CAFC,CAgCtCK,QAASA,EAAS,CAACC,CAAD;AAAKC,CAAL,CAAYC,CAAZ,CAAgB5B,CAAhB,CAAyB,CACvC,IAAI6B,EAAcF,CAAAG,IAAA,CAAU,QAAS,CAACC,CAAD,CAAO,CACxC,MAAOC,EAAA,CAASN,CAAT,CAAaK,CAAb,CAAmBH,CAAnB,CAAuB5B,CAAvB,CADiC,CAA1B,CAIlB,OAAO,SAAS,EAAG,CACf6B,CAAAI,QAAA,CAAoB,QAAS,CAACL,CAAD,CAAK,CAC9BA,CAAA,EAD8B,CAAlC,CADe,CALoB,CAiC3CM,QAASA,EAAyB,CAACd,CAAD,CAAIjB,CAAJ,CAAWgC,CAAX,CAAwB,CAAA,IAClDC,EAAOjC,CAAAkC,aAAAC,OACPC,EAAAA,CAAOH,CAAAf,OACPmB,KAAAA,EAAOJ,CAAAd,OAAPkB,CACAC,EAAOrB,CAAAC,OACPqB,EAAAA,CAAOtB,CAAAE,OAMX,OALeqB,KAAAC,KAAAC,EACNJ,CADMI,CACCN,CADDM,GACUJ,CADVI,CACiBN,CADjBM,GAENH,CAFMG,CAECL,CAFDK,GAEUH,CAFVG,CAEiBL,CAFjBK,EAKf,CAAkBV,CAXoC,CAmC1DW,QAASA,EAAmB,CAAC1B,CAAD,CAAI2B,CAAJ,CAAYC,CAAZ,CAAsB,CAC9C,IAAIC,EAAM,CACN5B,OAAQD,CAAAC,OADF,CAENC,OAAQF,CAAAE,OAFF,CAGN0B,SAAUA,CAAVA,EAAsB,CAClBE,EAAGF,CAAAG,KAAA,CAAc,GAAd,CADe,CAElBC,EAAGJ,CAAAG,KAAA,CAAc,GAAd,CAFe,CAGlBE,MAAOL,CAAAG,KAAA,CAAc,OAAd,CAHW,CAIlBG,OAAQN,CAAAG,KAAA,CAAc,QAAd,CAJU,CAHhB,CASNJ,OAAQ,EATF,CAaVA,EAAAd,QAAA,CAAe,QAAS,CAAC1B,CAAD,CAAQ,CAC5B,IAAIgD,EAAa,EAIjB7D,EAAA,CAAWa,CAAAhB,OAAAI,cAAX,CAAuC,QAAS,CAACC,CAAD,CAAM4D,CAAN,CAAW,CACvDD,CAAA,CAAWC,CAAX,CAAA,CAAkBjD,CAAA,CAAMiD,CAAN,CADqC,CAA3D,CAGAD,EAAAhD,MAAA,CAAmBA,CACnB0C,EAAAF,OAAA,CAAWxC,CAAAkD,GAAX,CAAA,CAAuBF,CATK,CAAhC,CAYA;MAAON,EA1BuC,CA2ClDS,QAASA,EAAgB,CAACnD,CAAD,CAAQ,CAAA,IACzBhB,EAASgB,CAAAhB,OADgB,CAEzBoE,EAAWpE,CAAAS,QAAAC,SAAA2D,QAEf,OAAOrD,EAAAP,QAAA,CAAc2D,CAAd,CAAA,CAEHpE,CAAAwD,OAAAc,OAAA,CAAqB,QAAS,CAACC,CAAD,CAAe,CACzC,MAAOA,EAAA9D,QAAA,CAAqB2D,CAArB,CAAP,GAA0CpD,CAAAP,QAAA,CAAc2D,CAAd,CADD,CAA7C,CAFG,CAMH,CAACpD,CAAD,CAVyB,CA8EjCwD,QAASA,EAAY,CAAC3C,CAAD,CAAIb,CAAJ,CAAW,CAAA,IACxByD,EAAgBN,CAAA,CAAiBnD,CAAjB,CADQ,CAExBhB,EAASgB,CAAAhB,OAFe,CAGxBY,EAAQZ,CAAAY,MAHgB,CAIxB6C,CAGCiB,EAAA,CACD1E,CAAAS,QAAAC,SADC,EAC0BV,CAAAS,QAAAC,SAAAiE,WAD1B,CAED,CAAA,CAFC,CAAL,GAII/D,CAAAgE,aACA,CADqBnB,CACrB,CADgCzD,CAAA6E,YAAA,CAAmBJ,CAAnB,CAChC,CAAA7D,CAAAkE,iBAAA,CAAuB,SAAvB,CAAkC9E,CAAAS,QAAAC,SAAA+C,SAAlC,CAAAsB,IAAA,CACS/E,CAAAgF,MADT,CALJ,CAUApE,EAAAkC,aAAA,CAAqB,CACjBC,OAAQQ,CAAA,CAAoB1B,CAApB,CAAuB4C,CAAvB,CAAsChB,CAAtC,CADS,CAEjBzC,MAAOA,CAFU,CAGjByD,cAAeA,CAHE,CAIjBQ,WAAY,CAAA,CAJK,CAjBO,CA2ChCC,QAASA,EAAY,CAACpC,CAAD,CAAeqC,CAAf,CAAuB,CAAA,IACpCnE,EAAQ8B,CAAA9B,MAD4B,CAGpCP,EAAU2E,CAAA,CADDpE,CAAAhB,OACOS,QAAAC,SAAN;AAA+BM,CAAAP,QAAAC,SAA/B,CAH0B,CAIpC2E,EAAc,EAJsB,CAKpCC,EAAaxC,CAAAyC,WALuB,CAMpCC,EAAU,EAIdrF,EAAA,CAAWa,CAAAhB,OAAAI,cAAX,CAAuC,QAAS,CAACC,CAAD,CAAM4D,CAAN,CAAW,CAGvD,GACIqB,CAAAA,CADJ,EAEQA,CAFR,GAEuBrB,CAFvB,EAGS5D,CAAAoF,OAHT,GAIQnF,CAAAD,CAAAC,WAJR,EAIsD,CAAA,CAJtD,GAI0BG,CAAA,CAAQJ,CAAAC,WAAR,CAJ1B,EAaA,GACIgF,CADJ,EAEQjF,CAAAkB,KAFR,GAIyB,GAJzB,GAIYlB,CAAAiB,KAJZ,EAIgCb,CAAAe,WAJhC,EAKyB,GALzB,GAKYnB,CAAAiB,KALZ,EAKgCb,CAAAgB,WALhC,EASI4D,CAAA,CAAYpB,CAAZ,CAAA,CAAmB5D,CAzBgC,CAA3D,CA8BAqC,EAAC4C,CAAA,CACG,CAACtE,CAAD,CADH,CAEG8B,CAAA2B,cAFJ/B,SAAA,CAGI,QAAS,CAACrB,CAAD,CAAI,CACTmE,CAAA,CAAQnE,CAAA6C,GAAR,CAAA,CAAgB,CACZlD,MAAOK,CADK,CAEZqE,UAAWrE,CAAAsE,cAAA,CACP7C,CAAAC,OADO,CACcoC,CADd,CACsBE,CADtB,CAFC,CADP,CAHjB,CAYA,OAAOG,EApDiC,CAoE5CI,QAASA,EAAY,CAAChF,CAAD,CAAQiF,CAAR,CAAiB,CAAA,IAC9BC,EAAYlF,CAAAkC,aAAAgD,UACZC,EAAAA,CAA0B,CAAA,CAAZ,GAAAF,CAAA,CAAoB,CAAA,CAApB,CAA4BT,CAAA,CAAM,CAC5CY,SAAU,GADkC,CAAN,CAEvCpF,CAAAH,QAAAwF,UAFuC,CAI9CrF,EAAAsF,oBAAA,CAA4B,CAAA,CAG5B/F,EAAA,CAAW2F,CAAX,CAAsB,QAAS,CAACK,CAAD,CAAW,CACtCA,CAAAnF,MAAAoF,OAAA,CAAsBD,CAAAT,UAAtB;AAA0C,CAAA,CAA1C,CADsC,CAA1C,CAIA9E,EAAAyF,OAAA,CAAaN,CAAb,CAKAO,WAAA,CAAW,QAAS,EAAG,CACnB,OAAO1F,CAAAsF,oBACHtF,EAAA2F,WAAJ,EAAyBC,CAAA5F,CAAA4F,YAAzB,EACI5F,CAAA2F,WAAAE,gBAAA,EAHe,CAAvB,CAKGV,CAAAC,SALH,CAlBkC,CAyUtCU,QAASA,EAAQ,CAAC1F,CAAD,CAAQ,CAAA,IACjBJ,EAAQI,CAAAhB,OAARY,EAAwBI,CAAAhB,OAAAY,MADP,CAEjBkC,EAAelC,CAAfkC,EAAwBlC,CAAAkC,aAGxBlC,EAAAA,CADJ,EAEI4F,CAAA5F,CAAA4F,YAFJ,EAIQ1D,CAJR,GAMYA,CAAAmC,WANZ,EAOYnC,CAAA6D,uBAPZ,EAQY7D,CAAA8D,iBARZ,GAQ8C5F,CAAAkD,GAR9C,GAYItD,CAAAiG,gBAAA,EAhBiB,CAsOzBC,QAASA,EAAU,CAACC,CAAD,CAAS,CACxB,IAAIC,EAAQ,CAAZ,CAES3F,CAAT,KAASA,CAAT,GAAc0F,EAAd,CACQA,CAAAE,eAAA,CAAsB5F,CAAtB,CAAJ,EACI2F,CAAA,EAGR,OAAOA,EARiB,CAyB5BE,QAASA,EAAY,CAACH,CAAD,CAAS,CAC1B,IAAK1F,IAAIA,CAAT,GAAc0F,EAAd,CACI,GAAIA,CAAAE,eAAA,CAAsB5F,CAAtB,CAAJ,CACI,MAAO0F,EAAA,CAAO1F,CAAP,CAHW,CA2D9B8F,QAASA,EAAS,CAACtF,CAAD,CAAIjB,CAAJ,CAAW,CAEzB,GAAI,CAAAA,CAAAwG,oBAAA,CAA0BvF,CAA1B,CAAJ,CAAA,CAFyB,IAMrBiB;AAAelC,CAAAkC,aANM,CAOrB9B,CAPqB,CAQrBqG,CAEAC,EAAAA,CAAe,CAGfxE,EAAJ,EAAoBA,CAAAmC,WAApB,GACIjE,CAqBA,CArBQ8B,CAAA9B,MAqBR,CApBAqG,CAoBA,CApBqBrG,CAAAhB,OAAAS,QAAAC,SAoBrB,CAjBAmB,CAAA0F,eAAA,EAiBA,CAdKzE,CAAA6D,uBAcL,GAbI7D,CAAA6D,uBAaJ,CAb0ChE,CAAA,CAClCd,CADkC,CAC/BjB,CAD+B,CACxB8D,CAAA,CACN1D,CAAAP,QAAAC,SADM,EAEFM,CAAAP,QAAAC,SAAA8G,gBAFE,CAGNH,CAHM,EAIFA,CAAAG,gBAJE,CAp6CGC,CAo6CH,CADwB,CAa1C,EAAI3E,CAAA6D,uBAAJ,GAEI7D,CAAAgD,UAUA,CAVyBZ,CAAA,CAAapC,CAAb,CAA2BjB,CAA3B,CAUzB,CAPAiE,CAOA,CAPYhD,CAAAgD,UAOZ,CANAwB,CAMA,CANeR,CAAA,CAAWhB,CAAX,CAMf,CALAK,CAKA,CAL4B,CAAjB,GAAAmB,CAAA,CACPJ,CAAA,CAAapB,CAAb,CADO,CAEP,IAGJ,CAAA9E,CAAA0G,eAAA,CAAqB,MAArB,CAA6B,CACzB3E,OAAQD,CAAAC,OADiB,CAEzB+C,UAAWhD,CAAAgD,UAFc,CAGzBK,SAAUA,CAAVA,EAAsBA,CAAAT,UAHG,CAIzBiC,WAAYxB,CAAZwB,EAAwBxB,CAAAnF,MAAAkD,GAJC,CAKzBoD,aAAcA,CALW,CAMzBxF,OAAQD,CAAAC,OANiB,CAOzBC,OAAQF,CAAAE,OAPiB,CAA7B,CAQG,QAAS,EAAG,CAhmBC,IACpB/B;AAgmBoBgB,CAhmBXhB,OADW,CAEpBY,EAAQZ,CAAAY,MAFY,CAGpBgH,EAAOhH,CAAAkC,aAHa,CAIpBrC,EAAU2E,CAAA,CAAMpF,CAAAS,QAAAC,SAAN,CA6lBUM,CA7lBqBP,QAAAC,SAA/B,CAJU,CAKpBc,EAAaf,CAAAe,WALO,CAMpBC,EAAahB,CAAAgB,WANO,CAOpBsB,EAAS6E,CAAA7E,OAPW,CAQpB8E,EAylBiBhG,CAzlBZC,OAAL+F,CAAgB9E,CAAAjB,OARI,CASpBgG,EAwlBiBjG,CAxlBZE,OAAL+F,CAAgB/E,CAAAhB,OATI,CAUpBgG,EAAQF,CAVY,CAWpBtC,EAAaqC,CAAArC,WAGb3E,EAAAoH,SAAJ,GACIH,CACA,CADK,CAACC,CACN,CAAAA,CAAA,CAAK,CAACC,CAFV,CAOA,IAAIrD,CAAA,CAAKjE,CAAAkE,WAAL,CAAyB,CAAA,CAAzB,CAAJ,CACIiB,CAAA,CAAahF,CAAb,CAAoB,CAAA,CAApB,CAGA,CAwkBoBI,CAxkBpByF,gBAAA,EAJJ,KAQI,IAAIlB,CAAJ,CAAA,CAE0BsC,IAAAA,EAAAA,CAAAA,CAAIC,EAAAA,CAAJD,CA7E1B7H,EA+oBoBgB,CA/oBXhB,OA6EiB6H,CA5E1BjH,EAAQZ,CAAAY,MA4EkBiH,CA3E1B/E,EAAelC,CAAAkC,aA2EW+E,CA1E1BI,CA0E0BJ,CAzE1B1B,CAyE0B0B,CAxE1BvC,EAAatF,CAAAI,cAAA,CAAqB0C,CAAAyC,WAArB,CAGjBY,EAAA,CAAWrD,CAAAgD,UAAA,CAuoBa9E,CAvoBUkD,GAAvB,CAAAwB,UACXuC,EAAA,CAA8C,UAAjC,GAAA,MAAO3C,EAAA2C,WAAP,CACT3C,CAAA2C,WAAA,CAAsB9B,CAAtB,CAqoBoBnF,CAroBpB,CADS,CACgCsE,CAAA2C,WAGzC3C,EAAA4C,aAAJ,EACI5C,CAAA4C,aAAA,CAAwBtH,CAAAgE,aAAxB,CAA4CuB,CAA5C,CAioBoBnF,CAjoBpB,CAKA4D,KAAAA;AAAAhE,CAAAgE,aAAAA,CACA,EAAoB,GAApB,GAAAU,CAAAhE,KAAA,EAA2BtB,CAAA2B,MAAAwG,SAA3B,EACoB,GADpB,GACA7C,CAAAhE,KADA,EAC2BtB,CAAA0B,MAAAyG,SAD3B,CAEI1I,CAAA,CAAewI,CAAf,CAFJ,CAEiCA,CAHjCrD,CAKO,EAAoB,GAApB,GAAAU,CAAAhE,KAAA,CACCuG,CADD,EACO/E,CAAAC,OAAAqF,OADP,EACqC,CADrC,EAC0C,CANjDxD,CAOO,EAAoB,GAApB,GAAAU,CAAAhE,KAAA,CACCwG,CADD,EACOhF,CAAAC,OAAAsF,OADP,EACqC,CADrC,EAC0C,CARjDzD,CAzNA0D,CAEJ,QAAQC,CAAR,EACA,KAAK,MAAL,CACID,CAAA,CAAc,CACV3E,EAAG6E,CAAA5E,KAAA,CAAU,GAAV,CAAHD,CAAoBA,CADV,CAEVG,MAAOV,IAAAqF,IAAA,CAAS,CAAT,CAAYD,CAAA5E,KAAA,CAAU,OAAV,CAAZ,CAAiCD,CAAjC,CAFG,CAId,MACJ,MAAK,OAAL,CACI2E,CAAA,CAAc,CACVxE,MAAOV,IAAAqF,IAAA,CAAS,CAAT,CAAYD,CAAA5E,KAAA,CAAU,OAAV,CAAZ,CAAiCD,CAAjC,CADG,CAGd,MACJ,MAAK,KAAL,CACI2E,CAAA,CAAc,CACVzE,EAAG2E,CAAA5E,KAAA,CAAU,GAAV,CAAHC,CAAoBA,CADV,CAEVE,OAAQX,IAAAqF,IAAA,CAAS,CAAT,CAAYD,CAAA5E,KAAA,CAAU,QAAV,CAAZ,CAAkCC,CAAlC,CAFE,CAId,MACJ,MAAK,QAAL,CACIyE,CAAA,CAAc,CACVvE,OAAQX,IAAAqF,IAAA,CAAS,CAAT,CAAYD,CAAA5E,KAAA,CAAU,QAAV,CAAZ,CAAkCC,CAAlC,CADE,CAnBlB,CAyBA2E,CAAA5E,KAAA,CAAU0E,CAAV,CAsPI,CAAA,IAKI1H,EAAAgE,aAAA8D,UAAA,CACIlH,CAAA,CAAaqG,CAAb,CAAkB,CADtB,CACyBpG,CAAA,CAAaqG,CAAb,CAAkB,CAD3C,CAOR/E,EAAAqF,OAAA;AAAgBP,CAChB9E,EAAAsF,OAAA,CAAgBP,CAsjBO,CARf,CAZJ,CAtBJ,CAXA,CAFyB,CA2E7Ba,QAASA,EAAO,CAAC9G,CAAD,CAAIjB,CAAJ,CAAW,CACvB,IAAIkC,EAAelC,CAAAkC,aAEnB,IACIA,CADJ,EAEIA,CAAAmC,WAFJ,EAGInC,CAAA6D,uBAHJ,CAIE,CAAA,IACM3F,EAAQ8B,CAAA9B,MADd,CAEM8E,EAAYhD,CAAAgD,UAFlB,CAGMwB,EAAeR,CAAA,CAAWhB,CAAX,CAHrB,CAIMK,EAA4B,CAAjB,GAAAmB,CAAA,CACPJ,CAAA,CAAapB,CAAb,CADO,CAEP,IAGJlF,EAAA4F,YAAJ,EACI5F,CAAAiG,gBAAA,EAIJhF,EAAA0F,eAAA,EACA3G,EAAAgI,YAAA,CAAoB,CAAA,CAIpB5H,EAAA0G,eAAA,CAAqB,MAArB,CAA6B,CACzB3E,OAAQD,CAAAC,OADiB,CAEzBjB,OAAQD,CAAAC,OAFiB,CAGzBC,OAAQF,CAAAE,OAHiB,CAIzB+D,UAAWA,CAJc,CAKzBwB,aAAcA,CALW,CAMzBnB,SAAUA,CAAVA,EAAsBA,CAAAT,UANG,CAOzBiC,WAAYxB,CAAZwB,EAAwBxB,CAAAnF,MAAAkD,GAPC,CAA7B,CAQG,QAAS,EAAG,CACX0B,CAAA,CAAahF,CAAb,CADW,CARf,CAnBF,CAiCF,OAAOA,CAAAkC,aAIHlC,EAAAgE,aAAJ,GACIhE,CAAAgE,aAAAiE,QAAA,EACA,CAAA,OAAOjI,CAAAgE,aAFX,CA5CuB,CAwK3BkE,QAASA,EAAiB,CAAClI,CAAD,CAAQ,CAAA,IAC1BmI,EAAYnI,CAAAmI,UADc;AAE1BC,EAAMxJ,CAAAwJ,IAGNrI,EAAA,CAAiBC,CAAjB,CAAJ,GACIsB,CAAA,CAAU6G,CAAV,CAAqB,CAAC,WAAD,CAAc,YAAd,CAArB,CAAkD,QAAS,CAAClH,CAAD,CAAI,CACjD,CAAA,CAAAD,CAAA,CAAmBC,CAAnB,CAAsBjB,CAAtB,CAhHO,KACrBqI,EA+G4CrI,CA/GhC2F,WADS,CAErB2C,EAAkB1J,CAAA4F,MAAA,CACd6D,CAAAjJ,OAAAS,QAAAC,SADc,CAEduI,CAAAxI,QAAAC,SAFc,CAFG,CAMrBc,EAAa0H,CAAA1H,WAAbA,EAA2C,CAAA,CANtB,CAOrBC,EAAayH,CAAAzH,WAAbA,EAA2C,CAAA,CAyGCb,EAtGhDgI,YAAA,CAAoB,CAAA,CAGdpH,EAAAA,CAAN,EAAoBC,CAAAA,CAApB,EAmGgDb,CA9F5CwG,oBAAA,CAA0BvF,CAA1B,CALJ,GAmGgDjB,CAzF5CkC,aAAJ,EAyFgDlC,CAzFtBkC,aAAAmC,WAA1B,CACI0D,CAAA,CAAQ9G,CAAR,CAwF4CjB,CAxF5C,CADJ,CAMIqI,CANJ,EAMiBlI,CAAA,CAAekI,CAAf,CANjB,GAyFgDrI,CAlF5CuI,YAEA,CAFoB,CAAA,CAEpB,CADA3E,CAAA,CAAa3C,CAAb,CAAgBoH,CAAhB,CACA,CAAAA,CAAAvB,eAAA,CAAyB,WAAzB,CAAsC7F,CAAtC,CATJ,CAVA,CAkGmE,CAA/D,CAqBA,CAlBAK,CAAA,CAAU6G,CAAV,CAAqB,CAAC,WAAD,CAAc,WAAd,CAArB,CAAiD,QAAS,CAAClH,CAAD,CAAI,CAC1DsF,CAAA,CAAUvF,CAAA,CAAmBC,CAAnB,CAAsBjB,CAAtB,CAAV,CAAwCA,CAAxC,CAD0D,CAA9D,CAkBA,CAfA6B,CAAA,CAASsG,CAAT,CAAoB,YAApB,CAAkC,QAAS,CAAClH,CAAD,CAAI,CAC3C8G,CAAA,CAAQ/G,CAAA,CAAmBC,CAAnB,CAAsBjB,CAAtB,CAAR,CAAsCA,CAAtC,CAD2C,CAA/C,CAeA,CAZAA,CAAAwI,sBAYA,CAZ8BlH,CAAA,CAC1B8G,CAD0B,CAE1B,CAAC,SAAD,CAAY,UAAZ,CAF0B;AAG1B,QAAS,CAACnH,CAAD,CAAI,CACT8G,CAAA,CAAQ/G,CAAA,CAAmBC,CAAnB,CAAsBjB,CAAtB,CAAR,CAAsCA,CAAtC,CADS,CAHa,CAY9B,CAHAA,CAAAyI,uBAGA,CAH+B,CAAA,CAG/B,CAAA5G,CAAA,CAAS7B,CAAT,CAAgB,SAAhB,CAA2B,QAAS,EAAG,CAC/BA,CAAAwI,sBAAJ,EACIxI,CAAAwI,sBAAA,EAF+B,CAAvC,CAtBJ,CAL8B,CAnhFxB,IA+IN3G,EAAWjD,CAAAiD,SA/IL,CAgJNtC,EAAaX,CAAAW,WAhJP,CAiJNuE,EAAOlF,CAAAkF,KAjJD,CAkJNU,EAAQ5F,CAAA4F,MAlJF,CAmJNkE,EAAc9J,CAAA8J,YAnJR,CAuNNC,EAAuBA,QAAS,CAACvI,CAAD,CAAQ,CACpCwI,CAAAA,CAAYxI,CAAAwI,UAAZA,EAA+BxI,CAAAyI,QAAAC,QAAA,EADK,KAEpC7J,EAAM2J,CAAAG,EAAN9J,EAAqB,CAFe,CAIpC+J,EAAUJ,CAAAzF,OAAV6F,CAA6B,CAEjC,OAAO,CAEH,GAFG,CAEE,CAFF,CAEK/J,CAFL,CAGH,GAHG,CAGE,CAHF,CAGK+J,CAHL,CAGe,CAHf,CAKH,GALG,CAKE,CALF,CAKK,CALL,CAKQ,CALR,CAKW,CALX,CAKc,CALd,CAKiB,CALjB,CAKoBA,CALpB,CAK8B,CAL9B,CAMH,GANG,CAME,CANF,CAMK,CANL,CAMQ,CANR,CAMW,CANX,CAMc,CANd,CAMiB,CANjB,CAMoBA,CANpB,CAM8B,CAN9B,CAQH,GARG,CAQE,CARF,CAQKA,CARL,CAQe,CARf,CASH,GATG,CASE,CATF,CAHMJ,CAAAzF,OAGN,CAHyBlE,CAGzB,CANiC,CAvNlC,CA2ONgK,EAAoBP,CAAAQ,KAAAC,UAAA3J,cAApByJ,CAA+D,CAC/DlG,EAAG,CACCrC,KAAM,GADP,CAECC,KAAM,CAAA,CAFP,CAD4D,CAK/DsC,EAAG,CACCvC,KAAM,GADP,CAECC,KAAM,CAAA,CAFP,CAL4D,CAY/D+H,EAAAU,MAAJ,GACIV,CAAAU,MAAAD,UAAA3J,cADJ,CACgDyJ,CADhD,CAMA,KAAII,EAAsBX,CAAAY,OAAAH,UAAA3J,cAAtB6J;AAAmE,CACnEtG,EAAG,CACCrC,KAAM,GADP,CAECC,KAAM,CAAA,CAFP,CADgE,CAKnEsC,EAAG,CACCvC,KAAM,GADP,CAECC,KAAM,CAAA,CAFP,CAGCkE,OAAQ,CAAA,CAHT,CAKCyC,aAAcA,QAAS,CAACzE,CAAD,CAAW0G,CAAX,CAAsBnJ,CAAtB,CAA6B,CAAA,IAK5CoJ,EAAYpJ,CAAAhB,OAAAqK,oBALgC,CAM5CxG,EAAIJ,CAAAG,KAAA,CAAc,GAAd,CAIJuG,EAAAtG,EAAJ,EAAmB7C,CAAAhB,OAAAS,QAAA2J,UAAnB,EAEIrG,CAEA,CAFSN,CAAAG,KAAA,CAAc,QAAd,CAET,CAAAH,CAAAG,KAAA,CAAc,CACVG,OAAQX,IAAAqF,IAAA,CAAS,CAAT,CAAYrF,IAAAkH,MAAA,CAAWvG,CAAX,EAFjBqG,CAAAG,CAAYH,CAAZG,EAAyB1G,CAAzB0G,CAA6BxG,CAA7BwG,EAAuC,CAEtB,EAAZ,CADE,CAAd,CAJJ,EASI9G,CAAAG,KAAA,CAAc,CACVC,EAAGT,IAAAkH,MAAA,CAAWzG,CAAX,EAAgBuG,CAAA,CAAYA,CAAZ,CAAwBvG,CAAxB,CAA4B,CAA5C,EADO,CAAd,CAnB4C,CALrD,CA+BCoE,WAAYA,QAAS,CAACkC,CAAD,CAAYnJ,CAAZ,CAAmB,CAAA,IAEhCwF,EADQxF,CAAAhB,OAAAY,MACM4F,YACd9G,EAAAA,CAAOyK,CAAAtG,EAAA,GAAgB7C,CAAAhB,OAAAS,QAAA2J,UAAhB,EAAkD,CAAlD,EACH,KADG,CACK,QACZI,EAAAA,CAAW/K,CAAA,CAAeC,CAAf,CAGX8G,EAAA,CAAYgE,CAAZ,CAAJ,GACIhE,CAAA,CAAYgE,CAAZ,CAAA3B,QAAA,EACA,CAAA,OAAOrC,CAAA,CAAYgE,CAAZ,CAFX,CAIA,OAAO9K,EAZ6B,CA/BzC,CA8CC+K,iBAAkBA,QAAS,CAACzJ,CAAD,CAAQ,CAC/B,IAAI0J,EAAO1J,CAAAwI,UAAPkB,EAA0B1J,CAAAyI,QAAAC,QAAA,EAE9B;MAAO,CACH/F,EAAG+G,CAAA/G,EADA,CAEHE,EAAG7C,CAAA6C,EAAA,GAAY7C,CAAAhB,OAAAS,QAAA2J,UAAZ,EAA8C,CAA9C,EACCM,CAAA7G,EADD,CACU6G,CAAA7G,EADV,CACmB6G,CAAA3G,OAHnB,CAHwB,CA9CpC,CAwDC4G,gBAAiBA,QAAS,CAAC3J,CAAD,CAAQ,CAC1BwI,CAAAA,CAAYxI,CAAAwI,UADc,KAE1BoB,EAASpB,CAAAG,EAATiB,EAAwB,CAFE,CAG1BC,EAAUrB,CAAA1F,MAAV+G,CAA4B,CAEhC,OAAO,CAEH,GAFG,CAEED,CAFF,CAEU,CAFV,CAGH,GAHG,CAGEC,CAHF,CAGY,CAHZ,CAGe,CAHf,CAKH,GALG,CAKE,CALF,CAKK,CALL,CAKQ,CALR,CAKW,CALX,CAKc,CALd,CAKiBA,CALjB,CAK2B,CAL3B,CAK8B,CAL9B,CAMH,GANG,CAME,CANF,CAMK,CANL,CAMQ,CANR,CAMW,CANX,CAMc,CANd,CAMiBA,CANjB,CAM2B,CAN3B,CAM8B,CAN9B,CAQH,GARG,CAQEA,CARF,CAQY,CARZ,CAQe,CARf,CASH,GATG,CASErB,CAAA1F,MATF,CASoB8G,CATpB,CAS4B,CAT5B,CALuB,CAxDnC,CALgE,CAkFnEtB,EAAAwB,OAAJ,GACIxB,CAAAwB,OAAAf,UAAA3J,cADJ,CACiD,CACzCuD,EAAGsG,CAAAtG,EADsC,CAEzCE,EAAGoG,CAAApG,EAFsC,CAWzCkH,OAAQ,CACJzK,WAAY,iBADR,CAEJgB,KAAM,GAFF,CAGJC,KAAM,CAAA,CAHF,CAIJkE,OAAQ,CAAA,CAJJ,CAKJwC,WAAY,KALR,CAMJwC,iBAAkBA,QAAS,CAACzJ,CAAD,CAAQ,CAC/B,IAAI0J,EAAO1J,CAAAgK,cAAAtB,QAAA,EAEX,OAAO,CACH/F,EAAG3C,CAAAiK,KADA,CAEHpH,EAAG6G,CAAA7G,EAAHA,CAAY6G,CAAA3G,OAAZF,CAA0B,CAFvB,CAHwB,CAN/B,CAcJ8G,gBAAiBV,CAAApG,EAAA8G,gBAdb,CAXiC,CADjD,CAgCIrB;CAAA4B,YAAJ,GACI5B,CAAA4B,YAAAnB,UAAA3J,cADJ,CACsD,CAC9CuD,EAAG,CACCrC,KAAM,GADP,CAECC,KAAM,CAAA,CAFP,CAD2C,CAa9C4J,IAAK,CACD7K,WAAY,cADX,CAEDgB,KAAM,GAFL,CAGDC,KAAM,CAAA,CAHL,CAIDkE,OAAQ,CAAA,CAJP,CAKDwC,WAAY,QALX,CAMDwC,iBAAkBA,QAAS,CAACzJ,CAAD,CAAQ,CAC3B0J,CAAAA,CAAO1J,CAAAwI,UAAPkB,EAA0B1J,CAAAyI,QAAAC,QAAA,EAE9B,OAAO,CACH/F,EAAG+G,CAAA/G,EADA,CAEHE,EAAG6G,CAAA7G,EAAHA,CAAY6G,CAAA3G,OAFT,CAHwB,CANlC,CAcD4G,gBAAiBV,CAAApG,EAAA8G,gBAdhB,CAeDS,aAAcA,QAAS,CAAC/K,CAAD,CAAMW,CAAN,CAAa,CAChC,MAAOX,EAAP,EAAcW,CAAAqK,KADkB,CAfnC,CAbyC,CAwC9CA,KAAM,CACF/K,WAAY,eADV,CAEFgB,KAAM,GAFJ,CAGFC,KAAM,CAAA,CAHJ,CAIFkE,OAAQ,CAAA,CAJN,CAKFwC,WAAY,KALV,CAMFwC,iBAAkBA,QAAS,CAACzJ,CAAD,CAAQ,CAC3B0J,CAAAA,CAAO1J,CAAAwI,UAAPkB,EAA0B1J,CAAAyI,QAAAC,QAAA,EAE9B,OAAO,CACH/F,EAAG+G,CAAA/G,EADA,CAEHE,EAAG6G,CAAA7G,EAFA,CAHwB,CANjC,CAcF8G,gBAAiBV,CAAApG,EAAA8G,gBAdf;AAeFS,aAAcA,QAAS,CAAC/K,CAAD,CAAMW,CAAN,CAAa,CAChC,MAAOX,EAAP,EAAcW,CAAAmK,IADkB,CAflC,CAxCwC,CADtD,CAgEI7B,EAAAgC,QAAJ,GACIhC,CAAAgC,QAAAvB,UAAA3J,cADJ,CACkD,CAC1CuD,EAAGsG,CAAAtG,EADuC,CAU1CwH,IAAK,CACD7K,WAAY,cADX,CAEDgB,KAAM,GAFL,CAGDC,KAAM,CAAA,CAHL,CAIDkE,OAAQ,CAAA,CAJP,CAKDwC,WAAY,QALX,CAMDwC,iBAAkBA,QAAS,CAACzJ,CAAD,CAAQ,CAC/B,MAAO,CACH2C,EAAG3C,CAAAwI,UAAA7F,EADA,CAEHE,EAAG7C,CAAAuK,QAFA,CADwB,CANlC,CAYDZ,gBAAiBV,CAAApG,EAAA8G,gBAZhB,CAaDS,aAAcA,QAAS,CAAC/K,CAAD,CAAMW,CAAN,CAAa,CAChC,MAAOX,EAAP,EAAcW,CAAAwK,GADkB,CAbnC,CAVqC,CAmC1CA,GAAI,CACAlL,WAAY,aADZ,CAEAgB,KAAM,GAFN,CAGAC,KAAM,CAAA,CAHN,CAIAkE,OAAQ,CAAA,CAJR,CAKAwC,WAAY,QALZ,CAMAwC,iBAAkBA,QAAS,CAACzJ,CAAD,CAAQ,CAC/B,MAAO,CACH2C,EAAG3C,CAAAwI,UAAA7F,EADA,CAEHE,EAAG7C,CAAAyK,OAFA,CADwB,CANnC,CAYAd,gBAAiBV,CAAApG,EAAA8G,gBAZjB;AAaAS,aAAcA,QAAS,CAAC/K,CAAD,CAAMW,CAAN,CAAa,CAChC,MAAOX,EAAP,EAAcW,CAAA0K,OAAd,EAA8BrL,CAA9B,EAAqCW,CAAAmK,IADL,CAbpC,CAnCsC,CAoD1CO,OAAQ,CAGJpK,KAAM,GAHF,CAIJC,KAAM,CAAA,CAJF,CApDkC,CAkE1CoK,GAAI,CACArL,WAAY,aADZ,CAEAgB,KAAM,GAFN,CAGAC,KAAM,CAAA,CAHN,CAIAkE,OAAQ,CAAA,CAJR,CAKAwC,WAAY,KALZ,CAMAwC,iBAAkBA,QAAS,CAACzJ,CAAD,CAAQ,CAC/B,MAAO,CACH2C,EAAG3C,CAAAwI,UAAA7F,EADA,CAEHE,EAAG7C,CAAA4K,OAFA,CADwB,CANnC,CAYAjB,gBAAiBV,CAAApG,EAAA8G,gBAZjB,CAaAS,aAAcA,QAAS,CAAC/K,CAAD,CAAMW,CAAN,CAAa,CAChC,MAAOX,EAAP,EAAcW,CAAAqK,KAAd,EAA4BhL,CAA5B,EAAmCW,CAAA0K,OADH,CAbpC,CAlEsC,CA2F1CL,KAAM,CACF/K,WAAY,eADV,CAEFgB,KAAM,GAFJ,CAGFC,KAAM,CAAA,CAHJ,CAIFkE,OAAQ,CAAA,CAJN,CAKFwC,WAAY,KALV,CAMFwC,iBAAkBA,QAAS,CAACzJ,CAAD,CAAQ,CAC/B,MAAO,CACH2C,EAAG3C,CAAAwI,UAAA7F,EADA,CAEHE,EAAG7C,CAAA6K,SAFA,CADwB,CANjC,CAYFlB,gBAAiBV,CAAApG,EAAA8G,gBAZf,CAaFS,aAAcA,QAAS,CAAC/K,CAAD;AAAMW,CAAN,CAAa,CAChC,MAAOX,EAAP,EAAcW,CAAA2K,GADkB,CAblC,CA3FoC,CADlD,CAkHIrC,EAAAwC,KAAJ,GACIxC,CAAAwC,KAAA/B,UAAA3J,cADJ,CAC+C,CACvCuD,EAAGsG,CAAAtG,EADoC,CAUvCwH,IAAK,CACD7K,WAAY,cADX,CAEDgB,KAAM,GAFL,CAGDC,KAAM,CAAA,CAHL,CAIDkE,OAAQ,CAAA,CAJP,CAKDwC,WAAY,QALX,CAMDwC,iBAAkBA,QAAS,CAACzJ,CAAD,CAAQ,CAC/B,MAAO,CACH2C,EAAG3C,CAAAwI,UAAA7F,EADA,CAEHE,EAAG7C,CAAA+K,QAFA,CADwB,CANlC,CAYDpB,gBAAiBV,CAAApG,EAAA8G,gBAZhB,CAaDS,aAAcA,QAAS,CAAC/K,CAAD,CAAMW,CAAN,CAAa,CAChC,MAAOX,EAAP,EAAcW,CAAAgL,KAAd,EAA4B3L,CAA5B,EAAmCW,CAAAiL,MADH,CAbnC,CAVkC,CAmCvCZ,KAAM,CACF/K,WAAY,eADV,CAEFgB,KAAM,GAFJ,CAGFC,KAAM,CAAA,CAHJ,CAIFkE,OAAQ,CAAA,CAJN,CAKFwC,WAAY,KALV,CAMFwC,iBAAkBA,QAAS,CAACzJ,CAAD,CAAQ,CAC/B,MAAO,CACH2C,EAAG3C,CAAAwI,UAAA7F,EADA,CAEHE,EAAG7C,CAAAkL,SAFA,CADwB,CANjC,CAYFvB,gBAAiBV,CAAApG,EAAA8G,gBAZf,CAaFS,aAAcA,QAAS,CAAC/K,CAAD;AAAMW,CAAN,CAAa,CAChC,MAAOX,EAAP,EAAcW,CAAAgL,KAAd,EAA4B3L,CAA5B,EAAmCW,CAAAiL,MADH,CAblC,CAnCiC,CA4DvCD,KAAM,CACF1L,WAAY,eADV,CAEFgB,KAAM,GAFJ,CAGFC,KAAM,CAAA,CAHJ,CAIFkE,OAAQ,CAAA,CAJN,CAKFwC,WAAYA,QAAS,CAACjH,CAAD,CAAQ,CACzB,MAAOA,EAAAgL,KAAA,EAAchL,CAAAiL,MAAd,CAA4B,KAA5B,CAAoC,QADlB,CAL3B,CAQFxB,iBAAkBA,QAAS,CAACzJ,CAAD,CAAQ,CAC/B,MAAO,CACH2C,EAAG3C,CAAAwI,UAAA7F,EADA,CAEHE,EAAG7C,CAAAmL,SAFA,CADwB,CARjC,CAcFxB,gBAAiBV,CAAApG,EAAA8G,gBAdf,CAeFS,aAAcA,QAAS,CAAC/K,CAAD,CAAMW,CAAN,CAAa,CAChC,MAAOX,EAAP,EAAcW,CAAAqK,KAAd,EAA4BhL,CAA5B,EAAmCW,CAAAmK,IADH,CAflC,CA5DiC,CAuFvCc,MAAO,CACH3L,WAAY,gBADT,CAEHgB,KAAM,GAFH,CAGHC,KAAM,CAAA,CAHH,CAIHkE,OAAQ,CAAA,CAJL,CAKHwC,WAAYA,QAAS,CAACjH,CAAD,CAAQ,CACzB,MAAOA,EAAAgL,KAAA,EAAchL,CAAAiL,MAAd,CAA4B,QAA5B,CAAuC,KADrB,CAL1B,CAQHxB,iBAAkBA,QAAS,CAACzJ,CAAD,CAAQ,CAC/B,MAAO,CACH2C,EAAG3C,CAAAwI,UAAA7F,EADA,CAEHE,EAAG7C,CAAAoL,UAFA,CADwB,CARhC;AAcHzB,gBAAiBV,CAAApG,EAAA8G,gBAdd,CAeHS,aAAcA,QAAS,CAAC/K,CAAD,CAAMW,CAAN,CAAa,CAChC,MAAOX,EAAP,EAAcW,CAAAqK,KAAd,EAA4BhL,CAA5B,EAAmCW,CAAAmK,IADH,CAfjC,CAvFgC,CAD/C,CA+GA,IAAI7B,CAAA+C,UAAJ,CAA2B,CACnBC,IAAAA,EAA2BhD,CAAA4B,YAAAnB,UAAA3J,cAA3BkM,CAGAC,EAA2BA,QAAS,CAACvL,CAAD,CAAQ,CACpC4J,CAAAA,CAAS5J,CAAAyI,QAAA,CACTzI,CAAAyI,QAAAC,QAAA,EAAA5F,MADS,CACuB,CADvB,CAC2B,CAD3B,CAET,CAEJ,OAAO,CACH,GADG,CACE,CADF,CACM8G,CADN,CACc,CADd,CAEH,GAFG,CAEEA,CAFF,CAEUA,CAFV,CAEkB,CAFlB,CAEqB,CAFrB,CAEwB,CAFxB,CAEoC,CAFpC,CAE2BA,CAF3B,CAEuC,CAFvC,CAGH,GAHG,CAGEA,CAHF,CAGUA,CAHV,CAGkB,CAHlB,CAGqB,CAHrB,CAGwB,CAHxB,CAGqC,EAHrC,CAG2BA,CAH3B,CAGwC,CAHxC,CALiC,CAYhDtB,EAAA+C,UAAAtC,UAAA3J,cAAA,CAAgD,CAC5CuD,EAAG2I,CAAA3I,EADyC,CAU5CwH,IAAK,CACD7K,WAAY,cADX,CAEDgB,KAAM,GAFL,CAGDC,KAAM,CAAA,CAHL,CAIDkE,OAAQ,CAAA,CAJP,CAKDwC,WAAY,QALX,CAMDwC,iBAAkBA,QAAS,CAACzJ,CAAD,CAAQ,CAG/B,MAAO,CAFH0J,CAEG,CAFI1J,CAAAwL,aAEJ,EAF0BxL,CAAAwL,aAAA9C,QAAA,EAE1B,EAAO,CACV/F,EAAG+G,CAAA/G,EAAHA,CAAY+G,CAAA5G,MAAZH,CAAyB,CADf,CAEVE,EAAG6G,CAAA7G,EAAHA,CAAY6G,CAAA3G,OAAZF;AAA0B,CAFhB,CAAP,CAGH,CAAEF,EAAI,IAAN,CAAWE,EAAI,IAAf,CAN2B,CANlC,CAcD8G,gBAAiB4B,CAdhB,CAeDnB,aAAckB,CAAAnB,IAAAC,aAfb,CAVuC,CAmC5CC,KAAM,CACF/K,WAAY,eADV,CAEFgB,KAAM,GAFJ,CAGFC,KAAM,CAAA,CAHJ,CAIFkE,OAAQ,CAAA,CAJN,CAKFwC,WAAY,KALV,CAMFwC,iBAAkBA,QAAS,CAACzJ,CAAD,CAAQ,CAG/B,MAAO,CAFH0J,CAEG,CAFI1J,CAAAyL,aAEJ,EAF0BzL,CAAAyL,aAAA/C,QAAA,EAE1B,EAAO,CACV/F,EAAG+G,CAAA/G,EAAHA,CAAY+G,CAAA5G,MAAZH,CAAyB,CADf,CAEVE,EAAG6G,CAAA7G,EAAHA,CAAY6G,CAAA3G,OAAZF,CAA0B,CAFhB,CAAP,CAGH,CAAEF,EAAI,IAAN,CAAWE,EAAI,IAAf,CAN2B,CANjC,CAcF8G,gBAAiB4B,CAdf,CAeFnB,aAAckB,CAAAjB,KAAAD,aAfZ,CAnCsC,CAhBzB,CAwEvB9B,CAAAoD,UAAJ,GACIpD,CAAAoD,UAAA3C,UAAA3J,cADJ,CACoD,CAC5CuD,EAAGsG,CAAAtG,EADyC,CAE5CE,EAAGuB,CAAA,CAAM6E,CAAApG,EAAN,CAA6B,CAC5B8G,gBAAiBA,QAAS,CAAC3J,CAAD,CAAQ,CAC9B,MAAOA,EAAA2L,MAAA,EAAe3L,CAAA4L,kBAAf,CAAyC,IAAzC,CACH3C,CAAApG,EAAA8G,gBAAA,CAAsC3J,CAAtC,CAF0B,CADN,CAA7B,CAFyC,CADpD,CAaA,IAAIsI,CAAAuD,OAAJ,CAAwB,IAIhBC;AAAyBA,QAAS,CAAC9L,CAAD,CAAQ+L,CAAR,CAAe,CAAA,IACzC/M,EAASgB,CAAAhB,OADgC,CAEzC2B,EAAQ3B,CAAA2B,MAFiC,CAGzCD,EAAQ1B,CAAA0B,MAHiC,CAIzCsG,EAAWhI,CAAAY,MAAAoH,SAGX9E,EAAAA,CAAOvB,CAAAqL,SAAA,CAAehM,CAAA,CAAM+L,CAAN,CAAf,CAA6B,CAAA,CAA7B,CANX,KAOI5J,EAAOzB,CAAAsL,SAAA,CAAehM,CAAA6C,EAAf,CAAwB,CAAA,CAAxB,CAGPmE,EAAJ,EACI9E,CACA,CADOvB,CAAAsL,IACP,CADmB/J,CACnB,CAAAC,CAAA,CAAOzB,CAAAuL,IAAP,CAAmB9J,CAAnB,CACInC,CAAAwI,UAAAzF,OADJ,CAC6B,CAHjC,EAKIZ,CALJ,EAKYnC,CAAAwI,UAAAzF,OALZ,CAKqC,CAGrC,OAAO,CACHJ,EAAGP,IAAAkH,MAAA,CAAWpH,CAAX,CADA,CAEHW,EAAGT,IAAAkH,MAAA,CAAWnH,CAAX,CAFA,CAnBsC,CAJjC,CA4BhB+J,EAAsB5D,CAAAuD,OAAA9C,UAAA3J,cAAtB8M,CAAmE,CAC/DrJ,EAAG,CACCvC,KAAM,GADP,CAECC,KAAM,CAAA,CAFP,CAD4D,CAa/DoC,EAAG,CACCrD,WAAY,aADb,CAECgB,KAAM,GAFP,CAGCC,KAAM,CAAA,CAHP,CAICkE,OAAQ,CAAA,CAJT,CAKCwC,WAAY,MALb,CAMCwC,iBAAkBA,QAAS,CAACzJ,CAAD,CAAQ,CAC/B,MAAO8L,EAAA,CAAuB9L,CAAvB,CAA8B,GAA9B,CADwB,CANpC,CASC2J,gBAAiBpB,CATlB,CAUC6B,aAAcA,QAAS,CAAC/K,CAAD,CAAMW,CAAN,CAAa,CAChC,MAAOX,EAAP,EAAcW,CAAAmM,GADkB,CAVrC,CAb4D,CAmC/DA,GAAI,CACA7M,WAAY,aADZ,CAEAgB,KAAM,GAFN;AAGAC,KAAM,CAAA,CAHN,CAIAkE,OAAQ,CAAA,CAJR,CAKAwC,WAAY,OALZ,CAMAwC,iBAAkBA,QAAS,CAACzJ,CAAD,CAAQ,CAC/B,MAAO8L,EAAA,CAAuB9L,CAAvB,CAA8B,IAA9B,CADwB,CANnC,CASA2J,gBAAiBpB,CATjB,CAUA6B,aAAcA,QAAS,CAAC/K,CAAD,CAAMW,CAAN,CAAa,CAChC,MAAOX,EAAP,EAAcW,CAAA2C,EADkB,CAVpC,CAnC2D,CAqDvE2F,EAAA8D,MAAJ,GACI9D,CAAA8D,MAAArD,UAAA3J,cADJ,CACgD,CACxCyD,EAAGqJ,CAAArJ,EADqC,CAUxCwJ,MAAOjI,CAAA,CAAM8H,CAAAvJ,EAAN,CAA6B,CAChCrD,WAAY,gBADoB,CAGhCgN,uBAAwBA,QAAS,CAACtM,CAAD,CAAQ,CACrC,MAAO,CAACA,CAAAuM,UAD6B,CAHT,CAA7B,CAViC,CAyBxCC,IAAKpI,CAAA,CAAM8H,CAAAC,GAAN,CAA8B,CAC/B7M,WAAY,cADmB,CAG/BgN,uBAAwBA,QAAS,CAACtM,CAAD,CAAQ,CACrC,MAAO,CAACA,CAAAuM,UAD6B,CAHV,CAA9B,CAzBmC,CADhD,CAqCA,yGAAA,MAAA,CAAA,GAAA,CAAA7K,QAAA,CAgBI,QAAS,CAACF,CAAD,CAAO,CACR8G,CAAA,CAAY9G,CAAZ,CAAJ;CACI8G,CAAA,CAAY9G,CAAZ,CAAAuH,UAAA3J,cADJ,CACgD,IADhD,CADY,CAhBpB,CAkEA,KAAIqN,EAAyB,CAMzB,UAAW,CAOPC,UAAW,6BAPJ,CAcPC,UAAW,CAdJ,CAsBPC,UAAW,MAtBJ,CA8BPC,MAAO,oBA9BA,CAqCPC,OAAQ,MArCD,CA4CPC,OAAQ,GA5CD,CANc,CAA7B,CA6DIC,EAA2B,CA6B3BN,UAAW,wBA7BgB,CAqC3BG,MAAO,MArCoB,CA6C3BD,UAAW,oBA7CgB,CAoD3BD,UAAW,CApDgB,CA2D3BI,OAAQ,GA3DmB,CA01B/BvO,EAAAyO,MAAAlE,UAAAjF,iBAAA,CAAqCoJ,QAAS,CAACC,CAAD,CAAQ1N,CAAR,CAAiB,CAAA,IACvDgD,EAAW,IAAAmB,aACXwJ,EAAAA,CAAkBhJ,CAAA,CAAMqI,CAAN,CAA8BhN,CAA9B,CAClB4N,EAAAA,CAAejJ,CAAA,CAAMgJ,CAAAE,QAAN,CAA+BF,CAAA,CAAgBD,CAAhB,CAA/B,CAEnB,OAAO1K,EAAAG,KAAA,CACG,CACF8J,UAAWW,CAAAX,UADT,CAEFa,OAAQF,CAAAT,UAFN,CAGFY,YAAaH,CAAAV,UAHX,CAIFc,KAAMJ,CAAAR,MAJJ,CAKFC,OAAQO,CAAAP,OALN,CAMFC,OAAQM,CAAAN,OANN,CADH,CAAAW,IAAA,CAUE,CAAEC,cAAe,MAAjB,CAVF,CALoD,CA+C/DnP;CAAAoP,MAAA7E,UAAApE,cAAA,CAAkCkJ,QAAS,CAAC9L,CAAD,CAASoC,CAAT,CAAiBE,CAAjB,CAA8B,CAAA,IACjErE,EAAQ,IADyD,CAEjEhB,EAASgB,CAAAhB,OAFwD,CAGjES,EAAU2E,CAAA,CAAMpF,CAAAS,QAAAC,SAAN,CAA+BM,CAAAP,QAAAC,SAA/B,CAHuD,CAIjEgB,EAAQ1B,CAAA0B,MAJyD,CAKjEC,EAAQ3B,CAAA2B,MALyD,CAMjEkG,EAAK1C,CAAArD,OAAL+F,CAAqB9E,CAAAjB,OACrBgG,EAAAA,CAAK3C,CAAApD,OAAL+F,CAAqB/E,CAAAhB,OAP4C,KAQjEiB,EAAO0B,CAAA,CAAK3B,CAAAY,EAAL,CAAe3C,CAAA2C,EAAf,CAR0D,CASjEV,EAAOyB,CAAA,CAAK3B,CAAAc,EAAL,CAAe7C,CAAA6C,EAAf,CAT0D,CAUjEiL,EAAUnN,CAAAoN,QAAA,CACNpN,CAAAqL,SAAA,CAAehK,CAAf,CAAqB,CAAA,CAArB,CADM,EAELrB,CAAAqN,MAAA,CAAcnH,CAAd,CAAmBC,CAFd,EAGN,CAAA,CAHM,CAAVgH,CAII9L,CAd6D,CAejEiM,EAAUvN,CAAAqN,QAAA,CACNrN,CAAAsL,SAAA,CAAe/J,CAAf,CAAqB,CAAA,CAArB,CADM,EAELvB,CAAAsN,MAAA,CAAcnH,CAAd,CAAmBC,CAFd,EAGN,CAAA,CAHM,CAAVmH,CAIIhM,CAnB6D,CAoBjEiM,EAAS,EApBwD,CAqBjEC,CArBiE,CAsBjEC,EAAcrM,CAAAS,OAAA,CAAcxC,CAAAkD,GAAd,CAtBmD,CAyB5DD,CAAT,KAASA,CAAT,GAAgBoB,EAAhB,CACI,GAAIA,CAAA4B,eAAA,CAA2BhD,CAA3B,CAAJ,CAAqC,CACjC,GAAyB1E,IAAAA,EAAzB,GAAI4P,CAAJ,CAAoC,CAChCA,CAAA,CAAmB,CAAA,CACnB,MAFgC,CAIpCA,CAAA,CAAmB,CAAA,CALc,CA6BzChP,CAAA,CAAWkF,CAAX,CAAwB,QAAS,CAAChF,CAAD,CAAM4D,CAAN,CAAW,CAAA,IACpCoL,EAASD,CAAA,CAAYnL,CAAZ,CAD2B,CAEpCqL,CACI,EAAA,CAAAD,CAAA,EAAuB,GAAb,GAAAhP,CAAAiB,KAAA,CAAmBwN,CAAnB,CAA6BG,CAAvC,CACA,KAAA,EAAA5O,CAAAiB,KAAAiO,YAAA,EAAA,CArBJC,EAAmBxP,CAAA,CAAOyP,CAAAC,YAAA,EAAP,CAAiC,MAAjC,CAAAC,WAAA;AACD,CADC,CACG,CAoBlB,CAnBJC,EAAYlL,CAAA,CACRjE,CAAA,CAAQ,eAAR,CAA0BgP,CAA1B,CADQ,CAC8BD,CAD9B,CAmBR,CAhBJK,EAAMnL,CAAA,CAAKjE,CAAA,CAAQ,SAAR,CAAoBgP,CAApB,CAAL,CAAqC,CAACK,QAAtC,CAgBF,CAfJrH,EAAM/D,CAAA,CAAKjE,CAAA,CAAQ,SAAR,CAAoBgP,CAApB,CAAL,CAAqCK,QAArC,CAGNF,EAAJ,GACIlM,CADJ,CACUN,IAAAkH,MAAA,CAAW5G,CAAX,CAAiBkM,CAAjB,CADV,CACwCA,CADxC,CAGA,EAAA,CAAOxM,IAAAqF,IAAA,CAASoH,CAAT,CAAczM,IAAAyM,IAAA,CAASpH,CAAT,CAAc/E,CAAd,CAAd,CAgBCyL,EAFR,EAGQ9O,CAAA+K,aAHR,EAIS,CAAA/K,CAAA+K,aAAA,CAAiBkE,CAAjB,CAAyBtO,CAAzB,CAJT,EAMezB,IAAAA,EANf,GAMI8P,CANJ,GAQIH,CAAA,CAAOjL,CAAP,CARJ,CAQkBqL,CARlB,CATwC,CAA5C,CAqBA,OAAOJ,EA5E8D,CA4FzE1P,EAAAuQ,OAAAhG,UAAAlF,YAAA,CAAiCmL,QAAS,CAACxM,CAAD,CAAS,CAAA,IAC3C5C,EAAQ,IAAAA,MADmC,CAE3CqP,EAAOH,QAFoC,CAG3CI,EAAO,CAACJ,QAHmC,CAI3CK,EAAOL,QAJoC,CAK3CM,EAAO,CAACN,QALmC,CAM3CO,CAGJ7M,EAAAd,QAAA,CAAe,QAAS,CAAC1B,CAAD,CAAQ,CAG5B,CAFI0J,CAEJ,CAFW1J,CAAAyI,QAEX,EAF4BzI,CAAAyI,QAAAC,QAAA,EAE5B,EAFuD1I,CAAAwI,UAEvD,IAAakB,CAAA5G,MAAb,EAA2B4G,CAAA3G,OAA3B,EAA0C2G,CAAA/G,EAA1C,EAAoD+G,CAAA7G,EAApD,IACIwM,CAIA,CAJU,CAAA,CAIV,CAHAJ,CAGA,CAHO7M,IAAAyM,IAAA,CAASnF,CAAA/G,EAAT,CAAiBsM,CAAjB,CAGP,CAFAC,CAEA,CAFO9M,IAAAqF,IAAA,CAASiC,CAAA/G,EAAT,CAAkB+G,CAAA5G,MAAlB,CAA8BoM,CAA9B,CAEP,CADAC,CACA,CADO/M,IAAAyM,IAAA,CAASnF,CAAA7G,EAAT,CAAiBsM,CAAjB,CACP,CAAAC,CAAA,CAAOhN,IAAAqF,IAAA,CAASiC,CAAA7G,EAAT;AAAkB6G,CAAA3G,OAAlB,CAA+BqM,CAA/B,CALX,CAH4B,CAAhC,CAYA,OAAOC,EAAA,CAAUzP,CAAA0P,SAAA9H,KAAA,CACbyH,CADa,CAEbE,CAFa,CAGbD,CAHa,CAGND,CAHM,CAIbG,CAJa,CAIND,CAJM,CAAV,CAKHvP,CAAA0P,SAAAC,EAAA,EA1B2C,CAgInD/Q,EAAAoP,MAAA7E,UAAAtD,gBAAA,CAAoC+J,QAAS,EAAG,CAAA,IACxCxP,EAAQ,IADgC,CAExChB,EAASgB,CAAAhB,OAF+B,CAGxCY,EAAQZ,CAAAY,MAHgC,CAIxC0P,EAAW1P,CAAA0P,SAJ6B,CAKxC7P,EAAU2E,CAAA,CAAMpF,CAAAS,QAAAC,SAAN,CAA+BM,CAAAP,QAAAC,SAA/B,CAIdP,EAAA,CAAWH,CAAAI,cAAX,CAAiC,QAAS,CAACC,CAAD,CAAM4D,CAAN,CAAW,CAAA,IAC7CwM,EAAgBrL,CAAA,CACZ4I,CADY,CAEZ3N,CAAAoQ,cAFY,CAGZhQ,CAAAiQ,WAHY,CAD6B,CAM7CC,EAAc,CACVjD,UAAW+C,CAAA/C,UADD,CAEV,eAAgB+C,CAAA9C,UAFN,CAGVc,KAAMgC,CAAA5C,MAHI,CAIVU,OAAQkC,CAAA7C,UAJE,CAN+B,CAY7CgD,EAAgBH,CAAAG,cAAhBA,EAA+CvQ,CAAAsK,gBAZF,CAa7CkG,EAAaxQ,CAAAoK,iBAbgC,CAiB7CqG,CAGAC,EAAAA,CAAW1Q,CAAAiN,uBAAA,CACPjN,CAAAiN,uBAAA,CAA2BtM,CAA3B,CADO,CAC6B,CAAA,CAGxCX,EAAAoF,OADJ,EAEIsL,CAFJ,EAGI1Q,CAAA4H,WAHJ;AAII2I,CAJJ,GAMQnQ,CAAA,CAAQ,WAAR,CAAsBJ,CAAAiB,KAAAiO,YAAA,EAAtB,CANR,EAOQ9O,CAAA,CAAQJ,CAAAC,WAAR,CAPR,GASgC,CAAA,CAThC,GASIG,CAAA,CAAQJ,CAAAC,WAAR,CATJ,GAaSM,CAAA4F,YAeL,GAdI5F,CAAA4F,YAcJ,CAdwB,CAChBxB,MAAOsL,CAAAC,EAAA,CAAW,mBAAX,CAAAxL,IAAA,CACE/E,CAAAgR,YADF,EACwBhR,CAAAgF,MADxB,CADS,CAcxB,EAPApE,CAAA4F,YAAAxF,MAOA,CAP0BA,CAAAkD,GAO1B,CAJA+M,CAIA,CAJMJ,CAAA,CAAW7P,CAAX,CAIN,CAHA2P,CAAAO,EAGA,CAHgBJ,CAGhB,CAHuBF,CAAA,CAAc5P,CAAd,CAGvB,CAFAmQ,CAEA,CAFuC,UAA1B,GAAA,MAAO9Q,EAAA4H,WAAP,CACT5H,CAAA4H,WAAA,CAAejH,CAAAP,QAAf,CAA8BO,CAA9B,CADS,CAC8BX,CAAA4H,WAC3C,CAAK6I,CAAAA,CAAL,EAAqB,CAArB,CAAaG,CAAAtN,EAAb,EAAkC,CAAlC,CAA0BsN,CAAApN,EAA1B,GAKA8M,CAAA7C,OA6BA,CA7BqB2C,CAAA3C,OAAA,EACH,GADG,GAChBzN,CAAAiB,KADgB,GACM,CAAE0G,CAAApH,CAAAoH,SADR,CAEjB,WAFiB,CAEH,WA2BlB,EAxBAoJ,CAwBA,CAxBSxQ,CAAA4F,YAAA,CAAkB2K,CAAlB,CAwBT,IAtBIC,CAsBJ,CAtBaxQ,CAAA4F,YAAA,CAAkB2K,CAAlB,CAsBb,CAtB6Cb,CAAAQ,KAAA,EAAA/L,IAAA,CAEhCnE,CAAA4F,YAAAxB,MAFgC,CAsB7C,EAhBAoM,CAAA1I,UAAA,CAAiBuI,CAAAtN,EAAjB,CAAwBsN,CAAApN,EAAxB,CAAAD,KAAA,CAAoC+M,CAApC,CAgBA,CAbAzO,CAAA,CACIkP,CAAAC,QADJ,CAEI,CAAC,YAAD;AAAe,WAAf,CAFJ,CAGI,QAAS,CAACxP,CAAD,CAAI,CAEL,CAAA,CAAAD,CAAA,CAAmBC,CAAnB,CAAsBjB,CAAtB,CAlHpB,KAAIA,EAkH8CI,CAlHtChB,OAAAY,MAGRA,EAAAwG,oBAAA,CAA0BvF,CAA1B,CAAJ,GAKAjB,CAAAuI,YASA,CAToB,CAAA,CASpB,CANA3E,CAAA,CAAa3C,CAAb,CAuGkDb,CAvGlD,CAMA,CALAJ,CAAAkC,aAAAyC,WAKA,CALgC1D,CAAA0D,WAKhC,CAiGyDtB,CAjGzD,CAiGkDjD,CArGlD0G,eAAA,CAAqB,WAArB,CAAkC7F,CAAlC,CAIA,CADAA,CAAAyP,gBAAA,EACA,CAAAzP,CAAA0F,eAAA,EAdA,CA6GyB,CAHjB,CAaA,CAJA9E,CAAA,CAAS7B,CAAA4F,YAAAxB,MAAAqM,QAAT,CAA0C,WAA1C,CAAuD,QAAS,EAAG,CAC/DzQ,CAAAkC,aAAA,CAAqBlC,CAAAkC,aAArB,EAA2C,EAC3ClC,EAAAkC,aAAA8D,iBAAA,CAAsC5F,CAAAkD,GAFyB,CAAnE,CAIA,CAAAhC,CAAA,CACItB,CAAA4F,YAAAxB,MAAAqM,QADJ,CAEI,CAAC,UAAD,CAAa,UAAb,CAFJ,CAGI,QAAS,EAAG,CA3JxB,IAAIzQ,EA4JmCI,CA5J3BhB,OAAAY,MAGRA,EAAAkC,aADJ,EA0JuC9B,CAxJnCkD,GAFJ,GAEiBtD,CAAAkC,aAAA8D,iBAFjB,EAII,OAAOhG,CAAAkC,aAAA8D,iBAENhG;CAAA2F,WAAL,EACIG,CAAA,CAmJmC1F,CAnJnC,CAkJoB,CAHhB,CAlCA,CA5BJ,CAvBiD,CAArD,CAT4C,CAgHhDxB,EAAAyO,MAAAlE,UAAAlD,gBAAA,CAAoC0K,QAAS,EAAG,CAChC3Q,IAER4F,YAAJ,GACIrG,CAAA,CAHQS,IAGG4F,YAAX,CAA8B,QAAS,CAACnG,CAAD,CAAM4D,CAAN,CAAW,CAClC,OAAZ,GAAIA,CAAJ,EAAuB5D,CAAAwI,QAAvB,EACIxI,CAAAwI,QAAA,EAF0C,CAAlD,CAQA,CAXQjI,IAQJ4F,YAAAxB,MAGJ,EAXQpE,IAQuB4F,YAAAxB,MAAA6D,QAG/B,EAXQjI,IASJ4F,YAAAxB,MAAA6D,QAAA,EAEJ,CAAA,OAXQjI,IAWD4F,YATX,CAH4C,CAqShD/D,EAAA,CAASjD,CAAAoP,MAAT,CAAkB,WAAlB,CAA+B,QAAS,EAAG,CACvC,IAAI5N,EAAQ,IAEZsF,WAAA,CAAW,QAAS,EAAG,CAhOD,IAClBtG,EAgOUgB,CAhODhB,OADS,CAElBY,EAAQZ,CAARY,EAAkBZ,CAAAY,MAFA,CAGlBkC,EAAelC,CAAfkC,EAAwBlC,CAAAkC,aAGxBlC,EAAAA,CADJ,EAGQkC,CAHR,EAIQA,CAAAmC,WAJR,EAKQnC,CAAA6D,uBALR,EAOK/F,CAAAsF,oBAPL,EAQIxF,CAAAV,CAAAS,QAAAC,SARJ,EAUQE,CAAAH,QAVR,EAWQG,CAAAH,QAAAG,MAXR;AAYQA,CAAAH,QAAAG,MAAA4Q,UAZR,GAgBQ5Q,CAAA4F,YAGJ,EAFI5F,CAAAiG,gBAAA,EAEJ,CAyMU7F,CAzMVyF,gBAAA,EAnBJ,CA2NuB,CAAvB,CAEG,EAFH,CAHuC,CAA3C,CAUAhE,EAAA,CAASjD,CAAAoP,MAAT,CAAkB,UAAlB,CAA8B,QAAS,EAAG,CACtC,IAAI5N,EAAQ,IAEZsF,WAAA,CAAW,QAAS,EAAG,CACftF,CAAAhB,OAAJ,EACI0G,CAAA,CAAS1F,CAAT,CAFe,CAAvB,CAIG,EAJH,CAHsC,CAA1C,CAYAyB,EAAA,CAASjD,CAAAoP,MAAT,CAAkB,QAAlB,CAA4B,QAAS,EAAG,CAAA,IAChChO,EAAQ,IAAAZ,OAAAY,MADwB,CAEhC4F,EAAc5F,CAAA4F,YAEdA,EAAJ,EAAmBA,CAAAxF,MAAnB,GAAyC,IAAAkD,GAAzC,EACItD,CAAAiG,gBAAA,EALgC,CAAxC,CAsBArH,EAAAyO,MAAAlE,UAAA3C,oBAAA,CAAwCqK,QAAS,CAAC5P,CAAD,CAAI,CAAA,IAE7C6P,EAAe,IAAAC,YAAA/Q,MAAf8Q,EAAyC,EAFI,CAG7CE,EAASF,CAAAE,OAATA,EAAgCF,CAAAE,OAAhCA,CAAsD,KAG1D,OAAQ/P,EAAA,CAFM6P,CAAAG,QAEN,EAF8BH,CAAAG,QAE9B,CAFqD,KAErD,CAAR,EAAsBhQ,CAAA,CAAE+P,CAAF,CAN2B,CAyDrDnP,EAAA,CAASjD,CAAAyO,MAAT,CAAkB,QAAlB,CAA4B,QAAS,EAAG,CAE/B,IAAA5E,uBAAL;AACIP,CAAA,CAAkB,IAAlB,CAHgC,CAAxC,CAzjFU,CAAb,CAAA,CAgkFCxJ,CAhkFD,CADmB,CAXvB;","sources":["draggable-points.src.js"],"names":["factory","module","exports","define","amd","Highcharts","undefined","H","flipResizeSide","side","left","right","top","bottom","isSeriesDraggable","series","props","i","objectEach","dragDropProps","val","optionName","push","length","options","dragDrop","isChartDraggable","chart","hasCartesianSeries","polar","isPointMovable","point","seriesDragDropOptions","pointDragDropOptions","hasMovableX","hasMovableY","p","axis","move","draggableX","draggableY","yAxis","xAxis","getNormalizedEvent","e","chartX","chartY","pointer","normalize","addEvents","el","types","fn","removeFuncs","map","type","addEvent","forEach","hasDraggedPastSensitivity","sensitivity","orig","dragDropData","origin","oldX","oldY","newX","newY","Math","sqrt","distance","getPositionSnapshot","points","guideBox","res","x","attr","y","width","height","pointProps","key","id","getGroupedPoints","groupKey","groupBy","filter","comparePoint","initDragDrop","groupedPoints","pick","liveRedraw","dragGuideBox","getGuideBox","setGuideBoxState","add","group","isDragging","getNewPoints","newPos","merge","updateProps","resizeProp","updateProp","hashmap","resize","newValues","getDropValues","updatePoints","animate","newPoints","animOptions","duration","animation","isDragDropAnimating","newPoint","update","redraw","setTimeout","hoverPoint","dragHandles","showDragHandles","mouseOut","draggedPastSensitivity","isHoveringHandle","hideDragHandles","countProps","object","count","hasOwnProperty","getFirstProp","mouseMove","zoomOrPanKeyPressed","seriesDragDropOpts","numNewPoints","preventDefault","dragSensitivity","defaultDragSensitivity","firePointEvent","newPointId","data","dX","dY","oldDx","inverted","resizeSide","beforeResize","reversed","prevdX","prevdY","resizeAttrs","updateSide","rect","max","translate","mouseUp","cancelClick","destroy","addDragDropEvents","container","doc","dragPoint","dragDropOptions","mouseIsDown","unbindDragDropMouseUp","hasAddedDragDropEvents","seriesTypes","horizHandleFormatter","shapeArgs","graphic","getBBox","r","centerY","lineDragDropProps","line","prototype","flags","columnDragDropProps","column","pointVals","threshold","translatedThreshold","round","diff","flipSide","handlePositioner","bBox","handleFormatter","radius","centerX","bullet","target","targetGraphic","barX","columnrange","low","propValidate","high","boxplot","lowPlot","q1","q1Plot","median","q3","q3Plot","highPlot","ohlc","plotLow","open","close","plotHigh","plotOpen","plotClose","arearange","columnrangeDragDropProps","arearangeHandleFormatter","lowerGraphic","upperGraphic","waterfall","isSum","isIntermediateSum","xrange","xrangeHandlePositioner","xProp","toPixels","len","xrangeDragDropProps","x2","gantt","start","validateIndividualDrag","milestone","end","defaultGuideBoxOptions","className","lineWidth","lineColor","color","cursor","zIndex","defaultDragHandleOptions","Chart","H.Chart.prototype.setGuideBoxState","state","guideBoxOptions","stateOptions","default","stroke","strokeWidth","fill","css","pointerEvents","Point","H.Point.prototype.getDropValues","dXValue","toValue","horiz","dYValue","result","updateSingleProp","pointOrigin","oldVal","newVal","toUpperCase","defaultPrecision","direction","toLowerCase","categories","precision","min","Infinity","Series","H.Series.prototype.getGuideBox","minX","maxX","minY","maxY","changed","renderer","g","H.Point.prototype.showDragHandles","handleOptions","dragHandle","handleAttrs","pathFormatter","positioner","path","validate","markerGroup","pos","d","handleSide","handle","element","stopPropagation","H.Chart.prototype.hideDragHandles","options3d","H.Chart.prototype.zoomOrPanKeyPressed","chartOptions","userOptions","panKey","zoomKey"]}

data/vendor/assets/javascripts/highstock/modules/draggable-points.src.js

@@ -0,0 +1,2650 @@
+/**
+ * @license Highcharts JS v7.0.3 (2019-02-06)
+ *
+ * (c) 2009-2019 Torstein Honsi
+ *
+ * License: www.highcharts.com/license
+ */
+'use strict';
+(function (factory) {
+    if (typeof module === 'object' && module.exports) {
+        factory['default'] = factory;
+        module.exports = factory;
+    } else if (typeof define === 'function' && define.amd) {
+        define(function () {
+            return factory;
+        });
+    } else {
+        factory(typeof Highcharts !== 'undefined' ? Highcharts : undefined);
+    }
+}(function (Highcharts) {
+    (function (H) {
+        /**
+         * (c) 2009-2019 Highsoft AS
+         * Authors: Øystein Moseng, Torstein Hønsi, Jon A. Nygård
+         *
+         * License: www.highcharts.com/license
+         */
+
+        /**
+         * Function callback to execute while series points are dragged. Return false to
+         * stop the default drag action.
+         *
+         * @callback Highcharts.SeriesPointDragCallbackFunction
+         *
+         * @param {Highcharts.Point} this
+         *        Point where the event occured.
+         *
+         * @param {Highcharts.SeriesPointDragEventObject} event
+         *        Event arguments.
+         */
+
+        /**
+         * Contains common information for a drag event on series points.
+         *
+         * @interface Highcharts.SeriesPointDragEventObject
+         *//**
+         * New points during drag.
+         * @name Highcharts.SeriesPointDragEventObject#newPoints
+         * @type {Highcharts.Dictionary<Highcharts.SeriesPointDragPointObject>}
+         *//**
+         * Original data.
+         * @name Highcharts.SeriesPointDragEventObject#origin
+         * @type {object}
+         *//**
+         * Prevent default drag action.
+         * @name Highcharts.SeriesPointDragEventObject#preventDefault
+         * @type {Function}
+         *//**
+         * Target point that caused the event.
+         * @name Highcharts.SeriesPointDragEventObject#target
+         * @type {Highcharts.Point}
+         *//**
+         * Event type.
+         * @name Highcharts.SeriesPointDragEventObject#type
+         * @type {"drag"}
+         */
+
+        /**
+         * Contains information about a dragged points new values.
+         *
+         * @interface Highcharts.SeriesPointDragPointObject
+         *//**
+         * New values.
+         * @name Highcharts.SeriesPointDragPointObject#newValues
+         * @type {Highcharts.Dictionary<number>}
+         *//**
+         * Dragged point.
+         * @name Highcharts.SeriesPointDragPointObject#point
+         * @type {Highcharts.Point}
+         */
+
+        /**
+         * Function callback to execute when a series point is dragged.
+         *
+         * @callback Highcharts.SeriesPointDragStartCallbackFunction
+         *
+         * @param {Highcharts.Point} this
+         *        Point where the event occured.
+         *
+         * @param {Highcharts.SeriesPointDragStartEventObject} event
+         *        Event arguments.
+         */
+
+        /**
+         * Contains common information for a drag event on series point.
+         *
+         * @interface Highcharts.SeriesPointDragStartEventObject
+         *
+         * @implements {global.MouseDownEvent}
+         *//**
+         * Data property being dragged.
+         * @name Highcharts.SeriesPointDragStartEventObject#updateProp
+         * @type {Highcharts.Dictionary<number>}
+         */
+
+        /**
+         * Function callback to execute when series points are dropped.
+         *
+         * @callback Highcharts.SeriesPointDropCallbackFunction
+         *
+         * @param {Highcharts.Point} this
+         *        Point where the event occured.
+         *
+         * @param {Highcharts.SeriesPointDropEventObject} event
+         *        Event arguments.
+         */
+
+        /**
+         * Contains common information for a drop event on series points.
+         *
+         * @interface Highcharts.SeriesPointDropEventObject
+         *//**
+         * New points after drop.
+         * @name Highcharts.SeriesPointDropEventObject#newPoints
+         * @type {Highcharts.Dictionary<Highcharts.SeriesPointDropPointObject>}
+         *//**
+         * Number of new points.
+         * @name Highcharts.SeriesPointDropEventObject#numNewPoints
+         * @type {number}
+         *//**
+         * Original data.
+         * @name Highcharts.SeriesPointDropEventObject#origin
+         * @type {object}
+         *//**
+         * Prevent default drop action.
+         * @name Highcharts.SeriesPointDropEventObject#preventDefault
+         * @type {Function}
+         *//**
+         * Target point that caused the event.
+         * @name Highcharts.SeriesPointDropEventObject#target
+         * @type {Highcharts.Point}
+         *//**
+         * Event type.
+         * @name Highcharts.SeriesPointDropEventObject#type
+         * @type {"drop"}
+         */
+
+        /**
+         * Contains information about a dropped points new values.
+         *
+         * @interface Highcharts.SeriesPointDropPointObject
+         *//**
+         * New values.
+         * @name Highcharts.SeriesPointDropPointObject#newValues
+         * @type {Highcharts.Dictionary<number>}
+         *//**
+         * Dragged point.
+         * @name Highcharts.SeriesPointDropPointObject#point
+         * @type {Highcharts.Point}
+         */
+
+
+
+        var addEvent = H.addEvent,
+            objectEach = H.objectEach,
+            pick = H.pick,
+            merge = H.merge,
+            seriesTypes = H.seriesTypes;
+
+        /**
+         * Flip a side property, used with resizeRect. If input side is "left", return
+         * "right" etc.
+         *
+         * @private
+         * @function flipResizeSide
+         *
+         * @param {string} side
+         *        Side prop to flip. Can be `left`, `right`, `top` or `bottom`.
+         *
+         * @return {"bottom"|"left"|"right"|"top"|undefined}
+         *         The flipped side.
+         */
+        function flipResizeSide(side) {
+            return {
+                left: 'right',
+                right: 'left',
+                top: 'bottom',
+                bottom: 'top'
+            }[side];
+        }
+
+        /* @todo
+        Add drag/drop support to specific data props for different series types.
+
+        The dragDrop.draggableX/Y user options on series enable/disable all of these per
+        irection unless they are specifically set in options using
+        dragDrop.{optionName}. If the prop does not specify an optionName here, it can
+        only be enabled/disabled by the user with draggableX/Y.
+
+        Supported options for each prop:
+            optionName: User option in series.dragDrop that enables/disables
+                dragging this prop.
+            axis: Can be 'x' or 'y'. Whether this prop is linked to x or y axis.
+            move: Whether or not this prop should be updated when moving points.
+            resize: Whether or not to draw a drag handle and allow user to drag and
+                update this prop by itself.
+            beforeResize: Hook to perform tasks before a resize is made. Gets
+                the guide box, the new points values, and the point as args.
+            resizeSide: Which side of the guide box to resize when dragging the
+                handle. Can be "left", "right", "top", "bottom". Chart.inverted is
+                handled automatically. Can also be a function, taking the new point
+                values as parameter, as well as the point, and returning a string
+                with the side.
+            propValidate: Function that takes the prop value and the point as
+                arguments, and returns true if the prop value is valid, false if
+                not. It is used to prevent e.g. resizing "low" above "high".
+            handlePositioner: For resizeable props, return 0,0 in SVG plot coords of
+                where to place the dragHandle. Gets point as argument. Should return
+                object with x and y properties.
+            handleFormatter: For resizeable props, return the path of the drag
+                handle as an SVG path array. Gets the point as argument. The handle
+                is translated according to handlePositioner.
+            handleOptions: Options to merge with the default handle options.
+
+            TODO:
+            - It makes sense to have support for resizing the size of bubbles and
+                e.g variwide columns. This requires us to support dragging along a
+                z-axis, somehow computing a relative value from old to new pixel
+                size.
+            - Moving maps could be useful, although we would have to compute new
+                point.path values in order to do it properly (using SVG translate
+                is easier, but won't update the data).
+        */
+
+        // 90deg rotated column handle path, used in multiple series types
+        var horizHandleFormatter = function (point) {
+            var shapeArgs = point.shapeArgs || point.graphic.getBBox(),
+                top = shapeArgs.r || 0, // Rounding of bar corners
+                bottom = shapeArgs.height - top,
+                centerY = shapeArgs.height / 2;
+
+            return [
+                // Top wick
+                'M', 0, top,
+                'L', 0, centerY - 5,
+                // Circle
+                'A', 1, 1, 0, 0, 0, 0, centerY + 5,
+                'A', 1, 1, 0, 0, 0, 0, centerY - 5,
+                // Bottom wick
+                'M', 0, centerY + 5,
+                'L', 0, bottom
+            ];
+        };
+
+        // Line series - only draggableX/Y, no drag handles
+        var lineDragDropProps = seriesTypes.line.prototype.dragDropProps = {
+            x: {
+                axis: 'x',
+                move: true
+            },
+            y: {
+                axis: 'y',
+                move: true
+            }
+        };
+
+        // Flag series - same as line/scatter
+        if (seriesTypes.flags) {
+            seriesTypes.flags.prototype.dragDropProps = lineDragDropProps;
+        }
+
+        // Column series - x can be moved, y can only be resized. Note extra
+        // functionality for handling upside down columns (below threshold).
+        var columnDragDropProps = seriesTypes.column.prototype.dragDropProps = {
+            x: {
+                axis: 'x',
+                move: true
+            },
+            y: {
+                axis: 'y',
+                move: false,
+                resize: true,
+                // Force guideBox start coordinates
+                beforeResize: function (guideBox, pointVals, point) {
+                    // We need to ensure that guideBox always starts at threshold.
+                    // We flip whether or not we update the top or bottom of the guide
+                    // box at threshold, but if we drag the mouse fast, the top has not
+                    // reached threshold before we cross over and update the bottom.
+                    var threshold = point.series.translatedThreshold,
+                        y = guideBox.attr('y'),
+                        height,
+                        diff;
+
+                    if (pointVals.y >= point.series.options.threshold || 0) {
+                        // Above threshold - always set height to hit the threshold
+                        height = guideBox.attr('height');
+                        diff = threshold ? threshold - (y + height) : 0;
+                        guideBox.attr({
+                            height: Math.max(0, Math.round(height + diff))
+                        });
+                    } else {
+                        // Below - always set y to start at threshold
+                        guideBox.attr({
+                            y: Math.round(y + (threshold ? threshold - y : 0))
+                        });
+                    }
+                },
+                // Flip the side of the resize handle if column is below threshold.
+                // Make sure we remove the handle on the other side.
+                resizeSide: function (pointVals, point) {
+                    var chart = point.series.chart,
+                        dragHandles = chart.dragHandles,
+                        side = pointVals.y >= (point.series.options.threshold || 0) ?
+                            'top' : 'bottom',
+                        flipSide = flipResizeSide(side);
+
+                    // Force remove handle on other side
+                    if (dragHandles[flipSide]) {
+                        dragHandles[flipSide].destroy();
+                        delete dragHandles[flipSide];
+                    }
+                    return side;
+                },
+                // Position handle at bottom if column is below threshold
+                handlePositioner: function (point) {
+                    var bBox = point.shapeArgs || point.graphic.getBBox();
+
+                    return {
+                        x: bBox.x,
+                        y: point.y >= (point.series.options.threshold || 0) ?
+                            bBox.y : bBox.y + bBox.height
+                    };
+                },
+                // Horizontal handle
+                handleFormatter: function (point) {
+                    var shapeArgs = point.shapeArgs,
+                        radius = shapeArgs.r || 0, // Rounding of bar corners
+                        centerX = shapeArgs.width / 2;
+
+                    return [
+                        // Left wick
+                        'M', radius, 0,
+                        'L', centerX - 5, 0,
+                        // Circle
+                        'A', 1, 1, 0, 0, 0, centerX + 5, 0,
+                        'A', 1, 1, 0, 0, 0, centerX - 5, 0,
+                        // Right wick
+                        'M', centerX + 5, 0,
+                        'L', shapeArgs.width - radius, 0
+                    ];
+                }
+            }
+        };
+
+        // Bullet graph, x/y same as column, but also allow target to be dragged.
+        if (seriesTypes.bullet) {
+            seriesTypes.bullet.prototype.dragDropProps = {
+                x: columnDragDropProps.x,
+                y: columnDragDropProps.y,
+                /**
+                 * Allow target value to be dragged individually. Requires
+                 * `draggable-points` module.
+                 *
+                 * @type      {boolean}
+                 * @default   true
+                 * @apioption plotOptions.bullet.dragDrop.draggableTarget
+                 */
+                target: {
+                    optionName: 'draggableTarget',
+                    axis: 'y',
+                    move: true,
+                    resize: true,
+                    resizeSide: 'top',
+                    handlePositioner: function (point) {
+                        var bBox = point.targetGraphic.getBBox();
+
+                        return {
+                            x: point.barX,
+                            y: bBox.y + bBox.height / 2
+                        };
+                    },
+                    handleFormatter: columnDragDropProps.y.handleFormatter
+                }
+            };
+        }
+
+        // Columnrange series - move x, resize or move low/high
+        if (seriesTypes.columnrange) {
+            seriesTypes.columnrange.prototype.dragDropProps = {
+                x: {
+                    axis: 'x',
+                    move: true
+                },
+                /**
+                 * Allow low value to be dragged individually. Requires
+                 * `draggable-points` module.
+                 *
+                 * @type      {boolean}
+                 * @default   true
+                 * @apioption plotOptions.columnrange.dragDrop.draggableLow
+                 */
+                low: {
+                    optionName: 'draggableLow',
+                    axis: 'y',
+                    move: true,
+                    resize: true,
+                    resizeSide: 'bottom',
+                    handlePositioner: function (point) {
+                        var bBox = point.shapeArgs || point.graphic.getBBox();
+
+                        return {
+                            x: bBox.x,
+                            y: bBox.y + bBox.height
+                        };
+                    },
+                    handleFormatter: columnDragDropProps.y.handleFormatter,
+                    propValidate: function (val, point) {
+                        return val <= point.high;
+                    }
+                },
+                /**
+                 * Allow high value to be dragged individually. Requires
+                 * `draggable-points` module.
+                 *
+                 * @type      {boolean}
+                 * @default   true
+                 * @apioption plotOptions.columnrange.dragDrop.draggableHigh
+                 */
+                high: {
+                    optionName: 'draggableHigh',
+                    axis: 'y',
+                    move: true,
+                    resize: true,
+                    resizeSide: 'top',
+                    handlePositioner: function (point) {
+                        var bBox = point.shapeArgs || point.graphic.getBBox();
+
+                        return {
+                            x: bBox.x,
+                            y: bBox.y
+                        };
+                    },
+                    handleFormatter: columnDragDropProps.y.handleFormatter,
+                    propValidate: function (val, point) {
+                        return val >= point.low;
+                    }
+                }
+            };
+        }
+
+        // Boxplot series - move x, resize or move low/q1/q3/high
+        if (seriesTypes.boxplot) {
+            seriesTypes.boxplot.prototype.dragDropProps = {
+                x: columnDragDropProps.x,
+                /**
+                 * Allow low value to be dragged individually. Requires
+                 * `draggable-points` module.
+                 *
+                 * @type      {boolean}
+                 * @default   true
+                 * @apioption plotOptions.boxplot.dragDrop.draggableLow
+                 */
+                low: {
+                    optionName: 'draggableLow',
+                    axis: 'y',
+                    move: true,
+                    resize: true,
+                    resizeSide: 'bottom',
+                    handlePositioner: function (point) {
+                        return {
+                            x: point.shapeArgs.x,
+                            y: point.lowPlot
+                        };
+                    },
+                    handleFormatter: columnDragDropProps.y.handleFormatter,
+                    propValidate: function (val, point) {
+                        return val <= point.q1;
+                    }
+                },
+                /**
+                 * Allow Q1 value to be dragged individually. Requires
+                 * `draggable-points` module.
+                 *
+                 * @type      {boolean}
+                 * @default   true
+                 * @apioption plotOptions.boxplot.dragDrop.draggableQ1
+                 */
+                q1: {
+                    optionName: 'draggableQ1',
+                    axis: 'y',
+                    move: true,
+                    resize: true,
+                    resizeSide: 'bottom',
+                    handlePositioner: function (point) {
+                        return {
+                            x: point.shapeArgs.x,
+                            y: point.q1Plot
+                        };
+                    },
+                    handleFormatter: columnDragDropProps.y.handleFormatter,
+                    propValidate: function (val, point) {
+                        return val <= point.median && val >= point.low;
+                    }
+                },
+                median: {
+                    // Median can not be dragged individually, just move the whole
+                    // point for this.
+                    axis: 'y',
+                    move: true
+                },
+                /**
+                 * Allow Q3 value to be dragged individually. Requires
+                 * `draggable-points` module.
+                 *
+                 * @type      {boolean}
+                 * @default   true
+                 * @apioption plotOptions.boxplot.dragDrop.draggableQ3
+                 */
+                q3: {
+                    optionName: 'draggableQ3',
+                    axis: 'y',
+                    move: true,
+                    resize: true,
+                    resizeSide: 'top',
+                    handlePositioner: function (point) {
+                        return {
+                            x: point.shapeArgs.x,
+                            y: point.q3Plot
+                        };
+                    },
+                    handleFormatter: columnDragDropProps.y.handleFormatter,
+                    propValidate: function (val, point) {
+                        return val <= point.high && val >= point.median;
+                    }
+                },
+                /**
+                 * Allow high value to be dragged individually. Requires
+                 * `draggable-points` module.
+                 *
+                 * @type      {boolean}
+                 * @default   true
+                 * @apioption plotOptions.boxplot.dragDrop.draggableHigh
+                 */
+                high: {
+                    optionName: 'draggableHigh',
+                    axis: 'y',
+                    move: true,
+                    resize: true,
+                    resizeSide: 'top',
+                    handlePositioner: function (point) {
+                        return {
+                            x: point.shapeArgs.x,
+                            y: point.highPlot
+                        };
+                    },
+                    handleFormatter: columnDragDropProps.y.handleFormatter,
+                    propValidate: function (val, point) {
+                        return val >= point.q3;
+                    }
+                }
+            };
+        }
+
+
+        // OHLC series - move x, resize or move open/high/low/close
+        if (seriesTypes.ohlc) {
+            seriesTypes.ohlc.prototype.dragDropProps = {
+                x: columnDragDropProps.x,
+                /**
+                 * Allow low value to be dragged individually. Requires
+                 * `draggable-points` module.
+                 *
+                 * @type      {boolean}
+                 * @default   true
+                 * @apioption plotOptions.ohlc.dragDrop.draggableLow
+                 */
+                low: {
+                    optionName: 'draggableLow',
+                    axis: 'y',
+                    move: true,
+                    resize: true,
+                    resizeSide: 'bottom',
+                    handlePositioner: function (point) {
+                        return {
+                            x: point.shapeArgs.x,
+                            y: point.plotLow
+                        };
+                    },
+                    handleFormatter: columnDragDropProps.y.handleFormatter,
+                    propValidate: function (val, point) {
+                        return val <= point.open && val <= point.close;
+                    }
+                },
+                /**
+                 * Allow high value to be dragged individually. Requires
+                 * `draggable-points` module.
+                 *
+                 * @type      {boolean}
+                 * @default   true
+                 * @apioption plotOptions.ohlc.dragDrop.draggableHigh
+                 */
+                high: {
+                    optionName: 'draggableHigh',
+                    axis: 'y',
+                    move: true,
+                    resize: true,
+                    resizeSide: 'top',
+                    handlePositioner: function (point) {
+                        return {
+                            x: point.shapeArgs.x,
+                            y: point.plotHigh
+                        };
+                    },
+                    handleFormatter: columnDragDropProps.y.handleFormatter,
+                    propValidate: function (val, point) {
+                        return val >= point.open && val >= point.close;
+                    }
+                },
+                /**
+                 * Allow open value to be dragged individually. Requires
+                 * `draggable-points` module.
+                 *
+                 * @type      {boolean}
+                 * @default   true
+                 * @apioption plotOptions.ohlc.dragDrop.draggableOpen
+                 */
+                open: {
+                    optionName: 'draggableOpen',
+                    axis: 'y',
+                    move: true,
+                    resize: true,
+                    resizeSide: function (point) {
+                        return point.open >= point.close ? 'top' : 'bottom';
+                    },
+                    handlePositioner: function (point) {
+                        return {
+                            x: point.shapeArgs.x,
+                            y: point.plotOpen
+                        };
+                    },
+                    handleFormatter: columnDragDropProps.y.handleFormatter,
+                    propValidate: function (val, point) {
+                        return val <= point.high && val >= point.low;
+                    }
+                },
+                /**
+                 * Allow close value to be dragged individually. Requires
+                 * `draggable-points` module.
+                 *
+                 * @type      {boolean}
+                 * @default   true
+                 * @apioption plotOptions.ohlc.dragDrop.draggableClose
+                 */
+                close: {
+                    optionName: 'draggableClose',
+                    axis: 'y',
+                    move: true,
+                    resize: true,
+                    resizeSide: function (point) {
+                        return point.open >= point.close ? 'bottom' : 'top';
+                    },
+                    handlePositioner: function (point) {
+                        return {
+                            x: point.shapeArgs.x,
+                            y: point.plotClose
+                        };
+                    },
+                    handleFormatter: columnDragDropProps.y.handleFormatter,
+                    propValidate: function (val, point) {
+                        return val <= point.high && val >= point.low;
+                    }
+                }
+            };
+        }
+
+        // Arearange series - move x, resize or move low/high
+        if (seriesTypes.arearange) {
+            var columnrangeDragDropProps = seriesTypes.columnrange
+                    .prototype.dragDropProps,
+                // Use a circle covering the marker as drag handle
+                arearangeHandleFormatter = function (point) {
+                    var radius = point.graphic ?
+                        point.graphic.getBBox().width / 2 + 1 :
+                        4;
+
+                    return [
+                        'M', 0 - radius, 0,
+                        'a', radius, radius, 0, 1, 0, radius * 2, 0,
+                        'a', radius, radius, 0, 1, 0, radius * -2, 0
+                    ];
+                };
+
+            seriesTypes.arearange.prototype.dragDropProps = {
+                x: columnrangeDragDropProps.x,
+                /**
+                 * Allow low value to be dragged individually. Requires
+                 * `draggable-points` module.
+                 *
+                 * @type      {boolean}
+                 * @default   true
+                 * @apioption plotOptions.arearange.dragDrop.draggableLow
+                 */
+                low: {
+                    optionName: 'draggableLow',
+                    axis: 'y',
+                    move: true,
+                    resize: true,
+                    resizeSide: 'bottom',
+                    handlePositioner: function (point) {
+                        var bBox = point.lowerGraphic && point.lowerGraphic.getBBox();
+
+                        return bBox ? {
+                            x: bBox.x + bBox.width / 2,
+                            y: bBox.y + bBox.height / 2
+                        } : { x: -999, y: -999 };
+                    },
+                    handleFormatter: arearangeHandleFormatter,
+                    propValidate: columnrangeDragDropProps.low.propValidate
+                },
+                /**
+                 * Allow high value to be dragged individually. Requires
+                 * `draggable-points` module.
+                 *
+                 * @type      {boolean}
+                 * @default   true
+                 * @apioption plotOptions.arearange.dragDrop.draggableHigh
+                 */
+                high: {
+                    optionName: 'draggableHigh',
+                    axis: 'y',
+                    move: true,
+                    resize: true,
+                    resizeSide: 'top',
+                    handlePositioner: function (point) {
+                        var bBox = point.upperGraphic && point.upperGraphic.getBBox();
+
+                        return bBox ? {
+                            x: bBox.x + bBox.width / 2,
+                            y: bBox.y + bBox.height / 2
+                        } : { x: -999, y: -999 };
+                    },
+                    handleFormatter: arearangeHandleFormatter,
+                    propValidate: columnrangeDragDropProps.high.propValidate
+                }
+            };
+        }
+
+        // Waterfall - mostly as column, but don't show drag handles for sum points
+        if (seriesTypes.waterfall) {
+            seriesTypes.waterfall.prototype.dragDropProps = {
+                x: columnDragDropProps.x,
+                y: merge(columnDragDropProps.y, {
+                    handleFormatter: function (point) {
+                        return point.isSum || point.isIntermediateSum ? null :
+                            columnDragDropProps.y.handleFormatter(point);
+                    }
+                })
+            };
+        }
+
+        // Xrange - resize/move x/x2, and move y
+        if (seriesTypes.xrange) {
+            // Handle positioner logic is the same for x and x2 apart from the
+            // x value. shapeArgs does not take yAxis reversed etc into account, so we
+            // use axis.toPixels to handle positioning.
+            var xrangeHandlePositioner = function (point, xProp) {
+                    var series = point.series,
+                        xAxis = series.xAxis,
+                        yAxis = series.yAxis,
+                        inverted = series.chart.inverted,
+                        // Using toPixels handles axis.reversed, but doesn't take
+                        // chart.inverted into account.
+                        newX = xAxis.toPixels(point[xProp], true),
+                        newY = yAxis.toPixels(point.y, true);
+
+                    // Handle chart inverted
+                    if (inverted) {
+                        newX = xAxis.len - newX;
+                        newY = yAxis.len - newY -
+                            point.shapeArgs.height / 2;
+                    } else {
+                        newY -= point.shapeArgs.height / 2;
+                    }
+
+                    return {
+                        x: Math.round(newX),
+                        y: Math.round(newY)
+                    };
+                },
+                xrangeDragDropProps = seriesTypes.xrange.prototype.dragDropProps = {
+                    y: {
+                        axis: 'y',
+                        move: true
+                    },
+                    /**
+                     * Allow x value to be dragged individually. Requires
+                     * `draggable-points` module.
+                     *
+                     * @type      {boolean}
+                     * @default   true
+                     * @apioption plotOptions.xrange.dragDrop.draggableX1
+                     */
+                    x: {
+                        optionName: 'draggableX1',
+                        axis: 'x',
+                        move: true,
+                        resize: true,
+                        resizeSide: 'left',
+                        handlePositioner: function (point) {
+                            return xrangeHandlePositioner(point, 'x');
+                        },
+                        handleFormatter: horizHandleFormatter,
+                        propValidate: function (val, point) {
+                            return val <= point.x2;
+                        }
+                    },
+                    /**
+                     * Allow x2 value to be dragged individually. Requires
+                     * `draggable-points` module.
+                     *
+                     * @type      {boolean}
+                     * @default   true
+                     * @apioption plotOptions.xrange.dragDrop.draggableX2
+                     */
+                    x2: {
+                        optionName: 'draggableX2',
+                        axis: 'x',
+                        move: true,
+                        resize: true,
+                        resizeSide: 'right',
+                        handlePositioner: function (point) {
+                            return xrangeHandlePositioner(point, 'x2');
+                        },
+                        handleFormatter: horizHandleFormatter,
+                        propValidate: function (val, point) {
+                            return val >= point.x;
+                        }
+                    }
+                };
+        }
+
+        // Gantt - same as xrange, but with aliases
+        if (seriesTypes.gantt) {
+            seriesTypes.gantt.prototype.dragDropProps = {
+                y: xrangeDragDropProps.y,
+                /**
+                 * Allow start value to be dragged individually. Requires
+                 * `draggable-points` module.
+                 *
+                 * @type      {boolean}
+                 * @default   true
+                 * @apioption plotOptions.gantt.dragDrop.draggableStart
+                 */
+                start: merge(xrangeDragDropProps.x, {
+                    optionName: 'draggableStart',
+                    // Do not allow individual drag handles for milestones
+                    validateIndividualDrag: function (point) {
+                        return !point.milestone;
+                    }
+                }),
+                /**
+                 * Allow end value to be dragged individually. Requires
+                 * `draggable-points` module.
+                 *
+                 * @type      {boolean}
+                 * @default   true
+                 * @apioption plotOptions.gantt.dragDrop.draggableEnd
+                 */
+                end: merge(xrangeDragDropProps.x2, {
+                    optionName: 'draggableEnd',
+                    // Do not allow individual drag handles for milestones
+                    validateIndividualDrag: function (point) {
+                        return !point.milestone;
+                    }
+                })
+            };
+        }
+
+        // Don't support certain series types
+        [
+            'gauge',
+            'pie',
+            'sunburst',
+            'wordcloud',
+            'sankey',
+            'histogram',
+            'pareto',
+            'vector',
+            'windbarb',
+            'treemap',
+            'bellcurve',
+            'sma',
+            'map',
+            'mapline'
+        ].forEach(
+            function (type) {
+                if (seriesTypes[type]) {
+                    seriesTypes[type].prototype.dragDropProps = null;
+                }
+            }
+        );
+
+        /**
+         * The draggable-points module allows points to be moved around or modified in
+         * the chart. In addition to the options mentioned under the `dragDrop` API
+         * structure, the module fires three events,
+         * [point.dragStart](plotOptions.series.point.events.dragStart),
+         * [point.drag](plotOptions.series.point.events.drag) and
+         * [point.drop](plotOptions.series.point.events.drop).
+         *
+         * It requires the `modules/draggable-points.js` file to be loaded.
+         *
+         * @sample highcharts/dragdrop/resize-column
+         *         Draggable column and line series
+         * @sample highcharts/dragdrop/bar-series
+         *         Draggable bar
+         * @sample highcharts/dragdrop/drag-bubble
+         *         Draggable bubbles
+         * @sample highcharts/dragdrop/drag-xrange
+         *         Draggable X range series
+         *
+         * @since     6.2.0
+         * @apioption plotOptions.series.dragDrop
+         */
+
+        /**
+         * The amount of pixels to drag the pointer before it counts as a drag
+         * operation. This prevents drag/drop to fire when just clicking or selecting
+         * points.
+         *
+         * @type      {number}
+         * @default   2
+         * @since     6.2.0
+         * @apioption plotOptions.series.dragDrop.dragSensitivity
+         */
+        var defaultDragSensitivity = 2;
+
+        /**
+         * Style options for the guide box. The guide box has one state by default, the
+         * `default` state.
+         *
+         * @type         {Highcharts.Dictionary<Highcharts.PlotSeriesDragDropGuideBoxDefaultOptions>}
+         * @since        6.2.0
+         * @optionparent plotOptions.series.dragDrop.guideBox
+         */
+        var defaultGuideBoxOptions = {
+            /**
+             * Style options for the guide box default state.
+             *
+             * @since 6.2.0
+             */
+            'default': {
+                /**
+                 * CSS class name of the guide box in this state. Defaults to
+                 * `highcharts-drag-box-default`.
+                 *
+                 * @since 6.2.0
+                 */
+                className: 'highcharts-drag-box-default',
+
+                /**
+                 * Width of the line around the guide box.
+                 *
+                 * @since 6.2.0
+                 */
+                lineWidth: 1,
+
+                /**
+                 * Color of the border around the guide box.
+                 *
+                 * @type  {Highcharts.ColorString}
+                 * @since 6.2.0
+                 */
+                lineColor: '#888',
+
+                /**
+                 * Guide box fill color.
+                 *
+                 * @type  {Highcharts.ColorString|Highcharts.GradientColorObject|Highcharts.PatternObject}
+                 * @since 6.2.0
+                 */
+                color: 'rgba(0, 0, 0, 0.1)',
+
+                /**
+                 * Guide box cursor.
+                 *
+                 * @since 6.2.0
+                 */
+                cursor: 'move',
+
+                /**
+                 * Guide box zIndex.
+                 *
+                 * @since 6.2.0
+                 */
+                zIndex: 900
+            }
+        };
+
+
+        /**
+         * Options for the drag handles.
+         *
+         * @since        6.2.0
+         * @optionparent plotOptions.series.dragDrop.dragHandle
+         */
+        var defaultDragHandleOptions = {
+
+            /**
+             * Function to define the SVG path to use for the drag handles. Takes the
+             * point as argument. Should return an SVG path in array format. The SVG
+             * path is automatically positioned on the point.
+             *
+             * @type      {Function}
+             * @since     6.2.0
+             * @apioption plotOptions.series.dragDrop.dragHandle.pathFormatter
+             */
+            // pathFormatter: null,
+
+            /**
+             * The mouse cursor to use for the drag handles. By default this is
+             * intelligently switching between `ew-resize` and `ns-resize` depending on
+             * the direction the point is being dragged.
+             *
+             * @type      {string}
+             * @since     6.2.0
+             * @apioption plotOptions.series.dragDrop.dragHandle.cursor
+             */
+            // cursor: null,
+
+            /**
+             * The class name of the drag handles. Defaults to `highcharts-drag-handle`.
+             *
+             * @since 6.2.0
+             */
+            className: 'highcharts-drag-handle',
+
+            /**
+             * The fill color of the drag handles.
+             *
+             * @type  {Highcharts.ColorString|Highcharts.GradientColorObject|Highcharts.PatternObject}
+             * @since 6.2.0
+             */
+            color: '#fff',
+
+            /**
+             * The line color of the drag handles.
+             *
+             * @type  {Highcharts.ColorString}
+             * @since 6.2.0
+             */
+            lineColor: 'rgba(0, 0, 0, 0.6)',
+
+            /**
+             * The line width for the drag handles.
+             *
+             * @since 6.2.0
+             */
+            lineWidth: 1,
+
+            /**
+             * The z index for the drag handles.
+             *
+             * @since 6.2.0
+             */
+            zIndex: 901
+        };
+
+        /**
+         * Set the minimum X value the points can be moved to.
+         *
+         * @sample {gantt} gantt/dragdrop/drag-gantt
+         *         Limit dragging
+         * @sample {highcharts} highcharts/dragdrop/drag-xrange
+         *         Limit dragging
+         *
+         * @type      {number}
+         * @since     6.2.0
+         * @apioption plotOptions.series.dragDrop.dragMinX
+         */
+
+        /**
+         * Set the maximum X value the points can be moved to.
+         *
+         * @sample {gantt} gantt/dragdrop/drag-gantt
+         *         Limit dragging
+         * @sample {highcharts} highcharts/dragdrop/drag-xrange
+         *         Limit dragging
+         *
+         * @type      {number}
+         * @since     6.2.0
+         * @apioption plotOptions.series.dragDrop.dragMaxX
+         */
+
+        /**
+         * Set the minimum Y value the points can be moved to.
+         *
+         * @sample {gantt} gantt/dragdrop/drag-gantt
+         *         Limit dragging
+         * @sample {highcharts} highcharts/dragdrop/drag-xrange
+         *         Limit dragging
+         *
+         * @type      {number}
+         * @since     6.2.0
+         * @apioption plotOptions.series.dragDrop.dragMinY
+         */
+
+        /**
+         * Set the maximum Y value the points can be moved to.
+         *
+         * @sample {gantt} gantt/dragdrop/drag-gantt
+         *         Limit dragging
+         * @sample {highcharts} highcharts/dragdrop/drag-xrange
+         *         Limit dragging
+         *
+         * @type      {number}
+         * @since     6.2.0
+         * @apioption plotOptions.series.dragDrop.dragMaxY
+         */
+
+        /**
+         * The X precision value to drag to for this series. Set to 0 to disable. By
+         * default this is disabled, except for category axes, where the default is 1.
+         *
+         * @type      {number}
+         * @default   0
+         * @since     6.2.0
+         * @apioption plotOptions.series.dragDrop.dragPrecisionX
+         */
+
+        /**
+         * The Y precision value to drag to for this series. Set to 0 to disable. By
+         * default this is disabled, except for category axes, where the default is 1.
+         *
+         * @type      {number}
+         * @default   0
+         * @since     6.2.0
+         * @apioption plotOptions.series.dragDrop.dragPrecisionY
+         */
+
+        /**
+         * Enable dragging in the X dimension.
+         *
+         * @type      {boolean}
+         * @since     6.2.0
+         * @apioption plotOptions.series.dragDrop.draggableX
+         */
+
+        /**
+         * Enable dragging in the Y dimension. Note that this is not supported for
+         * TreeGrid axes (the default axis type in Gantt charts).
+         *
+         * @type      {boolean}
+         * @since     6.2.0
+         * @apioption plotOptions.series.dragDrop.draggableY
+         */
+
+        /**
+         * Group the points by a property. Points with the same property value will be
+         * grouped together when moving.
+         *
+         * @sample {gantt} gantt/dragdrop/drag-gantt
+         *         Drag grouped points
+         * @sample {highcharts} highcharts/dragdrop/drag-xrange
+         *         Drag grouped points
+         *
+         * @type      {string}
+         * @since     6.2.0
+         * @apioption plotOptions.series.dragDrop.groupBy
+         */
+
+        /**
+         * Update points as they are dragged. If false, a guide box is drawn to
+         * illustrate the new point size.
+         *
+         * @sample {gantt} gantt/dragdrop/drag-gantt
+         *         liveRedraw disabled
+         * @sample {highcharts} highcharts/dragdrop/drag-xrange
+         *         liveRedraw disabled
+         *
+         * @type      {boolean}
+         * @default   true
+         * @since     6.2.0
+         * @apioption plotOptions.series.dragDrop.liveRedraw
+         */
+
+        /**
+         * Set a key to hold when dragging to zoom the chart. Requires the
+         * draggable-points module. This is useful to avoid zooming while moving points.
+         * Should be set different than [chart.panKey](#chart.panKey).
+         *
+         * @type       {string}
+         * @since      6.2.0
+         * @validvalue ["alt", "ctrl", "meta", "shift"]
+         * @apioption  chart.zoomKey
+         */
+
+        /**
+         * Callback that fires when starting to drag a point. The mouse event object is
+         * passed in as an argument. If a drag handle is used, `e.updateProp` is set to
+         * the data property being dragged. The `this` context is the point. See
+         * [drag and drop options](plotOptions.series.dragDrop).
+         *
+         * Requires the `draggable-points` module.
+         *
+         * @sample {highcharts} highcharts/dragdrop/drag-xrange
+         *         Drag events
+         *
+         * @type      {Highcharts.SeriesPointDragStartCallbackFunction}
+         * @since     6.2.0
+         * @apioption plotOptions.series.point.events.dragStart
+         */
+
+        /**
+         * Callback that fires while dragging a point. The mouse event is passed in as
+         * parameter. The original data can be accessed from `e.origin`, and the new
+         * point values can be accessed from `e.newPoints`. If there is only a single
+         * point being updated, it can be accessed from `e.newPoint` for simplicity, and
+         * its ID can be accessed from `e.newPointId`. The `this` context is the point
+         * being dragged. To stop the default drag action, return false. See
+         * [drag and drop options](plotOptions.series.dragDrop).
+         *
+         * Requires the `draggable-points` module.
+         *
+         * @sample {highcharts} highcharts/dragdrop/drag-xrange
+         *         Drag events
+         *
+         * @type      {Highcharts.SeriesPointDragCallbackFunction}
+         * @since     6.2.0
+         * @apioption plotOptions.series.point.events.drag
+         */
+
+        /**
+         * Callback that fires when the point is dropped. The parameters passed are the
+         * same as for [drag](#plotOptions.series.point.events.drag). To stop the
+         * default drop action, return false. See
+         * [drag and drop options](plotOptions.series.dragDrop).
+         *
+         * Requires the `draggable-points` module.
+         *
+         * @sample {highcharts} highcharts/dragdrop/drag-xrange
+         *         Drag events
+         *
+         * @type      {Highcharts.SeriesPointDropCallbackFunction}
+         * @since     6.2.0
+         * @apioption plotOptions.series.point.events.drop
+         */
+
+        /**
+         * Point specific options for the draggable-points module. Overrides options on
+         * `series.dragDrop`.
+         *
+         * Requires the `draggable-points` module.
+         *
+         * @extends   plotOptions.series.dragDrop
+         * @since     6.2.0
+         * @apioption series.line.data.dragDrop
+         */
+
+
+        /**
+         * Utility function to test if a series is using drag/drop, looking at its
+         * options.
+         *
+         * @private
+         * @function isSeriesDraggable
+         *
+         * @param {Highcharts.Series} series
+         *        The series to test.
+         *
+         * @return {boolean}
+         *         True if the series is using drag/drop.
+         */
+        function isSeriesDraggable(series) {
+            var props = ['draggableX', 'draggableY'],
+                i;
+
+            // Add optionNames from dragDropProps to the array of props to check for
+            objectEach(series.dragDropProps, function (val) {
+                if (val.optionName) {
+                    props.push(val.optionName);
+                }
+            });
+
+            // Loop over all options we have that could enable dragDrop for this
+            // series. If any of them are truthy, this series is draggable.
+            i = props.length;
+            while (i--) {
+                if (series.options.dragDrop[props[i]]) {
+                    return true;
+                }
+            }
+        }
+
+
+        /**
+         * Utility function to test if a chart should have drag/drop enabled, looking at
+         * its options.
+         *
+         * @private
+         * @function isChartDraggable
+         *
+         * @param {Highcharts.Chart} chart
+         *        The chart to test.
+         *
+         * @return {boolean}
+         *         True if the chart is drag/droppable.
+         */
+        function isChartDraggable(chart) {
+            var i = chart.series ? chart.series.length : 0;
+
+            if (chart.hasCartesianSeries && !chart.polar) {
+                while (i--) {
+                    if (
+                        chart.series[i].options.dragDrop &&
+                        isSeriesDraggable(chart.series[i])
+                    ) {
+                        return true;
+                    }
+                }
+            }
+        }
+
+
+        /**
+         * Utility function to test if a point is movable (any of its props can be
+         * dragged by a move, not just individually).
+         *
+         * @private
+         * @function isPointMovable
+         *
+         * @param {Highcharts.Point} point
+         *        The point to test.
+         *
+         * @return {boolean}
+         *         True if the point is movable.
+         */
+        function isPointMovable(point) {
+            var series = point.series,
+                seriesDragDropOptions = series.options.dragDrop || {},
+                pointDragDropOptions = point.options && point.options.dragDrop,
+                updateProps = series.dragDropProps,
+                hasMovableX,
+                hasMovableY;
+
+            objectEach(updateProps, function (p) {
+                if (p.axis === 'x' && p.move) {
+                    hasMovableX = true;
+                } else if (p.axis === 'y' && p.move) {
+                    hasMovableY = true;
+                }
+            });
+
+            // We can only move the point if draggableX/Y is set, even if all the
+            // individual prop options are set.
+            return (
+                seriesDragDropOptions.draggableX && hasMovableX ||
+                    seriesDragDropOptions.draggableY && hasMovableY
+            ) &&
+                !(
+                    pointDragDropOptions &&
+                    pointDragDropOptions.draggableX === false &&
+                    pointDragDropOptions.draggableY === false
+                ) &&
+                series.yAxis &&
+                series.xAxis;
+        }
+
+
+        /**
+         * Take a mouse/touch event and return the event object with chartX/chartY.
+         *
+         * @private
+         * @function getNormalizedEvent
+         *
+         * @param {global.Event} e
+         *        The event to normalize.
+         *
+         * @return {global.Event}
+         *         The normalized event.
+         */
+        function getNormalizedEvent(e, chart) {
+            return e.chartX === undefined || e.chartY === undefined ?
+                chart.pointer.normalize(e) : e;
+        }
+
+
+        /**
+         * Add multiple event listeners with the same handler to the same element.
+         *
+         * @private
+         * @function addEvents
+         *
+         * @param {*} el
+         *        The element or object to add listeners to.
+         *
+         * @param {Array<string>} types
+         *        Array with the event types this handler should apply to.
+         *
+         * @param {Highcharts.EventCallbackFunction} fn
+         *        The function callback to execute when the events are fired.
+         *
+         * @param {Highcharts.Dictionary<*>} options
+         *        Event options
+         *
+         * @param {number} options.order
+         *        The order the event handler should be called. This opens for having
+         *        one handler be called before another, independent of in which order
+         *        they were added.
+         *
+         * @return {Function}
+         *         A callback function to remove the added events.
+         */
+        function addEvents(el, types, fn, options) {
+            var removeFuncs = types.map(function (type) {
+                return addEvent(el, type, fn, options);
+            });
+
+            return function () {
+                removeFuncs.forEach(function (fn) {
+                    fn();
+                });
+            };
+        }
+
+
+        /**
+         * In mousemove events, check that we have dragged mouse further than the
+         * dragSensitivity before we call mouseMove handler.
+         *
+         * @private
+         * @function hasDraggedPastSensitivity
+         *
+         * @param {global.Event} e
+         *        Mouse move event to test.
+         *
+         * @param {Highcharts.Chart} chart
+         *        Chart that has started dragging.
+         *
+         * @param {number} sensitivity
+         *        Pixel sensitivity to test against.
+         *
+         * @return {boolean}
+         *         True if the event is moved past sensitivity relative to the chart's
+         *         drag origin.
+         */
+        function hasDraggedPastSensitivity(e, chart, sensitivity) {
+            var orig = chart.dragDropData.origin,
+                oldX = orig.chartX,
+                oldY = orig.chartY,
+                newX = e.chartX,
+                newY = e.chartY,
+                distance = Math.sqrt(
+                    (newX - oldX) * (newX - oldX) +
+                    (newY - oldY) * (newY - oldY)
+                );
+
+            return distance > sensitivity;
+        }
+
+
+        /**
+         * Get a snapshot of points, mouse position, and guide box dimensions
+         *
+         * @private
+         * @function getPositionSnapshot
+         *
+         * @param {global.Event} e
+         *        Mouse event with mouse position to snapshot.
+         *
+         * @param {Array<Highcharts.Point>} points
+         *        Points to take snapshot of. We store the value of the data properties
+         *        defined in each series' dragDropProps.
+         *
+         * @param {Highcharts.SVGElement} [guideBox]
+         *        The guide box to take snapshot of.
+         *
+         * @return {object}
+         *         Snapshot object. Point properties are placed in a hashmap with IDs as
+         *         keys.
+         */
+        function getPositionSnapshot(e, points, guideBox) {
+            var res = {
+                chartX: e.chartX,
+                chartY: e.chartY,
+                guideBox: guideBox && {
+                    x: guideBox.attr('x'),
+                    y: guideBox.attr('y'),
+                    width: guideBox.attr('width'),
+                    height: guideBox.attr('height')
+                },
+                points: {}
+            };
+
+            // Loop over the points and add their props
+            points.forEach(function (point) {
+                var pointProps = {};
+
+                // Add all of the props defined in the series' dragDropProps to the
+                // snapshot
+                objectEach(point.series.dragDropProps, function (val, key) {
+                    pointProps[key] = point[key];
+                });
+                pointProps.point = point; // Store reference to point
+                res.points[point.id] = pointProps;
+            });
+
+            return res;
+        }
+
+
+        /**
+         * Get a list of points that are grouped with this point. If only one point is
+         * in the group, that point is returned by itself in an array.
+         *
+         * @private
+         * @function getGroupedPoints
+         *
+         * @param {Highcharts.Point} point
+         *        Point to find group from.
+         *
+         * @return {Array<Highcharts.Point>}
+         *         Array of points in this group.
+         */
+        function getGroupedPoints(point) {
+            var series = point.series,
+                groupKey = series.options.dragDrop.groupBy;
+
+            return point.options[groupKey] ?
+                // If we have a grouping option, filter the points by that
+                series.points.filter(function (comparePoint) {
+                    return comparePoint.options[groupKey] === point.options[groupKey];
+                }) :
+                // Otherwise return the point by itself only
+                [point];
+        }
+
+
+        /**
+         * Resize a rect element on one side. The element is modified.
+         *
+         * @private
+         * @function resizeRect
+         *
+         * @param {Highcharts.SVGElement} rect
+         *        Rect element to resize.
+         *
+         * @param {string} updateSide
+         *        Which side of the rect to update. Can be `left`, `right`, `top` or
+         *        `bottom`.
+         *
+         * @param {object} update
+         *        Object with x and y properties, detailing how much to resize each
+         *        dimension.
+         *
+         * @return {Highcharts.SVGElement}
+         *         The modified rect.
+         */
+        function resizeRect(rect, updateSide, update) {
+            var resizeAttrs;
+
+            switch (updateSide) {
+            case 'left':
+                resizeAttrs = {
+                    x: rect.attr('x') + update.x,
+                    width: Math.max(1, rect.attr('width') - update.x)
+                };
+                break;
+            case 'right':
+                resizeAttrs = {
+                    width: Math.max(1, rect.attr('width') + update.x)
+                };
+                break;
+            case 'top':
+                resizeAttrs = {
+                    y: rect.attr('y') + update.y,
+                    height: Math.max(1, rect.attr('height') - update.y)
+                };
+                break;
+            case 'bottom':
+                resizeAttrs = {
+                    height: Math.max(1, rect.attr('height') + update.y)
+                };
+                break;
+            default:
+            }
+            rect.attr(resizeAttrs);
+        }
+
+
+        /**
+         * Prepare chart.dragDropData with origin info, and show the guide box.
+         *
+         * @private
+         * @function initDragDrop
+         *
+         * @param {global.Event} e
+         *        Mouse event with original mouse position.
+         *
+         * @param {Highcharts.Point} point
+         *        The point the dragging started on.
+         */
+        function initDragDrop(e, point) {
+            var groupedPoints = getGroupedPoints(point),
+                series = point.series,
+                chart = series.chart,
+                guideBox;
+
+            // If liveRedraw is disabled, show the guide box with the default state
+            if (!pick(
+                series.options.dragDrop && series.options.dragDrop.liveRedraw,
+                true
+            )) {
+                chart.dragGuideBox = guideBox = series.getGuideBox(groupedPoints);
+                chart.setGuideBoxState('default', series.options.dragDrop.guideBox)
+                    .add(series.group);
+            }
+
+            // Store some data on the chart to pick up later
+            chart.dragDropData = {
+                origin: getPositionSnapshot(e, groupedPoints, guideBox),
+                point: point,
+                groupedPoints: groupedPoints,
+                isDragging: true
+            };
+        }
+
+
+        /**
+         * Calculate new point options from points being dragged.
+         *
+         * @private
+         * @function getNewPoints
+         *
+         * @param {object} dragDropData
+         *        A chart's dragDropData with drag/drop origin information, and info on
+         *        which points are being dragged.
+         *
+         * @param {global.Event} newPos
+         *        Event with the new position of the mouse (chartX/Y properties).
+         *
+         * @return {Array<object>}
+         *         Hashmap with point.id mapped to an object with the original point
+         *         reference, as well as the new data values.
+         */
+        function getNewPoints(dragDropData, newPos) {
+            var point = dragDropData.point,
+                series = point.series,
+                options = merge(series.options.dragDrop, point.options.dragDrop),
+                updateProps = {},
+                resizeProp = dragDropData.updateProp,
+                hashmap = {};
+
+            // Go through the data props that can be updated on this series and find out
+            // which ones we want to update.
+            objectEach(point.series.dragDropProps, function (val, key) {
+                // If we are resizing, skip if this key is not the correct one or it
+                // is not resizable.
+                if (
+                    resizeProp && (
+                        resizeProp !== key ||
+                        !val.resize ||
+                        val.optionName && options[val.optionName] === false
+                    )
+                ) {
+                    return;
+                }
+
+                // If we are resizing, we now know it is good. If we are moving, check
+                // that moving along this axis is enabled, and the prop is movable.
+                // If this prop is enabled, add it to be updated.
+                if (
+                    resizeProp || (
+                        val.move &&
+                        (
+                            val.axis === 'x' && options.draggableX ||
+                            val.axis === 'y' && options.draggableY
+                        )
+                    )
+                ) {
+                    updateProps[key] = val;
+                }
+            });
+
+            // Go through the points to be updated and get new options for each of them
+            (resizeProp ? // If resizing).forEach(only update the point we are resizing
+                [point] :
+                dragDropData.groupedPoints).forEach(
+                function (p) {
+                    hashmap[p.id] = {
+                        point: p,
+                        newValues: p.getDropValues(
+                            dragDropData.origin, newPos, updateProps
+                        )
+                    };
+                }
+            );
+            return hashmap;
+        }
+
+
+        /**
+         * Update the points in a chart from dragDropData.newPoints.
+         *
+         * @private
+         * @function updatePoints
+         *
+         * @param {Highcharts.Chart} chart
+         *        A chart with dragDropData.newPoints.
+         *
+         * @param {boolean} [animate=true]
+         *        Animate updating points?
+         */
+        function updatePoints(chart, animate) {
+            var newPoints = chart.dragDropData.newPoints,
+                animOptions = animate === false ? false : merge({
+                    duration: 400 // 400 is the default in H.animate
+                }, chart.options.animation);
+
+            chart.isDragDropAnimating = true;
+
+            // Update the points
+            objectEach(newPoints, function (newPoint) {
+                newPoint.point.update(newPoint.newValues, false);
+            });
+
+            chart.redraw(animOptions);
+
+            // Clear the isAnimating flag after animation duration is complete.
+            // The complete handler for animation seems to have bugs at this time, so
+            // we have to use a timeout instead.
+            setTimeout(function () {
+                delete chart.isDragDropAnimating;
+                if (chart.hoverPoint && !chart.dragHandles) {
+                    chart.hoverPoint.showDragHandles();
+                }
+            }, animOptions.duration);
+        }
+
+
+        /**
+         * Resize the guide box according to point options and a difference in mouse
+         * positions. Handles reversed axes.
+         *
+         * @private
+         * @function resizeGuideBox
+         *
+         * @param {Highcharts.Point} point
+         *        The point that is being resized.
+         *
+         * @param {number} dX
+         *        Difference in X position.
+         *
+         * @param {number} dY
+         *        Difference in Y position.
+         */
+        function resizeGuideBox(point, dX, dY) {
+            var series = point.series,
+                chart = series.chart,
+                dragDropData = chart.dragDropData,
+                resizeSide,
+                newPoint,
+                resizeProp = series.dragDropProps[dragDropData.updateProp];
+
+            // dragDropProp.resizeSide holds info on which side to resize.
+            newPoint = dragDropData.newPoints[point.id].newValues;
+            resizeSide = typeof resizeProp.resizeSide === 'function' ?
+                resizeProp.resizeSide(newPoint, point) : resizeProp.resizeSide;
+
+            // Call resize hook if it is defined
+            if (resizeProp.beforeResize) {
+                resizeProp.beforeResize(chart.dragGuideBox, newPoint, point);
+            }
+
+            // Do the resize
+            resizeRect(
+                chart.dragGuideBox,
+                resizeProp.axis === 'x' && series.xAxis.reversed ||
+                resizeProp.axis === 'y' && series.yAxis.reversed ?
+                    flipResizeSide(resizeSide) : resizeSide,
+                {
+                    x: resizeProp.axis === 'x' ?
+                        dX - (dragDropData.origin.prevdX || 0) : 0,
+                    y: resizeProp.axis === 'y' ?
+                        dY - (dragDropData.origin.prevdY || 0) : 0
+                }
+            );
+        }
+
+
+        /**
+         * Default mouse move handler while dragging. Handles updating points or guide
+         * box.
+         *
+         * @private
+         * @function dragMove
+         *
+         * @param {global.Event} e
+         *        The mouse move event.
+         *
+         * @param {Highcharts.Point} point
+         *        The point that is dragged.
+         */
+        function dragMove(e, point) {
+            var series = point.series,
+                chart = series.chart,
+                data = chart.dragDropData,
+                options = merge(series.options.dragDrop, point.options.dragDrop),
+                draggableX = options.draggableX,
+                draggableY = options.draggableY,
+                origin = data.origin,
+                dX = e.chartX - origin.chartX,
+                dY = e.chartY - origin.chartY,
+                oldDx = dX,
+                updateProp = data.updateProp;
+
+            // Handle inverted
+            if (chart.inverted) {
+                dX = -dY;
+                dY = -oldDx;
+            }
+
+            // If we have liveRedraw enabled, update the points immediately. Otherwise
+            // update the guideBox.
+            if (pick(options.liveRedraw, true)) {
+                updatePoints(chart, false);
+
+                // Update drag handles
+                point.showDragHandles();
+
+            } else {
+                // No live redraw, update guide box
+                if (updateProp) {
+                    // We are resizing, so resize the guide box
+                    resizeGuideBox(point, dX, dY);
+                } else {
+                    // We are moving, so move the guide box
+                    chart.dragGuideBox.translate(
+                        draggableX ? dX : 0, draggableY ? dY : 0
+                    );
+                }
+            }
+
+            // Update stored previous dX/Y
+            origin.prevdX = dX;
+            origin.prevdY = dY;
+        }
+
+
+        /**
+         * Set the state of the guide box.
+         *
+         * @private
+         * @function Highcharts.Chart#setGuideBoxState
+         *
+         * @param {string} state
+         *        The state to set the guide box to.
+         *
+         * @param {object} options
+         *        Additional overall guideBox options to consider.
+         *
+         * @return {Highcharts.SVGElement}
+         *         The modified guide box.
+         */
+        H.Chart.prototype.setGuideBoxState = function (state, options) {
+            var guideBox = this.dragGuideBox,
+                guideBoxOptions = merge(defaultGuideBoxOptions, options),
+                stateOptions = merge(guideBoxOptions.default, guideBoxOptions[state]);
+
+            return guideBox
+                .attr({
+                    className: stateOptions.className,
+                    stroke: stateOptions.lineColor,
+                    strokeWidth: stateOptions.lineWidth,
+                    fill: stateOptions.color,
+                    cursor: stateOptions.cursor,
+                    zIndex: stateOptions.zIndex
+                })
+                // Use pointerEvents 'none' to avoid capturing the click event
+                .css({ pointerEvents: 'none' });
+        };
+
+
+        /**
+         * Get updated point values when dragging a point.
+         *
+         * @private
+         * @function Highcharts.Point#getDropValues
+         *
+         * @param {object} origin
+         *        Mouse position (chartX/Y) and point props at current data values.
+         *        Point props should be organized per point.id in a hashmap.
+         *
+         * @param {global.Event} newPos
+         *        New mouse position (chartX/Y).
+         *
+         * @param {object} updateProps
+         *        Point props to modify. Map of prop objects where each key refers to
+         *        the prop, and the value is an object with an axis property. Example:
+         *        {
+         *            x: {
+         *                axis: 'x'
+         *            },
+         *            x2: {
+         *                axis: 'x'
+         *            }
+         *        }
+         *
+         * @return {object}
+         *         An object with updated data values.
+         */
+        H.Point.prototype.getDropValues = function (origin, newPos, updateProps) {
+            var point = this,
+                series = point.series,
+                options = merge(series.options.dragDrop, point.options.dragDrop),
+                yAxis = series.yAxis,
+                xAxis = series.xAxis,
+                dX = newPos.chartX - origin.chartX,
+                dY = newPos.chartY - origin.chartY,
+                oldX = pick(origin.x, point.x),
+                oldY = pick(origin.y, point.y),
+                dXValue = xAxis.toValue(
+                    xAxis.toPixels(oldX, true) +
+                    (xAxis.horiz ? dX : dY),
+                    true
+                ) - oldX,
+                dYValue = yAxis.toValue(
+                    yAxis.toPixels(oldY, true) +
+                    (yAxis.horiz ? dX : dY),
+                    true
+                ) - oldY,
+                result = {},
+                updateSingleProp,
+                pointOrigin = origin.points[point.id];
+
+            // Find out if we only have one prop to update
+            for (var key in updateProps) {
+                if (updateProps.hasOwnProperty(key)) {
+                    if (updateSingleProp !== undefined) {
+                        updateSingleProp = false;
+                        break;
+                    }
+                    updateSingleProp = true;
+                }
+            }
+
+            // Utility function to apply precision and limit a value within the
+            // draggable range
+            function limitToRange(val, direction) {
+                var defaultPrecision = series[direction.toLowerCase() + 'Axis']
+                        .categories ? 1 : 0,
+                    precision = pick(
+                        options['dragPrecision' + direction], defaultPrecision
+                    ),
+                    min = pick(options['dragMin' + direction], -Infinity),
+                    max = pick(options['dragMax' + direction], Infinity),
+                    res = val;
+
+                if (precision) {
+                    res = Math.round(res / precision) * precision;
+                }
+                return Math.max(min, Math.min(max, res));
+            }
+
+            // Assign new value to property. Adds dX/YValue to the old value, limiting
+            // it within min/max ranges.
+            objectEach(updateProps, function (val, key) {
+                var oldVal = pointOrigin[key],
+                    newVal = limitToRange(
+                        oldVal + (val.axis === 'x' ? dXValue : dYValue),
+                        val.axis.toUpperCase()
+                    );
+
+                // If we are updating a single prop, and it has a validation function
+                // for the prop, run it. If it fails, don't update the value.
+                if (
+                    !(
+                        updateSingleProp &&
+                        val.propValidate &&
+                        !val.propValidate(newVal, point)
+                    ) &&
+                    oldVal !== undefined
+                ) {
+                    result[key] = newVal;
+                }
+            });
+
+            return result;
+        };
+
+
+        /**
+         * Returns an SVGElement to use as the guide box for a set of points.
+         *
+         * @private
+         * @function Highcharts.Series#getGuideBox
+         *
+         * @param {Array<Highcharts.Point>} points
+         *        The state to set the guide box to.
+         *
+         * @return {Highcharts.SVGElement}
+         *         An SVG element for the guide box, not added to DOM.
+         */
+        H.Series.prototype.getGuideBox = function (points) {
+            var chart = this.chart,
+                minX = Infinity,
+                maxX = -Infinity,
+                minY = Infinity,
+                maxY = -Infinity,
+                changed;
+
+            // Find bounding box of all points
+            points.forEach(function (point) {
+                var bBox = point.graphic && point.graphic.getBBox() || point.shapeArgs;
+
+                if (bBox && (bBox.width || bBox.height || bBox.x || bBox.y)) {
+                    changed = true;
+                    minX = Math.min(bBox.x, minX);
+                    maxX = Math.max(bBox.x + bBox.width, maxX);
+                    minY = Math.min(bBox.y, minY);
+                    maxY = Math.max(bBox.y + bBox.height, maxY);
+                }
+            });
+
+            return changed ? chart.renderer.rect(
+                minX,
+                minY,
+                maxX - minX,
+                maxY - minY
+            ) : chart.renderer.g();
+        };
+
+
+        /**
+         * On point mouse out. Hide drag handles, depending on state.
+         *
+         * @private
+         * @function mouseOut
+         *
+         * @param {Highcharts.Point} point
+         *        The point mousing out of.
+         */
+        function mouseOut(point) {
+            var chart = point.series && point.series.chart,
+                dragDropData = chart && chart.dragDropData;
+
+            if (
+                chart &&
+                chart.dragHandles &&
+                !(
+                    dragDropData &&
+                    (
+                        dragDropData.isDragging &&
+                        dragDropData.draggedPastSensitivity ||
+                        dragDropData.isHoveringHandle === point.id
+                    )
+                )
+            ) {
+                chart.hideDragHandles();
+            }
+        }
+
+
+        /**
+         * Mouseout on resize handle. Handle states, and possibly run mouseOut on point.
+         *
+         * @private
+         * @function onResizeHandleMouseOut
+         *
+         * @param {Highcharts.Point} point
+         *        The point mousing out of.
+         */
+        function onResizeHandleMouseOut(point) {
+            var chart = point.series.chart;
+
+            if (
+                chart.dragDropData &&
+                point.id === chart.dragDropData.isHoveringHandle
+            ) {
+                delete chart.dragDropData.isHoveringHandle;
+            }
+            if (!chart.hoverPoint) {
+                mouseOut(point);
+            }
+        }
+
+
+        /**
+         * Mousedown on resize handle. Init a drag if the conditions are right.
+         *
+         * @private
+         * @function onResizeHandleMouseDown
+         *
+         * @param {global.Event} e
+         *        The mousedown event.
+         *
+         * @param {Highcharts.Point} point
+         *        The point mousing down on.
+         *
+         * @param {string} updateProp
+         *        The data property this resize handle is attached to for this point.
+         */
+        function onResizeHandleMouseDown(e, point, updateProp) {
+            var chart = point.series.chart;
+
+            // Ignore if zoom/pan key is pressed
+            if (chart.zoomOrPanKeyPressed(e)) {
+                return;
+            }
+
+            // Prevent zooming
+            chart.mouseIsDown = false;
+
+            // We started a drag
+            initDragDrop(e, point);
+            chart.dragDropData.updateProp = e.updateProp = updateProp;
+            point.firePointEvent('dragStart', e);
+
+            // Prevent default to avoid point click for dragging too
+            e.stopPropagation();
+            e.preventDefault();
+        }
+
+
+        /**
+         * Render drag handles on a point - depending on which handles are enabled - and
+         * attach events to them.
+         *
+         * @private
+         * @function Highcharts.Point#showDragHandles
+         */
+        H.Point.prototype.showDragHandles = function () {
+            var point = this,
+                series = point.series,
+                chart = series.chart,
+                renderer = chart.renderer,
+                options = merge(series.options.dragDrop, point.options.dragDrop);
+
+            // Go through each updateProp and see if we are supposed to create a handle
+            // for it.
+            objectEach(series.dragDropProps, function (val, key) {
+                var handleOptions = merge(
+                        defaultDragHandleOptions,
+                        val.handleOptions,
+                        options.dragHandle
+                    ),
+                    handleAttrs = {
+                        className: handleOptions.className,
+                        'stroke-width': handleOptions.lineWidth,
+                        fill: handleOptions.color,
+                        stroke: handleOptions.lineColor
+                    },
+                    pathFormatter = handleOptions.pathFormatter || val.handleFormatter,
+                    positioner = val.handlePositioner,
+                    pos,
+                    handle,
+                    handleSide,
+                    path,
+                    // Run validation function on whether or not we allow individual
+                    // updating of this prop.
+                    validate = val.validateIndividualDrag ?
+                        val.validateIndividualDrag(point) : true;
+
+                if (
+                    val.resize &&
+                    validate &&
+                    val.resizeSide &&
+                    pathFormatter &&
+                    (
+                        options['draggable' + val.axis.toUpperCase()] ||
+                        options[val.optionName]
+                    ) &&
+                    options[val.optionName] !== false
+                ) {
+
+                    // Create group if it doesn't exist
+                    if (!chart.dragHandles) {
+                        chart.dragHandles = {
+                            group: renderer.g('drag-drop-handles')
+                                .add(series.markerGroup || series.group)
+                        };
+                    }
+
+                    // Store which point this is
+                    chart.dragHandles.point = point.id;
+
+                    // Find position and path of handle
+                    pos = positioner(point);
+                    handleAttrs.d = path = pathFormatter(point);
+                    handleSide = typeof val.resizeSide === 'function' ?
+                        val.resizeSide(point.options, point) : val.resizeSide;
+                    if (!path || pos.x < 0 || pos.y < 0) {
+                        return;
+                    }
+
+                    // If cursor is not set explicitly, use axis direction
+                    handleAttrs.cursor = handleOptions.cursor ||
+                        (val.axis === 'x') !== !!chart.inverted ?
+                        'ew-resize' : 'ns-resize';
+
+                    // Create and add the handle element if it doesn't exist
+                    handle = chart.dragHandles[handleSide];
+                    if (!handle) {
+                        handle = chart.dragHandles[handleSide] = renderer
+                            .path()
+                            .add(chart.dragHandles.group);
+                    }
+
+                    // Move and update handle
+                    handle.translate(pos.x, pos.y).attr(handleAttrs);
+
+                    // Add events
+                    addEvents(
+                        handle.element,
+                        ['touchstart', 'mousedown'],
+                        function (e) {
+                            onResizeHandleMouseDown(
+                                getNormalizedEvent(e, chart), point, key
+                            );
+                        }
+                    );
+                    addEvent(chart.dragHandles.group.element, 'mouseover', function () {
+                        chart.dragDropData = chart.dragDropData || {};
+                        chart.dragDropData.isHoveringHandle = point.id;
+                    });
+                    addEvents(
+                        chart.dragHandles.group.element,
+                        ['touchend', 'mouseout'],
+                        function () {
+                            onResizeHandleMouseOut(point);
+                        }
+                    );
+                }
+            });
+        };
+
+
+        /**
+         * Remove the chart's drag handles if they exist.
+         *
+         * @private
+         * @function Highcharts.Chart#hideDragHandles
+         */
+        H.Chart.prototype.hideDragHandles = function () {
+            var chart = this;
+
+            if (chart.dragHandles) {
+                objectEach(chart.dragHandles, function (val, key) {
+                    if (key !== 'group' && val.destroy) {
+                        val.destroy();
+                    }
+                });
+                if (chart.dragHandles.group && chart.dragHandles.group.destroy) {
+                    chart.dragHandles.group.destroy();
+                }
+                delete chart.dragHandles;
+            }
+        };
+
+
+        /**
+         * Utility function to count the number of props in an object.
+         *
+         * @private
+         * @function countProps
+         *
+         * @param {object} object
+         *        The object to count.
+         *
+         * @return {number}
+         *         Number of own properties on the object.
+         */
+        function countProps(object) {
+            var count = 0;
+
+            for (var p in object) {
+                if (object.hasOwnProperty(p)) {
+                    count++;
+                }
+            }
+            return count;
+        }
+
+
+        /**
+         * Utility function to get the value of the first prop of an object. (Note that
+         * the order of keys in an object is usually not guaranteed.)
+         *
+         * @private
+         * @function getFirstProp
+         *
+         * @param {object} object
+         *        The object to count.
+         *
+         * @return {*}
+         *         Value of the first prop in the object.
+         */
+        function getFirstProp(object) {
+            for (var p in object) {
+                if (object.hasOwnProperty(p)) {
+                    return object[p];
+                }
+            }
+        }
+
+
+        /**
+         * Mouseover on a point. Show drag handles if the conditions are right.
+         *
+         * @private
+         * @function mouseOver
+         *
+         * @param {Highcharts.Point} point
+         *        The point mousing over.
+         */
+        function mouseOver(point) {
+            var series = point.series,
+                chart = series && series.chart,
+                dragDropData = chart && chart.dragDropData;
+
+            if (
+                chart &&
+                !(
+                    dragDropData &&
+                    dragDropData.isDragging && // Ignore if dragging a point
+                    dragDropData.draggedPastSensitivity
+                ) &&
+                !chart.isDragDropAnimating && // Ignore if animating
+                series.options.dragDrop && // No need to compute handles without this
+                !(
+                    chart.options &&
+                    chart.options.chart &&
+                    chart.options.chart.options3d // No 3D support
+                )
+            ) {
+                // Hide the handles if they exist on another point already
+                if (chart.dragHandles) {
+                    chart.hideDragHandles();
+                }
+                point.showDragHandles();
+            }
+        }
+
+
+        /**
+         * On container mouse move. Handle drag sensitivity and fire drag event.
+         *
+         * @private
+         * @function mouseMove
+         *
+         * @param {global.Event} e
+         *        The mouse move event.
+         *
+         * @param {Highcharts.Chart} chart
+         *        The chart we are moving across.
+         */
+        function mouseMove(e, chart) {
+            // Ignore if zoom/pan key is pressed
+            if (chart.zoomOrPanKeyPressed(e)) {
+                return;
+            }
+
+            var dragDropData = chart.dragDropData,
+                point,
+                seriesDragDropOpts,
+                newPoints,
+                numNewPoints = 0,
+                newPoint;
+
+            if (dragDropData && dragDropData.isDragging) {
+                point = dragDropData.point;
+                seriesDragDropOpts = point.series.options.dragDrop;
+
+                // No tooltip for dragging
+                e.preventDefault();
+
+                // Update sensitivity test if not passed yet
+                if (!dragDropData.draggedPastSensitivity) {
+                    dragDropData.draggedPastSensitivity = hasDraggedPastSensitivity(
+                        e, chart, pick(
+                            point.options.dragDrop &&
+                                point.options.dragDrop.dragSensitivity,
+                            seriesDragDropOpts &&
+                                seriesDragDropOpts.dragSensitivity,
+                            defaultDragSensitivity
+                        )
+                    );
+                }
+
+                // If we have dragged past dragSensitivity, run the mousemove handler
+                // for dragging
+                if (dragDropData.draggedPastSensitivity) {
+                    // Find the new point values from the moving
+                    dragDropData.newPoints = getNewPoints(dragDropData, e);
+
+                    // If we are only dragging one point, add it to the event
+                    newPoints = dragDropData.newPoints;
+                    numNewPoints = countProps(newPoints);
+                    newPoint = numNewPoints === 1 ?
+                        getFirstProp(newPoints) :
+                        null;
+
+                    // Run the handler
+                    point.firePointEvent('drag', {
+                        origin: dragDropData.origin,
+                        newPoints: dragDropData.newPoints,
+                        newPoint: newPoint && newPoint.newValues,
+                        newPointId: newPoint && newPoint.point.id,
+                        numNewPoints: numNewPoints,
+                        chartX: e.chartX,
+                        chartY: e.chartY
+                    }, function () {
+                        dragMove(e, point);
+                    });
+                }
+            }
+        }
+
+
+        /**
+         * On container mouse up. Fire drop event and reset state.
+         *
+         * @private
+         * @function mouseUp
+         *
+         * @param {global.Event} e
+         *        The mouse up event.
+         *
+         * @param {Highcharts.Chart} chart
+         *        The chart we were dragging in.
+         */
+        function mouseUp(e, chart) {
+            var dragDropData = chart.dragDropData;
+
+            if (
+                dragDropData &&
+                dragDropData.isDragging &&
+                dragDropData.draggedPastSensitivity
+            ) {
+                var point = dragDropData.point,
+                    newPoints = dragDropData.newPoints,
+                    numNewPoints = countProps(newPoints),
+                    newPoint = numNewPoints === 1 ?
+                        getFirstProp(newPoints) :
+                        null;
+
+                // Hide the drag handles
+                if (chart.dragHandles) {
+                    chart.hideDragHandles();
+                }
+
+                // Prevent default action
+                e.preventDefault();
+                chart.cancelClick = true;
+
+                // Fire the event, with a default handler that updates the points
+
+                point.firePointEvent('drop', {
+                    origin: dragDropData.origin,
+                    chartX: e.chartX,
+                    chartY: e.chartY,
+                    newPoints: newPoints,
+                    numNewPoints: numNewPoints,
+                    newPoint: newPoint && newPoint.newValues,
+                    newPointId: newPoint && newPoint.point.id
+                }, function () {
+                    updatePoints(chart);
+                });
+            }
+
+            // Reset
+            delete chart.dragDropData;
+
+            // Clean up the drag guide box if it exists. This is always added on
+            // drag start, even if user is overriding events.
+            if (chart.dragGuideBox) {
+                chart.dragGuideBox.destroy();
+                delete chart.dragGuideBox;
+            }
+        }
+
+
+        /**
+         * On container mouse down. Init dragdrop if conditions are right.
+         *
+         * @private
+         * @function mouseDown
+         *
+         * @param {global.Event} e
+         *        The mouse down event.
+         *
+         * @param {Highcharts.Chart} chart
+         *        The chart we are clicking.
+         */
+        function mouseDown(e, chart) {
+            var dragPoint = chart.hoverPoint,
+                dragDropOptions = H.merge(
+                    dragPoint.series.options.dragDrop,
+                    dragPoint.options.dragDrop
+                ),
+                draggableX = dragDropOptions.draggableX || false,
+                draggableY = dragDropOptions.draggableY || false;
+
+            // Reset cancel click
+            chart.cancelClick = false;
+
+            // Ignore if option is disable for the point
+            if (!(draggableX || draggableY)) {
+                return;
+            }
+
+            // Ignore if zoom/pan key is pressed
+            if (chart.zoomOrPanKeyPressed(e)) {
+                return;
+            }
+
+            // If we somehow get a mousedown event while we are dragging, cancel
+            if (chart.dragDropData && chart.dragDropData.isDragging) {
+                mouseUp(e, chart);
+                return;
+            }
+
+            // If this point is movable, start dragging it
+            if (dragPoint && isPointMovable(dragPoint)) {
+                chart.mouseIsDown = false; // Prevent zooming
+                initDragDrop(e, dragPoint);
+                dragPoint.firePointEvent('dragStart', e);
+            }
+        }
+
+
+        // Point hover event. We use a short timeout due to issues with coordinating
+        // point mouseover/out events on dragHandles and points. Particularly arearange
+        // series are finicky since the markers are not individual points. This logic
+        // should preferably be improved in the future. Notice that the mouseOut event
+        // below must have a shorter timeout to ensure event order.
+        addEvent(H.Point, 'mouseOver', function () {
+            var point = this;
+
+            setTimeout(function () {
+                mouseOver(point);
+            }, 12);
+        });
+
+
+        // Point mouseleave event. See above function for explanation of the timeout.
+        addEvent(H.Point, 'mouseOut', function () {
+            var point = this;
+
+            setTimeout(function () {
+                if (point.series) {
+                    mouseOut(point);
+                }
+            }, 10);
+        });
+
+
+        // Hide drag handles on a point if it is removed
+        addEvent(H.Point, 'remove', function () {
+            var chart = this.series.chart,
+                dragHandles = chart.dragHandles;
+
+            if (dragHandles && dragHandles.point === this.id) {
+                chart.hideDragHandles();
+            }
+        });
+
+
+        /**
+         * Check whether the zoomKey or panKey is pressed.
+         *
+         * @private
+         * @function Highcharts.Chart#zoomOrPanKeyPressed
+         *
+         * @param {global.Event} e
+         *        A mouse event.
+         *
+         * @return {boolean}
+         *         True if the zoom or pan keys are pressed. False otherwise.
+         */
+        H.Chart.prototype.zoomOrPanKeyPressed = function (e) {
+            // Check whether the panKey and zoomKey are set in chart.userOptions
+            var chartOptions = this.userOptions.chart || {},
+                panKey = chartOptions.panKey && chartOptions.panKey + 'Key',
+                zoomKey = chartOptions.zoomKey && chartOptions.zoomKey + 'Key';
+
+            return (e[zoomKey] || e[panKey]);
+        };
+
+
+        /**
+         * Add events to document and chart if the chart is draggable.
+         *
+         * @private
+         * @function addDragDropEvents
+         *
+         * @param {Highcharts.Chart} chart
+         *        The chart to add events to.
+         */
+        function addDragDropEvents(chart) {
+            var container = chart.container,
+                doc = H.doc;
+
+            // Only enable if we have a draggable chart
+            if (isChartDraggable(chart)) {
+                addEvents(container, ['mousedown', 'touchstart'], function (e) {
+                    mouseDown(getNormalizedEvent(e, chart), chart);
+                });
+                addEvents(container, ['mousemove', 'touchmove'], function (e) {
+                    mouseMove(getNormalizedEvent(e, chart), chart);
+                });
+                addEvent(container, 'mouseleave', function (e) {
+                    mouseUp(getNormalizedEvent(e, chart), chart);
+                });
+                chart.unbindDragDropMouseUp = addEvents(
+                    doc,
+                    ['mouseup', 'touchend'],
+                    function (e) {
+                        mouseUp(getNormalizedEvent(e, chart), chart);
+                    }
+                );
+
+                // Add flag to avoid doing this again
+                chart.hasAddedDragDropEvents = true;
+
+                // Add cleanup to make sure we don't pollute document
+                addEvent(chart, 'destroy', function () {
+                    if (chart.unbindDragDropMouseUp) {
+                        chart.unbindDragDropMouseUp();
+                    }
+                });
+            }
+        }
+
+
+        // Add event listener to Chart.render that checks whether or not we should add
+        // dragdrop.
+        addEvent(H.Chart, 'render', function () {
+            // If we don't have dragDrop events, see if we should add them
+            if (!this.hasAddedDragDropEvents) {
+                addDragDropEvents(this);
+            }
+        });
+
+    }(Highcharts));
+    return (function () {
+
+
+    }());
+}));