omniscientjs 0.1.0

checksums.yaml

@@ -0,0 +1,7 @@
+---
+SHA1:
+  metadata.gz: 20dbbf48dc3743f9e2565966ecd0c901415c1979
+  data.tar.gz: f6e1e7a2b9e410a15ab520f1f0c783bafb610b52
+SHA512:
+  metadata.gz: 577ed4c9bc222f93fa6d6b3344b453598427d66dd4c68a16da9a7c457ef425a9ecd886780d8fa9cfa6bc869267b9eab97556035a9adc5bf34e17eb44592a8030
+  data.tar.gz: 0c7a5b6ada6cb71612cf4f19f4f2fdb9af14dfe0ca77ce68e3b109ffc85ef113ef5621649d7c7a561f861e5dc703c85ae883b8bbc3bd8b40ef2342ac56d9e198

data/.gitignore

@@ -0,0 +1,9 @@
+/.bundle/
+/.yardoc
+/Gemfile.lock
+/_yardoc/
+/coverage/
+/doc/
+/pkg/
+/spec/reports/
+/tmp/

data/.rspec

@@ -0,0 +1,2 @@
+--format documentation
+--color

data/.travis.yml

@@ -0,0 +1,5 @@
+sudo: false
+language: ruby
+rvm:
+  - 2.3.0
+before_install: gem install bundler -v 1.12.5

data/CODE_OF_CONDUCT.md

@@ -0,0 +1,49 @@
+# Contributor Code of Conduct
+
+As contributors and maintainers of this project, and in the interest of
+fostering an open and welcoming community, we pledge to respect all people who
+contribute through reporting issues, posting feature requests, updating
+documentation, submitting pull requests or patches, and other activities.
+
+We are committed to making participation in this project a harassment-free
+experience for everyone, regardless of level of experience, gender, gender
+identity and expression, sexual orientation, disability, personal appearance,
+body size, race, ethnicity, age, religion, or nationality.
+
+Examples of unacceptable behavior by participants include:
+
+* The use of sexualized language or imagery
+* Personal attacks
+* Trolling or insulting/derogatory comments
+* Public or private harassment
+* Publishing other's private information, such as physical or electronic
+  addresses, without explicit permission
+* Other unethical or unprofessional conduct
+
+Project maintainers have the right and responsibility to remove, edit, or
+reject comments, commits, code, wiki edits, issues, and other contributions
+that are not aligned to this Code of Conduct, or to ban temporarily or
+permanently any contributor for other behaviors that they deem inappropriate,
+threatening, offensive, or harmful.
+
+By adopting this Code of Conduct, project maintainers commit themselves to
+fairly and consistently applying these principles to every aspect of managing
+this project. Project maintainers who do not follow or enforce the Code of
+Conduct may be permanently removed from the project team.
+
+This code of conduct applies both within project spaces and in public spaces
+when an individual is representing the project or its community.
+
+Instances of abusive, harassing, or otherwise unacceptable behavior may be
+reported by contacting a project maintainer at namburu.karthik@gmail.com. All
+complaints will be reviewed and investigated and will result in a response that
+is deemed necessary and appropriate to the circumstances. Maintainers are
+obligated to maintain confidentiality with regard to the reporter of an
+incident.
+
+This Code of Conduct is adapted from the [Contributor Covenant][homepage],
+version 1.3.0, available at
+[http://contributor-covenant.org/version/1/3/0/][version]
+
+[homepage]: http://contributor-covenant.org
+[version]: http://contributor-covenant.org/version/1/3/0/

data/Gemfile

@@ -0,0 +1,4 @@
+source 'https://rubygems.org'
+
+# Specify your gem's dependencies in omniscientjs.gemspec
+gemspec

data/LICENSE.txt

@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2016 karthiknamburu
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.

data/README.md

@@ -0,0 +1,41 @@
+# Omniscientjs
+
+Welcome to your new gem! In this directory, you'll find the files you need to be able to package up your Ruby library into a gem. Put your Ruby code in the file `lib/omniscientjs`. To experiment with that code, run `bin/console` for an interactive prompt.
+
+TODO: Delete this and the text above, and describe your gem
+
+## Installation
+
+Add this line to your application's Gemfile:
+
+```ruby
+gem 'omniscientjs'
+```
+
+And then execute:
+
+    $ bundle
+
+Or install it yourself as:
+
+    $ gem install omniscientjs
+
+## Usage
+
+TODO: Write usage instructions here
+
+## Development
+
+After checking out the repo, run `bin/setup` to install dependencies. Then, run `rake spec` to run the tests. You can also run `bin/console` for an interactive prompt that will allow you to experiment.
+
+To install this gem onto your local machine, run `bundle exec rake install`. To release a new version, update the version number in `version.rb`, and then run `bundle exec rake release`, which will create a git tag for the version, push git commits and tags, and push the `.gem` file to [rubygems.org](https://rubygems.org).
+
+## Contributing
+
+Bug reports and pull requests are welcome on GitHub at https://github.com/[USERNAME]/omniscientjs. This project is intended to be a safe, welcoming space for collaboration, and contributors are expected to adhere to the [Contributor Covenant](http://contributor-covenant.org) code of conduct.
+
+
+## License
+
+The gem is available as open source under the terms of the [MIT License](http://opensource.org/licenses/MIT).
+

data/Rakefile

@@ -0,0 +1,6 @@
+require "bundler/gem_tasks"
+require "rspec/core/rake_task"
+
+RSpec::Core::RakeTask.new(:spec)
+
+task :default => :spec

data/bin/console

@@ -0,0 +1,14 @@
+#!/usr/bin/env ruby
+
+require "bundler/setup"
+require "omniscientjs"
+
+# You can add fixtures and/or initialization code here to make experimenting
+# with your gem easier. You can also use a different console, if you like.
+
+# (If you use this, don't forget to add pry to your Gemfile!)
+# require "pry"
+# Pry.start
+
+require "irb"
+IRB.start

data/bin/setup

@@ -0,0 +1,8 @@
+#!/usr/bin/env bash
+set -euo pipefail
+IFS=$'\n\t'
+set -vx
+
+bundle install
+
+# Do any other automated setup that you need to do here

data/lib/omniscientjs.rb

@@ -0,0 +1,6 @@
+require "omniscientjs/version"
+
+module Omniscientjs
+  class Engine < ::Rails::Engine 
+  end
+end

data/lib/omniscientjs/version.rb

@@ -0,0 +1,3 @@
+module Omniscientjs
+  VERSION = "0.1.0"
+end

data/omniscientjs.gemspec

@@ -0,0 +1,33 @@
+# coding: utf-8
+lib = File.expand_path('../lib', __FILE__)
+$LOAD_PATH.unshift(lib) unless $LOAD_PATH.include?(lib)
+require 'omniscientjs/version'
+
+Gem::Specification.new do |spec|
+  spec.name          = "omniscientjs"
+  spec.version       = Omniscientjs::VERSION
+  spec.authors       = ["karthiknamburu"]
+  spec.email         = ["namburu.karthik@gmail.com"]
+
+  spec.summary       = %q{A Gem to Integrate Omniscient javascript}
+  spec.description   = %q{A Gem to Integrate Omniscient javascript}
+  spec.homepage      = "https://github.com/karthiknamburu/omniscientjs"
+  spec.license       = "MIT"
+
+  # Prevent pushing this gem to RubyGems.org. To allow pushes either set the 'allowed_push_host'
+  # to allow pushing to a single host or delete this section to allow pushing to any host.
+  if spec.respond_to?(:metadata)
+    spec.metadata['allowed_push_host'] = "https://rubygems.org"
+  else
+    raise "RubyGems 2.0 or newer is required to protect against public gem pushes."
+  end
+
+  spec.files         = `git ls-files -z`.split("\x0").reject { |f| f.match(%r{^(test|spec|features)/}) }
+  spec.bindir        = "exe"
+  spec.executables   = spec.files.grep(%r{^exe/}) { |f| File.basename(f) }
+  spec.require_paths = ["lib"]
+
+  spec.add_development_dependency "bundler", "~> 1.12"
+  spec.add_development_dependency "rake", "~> 10.0"
+  spec.add_development_dependency "rspec", "~> 3.0"
+end

data/vendor/javascripts/omniscient.js

@@ -0,0 +1,3014 @@
+/**
+* Omniscient.js v4.1.1
+* Authors: @torgeir,@mikaelbr
+***************************************/
+(function(f){if(typeof exports==="object"&&typeof module!=="undefined"){module.exports=f()}else if(typeof define==="function"&&define.amd){define([],f)}else{var g;if(typeof window!=="undefined"){g=window}else if(typeof global!=="undefined"){g=global}else if(typeof self!=="undefined"){g=self}else{g=this}g.omniscient = f()}})(function(){var define,module,exports;return (function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof require=="function"&&require;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw f.code="MODULE_NOT_FOUND",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof require=="function"&&require;for(var o=0;o<r.length;o++)s(r[o]);return s})({1:[function(_dereq_,module,exports){
+"use strict";
+
+var shouldupdate = _dereq_('./shouldupdate');
+
+/**
+ * Directly fetch `cache` to use outside of Omniscient.
+ * You can do this if you want to define functions that caches computed
+ * result to avoid recomputing if invoked with equal arguments as last time.
+ *
+ * Returns optimized version of given `f` function for repeated
+ * calls with an equal inputs. Returned function caches last input
+ * and a result of the computation for it, which is handy for
+ * optimizing `render` when computations are run on unchanged parts
+ * of state. Although note that only last result is cached so it is
+ * not practical to call it mulitple times with in the same `render`
+ * call.
+ *
+ * @param {Function} Function that does a computation.
+ *
+ * @module cached
+ * @returns {Function} Optimized function
+ * @api public
+ */
+module.exports = factory();
+
+/**
+ * Create a “local” instance of the `cache` with overriden defaults.
+ *
+ * ### Options
+ * ```js
+ * {
+ *   isEqualProps: function (currentProps, nextProps), // check props
+ * }
+ * ```
+ *
+ * @param {Object} [Options] Options with defaults to override
+ *
+ * @module cached.withDefaults
+ * @returns {Function} cached with overriden defaults
+ * @api public
+ */
+module.exports.withDefaults = factory;
+
+function factory (methods) {
+  var isEqual = (methods && methods.isEqualProps) || shouldupdate.isEqualProps;
+
+  return function cached (f) {
+    var input,
+        output;
+
+    return function () {
+      if (!isEqual(arguments, input)) {
+        output = f.apply(this, arguments);
+      }
+      // Update input either way to allow GC reclaim it unless
+      // anything else is referring to it.
+      input = arguments;
+      return output;
+    };
+  };
+}
+
+},{"./shouldupdate":34}],2:[function(_dereq_,module,exports){
+(function (global){
+"use strict";
+
+var React = (typeof window !== "undefined" ? window['React'] : typeof global !== "undefined" ? global['React'] : null);
+var assign = _dereq_('lodash.assign');
+
+var shouldComponentUpdate = _dereq_('./shouldupdate');
+var cached = _dereq_('./cached');
+
+/**
+ * Create components for functional views.
+ *
+ * The API of Omniscient is pretty simple, you create a Stateless React Component
+ * but memoized with a smart implemented `shouldComponentUpdate`.
+ *
+ * The provided `shouldComponentUpdate` handles immutable data and cursors by default.
+ * It also falls back to a deep value check if passed props isn't immutable structures.
+ *
+ * You can use an Omniscient component in the same way you'd use a React Stateless Function,
+ * or you can use some of the additional features, such as string defined display name and
+ * pass in life cycle methods. These are features normally not accessible for vanilla
+ * Stateless React Components.
+ *
+ * If you simply pass one cursor, the cursor will be accessible on the
+ * `props.cursor` accessor.
+ *
+ * @param {String} displayName Component's display name. Used when debug()'ing and by React
+ * @param {Array|Object} mixins React mixins. Object literals with functions, or array of object literals with functions.
+ * @param {Function} render Stateless component to add memoization on.
+ *
+ * @property {Function} shouldComponentUpdate Get default shouldComponentUpdate
+ * @module omniscient
+ * @returns {Component}
+ * @api public
+ */
+
+module.exports = factory();
+
+/**
+ * Create a “local” instance of the Omniscient component creator by using the `.withDefaults` method.
+ * This also allows you to override any defaults that Omniscient use to check equality of objects,
+ * unwrap cursors, etc.
+ *
+ * ### Options
+ * ```js
+ * {
+ *   // Goes directly to component
+ *   shouldComponentUpdate: function(nextProps, nextState), // check update
+ *   cursorField: '__singleCursor', // cursor property name to "unwrap" before passing in to render
+ *   isNode: function(propValue), // determines if propValue is a valid React node
+ *   classDecorator: function(Component), // Allows for decorating created class
+ *
+ *   // Passed on to `shouldComponentUpdate`
+ *   isCursor: function (cursor), // check if is props
+ *   isEqualCursor: function (oneCursor, otherCursor), // check cursor
+ *   isEqualState: function (currentState, nextState), // check state
+ *   isImmutable: function (currentState, nextState), // check if object is immutable
+ *   isEqualProps: function (currentProps, nextProps), // check props
+ *   isIgnorable: function (propertyValue, propertyKey), // check if property item is ignorable
+ *   unCursor: function (cursor) // convert from cursor to object
+ * }
+ * ```
+ *
+ * ### Examples
+ *
+ * #### Un-wrapping curors
+ * ```jsx
+ * var localComponent = component.withDefaults({
+ *   cursorField: 'foobar'
+ * });
+ *
+ * var Component = localComponent(function (myCursor) {
+ *   // Now you have myCursor directly instead of having to do props.foobar
+ * });
+ *
+ * React.render(<Component foobar={myCursor} />, mountingPoint);
+ * ```
+ *
+ * #### Decorating class components
+ * ```jsx
+ * // Some third party libraries requires you to decorate the
+ * // React class, not the created component. You can do that
+ * // by creating a decorated component factory
+ * var decoratedComponent = component.withDefaults({
+ *   classDecorator: compose(Radium, function (Component) {
+ *     var DecoratedComponent = doSomething(Component);
+ *     return DecoratedComponent;
+ *   })
+ * });
+ *
+ * var Component = decoratedComponent(function (props) {
+ *   // ... some implementation
+ * });
+ *
+ * React.render(<Component  />, mountingPoint);
+ * ```
+ *
+ * @param {Object} Options Options with defaults to override
+ *
+ * @property {Function} shouldComponentUpdate Get default shouldComponentUpdate
+ *
+ * @module omniscient.withDefaults
+ * @returns {Component}
+ * @api public
+ */
+module.exports.withDefaults = factory;
+
+function factory (initialOptions) {
+  var debug;
+  initialOptions = initialOptions || {};
+  var _shouldComponentUpdate = initialOptions.shouldComponentUpdate ||
+        shouldComponentUpdate.withDefaults(initialOptions);
+  var _isCursor = initialOptions.isCursor || shouldComponentUpdate.isCursor;
+  var _isImmutable = initialOptions.isImmutable || shouldComponentUpdate.isImmutable;
+  var _hiddenCursorField = initialOptions.cursorField || '__singleCursor';
+  var _isNode = initialOptions.isNode || isNode;
+  var _classDecorator = initialOptions.classDecorator || identity;
+  var _cached = cached.withDefaults(_shouldComponentUpdate);
+
+  var CreatedComponent = ComponentCreatorFactory(_classDecorator);
+
+  /**
+   * Create components for functional views, with an attached local class decorator.
+   * Omniscient uses a `React.createClass()` internally to create an higher order
+   * component to attach performance boost and add some syntactic sugar to your
+   * components. Sometimes third party apps need to be added as decorator to this
+   * internal class. For instance Redux or Radium.
+   * This create factory behaves the same as normal Omniscient.js component
+   * creation, but with the additional first parameter for class decorator.
+   *
+   * The API of Omniscient is pretty simple, you create a Stateless React Component
+   * but memoized with a smart implemented `shouldComponentUpdate`.
+   *
+   * The provided `shouldComponentUpdate` handles immutable data and cursors by default.
+   * It also falls back to a deep value check if passed props isn't immutable structures.
+   *
+   * You can use an Omniscient component in the same way you'd use a React Stateless Function,
+   * or you can use some of the additional features, such as string defined display name and
+   * pass in life cycle methods. These are features normally not accessible for vanilla
+   * Stateless React Components.
+   *
+   * If you simply pass one cursor, the cursor will be accessible on the
+   * `props.cursor` accessor.
+   *
+   * #### Decorating class components
+   * ```jsx
+   * // Some third party libraries requires you to decorate the
+   * // React class, not the created component. You can do that
+   * // by creating a decorated component factory
+   * var someDecorator = compose(Radium, function (Component) {
+   *   var DecoratedComponent = doSomething(Component);
+   *   return DecoratedComponent;
+   * });
+   * var Component = component.classDecorator(someDecorator, function (props) {
+   *   // ... some implementation
+   * });
+   *
+   * React.render(<Component />, mountingPoint);
+   * ```
+   *
+   * Also works by creating a component factory:
+   *
+   * ```jsx
+   * var someDecorator = compose(Radium, function (Component) {
+   *   var DecoratedComponent = doSomething(Component);
+   *   return DecoratedComponent;
+   * });
+   * var newFactory = component.classDecorator(someDecorator);
+   * var Component = newFactory(function (props) {
+   *   // ... some implementation
+   * });
+   *
+   * React.render(<Component />, mountingPoint);
+   * ```
+   *
+   * @param {Function} classDecorator Decorator to use for internal class (e.g. Redux connect, Radium)
+   * @param {String} [displayName] Component's display name. Used when debug()'ing and by React
+   * @param {Array|Object} [mixins] React mixins. Object literals with functions, or array of object literals with functions.
+   * @param {Function} [render] Stateless component to add memoization on.
+   *
+   * @property {Function} shouldComponentUpdate Get default shouldComponentUpdate
+   * @module omniscient
+   * @returns {Component|Function}
+   * @api public
+   */
+  CreatedComponent.classDecorator = function (classDecorator) {
+    var shouldPartiallyApply = arguments.length === 1;
+    if (shouldPartiallyApply) {
+      return ComponentCreatorFactory(classDecorator);
+    }
+    return ComponentCreatorFactory(classDecorator).apply(null, toArray(arguments).slice(1));
+  };
+  return CreatedComponent;
+
+  function ComponentCreatorFactory (passedClassDecorator) {
+
+    /**
+     * Activate debugging for components. Will log when a component renders,
+     * the outcome of `shouldComponentUpdate`, and why the component re-renders.
+     *
+     * ### Example
+     * ```js
+     * Search>: shouldComponentUpdate => true (cursors have changed)
+     * Search>: render
+     * SearchBox>: shouldComponentUpdate => true (cursors have changed)
+     * SearchBox>: render
+     * ```
+     *
+     * @example omniscient.debug(/Search/i);
+     *
+     * @param {RegExp} pattern Filter pattern. Only show messages matching pattern
+     *
+     * @module omniscient.debug
+     * @returns {Immstruct}
+     * @api public
+     */
+    ComponentCreator.debug = debugFn;
+    ComponentCreator.cached = _cached;
+    ComponentCreator.shouldComponentUpdate = _shouldComponentUpdate;
+
+    return ComponentCreator;
+
+    function ComponentCreator (displayName, mixins, render) {
+      var options = createDefaultArguments(displayName, mixins, render);
+      var methodStatics = pickStaticMixins(options.mixins);
+
+      var componentObject = {
+        displayName: options.displayName || options.render.name,
+        mixins: options.mixins,
+        render: function render () {
+          if (debug) debug.call(this, 'render');
+          // If `props['__singleCursor']` is set a single cursor was passed
+          // to the component, pick it out and pass it.
+          var input = this.props[_hiddenCursorField] || this.props;
+          this.cursor = this.props[_hiddenCursorField];
+          return options.render.call(this, input);
+        }
+      };
+
+      if (methodStatics) {
+        componentObject.statics = methodStatics;
+        removeOldStaticMethods(options.mixins);
+      }
+
+      var Component = passedClassDecorator(React.createClass(componentObject));
+
+      /**
+       * Invoke component (rendering it)
+       *
+       * @param {String} displayName Component display name. Used in debug and by React
+       * @param {Object} props Properties (triggers update when changed). Can be cursors, object and immutable structures
+       * @param {Object} ...rest Child components (React elements, scalar values)
+       *
+       * @module Component
+       * @returns {ReactElement}
+       * @api public
+       */
+      var create = function (keyOrProps, propsOrPublicContext, ReactUpdateQueue) {
+        // After stateless arrow functions was allowed as components, react will instantiate
+        // the `create` function if it has a prototype. We are passed `props`, `publicContext`
+        // and `ReactUpdateQueue`.
+        // https://github.com/facebook/react/blob/88bae3fb73511893519195e451c56896463f669b/src/renderers/shared/reconciler/ReactCompositeComponent.js#L154-L171
+        if (typeof ReactUpdateQueue == 'object' && !_isNode(ReactUpdateQueue)) {
+          var publicProps = keyOrProps,
+              publicContext = propsOrPublicContext;
+          return new Component(publicProps, publicContext, ReactUpdateQueue);
+        }
+
+        var key = keyOrProps,
+            props = propsOrPublicContext;
+
+        if (typeof key === 'object') {
+          props = key;
+          key   = void 0;
+        }
+
+        var children = flatten(sliceFrom(arguments, props).filter(_isNode));
+
+        var _props,
+            inputCursor;
+
+        // If passed props is a signle cursor we move it to `props[_hiddenCursorField]`
+        // to simplify should component update. The render function will move it back.
+        // The name '__singleCursor' is used to not clash with names of user passed properties
+        if (_isCursor(props) || _isImmutable(props)) {
+          inputCursor = props;
+          _props = {};
+          _props[_hiddenCursorField] = inputCursor;
+        } else {
+          _props = assign({}, props);
+        }
+
+        if (key) {
+          _props.key = key;
+        }
+
+        if (children.length) {
+          _props.children = children;
+        }
+
+        return React.createElement(Component, _props);
+      };
+
+      if (methodStatics) {
+        create = assign(create, methodStatics);
+      }
+
+      return assign(create, Component, { type: Component });
+    }
+  }
+
+  function debugFn (pattern, logFn) {
+    if (_shouldComponentUpdate.debug) {
+      debug = _shouldComponentUpdate.debug(pattern, logFn);
+    }
+  }
+
+  function createDefaultArguments (displayName, mixins, render) {
+
+    // (render)
+    if (typeof displayName === 'function') {
+      render      = displayName;
+      mixins      = [];
+      displayName = void 0;
+    }
+
+    // (mixins, render)
+    if (typeof displayName === 'object' && typeof mixins === 'function') {
+      render      = mixins;
+      mixins      = displayName;
+      displayName = void 0;
+    }
+
+    // (displayName, render)
+    if (typeof displayName === 'string' && typeof mixins === 'function') {
+      render = mixins;
+      mixins = [];
+    }
+
+    // Else (displayName, mixins, render)
+
+    if (!Array.isArray(mixins)) {
+      mixins = [mixins];
+    }
+
+    if (!hasShouldComponentUpdate(mixins)) {
+      mixins.unshift({
+        shouldComponentUpdate: _shouldComponentUpdate
+      });
+    }
+
+    return {
+      displayName: displayName,
+      mixins: mixins,
+      render: render
+    };
+  }
+}
+
+/**
+ * Predicate showing whether or not the argument is a valid React Node
+ * or not. Can be numbers, strings, bools, and React Elements.
+ *
+ * React's isNode check from ReactPropTypes validator
+ * but adjusted to not accept objects to avoid collision with props.
+ *
+ * @param {String} propValue Property value to check if is valid React Node
+ *
+ * @returns {Boolean}
+ * @api private
+ */
+function isNode (propValue) {
+  switch (typeof propValue) {
+  case 'number':
+  case 'string':
+    return true;
+  case 'boolean':
+    return !propValue;
+  case 'object':
+    if (Array.isArray(propValue)) {
+      return propValue.every(isNode);
+    }
+    if (React.isValidElement(propValue)) {
+      return true;
+    }
+    return false;
+  default:
+    return false;
+  }
+}
+
+function pickStaticMixins (mixins) {
+  var filtered = mixins.filter(function (obj) {
+    return !!obj.statics;
+  });
+
+  if (!filtered.length) {
+    return void 0;
+  }
+
+  var statics = {};
+  filtered.forEach(function (obj) {
+    statics = assign(statics, obj.statics);
+  });
+
+  return statics;
+}
+
+function removeOldStaticMethods (mixins) {
+  mixins.filter(function (obj) {
+    return !!obj.statics;
+  }).forEach(function (obj) {
+    delete obj.statics;
+  });
+}
+
+function hasShouldComponentUpdate (mixins) {
+  return mixins.some(function (mixin) {
+    if (mixin.shouldComponentUpdate) return true;
+    if (!Array.isArray(mixin.mixins)) return false;
+    return hasShouldComponentUpdate(mixin.mixins);
+  });
+}
+
+function identity (fn) {
+  return fn;
+}
+
+function toArray (args) {
+  return Array.prototype.slice.call(args);
+}
+
+function sliceFrom (args, value) {
+  var array = toArray(args);
+  var index = Math.max(array.indexOf(value), 0);
+  return array.slice(index);
+}
+
+// Just a shallow flatten
+function flatten (array) {
+  return Array.prototype.concat.apply([], array);
+}
+
+}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
+},{"./cached":1,"./shouldupdate":34,"lodash.assign":3}],3:[function(_dereq_,module,exports){
+/**
+ * lodash 3.2.0 (Custom Build) <https://lodash.com/>
+ * Build: `lodash modern modularize exports="npm" -o ./`
+ * Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/>
+ * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>
+ * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
+ * Available under MIT license <https://lodash.com/license>
+ */
+var baseAssign = _dereq_('lodash._baseassign'),
+    createAssigner = _dereq_('lodash._createassigner'),
+    keys = _dereq_('lodash.keys');
+
+/**
+ * A specialized version of `_.assign` for customizing assigned values without
+ * support for argument juggling, multiple sources, and `this` binding `customizer`
+ * functions.
+ *
+ * @private
+ * @param {Object} object The destination object.
+ * @param {Object} source The source object.
+ * @param {Function} customizer The function to customize assigned values.
+ * @returns {Object} Returns `object`.
+ */
+function assignWith(object, source, customizer) {
+  var index = -1,
+      props = keys(source),
+      length = props.length;
+
+  while (++index < length) {
+    var key = props[index],
+        value = object[key],
+        result = customizer(value, source[key], key, object, source);
+
+    if ((result === result ? (result !== value) : (value === value)) ||
+        (value === undefined && !(key in object))) {
+      object[key] = result;
+    }
+  }
+  return object;
+}
+
+/**
+ * Assigns own enumerable properties of source object(s) to the destination
+ * object. Subsequent sources overwrite property assignments of previous sources.
+ * If `customizer` is provided it is invoked to produce the assigned values.
+ * The `customizer` is bound to `thisArg` and invoked with five arguments:
+ * (objectValue, sourceValue, key, object, source).
+ *
+ * **Note:** This method mutates `object` and is based on
+ * [`Object.assign`](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-object.assign).
+ *
+ * @static
+ * @memberOf _
+ * @alias extend
+ * @category Object
+ * @param {Object} object The destination object.
+ * @param {...Object} [sources] The source objects.
+ * @param {Function} [customizer] The function to customize assigned values.
+ * @param {*} [thisArg] The `this` binding of `customizer`.
+ * @returns {Object} Returns `object`.
+ * @example
+ *
+ * _.assign({ 'user': 'barney' }, { 'age': 40 }, { 'user': 'fred' });
+ * // => { 'user': 'fred', 'age': 40 }
+ *
+ * // using a customizer callback
+ * var defaults = _.partialRight(_.assign, function(value, other) {
+ *   return _.isUndefined(value) ? other : value;
+ * });
+ *
+ * defaults({ 'user': 'barney' }, { 'age': 36 }, { 'user': 'fred' });
+ * // => { 'user': 'barney', 'age': 36 }
+ */
+var assign = createAssigner(function(object, source, customizer) {
+  return customizer
+    ? assignWith(object, source, customizer)
+    : baseAssign(object, source);
+});
+
+module.exports = assign;
+
+},{"lodash._baseassign":4,"lodash._createassigner":6,"lodash.keys":10}],4:[function(_dereq_,module,exports){
+/**
+ * lodash 3.2.0 (Custom Build) <https://lodash.com/>
+ * Build: `lodash modern modularize exports="npm" -o ./`
+ * Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/>
+ * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>
+ * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
+ * Available under MIT license <https://lodash.com/license>
+ */
+var baseCopy = _dereq_('lodash._basecopy'),
+    keys = _dereq_('lodash.keys');
+
+/**
+ * The base implementation of `_.assign` without support for argument juggling,
+ * multiple sources, and `customizer` functions.
+ *
+ * @private
+ * @param {Object} object The destination object.
+ * @param {Object} source The source object.
+ * @returns {Object} Returns `object`.
+ */
+function baseAssign(object, source) {
+  return source == null
+    ? object
+    : baseCopy(source, keys(source), object);
+}
+
+module.exports = baseAssign;
+
+},{"lodash._basecopy":5,"lodash.keys":10}],5:[function(_dereq_,module,exports){
+/**
+ * lodash 3.0.1 (Custom Build) <https://lodash.com/>
+ * Build: `lodash modern modularize exports="npm" -o ./`
+ * Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/>
+ * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>
+ * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
+ * Available under MIT license <https://lodash.com/license>
+ */
+
+/**
+ * Copies properties of `source` to `object`.
+ *
+ * @private
+ * @param {Object} source The object to copy properties from.
+ * @param {Array} props The property names to copy.
+ * @param {Object} [object={}] The object to copy properties to.
+ * @returns {Object} Returns `object`.
+ */
+function baseCopy(source, props, object) {
+  object || (object = {});
+
+  var index = -1,
+      length = props.length;
+
+  while (++index < length) {
+    var key = props[index];
+    object[key] = source[key];
+  }
+  return object;
+}
+
+module.exports = baseCopy;
+
+},{}],6:[function(_dereq_,module,exports){
+/**
+ * lodash 3.1.1 (Custom Build) <https://lodash.com/>
+ * Build: `lodash modern modularize exports="npm" -o ./`
+ * Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/>
+ * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>
+ * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
+ * Available under MIT license <https://lodash.com/license>
+ */
+var bindCallback = _dereq_('lodash._bindcallback'),
+    isIterateeCall = _dereq_('lodash._isiterateecall'),
+    restParam = _dereq_('lodash.restparam');
+
+/**
+ * Creates a function that assigns properties of source object(s) to a given
+ * destination object.
+ *
+ * **Note:** This function is used to create `_.assign`, `_.defaults`, and `_.merge`.
+ *
+ * @private
+ * @param {Function} assigner The function to assign values.
+ * @returns {Function} Returns the new assigner function.
+ */
+function createAssigner(assigner) {
+  return restParam(function(object, sources) {
+    var index = -1,
+        length = object == null ? 0 : sources.length,
+        customizer = length > 2 ? sources[length - 2] : undefined,
+        guard = length > 2 ? sources[2] : undefined,
+        thisArg = length > 1 ? sources[length - 1] : undefined;
+
+    if (typeof customizer == 'function') {
+      customizer = bindCallback(customizer, thisArg, 5);
+      length -= 2;
+    } else {
+      customizer = typeof thisArg == 'function' ? thisArg : undefined;
+      length -= (customizer ? 1 : 0);
+    }
+    if (guard && isIterateeCall(sources[0], sources[1], guard)) {
+      customizer = length < 3 ? undefined : customizer;
+      length = 1;
+    }
+    while (++index < length) {
+      var source = sources[index];
+      if (source) {
+        assigner(object, source, customizer);
+      }
+    }
+    return object;
+  });
+}
+
+module.exports = createAssigner;
+
+},{"lodash._bindcallback":7,"lodash._isiterateecall":8,"lodash.restparam":9}],7:[function(_dereq_,module,exports){
+/**
+ * lodash 3.0.1 (Custom Build) <https://lodash.com/>
+ * Build: `lodash modern modularize exports="npm" -o ./`
+ * Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/>
+ * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>
+ * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
+ * Available under MIT license <https://lodash.com/license>
+ */
+
+/**
+ * A specialized version of `baseCallback` which only supports `this` binding
+ * and specifying the number of arguments to provide to `func`.
+ *
+ * @private
+ * @param {Function} func The function to bind.
+ * @param {*} thisArg The `this` binding of `func`.
+ * @param {number} [argCount] The number of arguments to provide to `func`.
+ * @returns {Function} Returns the callback.
+ */
+function bindCallback(func, thisArg, argCount) {
+  if (typeof func != 'function') {
+    return identity;
+  }
+  if (thisArg === undefined) {
+    return func;
+  }
+  switch (argCount) {
+    case 1: return function(value) {
+      return func.call(thisArg, value);
+    };
+    case 3: return function(value, index, collection) {
+      return func.call(thisArg, value, index, collection);
+    };
+    case 4: return function(accumulator, value, index, collection) {
+      return func.call(thisArg, accumulator, value, index, collection);
+    };
+    case 5: return function(value, other, key, object, source) {
+      return func.call(thisArg, value, other, key, object, source);
+    };
+  }
+  return function() {
+    return func.apply(thisArg, arguments);
+  };
+}
+
+/**
+ * This method returns the first argument provided to it.
+ *
+ * @static
+ * @memberOf _
+ * @category Utility
+ * @param {*} value Any value.
+ * @returns {*} Returns `value`.
+ * @example
+ *
+ * var object = { 'user': 'fred' };
+ *
+ * _.identity(object) === object;
+ * // => true
+ */
+function identity(value) {
+  return value;
+}
+
+module.exports = bindCallback;
+
+},{}],8:[function(_dereq_,module,exports){
+/**
+ * lodash 3.0.9 (Custom Build) <https://lodash.com/>
+ * Build: `lodash modern modularize exports="npm" -o ./`
+ * Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/>
+ * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>
+ * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
+ * Available under MIT license <https://lodash.com/license>
+ */
+
+/** Used to detect unsigned integer values. */
+var reIsUint = /^\d+$/;
+
+/**
+ * Used as the [maximum length](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-number.max_safe_integer)
+ * of an array-like value.
+ */
+var MAX_SAFE_INTEGER = 9007199254740991;
+
+/**
+ * The base implementation of `_.property` without support for deep paths.
+ *
+ * @private
+ * @param {string} key The key of the property to get.
+ * @returns {Function} Returns the new function.
+ */
+function baseProperty(key) {
+  return function(object) {
+    return object == null ? undefined : object[key];
+  };
+}
+
+/**
+ * Gets the "length" property value of `object`.
+ *
+ * **Note:** This function is used to avoid a [JIT bug](https://bugs.webkit.org/show_bug.cgi?id=142792)
+ * that affects Safari on at least iOS 8.1-8.3 ARM64.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @returns {*} Returns the "length" value.
+ */
+var getLength = baseProperty('length');
+
+/**
+ * Checks if `value` is array-like.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is array-like, else `false`.
+ */
+function isArrayLike(value) {
+  return value != null && isLength(getLength(value));
+}
+
+/**
+ * Checks if `value` is a valid array-like index.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index.
+ * @returns {boolean} Returns `true` if `value` is a valid index, else `false`.
+ */
+function isIndex(value, length) {
+  value = (typeof value == 'number' || reIsUint.test(value)) ? +value : -1;
+  length = length == null ? MAX_SAFE_INTEGER : length;
+  return value > -1 && value % 1 == 0 && value < length;
+}
+
+/**
+ * Checks if the provided arguments are from an iteratee call.
+ *
+ * @private
+ * @param {*} value The potential iteratee value argument.
+ * @param {*} index The potential iteratee index or key argument.
+ * @param {*} object The potential iteratee object argument.
+ * @returns {boolean} Returns `true` if the arguments are from an iteratee call, else `false`.
+ */
+function isIterateeCall(value, index, object) {
+  if (!isObject(object)) {
+    return false;
+  }
+  var type = typeof index;
+  if (type == 'number'
+      ? (isArrayLike(object) && isIndex(index, object.length))
+      : (type == 'string' && index in object)) {
+    var other = object[index];
+    return value === value ? (value === other) : (other !== other);
+  }
+  return false;
+}
+
+/**
+ * Checks if `value` is a valid array-like length.
+ *
+ * **Note:** This function is based on [`ToLength`](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-tolength).
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a valid length, else `false`.
+ */
+function isLength(value) {
+  return typeof value == 'number' && value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER;
+}
+
+/**
+ * Checks if `value` is the [language type](https://es5.github.io/#x8) of `Object`.
+ * (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)
+ *
+ * @static
+ * @memberOf _
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is an object, else `false`.
+ * @example
+ *
+ * _.isObject({});
+ * // => true
+ *
+ * _.isObject([1, 2, 3]);
+ * // => true
+ *
+ * _.isObject(1);
+ * // => false
+ */
+function isObject(value) {
+  // Avoid a V8 JIT bug in Chrome 19-20.
+  // See https://code.google.com/p/v8/issues/detail?id=2291 for more details.
+  var type = typeof value;
+  return !!value && (type == 'object' || type == 'function');
+}
+
+module.exports = isIterateeCall;
+
+},{}],9:[function(_dereq_,module,exports){
+/**
+ * lodash 3.6.1 (Custom Build) <https://lodash.com/>
+ * Build: `lodash modern modularize exports="npm" -o ./`
+ * Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/>
+ * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>
+ * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
+ * Available under MIT license <https://lodash.com/license>
+ */
+
+/** Used as the `TypeError` message for "Functions" methods. */
+var FUNC_ERROR_TEXT = 'Expected a function';
+
+/* Native method references for those with the same name as other `lodash` methods. */
+var nativeMax = Math.max;
+
+/**
+ * Creates a function that invokes `func` with the `this` binding of the
+ * created function and arguments from `start` and beyond provided as an array.
+ *
+ * **Note:** This method is based on the [rest parameter](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Functions/rest_parameters).
+ *
+ * @static
+ * @memberOf _
+ * @category Function
+ * @param {Function} func The function to apply a rest parameter to.
+ * @param {number} [start=func.length-1] The start position of the rest parameter.
+ * @returns {Function} Returns the new function.
+ * @example
+ *
+ * var say = _.restParam(function(what, names) {
+ *   return what + ' ' + _.initial(names).join(', ') +
+ *     (_.size(names) > 1 ? ', & ' : '') + _.last(names);
+ * });
+ *
+ * say('hello', 'fred', 'barney', 'pebbles');
+ * // => 'hello fred, barney, & pebbles'
+ */
+function restParam(func, start) {
+  if (typeof func != 'function') {
+    throw new TypeError(FUNC_ERROR_TEXT);
+  }
+  start = nativeMax(start === undefined ? (func.length - 1) : (+start || 0), 0);
+  return function() {
+    var args = arguments,
+        index = -1,
+        length = nativeMax(args.length - start, 0),
+        rest = Array(length);
+
+    while (++index < length) {
+      rest[index] = args[start + index];
+    }
+    switch (start) {
+      case 0: return func.call(this, rest);
+      case 1: return func.call(this, args[0], rest);
+      case 2: return func.call(this, args[0], args[1], rest);
+    }
+    var otherArgs = Array(start + 1);
+    index = -1;
+    while (++index < start) {
+      otherArgs[index] = args[index];
+    }
+    otherArgs[start] = rest;
+    return func.apply(this, otherArgs);
+  };
+}
+
+module.exports = restParam;
+
+},{}],10:[function(_dereq_,module,exports){
+/**
+ * lodash 3.1.2 (Custom Build) <https://lodash.com/>
+ * Build: `lodash modern modularize exports="npm" -o ./`
+ * Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/>
+ * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>
+ * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
+ * Available under MIT license <https://lodash.com/license>
+ */
+var getNative = _dereq_('lodash._getnative'),
+    isArguments = _dereq_('lodash.isarguments'),
+    isArray = _dereq_('lodash.isarray');
+
+/** Used to detect unsigned integer values. */
+var reIsUint = /^\d+$/;
+
+/** Used for native method references. */
+var objectProto = Object.prototype;
+
+/** Used to check objects for own properties. */
+var hasOwnProperty = objectProto.hasOwnProperty;
+
+/* Native method references for those with the same name as other `lodash` methods. */
+var nativeKeys = getNative(Object, 'keys');
+
+/**
+ * Used as the [maximum length](http://ecma-international.org/ecma-262/6.0/#sec-number.max_safe_integer)
+ * of an array-like value.
+ */
+var MAX_SAFE_INTEGER = 9007199254740991;
+
+/**
+ * The base implementation of `_.property` without support for deep paths.
+ *
+ * @private
+ * @param {string} key The key of the property to get.
+ * @returns {Function} Returns the new function.
+ */
+function baseProperty(key) {
+  return function(object) {
+    return object == null ? undefined : object[key];
+  };
+}
+
+/**
+ * Gets the "length" property value of `object`.
+ *
+ * **Note:** This function is used to avoid a [JIT bug](https://bugs.webkit.org/show_bug.cgi?id=142792)
+ * that affects Safari on at least iOS 8.1-8.3 ARM64.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @returns {*} Returns the "length" value.
+ */
+var getLength = baseProperty('length');
+
+/**
+ * Checks if `value` is array-like.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is array-like, else `false`.
+ */
+function isArrayLike(value) {
+  return value != null && isLength(getLength(value));
+}
+
+/**
+ * Checks if `value` is a valid array-like index.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index.
+ * @returns {boolean} Returns `true` if `value` is a valid index, else `false`.
+ */
+function isIndex(value, length) {
+  value = (typeof value == 'number' || reIsUint.test(value)) ? +value : -1;
+  length = length == null ? MAX_SAFE_INTEGER : length;
+  return value > -1 && value % 1 == 0 && value < length;
+}
+
+/**
+ * Checks if `value` is a valid array-like length.
+ *
+ * **Note:** This function is based on [`ToLength`](http://ecma-international.org/ecma-262/6.0/#sec-tolength).
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a valid length, else `false`.
+ */
+function isLength(value) {
+  return typeof value == 'number' && value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER;
+}
+
+/**
+ * A fallback implementation of `Object.keys` which creates an array of the
+ * own enumerable property names of `object`.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the array of property names.
+ */
+function shimKeys(object) {
+  var props = keysIn(object),
+      propsLength = props.length,
+      length = propsLength && object.length;
+
+  var allowIndexes = !!length && isLength(length) &&
+    (isArray(object) || isArguments(object));
+
+  var index = -1,
+      result = [];
+
+  while (++index < propsLength) {
+    var key = props[index];
+    if ((allowIndexes && isIndex(key, length)) || hasOwnProperty.call(object, key)) {
+      result.push(key);
+    }
+  }
+  return result;
+}
+
+/**
+ * Checks if `value` is the [language type](https://es5.github.io/#x8) of `Object`.
+ * (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)
+ *
+ * @static
+ * @memberOf _
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is an object, else `false`.
+ * @example
+ *
+ * _.isObject({});
+ * // => true
+ *
+ * _.isObject([1, 2, 3]);
+ * // => true
+ *
+ * _.isObject(1);
+ * // => false
+ */
+function isObject(value) {
+  // Avoid a V8 JIT bug in Chrome 19-20.
+  // See https://code.google.com/p/v8/issues/detail?id=2291 for more details.
+  var type = typeof value;
+  return !!value && (type == 'object' || type == 'function');
+}
+
+/**
+ * Creates an array of the own enumerable property names of `object`.
+ *
+ * **Note:** Non-object values are coerced to objects. See the
+ * [ES spec](http://ecma-international.org/ecma-262/6.0/#sec-object.keys)
+ * for more details.
+ *
+ * @static
+ * @memberOf _
+ * @category Object
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the array of property names.
+ * @example
+ *
+ * function Foo() {
+ *   this.a = 1;
+ *   this.b = 2;
+ * }
+ *
+ * Foo.prototype.c = 3;
+ *
+ * _.keys(new Foo);
+ * // => ['a', 'b'] (iteration order is not guaranteed)
+ *
+ * _.keys('hi');
+ * // => ['0', '1']
+ */
+var keys = !nativeKeys ? shimKeys : function(object) {
+  var Ctor = object == null ? undefined : object.constructor;
+  if ((typeof Ctor == 'function' && Ctor.prototype === object) ||
+      (typeof object != 'function' && isArrayLike(object))) {
+    return shimKeys(object);
+  }
+  return isObject(object) ? nativeKeys(object) : [];
+};
+
+/**
+ * Creates an array of the own and inherited enumerable property names of `object`.
+ *
+ * **Note:** Non-object values are coerced to objects.
+ *
+ * @static
+ * @memberOf _
+ * @category Object
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the array of property names.
+ * @example
+ *
+ * function Foo() {
+ *   this.a = 1;
+ *   this.b = 2;
+ * }
+ *
+ * Foo.prototype.c = 3;
+ *
+ * _.keysIn(new Foo);
+ * // => ['a', 'b', 'c'] (iteration order is not guaranteed)
+ */
+function keysIn(object) {
+  if (object == null) {
+    return [];
+  }
+  if (!isObject(object)) {
+    object = Object(object);
+  }
+  var length = object.length;
+  length = (length && isLength(length) &&
+    (isArray(object) || isArguments(object)) && length) || 0;
+
+  var Ctor = object.constructor,
+      index = -1,
+      isProto = typeof Ctor == 'function' && Ctor.prototype === object,
+      result = Array(length),
+      skipIndexes = length > 0;
+
+  while (++index < length) {
+    result[index] = (index + '');
+  }
+  for (var key in object) {
+    if (!(skipIndexes && isIndex(key, length)) &&
+        !(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) {
+      result.push(key);
+    }
+  }
+  return result;
+}
+
+module.exports = keys;
+
+},{"lodash._getnative":11,"lodash.isarguments":12,"lodash.isarray":13}],11:[function(_dereq_,module,exports){
+/**
+ * lodash 3.9.1 (Custom Build) <https://lodash.com/>
+ * Build: `lodash modern modularize exports="npm" -o ./`
+ * Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/>
+ * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>
+ * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
+ * Available under MIT license <https://lodash.com/license>
+ */
+
+/** `Object#toString` result references. */
+var funcTag = '[object Function]';
+
+/** Used to detect host constructors (Safari > 5). */
+var reIsHostCtor = /^\[object .+?Constructor\]$/;
+
+/**
+ * Checks if `value` is object-like.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is object-like, else `false`.
+ */
+function isObjectLike(value) {
+  return !!value && typeof value == 'object';
+}
+
+/** Used for native method references. */
+var objectProto = Object.prototype;
+
+/** Used to resolve the decompiled source of functions. */
+var fnToString = Function.prototype.toString;
+
+/** Used to check objects for own properties. */
+var hasOwnProperty = objectProto.hasOwnProperty;
+
+/**
+ * Used to resolve the [`toStringTag`](http://ecma-international.org/ecma-262/6.0/#sec-object.prototype.tostring)
+ * of values.
+ */
+var objToString = objectProto.toString;
+
+/** Used to detect if a method is native. */
+var reIsNative = RegExp('^' +
+  fnToString.call(hasOwnProperty).replace(/[\\^$.*+?()[\]{}|]/g, '\\$&')
+  .replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$'
+);
+
+/**
+ * Gets the native function at `key` of `object`.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @param {string} key The key of the method to get.
+ * @returns {*} Returns the function if it's native, else `undefined`.
+ */
+function getNative(object, key) {
+  var value = object == null ? undefined : object[key];
+  return isNative(value) ? value : undefined;
+}
+
+/**
+ * Checks if `value` is classified as a `Function` object.
+ *
+ * @static
+ * @memberOf _
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is correctly classified, else `false`.
+ * @example
+ *
+ * _.isFunction(_);
+ * // => true
+ *
+ * _.isFunction(/abc/);
+ * // => false
+ */
+function isFunction(value) {
+  // The use of `Object#toString` avoids issues with the `typeof` operator
+  // in older versions of Chrome and Safari which return 'function' for regexes
+  // and Safari 8 equivalents which return 'object' for typed array constructors.
+  return isObject(value) && objToString.call(value) == funcTag;
+}
+
+/**
+ * Checks if `value` is the [language type](https://es5.github.io/#x8) of `Object`.
+ * (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)
+ *
+ * @static
+ * @memberOf _
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is an object, else `false`.
+ * @example
+ *
+ * _.isObject({});
+ * // => true
+ *
+ * _.isObject([1, 2, 3]);
+ * // => true
+ *
+ * _.isObject(1);
+ * // => false
+ */
+function isObject(value) {
+  // Avoid a V8 JIT bug in Chrome 19-20.
+  // See https://code.google.com/p/v8/issues/detail?id=2291 for more details.
+  var type = typeof value;
+  return !!value && (type == 'object' || type == 'function');
+}
+
+/**
+ * Checks if `value` is a native function.
+ *
+ * @static
+ * @memberOf _
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a native function, else `false`.
+ * @example
+ *
+ * _.isNative(Array.prototype.push);
+ * // => true
+ *
+ * _.isNative(_);
+ * // => false
+ */
+function isNative(value) {
+  if (value == null) {
+    return false;
+  }
+  if (isFunction(value)) {
+    return reIsNative.test(fnToString.call(value));
+  }
+  return isObjectLike(value) && reIsHostCtor.test(value);
+}
+
+module.exports = getNative;
+
+},{}],12:[function(_dereq_,module,exports){
+/**
+ * lodash 3.0.4 (Custom Build) <https://lodash.com/>
+ * Build: `lodash modern modularize exports="npm" -o ./`
+ * Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/>
+ * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>
+ * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
+ * Available under MIT license <https://lodash.com/license>
+ */
+
+/**
+ * Checks if `value` is object-like.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is object-like, else `false`.
+ */
+function isObjectLike(value) {
+  return !!value && typeof value == 'object';
+}
+
+/** Used for native method references. */
+var objectProto = Object.prototype;
+
+/** Used to check objects for own properties. */
+var hasOwnProperty = objectProto.hasOwnProperty;
+
+/** Native method references. */
+var propertyIsEnumerable = objectProto.propertyIsEnumerable;
+
+/**
+ * Used as the [maximum length](http://ecma-international.org/ecma-262/6.0/#sec-number.max_safe_integer)
+ * of an array-like value.
+ */
+var MAX_SAFE_INTEGER = 9007199254740991;
+
+/**
+ * The base implementation of `_.property` without support for deep paths.
+ *
+ * @private
+ * @param {string} key The key of the property to get.
+ * @returns {Function} Returns the new function.
+ */
+function baseProperty(key) {
+  return function(object) {
+    return object == null ? undefined : object[key];
+  };
+}
+
+/**
+ * Gets the "length" property value of `object`.
+ *
+ * **Note:** This function is used to avoid a [JIT bug](https://bugs.webkit.org/show_bug.cgi?id=142792)
+ * that affects Safari on at least iOS 8.1-8.3 ARM64.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @returns {*} Returns the "length" value.
+ */
+var getLength = baseProperty('length');
+
+/**
+ * Checks if `value` is array-like.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is array-like, else `false`.
+ */
+function isArrayLike(value) {
+  return value != null && isLength(getLength(value));
+}
+
+/**
+ * Checks if `value` is a valid array-like length.
+ *
+ * **Note:** This function is based on [`ToLength`](http://ecma-international.org/ecma-262/6.0/#sec-tolength).
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a valid length, else `false`.
+ */
+function isLength(value) {
+  return typeof value == 'number' && value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER;
+}
+
+/**
+ * Checks if `value` is classified as an `arguments` object.
+ *
+ * @static
+ * @memberOf _
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is correctly classified, else `false`.
+ * @example
+ *
+ * _.isArguments(function() { return arguments; }());
+ * // => true
+ *
+ * _.isArguments([1, 2, 3]);
+ * // => false
+ */
+function isArguments(value) {
+  return isObjectLike(value) && isArrayLike(value) &&
+    hasOwnProperty.call(value, 'callee') && !propertyIsEnumerable.call(value, 'callee');
+}
+
+module.exports = isArguments;
+
+},{}],13:[function(_dereq_,module,exports){
+/**
+ * lodash 3.0.4 (Custom Build) <https://lodash.com/>
+ * Build: `lodash modern modularize exports="npm" -o ./`
+ * Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/>
+ * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>
+ * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
+ * Available under MIT license <https://lodash.com/license>
+ */
+
+/** `Object#toString` result references. */
+var arrayTag = '[object Array]',
+    funcTag = '[object Function]';
+
+/** Used to detect host constructors (Safari > 5). */
+var reIsHostCtor = /^\[object .+?Constructor\]$/;
+
+/**
+ * Checks if `value` is object-like.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is object-like, else `false`.
+ */
+function isObjectLike(value) {
+  return !!value && typeof value == 'object';
+}
+
+/** Used for native method references. */
+var objectProto = Object.prototype;
+
+/** Used to resolve the decompiled source of functions. */
+var fnToString = Function.prototype.toString;
+
+/** Used to check objects for own properties. */
+var hasOwnProperty = objectProto.hasOwnProperty;
+
+/**
+ * Used to resolve the [`toStringTag`](http://ecma-international.org/ecma-262/6.0/#sec-object.prototype.tostring)
+ * of values.
+ */
+var objToString = objectProto.toString;
+
+/** Used to detect if a method is native. */
+var reIsNative = RegExp('^' +
+  fnToString.call(hasOwnProperty).replace(/[\\^$.*+?()[\]{}|]/g, '\\$&')
+  .replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$'
+);
+
+/* Native method references for those with the same name as other `lodash` methods. */
+var nativeIsArray = getNative(Array, 'isArray');
+
+/**
+ * Used as the [maximum length](http://ecma-international.org/ecma-262/6.0/#sec-number.max_safe_integer)
+ * of an array-like value.
+ */
+var MAX_SAFE_INTEGER = 9007199254740991;
+
+/**
+ * Gets the native function at `key` of `object`.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @param {string} key The key of the method to get.
+ * @returns {*} Returns the function if it's native, else `undefined`.
+ */
+function getNative(object, key) {
+  var value = object == null ? undefined : object[key];
+  return isNative(value) ? value : undefined;
+}
+
+/**
+ * Checks if `value` is a valid array-like length.
+ *
+ * **Note:** This function is based on [`ToLength`](http://ecma-international.org/ecma-262/6.0/#sec-tolength).
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a valid length, else `false`.
+ */
+function isLength(value) {
+  return typeof value == 'number' && value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER;
+}
+
+/**
+ * Checks if `value` is classified as an `Array` object.
+ *
+ * @static
+ * @memberOf _
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is correctly classified, else `false`.
+ * @example
+ *
+ * _.isArray([1, 2, 3]);
+ * // => true
+ *
+ * _.isArray(function() { return arguments; }());
+ * // => false
+ */
+var isArray = nativeIsArray || function(value) {
+  return isObjectLike(value) && isLength(value.length) && objToString.call(value) == arrayTag;
+};
+
+/**
+ * Checks if `value` is classified as a `Function` object.
+ *
+ * @static
+ * @memberOf _
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is correctly classified, else `false`.
+ * @example
+ *
+ * _.isFunction(_);
+ * // => true
+ *
+ * _.isFunction(/abc/);
+ * // => false
+ */
+function isFunction(value) {
+  // The use of `Object#toString` avoids issues with the `typeof` operator
+  // in older versions of Chrome and Safari which return 'function' for regexes
+  // and Safari 8 equivalents which return 'object' for typed array constructors.
+  return isObject(value) && objToString.call(value) == funcTag;
+}
+
+/**
+ * Checks if `value` is the [language type](https://es5.github.io/#x8) of `Object`.
+ * (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)
+ *
+ * @static
+ * @memberOf _
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is an object, else `false`.
+ * @example
+ *
+ * _.isObject({});
+ * // => true
+ *
+ * _.isObject([1, 2, 3]);
+ * // => true
+ *
+ * _.isObject(1);
+ * // => false
+ */
+function isObject(value) {
+  // Avoid a V8 JIT bug in Chrome 19-20.
+  // See https://code.google.com/p/v8/issues/detail?id=2291 for more details.
+  var type = typeof value;
+  return !!value && (type == 'object' || type == 'function');
+}
+
+/**
+ * Checks if `value` is a native function.
+ *
+ * @static
+ * @memberOf _
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a native function, else `false`.
+ * @example
+ *
+ * _.isNative(Array.prototype.push);
+ * // => true
+ *
+ * _.isNative(_);
+ * // => false
+ */
+function isNative(value) {
+  if (value == null) {
+    return false;
+  }
+  if (isFunction(value)) {
+    return reIsNative.test(fnToString.call(value));
+  }
+  return isObjectLike(value) && reIsHostCtor.test(value);
+}
+
+module.exports = isArray;
+
+},{}],14:[function(_dereq_,module,exports){
+/**
+ * lodash 3.0.4 (Custom Build) <https://lodash.com/>
+ * Build: `lodash modern modularize exports="npm" -o ./`
+ * Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/>
+ * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>
+ * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
+ * Available under MIT license <https://lodash.com/license>
+ */
+var baseIsEqual = _dereq_('lodash._baseisequal'),
+    bindCallback = _dereq_('lodash._bindcallback');
+
+/**
+ * Performs a deep comparison between two values to determine if they are
+ * equivalent. If `customizer` is provided it is invoked to compare values.
+ * If `customizer` returns `undefined` comparisons are handled by the method
+ * instead. The `customizer` is bound to `thisArg` and invoked with three
+ * arguments: (value, other [, index|key]).
+ *
+ * **Note:** This method supports comparing arrays, booleans, `Date` objects,
+ * numbers, `Object` objects, regexes, and strings. Objects are compared by
+ * their own, not inherited, enumerable properties. Functions and DOM nodes
+ * are **not** supported. Provide a customizer function to extend support
+ * for comparing other values.
+ *
+ * @static
+ * @memberOf _
+ * @alias eq
+ * @category Lang
+ * @param {*} value The value to compare.
+ * @param {*} other The other value to compare.
+ * @param {Function} [customizer] The function to customize value comparisons.
+ * @param {*} [thisArg] The `this` binding of `customizer`.
+ * @returns {boolean} Returns `true` if the values are equivalent, else `false`.
+ * @example
+ *
+ * var object = { 'user': 'fred' };
+ * var other = { 'user': 'fred' };
+ *
+ * object == other;
+ * // => false
+ *
+ * _.isEqual(object, other);
+ * // => true
+ *
+ * // using a customizer callback
+ * var array = ['hello', 'goodbye'];
+ * var other = ['hi', 'goodbye'];
+ *
+ * _.isEqual(array, other, function(value, other) {
+ *   if (_.every([value, other], RegExp.prototype.test, /^h(?:i|ello)$/)) {
+ *     return true;
+ *   }
+ * });
+ * // => true
+ */
+function isEqual(value, other, customizer, thisArg) {
+  customizer = typeof customizer == 'function' ? bindCallback(customizer, thisArg, 3) : undefined;
+  var result = customizer ? customizer(value, other) : undefined;
+  return  result === undefined ? baseIsEqual(value, other, customizer) : !!result;
+}
+
+module.exports = isEqual;
+
+},{"lodash._baseisequal":15,"lodash._bindcallback":21}],15:[function(_dereq_,module,exports){
+/**
+ * lodash 3.0.7 (Custom Build) <https://lodash.com/>
+ * Build: `lodash modern modularize exports="npm" -o ./`
+ * Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/>
+ * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>
+ * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
+ * Available under MIT license <https://lodash.com/license>
+ */
+var isArray = _dereq_('lodash.isarray'),
+    isTypedArray = _dereq_('lodash.istypedarray'),
+    keys = _dereq_('lodash.keys');
+
+/** `Object#toString` result references. */
+var argsTag = '[object Arguments]',
+    arrayTag = '[object Array]',
+    boolTag = '[object Boolean]',
+    dateTag = '[object Date]',
+    errorTag = '[object Error]',
+    numberTag = '[object Number]',
+    objectTag = '[object Object]',
+    regexpTag = '[object RegExp]',
+    stringTag = '[object String]';
+
+/**
+ * Checks if `value` is object-like.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is object-like, else `false`.
+ */
+function isObjectLike(value) {
+  return !!value && typeof value == 'object';
+}
+
+/** Used for native method references. */
+var objectProto = Object.prototype;
+
+/** Used to check objects for own properties. */
+var hasOwnProperty = objectProto.hasOwnProperty;
+
+/**
+ * Used to resolve the [`toStringTag`](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-object.prototype.tostring)
+ * of values.
+ */
+var objToString = objectProto.toString;
+
+/**
+ * A specialized version of `_.some` for arrays without support for callback
+ * shorthands and `this` binding.
+ *
+ * @private
+ * @param {Array} array The array to iterate over.
+ * @param {Function} predicate The function invoked per iteration.
+ * @returns {boolean} Returns `true` if any element passes the predicate check,
+ *  else `false`.
+ */
+function arraySome(array, predicate) {
+  var index = -1,
+      length = array.length;
+
+  while (++index < length) {
+    if (predicate(array[index], index, array)) {
+      return true;
+    }
+  }
+  return false;
+}
+
+/**
+ * The base implementation of `_.isEqual` without support for `this` binding
+ * `customizer` functions.
+ *
+ * @private
+ * @param {*} value The value to compare.
+ * @param {*} other The other value to compare.
+ * @param {Function} [customizer] The function to customize comparing values.
+ * @param {boolean} [isLoose] Specify performing partial comparisons.
+ * @param {Array} [stackA] Tracks traversed `value` objects.
+ * @param {Array} [stackB] Tracks traversed `other` objects.
+ * @returns {boolean} Returns `true` if the values are equivalent, else `false`.
+ */
+function baseIsEqual(value, other, customizer, isLoose, stackA, stackB) {
+  if (value === other) {
+    return true;
+  }
+  if (value == null || other == null || (!isObject(value) && !isObjectLike(other))) {
+    return value !== value && other !== other;
+  }
+  return baseIsEqualDeep(value, other, baseIsEqual, customizer, isLoose, stackA, stackB);
+}
+
+/**
+ * A specialized version of `baseIsEqual` for arrays and objects which performs
+ * deep comparisons and tracks traversed objects enabling objects with circular
+ * references to be compared.
+ *
+ * @private
+ * @param {Object} object The object to compare.
+ * @param {Object} other The other object to compare.
+ * @param {Function} equalFunc The function to determine equivalents of values.
+ * @param {Function} [customizer] The function to customize comparing objects.
+ * @param {boolean} [isLoose] Specify performing partial comparisons.
+ * @param {Array} [stackA=[]] Tracks traversed `value` objects.
+ * @param {Array} [stackB=[]] Tracks traversed `other` objects.
+ * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.
+ */
+function baseIsEqualDeep(object, other, equalFunc, customizer, isLoose, stackA, stackB) {
+  var objIsArr = isArray(object),
+      othIsArr = isArray(other),
+      objTag = arrayTag,
+      othTag = arrayTag;
+
+  if (!objIsArr) {
+    objTag = objToString.call(object);
+    if (objTag == argsTag) {
+      objTag = objectTag;
+    } else if (objTag != objectTag) {
+      objIsArr = isTypedArray(object);
+    }
+  }
+  if (!othIsArr) {
+    othTag = objToString.call(other);
+    if (othTag == argsTag) {
+      othTag = objectTag;
+    } else if (othTag != objectTag) {
+      othIsArr = isTypedArray(other);
+    }
+  }
+  var objIsObj = objTag == objectTag,
+      othIsObj = othTag == objectTag,
+      isSameTag = objTag == othTag;
+
+  if (isSameTag && !(objIsArr || objIsObj)) {
+    return equalByTag(object, other, objTag);
+  }
+  if (!isLoose) {
+    var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'),
+        othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__');
+
+    if (objIsWrapped || othIsWrapped) {
+      return equalFunc(objIsWrapped ? object.value() : object, othIsWrapped ? other.value() : other, customizer, isLoose, stackA, stackB);
+    }
+  }
+  if (!isSameTag) {
+    return false;
+  }
+  // Assume cyclic values are equal.
+  // For more information on detecting circular references see https://es5.github.io/#JO.
+  stackA || (stackA = []);
+  stackB || (stackB = []);
+
+  var length = stackA.length;
+  while (length--) {
+    if (stackA[length] == object) {
+      return stackB[length] == other;
+    }
+  }
+  // Add `object` and `other` to the stack of traversed objects.
+  stackA.push(object);
+  stackB.push(other);
+
+  var result = (objIsArr ? equalArrays : equalObjects)(object, other, equalFunc, customizer, isLoose, stackA, stackB);
+
+  stackA.pop();
+  stackB.pop();
+
+  return result;
+}
+
+/**
+ * A specialized version of `baseIsEqualDeep` for arrays with support for
+ * partial deep comparisons.
+ *
+ * @private
+ * @param {Array} array The array to compare.
+ * @param {Array} other The other array to compare.
+ * @param {Function} equalFunc The function to determine equivalents of values.
+ * @param {Function} [customizer] The function to customize comparing arrays.
+ * @param {boolean} [isLoose] Specify performing partial comparisons.
+ * @param {Array} [stackA] Tracks traversed `value` objects.
+ * @param {Array} [stackB] Tracks traversed `other` objects.
+ * @returns {boolean} Returns `true` if the arrays are equivalent, else `false`.
+ */
+function equalArrays(array, other, equalFunc, customizer, isLoose, stackA, stackB) {
+  var index = -1,
+      arrLength = array.length,
+      othLength = other.length;
+
+  if (arrLength != othLength && !(isLoose && othLength > arrLength)) {
+    return false;
+  }
+  // Ignore non-index properties.
+  while (++index < arrLength) {
+    var arrValue = array[index],
+        othValue = other[index],
+        result = customizer ? customizer(isLoose ? othValue : arrValue, isLoose ? arrValue : othValue, index) : undefined;
+
+    if (result !== undefined) {
+      if (result) {
+        continue;
+      }
+      return false;
+    }
+    // Recursively compare arrays (susceptible to call stack limits).
+    if (isLoose) {
+      if (!arraySome(other, function(othValue) {
+            return arrValue === othValue || equalFunc(arrValue, othValue, customizer, isLoose, stackA, stackB);
+          })) {
+        return false;
+      }
+    } else if (!(arrValue === othValue || equalFunc(arrValue, othValue, customizer, isLoose, stackA, stackB))) {
+      return false;
+    }
+  }
+  return true;
+}
+
+/**
+ * A specialized version of `baseIsEqualDeep` for comparing objects of
+ * the same `toStringTag`.
+ *
+ * **Note:** This function only supports comparing values with tags of
+ * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`.
+ *
+ * @private
+ * @param {Object} value The object to compare.
+ * @param {Object} other The other object to compare.
+ * @param {string} tag The `toStringTag` of the objects to compare.
+ * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.
+ */
+function equalByTag(object, other, tag) {
+  switch (tag) {
+    case boolTag:
+    case dateTag:
+      // Coerce dates and booleans to numbers, dates to milliseconds and booleans
+      // to `1` or `0` treating invalid dates coerced to `NaN` as not equal.
+      return +object == +other;
+
+    case errorTag:
+      return object.name == other.name && object.message == other.message;
+
+    case numberTag:
+      // Treat `NaN` vs. `NaN` as equal.
+      return (object != +object)
+        ? other != +other
+        : object == +other;
+
+    case regexpTag:
+    case stringTag:
+      // Coerce regexes to strings and treat strings primitives and string
+      // objects as equal. See https://es5.github.io/#x15.10.6.4 for more details.
+      return object == (other + '');
+  }
+  return false;
+}
+
+/**
+ * A specialized version of `baseIsEqualDeep` for objects with support for
+ * partial deep comparisons.
+ *
+ * @private
+ * @param {Object} object The object to compare.
+ * @param {Object} other The other object to compare.
+ * @param {Function} equalFunc The function to determine equivalents of values.
+ * @param {Function} [customizer] The function to customize comparing values.
+ * @param {boolean} [isLoose] Specify performing partial comparisons.
+ * @param {Array} [stackA] Tracks traversed `value` objects.
+ * @param {Array} [stackB] Tracks traversed `other` objects.
+ * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.
+ */
+function equalObjects(object, other, equalFunc, customizer, isLoose, stackA, stackB) {
+  var objProps = keys(object),
+      objLength = objProps.length,
+      othProps = keys(other),
+      othLength = othProps.length;
+
+  if (objLength != othLength && !isLoose) {
+    return false;
+  }
+  var index = objLength;
+  while (index--) {
+    var key = objProps[index];
+    if (!(isLoose ? key in other : hasOwnProperty.call(other, key))) {
+      return false;
+    }
+  }
+  var skipCtor = isLoose;
+  while (++index < objLength) {
+    key = objProps[index];
+    var objValue = object[key],
+        othValue = other[key],
+        result = customizer ? customizer(isLoose ? othValue : objValue, isLoose? objValue : othValue, key) : undefined;
+
+    // Recursively compare objects (susceptible to call stack limits).
+    if (!(result === undefined ? equalFunc(objValue, othValue, customizer, isLoose, stackA, stackB) : result)) {
+      return false;
+    }
+    skipCtor || (skipCtor = key == 'constructor');
+  }
+  if (!skipCtor) {
+    var objCtor = object.constructor,
+        othCtor = other.constructor;
+
+    // Non `Object` object instances with different constructors are not equal.
+    if (objCtor != othCtor &&
+        ('constructor' in object && 'constructor' in other) &&
+        !(typeof objCtor == 'function' && objCtor instanceof objCtor &&
+          typeof othCtor == 'function' && othCtor instanceof othCtor)) {
+      return false;
+    }
+  }
+  return true;
+}
+
+/**
+ * Checks if `value` is the [language type](https://es5.github.io/#x8) of `Object`.
+ * (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)
+ *
+ * @static
+ * @memberOf _
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is an object, else `false`.
+ * @example
+ *
+ * _.isObject({});
+ * // => true
+ *
+ * _.isObject([1, 2, 3]);
+ * // => true
+ *
+ * _.isObject(1);
+ * // => false
+ */
+function isObject(value) {
+  // Avoid a V8 JIT bug in Chrome 19-20.
+  // See https://code.google.com/p/v8/issues/detail?id=2291 for more details.
+  var type = typeof value;
+  return !!value && (type == 'object' || type == 'function');
+}
+
+module.exports = baseIsEqual;
+
+},{"lodash.isarray":16,"lodash.istypedarray":17,"lodash.keys":18}],16:[function(_dereq_,module,exports){
+arguments[4][13][0].apply(exports,arguments)
+},{"dup":13}],17:[function(_dereq_,module,exports){
+/**
+ * lodash 3.0.2 (Custom Build) <https://lodash.com/>
+ * Build: `lodash modern modularize exports="npm" -o ./`
+ * Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/>
+ * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>
+ * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
+ * Available under MIT license <https://lodash.com/license>
+ */
+
+/** `Object#toString` result references. */
+var argsTag = '[object Arguments]',
+    arrayTag = '[object Array]',
+    boolTag = '[object Boolean]',
+    dateTag = '[object Date]',
+    errorTag = '[object Error]',
+    funcTag = '[object Function]',
+    mapTag = '[object Map]',
+    numberTag = '[object Number]',
+    objectTag = '[object Object]',
+    regexpTag = '[object RegExp]',
+    setTag = '[object Set]',
+    stringTag = '[object String]',
+    weakMapTag = '[object WeakMap]';
+
+var arrayBufferTag = '[object ArrayBuffer]',
+    float32Tag = '[object Float32Array]',
+    float64Tag = '[object Float64Array]',
+    int8Tag = '[object Int8Array]',
+    int16Tag = '[object Int16Array]',
+    int32Tag = '[object Int32Array]',
+    uint8Tag = '[object Uint8Array]',
+    uint8ClampedTag = '[object Uint8ClampedArray]',
+    uint16Tag = '[object Uint16Array]',
+    uint32Tag = '[object Uint32Array]';
+
+/** Used to identify `toStringTag` values of typed arrays. */
+var typedArrayTags = {};
+typedArrayTags[float32Tag] = typedArrayTags[float64Tag] =
+typedArrayTags[int8Tag] = typedArrayTags[int16Tag] =
+typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] =
+typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] =
+typedArrayTags[uint32Tag] = true;
+typedArrayTags[argsTag] = typedArrayTags[arrayTag] =
+typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] =
+typedArrayTags[dateTag] = typedArrayTags[errorTag] =
+typedArrayTags[funcTag] = typedArrayTags[mapTag] =
+typedArrayTags[numberTag] = typedArrayTags[objectTag] =
+typedArrayTags[regexpTag] = typedArrayTags[setTag] =
+typedArrayTags[stringTag] = typedArrayTags[weakMapTag] = false;
+
+/**
+ * Checks if `value` is object-like.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is object-like, else `false`.
+ */
+function isObjectLike(value) {
+  return !!value && typeof value == 'object';
+}
+
+/** Used for native method references. */
+var objectProto = Object.prototype;
+
+/**
+ * Used to resolve the [`toStringTag`](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-object.prototype.tostring)
+ * of values.
+ */
+var objToString = objectProto.toString;
+
+/**
+ * Used as the [maximum length](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-number.max_safe_integer)
+ * of an array-like value.
+ */
+var MAX_SAFE_INTEGER = 9007199254740991;
+
+/**
+ * Checks if `value` is a valid array-like length.
+ *
+ * **Note:** This function is based on [`ToLength`](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-tolength).
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a valid length, else `false`.
+ */
+function isLength(value) {
+  return typeof value == 'number' && value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER;
+}
+
+/**
+ * Checks if `value` is classified as a typed array.
+ *
+ * @static
+ * @memberOf _
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is correctly classified, else `false`.
+ * @example
+ *
+ * _.isTypedArray(new Uint8Array);
+ * // => true
+ *
+ * _.isTypedArray([]);
+ * // => false
+ */
+function isTypedArray(value) {
+  return isObjectLike(value) && isLength(value.length) && !!typedArrayTags[objToString.call(value)];
+}
+
+module.exports = isTypedArray;
+
+},{}],18:[function(_dereq_,module,exports){
+arguments[4][10][0].apply(exports,arguments)
+},{"dup":10,"lodash._getnative":19,"lodash.isarguments":20,"lodash.isarray":16}],19:[function(_dereq_,module,exports){
+arguments[4][11][0].apply(exports,arguments)
+},{"dup":11}],20:[function(_dereq_,module,exports){
+arguments[4][12][0].apply(exports,arguments)
+},{"dup":12}],21:[function(_dereq_,module,exports){
+arguments[4][7][0].apply(exports,arguments)
+},{"dup":7}],22:[function(_dereq_,module,exports){
+/**
+ * lodash 3.1.0 (Custom Build) <https://lodash.com/>
+ * Build: `lodash modern modularize exports="npm" -o ./`
+ * Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/>
+ * Based on Underscore.js 1.8.2 <http://underscorejs.org/LICENSE>
+ * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
+ * Available under MIT license <https://lodash.com/license>
+ */
+var baseFlatten = _dereq_('lodash._baseflatten'),
+    bindCallback = _dereq_('lodash._bindcallback'),
+    pickByArray = _dereq_('lodash._pickbyarray'),
+    pickByCallback = _dereq_('lodash._pickbycallback'),
+    restParam = _dereq_('lodash.restparam');
+
+/**
+ * Creates an object composed of the picked `object` properties. Property
+ * names may be specified as individual arguments or as arrays of property
+ * names. If `predicate` is provided it is invoked for each property of `object`
+ * picking the properties `predicate` returns truthy for. The predicate is
+ * bound to `thisArg` and invoked with three arguments: (value, key, object).
+ *
+ * @static
+ * @memberOf _
+ * @category Object
+ * @param {Object} object The source object.
+ * @param {Function|...(string|string[])} [predicate] The function invoked per
+ *  iteration or property names to pick, specified as individual property
+ *  names or arrays of property names.
+ * @param {*} [thisArg] The `this` binding of `predicate`.
+ * @returns {Object} Returns the new object.
+ * @example
+ *
+ * var object = { 'user': 'fred', 'age': 40 };
+ *
+ * _.pick(object, 'user');
+ * // => { 'user': 'fred' }
+ *
+ * _.pick(object, _.isString);
+ * // => { 'user': 'fred' }
+ */
+var pick = restParam(function(object, props) {
+  if (object == null) {
+    return {};
+  }
+  return typeof props[0] == 'function'
+    ? pickByCallback(object, bindCallback(props[0], props[1], 3))
+    : pickByArray(object, baseFlatten(props));
+});
+
+module.exports = pick;
+
+},{"lodash._baseflatten":23,"lodash._bindcallback":26,"lodash._pickbyarray":27,"lodash._pickbycallback":28,"lodash.restparam":33}],23:[function(_dereq_,module,exports){
+/**
+ * lodash 3.1.4 (Custom Build) <https://lodash.com/>
+ * Build: `lodash modern modularize exports="npm" -o ./`
+ * Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/>
+ * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>
+ * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
+ * Available under MIT license <https://lodash.com/license>
+ */
+var isArguments = _dereq_('lodash.isarguments'),
+    isArray = _dereq_('lodash.isarray');
+
+/**
+ * Checks if `value` is object-like.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is object-like, else `false`.
+ */
+function isObjectLike(value) {
+  return !!value && typeof value == 'object';
+}
+
+/**
+ * Used as the [maximum length](http://ecma-international.org/ecma-262/6.0/#sec-number.max_safe_integer)
+ * of an array-like value.
+ */
+var MAX_SAFE_INTEGER = 9007199254740991;
+
+/**
+ * Appends the elements of `values` to `array`.
+ *
+ * @private
+ * @param {Array} array The array to modify.
+ * @param {Array} values The values to append.
+ * @returns {Array} Returns `array`.
+ */
+function arrayPush(array, values) {
+  var index = -1,
+      length = values.length,
+      offset = array.length;
+
+  while (++index < length) {
+    array[offset + index] = values[index];
+  }
+  return array;
+}
+
+/**
+ * The base implementation of `_.flatten` with added support for restricting
+ * flattening and specifying the start index.
+ *
+ * @private
+ * @param {Array} array The array to flatten.
+ * @param {boolean} [isDeep] Specify a deep flatten.
+ * @param {boolean} [isStrict] Restrict flattening to arrays-like objects.
+ * @param {Array} [result=[]] The initial result value.
+ * @returns {Array} Returns the new flattened array.
+ */
+function baseFlatten(array, isDeep, isStrict, result) {
+  result || (result = []);
+
+  var index = -1,
+      length = array.length;
+
+  while (++index < length) {
+    var value = array[index];
+    if (isObjectLike(value) && isArrayLike(value) &&
+        (isStrict || isArray(value) || isArguments(value))) {
+      if (isDeep) {
+        // Recursively flatten arrays (susceptible to call stack limits).
+        baseFlatten(value, isDeep, isStrict, result);
+      } else {
+        arrayPush(result, value);
+      }
+    } else if (!isStrict) {
+      result[result.length] = value;
+    }
+  }
+  return result;
+}
+
+/**
+ * The base implementation of `_.property` without support for deep paths.
+ *
+ * @private
+ * @param {string} key The key of the property to get.
+ * @returns {Function} Returns the new function.
+ */
+function baseProperty(key) {
+  return function(object) {
+    return object == null ? undefined : object[key];
+  };
+}
+
+/**
+ * Gets the "length" property value of `object`.
+ *
+ * **Note:** This function is used to avoid a [JIT bug](https://bugs.webkit.org/show_bug.cgi?id=142792)
+ * that affects Safari on at least iOS 8.1-8.3 ARM64.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @returns {*} Returns the "length" value.
+ */
+var getLength = baseProperty('length');
+
+/**
+ * Checks if `value` is array-like.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is array-like, else `false`.
+ */
+function isArrayLike(value) {
+  return value != null && isLength(getLength(value));
+}
+
+/**
+ * Checks if `value` is a valid array-like length.
+ *
+ * **Note:** This function is based on [`ToLength`](http://ecma-international.org/ecma-262/6.0/#sec-tolength).
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a valid length, else `false`.
+ */
+function isLength(value) {
+  return typeof value == 'number' && value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER;
+}
+
+module.exports = baseFlatten;
+
+},{"lodash.isarguments":24,"lodash.isarray":25}],24:[function(_dereq_,module,exports){
+arguments[4][12][0].apply(exports,arguments)
+},{"dup":12}],25:[function(_dereq_,module,exports){
+arguments[4][13][0].apply(exports,arguments)
+},{"dup":13}],26:[function(_dereq_,module,exports){
+arguments[4][7][0].apply(exports,arguments)
+},{"dup":7}],27:[function(_dereq_,module,exports){
+/**
+ * lodash 3.0.2 (Custom Build) <https://lodash.com/>
+ * Build: `lodash modern modularize exports="npm" -o ./`
+ * Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/>
+ * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>
+ * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
+ * Available under MIT license <https://lodash.com/license>
+ */
+
+/**
+ * A specialized version of `_.pick` which picks `object` properties specified
+ * by `props`.
+ *
+ * @private
+ * @param {Object} object The source object.
+ * @param {string[]} props The property names to pick.
+ * @returns {Object} Returns the new object.
+ */
+function pickByArray(object, props) {
+  object = toObject(object);
+
+  var index = -1,
+      length = props.length,
+      result = {};
+
+  while (++index < length) {
+    var key = props[index];
+    if (key in object) {
+      result[key] = object[key];
+    }
+  }
+  return result;
+}
+
+/**
+ * Converts `value` to an object if it's not one.
+ *
+ * @private
+ * @param {*} value The value to process.
+ * @returns {Object} Returns the object.
+ */
+function toObject(value) {
+  return isObject(value) ? value : Object(value);
+}
+
+/**
+ * Checks if `value` is the [language type](https://es5.github.io/#x8) of `Object`.
+ * (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)
+ *
+ * @static
+ * @memberOf _
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is an object, else `false`.
+ * @example
+ *
+ * _.isObject({});
+ * // => true
+ *
+ * _.isObject([1, 2, 3]);
+ * // => true
+ *
+ * _.isObject(1);
+ * // => false
+ */
+function isObject(value) {
+  // Avoid a V8 JIT bug in Chrome 19-20.
+  // See https://code.google.com/p/v8/issues/detail?id=2291 for more details.
+  var type = typeof value;
+  return !!value && (type == 'object' || type == 'function');
+}
+
+module.exports = pickByArray;
+
+},{}],28:[function(_dereq_,module,exports){
+/**
+ * lodash 3.0.0 (Custom Build) <https://lodash.com/>
+ * Build: `lodash modern modularize exports="npm" -o ./`
+ * Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/>
+ * Based on Underscore.js 1.7.0 <http://underscorejs.org/LICENSE>
+ * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
+ * Available under MIT license <https://lodash.com/license>
+ */
+var baseFor = _dereq_('lodash._basefor'),
+    keysIn = _dereq_('lodash.keysin');
+
+/**
+ * The base implementation of `_.forIn` without support for callback
+ * shorthands and `this` binding.
+ *
+ * @private
+ * @param {Object} object The object to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @returns {Object} Returns `object`.
+ */
+function baseForIn(object, iteratee) {
+  return baseFor(object, iteratee, keysIn);
+}
+
+/**
+ * A specialized version of `_.pick` that picks `object` properties `predicate`
+ * returns truthy for.
+ *
+ * @private
+ * @param {Object} object The source object.
+ * @param {Function} predicate The function invoked per iteration.
+ * @returns {Object} Returns the new object.
+ */
+function pickByCallback(object, predicate) {
+  var result = {};
+  baseForIn(object, function(value, key, object) {
+    if (predicate(value, key, object)) {
+      result[key] = value;
+    }
+  });
+  return result;
+}
+
+module.exports = pickByCallback;
+
+},{"lodash._basefor":29,"lodash.keysin":30}],29:[function(_dereq_,module,exports){
+/**
+ * lodash 3.0.2 (Custom Build) <https://lodash.com/>
+ * Build: `lodash modern modularize exports="npm" -o ./`
+ * Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/>
+ * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>
+ * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
+ * Available under MIT license <https://lodash.com/license>
+ */
+
+/**
+ * The base implementation of `baseForIn` and `baseForOwn` which iterates
+ * over `object` properties returned by `keysFunc` invoking `iteratee` for
+ * each property. Iteratee functions may exit iteration early by explicitly
+ * returning `false`.
+ *
+ * @private
+ * @param {Object} object The object to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @param {Function} keysFunc The function to get the keys of `object`.
+ * @returns {Object} Returns `object`.
+ */
+var baseFor = createBaseFor();
+
+/**
+ * Creates a base function for `_.forIn` or `_.forInRight`.
+ *
+ * @private
+ * @param {boolean} [fromRight] Specify iterating from right to left.
+ * @returns {Function} Returns the new base function.
+ */
+function createBaseFor(fromRight) {
+  return function(object, iteratee, keysFunc) {
+    var iterable = toObject(object),
+        props = keysFunc(object),
+        length = props.length,
+        index = fromRight ? length : -1;
+
+    while ((fromRight ? index-- : ++index < length)) {
+      var key = props[index];
+      if (iteratee(iterable[key], key, iterable) === false) {
+        break;
+      }
+    }
+    return object;
+  };
+}
+
+/**
+ * Converts `value` to an object if it's not one.
+ *
+ * @private
+ * @param {*} value The value to process.
+ * @returns {Object} Returns the object.
+ */
+function toObject(value) {
+  return isObject(value) ? value : Object(value);
+}
+
+/**
+ * Checks if `value` is the [language type](https://es5.github.io/#x8) of `Object`.
+ * (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)
+ *
+ * @static
+ * @memberOf _
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is an object, else `false`.
+ * @example
+ *
+ * _.isObject({});
+ * // => true
+ *
+ * _.isObject([1, 2, 3]);
+ * // => true
+ *
+ * _.isObject(1);
+ * // => false
+ */
+function isObject(value) {
+  // Avoid a V8 JIT bug in Chrome 19-20.
+  // See https://code.google.com/p/v8/issues/detail?id=2291 for more details.
+  var type = typeof value;
+  return !!value && (type == 'object' || type == 'function');
+}
+
+module.exports = baseFor;
+
+},{}],30:[function(_dereq_,module,exports){
+/**
+ * lodash 3.0.8 (Custom Build) <https://lodash.com/>
+ * Build: `lodash modern modularize exports="npm" -o ./`
+ * Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/>
+ * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>
+ * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
+ * Available under MIT license <https://lodash.com/license>
+ */
+var isArguments = _dereq_('lodash.isarguments'),
+    isArray = _dereq_('lodash.isarray');
+
+/** Used to detect unsigned integer values. */
+var reIsUint = /^\d+$/;
+
+/** Used for native method references. */
+var objectProto = Object.prototype;
+
+/** Used to check objects for own properties. */
+var hasOwnProperty = objectProto.hasOwnProperty;
+
+/**
+ * Used as the [maximum length](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-number.max_safe_integer)
+ * of an array-like value.
+ */
+var MAX_SAFE_INTEGER = 9007199254740991;
+
+/**
+ * Checks if `value` is a valid array-like index.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index.
+ * @returns {boolean} Returns `true` if `value` is a valid index, else `false`.
+ */
+function isIndex(value, length) {
+  value = (typeof value == 'number' || reIsUint.test(value)) ? +value : -1;
+  length = length == null ? MAX_SAFE_INTEGER : length;
+  return value > -1 && value % 1 == 0 && value < length;
+}
+
+/**
+ * Checks if `value` is a valid array-like length.
+ *
+ * **Note:** This function is based on [`ToLength`](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-tolength).
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a valid length, else `false`.
+ */
+function isLength(value) {
+  return typeof value == 'number' && value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER;
+}
+
+/**
+ * Checks if `value` is the [language type](https://es5.github.io/#x8) of `Object`.
+ * (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)
+ *
+ * @static
+ * @memberOf _
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is an object, else `false`.
+ * @example
+ *
+ * _.isObject({});
+ * // => true
+ *
+ * _.isObject([1, 2, 3]);
+ * // => true
+ *
+ * _.isObject(1);
+ * // => false
+ */
+function isObject(value) {
+  // Avoid a V8 JIT bug in Chrome 19-20.
+  // See https://code.google.com/p/v8/issues/detail?id=2291 for more details.
+  var type = typeof value;
+  return !!value && (type == 'object' || type == 'function');
+}
+
+/**
+ * Creates an array of the own and inherited enumerable property names of `object`.
+ *
+ * **Note:** Non-object values are coerced to objects.
+ *
+ * @static
+ * @memberOf _
+ * @category Object
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the array of property names.
+ * @example
+ *
+ * function Foo() {
+ *   this.a = 1;
+ *   this.b = 2;
+ * }
+ *
+ * Foo.prototype.c = 3;
+ *
+ * _.keysIn(new Foo);
+ * // => ['a', 'b', 'c'] (iteration order is not guaranteed)
+ */
+function keysIn(object) {
+  if (object == null) {
+    return [];
+  }
+  if (!isObject(object)) {
+    object = Object(object);
+  }
+  var length = object.length;
+  length = (length && isLength(length) &&
+    (isArray(object) || isArguments(object)) && length) || 0;
+
+  var Ctor = object.constructor,
+      index = -1,
+      isProto = typeof Ctor == 'function' && Ctor.prototype === object,
+      result = Array(length),
+      skipIndexes = length > 0;
+
+  while (++index < length) {
+    result[index] = (index + '');
+  }
+  for (var key in object) {
+    if (!(skipIndexes && isIndex(key, length)) &&
+        !(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) {
+      result.push(key);
+    }
+  }
+  return result;
+}
+
+module.exports = keysIn;
+
+},{"lodash.isarguments":31,"lodash.isarray":32}],31:[function(_dereq_,module,exports){
+arguments[4][12][0].apply(exports,arguments)
+},{"dup":12}],32:[function(_dereq_,module,exports){
+arguments[4][13][0].apply(exports,arguments)
+},{"dup":13}],33:[function(_dereq_,module,exports){
+arguments[4][9][0].apply(exports,arguments)
+},{"dup":9}],34:[function(_dereq_,module,exports){
+"use strict";
+
+var filter  = _dereq_('lodash.pick'),
+    isEqual = _dereq_('lodash.isequal');
+
+
+/**
+ * Directly fetch `shouldComponentUpdate` mixin to use outside of Omniscient.
+ * You can do this if you don't want to use Omniscients syntactic sugar.
+ *
+ * @param {Object} nextProps Next props. Can be objects of cursors, values or immutable structures
+ * @param {Object} nextState Next state. Can be objects of values or immutable structures
+ *
+ * @property {Function} isCursor Get default isCursor
+ * @property {Function} isEqualState Get default isEqualState
+ * @property {Function} isEqualProps Get default isEqualProps
+ * @property {Function} isEqualCursor Get default isEqualCursor
+ * @property {Function} isImmutable Get default isImmutable
+ * @property {Function} isIgnorable Get default isIgnorable
+ * @property {Function} debug Get default debug
+ *
+ * @module shouldComponentUpdate
+ * @returns {Component}
+ * @api public
+ */
+module.exports = factory();
+
+/**
+ * Create a “local” instance of the shouldComponentUpdate with overriden defaults.
+ *
+ * ### Options
+ * ```js
+ * {
+ *   isCursor: function (cursor), // check if is props
+ *   isEqualCursor: function (oneCursor, otherCursor), // check cursor
+ *   isEqualState: function (currentState, nextState), // check state
+ *   isImmutable: function (currentState, nextState), // check if object is immutable
+ *   isEqualProps: function (currentProps, nextProps), // check props
+ *   isIgnorable: function (propertyValue, propertyKey), // check if property item is ignorable
+ *   unCursor: function (cursor) // convert from cursor to object
+ * }
+ * ```
+ *
+ * @param {Object} [Options] Options with defaults to override
+ *
+ * @module shouldComponentUpdate.withDefaults
+ * @returns {Function} shouldComponentUpdate with overriden defaults
+ * @api public
+ */
+module.exports.withDefaults = factory;
+
+function factory (methods) {
+  var debug;
+  methods = methods || {};
+
+  var _isCursor      = methods.isCursor || isCursor,
+      _isEqualCursor = methods.isEqualCursor || isEqualCursor,
+      _isEqualState  = methods.isEqualState || isEqualState,
+      _isEqualProps  = methods.isEqualProps || isEqualProps,
+      _isImmutable   = methods.isImmutable || isImmutable,
+      _isIgnorable   = methods.isIgnorable || isIgnorable,
+      _unCursor      = methods.unCursor || unCursor;
+
+  var isNotIgnorable = not(or(_isIgnorable, isChildren));
+
+  shouldComponentUpdate.isCursor = _isCursor;
+  shouldComponentUpdate.isEqualState = _isEqualState;
+  shouldComponentUpdate.isEqualProps = _isEqualProps;
+  shouldComponentUpdate.isEqualCursor = _isEqualCursor;
+  shouldComponentUpdate.isImmutable = _isImmutable;
+  shouldComponentUpdate.debug = debugFn;
+
+  return shouldComponentUpdate;
+
+  function shouldComponentUpdate (nextProps, nextState) {
+    if (nextProps === this.props && nextState === this.state) {
+      if (debug) debug.call(this, 'shouldComponentUpdate => false (equal input)');
+      return false;
+    }
+
+    if (!_isEqualState(this.state, nextState)) {
+      if (debug) debug.call(this, 'shouldComponentUpdate => true (state has changed)');
+      return true;
+    }
+
+    var filteredNextProps    = filter(nextProps, isNotIgnorable),
+        filteredCurrentProps = filter(this.props, isNotIgnorable);
+
+    if (!_isEqualProps(filteredCurrentProps, filteredNextProps)) {
+      if (debug) debug.call(this, 'shouldComponentUpdate => true (props have changed)');
+      return true;
+    }
+
+    if (debug) debug.call(this, 'shouldComponentUpdate => false');
+    return false;
+  }
+
+  /**
+   * Predicate to check if state is equal. Checks in the tree for immutable structures
+   * and if it is, check by reference. Does not support cursors.
+   *
+   * Override through `shouldComponentUpdate.withDefaults`.
+   *
+   * @param {Object} value
+   * @param {Object} other
+   *
+   * @module shouldComponentUpdate.isEqualState
+   * @returns {Boolean}
+   * @api public
+   */
+  function isEqualState (value, other) {
+    return isEqual(value, other, function (current, next) {
+      if (current === next) return true;
+      return compare(current, next, _isImmutable, isEqualImmutable);
+    });
+  }
+
+  /**
+   * Predicate to check if props are equal. Checks in the tree for cursors and immutable structures
+   * and if it is, check by reference.
+   *
+   * Override through `shouldComponentUpdate.withDefaults`.
+   *
+   * @param {Object} value
+   * @param {Object} other
+   *
+   * @module shouldComponentUpdate.isEqualProps
+   * @returns {Boolean}
+   * @api public
+   */
+  function isEqualProps (value, other) {
+    if (value === other) return true;
+
+    var cursorsEqual = compare(value, other, _isCursor, _isEqualCursor);
+    if (cursorsEqual !== void 0) return cursorsEqual;
+
+    var immutableEqual = compare(value, other, _isImmutable, isEqualImmutable);
+    if (immutableEqual !== void 0) return immutableEqual;
+
+    return isEqual(value, other, function (current, next) {
+      if (current === next) return true;
+
+      var cursorsEqual = compare(current, next, _isCursor, _isEqualCursor);
+      if (cursorsEqual !== void 0) return cursorsEqual;
+
+      return compare(current, next, _isImmutable, isEqualImmutable);
+    });
+  }
+
+  /**
+   * Predicate to check if cursors are equal through reference checks. Uses `unCursor`.
+   * Override through `shouldComponentUpdate.withDefaults` to support different cursor
+   * implementations.
+   *
+   * @param {Cursor} a
+   * @param {Cursor} b
+   *
+   * @module shouldComponentUpdate.isEqualCursor
+   * @returns {Boolean}
+   * @api public
+   */
+  function isEqualCursor (a, b) {
+    return _unCursor(a) === _unCursor(b);
+  }
+
+  function debugFn (pattern, logFn) {
+    if (typeof pattern === 'function') {
+      logFn   = pattern;
+      pattern = void 0;
+    }
+
+    var logger = logFn;
+    if (!logger && console.debug) {
+      logger = console.debug.bind(console);
+    }
+    if (!logger && console.info) {
+      logger = console.info.bind(console);
+    }
+
+    var regex = new RegExp(pattern || '.*');
+    debug = function (str) {
+      var element = this._currentElement;
+      if (this._reactInternalInstance && this._reactInternalInstance._currentElement) {
+        element = this._reactInternalInstance._currentElement;
+      }
+      var key = element && element.key ? ' key=' + element.key : '';
+      var name = this.constructor.displayName;
+      if (!key && !name) {
+        name = 'Unknown';
+      }
+      var tag = name + key;
+      if (regex.test(tag)) logger('<' + tag + '>: ' + str);
+    };
+    return debug;
+  }
+}
+
+function compare (current, next, typeCheck, equalCheck) {
+  var isCurrent = typeCheck(current);
+  var isNext = typeCheck(next);
+
+  if (isCurrent && isNext) {
+    return equalCheck(current, next);
+  }
+  if (isCurrent || isNext) {
+    return false;
+  }
+  return void 0;
+}
+
+function isEqualImmutable (a, b) {
+  return a === b;
+}
+
+/**
+ * Predicate to check if a potential is an immutable structure or not.
+ * Override through `shouldComponentUpdate.withDefaults` to support different cursor
+ * implementations.
+ *
+ * @param {maybeImmutable} value to check if it is immutable.
+ *
+ * @module shouldComponentUpdate.isImmutable
+ * @returns {Boolean}
+ * @api public
+ */
+var IS_ITERABLE_SENTINEL = '@@__IMMUTABLE_ITERABLE__@@';
+function isImmutable(maybeImmutable) {
+  return !!(maybeImmutable && maybeImmutable[IS_ITERABLE_SENTINEL]);
+}
+
+/**
+ * Transforming function to take in cursor and return a non-cursor.
+ * Override through `shouldComponentUpdate.withDefaults` to support different cursor
+ * implementations.
+ *
+ * @param {cursor} cursor to transform
+ *
+ * @module shouldComponentUpdate.unCursor
+ * @returns {Object|Number|String|Boolean}
+ * @api public
+ */
+function unCursor(cursor) {
+  return !isCursor(cursor) ? cursor : cursor.deref();
+}
+
+/**
+ * Predicate to check if `potential` is Immutable cursor or not (defaults to duck testing
+ * Immutable.js cursors). Can override through `.withDefaults()`.
+ *
+ * @param {potential} potential to check if is cursor
+ *
+ * @module shouldComponentUpdate.isCursor
+ * @returns {Boolean}
+ * @api public
+ */
+function isCursor (potential) {
+  return !!(potential && typeof potential.deref === 'function');
+}
+
+function not (fn) {
+  return function () {
+    return !fn.apply(fn, arguments);
+  };
+}
+
+/**
+ * Predicate to check if a property on props should be ignored or not.
+ * For now this defaults to ignore if property key is `statics`, but that
+ * is deprecated behaviour, and will be removed by the next major release.
+ *
+ * Override through `shouldComponentUpdate.withDefaults`.
+ *
+ * @param {Object} value
+ * @param {String} key
+ *
+ * @module shouldComponentUpdate.isIgnorable
+ * @returns {Boolean}
+ * @api public
+ */
+function isIgnorable (_, key) {
+  return false;
+}
+
+function isChildren (_, key) {
+  return key === 'children';
+}
+
+function or (fn1, fn2) {
+  return function () {
+    return fn1.apply(null, arguments) || fn2.apply(null, arguments);
+  };
+}
+
+},{"lodash.isequal":14,"lodash.pick":22}]},{},[2])(2)
+});